Introduce containerd-shim-runhcs-v1 on Windows

Implements the containerd-shim-runhcs-v1 shim on Windows for the runtime
v2 shim API.

Signed-off-by: Justin Terry (VM) <juterry@microsoft.com>
This commit is contained in:
Justin Terry (VM)
2018-08-08 11:35:15 -07:00
parent 3f42445e38
commit 019b0c34de
101 changed files with 6735 additions and 3649 deletions

View File

@@ -176,6 +176,10 @@ bin/containerd-shim-runc-v1: cmd/containerd-shim-runc-v1 FORCE # set !cgo and om
@echo "$(WHALE) bin/containerd-shim-runc-v1" @echo "$(WHALE) bin/containerd-shim-runc-v1"
@CGO_ENABLED=0 go build ${GO_BUILD_FLAGS} -o bin/containerd-shim-runc-v1 ${SHIM_GO_LDFLAGS} ${GO_TAGS} ./cmd/containerd-shim-runc-v1 @CGO_ENABLED=0 go build ${GO_BUILD_FLAGS} -o bin/containerd-shim-runc-v1 ${SHIM_GO_LDFLAGS} ${GO_TAGS} ./cmd/containerd-shim-runc-v1
bin/containerd-shim-runhcs-v1: cmd/containerd-shim-runhcs-v1 FORCE # set !cgo and omit pie for a static shim build: https://github.com/golang/go/issues/17789#issuecomment-258542220
@echo "$(WHALE) bin/containerd-shim-runhcs-v1${BINARY_SUFFIX}"
@CGO_ENABLED=0 go build ${GO_BUILD_FLAGS} -o bin/containerd-shim-runhcs-v1${BINARY_SUFFIX} ${SHIM_GO_LDFLAGS} ${GO_TAGS} ./cmd/containerd-shim-runhcs-v1
binaries: $(BINARIES) ## build binaries binaries: $(BINARIES) ## build binaries
@echo "$(WHALE) $@" @echo "$(WHALE) $@"

View File

@@ -16,6 +16,7 @@
#Windows specific settings. #Windows specific settings.
WHALE = "+" WHALE = "+"
ONI = "-" ONI = "-"
COMMANDS += containerd-shim-runhcs-v1
BINARY_SUFFIX=".exe" BINARY_SUFFIX=".exe"

View File

@@ -74,7 +74,7 @@ func copyIO(fifos *FIFOSet, ioset *Streams) (*cio, error) {
if fifos.Stdout != "" { if fifos.Stdout != "" {
l, err := winio.ListenPipe(fifos.Stdout, nil) l, err := winio.ListenPipe(fifos.Stdout, nil)
if err != nil { if err != nil {
return nil, errors.Wrapf(err, "failed to create stdin pipe %s", fifos.Stdout) return nil, errors.Wrapf(err, "failed to create stdout pipe %s", fifos.Stdout)
} }
defer func(l net.Listener) { defer func(l net.Listener) {
if err != nil { if err != nil {

View File

@@ -0,0 +1,28 @@
// +build windows
/*
Copyright The containerd Authors.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package main
import (
"github.com/containerd/containerd/runtime/v2/runhcs"
"github.com/containerd/containerd/runtime/v2/shim"
)
func main() {
shim.Run("io.containerd.runhcs.v1", runhcs.New)
}

View File

@@ -0,0 +1,98 @@
// +build windows
/*
Copyright The containerd Authors.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package runhcs
import (
"bytes"
"context"
"os/exec"
"sync"
"syscall"
"time"
)
var (
bytesBufferPool = sync.Pool{
New: func() interface{} {
return bytes.NewBuffer(nil)
},
}
)
func getBuffer() *bytes.Buffer {
return bytesBufferPool.Get().(*bytes.Buffer)
}
func putBuffer(b *bytes.Buffer) {
b.Reset()
bytesBufferPool.Put(b)
}
type processExit struct {
pid uint32
exitStatus uint32
exitedAt time.Time
exitErr error
}
func runCmd(ctx context.Context, c *exec.Cmd) (*processExit, error) {
ec, startErr := startCmd(ctx, c)
if startErr != nil {
return nil, startErr
}
er, cmdErr := waitCmd(ctx, ec)
return er, cmdErr
}
func startCmd(ctx context.Context, c *exec.Cmd) (<-chan *processExit, error) {
if err := c.Start(); err != nil {
return nil, err
}
ec := make(chan *processExit, 1)
go func() {
defer close(ec)
var status int
eerr := c.Wait()
if eerr != nil {
status = 255
if exitErr, ok := eerr.(*exec.ExitError); ok {
if ws, ok := exitErr.Sys().(syscall.WaitStatus); ok {
status = ws.ExitStatus()
}
}
}
ec <- &processExit{
pid: uint32(c.Process.Pid),
exitStatus: uint32(status),
exitedAt: time.Now(),
exitErr: eerr,
}
}()
return ec, nil
}
func waitCmd(ctx context.Context, ec <-chan *processExit) (*processExit, error) {
e := <-ec
if e.exitStatus != 0 {
return e, e.exitErr
}
return e, nil
}

159
runtime/v2/runhcs/io.go Normal file
View File

@@ -0,0 +1,159 @@
// +build windows
/*
Copyright The containerd Authors.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package runhcs
import (
"context"
"io"
"net"
"sync"
"time"
"github.com/Microsoft/go-winio"
"github.com/containerd/containerd/log"
runc "github.com/containerd/go-runc"
"github.com/pkg/errors"
"golang.org/x/sync/errgroup"
)
type pipeSet struct {
stdin net.Conn
stdout net.Conn
stderr net.Conn
}
// newPipeSet connects to the provided pipe addresses
func newPipeSet(ctx context.Context, stdin, stdout, stderr string, terminal bool) (*pipeSet, error) {
var (
err error
set = &pipeSet{}
)
defer func() {
if err != nil {
set.Close()
}
}()
g, _ := errgroup.WithContext(ctx)
dialfn := func(name string, conn *net.Conn) error {
if name == "" {
return nil
}
dialTimeout := 3 * time.Second
c, err := winio.DialPipe(name, &dialTimeout)
if err != nil {
return errors.Wrapf(err, "failed to connect to %s", name)
}
*conn = c
return nil
}
g.Go(func() error {
return dialfn(stdin, &set.stdin)
})
g.Go(func() error {
return dialfn(stdout, &set.stdout)
})
g.Go(func() error {
return dialfn(stderr, &set.stderr)
})
err = g.Wait()
if err != nil {
return nil, err
}
return set, nil
}
// Close terminates all successfully dialed IO connections
func (p *pipeSet) Close() {
for _, cn := range []net.Conn{p.stdin, p.stdout, p.stderr} {
if cn != nil {
cn.Close()
}
}
}
type pipeRelay struct {
ctx context.Context
ps *pipeSet
io runc.IO
wg sync.WaitGroup
once sync.Once
}
func newPipeRelay(ctx context.Context, ps *pipeSet, downstream runc.IO) *pipeRelay {
pr := &pipeRelay{
ctx: ctx,
ps: ps,
io: downstream,
}
if ps.stdin != nil {
go func() {
if _, err := io.Copy(downstream.Stdin(), ps.stdin); err != nil {
if err != winio.ErrFileClosed {
log.G(ctx).WithError(err).Error("error copying stdin to pipe")
}
}
}()
}
if ps.stdout != nil {
pr.wg.Add(1)
go func() {
if _, err := io.Copy(ps.stdout, downstream.Stdout()); err != nil {
log.G(ctx).WithError(err).Error("error copying stdout from pipe")
}
pr.wg.Done()
}()
}
if ps.stderr != nil {
pr.wg.Add(1)
go func() {
if _, err := io.Copy(ps.stderr, downstream.Stderr()); err != nil {
log.G(pr.ctx).WithError(err).Error("error copying stderr from pipe")
}
pr.wg.Done()
}()
}
return pr
}
func (pr *pipeRelay) wait() {
pr.wg.Wait()
}
// closeIO closes stdin to unblock an waiters
func (pr *pipeRelay) closeIO() {
if pr.ps.stdin != nil {
pr.ps.Close()
pr.io.Stdin().Close()
}
}
// close closes all open pipes
func (pr *pipeRelay) close() {
pr.once.Do(func() {
pr.io.Close()
pr.ps.Close()
})
}

View File

@@ -0,0 +1,178 @@
// +build windows
/*
Copyright The containerd Authors.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package runhcs
import (
"context"
"os"
"os/exec"
"sync"
"sync/atomic"
"syscall"
"time"
eventstypes "github.com/containerd/containerd/api/events"
"github.com/containerd/containerd/runtime"
)
func newProcess(ctx context.Context, s *service, id string, pid uint32, pr *pipeRelay, bundle, stdin, stdout, stderr string, terminal bool) (*process, error) {
p, err := os.FindProcess(int(pid))
if err != nil {
return nil, err
}
process := &process{
cid: id,
id: id,
pid: pid,
bundle: bundle,
stdin: stdin,
stdout: stdout,
stderr: stderr,
terminal: terminal,
relay: pr,
waitBlock: make(chan struct{}),
}
// Store the default non-exited value for calls to stat
process.exit.Store(&processExit{
pid: pid,
exitStatus: 255,
exitedAt: time.Time{},
exitErr: nil,
})
go waitForProcess(ctx, process, p, s)
return process, nil
}
func waitForProcess(ctx context.Context, process *process, p *os.Process, s *service) {
var status int
_, eerr := p.Wait()
if eerr != nil {
status = 255
if exitErr, ok := eerr.(*exec.ExitError); ok {
if ws, ok := exitErr.Sys().(syscall.WaitStatus); ok {
status = ws.ExitStatus()
}
}
}
now := time.Now()
process.exit.Store(&processExit{
pid: process.pid,
exitStatus: uint32(status),
exitedAt: now,
exitErr: eerr,
})
// Wait for the relay
process.relay.wait()
// close the client io, and free upstream waiters
process.close()
s.publisher.Publish(
ctx,
runtime.TaskExitEventTopic,
&eventstypes.TaskExit{
ContainerID: process.cid,
ID: process.id,
Pid: process.pid,
ExitStatus: uint32(status),
ExitedAt: now,
})
}
func newExecProcess(ctx context.Context, s *service, cid, id string, pr *pipeRelay, bundle, stdin, stdout, stderr string, terminal bool) (*process, error) {
process := &process{
cid: cid,
id: id,
bundle: bundle,
stdin: stdin,
stdout: stdout,
stderr: stderr,
terminal: terminal,
relay: pr,
waitBlock: make(chan struct{}),
}
// Store the default non-exited value for calls to stat
process.exit.Store(&processExit{
exitStatus: 255,
exitedAt: time.Time{},
exitErr: nil,
})
return process, nil
}
type process struct {
sync.Mutex
cid string
id string
pid uint32
bundle string
stdin string
stdout string
stderr string
terminal bool
relay *pipeRelay
// started track if the process has ever been started and will not be reset
// for the lifetime of the process object.
started bool
waitBlock chan struct{}
// exit holds the exit value for all calls to `stat`. By default a
// non-exited value is stored of status: 255, at: time 0.
exit atomic.Value
// closeOnce is responsible for closing waitBlock and any io.
closeOnce sync.Once
}
// closeIO closes the stdin of the executing process to unblock any waiters
func (p *process) closeIO() {
p.Lock()
defer p.Unlock()
p.relay.closeIO()
}
// close closes all stdio and frees any waiters. This is safe to call multiple
// times.
func (p *process) close() {
p.closeOnce.Do(func() {
p.relay.close()
// Free any waiters
close(p.waitBlock)
})
}
// stat is a non-blocking query of the current process state.
func (p *process) stat() *processExit {
er := p.exit.Load()
return er.(*processExit)
}
// wait waits for the container process to exit and returns the exit status. If
// the process failed post start the processExit will contain the exitErr. This
// is safe to call previous to calling start().
func (p *process) wait() *processExit {
<-p.waitBlock
return p.stat()
}

View File

@@ -0,0 +1,761 @@
// +build windows
/*
Copyright The containerd Authors.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package runhcs
import (
"context"
"encoding/json"
"fmt"
"os"
"os/exec"
"path"
"path/filepath"
"strconv"
"strings"
"sync"
"time"
"github.com/Microsoft/hcsshim/cmd/go-runhcs"
containerd_types "github.com/containerd/containerd/api/types"
"github.com/containerd/containerd/api/types/task"
"github.com/containerd/containerd/errdefs"
"github.com/containerd/containerd/events"
"github.com/containerd/containerd/log"
"github.com/containerd/containerd/mount"
"github.com/containerd/containerd/namespaces"
"github.com/containerd/containerd/runtime/v2/shim"
taskAPI "github.com/containerd/containerd/runtime/v2/task"
"github.com/containerd/go-runc"
ptypes "github.com/gogo/protobuf/types"
oci "github.com/opencontainers/runtime-spec/specs-go"
"github.com/pkg/errors"
"github.com/sirupsen/logrus"
)
const (
runhcsBinary = "runhcs"
runhcsVersion = "0.0.1"
runhcsDebugLegacy = "--debug" // TODO: JTERRY75 remove when all cmd's are complete in go-runhcs
)
var (
empty = &ptypes.Empty{}
runhcsDebug = false
)
func init() {
if logrus.GetLevel() == logrus.DebugLevel {
runhcsDebug = true
}
}
func newRunhcs(bundle string) *runhcs.Runhcs {
rhs := &runhcs.Runhcs{
Debug: runhcsDebug,
LogFormat: runhcs.JSON,
Owner: "containerd-runhcs-shim-v1",
}
if rhs.Debug {
rhs.Log = filepath.Join(bundle, "runhcs-debug.log")
}
return rhs
}
// New returns a new runhcs shim service that can be used via GRPC
func New(ctx context.Context, id string, publisher events.Publisher) (shim.Shim, error) {
return &service{
context: ctx,
id: id,
processes: make(map[string]*process),
publisher: publisher,
}, nil
}
var _ = (taskAPI.TaskService)(&service{})
var _ = (shim.Shim)(&service{})
// service is the runhcs shim implementation of the v2 TaskService over GRPC
type service struct {
mu sync.Mutex
context context.Context
id string
processes map[string]*process
publisher events.Publisher
}
// getProcess attempts to get a process by id.
// The caller MUST NOT have locked s.mu previous to calling this function.
func (s *service) getProcess(id string) (*process, error) {
s.mu.Lock()
defer s.mu.Unlock()
return s.getProcessLocked(id)
}
// getProcessLocked attempts to get a process by id.
// The caller MUST protect s.mu previous to calling this function.
func (s *service) getProcessLocked(id string) (*process, error) {
var p *process
var ok bool
if p, ok = s.processes[id]; !ok {
return nil, errdefs.ToGRPCf(errdefs.ErrNotFound, "process %s", id)
}
return p, nil
}
func (s *service) Cleanup(ctx context.Context) (*taskAPI.DeleteResponse, error) {
log.G(ctx).Info("Starting Cleanup")
_, err := namespaces.NamespaceRequired(ctx)
if err != nil {
return nil, err
}
path, err := os.Getwd()
if err != nil {
return nil, err
}
if err := os.RemoveAll(path); err != nil {
return nil, err
}
return &taskAPI.DeleteResponse{
ExitedAt: time.Now(),
ExitStatus: 255,
}, nil
}
func (s *service) StartShim(ctx context.Context, id, containerdBinary, containerdAddress string) (string, error) {
ns, err := namespaces.NamespaceRequired(ctx)
if err != nil {
return "", err
}
self, err := os.Executable()
if err != nil {
return "", err
}
cwd, err := os.Getwd()
if err != nil {
return "", err
}
socketAddress, err := shim.SocketAddress(ctx, id)
if err != nil {
return "", err
}
args := []string{
"-namespace", ns,
"-id", id,
"-address", containerdAddress,
"-publish-binary", containerdBinary,
"-socket", socketAddress,
"-debug",
}
cmd := exec.Command(self, args...)
cmd.Dir = cwd
cmd.Env = append(os.Environ(), "GOMAXPROCS=2")
if err = cmd.Start(); err != nil {
return "", err
}
defer func() {
if err != nil {
cmd.Process.Kill()
}
}()
// TODO: JTERRY75 - Windows does not use the ExtraFiles to pass the socket
// because winio does not support it which exposes a race condition between
// these two processes. For now AnonDialer will retry if the file does not
// exist up to the timeout waiting for the shim service to create the pipe.
go cmd.Wait()
if err := shim.WritePidFile("shim.pid", cmd.Process.Pid); err != nil {
return "", err
}
if err := shim.WriteAddress("address", socketAddress); err != nil {
return "", err
}
return socketAddress, nil
}
// State returns runtime state information for a process
func (s *service) State(ctx context.Context, r *taskAPI.StateRequest) (*taskAPI.StateResponse, error) {
s.mu.Lock()
defer s.mu.Unlock()
var p *process
var err error
if p, err = s.getProcessLocked(r.ID); err != nil {
return nil, err
}
cmd := exec.Command(runhcsBinary, runhcsDebugLegacy, "state", r.ID)
sout := getBuffer()
defer putBuffer(sout)
cmd.Stdout = sout
_, stateErr := runCmd(ctx, cmd)
if stateErr != nil {
return nil, stateErr
}
// TODO: JTERRY75 merge this with runhcs declaration
type containerState struct {
// Version is the OCI version for the container
Version string `json:"ociVersion"`
// ID is the container ID
ID string `json:"id"`
// InitProcessPid is the init process id in the parent namespace
InitProcessPid int `json:"pid"`
// Status is the current status of the container, running, paused, ...
Status string `json:"status"`
// Bundle is the path on the filesystem to the bundle
Bundle string `json:"bundle"`
// Rootfs is a path to a directory containing the container's root filesystem.
Rootfs string `json:"rootfs"`
// Created is the unix timestamp for the creation time of the container in UTC
Created time.Time `json:"created"`
// Annotations is the user defined annotations added to the config.
Annotations map[string]string `json:"annotations,omitempty"`
// The owner of the state directory (the owner of the container).
Owner string `json:"owner"`
}
var cs containerState
if err := json.NewDecoder(sout).Decode(&cs); err != nil {
log.G(ctx).WithError(err).Debugf("failed to decode runhcs state output: %s", sout.Bytes())
return nil, err
}
status := task.StatusUnknown
switch cs.Status {
case "created":
status = task.StatusCreated
case "running":
status = task.StatusRunning
case "stopped":
status = task.StatusStopped
case "paused":
status = task.StatusPaused
}
pe := p.stat()
return &taskAPI.StateResponse{
ID: r.ID,
Bundle: cs.Bundle,
Pid: uint32(cs.InitProcessPid),
Status: status,
Stdin: p.stdin,
Stdout: p.stdout,
Stderr: p.stderr,
Terminal: p.terminal,
ExitStatus: pe.exitStatus,
ExitedAt: pe.exitedAt,
}, nil
}
func writeMountsToConfig(bundle string, mounts []*containerd_types.Mount) error {
if len(mounts) != 1 {
return errors.New("Rootfs does not contain exactly 1 mount for the root file system")
}
m := mounts[0]
if m.Type != "windows-layer" && m.Type != "lcow-layer" {
return errors.Errorf("unsupported mount type '%s'", m.Type)
}
// parentLayerPaths are passed in layerN, layerN-1, ..., layer 0
//
// The OCI spec expects:
// windows-layer order is layerN, layerN-1, ..., layer0, scratch
// lcow-layer order is layer0, layer1, ..., layerN, scratch
var parentLayerPaths []string
for _, option := range mounts[0].Options {
if strings.HasPrefix(option, mount.ParentLayerPathsFlag) {
err := json.Unmarshal([]byte(option[len(mount.ParentLayerPathsFlag):]), &parentLayerPaths)
if err != nil {
return errors.Wrap(err, "failed to unmarshal parent layer paths from mount")
}
}
}
if m.Type == "lcow-layer" {
// Reverse the lcow-layer parents
for i := len(parentLayerPaths)/2 - 1; i >= 0; i-- {
opp := len(parentLayerPaths) - 1 - i
parentLayerPaths[i], parentLayerPaths[opp] = parentLayerPaths[opp], parentLayerPaths[i]
}
}
cf, err := os.OpenFile(path.Join(bundle, "config.json"), os.O_RDWR, 0)
if err != nil {
return errors.Wrap(err, "bundle does not contain config.json")
}
defer cf.Close()
var spec oci.Spec
if err := json.NewDecoder(cf).Decode(&spec); err != nil {
return errors.Wrap(err, "bundle config.json is not valid oci spec")
}
if err := cf.Truncate(0); err != nil {
return errors.Wrap(err, "failed to truncate config.json")
}
if _, err := cf.Seek(0, 0); err != nil {
return errors.Wrap(err, "failed to seek to 0 in config.json")
}
// Append the parents
spec.Windows.LayerFolders = append(spec.Windows.LayerFolders, parentLayerPaths...)
// Append the scratch
spec.Windows.LayerFolders = append(spec.Windows.LayerFolders, m.Source)
if err := json.NewEncoder(cf).Encode(spec); err != nil {
return errors.Wrap(err, "failed to write Mounts into config.json")
}
return nil
}
// Create a new initial process and container with runhcs
func (s *service) Create(ctx context.Context, r *taskAPI.CreateTaskRequest) (*taskAPI.CreateTaskResponse, error) {
// Hold the lock for the entire duration to avoid duplicate process creation.
s.mu.Lock()
defer s.mu.Unlock()
if p := s.processes[r.ID]; p != nil {
return nil, errdefs.ToGRPCf(errdefs.ErrAlreadyExists, "process %s already exists", r.ID)
}
if r.ID != s.id {
return nil, errdefs.ToGRPCf(errdefs.ErrFailedPrecondition, "init process id '%s' != shim id '%s'", r.ID, s.id)
}
// Add the mounts to the layer paths
if err := writeMountsToConfig(r.Bundle, r.Rootfs); err != nil {
return nil, errdefs.ToGRPC(err)
}
// Create the IO for the process
io, err := runc.NewPipeIO()
if err != nil {
return nil, errors.Wrap(err, "failed to create io pipes")
}
defer func() {
if err != nil {
io.Close()
}
}()
// Create the upstream IO
ps, err := newPipeSet(ctx, r.Stdin, r.Stdout, r.Stderr, r.Terminal)
if err != nil {
return nil, errors.Wrap(err, "failed to connect to upstream IO")
}
defer func() {
if err != nil {
ps.Close()
}
}()
// Create the relay for them both.
pr := newPipeRelay(ctx, ps, io)
defer func() {
if err != nil {
pr.close()
}
}()
pidfilePath := path.Join(r.Bundle, "runhcs-pidfile.pid")
copts := &runhcs.CreateOpts{
IO: io,
PidFile: pidfilePath,
ShimLog: path.Join(r.Bundle, "runhcs-shim.log"),
VMLog: path.Join(r.Bundle, "runhcs-vm-shim.log"),
}
rhcs := newRunhcs(r.Bundle)
err = rhcs.Create(ctx, r.ID, r.Bundle, copts)
if err != nil {
return nil, err
}
// We successfully created the process. Convert from initpid to the container process.
pid, err := runc.ReadPidFile(pidfilePath)
if err != nil {
return nil, errors.Wrap(err, "failed to read container pid from pidfile")
}
process, err := newProcess(
ctx,
s,
r.ID,
uint32(pid),
pr,
r.Bundle,
r.Stdin,
r.Stdout,
r.Stderr,
r.Terminal)
if err != nil {
return nil, err
}
s.processes[r.ID] = process
return &taskAPI.CreateTaskResponse{
Pid: uint32(pid),
}, nil
}
// Start a process
func (s *service) Start(ctx context.Context, r *taskAPI.StartRequest) (*taskAPI.StartResponse, error) {
log.G(ctx).Infof("Start: %s: %s", r.ID, r.ExecID)
var p *process
var err error
var id string
if r.ExecID != "" {
id = r.ExecID
} else {
id = r.ID
}
if p, err = s.getProcess(id); err != nil {
return nil, err
}
p.Lock()
defer p.Unlock()
if p.started {
return nil, errors.New("cannot start already started container or process")
}
rhcs := newRunhcs(p.bundle)
// This is a start/exec
if r.ExecID != "" {
execFmt := fmt.Sprintf("exec-%s-%s", r.ID, r.ExecID)
pidfilePath := path.Join(p.bundle, fmt.Sprintf("runhcs-%s-pidfile.pid", execFmt))
procConfig := path.Join(p.bundle, execFmt+"config.json")
eopts := &runhcs.ExecOpts{
IO: p.relay.io,
PidFile: pidfilePath,
ShimLog: path.Join(p.bundle, fmt.Sprintf("runhcs-%s-shim.log", execFmt)),
Detach: true,
}
err = rhcs.Exec(ctx, r.ID, procConfig, eopts)
if err != nil {
return nil, errors.Wrapf(err, "failed to exec process: %s", r.ExecID)
}
p.started = true
// We successfully exec'd the process. Convert from initpid to the container process.
pid, err := runc.ReadPidFile(pidfilePath)
if err != nil {
return nil, errors.Wrap(err, "failed to read container pid from pidfile")
}
proc, err := os.FindProcess(pid)
if err != nil {
return nil, errors.Wrap(err, "failed to find exec process pid")
}
p.pid = uint32(pid)
go waitForProcess(ctx, p, proc, s)
} else {
if err := rhcs.Start(ctx, p.id); err != nil {
return nil, errors.Wrapf(err, "failed to start container: %s", p.id)
}
p.started = true
// TODO: JTERRY75 - This is a total hack. We cant return from this call
// until the state has transitioned. Because runhcs start is long lived it
// will return before the actual state is "RUNNING" which causes a failure
// if the 'state' query comes in and it is not in the "RUNNING" state.
stateRequest := &taskAPI.StateRequest{
ID: r.ID,
ExecID: r.ExecID,
}
for {
sr, err := s.State(ctx, stateRequest)
if err != nil {
log.G(ctx).WithError(err).Debug("failed to query state of container")
break
}
// Have we transitioned states yet? Expect != created && != unknown
if sr.Status != task.StatusCreated && sr.Status != task.StatusUnknown {
break
}
time.Sleep(1 * time.Second)
}
}
return &taskAPI.StartResponse{
Pid: p.pid,
}, nil
}
// Delete the initial process and container
func (s *service) Delete(ctx context.Context, r *taskAPI.DeleteRequest) (*taskAPI.DeleteResponse, error) {
var p *process
var err error
if p, err = s.getProcess(r.ExecID); err != nil {
return nil, err
}
rhs := newRunhcs(p.bundle)
dopts := &runhcs.DeleteOpts{
Force: true,
}
if err := rhs.Delete(ctx, p.id, dopts); err != nil {
return nil, errors.Wrapf(err, "failed to delete container: %s", p.id)
}
select {
case <-time.After(5 * time.Second):
// Force close the container process since it didnt shutdown in time.
p.close()
case <-p.waitBlock:
}
exit := p.stat()
s.mu.Lock()
delete(s.processes, r.ID)
s.mu.Unlock()
return &taskAPI.DeleteResponse{
ExitedAt: exit.exitedAt,
ExitStatus: exit.exitStatus,
Pid: p.pid,
}, nil
}
// Pids returns all pids inside the container
func (s *service) Pids(ctx context.Context, r *taskAPI.PidsRequest) (*taskAPI.PidsResponse, error) {
return nil, errdefs.ErrNotImplemented
}
// Pause the container
func (s *service) Pause(ctx context.Context, r *taskAPI.PauseRequest) (*ptypes.Empty, error) {
// TODO: Validate that 'id' is actually a valid parent container ID
if _, err := s.getProcess(r.ID); err != nil {
return nil, err
}
cmd := exec.Command(runhcsBinary, runhcsDebugLegacy, "pause", r.ID)
_, err := runCmd(ctx, cmd)
if err != nil {
return nil, err
}
return empty, nil
}
// Resume the container
func (s *service) Resume(ctx context.Context, r *taskAPI.ResumeRequest) (*ptypes.Empty, error) {
// TODO: Validate that 'id' is actually a valid parent container ID
if _, err := s.getProcess(r.ID); err != nil {
return nil, err
}
cmd := exec.Command(runhcsBinary, runhcsDebugLegacy, "resume", r.ID)
_, err := runCmd(ctx, cmd)
if err != nil {
return nil, err
}
return empty, nil
}
// Checkpoint the container
func (s *service) Checkpoint(ctx context.Context, r *taskAPI.CheckpointTaskRequest) (*ptypes.Empty, error) {
return nil, errdefs.ErrNotImplemented
}
// Kill a process with the provided signal
func (s *service) Kill(ctx context.Context, r *taskAPI.KillRequest) (*ptypes.Empty, error) {
var p *process
var err error
if p, err = s.getProcess(r.ExecID); err != nil {
return nil, err
}
// TODO: JTERRY75 runhcs needs r.Signal in string form
// TODO: JTERRY75 runhcs support for r.All?
rhcs := newRunhcs(p.bundle)
if err = rhcs.Kill(ctx, p.id, strconv.FormatUint(uint64(r.Signal), 10)); err != nil {
if !strings.Contains(err.Error(), "container is not running") {
return nil, err
}
}
return empty, nil
}
// Exec an additional process inside the container
func (s *service) Exec(ctx context.Context, r *taskAPI.ExecProcessRequest) (*ptypes.Empty, error) {
s.mu.Lock()
defer s.mu.Unlock()
var parent *process
var err error
// Get the parent container
if parent, err = s.getProcessLocked(r.ID); err != nil {
return nil, err
}
if p := s.processes[r.ExecID]; p != nil {
return nil, errdefs.ToGRPCf(errdefs.ErrAlreadyExists, "exec process %s already exists", r.ExecID)
}
execFmt := fmt.Sprintf("exec-%s-%s", r.ID, r.ExecID)
var spec oci.Process
if err := json.Unmarshal(r.Spec.Value, &spec); err != nil {
return nil, errors.Wrap(err, "request.Spec was not oci process")
}
procConfig := path.Join(parent.bundle, execFmt+"config.json")
cf, err := os.OpenFile(procConfig, os.O_CREATE|os.O_WRONLY, 0)
if err != nil {
return nil, errors.Wrap(err, "bundle does not contain config.json")
}
if err := json.NewEncoder(cf).Encode(spec); err != nil {
cf.Close()
return nil, errors.Wrap(err, "failed to write Mounts into config.json")
}
cf.Close()
// Create the IO for the process
io, err := runc.NewPipeIO()
if err != nil {
return nil, errors.Wrap(err, "failed to create io pipes")
}
defer func() {
if err != nil {
io.Close()
}
}()
// Create the upstream IO
ps, err := newPipeSet(ctx, r.Stdin, r.Stdout, r.Stderr, r.Terminal)
if err != nil {
return nil, errors.Wrap(err, "failed to connect to upstream IO")
}
defer func() {
if err != nil {
ps.Close()
}
}()
// Create the relay for them both.
pr := newPipeRelay(ctx, ps, io)
defer func() {
if err != nil {
pr.close()
}
}()
process, err := newExecProcess(
ctx,
s,
r.ID,
r.ExecID,
pr,
parent.bundle,
r.Stdin,
r.Stdout,
r.Stderr,
r.Terminal)
if err != nil {
return nil, err
}
s.processes[r.ExecID] = process
return empty, nil
}
// ResizePty of a process
func (s *service) ResizePty(ctx context.Context, r *taskAPI.ResizePtyRequest) (*ptypes.Empty, error) {
var p *process
var err error
if p, err = s.getProcess(r.ExecID); err != nil {
return nil, err
}
cmd := exec.Command(
runhcsBinary,
runhcsDebugLegacy,
"resize-tty",
r.ID,
"-p",
strconv.FormatUint(uint64(p.pid), 10),
strconv.FormatUint(uint64(r.Width), 10),
strconv.FormatUint(uint64(r.Height), 10))
_, err = runCmd(ctx, cmd)
if err != nil {
return nil, err
}
return empty, nil
}
// CloseIO of a process
func (s *service) CloseIO(ctx context.Context, r *taskAPI.CloseIORequest) (*ptypes.Empty, error) {
var p *process
var err error
if p, err = s.getProcess(r.ExecID); err != nil {
return nil, err
}
p.closeIO()
return empty, nil
}
// Update a running container
func (s *service) Update(ctx context.Context, r *taskAPI.UpdateTaskRequest) (*ptypes.Empty, error) {
return nil, errdefs.ErrNotImplemented
}
// Wait for a process to exit
func (s *service) Wait(ctx context.Context, r *taskAPI.WaitRequest) (*taskAPI.WaitResponse, error) {
var p *process
var err error
if p, err = s.getProcess(r.ExecID); err != nil {
return nil, err
}
pe := p.wait()
return &taskAPI.WaitResponse{
ExitedAt: pe.exitedAt,
ExitStatus: pe.exitStatus,
}, nil
}
// Stats returns statistics about the running container
func (s *service) Stats(ctx context.Context, r *taskAPI.StatsRequest) (*taskAPI.StatsResponse, error) {
return nil, errdefs.ErrNotImplemented
}
// Connect returns the runhcs shim information
func (s *service) Connect(ctx context.Context, r *taskAPI.ConnectRequest) (*taskAPI.ConnectResponse, error) {
return &taskAPI.ConnectResponse{
ShimPid: uint32(os.Getpid()),
TaskPid: s.processes[s.id].pid,
Version: runhcsVersion,
}, nil
}
// Shutdown stops this instance of the runhcs shim
func (s *service) Shutdown(ctx context.Context, r *taskAPI.ShutdownRequest) (*ptypes.Empty, error) {
os.Exit(0)
return empty, nil
}

View File

@@ -27,6 +27,7 @@ import (
"os" "os"
"os/exec" "os/exec"
"sync" "sync"
"unsafe"
winio "github.com/Microsoft/go-winio" winio "github.com/Microsoft/go-winio"
"github.com/containerd/containerd/events" "github.com/containerd/containerd/events"
@@ -35,6 +36,7 @@ import (
"github.com/containerd/typeurl" "github.com/containerd/typeurl"
"github.com/pkg/errors" "github.com/pkg/errors"
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
"golang.org/x/sys/windows"
) )
// setupSignals creates a new signal handler for all signals // setupSignals creates a new signal handler for all signals
@@ -51,8 +53,43 @@ func subreaper() error {
return nil return nil
} }
type fakeSignal struct {
}
func (fs *fakeSignal) String() string {
return ""
}
func (fs *fakeSignal) Signal() {
}
func setupDumpStacks(dump chan<- os.Signal) { func setupDumpStacks(dump chan<- os.Signal) {
// TODO: JTERRY75: Make this based on events. signal.Notify(dump, syscall.SIGUSR1) // Windows does not support signals like *nix systems. So instead of
// trapping on SIGUSR1 to dump stacks, we wait on a Win32 event to be
// signaled. ACL'd to builtin administrators and local system
event := "Global\\containerd-shim-runhcs-v1-" + fmt.Sprint(os.Getpid())
ev, _ := windows.UTF16PtrFromString(event)
sd, err := winio.SddlToSecurityDescriptor("D:P(A;;GA;;;BA)(A;;GA;;;SY)")
if err != nil {
logrus.Errorf("failed to get security descriptor for debug stackdump event %s: %s", event, err.Error())
return
}
var sa windows.SecurityAttributes
sa.Length = uint32(unsafe.Sizeof(sa))
sa.InheritHandle = 1
sa.SecurityDescriptor = uintptr(unsafe.Pointer(&sd[0]))
h, err := windows.CreateEvent(&sa, 0, 0, ev)
if h == 0 || err != nil {
logrus.Errorf("failed to create debug stackdump event %s: %s", event, err.Error())
return
}
go func() {
logrus.Debugf("Stackdump - waiting signal at %s", event)
for {
windows.WaitForSingleObject(h, windows.INFINITE)
dump <- new(fakeSignal)
}
}()
} }
// serve serves the ttrpc API over a unix socket at the provided path // serve serves the ttrpc API over a unix socket at the provided path

View File

@@ -1,4 +1,4 @@
github.com/containerd/go-runc edcf3de1f4971445c42d61f20d506b30612aa031 github.com/containerd/go-runc 808e8444ac4633a8e5eb7314fc6b5d27051727dd
github.com/containerd/console 4d8a41f4ce5b9bae77c41786ea2458330f43f081 github.com/containerd/console 4d8a41f4ce5b9bae77c41786ea2458330f43f081
github.com/containerd/cgroups 5e610833b72089b37d0e615de9a92dfc043757c2 github.com/containerd/cgroups 5e610833b72089b37d0e615de9a92dfc043757c2
github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40 github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40
@@ -33,7 +33,7 @@ golang.org/x/sync 450f422ab23cf9881c94e2db30cac0eb1b7cf80c
github.com/BurntSushi/toml a368813c5e648fee92e5f6c30e3944ff9d5e8895 github.com/BurntSushi/toml a368813c5e648fee92e5f6c30e3944ff9d5e8895
github.com/grpc-ecosystem/go-grpc-prometheus 6b7015e65d366bf3f19b2b2a000a831940f0f7e0 github.com/grpc-ecosystem/go-grpc-prometheus 6b7015e65d366bf3f19b2b2a000a831940f0f7e0
github.com/Microsoft/go-winio v0.4.10 github.com/Microsoft/go-winio v0.4.10
github.com/Microsoft/hcsshim v0.6.14 github.com/Microsoft/hcsshim 44c060121b68e8bdc40b411beba551f3b4ee9e55
github.com/boltdb/bolt e9cf4fae01b5a8ff89d0ec6b32f0d9c9f79aefdd github.com/boltdb/bolt e9cf4fae01b5a8ff89d0ec6b32f0d9c9f79aefdd
google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944 google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944
golang.org/x/text 19e51611da83d6be54ddafce4a4af510cb3e9ea4 golang.org/x/text 19e51611da83d6be54ddafce4a4af510cb3e9ea4

View File

@@ -1,12 +1,13 @@
# hcsshim # hcsshim
This package supports launching Windows Server containers from Go. It is [![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
primarily used in the [Docker Engine](https://github.com/docker/docker) project,
but it can be freely used by other projects as well.
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
## Contributing ## Contributing
---------------
This project welcomes contributions and suggestions. Most contributions require you to agree to a This project welcomes contributions and suggestions. Most contributions require you to agree to a
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
the rights to use your contribution. For details, visit https://cla.microsoft.com. the rights to use your contribution. For details, visit https://cla.microsoft.com.
@@ -19,6 +20,11 @@ This project has adopted the [Microsoft Open Source Code of Conduct](https://ope
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments. contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
## Dependencies
This project requires Golang 1.9 or newer to build.
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
## Reporting Security Issues ## Reporting Security Issues
@@ -29,5 +35,7 @@ email to ensure we received your original message. Further information, includin
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in [MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default). the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
------------------------------------------- For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
---------------
Copyright (c) 2018 Microsoft Corp. All rights reserved. Copyright (c) 2018 Microsoft Corp. All rights reserved.

View File

@@ -1,28 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// ActivateLayer will find the layer with the given id and mount it's filesystem.
// For a read/write layer, the mounted filesystem will appear as a volume on the
// host, while a read-only layer is generally expected to be a no-op.
// An activated layer must later be deactivated via DeactivateLayer.
func ActivateLayer(info DriverInfo, id string) error {
title := "hcsshim::ActivateLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = activateLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour)
return nil
}

View File

@@ -0,0 +1,201 @@
Apache License
Version 2.0, January 2004
http://www.apache.org/licenses/
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
1. Definitions.
"License" shall mean the terms and conditions for use, reproduction,
and distribution as defined by Sections 1 through 9 of this document.
"Licensor" shall mean the copyright owner or entity authorized by
the copyright owner that is granting the License.
"Legal Entity" shall mean the union of the acting entity and all
other entities that control, are controlled by, or are under common
control with that entity. For the purposes of this definition,
"control" means (i) the power, direct or indirect, to cause the
direction or management of such entity, whether by contract or
otherwise, or (ii) ownership of fifty percent (50%) or more of the
outstanding shares, or (iii) beneficial ownership of such entity.
"You" (or "Your") shall mean an individual or Legal Entity
exercising permissions granted by this License.
"Source" form shall mean the preferred form for making modifications,
including but not limited to software source code, documentation
source, and configuration files.
"Object" form shall mean any form resulting from mechanical
transformation or translation of a Source form, including but
not limited to compiled object code, generated documentation,
and conversions to other media types.
"Work" shall mean the work of authorship, whether in Source or
Object form, made available under the License, as indicated by a
copyright notice that is included in or attached to the work
(an example is provided in the Appendix below).
"Derivative Works" shall mean any work, whether in Source or Object
form, that is based on (or derived from) the Work and for which the
editorial revisions, annotations, elaborations, or other modifications
represent, as a whole, an original work of authorship. For the purposes
of this License, Derivative Works shall not include works that remain
separable from, or merely link (or bind by name) to the interfaces of,
the Work and Derivative Works thereof.
"Contribution" shall mean any work of authorship, including
the original version of the Work and any modifications or additions
to that Work or Derivative Works thereof, that is intentionally
submitted to Licensor for inclusion in the Work by the copyright owner
or by an individual or Legal Entity authorized to submit on behalf of
the copyright owner. For the purposes of this definition, "submitted"
means any form of electronic, verbal, or written communication sent
to the Licensor or its representatives, including but not limited to
communication on electronic mailing lists, source code control systems,
and issue tracking systems that are managed by, or on behalf of, the
Licensor for the purpose of discussing and improving the Work, but
excluding communication that is conspicuously marked or otherwise
designated in writing by the copyright owner as "Not a Contribution."
"Contributor" shall mean Licensor and any individual or Legal Entity
on behalf of whom a Contribution has been received by Licensor and
subsequently incorporated within the Work.
2. Grant of Copyright License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
copyright license to reproduce, prepare Derivative Works of,
publicly display, publicly perform, sublicense, and distribute the
Work and such Derivative Works in Source or Object form.
3. Grant of Patent License. Subject to the terms and conditions of
this License, each Contributor hereby grants to You a perpetual,
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
(except as stated in this section) patent license to make, have made,
use, offer to sell, sell, import, and otherwise transfer the Work,
where such license applies only to those patent claims licensable
by such Contributor that are necessarily infringed by their
Contribution(s) alone or by combination of their Contribution(s)
with the Work to which such Contribution(s) was submitted. If You
institute patent litigation against any entity (including a
cross-claim or counterclaim in a lawsuit) alleging that the Work
or a Contribution incorporated within the Work constitutes direct
or contributory patent infringement, then any patent licenses
granted to You under this License for that Work shall terminate
as of the date such litigation is filed.
4. Redistribution. You may reproduce and distribute copies of the
Work or Derivative Works thereof in any medium, with or without
modifications, and in Source or Object form, provided that You
meet the following conditions:
(a) You must give any other recipients of the Work or
Derivative Works a copy of this License; and
(b) You must cause any modified files to carry prominent notices
stating that You changed the files; and
(c) You must retain, in the Source form of any Derivative Works
that You distribute, all copyright, patent, trademark, and
attribution notices from the Source form of the Work,
excluding those notices that do not pertain to any part of
the Derivative Works; and
(d) If the Work includes a "NOTICE" text file as part of its
distribution, then any Derivative Works that You distribute must
include a readable copy of the attribution notices contained
within such NOTICE file, excluding those notices that do not
pertain to any part of the Derivative Works, in at least one
of the following places: within a NOTICE text file distributed
as part of the Derivative Works; within the Source form or
documentation, if provided along with the Derivative Works; or,
within a display generated by the Derivative Works, if and
wherever such third-party notices normally appear. The contents
of the NOTICE file are for informational purposes only and
do not modify the License. You may add Your own attribution
notices within Derivative Works that You distribute, alongside
or as an addendum to the NOTICE text from the Work, provided
that such additional attribution notices cannot be construed
as modifying the License.
You may add Your own copyright statement to Your modifications and
may provide additional or different license terms and conditions
for use, reproduction, or distribution of Your modifications, or
for any such Derivative Works as a whole, provided Your use,
reproduction, and distribution of the Work otherwise complies with
the conditions stated in this License.
5. Submission of Contributions. Unless You explicitly state otherwise,
any Contribution intentionally submitted for inclusion in the Work
by You to the Licensor shall be under the terms and conditions of
this License, without any additional terms or conditions.
Notwithstanding the above, nothing herein shall supersede or modify
the terms of any separate license agreement you may have executed
with Licensor regarding such Contributions.
6. Trademarks. This License does not grant permission to use the trade
names, trademarks, service marks, or product names of the Licensor,
except as required for reasonable and customary use in describing the
origin of the Work and reproducing the content of the NOTICE file.
7. Disclaimer of Warranty. Unless required by applicable law or
agreed to in writing, Licensor provides the Work (and each
Contributor provides its Contributions) on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
implied, including, without limitation, any warranties or conditions
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
PARTICULAR PURPOSE. You are solely responsible for determining the
appropriateness of using or redistributing the Work and assume any
risks associated with Your exercise of permissions under this License.
8. Limitation of Liability. In no event and under no legal theory,
whether in tort (including negligence), contract, or otherwise,
unless required by applicable law (such as deliberate and grossly
negligent acts) or agreed to in writing, shall any Contributor be
liable to You for damages, including any direct, indirect, special,
incidental, or consequential damages of any character arising as a
result of this License or out of the use or inability to use the
Work (including but not limited to damages for loss of goodwill,
work stoppage, computer failure or malfunction, or any and all
other commercial damages or losses), even if such Contributor
has been advised of the possibility of such damages.
9. Accepting Warranty or Additional Liability. While redistributing
the Work or Derivative Works thereof, You may choose to offer,
and charge a fee for, acceptance of support, warranty, indemnity,
or other liability obligations and/or rights consistent with this
License. However, in accepting such obligations, You may act only
on Your own behalf and on Your sole responsibility, not on behalf
of any other Contributor, and only if You agree to indemnify,
defend, and hold each Contributor harmless for any liability
incurred by, or claims asserted against, such Contributor by reason
of your accepting any such warranty or additional liability.
END OF TERMS AND CONDITIONS
APPENDIX: How to apply the Apache License to your work.
To apply the Apache License to your work, attach the following
boilerplate notice, with the fields enclosed by brackets "[]"
replaced with your own identifying information. (Don't include
the brackets!) The text should be enclosed in the appropriate
comment syntax for the file format. We also recommend that a
file or class name and description of purpose be included on the
same "printed page" as the copyright notice for easier
identification within third-party archives.
Copyright [yyyy] [name of copyright owner]
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.

View File

@@ -0,0 +1,22 @@
go-runhcs is a fork of go-runc
The following is runc's legal notice.
---
runc
Copyright 2012-2015 Docker, Inc.
This product includes software developed at Docker, Inc. (http://www.docker.com).
The following is courtesy of our legal counsel:
Use and transfer of Docker may be subject to certain restrictions by the
United States and other governments.
It is your responsibility to ensure that your use and/or transfer does not
violate applicable laws.
For more information, please see http://www.bis.doc.gov
See also http://www.apache.org/dev/crypto.html and/or seek legal counsel.

View File

@@ -0,0 +1,125 @@
package runhcs
import (
"bytes"
"context"
"fmt"
"os"
"os/exec"
"sync"
"github.com/containerd/go-runc"
)
// Format is the type of log formatting options available.
type Format string
const (
none Format = ""
// Text is the default text log ouput.
Text Format = "text"
// JSON is the JSON formatted log output.
JSON Format = "json"
command = "runhcs"
)
var bytesBufferPool = sync.Pool{
New: func() interface{} {
return bytes.NewBuffer(nil)
},
}
func getBuf() *bytes.Buffer {
return bytesBufferPool.Get().(*bytes.Buffer)
}
func putBuf(b *bytes.Buffer) {
b.Reset()
bytesBufferPool.Put(b)
}
// Runhcs is the client to the runhcs cli
type Runhcs struct {
// Debug enables debug output for logging.
Debug bool
// Log sets the log file path where internal debug information is written.
Log string
// LogFormat sets the format used by logs.
LogFormat Format
// Owner sets the compute system owner property.
Owner string
// Root is the registry key root for storage of runhcs container state.
Root string
}
func (r *Runhcs) args() []string {
var out []string
if r.Debug {
out = append(out, "--debug")
}
if r.Log != "" {
// TODO: JTERRY75 - Should we do abs here?
out = append(out, "--log", r.Log)
}
if r.LogFormat != none {
out = append(out, "--log-format", string(r.LogFormat))
}
if r.Owner != "" {
out = append(out, "--owner", r.Owner)
}
if r.Root != "" {
out = append(out, "--root", r.Root)
}
return out
}
func (r *Runhcs) command(context context.Context, args ...string) *exec.Cmd {
cmd := exec.CommandContext(context, command, append(r.args(), args...)...)
cmd.Env = os.Environ()
return cmd
}
// runOrError will run the provided command. If an error is
// encountered and neither Stdout or Stderr was set the error and the
// stderr of the command will be returned in the format of <error>:
// <stderr>
func (r *Runhcs) runOrError(cmd *exec.Cmd) error {
if cmd.Stdout != nil || cmd.Stderr != nil {
ec, err := runc.Monitor.Start(cmd)
if err != nil {
return err
}
status, err := runc.Monitor.Wait(cmd, ec)
if err == nil && status != 0 {
err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0])
}
return err
}
data, err := cmdOutput(cmd, true)
if err != nil {
return fmt.Errorf("%s: %s", err, data)
}
return nil
}
func cmdOutput(cmd *exec.Cmd, combined bool) ([]byte, error) {
b := getBuf()
defer putBuf(b)
cmd.Stdout = b
if combined {
cmd.Stderr = b
}
ec, err := runc.Monitor.Start(cmd)
if err != nil {
return nil, err
}
status, err := runc.Monitor.Wait(cmd, ec)
if err == nil && status != 0 {
err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0])
}
return b.Bytes(), err
}

View File

@@ -0,0 +1,91 @@
package runhcs
import (
"context"
"fmt"
"path/filepath"
runc "github.com/containerd/go-runc"
)
// CreateOpts is set of options that can be used with the Create command.
type CreateOpts struct {
runc.IO
// PidFile is the path to the file to write the process id to.
PidFile string
// ShimLog is the path to the log file for the launched shim process.
ShimLog string
// VMLog is the path to the log file for the launched VM shim process.
VMLog string
// VMConsole is the path to the pipe for the VM's console (e.g. \\.\pipe\debugpipe)
VMConsole string
}
func (opt *CreateOpts) args() ([]string, error) {
var out []string
if opt.PidFile != "" {
abs, err := filepath.Abs(opt.PidFile)
if err != nil {
return nil, err
}
out = append(out, "--pid-file", abs)
}
if opt.ShimLog != "" {
abs, err := filepath.Abs(opt.ShimLog)
if err != nil {
return nil, err
}
out = append(out, "--shim-log", abs)
}
if opt.VMLog != "" {
abs, err := filepath.Abs(opt.VMLog)
if err != nil {
return nil, err
}
out = append(out, "--vm-log", abs)
}
if opt.VMConsole != "" {
out = append(out, "--vm-console", opt.VMConsole)
}
return out, nil
}
// Create creates a new container and returns its pid if it was created
// successfully.
func (r *Runhcs) Create(context context.Context, id, bundle string, opts *CreateOpts) error {
args := []string{"create", "--bundle", bundle}
if opts != nil {
oargs, err := opts.args()
if err != nil {
return err
}
args = append(args, oargs...)
}
cmd := r.command(context, append(args, id)...)
if opts != nil && opts.IO != nil {
opts.Set(cmd)
}
if cmd.Stdout == nil && cmd.Stderr == nil {
data, err := cmdOutput(cmd, true)
if err != nil {
return fmt.Errorf("%s: %s", err, data)
}
return nil
}
ec, err := runc.Monitor.Start(cmd)
if err != nil {
return err
}
if opts != nil && opts.IO != nil {
if c, ok := opts.IO.(runc.StartCloser); ok {
if err := c.CloseAfterStart(); err != nil {
return err
}
}
}
status, err := runc.Monitor.Wait(cmd, ec)
if err == nil && status != 0 {
err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0])
}
return nil
}

View File

@@ -0,0 +1,33 @@
package runhcs
import (
"context"
)
// DeleteOpts is set of options that can be used with the Delete command.
type DeleteOpts struct {
// Force forcibly deletes the container if it is still running (uses SIGKILL).
Force bool
}
func (opt *DeleteOpts) args() ([]string, error) {
var out []string
if opt.Force {
out = append(out, "--force")
}
return out, nil
}
// Delete any resources held by the container often used with detached
// containers.
func (r *Runhcs) Delete(context context.Context, id string, opts *DeleteOpts) error {
args := []string{"delete"}
if opts != nil {
oargs, err := opts.args()
if err != nil {
return err
}
args = append(args, oargs...)
}
return r.runOrError(r.command(context, append(args, id)...))
}

View File

@@ -0,0 +1,82 @@
package runhcs
import (
"context"
"fmt"
"path/filepath"
"github.com/containerd/go-runc"
)
// ExecOpts is set of options that can be used with the Exec command.
type ExecOpts struct {
runc.IO
// Detach from the container's process.
Detach bool
// PidFile is the path to the file to write the process id to.
PidFile string
// ShimLog is the path to the log file for the launched shim process.
ShimLog string
}
func (opt *ExecOpts) args() ([]string, error) {
var out []string
if opt.Detach {
out = append(out, "--detach")
}
if opt.PidFile != "" {
abs, err := filepath.Abs(opt.PidFile)
if err != nil {
return nil, err
}
out = append(out, "--pid-file", abs)
}
if opt.ShimLog != "" {
abs, err := filepath.Abs(opt.ShimLog)
if err != nil {
return nil, err
}
out = append(out, "--shim-log", abs)
}
return out, nil
}
// Exec executes an additional process inside the container based on the
// oci.Process spec found at processFile.
func (r *Runhcs) Exec(context context.Context, id, processFile string, opts *ExecOpts) error {
args := []string{"exec", "--process", processFile}
if opts != nil {
oargs, err := opts.args()
if err != nil {
return err
}
args = append(args, oargs...)
}
cmd := r.command(context, append(args, id)...)
if opts != nil && opts.IO != nil {
opts.Set(cmd)
}
if cmd.Stdout == nil && cmd.Stderr == nil {
data, err := cmdOutput(cmd, true)
if err != nil {
return fmt.Errorf("%s: %s", err, data)
}
return nil
}
ec, err := runc.Monitor.Start(cmd)
if err != nil {
return err
}
if opts != nil && opts.IO != nil {
if c, ok := opts.IO.(runc.StartCloser); ok {
if err := c.CloseAfterStart(); err != nil {
return err
}
}
}
status, err := runc.Monitor.Wait(cmd, ec)
if err == nil && status != 0 {
err = fmt.Errorf("%s did not terminate sucessfully", cmd.Args[0])
}
return err
}

View File

@@ -0,0 +1,11 @@
package runhcs
import (
"context"
)
// Kill sends the specified signal (default: SIGTERM) to the container's init
// process.
func (r *Runhcs) Kill(context context.Context, id, signal string) error {
return r.runOrError(r.command(context, "kill", id, signal))
}

View File

@@ -0,0 +1,10 @@
package runhcs
import (
"context"
)
// Start will start an already created container.
func (r *Runhcs) Start(context context.Context, id string) error {
return r.runOrError(r.command(context, "start", id))
}

View File

@@ -1,845 +1,192 @@
package hcsshim package hcsshim
import ( import (
"encoding/json"
"fmt" "fmt"
"os" "os"
"strconv"
"sync"
"syscall"
"time" "time"
"github.com/sirupsen/logrus" "github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/mergemaps"
"github.com/Microsoft/hcsshim/internal/schema1"
) )
var (
defaultTimeout = time.Minute * 4
)
const (
pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}`
statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}`
processListQuery = `{ "PropertyTypes" : ["ProcessList"]}`
mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}`
)
type container struct {
handleLock sync.RWMutex
handle hcsSystem
id string
callbackNumber uintptr
}
// ContainerProperties holds the properties for a container and the processes running in that container // ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties struct { type ContainerProperties = schema1.ContainerProperties
ID string `json:"Id"`
Name string
SystemType string
Owner string
SiloGUID string `json:"SiloGuid,omitempty"`
RuntimeID string `json:"RuntimeId,omitempty"`
IsRuntimeTemplate bool `json:",omitempty"`
RuntimeImagePath string `json:",omitempty"`
Stopped bool `json:",omitempty"`
ExitType string `json:",omitempty"`
AreUpdatesPending bool `json:",omitempty"`
ObRoot string `json:",omitempty"`
Statistics Statistics `json:",omitempty"`
ProcessList []ProcessListItem `json:",omitempty"`
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
}
// MemoryStats holds the memory statistics for a container // MemoryStats holds the memory statistics for a container
type MemoryStats struct { type MemoryStats = schema1.MemoryStats
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
}
// ProcessorStats holds the processor statistics for a container // ProcessorStats holds the processor statistics for a container
type ProcessorStats struct { type ProcessorStats = schema1.ProcessorStats
TotalRuntime100ns uint64 `json:",omitempty"`
RuntimeUser100ns uint64 `json:",omitempty"`
RuntimeKernel100ns uint64 `json:",omitempty"`
}
// StorageStats holds the storage statistics for a container // StorageStats holds the storage statistics for a container
type StorageStats struct { type StorageStats = schema1.StorageStats
ReadCountNormalized uint64 `json:",omitempty"`
ReadSizeBytes uint64 `json:",omitempty"`
WriteCountNormalized uint64 `json:",omitempty"`
WriteSizeBytes uint64 `json:",omitempty"`
}
// NetworkStats holds the network statistics for a container // NetworkStats holds the network statistics for a container
type NetworkStats struct { type NetworkStats = schema1.NetworkStats
BytesReceived uint64 `json:",omitempty"`
BytesSent uint64 `json:",omitempty"`
PacketsReceived uint64 `json:",omitempty"`
PacketsSent uint64 `json:",omitempty"`
DroppedPacketsIncoming uint64 `json:",omitempty"`
DroppedPacketsOutgoing uint64 `json:",omitempty"`
EndpointId string `json:",omitempty"`
InstanceId string `json:",omitempty"`
}
// Statistics is the structure returned by a statistics call on a container // Statistics is the structure returned by a statistics call on a container
type Statistics struct { type Statistics = schema1.Statistics
Timestamp time.Time `json:",omitempty"`
ContainerStartTime time.Time `json:",omitempty"`
Uptime100ns uint64 `json:",omitempty"`
Memory MemoryStats `json:",omitempty"`
Processor ProcessorStats `json:",omitempty"`
Storage StorageStats `json:",omitempty"`
Network []NetworkStats `json:",omitempty"`
}
// ProcessList is the structure of an item returned by a ProcessList call on a container // ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem struct { type ProcessListItem = schema1.ProcessListItem
CreateTimestamp time.Time `json:",omitempty"`
ImageName string `json:",omitempty"`
KernelTime100ns uint64 `json:",omitempty"`
MemoryCommitBytes uint64 `json:",omitempty"`
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
ProcessId uint32 `json:",omitempty"`
UserTime100ns uint64 `json:",omitempty"`
}
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container // MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController struct { type MappedVirtualDiskController = schema1.MappedVirtualDiskController
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
}
// Type of Request Support in ModifySystem // Type of Request Support in ModifySystem
type RequestType string type RequestType = schema1.RequestType
// Type of Resource Support in ModifySystem // Type of Resource Support in ModifySystem
type ResourceType string type ResourceType = schema1.ResourceType
// RequestType const // RequestType const
const ( const (
Add RequestType = "Add" Add = schema1.Add
Remove RequestType = "Remove" Remove = schema1.Remove
Network ResourceType = "Network" Network = schema1.Network
) )
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system // ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove // Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse struct { type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
Resource ResourceType `json:"ResourceType"`
Data interface{} `json:"Settings"` type container struct {
Request RequestType `json:"RequestType,omitempty"` system *hcs.System
} }
// createContainerAdditionalJSON is read from the environment at initialisation // createComputeSystemAdditionalJSON is read from the environment at initialisation
// time. It allows an environment variable to define additional JSON which // time. It allows an environment variable to define additional JSON which
// is merged in the CreateContainer call to HCS. // is merged in the CreateComputeSystem call to HCS.
var createContainerAdditionalJSON string var createContainerAdditionalJSON []byte
// currentContainerStarts is used to limit the number of concurrent container
// starts.
var currentContainerStarts containerStarts
type containerStarts struct {
maxParallel int
inProgress int
sync.Mutex
}
func init() { func init() {
createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON") createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
if len(mpsS) > 0 {
mpsI, err := strconv.Atoi(mpsS)
if err != nil || mpsI < 0 {
return
}
currentContainerStarts.maxParallel = mpsI
}
} }
// CreateContainer creates a new container with the given configuration but does not start it. // CreateContainer creates a new container with the given configuration but does not start it.
func CreateContainer(id string, c *ContainerConfig) (Container, error) { func CreateContainer(id string, c *ContainerConfig) (Container, error) {
return createContainerWithJSON(id, c, "") fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
} if err != nil {
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
// CreateContainerWithJSON creates a new container with the given configuration but does not start it.
// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS.
func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
return createContainerWithJSON(id, c, additionalJSON)
}
func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) {
operation := "CreateContainer"
title := "HCSShim::" + operation
container := &container{
id: id,
} }
configurationb, err := json.Marshal(c) system, err := hcs.CreateComputeSystem(id, fullConfig)
if err != nil { if err != nil {
return nil, err return nil, err
} }
return &container{system}, err
configuration := string(configurationb)
logrus.Debugf(title+" id=%s config=%s", id, configuration)
// Merge any additional JSON. Priority is given to what is passed in explicitly,
// falling back to what's set in the environment.
if additionalJSON == "" && createContainerAdditionalJSON != "" {
additionalJSON = createContainerAdditionalJSON
}
if additionalJSON != "" {
configurationMap := map[string]interface{}{}
if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil {
return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err)
}
additionalMap := map[string]interface{}{}
if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil {
return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err)
}
mergedMap := mergeMaps(additionalMap, configurationMap)
mergedJSON, err := json.Marshal(mergedMap)
if err != nil {
return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err)
}
configuration = string(mergedJSON)
logrus.Debugf(title+" id=%s merged config=%s", id, configuration)
}
var (
resultp *uint16
identity syscall.Handle
)
createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp)
if createError == nil || IsPending(createError) {
if err := container.registerCallback(); err != nil {
// Terminate the container if it still exists. We're okay to ignore a failure here.
container.Terminate()
return nil, makeContainerError(container, operation, "", err)
}
}
err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout)
if err != nil {
if err == ErrTimeout {
// Terminate the container if it still exists. We're okay to ignore a failure here.
container.Terminate()
}
return nil, makeContainerError(container, operation, configuration, err)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle)
return container, nil
}
// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
// in ToMap are overwritten. Values in fromMap are added to ToMap.
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
func mergeMaps(fromMap, ToMap interface{}) interface{} {
switch fromMap := fromMap.(type) {
case map[string]interface{}:
ToMap, ok := ToMap.(map[string]interface{})
if !ok {
return fromMap
}
for keyToMap, valueToMap := range ToMap {
if valueFromMap, ok := fromMap[keyToMap]; ok {
fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap)
} else {
fromMap[keyToMap] = valueToMap
}
}
case nil:
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
ToMap, ok := ToMap.(map[string]interface{})
if ok {
return ToMap
}
}
return fromMap
} }
// OpenContainer opens an existing container by ID. // OpenContainer opens an existing container by ID.
func OpenContainer(id string) (Container, error) { func OpenContainer(id string) (Container, error) {
operation := "OpenContainer" system, err := hcs.OpenComputeSystem(id)
title := "HCSShim::" + operation
logrus.Debugf(title+" id=%s", id)
container := &container{
id: id,
}
var (
handle hcsSystem
resultp *uint16
)
err := hcsOpenComputeSystem(id, &handle, &resultp)
err = processHcsResult(err, resultp)
if err != nil { if err != nil {
return nil, makeContainerError(container, operation, "", err) return nil, err
} }
return &container{system}, err
container.handle = handle
if err := container.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
return container, nil
} }
// GetContainers gets a list of the containers on the system that match the query // GetContainers gets a list of the containers on the system that match the query
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
operation := "GetContainers" return hcs.GetComputeSystems(q)
title := "HCSShim::" + operation
queryb, err := json.Marshal(q)
if err != nil {
return nil, err
}
query := string(queryb)
logrus.Debugf(title+" query=%s", query)
var (
resultp *uint16
computeSystemsp *uint16
)
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
if computeSystemsp == nil {
return nil, ErrUnexpectedValue
}
computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp)
computeSystems := []ContainerProperties{}
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
return nil, err
}
logrus.Debugf(title + " succeeded")
return computeSystems, nil
} }
// Start synchronously starts the container. // Start synchronously starts the container.
func (container *container) Start() error { func (container *container) Start() error {
container.handleLock.RLock() return convertSystemError(container.system.Start(), container)
defer container.handleLock.RUnlock()
operation := "Start"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
// This is a very simple backoff-retry loop to limit the number
// of parallel container starts if environment variable
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
// It should generally only be used as a workaround to various
// platform issues that exist between RS1 and RS4 as of Aug 2018.
if currentContainerStarts.maxParallel > 0 {
for {
currentContainerStarts.Lock()
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
currentContainerStarts.inProgress++
currentContainerStarts.Unlock()
break
}
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
currentContainerStarts.Unlock()
time.Sleep(100 * time.Millisecond)
}
}
// Make sure we decrement the count when we are done.
defer func() {
currentContainerStarts.Lock()
currentContainerStarts.inProgress--
currentContainerStarts.Unlock()
}()
}
var resultp *uint16
err := hcsStartComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
} }
// Shutdown requests a container shutdown, if IsPending() on the error returned is true, // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
// it may not actually be shut down until Wait() succeeds.
func (container *container) Shutdown() error { func (container *container) Shutdown() error {
container.handleLock.RLock() return convertSystemError(container.system.Shutdown(), container)
defer container.handleLock.RUnlock()
operation := "Shutdown"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsShutdownComputeSystem(container.handle, "", &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
} }
// Terminate requests a container terminate, if IsPending() on the error returned is true, // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
// it may not actually be shut down until Wait() succeeds.
func (container *container) Terminate() error { func (container *container) Terminate() error {
container.handleLock.RLock() return convertSystemError(container.system.Terminate(), container)
defer container.handleLock.RUnlock()
operation := "Terminate"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsTerminateComputeSystem(container.handle, "", &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
} }
// Wait synchronously waits for the container to shutdown or terminate. // Waits synchronously waits for the container to shutdown or terminate.
func (container *container) Wait() error { func (container *container) Wait() error {
operation := "Wait" return convertSystemError(container.system.Wait(), container)
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
} }
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
// If the timeout expires, IsTimeout(err) == true // returns false if timeout occurs.
func (container *container) WaitTimeout(timeout time.Duration) error { func (container *container) WaitTimeout(t time.Duration) error {
operation := "WaitTimeout" return convertSystemError(container.system.WaitTimeout(t), container)
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
} }
func (container *container) properties(query string) (*ContainerProperties, error) { // Pause pauses the execution of a container.
var ( func (container *container) Pause() error {
resultp *uint16 return convertSystemError(container.system.Pause(), container)
propertiesp *uint16 }
)
err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
if propertiesp == nil { // Resume resumes the execution of a container.
return nil, ErrUnexpectedValue func (container *container) Resume() error {
} return convertSystemError(container.system.Resume(), container)
propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
properties := &ContainerProperties{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, err
}
return properties, nil
} }
// HasPendingUpdates returns true if the container has updates pending to install // HasPendingUpdates returns true if the container has updates pending to install
func (container *container) HasPendingUpdates() (bool, error) { func (container *container) HasPendingUpdates() (bool, error) {
container.handleLock.RLock() return false, nil
defer container.handleLock.RUnlock()
operation := "HasPendingUpdates"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return false, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(pendingUpdatesQuery)
if err != nil {
return false, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.AreUpdatesPending, nil
} }
// Statistics returns statistics for the container // Statistics returns statistics for the container. This is a legacy v1 call
func (container *container) Statistics() (Statistics, error) { func (container *container) Statistics() (Statistics, error) {
container.handleLock.RLock() properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
defer container.handleLock.RUnlock()
operation := "Statistics"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(statisticsQuery)
if err != nil { if err != nil {
return Statistics{}, makeContainerError(container, operation, "", err) return Statistics{}, convertSystemError(err, container)
} }
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.Statistics, nil return properties.Statistics, nil
} }
// ProcessList returns an array of ProcessListItems for the container // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
func (container *container) ProcessList() ([]ProcessListItem, error) { func (container *container) ProcessList() ([]ProcessListItem, error) {
container.handleLock.RLock() properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
defer container.handleLock.RUnlock()
operation := "ProcessList"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(processListQuery)
if err != nil { if err != nil {
return nil, makeContainerError(container, operation, "", err) return nil, convertSystemError(err, container)
} }
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.ProcessList, nil return properties.ProcessList, nil
} }
// MappedVirtualDisks returns a map of the controllers and the disks mapped // This is a legacy v1 call
// to a container.
//
// Example of JSON returned by the query.
//{
// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm",
// "SystemType":"Container",
// "RuntimeOsType":"Linux",
// "RuntimeId":"00000000-0000-0000-0000-000000000000",
// "State":"Running",
// "MappedVirtualDiskControllers":{
// "0":{
// "MappedVirtualDisks":{
// "2":{
// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx",
// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch",
// "Lun":2,
// "CreateInUtilityVM":true
// },
// "3":{
// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx",
// "Lun":3,
// "CreateInUtilityVM":true,
// "AttachOnly":true
// }
// }
// }
// }
//}
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
container.handleLock.RLock() properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
defer container.handleLock.RUnlock()
operation := "MappedVirtualDiskList"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
properties, err := container.properties(mappedVirtualDiskQuery)
if err != nil { if err != nil {
return nil, makeContainerError(container, operation, "", err) return nil, convertSystemError(err, container)
} }
logrus.Debugf(title+" succeeded id=%s", container.id)
return properties.MappedVirtualDiskControllers, nil return properties.MappedVirtualDiskControllers, nil
} }
// Pause pauses the execution of the container. This feature is not enabled in TP5.
func (container *container) Pause() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Pause"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsPauseComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
}
// Resume resumes the execution of the container. This feature is not enabled in TP5.
func (container *container) Resume() error {
container.handleLock.RLock()
defer container.handleLock.RUnlock()
operation := "Resume"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsResumeComputeSystem(container.handle, "", &resultp)
err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
}
// CreateProcess launches a new process within the container. // CreateProcess launches a new process within the container.
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
container.handleLock.RLock() p, err := container.system.CreateProcess(c)
defer container.handleLock.RUnlock()
operation := "CreateProcess"
title := "HCSShim::Container::" + operation
var (
processInfo hcsProcessInformation
processHandle hcsProcess
resultp *uint16
)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
// If we are not emulating a console, ignore any console size passed to us
if !c.EmulateConsole {
c.ConsoleSize[0] = 0
c.ConsoleSize[1] = 0
}
configurationb, err := json.Marshal(c)
if err != nil { if err != nil {
return nil, makeContainerError(container, operation, "", err) return nil, convertSystemError(err, container)
} }
return &process{p}, nil
configuration := string(configurationb)
logrus.Debugf(title+" id=%s config=%s", container.id, configuration)
err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, makeContainerError(container, operation, configuration, err)
}
process := &process{
handle: processHandle,
processID: int(processInfo.ProcessId),
container: container,
cachedPipes: &cachedPipes{
stdIn: processInfo.StdInput,
stdOut: processInfo.StdOutput,
stdErr: processInfo.StdError,
},
}
if err := process.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID)
return process, nil
} }
// OpenProcess gets an interface to an existing process within the container. // OpenProcess gets an interface to an existing process within the container.
func (container *container) OpenProcess(pid int) (Process, error) { func (container *container) OpenProcess(pid int) (Process, error) {
container.handleLock.RLock() p, err := container.system.OpenProcess(pid)
defer container.handleLock.RUnlock()
operation := "OpenProcess"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s, processid=%d", container.id, pid)
var (
processHandle hcsProcess
resultp *uint16
)
if container.handle == 0 {
return nil, makeContainerError(container, operation, "", ErrAlreadyClosed)
}
err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp)
err = processHcsResult(err, resultp)
if err != nil { if err != nil {
return nil, makeContainerError(container, operation, "", err) return nil, convertSystemError(err, container)
} }
return &process{p}, nil
process := &process{
handle: processHandle,
processID: pid,
container: container,
}
if err := process.registerCallback(); err != nil {
return nil, makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID)
return process, nil
} }
// Close cleans up any state associated with the container but does not terminate or wait for it. // Close cleans up any state associated with the container but does not terminate or wait for it.
func (container *container) Close() error { func (container *container) Close() error {
container.handleLock.Lock() return convertSystemError(container.system.Close(), container)
defer container.handleLock.Unlock()
operation := "Close"
title := "HCSShim::Container::" + operation
logrus.Debugf(title+" id=%s", container.id)
// Don't double free this
if container.handle == 0 {
return nil
}
if err := container.unregisterCallback(); err != nil {
return makeContainerError(container, operation, "", err)
}
if err := hcsCloseComputeSystem(container.handle); err != nil {
return makeContainerError(container, operation, "", err)
}
container.handle = 0
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
} }
func (container *container) registerCallback() error { // Modify the System
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
container.callbackNumber = callbackNumber
return nil
}
func (container *container) unregisterCallback() error {
callbackNumber := container.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterComputeSystemCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterComputeSystemCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}
// Modifies the System by sending a request to HCS
func (container *container) Modify(config *ResourceModificationRequestResponse) error { func (container *container) Modify(config *ResourceModificationRequestResponse) error {
container.handleLock.RLock() return convertSystemError(container.system.Modify(config), container)
defer container.handleLock.RUnlock()
operation := "Modify"
title := "HCSShim::Container::" + operation
if container.handle == 0 {
return makeContainerError(container, operation, "", ErrAlreadyClosed)
}
requestJSON, err := json.Marshal(config)
if err != nil {
return err
}
requestString := string(requestJSON)
logrus.Debugf(title+" id=%s request=%s", container.id, requestString)
var resultp *uint16
err = hcsModifyComputeSystem(container.handle, requestString, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeContainerError(container, operation, "", err)
}
logrus.Debugf(title+" succeeded id=%s", container.id)
return nil
} }

View File

@@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
// the parent layer provided.
func CreateLayer(info DriverInfo, id, parent string) error {
title := "hcsshim::CreateLayer "
logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = createLayer(&infop, id, parent)
if err != nil {
err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour)
return nil
}

View File

@@ -1,35 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// CreateSandboxLayer creates and populates new read-write layer for use by a container.
// This requires both the id of the direct parent layer, as well as the full list
// of paths to all parent layers up to the base (and including the direct parent
// whose id was provided).
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
title := "hcsshim::CreateSandboxLayer "
logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = createSandboxLayer(&infop, layerId, parentId, layers)
if err != nil {
err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId)
return nil
}

View File

@@ -1,26 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
func DeactivateLayer(info DriverInfo, id string) error {
title := "hcsshim::DeactivateLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = deactivateLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
return nil
}

View File

@@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// DestroyLayer will remove the on-disk files representing the layer with the given
// id, including that layer's containing folder, if any.
func DestroyLayer(info DriverInfo, id string) error {
title := "hcsshim::DestroyLayer "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = destroyLayer(&infop, id)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id)
return nil
}

View File

@@ -1,92 +1,83 @@
package hcsshim package hcsshim
import ( import (
"errors"
"fmt" "fmt"
"syscall" "syscall"
"github.com/Microsoft/hcsshim/internal/hns"
"github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/hcserror"
) )
var ( var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
// ErrElementNotFound is an error encountered when the object being referenced does not exist // ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = syscall.Errno(0x490) ErrElementNotFound = hcs.ErrElementNotFound
// ErrElementNotFound is an error encountered when the object being referenced does not exist // ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = syscall.Errno(0x32) ErrNotSupported = hcs.ErrNotSupported
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d // decimal -2147024883 / hex 0x8007000d
ErrInvalidData = syscall.Errno(0xd) ErrInvalidData = hcs.ErrInvalidData
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") ErrHandleClose = hcs.ErrHandleClose
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") ErrAlreadyClosed = hcs.ErrAlreadyClosed
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used // ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") ErrInvalidProcessState = hcs.ErrInvalidProcessState
// ErrTimeout is an error encountered when waiting on a notification times out // ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = errors.New("hcsshim: timeout waiting for notification") ErrTimeout = hcs.ErrTimeout
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification // a different expected notification
ErrUnexpectedContainerExit = errors.New("unexpected container exit") ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification // is lost while waiting for a notification
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value // ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = errors.New("unexpected value returned from hcs") ErrUnexpectedValue = hcs.ErrUnexpectedValue
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
// ErrProcNotFound is an error encountered when the the process cannot be found // ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = syscall.Errno(0x7f) ErrProcNotFound = hcs.ErrProcNotFound
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
// ErrNotSupported is an error encountered when hcs doesn't support the request // ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = errors.New("unsupported platform request") ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
) )
type EndpointNotFoundError struct { type EndpointNotFoundError = hns.EndpointNotFoundError
EndpointName string type NetworkNotFoundError = hns.NetworkNotFoundError
}
func (e EndpointNotFoundError) Error() string {
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
}
type NetworkNotFoundError struct {
NetworkName string
}
func (e NetworkNotFoundError) Error() string {
return fmt.Sprintf("Network %s not found", e.NetworkName)
}
// ProcessError is an error encountered in HCS during an operation on a Process object // ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct { type ProcessError struct {
@@ -94,6 +85,7 @@ type ProcessError struct {
Operation string Operation string
ExtraInfo string ExtraInfo string
Err error Err error
Events []hcs.ErrorEvent
} }
// ContainerError is an error encountered in HCS during an operation on a Container object // ContainerError is an error encountered in HCS during an operation on a Container object
@@ -102,6 +94,7 @@ type ContainerError struct {
Operation string Operation string
ExtraInfo string ExtraInfo string
Err error Err error
Events []hcs.ErrorEvent
} }
func (e *ContainerError) Error() string { func (e *ContainerError) Error() string {
@@ -113,7 +106,7 @@ func (e *ContainerError) Error() string {
return "unexpected nil container for error: " + e.Err.Error() return "unexpected nil container for error: " + e.Err.Error()
} }
s := "container " + e.Container.id s := "container " + e.Container.system.ID()
if e.Operation != "" { if e.Operation != "" {
s += " encountered an error during " + e.Operation s += " encountered an error during " + e.Operation
@@ -123,11 +116,15 @@ func (e *ContainerError) Error() string {
case nil: case nil:
break break
case syscall.Errno: case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default: default:
s += fmt.Sprintf(": %s", e.Err.Error()) s += fmt.Sprintf(": %s", e.Err.Error())
} }
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.ExtraInfo != "" { if e.ExtraInfo != "" {
s += " extra info: " + e.ExtraInfo s += " extra info: " + e.ExtraInfo
} }
@@ -153,12 +150,7 @@ func (e *ProcessError) Error() string {
return "Unexpected nil process for error: " + e.Err.Error() return "Unexpected nil process for error: " + e.Err.Error()
} }
s := fmt.Sprintf("process %d", e.Process.processID) s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
if e.Process.container != nil {
s += " in container " + e.Process.container.id
}
if e.Operation != "" { if e.Operation != "" {
s += " encountered an error during " + e.Operation s += " encountered an error during " + e.Operation
} }
@@ -167,11 +159,15 @@ func (e *ProcessError) Error() string {
case nil: case nil:
break break
case syscall.Errno: case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default: default:
s += fmt.Sprintf(": %s", e.Err.Error()) s += fmt.Sprintf(": %s", e.Err.Error())
} }
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s return s
} }
@@ -189,37 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. // will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool { func IsNotExist(err error) bool {
err = getInnerError(err)
if _, ok := err.(EndpointNotFoundError); ok { if _, ok := err.(EndpointNotFoundError); ok {
return true return true
} }
if _, ok := err.(NetworkNotFoundError); ok { if _, ok := err.(NetworkNotFoundError); ok {
return true return true
} }
return err == ErrComputeSystemDoesNotExist || return hcs.IsNotExist(getInnerError(err))
err == ErrElementNotFound ||
err == ErrProcNotFound
} }
// IsAlreadyClosed checks if an error is caused by the Container or Process having been // IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method. // already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool { func IsAlreadyClosed(err error) bool {
err = getInnerError(err) return hcs.IsAlreadyClosed(getInnerError(err))
return err == ErrAlreadyClosed
} }
// IsPending returns a boolean indicating whether the error is that // IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background. // the requested operation is being completed in the background.
func IsPending(err error) bool { func IsPending(err error) bool {
err = getInnerError(err) return hcs.IsPending(getInnerError(err))
return err == ErrVmcomputeOperationPending
} }
// IsTimeout returns a boolean indicating whether the error is caused by // IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete. // a timeout waiting for the operation to complete.
func IsTimeout(err error) bool { func IsTimeout(err error) bool {
err = getInnerError(err) return hcs.IsTimeout(getInnerError(err))
return err == ErrTimeout
} }
// IsAlreadyStopped returns a boolean indicating whether the error is caused by // IsAlreadyStopped returns a boolean indicating whether the error is caused by
@@ -228,10 +218,7 @@ func IsTimeout(err error) bool {
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. // will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool { func IsAlreadyStopped(err error) bool {
err = getInnerError(err) return hcs.IsAlreadyStopped(getInnerError(err))
return err == ErrVmcomputeAlreadyStopped ||
err == ErrElementNotFound ||
err == ErrProcNotFound
} }
// IsNotSupported returns a boolean indicating whether the error is caused by // IsNotSupported returns a boolean indicating whether the error is caused by
@@ -240,12 +227,7 @@ func IsAlreadyStopped(err error) bool {
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform // is thrown from the Platform
func IsNotSupported(err error) bool { func IsNotSupported(err error) bool {
err = getInnerError(err) return hcs.IsNotSupported(getInnerError(err))
// If Platform doesn't recognize or support the request sent, below errors are seen
return err == ErrVmcomputeInvalidJSON ||
err == ErrInvalidData ||
err == ErrNotSupported ||
err == ErrVmcomputeUnknownMessage
} }
func getInnerError(err error) error { func getInnerError(err error) error {
@@ -259,3 +241,17 @@ func getInnerError(err error) error {
} }
return err return err
} }
func convertSystemError(err error, c *container) error {
if serr, ok := err.(*hcs.SystemError); ok {
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
}
return err
}
func convertProcessError(err error, p *process) error {
if perr, ok := err.(*hcs.ProcessError); ok {
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
}
return err
}

View File

@@ -1,26 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// ExpandSandboxSize expands the size of a layer to at least size bytes.
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
title := "hcsshim::ExpandSandboxSize "
logrus.Debugf(title+"layerId=%s size=%d", layerId, size)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = expandSandboxSize(&infop, layerId, size)
if err != nil {
err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size)
return nil
}

View File

@@ -1,19 +0,0 @@
package hcsshim
import (
"crypto/sha1"
"fmt"
)
type GUID [16]byte
func NewGUID(source string) *GUID {
h := sha1.Sum([]byte(source))
var g GUID
copy(g[0:], h[0:16])
return &g
}
func (g *GUID) ToString() string {
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
}

View File

@@ -4,80 +4,20 @@
package hcsshim package hcsshim
import ( import (
"fmt"
"syscall" "syscall"
"unsafe"
"github.com/sirupsen/logrus" "github.com/Microsoft/hcsshim/internal/hcserror"
) )
//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go safeopen.go //go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid?
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings?
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
const ( const (
// Specific user-visible exit codes // Specific user-visible exit codes
WaitErrExecFailed = 32767 WaitErrExecFailed = 32767
ERROR_GEN_FAILURE = syscall.Errno(31) ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
WSAEINVAL = syscall.Errno(10022) WSAEINVAL = syscall.Errno(10022)
@@ -85,82 +25,4 @@ const (
TimeoutInfinite = 0xFFFFFFFF TimeoutInfinite = 0xFFFFFFFF
) )
type HcsError struct { type HcsError = hcserror.HcsError
title string
rest string
Err error
}
type hcsSystem syscall.Handle
type hcsProcess syscall.Handle
type hcsCallback syscall.Handle
type hcsProcessInformation struct {
ProcessId uint32
Reserved uint32
StdInput syscall.Handle
StdOutput syscall.Handle
StdError syscall.Handle
}
func makeError(err error, title, rest string) error {
// Pass through DLL errors directly since they do not originate from HCS.
if _, ok := err.(*syscall.DLLError); ok {
return err
}
return &HcsError{title, rest, err}
}
func makeErrorf(err error, title, format string, a ...interface{}) error {
return makeError(err, title, fmt.Sprintf(format, a...))
}
func win32FromError(err error) uint32 {
if herr, ok := err.(*HcsError); ok {
return win32FromError(herr.Err)
}
if code, ok := err.(syscall.Errno); ok {
return uint32(code)
}
return uint32(ERROR_GEN_FAILURE)
}
func win32FromHresult(hr uintptr) uintptr {
if hr&0x1fff0000 == 0x00070000 {
return hr & 0xffff
}
return hr
}
func (e *HcsError) Error() string {
s := e.title
if len(s) > 0 && s[len(s)-1] != ' ' {
s += " "
}
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err))
if e.rest != "" {
if e.rest[0] != ' ' {
s += " "
}
s += e.rest
}
return s
}
func convertAndFreeCoTaskMemString(buffer *uint16) string {
str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:])
coTaskMemFree(unsafe.Pointer(buffer))
return str
}
func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
return []byte(convertAndFreeCoTaskMemString(buffer))
}
func processHcsResult(err error, resultp *uint16) error {
if resultp != nil {
result := convertAndFreeCoTaskMemString(resultp)
logrus.Debugf("Result: %s", result)
}
return err
}

View File

@@ -1,29 +1,11 @@
package hcsshim package hcsshim
import ( import (
"encoding/json" "github.com/Microsoft/hcsshim/internal/hns"
"net"
"github.com/sirupsen/logrus"
) )
// HNSEndpoint represents a network endpoint in HNS // HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint struct { type HNSEndpoint = hns.HNSEndpoint
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
VirtualNetwork string `json:",omitempty"`
VirtualNetworkName string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacAddress string `json:",omitempty"`
IPAddress net.IP `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
EnableInternalDNS bool `json:",omitempty"`
DisableICC bool `json:",omitempty"`
PrefixLength uint8 `json:",omitempty"`
IsRemoteEndpoint bool `json:",omitempty"`
}
//SystemType represents the type of the system on which actions are done //SystemType represents the type of the system on which actions are done
type SystemType string type SystemType string
@@ -37,39 +19,19 @@ const (
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system // EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove // Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest struct { type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
ContainerID string `json:"ContainerId,omitempty"`
SystemType SystemType `json:"SystemType"`
CompartmentID uint16 `json:"CompartmentId,omitempty"`
VirtualNICName string `json:"VirtualNicName,omitempty"`
}
// EndpointResquestResponse is object to get the endpoint request response // EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse struct { type EndpointResquestResponse = hns.EndpointResquestResponse
Success bool
Error string
}
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint // HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
endpoint := &HNSEndpoint{} return hns.HNSEndpointRequest(method, path, request)
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
} }
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints // HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) { func HNSListEndpointRequest() ([]HNSEndpoint, error) {
var endpoint []HNSEndpoint return hns.HNSListEndpointRequest()
err := hnsCall("GET", "/endpoints/", "", &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
} }
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
@@ -120,204 +82,10 @@ func modifyNetworkEndpoint(containerID string, endpointID string, request Reques
// GetHNSEndpointByID get the Endpoint by ID // GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return HNSEndpointRequest("GET", endpointID, "") return hns.GetHNSEndpointByID(endpointID)
} }
// GetHNSEndpointByName gets the endpoint filtered by Name // GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
hnsResponse, err := HNSListEndpointRequest() return hns.GetHNSEndpointByName(endpointName)
if err != nil {
return nil, err
}
for _, hnsEndpoint := range hnsResponse {
if hnsEndpoint.Name == endpointName {
return &hnsEndpoint, nil
}
}
return nil, EndpointNotFoundError{EndpointName: endpointName}
}
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
operation := "Create"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
return HNSEndpointRequest("POST", "", string(jsonString))
}
// Delete Endpoint by sending EndpointRequest to HNS
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
operation := "Delete"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
return HNSEndpointRequest("DELETE", endpoint.Id, "")
}
// Update Endpoint
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
operation := "Update"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
return endpoint, err
}
// ContainerHotAttach attaches an endpoint to a running container
func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error {
operation := "ContainerHotAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
return modifyNetworkEndpoint(containerID, endpoint.Id, Add)
}
// ContainerHotDetach detaches an endpoint from a running container
func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error {
operation := "ContainerHotDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID)
return modifyNetworkEndpoint(containerID, endpoint.Id, Remove)
}
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
operation := "ApplyACLPolicy"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
for _, policy := range policies {
if policy == nil {
continue
}
jsonString, err := json.Marshal(policy)
if err != nil {
return err
}
endpoint.Policies = append(endpoint.Policies, jsonString)
}
_, err := endpoint.Update()
return err
}
// ContainerAttach attaches an endpoint to container
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
operation := "ContainerAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
CompartmentID: compartmentID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// ContainerDetach detaches an endpoint from container
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
operation := "ContainerDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// HostAttach attaches a nic on the host
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
operation := "HostAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
CompartmentID: compartmentID,
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// HostDetach detaches a nic on the host
func (endpoint *HNSEndpoint) HostDetach() error {
operation := "HostDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
operation := "VirtualMachineNicAttach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
VirtualNICName: virtualMachineNICName,
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
operation := "VirtualMachineNicDetach"
title := "HCSShim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
} }

16
vendor/github.com/Microsoft/hcsshim/hnsglobals.go generated vendored Normal file
View File

@@ -0,0 +1,16 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSGlobals = hns.HNSGlobals
type HNSVersion = hns.HNSVersion
var (
HNSVersion1803 = hns.HNSVersion1803
)
func GetHNSGlobals() (*HNSGlobals, error) {
return hns.GetHNSGlobals()
}

View File

@@ -1,141 +1,36 @@
package hcsshim package hcsshim
import ( import (
"encoding/json" "github.com/Microsoft/hcsshim/internal/hns"
"net"
"github.com/sirupsen/logrus"
) )
// Subnet is assoicated with a network and represents a list // Subnet is assoicated with a network and represents a list
// of subnets available to the network // of subnets available to the network
type Subnet struct { type Subnet = hns.Subnet
AddressPrefix string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
}
// MacPool is assoicated with a network and represents a list // MacPool is assoicated with a network and represents a list
// of macaddresses available to the network // of macaddresses available to the network
type MacPool struct { type MacPool = hns.MacPool
StartMacAddress string `json:",omitempty"`
EndMacAddress string `json:",omitempty"`
}
// HNSNetwork represents a network in HNS // HNSNetwork represents a network in HNS
type HNSNetwork struct { type HNSNetwork = hns.HNSNetwork
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
Type string `json:",omitempty"`
NetworkAdapterName string `json:",omitempty"`
SourceMac string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacPools []MacPool `json:",omitempty"`
Subnets []Subnet `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
DNSServerCompartment uint32 `json:",omitempty"`
ManagementIP string `json:",omitempty"`
AutomaticDNS bool `json:",omitempty"`
}
type hnsNetworkResponse struct {
Success bool
Error string
Output HNSNetwork
}
type hnsResponse struct {
Success bool
Error string
Output json.RawMessage
}
// HNSNetworkRequest makes a call into HNS to update/query a single network // HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
var network HNSNetwork return hns.HNSNetworkRequest(method, path, request)
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return &network, nil
} }
// HNSListNetworkRequest makes a HNS call to query the list of available networks // HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
var network []HNSNetwork return hns.HNSListNetworkRequest(method, path, request)
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return network, nil
} }
// GetHNSNetworkByID // GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return HNSNetworkRequest("GET", networkID, "") return hns.GetHNSNetworkByID(networkID)
} }
// GetHNSNetworkName filtered by Name // GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
hsnnetworks, err := HNSListNetworkRequest("GET", "", "") return hns.GetHNSNetworkByName(networkName)
if err != nil {
return nil, err
}
for _, hnsnetwork := range hsnnetworks {
if hnsnetwork.Name == networkName {
return &hnsnetwork, nil
}
}
return nil, NetworkNotFoundError{NetworkName: networkName}
}
// Create Network by sending NetworkRequest to HNS.
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
operation := "Create"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
jsonString, err := json.Marshal(network)
if err != nil {
return nil, err
}
return HNSNetworkRequest("POST", "", string(jsonString))
}
// Delete Network by sending NetworkRequest to HNS
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
operation := "Delete"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
return HNSNetworkRequest("DELETE", network.Id, "")
}
// Creates an endpoint on the Network.
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
return &HNSEndpoint{
VirtualNetwork: network.Id,
IPAddress: ipAddress,
MacAddress: string(macAddress),
}
}
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateEndpoint"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
endpoint.VirtualNetwork = network.Id
return endpoint.Create()
}
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateRemoteEndpoint"
title := "HCSShim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
endpoint.IsRemoteEndpoint = true
return network.CreateEndpoint(endpoint)
} }

View File

@@ -1,94 +1,57 @@
package hcsshim package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// Type of Request Support in ModifySystem // Type of Request Support in ModifySystem
type PolicyType string type PolicyType = hns.PolicyType
// RequestType const // RequestType const
const ( const (
Nat PolicyType = "NAT" Nat = hns.Nat
ACL PolicyType = "ACL" ACL = hns.ACL
PA PolicyType = "PA" PA = hns.PA
VLAN PolicyType = "VLAN" VLAN = hns.VLAN
VSID PolicyType = "VSID" VSID = hns.VSID
VNet PolicyType = "VNET" VNet = hns.VNet
L2Driver PolicyType = "L2Driver" L2Driver = hns.L2Driver
Isolation PolicyType = "Isolation" Isolation = hns.Isolation
QOS PolicyType = "QOS" QOS = hns.QOS
OutboundNat PolicyType = "OutBoundNAT" OutboundNat = hns.OutboundNat
ExternalLoadBalancer PolicyType = "ELB" ExternalLoadBalancer = hns.ExternalLoadBalancer
Route PolicyType = "ROUTE" Route = hns.Route
) )
type NatPolicy struct { type NatPolicy = hns.NatPolicy
Type PolicyType `json:"Type"`
Protocol string
InternalPort uint16
ExternalPort uint16
}
type QosPolicy struct { type QosPolicy = hns.QosPolicy
Type PolicyType `json:"Type"`
MaximumOutgoingBandwidthInBytes uint64
}
type IsolationPolicy struct { type IsolationPolicy = hns.IsolationPolicy
Type PolicyType `json:"Type"`
VLAN uint
VSID uint
InDefaultIsolation bool
}
type VlanPolicy struct { type VlanPolicy = hns.VlanPolicy
Type PolicyType `json:"Type"`
VLAN uint
}
type VsidPolicy struct { type VsidPolicy = hns.VsidPolicy
Type PolicyType `json:"Type"`
VSID uint
}
type PaPolicy struct { type PaPolicy = hns.PaPolicy
Type PolicyType `json:"Type"`
PA string `json:"PA"`
}
type OutboundNatPolicy struct { type OutboundNatPolicy = hns.OutboundNatPolicy
Policy
VIP string `json:"VIP,omitempty"`
Exceptions []string `json:"ExceptionList,omitempty"`
}
type ActionType string type ActionType = hns.ActionType
type DirectionType string type DirectionType = hns.DirectionType
type RuleType string type RuleType = hns.RuleType
const ( const (
Allow ActionType = "Allow" Allow = hns.Allow
Block ActionType = "Block" Block = hns.Block
In DirectionType = "In" In = hns.In
Out DirectionType = "Out" Out = hns.Out
Host RuleType = "Host" Host = hns.Host
Switch RuleType = "Switch" Switch = hns.Switch
) )
type ACLPolicy struct { type ACLPolicy = hns.ACLPolicy
Type PolicyType `json:"Type"`
Protocol uint16
InternalPort uint16
Action ActionType
Direction DirectionType
LocalAddresses string
RemoteAddresses string
LocalPort uint16
RemotePort uint16
RuleType RuleType `json:"RuleType,omitempty"`
Priority uint16
ServiceName string
}
type Policy struct { type Policy = hns.Policy
Type PolicyType `json:"Type"`
}

View File

@@ -1,200 +1,47 @@
package hcsshim package hcsshim
import ( import (
"encoding/json" "github.com/Microsoft/hcsshim/internal/hns"
"github.com/sirupsen/logrus"
) )
// RoutePolicy is a structure defining schema for Route based Policy // RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy struct { type RoutePolicy = hns.RoutePolicy
Policy
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
NextHop string `json:"NextHop,omitempty"`
EncapEnabled bool `json:"NeedEncap,omitempty"`
}
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy // ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy struct { type ELBPolicy = hns.ELBPolicy
LBPolicy
SourceVIP string `json:"SourceVIP,omitempty"`
VIPs []string `json:"VIPs,omitempty"`
ILB bool `json:"ILB,omitempty"`
}
// LBPolicy is a structure defining schema for LoadBalancing based Policy // LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy struct { type LBPolicy = hns.LBPolicy
Policy
Protocol uint16 `json:"Protocol,omitempty"`
InternalPort uint16
ExternalPort uint16
}
// PolicyList is a structure defining schema for Policy list request // PolicyList is a structure defining schema for Policy list request
type PolicyList struct { type PolicyList = hns.PolicyList
ID string `json:"ID,omitempty"`
EndpointReferences []string `json:"References,omitempty"`
Policies []json.RawMessage `json:"Policies,omitempty"`
}
// HNSPolicyListRequest makes a call into HNS to update/query a single network // HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
var policy PolicyList return hns.HNSPolicyListRequest(method, path, request)
err := hnsCall(method, "/policylists/"+path, request, &policy)
if err != nil {
return nil, err
}
return &policy, nil
} }
// HNSListPolicyListRequest gets all the policy list // HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) { func HNSListPolicyListRequest() ([]PolicyList, error) {
var plist []PolicyList return hns.HNSListPolicyListRequest()
err := hnsCall("GET", "/policylists/", "", &plist)
if err != nil {
return nil, err
}
return plist, nil
} }
// PolicyListRequest makes a HNS call to modify/query a network policy list // PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) { func PolicyListRequest(method, path, request string) (*PolicyList, error) {
policylist := &PolicyList{} return hns.PolicyListRequest(method, path, request)
err := hnsCall(method, "/policylists/"+path, request, &policylist)
if err != nil {
return nil, err
}
return policylist, nil
} }
// GetPolicyListByID get the policy list by ID // GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) { func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return PolicyListRequest("GET", policyListID, "") return hns.GetPolicyListByID(policyListID)
}
// Create PolicyList by sending PolicyListRequest to HNS.
func (policylist *PolicyList) Create() (*PolicyList, error) {
operation := "Create"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
jsonString, err := json.Marshal(policylist)
if err != nil {
return nil, err
}
return PolicyListRequest("POST", "", string(jsonString))
}
// Delete deletes PolicyList
func (policylist *PolicyList) Delete() (*PolicyList, error) {
operation := "Delete"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
return PolicyListRequest("DELETE", policylist.ID, "")
}
// AddEndpoint add an endpoint to a Policy List
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "AddEndpoint"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
// Add Endpoint to the Existing List
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
return policylist.Create()
}
// RemoveEndpoint removes an endpoint from the Policy List
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "RemoveEndpoint"
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
elementToRemove := "/endpoints/" + endpoint.Id
var references []string
for _, endpointReference := range policylist.EndpointReferences {
if endpointReference == elementToRemove {
continue
}
references = append(references, endpointReference)
}
policylist.EndpointReferences = references
return policylist.Create()
} }
// AddLoadBalancer policy list for the specified endpoints // AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
operation := "AddLoadBalancer" return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
policylist := &PolicyList{}
elbPolicy := &ELBPolicy{
SourceVIP: sourceVIP,
ILB: isILB,
}
if len(vip) > 0 {
elbPolicy.VIPs = []string{vip}
}
elbPolicy.Type = ExternalLoadBalancer
elbPolicy.Protocol = protocol
elbPolicy.InternalPort = internalPort
elbPolicy.ExternalPort = externalPort
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(elbPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
} }
// AddRoute adds route policy list for the specified endpoints // AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
operation := "AddRoute" return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
title := "HCSShim::PolicyList::" + operation
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
policylist := &PolicyList{}
rPolicy := &RoutePolicy{
DestinationPrefix: destinationPrefix,
NextHop: nextHop,
EncapEnabled: encapEnabled,
}
rPolicy.Type = Route
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(rPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
} }

13
vendor/github.com/Microsoft/hcsshim/hnssupport.go generated vendored Normal file
View File

@@ -0,0 +1,13 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSSupportedFeatures = hns.HNSSupportedFeatures
type HNSAclFeatures = hns.HNSAclFeatures
func GetHNSSupportedFeatures() HNSSupportedFeatures {
return hns.GetHNSSupportedFeatures()
}

View File

@@ -1,142 +1,27 @@
package hcsshim package hcsshim
import ( import (
"encoding/json"
"io" "io"
"time" "time"
"github.com/Microsoft/hcsshim/internal/schema1"
) )
// RegistryKey is used to specify registry key name
type RegistryKey struct {
Hive string
Name string
Volatile bool `json:",omitempty"`
}
// RegistryKey is used to specify registry key name
type RegistryValue struct {
Key RegistryKey
Name string
Type string
StringValue string `json:",omitempty"`
BinaryValue []byte `json:",omitempty"`
DWordValue *uint32 `json:",omitempty"`
QWordValue *uint64 `json:",omitempty"`
CustomType *uint32 `json:",omitempty"`
}
type RegistryChanges struct {
AddValues []RegistryValue `json:",omitempty"`
DeleteKeys []RegistryValue `json:",omitempty"`
}
// ProcessConfig is used as both the input of Container.CreateProcess // ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS // and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig struct { type ProcessConfig = schema1.ProcessConfig
ApplicationName string `json:",omitempty"`
CommandLine string `json:",omitempty"`
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
User string `json:",omitempty"`
WorkingDirectory string `json:",omitempty"`
Environment map[string]string `json:",omitempty"`
EmulateConsole bool `json:",omitempty"`
CreateStdInPipe bool `json:",omitempty"`
CreateStdOutPipe bool `json:",omitempty"`
CreateStdErrPipe bool `json:",omitempty"`
ConsoleSize [2]uint `json:",omitempty"`
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
}
type Layer struct { type Layer = schema1.Layer
ID string type MappedDir = schema1.MappedDir
Path string type MappedPipe = schema1.MappedPipe
} type HvRuntime = schema1.HvRuntime
type MappedVirtualDisk = schema1.MappedVirtualDisk
type MappedDir struct {
HostPath string
ContainerPath string
ReadOnly bool
BandwidthMaximum uint64
IOPSMaximum uint64
CreateInUtilityVM bool
// LinuxMetadata - Support added in 1803/RS4+.
LinuxMetadata bool `json:",omitempty"`
}
type MappedPipe struct {
HostPath string
ContainerPipeName string
}
type HvRuntime struct {
ImagePath string `json:",omitempty"`
SkipTemplate bool `json:",omitempty"`
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
}
type MappedVirtualDisk struct {
HostPath string `json:",omitempty"` // Path to VHD on the host
ContainerPath string // Platform-specific mount point path in the container
CreateInUtilityVM bool `json:",omitempty"`
ReadOnly bool `json:",omitempty"`
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
AttachOnly bool `json:",omitempty:`
}
// AssignedDevice represents a device that has been directly assigned to a container
//
// NOTE: Support added in RS5
type AssignedDevice struct {
// InterfaceClassGUID of the device to assign to container.
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
}
// ContainerConfig is used as both the input of CreateContainer // ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS // and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig struct { type ContainerConfig = schema1.ContainerConfig
SystemType string // HCS requires this to be hard-coded to "Container"
Name string // Name of the container. We use the docker ID.
Owner string `json:",omitempty"` // The management platform that created this container
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
Credentials string `json:",omitempty"` // Credentials information
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
HostName string `json:",omitempty"` // Hostname
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
HvPartition bool // True if it a Hyper-V Container
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
Servicing bool `json:",omitempty"` // True if this container is for servicing
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
RegistryChanges *RegistryChanges `json:",omitempty"` // Registry changes to be applied to the container
}
type ComputeSystemQuery struct { type ComputeSystemQuery = schema1.ComputeSystemQuery
IDs []string `json:"Ids,omitempty"`
Types []string `json:",omitempty"`
Names []string `json:",omitempty"`
Owners []string `json:",omitempty"`
}
// Container represents a created (but not necessarily running) container. // Container represents a created (but not necessarily running) container.
type Container interface { type Container interface {

View File

@@ -0,0 +1,22 @@
package guid
import (
"crypto/rand"
"fmt"
"io"
)
type GUID [16]byte
func New() GUID {
g := GUID{}
_, err := io.ReadFull(rand.Reader, g[:])
if err != nil {
panic(err)
}
return g
}
func (g GUID) String() string {
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
}

View File

@@ -1,8 +1,10 @@
package hcsshim package hcs
import ( import (
"sync" "sync"
"syscall" "syscall"
"github.com/Microsoft/hcsshim/internal/interop"
) )
var ( var (
@@ -62,7 +64,7 @@ func closeChannels(channels notificationChannels) {
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
var result error var result error
if int32(notificationStatus) < 0 { if int32(notificationStatus) < 0 {
result = syscall.Errno(win32FromHresult(notificationStatus)) result = interop.Win32FromHresult(notificationStatus)
} }
callbackMapLock.RLock() callbackMapLock.RLock()

View File

@@ -1,4 +1,4 @@
package hcsshim package hcs
import "C" import "C"

View File

@@ -0,0 +1,279 @@
package hcs
import (
"encoding/json"
"errors"
"fmt"
"syscall"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = syscall.Errno(0x490)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = syscall.Errno(0x32)
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d
ErrInvalidData = syscall.Errno(0xd)
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
// ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
// ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = syscall.Errno(0x7f)
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
// ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = errors.New("unsupported platform request")
)
type ErrorEvent struct {
Message string `json:"Message,omitempty"` // Fully formated error message
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
Provider string `json:"Provider,omitempty"`
EventID uint16 `json:"EventId,omitempty"`
Flags uint32 `json:"Flags,omitempty"`
Source string `json:"Source,omitempty"`
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
}
type hcsResult struct {
Error int32
ErrorMessage string
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
}
func (ev *ErrorEvent) String() string {
evs := "[Event Detail: " + ev.Message
if ev.StackTrace != "" {
evs += " Stack Trace: " + ev.StackTrace
}
if ev.Provider != "" {
evs += " Provider: " + ev.Provider
}
if ev.EventID != 0 {
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
}
if ev.Flags != 0 {
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
}
if ev.Source != "" {
evs += " Source: " + ev.Source
}
evs += "]"
return evs
}
func processHcsResult(resultp *uint16) []ErrorEvent {
if resultp != nil {
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
logrus.Debugf("Result: %s", resultj)
result := &hcsResult{}
if err := json.Unmarshal([]byte(resultj), result); err != nil {
logrus.Warnf("Could not unmarshal HCS result %s: %s", resultj, err)
return nil
}
return result.ErrorEvents
}
return nil
}
type HcsError struct {
Op string
Err error
Events []ErrorEvent
}
func (e *HcsError) Error() string {
s := e.Op + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
// ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct {
SystemID string
Pid int
Op string
Err error
Events []ErrorEvent
}
// SystemError is an error encountered in HCS during an operation on a Container object
type SystemError struct {
ID string
Op string
Err error
Extra string
Events []ErrorEvent
}
func (e *SystemError) Error() string {
s := e.Op + " " + e.ID + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.Extra != "" {
s += "\n(extra info: " + e.Extra + ")"
}
return s
}
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*SystemError); ok {
return err
}
return &SystemError{
ID: system.ID(),
Op: op,
Extra: extra,
Err: err,
Events: events,
}
}
func (e *ProcessError) Error() string {
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*ProcessError); ok {
return err
}
return &ProcessError{
Pid: process.Pid(),
SystemID: process.SystemID(),
Op: op,
Err: err,
Events: events,
}
}
// IsNotExist checks if an error is caused by the Container or Process not existing.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool {
err = getInnerError(err)
return err == ErrComputeSystemDoesNotExist ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool {
err = getInnerError(err)
return err == ErrAlreadyClosed
}
// IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background.
func IsPending(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeOperationPending
}
// IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete.
func IsTimeout(err error) bool {
err = getInnerError(err)
return err == ErrTimeout
}
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
// a Container or Process being already stopped.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeAlreadyStopped ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsNotSupported returns a boolean indicating whether the error is caused by
// unsupported platform requests
// Note: Currently Unsupported platform requests can be mean either
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform
func IsNotSupported(err error) bool {
err = getInnerError(err)
// If Platform doesn't recognize or support the request sent, below errors are seen
return err == ErrVmcomputeInvalidJSON ||
err == ErrInvalidData ||
err == ErrNotSupported ||
err == ErrVmcomputeUnknownMessage
}
func getInnerError(err error) error {
switch pe := err.(type) {
case nil:
return nil
case *HcsError:
err = pe.Err
case *SystemError:
err = pe.Err
case *ProcessError:
err = pe.Err
}
return err
}

View File

@@ -0,0 +1,47 @@
// Shim for the Host Compute Service (HCS) to manage Windows Server
// containers and Hyper-V containers.
package hcs
import (
"syscall"
)
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
type hcsSystem syscall.Handle
type hcsProcess syscall.Handle
type hcsCallback syscall.Handle
type hcsProcessInformation struct {
ProcessId uint32
Reserved uint32
StdInput syscall.Handle
StdOutput syscall.Handle
StdError syscall.Handle
}

View File

@@ -0,0 +1,386 @@
package hcs
import (
"encoding/json"
"io"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
// ContainerError is an error encountered in HCS
type Process struct {
handleLock sync.RWMutex
handle hcsProcess
processID int
system *System
cachedPipes *cachedPipes
callbackNumber uintptr
}
type cachedPipes struct {
stdIn syscall.Handle
stdOut syscall.Handle
stdErr syscall.Handle
}
type processModifyRequest struct {
Operation string
ConsoleSize *consoleSize `json:",omitempty"`
CloseHandle *closeHandle `json:",omitempty"`
}
type consoleSize struct {
Height uint16
Width uint16
}
type closeHandle struct {
Handle string
}
type ProcessStatus struct {
ProcessID uint32
Exited bool
ExitCode uint32
LastWaitResult int32
}
const (
stdIn string = "StdIn"
stdOut string = "StdOut"
stdErr string = "StdErr"
)
const (
modifyConsoleSize string = "ConsoleSize"
modifyCloseHandle string = "CloseHandle"
)
// Pid returns the process ID of the process within the container.
func (process *Process) Pid() int {
return process.processID
}
// SystemID returns the ID of the process's compute system.
func (process *Process) SystemID() string {
return process.system.ID()
}
// Kill signals the process to terminate but does not wait for it to finish terminating.
func (process *Process) Kill() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Kill"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsTerminateProcess(process.handle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// Wait waits for the process to exit.
func (process *Process) Wait() error {
operation := "Wait"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs.
func (process *Process) WaitTimeout(timeout time.Duration) error {
operation := "WaitTimeout"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// ResizeConsole resizes the console of the process.
func (process *Process) ResizeConsole(width, height uint16) error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "ResizeConsole"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyConsoleSize,
ConsoleSize: &consoleSize{
Height: height,
Width: width,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *Process) Properties() (*ProcessStatus, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Properties"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var (
resultp *uint16
propertiesp *uint16
)
err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeProcessError(process, operation, err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &ProcessStatus{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
return properties, nil
}
// ExitCode returns the exit code of the process. The process must have
// already terminated.
func (process *Process) ExitCode() (int, error) {
operation := "ExitCode"
properties, err := process.Properties()
if err != nil {
return 0, makeProcessError(process, operation, err, nil)
}
if properties.Exited == false {
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
}
if properties.LastWaitResult != 0 {
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
}
return int(properties.ExitCode), nil
}
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces.
func (process *Process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Stdio"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var stdIn, stdOut, stdErr syscall.Handle
if process.cachedPipes == nil {
var (
processInfo hcsProcessInformation
resultp *uint16
)
err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, events)
}
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
} else {
// Use cached pipes
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
// Invalidate the cache
process.cachedPipes = nil
}
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return pipes[0], pipes[1], pipes[2], nil
}
// CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin.
func (process *Process) CloseStdin() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "CloseStdin"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyCloseHandle,
CloseHandle: &closeHandle{
Handle: stdIn,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// Close cleans up any state associated with the process but does not kill
// or wait on it.
func (process *Process) Close() error {
process.handleLock.Lock()
defer process.handleLock.Unlock()
operation := "Close"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
// Don't double free this
if process.handle == 0 {
return nil
}
if err := process.unregisterCallback(); err != nil {
return makeProcessError(process, operation, err, nil)
}
if err := hcsCloseProcess(process.handle); err != nil {
return makeProcessError(process, operation, err, nil)
}
process.handle = 0
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *Process) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
process.callbackNumber = callbackNumber
return nil
}
func (process *Process) unregisterCallback() error {
callbackNumber := process.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterProcessCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterProcessCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}

View File

@@ -0,0 +1,547 @@
package hcs
import (
"encoding/json"
"os"
"strconv"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/Microsoft/hcsshim/internal/schema1"
"github.com/Microsoft/hcsshim/internal/timeout"
"github.com/sirupsen/logrus"
)
// currentContainerStarts is used to limit the number of concurrent container
// starts.
var currentContainerStarts containerStarts
type containerStarts struct {
maxParallel int
inProgress int
sync.Mutex
}
func init() {
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
if len(mpsS) > 0 {
mpsI, err := strconv.Atoi(mpsS)
if err != nil || mpsI < 0 {
return
}
currentContainerStarts.maxParallel = mpsI
}
}
type System struct {
handleLock sync.RWMutex
handle hcsSystem
id string
callbackNumber uintptr
}
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (*System, error) {
operation := "CreateComputeSystem"
title := "hcsshim::" + operation
computeSystem := &System{
id: id,
}
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
if err != nil {
return nil, err
}
hcsDocument := string(hcsDocumentB)
logrus.Debugf(title+" ID=%s config=%s", id, hcsDocument)
var (
resultp *uint16
identity syscall.Handle
)
createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
if createError == nil || IsPending(createError) {
if err := computeSystem.registerCallback(); err != nil {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
}
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.Duration)
if err != nil {
if err == ErrTimeout {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
}
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, computeSystem.handle)
return computeSystem, nil
}
// OpenComputeSystem opens an existing compute system by ID.
func OpenComputeSystem(id string) (*System, error) {
operation := "OpenComputeSystem"
title := "hcsshim::" + operation
logrus.Debugf(title+" ID=%s", id)
computeSystem := &System{
id: id,
}
var (
handle hcsSystem
resultp *uint16
)
err := hcsOpenComputeSystem(id, &handle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, events)
}
computeSystem.handle = handle
if err := computeSystem.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
return computeSystem, nil
}
// GetComputeSystems gets a list of the compute systems on the system that match the query
func GetComputeSystems(q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
operation := "GetComputeSystems"
title := "hcsshim::" + operation
queryb, err := json.Marshal(q)
if err != nil {
return nil, err
}
query := string(queryb)
logrus.Debugf(title+" query=%s", query)
var (
resultp *uint16
computeSystemsp *uint16
)
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, &HcsError{Op: operation, Err: err, Events: events}
}
if computeSystemsp == nil {
return nil, ErrUnexpectedValue
}
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
computeSystems := []schema1.ContainerProperties{}
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
return nil, err
}
logrus.Debugf(title + " succeeded")
return computeSystems, nil
}
// Start synchronously starts the computeSystem.
func (computeSystem *System) Start() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Start ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
}
// This is a very simple backoff-retry loop to limit the number
// of parallel container starts if environment variable
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
// It should generally only be used as a workaround to various
// platform issues that exist between RS1 and RS4 as of Aug 2018
if currentContainerStarts.maxParallel > 0 {
for {
currentContainerStarts.Lock()
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
currentContainerStarts.inProgress++
currentContainerStarts.Unlock()
break
}
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
currentContainerStarts.Unlock()
time.Sleep(100 * time.Millisecond)
}
}
// Make sure we decrement the count when we are done.
defer func() {
currentContainerStarts.Lock()
currentContainerStarts.inProgress--
currentContainerStarts.Unlock()
}()
}
var resultp *uint16
err := hcsStartComputeSystem(computeSystem.handle, "", &resultp)
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.Duration)
if err != nil {
return makeSystemError(computeSystem, "Start", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// ID returns the compute system's identifier.
func (computeSystem *System) ID() string {
return computeSystem.id
}
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Shutdown() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Shutdown"
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Shutdown", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Terminate() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Terminate ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Terminate", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Wait synchronously waits for the compute system to shutdown or terminate.
func (computeSystem *System) Wait() error {
title := "hcsshim::ComputeSystem::Wait ID=" + computeSystem.ID()
logrus.Debugf(title)
err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
if err != nil {
return makeSystemError(computeSystem, "Wait", "", err, nil)
}
logrus.Debugf(title + " succeeded")
return nil
}
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
// If the timeout expires, IsTimeout(err) == true
func (computeSystem *System) WaitTimeout(timeout time.Duration) error {
title := "hcsshim::ComputeSystem::WaitTimeout ID=" + computeSystem.ID()
logrus.Debugf(title)
err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
if err != nil {
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
}
logrus.Debugf(title + " succeeded")
return nil
}
func (computeSystem *System) Properties(types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
queryj, err := json.Marshal(schema1.PropertyQuery{types})
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
var resultp, propertiesp *uint16
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &schema1.ContainerProperties{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
return properties, nil
}
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Pause() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Pause ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.Duration)
if err != nil {
return makeSystemError(computeSystem, "Pause", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Resume() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Resume ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
err := hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.Duration)
if err != nil {
return makeSystemError(computeSystem, "Resume", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// CreateProcess launches a new process within the computeSystem.
func (computeSystem *System) CreateProcess(c interface{}) (*Process, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::CreateProcess ID=" + computeSystem.ID()
var (
processInfo hcsProcessInformation
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
}
configurationb, err := json.Marshal(c)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
configuration := string(configurationb)
logrus.Debugf(title+" config=%s", configuration)
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
}
process := &Process{
handle: processHandle,
processID: int(processInfo.ProcessId),
system: computeSystem,
cachedPipes: &cachedPipes{
stdIn: processInfo.StdInput,
stdOut: processInfo.StdOutput,
stdErr: processInfo.StdError,
},
}
if err := process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return process, nil
}
// OpenProcess gets an interface to an existing process within the computeSystem.
func (computeSystem *System) OpenProcess(pid int) (*Process, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::OpenProcess ID=" + computeSystem.ID()
logrus.Debugf(title+" processid=%d", pid)
var (
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
}
err := hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
}
process := &Process{
handle: processHandle,
processID: pid,
system: computeSystem,
}
if err := process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
}
logrus.Debugf(title+" succeeded processid=%s", process.processID)
return process, nil
}
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
func (computeSystem *System) Close() error {
computeSystem.handleLock.Lock()
defer computeSystem.handleLock.Unlock()
title := "hcsshim::ComputeSystem::Close ID=" + computeSystem.ID()
logrus.Debugf(title)
// Don't double free this
if computeSystem.handle == 0 {
return nil
}
if err := computeSystem.unregisterCallback(); err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
if err := hcsCloseComputeSystem(computeSystem.handle); err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
computeSystem.handle = 0
logrus.Debugf(title + " succeeded")
return nil
}
func (computeSystem *System) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
computeSystem.callbackNumber = callbackNumber
return nil
}
func (computeSystem *System) unregisterCallback() error {
callbackNumber := computeSystem.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterComputeSystemCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterComputeSystemCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}
// Modifies the System by sending a request to HCS
func (computeSystem *System) Modify(config interface{}) error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::Modify ID=" + computeSystem.id
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
}
requestJSON, err := json.Marshal(config)
if err != nil {
return err
}
requestString := string(requestJSON)
logrus.Debugf(title + " " + requestString)
var resultp *uint16
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Modify", requestString, err, events)
}
logrus.Debugf(title + " succeeded ")
return nil
}

View File

@@ -1,4 +1,4 @@
package hcsshim package hcs
import ( import (
"io" "io"

View File

@@ -1,4 +1,4 @@
package hcsshim package hcs
import ( import (
"time" "time"
@@ -6,13 +6,13 @@ import (
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
) )
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
err = processHcsResult(err, resultp) events := processHcsResult(resultp)
if IsPending(err) { if IsPending(err) {
return waitForNotification(callbackNumber, expectedNotification, timeout) return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
} }
return err return events, err
} }
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {

View File

@@ -0,0 +1,441 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hcs
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
)
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(query)
if hr != nil {
return
}
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
}
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
}
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _hcsOpenComputeSystem(_p0, computeSystem, result)
}
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsStartComputeSystem(computeSystem, _p0, result)
}
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsStartComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
}
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
}
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsPauseComputeSystem(computeSystem, _p0, result)
}
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsResumeComputeSystem(computeSystem, _p0, result)
}
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
}
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsModifyComputeSystem(computeSystem, _p0, result)
}
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(processParameters)
if hr != nil {
return
}
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
}
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsCreateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsOpenProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseProcess(process hcsProcess) (hr error) {
if hr = procHcsCloseProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
if hr = procHcsTerminateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
if hr = procHcsGetProcessInfo.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
if hr = procHcsGetProcessProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(settings)
if hr != nil {
return
}
return _hcsModifyProcess(process, _p0, result)
}
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
if hr = procHcsModifyProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetServiceProperties(_p0, properties, result)
}
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetServiceProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@@ -0,0 +1,51 @@
package hcserror
import (
"fmt"
"syscall"
)
const ERROR_GEN_FAILURE = syscall.Errno(31)
type HcsError struct {
title string
rest string
Err error
}
func (e *HcsError) Error() string {
s := e.title
if len(s) > 0 && s[len(s)-1] != ' ' {
s += " "
}
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
if e.rest != "" {
if e.rest[0] != ' ' {
s += " "
}
s += e.rest
}
return s
}
func New(err error, title, rest string) error {
// Pass through DLL errors directly since they do not originate from HCS.
if _, ok := err.(*syscall.DLLError); ok {
return err
}
return &HcsError{title, rest, err}
}
func Errorf(err error, title, format string, a ...interface{}) error {
return New(err, title, fmt.Sprintf(format, a...))
}
func Win32FromError(err error) uint32 {
if herr, ok := err.(*HcsError); ok {
return Win32FromError(herr.Err)
}
if code, ok := err.(syscall.Errno); ok {
return uint32(code)
}
return uint32(ERROR_GEN_FAILURE)
}

View File

@@ -0,0 +1,23 @@
package hns
import "fmt"
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
type EndpointNotFoundError struct {
EndpointName string
}
func (e EndpointNotFoundError) Error() string {
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
}
type NetworkNotFoundError struct {
NetworkName string
}
func (e NetworkNotFoundError) Error() string {
return fmt.Sprintf("Network %s not found", e.NetworkName)
}

View File

@@ -0,0 +1,260 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
VirtualNetwork string `json:",omitempty"`
VirtualNetworkName string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacAddress string `json:",omitempty"`
IPAddress net.IP `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
EnableInternalDNS bool `json:",omitempty"`
DisableICC bool `json:",omitempty"`
PrefixLength uint8 `json:",omitempty"`
IsRemoteEndpoint bool `json:",omitempty"`
Namespace *Namespace `json:",omitempty"`
}
//SystemType represents the type of the system on which actions are done
type SystemType string
// SystemType const
const (
ContainerType SystemType = "Container"
VirtualMachineType SystemType = "VirtualMachine"
HostType SystemType = "Host"
)
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest struct {
ContainerID string `json:"ContainerId,omitempty"`
SystemType SystemType `json:"SystemType"`
CompartmentID uint16 `json:"CompartmentId,omitempty"`
VirtualNICName string `json:"VirtualNicName,omitempty"`
}
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse struct {
Success bool
Error string
}
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
endpoint := &HNSEndpoint{}
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
var endpoint []HNSEndpoint
err := hnsCall("GET", "/endpoints/", "", &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return HNSEndpointRequest("GET", endpointID, "")
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
hnsResponse, err := HNSListEndpointRequest()
if err != nil {
return nil, err
}
for _, hnsEndpoint := range hnsResponse {
if hnsEndpoint.Name == endpointName {
return &hnsEndpoint, nil
}
}
return nil, EndpointNotFoundError{EndpointName: endpointName}
}
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
operation := "Create"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
return HNSEndpointRequest("POST", "", string(jsonString))
}
// Delete Endpoint by sending EndpointRequest to HNS
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
operation := "Delete"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
return HNSEndpointRequest("DELETE", endpoint.Id, "")
}
// Update Endpoint
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
operation := "Update"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
return endpoint, err
}
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
operation := "ApplyACLPolicy"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
for _, policy := range policies {
if policy == nil {
continue
}
jsonString, err := json.Marshal(policy)
if err != nil {
return err
}
endpoint.Policies = append(endpoint.Policies, jsonString)
}
_, err := endpoint.Update()
return err
}
// ContainerAttach attaches an endpoint to container
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
operation := "ContainerAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
CompartmentID: compartmentID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// ContainerDetach detaches an endpoint from container
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
operation := "ContainerDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// HostAttach attaches a nic on the host
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
operation := "HostAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
CompartmentID: compartmentID,
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// HostDetach detaches a nic on the host
func (endpoint *HNSEndpoint) HostDetach() error {
operation := "HostDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
operation := "VirtualMachineNicAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
VirtualNICName: virtualMachineNICName,
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
operation := "VirtualMachineNicDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}

View File

@@ -1,9 +1,11 @@
package hcsshim package hns
import ( import (
"encoding/json" "encoding/json"
"fmt" "fmt"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
) )
@@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error {
err := _hnsCall(method, path, request, &responseBuffer) err := _hnsCall(method, path, request, &responseBuffer)
if err != nil { if err != nil {
return makeError(err, "hnsCall ", "") return hcserror.New(err, "hnsCall ", "")
} }
response := convertAndFreeCoTaskMemString(responseBuffer) response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
hnsresponse := &hnsResponse{} hnsresponse := &hnsResponse{}
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {

View File

@@ -0,0 +1,28 @@
package hns
type HNSGlobals struct {
Version HNSVersion `json:"Version"`
}
type HNSVersion struct {
Major int `json:"Major"`
Minor int `json:"Minor"`
}
var (
HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
)
func GetHNSGlobals() (*HNSGlobals, error) {
var version HNSVersion
err := hnsCall("GET", "/globals/version", "", &version)
if err != nil {
return nil, err
}
globals := &HNSGlobals{
Version: version,
}
return globals, nil
}

View File

@@ -0,0 +1,141 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet struct {
AddressPrefix string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
}
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool struct {
StartMacAddress string `json:",omitempty"`
EndMacAddress string `json:",omitempty"`
}
// HNSNetwork represents a network in HNS
type HNSNetwork struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
Type string `json:",omitempty"`
NetworkAdapterName string `json:",omitempty"`
SourceMac string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacPools []MacPool `json:",omitempty"`
Subnets []Subnet `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
DNSServerCompartment uint32 `json:",omitempty"`
ManagementIP string `json:",omitempty"`
AutomaticDNS bool `json:",omitempty"`
}
type hnsNetworkResponse struct {
Success bool
Error string
Output HNSNetwork
}
type hnsResponse struct {
Success bool
Error string
Output json.RawMessage
}
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
var network HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return &network, nil
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
var network []HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return network, nil
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return HNSNetworkRequest("GET", networkID, "")
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
if err != nil {
return nil, err
}
for _, hnsnetwork := range hsnnetworks {
if hnsnetwork.Name == networkName {
return &hnsnetwork, nil
}
}
return nil, NetworkNotFoundError{NetworkName: networkName}
}
// Create Network by sending NetworkRequest to HNS.
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
operation := "Create"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
jsonString, err := json.Marshal(network)
if err != nil {
return nil, err
}
return HNSNetworkRequest("POST", "", string(jsonString))
}
// Delete Network by sending NetworkRequest to HNS
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
operation := "Delete"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
return HNSNetworkRequest("DELETE", network.Id, "")
}
// Creates an endpoint on the Network.
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
return &HNSEndpoint{
VirtualNetwork: network.Id,
IPAddress: ipAddress,
MacAddress: string(macAddress),
}
}
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
endpoint.VirtualNetwork = network.Id
return endpoint.Create()
}
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateRemoteEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
endpoint.IsRemoteEndpoint = true
return network.CreateEndpoint(endpoint)
}

View File

@@ -0,0 +1,98 @@
package hns
// Type of Request Support in ModifySystem
type PolicyType string
// RequestType const
const (
Nat PolicyType = "NAT"
ACL PolicyType = "ACL"
PA PolicyType = "PA"
VLAN PolicyType = "VLAN"
VSID PolicyType = "VSID"
VNet PolicyType = "VNET"
L2Driver PolicyType = "L2Driver"
Isolation PolicyType = "Isolation"
QOS PolicyType = "QOS"
OutboundNat PolicyType = "OutBoundNAT"
ExternalLoadBalancer PolicyType = "ELB"
Route PolicyType = "ROUTE"
)
type NatPolicy struct {
Type PolicyType `json:"Type"`
Protocol string
InternalPort uint16
ExternalPort uint16
}
type QosPolicy struct {
Type PolicyType `json:"Type"`
MaximumOutgoingBandwidthInBytes uint64
}
type IsolationPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
VSID uint
InDefaultIsolation bool
}
type VlanPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
}
type VsidPolicy struct {
Type PolicyType `json:"Type"`
VSID uint
}
type PaPolicy struct {
Type PolicyType `json:"Type"`
PA string `json:"PA"`
}
type OutboundNatPolicy struct {
Policy
VIP string `json:"VIP,omitempty"`
Exceptions []string `json:"ExceptionList,omitempty"`
}
type ActionType string
type DirectionType string
type RuleType string
const (
Allow ActionType = "Allow"
Block ActionType = "Block"
In DirectionType = "In"
Out DirectionType = "Out"
Host RuleType = "Host"
Switch RuleType = "Switch"
)
type ACLPolicy struct {
Type PolicyType `json:"Type"`
Id string `json:"Id,omitempty"`
Protocol uint16
Protocols string `json:"Protocols,omitempty"`
InternalPort uint16
Action ActionType
Direction DirectionType
LocalAddresses string
RemoteAddresses string
LocalPorts string `json:"LocalPorts,omitempty"`
LocalPort uint16
RemotePorts string `json:"RemotePorts,omitempty"`
RemotePort uint16
RuleType RuleType `json:"RuleType,omitempty"`
Priority uint16
ServiceName string
}
type Policy struct {
Type PolicyType `json:"Type"`
}

View File

@@ -0,0 +1,200 @@
package hns
import (
"encoding/json"
"github.com/sirupsen/logrus"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy struct {
Policy
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
NextHop string `json:"NextHop,omitempty"`
EncapEnabled bool `json:"NeedEncap,omitempty"`
}
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy struct {
LBPolicy
SourceVIP string `json:"SourceVIP,omitempty"`
VIPs []string `json:"VIPs,omitempty"`
ILB bool `json:"ILB,omitempty"`
}
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy struct {
Policy
Protocol uint16 `json:"Protocol,omitempty"`
InternalPort uint16
ExternalPort uint16
}
// PolicyList is a structure defining schema for Policy list request
type PolicyList struct {
ID string `json:"ID,omitempty"`
EndpointReferences []string `json:"References,omitempty"`
Policies []json.RawMessage `json:"Policies,omitempty"`
}
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
var policy PolicyList
err := hnsCall(method, "/policylists/"+path, request, &policy)
if err != nil {
return nil, err
}
return &policy, nil
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
var plist []PolicyList
err := hnsCall("GET", "/policylists/", "", &plist)
if err != nil {
return nil, err
}
return plist, nil
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
policylist := &PolicyList{}
err := hnsCall(method, "/policylists/"+path, request, &policylist)
if err != nil {
return nil, err
}
return policylist, nil
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return PolicyListRequest("GET", policyListID, "")
}
// Create PolicyList by sending PolicyListRequest to HNS.
func (policylist *PolicyList) Create() (*PolicyList, error) {
operation := "Create"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
jsonString, err := json.Marshal(policylist)
if err != nil {
return nil, err
}
return PolicyListRequest("POST", "", string(jsonString))
}
// Delete deletes PolicyList
func (policylist *PolicyList) Delete() (*PolicyList, error) {
operation := "Delete"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
return PolicyListRequest("DELETE", policylist.ID, "")
}
// AddEndpoint add an endpoint to a Policy List
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "AddEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
// Add Endpoint to the Existing List
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
return policylist.Create()
}
// RemoveEndpoint removes an endpoint from the Policy List
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "RemoveEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
elementToRemove := "/endpoints/" + endpoint.Id
var references []string
for _, endpointReference := range policylist.EndpointReferences {
if endpointReference == elementToRemove {
continue
}
references = append(references, endpointReference)
}
policylist.EndpointReferences = references
return policylist.Create()
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
operation := "AddLoadBalancer"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
policylist := &PolicyList{}
elbPolicy := &ELBPolicy{
SourceVIP: sourceVIP,
ILB: isILB,
}
if len(vip) > 0 {
elbPolicy.VIPs = []string{vip}
}
elbPolicy.Type = ExternalLoadBalancer
elbPolicy.Protocol = protocol
elbPolicy.InternalPort = internalPort
elbPolicy.ExternalPort = externalPort
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(elbPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
operation := "AddRoute"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
policylist := &PolicyList{}
rPolicy := &RoutePolicy{
DestinationPrefix: destinationPrefix,
NextHop: nextHop,
EncapEnabled: encapEnabled,
}
rPolicy.Type = Route
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(rPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}

View File

@@ -0,0 +1,49 @@
package hns
import (
"github.com/sirupsen/logrus"
)
type HNSSupportedFeatures struct {
Acl HNSAclFeatures `json:"ACL"`
}
type HNSAclFeatures struct {
AclAddressLists bool `json:"AclAddressLists"`
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
AclPortRanges bool `json:"AclPortRanges"`
AclRuleId bool `json:"AclRuleId"`
}
func GetHNSSupportedFeatures() HNSSupportedFeatures {
var hnsFeatures HNSSupportedFeatures
globals, err := GetHNSGlobals()
if err != nil {
// Expected on pre-1803 builds, all features will be false/unsupported
logrus.Debugf("Unable to obtain HNS globals: %s", err)
return hnsFeatures
}
hnsFeatures.Acl = HNSAclFeatures{
AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803),
}
return hnsFeatures
}
func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
if currentVersion.Major < minVersionSupported.Major {
return false
}
if currentVersion.Major > minVersionSupported.Major {
return true
}
if currentVersion.Minor < minVersionSupported.Minor {
return false
}
return true
}

View File

@@ -0,0 +1,110 @@
package hns
import (
"encoding/json"
"fmt"
"os"
"path"
"strings"
)
type namespaceRequest struct {
IsDefault bool `json:",omitempty"`
}
type namespaceEndpointRequest struct {
ID string `json:"Id"`
}
type NamespaceResource struct {
Type string
Data json.RawMessage
}
type namespaceResourceRequest struct {
Type string
Data interface{}
}
type Namespace struct {
ID string
IsDefault bool `json:",omitempty"`
ResourceList []NamespaceResource `json:",omitempty"`
}
func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
var err error
hnspath := "/namespaces/"
if id != nil {
hnspath = path.Join(hnspath, *id)
}
if subpath != "" {
hnspath = path.Join(hnspath, subpath)
}
var reqJSON []byte
if request != nil {
if reqJSON, err = json.Marshal(request); err != nil {
return nil, err
}
}
var ns Namespace
err = hnsCall(method, hnspath, string(reqJSON), &ns)
if err != nil {
if strings.Contains(err.Error(), "Element not found.") {
return nil, os.ErrNotExist
}
return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
}
return &ns, err
}
func CreateNamespace() (string, error) {
req := namespaceRequest{}
ns, err := issueNamespaceRequest(nil, "POST", "", &req)
if err != nil {
return "", err
}
return ns.ID, nil
}
func RemoveNamespace(id string) error {
_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
return err
}
func GetNamespaceEndpoints(id string) ([]string, error) {
ns, err := issueNamespaceRequest(&id, "GET", "", nil)
if err != nil {
return nil, err
}
var endpoints []string
for _, rsrc := range ns.ResourceList {
if rsrc.Type == "Endpoint" {
var endpoint namespaceEndpointRequest
err = json.Unmarshal(rsrc.Data, &endpoint)
if err != nil {
return nil, fmt.Errorf("unmarshal endpoint: %s", err)
}
endpoints = append(endpoints, endpoint.ID)
}
}
return endpoints, nil
}
func AddNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
return err
}
func RemoveNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
return err
}

View File

@@ -0,0 +1,74 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hns
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHNSCall = modvmcompute.NewProc("HNSCall")
)
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(method)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
var _p2 *uint16
_p2, hr = syscall.UTF16PtrFromString(object)
if hr != nil {
return
}
return __hnsCall(_p0, _p1, _p2, response)
}
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
if hr = procHNSCall.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@@ -0,0 +1,27 @@
package interop
import (
"syscall"
"unsafe"
)
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
coTaskMemFree(unsafe.Pointer(buffer))
return str
}
func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
return []byte(ConvertAndFreeCoTaskMemString(buffer))
}
func Win32FromHresult(hr uintptr) syscall.Errno {
if hr&0x1fff0000 == 0x00070000 {
return syscall.Errno(hr & 0xffff)
}
return syscall.Errno(hr)
}

View File

@@ -0,0 +1,48 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package interop
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modole32 = windows.NewLazySystemDLL("ole32.dll")
procCoTaskMemFree = modole32.NewProc("CoTaskMemFree")
)
func coTaskMemFree(buffer unsafe.Pointer) {
syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
return
}

View File

@@ -0,0 +1,24 @@
package longpath
import (
"path/filepath"
"strings"
)
// LongAbs makes a path absolute and returns it in NT long path form.
func LongAbs(path string) (string, error) {
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
return path, nil
}
if !filepath.IsAbs(path) {
absPath, err := filepath.Abs(path)
if err != nil {
return "", err
}
path = absPath
}
if strings.HasPrefix(path, `\\`) {
return `\\?\UNC\` + path[2:], nil
}
return `\\?\` + path, nil
}

View File

@@ -0,0 +1,52 @@
package mergemaps
import "encoding/json"
// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
// in ToMap are overwritten. Values in fromMap are added to ToMap.
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
func Merge(fromMap, ToMap interface{}) interface{} {
switch fromMap := fromMap.(type) {
case map[string]interface{}:
ToMap, ok := ToMap.(map[string]interface{})
if !ok {
return fromMap
}
for keyToMap, valueToMap := range ToMap {
if valueFromMap, ok := fromMap[keyToMap]; ok {
fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
} else {
fromMap[keyToMap] = valueToMap
}
}
case nil:
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
ToMap, ok := ToMap.(map[string]interface{})
if ok {
return ToMap
}
}
return fromMap
}
// MergeJSON merges the contents of a JSON string into an object representation,
// returning a new object suitable for translating to JSON.
func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
if len(additionalJSON) == 0 {
return object, nil
}
objectJSON, err := json.Marshal(object)
if err != nil {
return nil, err
}
var objectMap, newMap map[string]interface{}
err = json.Unmarshal(objectJSON, &objectMap)
if err != nil {
return nil, err
}
err = json.Unmarshal(additionalJSON, &newMap)
if err != nil {
return nil, err
}
return Merge(newMap, objectMap), nil
}

View File

@@ -1,4 +1,4 @@
package hcsshim package safefile
import ( import (
"errors" "errors"
@@ -10,9 +10,13 @@ import (
"unicode/utf16" "unicode/utf16"
"unsafe" "unsafe"
"github.com/Microsoft/hcsshim/internal/longpath"
winio "github.com/Microsoft/go-winio" winio "github.com/Microsoft/go-winio"
) )
//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile //sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile //sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb //sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
@@ -53,28 +57,28 @@ const (
_FileLinkInformation = 11 _FileLinkInformation = 11
_FileDispositionInformationEx = 64 _FileDispositionInformationEx = 64
_FILE_READ_ATTRIBUTES = 0x0080 FILE_READ_ATTRIBUTES = 0x0080
_FILE_WRITE_ATTRIBUTES = 0x0100 FILE_WRITE_ATTRIBUTES = 0x0100
_DELETE = 0x10000 DELETE = 0x10000
_FILE_OPEN = 1 FILE_OPEN = 1
_FILE_CREATE = 2 FILE_CREATE = 2
_FILE_DIRECTORY_FILE = 0x00000001 FILE_DIRECTORY_FILE = 0x00000001
_FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
_FILE_DELETE_ON_CLOSE = 0x00001000 FILE_DELETE_ON_CLOSE = 0x00001000
_FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
_FILE_OPEN_REPARSE_POINT = 0x00200000 FILE_OPEN_REPARSE_POINT = 0x00200000
_FILE_DISPOSITION_DELETE = 0x00000001 FILE_DISPOSITION_DELETE = 0x00000001
_OBJ_DONT_REPARSE = 0x1000 _OBJ_DONT_REPARSE = 0x1000
_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B _STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
) )
func openRoot(path string) (*os.File, error) { func OpenRoot(path string) (*os.File, error) {
longpath, err := makeLongAbsPath(path) longpath, err := longpath.LongAbs(path)
if err != nil { if err != nil {
return nil, err return nil, err
} }
@@ -141,7 +145,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
0, 0,
shareFlags, shareFlags,
createDisposition, createDisposition,
_FILE_OPEN_FOR_BACKUP_INTENT|_FILE_SYNCHRONOUS_IO_NONALERT|flags, FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
nil, nil,
0, 0,
) )
@@ -149,7 +153,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
return nil, rtlNtStatusToDosError(status) return nil, rtlNtStatusToDosError(status)
} }
fullPath, err := makeLongAbsPath(filepath.Join(root.Name(), path)) fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
if err != nil { if err != nil {
syscall.Close(syscall.Handle(h)) syscall.Close(syscall.Handle(h))
return nil, err return nil, err
@@ -158,9 +162,9 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl
return os.NewFile(h, fullPath), nil return os.NewFile(h, fullPath), nil
} }
// openRelative opens a relative path from the given root, failing if // OpenRelative opens a relative path from the given root, failing if
// any of the intermediate path components are reparse points. // any of the intermediate path components are reparse points.
func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags) f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
if err != nil { if err != nil {
err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err} err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
@@ -168,17 +172,17 @@ func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint
return f, err return f, err
} }
// linkRelative creates a hard link from oldname to newname (relative to oldroot // LinkRelative creates a hard link from oldname to newname (relative to oldroot
// and newroot), failing if any of the intermediate path components are reparse // and newroot), failing if any of the intermediate path components are reparse
// points. // points.
func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error { func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
// Open the old file. // Open the old file.
oldf, err := openRelativeInternal( oldf, err := openRelativeInternal(
oldname, oldname,
oldroot, oldroot,
syscall.FILE_WRITE_ATTRIBUTES, syscall.FILE_WRITE_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN, FILE_OPEN,
0, 0,
) )
if err != nil { if err != nil {
@@ -195,8 +199,8 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.
newroot, newroot,
syscall.GENERIC_READ, syscall.GENERIC_READ,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN, FILE_OPEN,
_FILE_DIRECTORY_FILE) FILE_DIRECTORY_FILE)
if err != nil { if err != nil {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err} return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
} }
@@ -248,7 +252,7 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.
// deleteOnClose marks a file to be deleted when the handle is closed. // deleteOnClose marks a file to be deleted when the handle is closed.
func deleteOnClose(f *os.File) error { func deleteOnClose(f *os.File) error {
disposition := fileDispositionInformationEx{Flags: _FILE_DISPOSITION_DELETE} disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
var iosb ioStatusBlock var iosb ioStatusBlock
status := ntSetInformationFile( status := ntSetInformationFile(
f.Fd(), f.Fd(),
@@ -281,16 +285,16 @@ func clearReadOnly(f *os.File) error {
return winio.SetFileBasicInfo(f, &sbi) return winio.SetFileBasicInfo(f, &sbi)
} }
// removeRelative removes a file or directory relative to a root, failing if any // RemoveRelative removes a file or directory relative to a root, failing if any
// intermediate path components are reparse points. // intermediate path components are reparse points.
func removeRelative(path string, root *os.File) error { func RemoveRelative(path string, root *os.File) error {
f, err := openRelativeInternal( f, err := openRelativeInternal(
path, path,
root, root,
_FILE_READ_ATTRIBUTES|_FILE_WRITE_ATTRIBUTES|_DELETE, FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN, FILE_OPEN,
_FILE_OPEN_REPARSE_POINT) FILE_OPEN_REPARSE_POINT)
if err == nil { if err == nil {
defer f.Close() defer f.Close()
err = deleteOnClose(f) err = deleteOnClose(f)
@@ -306,10 +310,10 @@ func removeRelative(path string, root *os.File) error {
return nil return nil
} }
// removeAllRelative removes a directory tree relative to a root, failing if any // RemoveAllRelative removes a directory tree relative to a root, failing if any
// intermediate path components are reparse points. // intermediate path components are reparse points.
func removeAllRelative(path string, root *os.File) error { func RemoveAllRelative(path string, root *os.File) error {
fi, err := lstatRelative(path, root) fi, err := LstatRelative(path, root)
if err != nil { if err != nil {
if os.IsNotExist(err) { if os.IsNotExist(err) {
return nil return nil
@@ -319,7 +323,7 @@ func removeAllRelative(path string, root *os.File) error {
fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 { if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
// If this is a reparse point, it can't have children. Simple remove will do. // If this is a reparse point, it can't have children. Simple remove will do.
err := removeRelative(path, root) err := RemoveRelative(path, root)
if err == nil || os.IsNotExist(err) { if err == nil || os.IsNotExist(err) {
return nil return nil
} }
@@ -327,7 +331,7 @@ func removeAllRelative(path string, root *os.File) error {
} }
// It is necessary to use os.Open as Readdirnames does not work with // It is necessary to use os.Open as Readdirnames does not work with
// openRelative. This is safe because the above lstatrelative fails // OpenRelative. This is safe because the above lstatrelative fails
// if the target is outside the root, and we know this is not a // if the target is outside the root, and we know this is not a
// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check. // symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
fd, err := os.Open(filepath.Join(root.Name(), path)) fd, err := os.Open(filepath.Join(root.Name(), path))
@@ -344,7 +348,7 @@ func removeAllRelative(path string, root *os.File) error {
for { for {
names, err1 := fd.Readdirnames(100) names, err1 := fd.Readdirnames(100)
for _, name := range names { for _, name := range names {
err1 := removeAllRelative(path+string(os.PathSeparator)+name, root) err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
if err == nil { if err == nil {
err = err1 err = err1
} }
@@ -363,7 +367,7 @@ func removeAllRelative(path string, root *os.File) error {
fd.Close() fd.Close()
// Remove directory. // Remove directory.
err1 := removeRelative(path, root) err1 := RemoveRelative(path, root)
if err1 == nil || os.IsNotExist(err1) { if err1 == nil || os.IsNotExist(err1) {
return nil return nil
} }
@@ -373,16 +377,16 @@ func removeAllRelative(path string, root *os.File) error {
return err return err
} }
// mkdirRelative creates a directory relative to a root, failing if any // MkdirRelative creates a directory relative to a root, failing if any
// intermediate path components are reparse points. // intermediate path components are reparse points.
func mkdirRelative(path string, root *os.File) error { func MkdirRelative(path string, root *os.File) error {
f, err := openRelativeInternal( f, err := openRelativeInternal(
path, path,
root, root,
0, 0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_CREATE, FILE_CREATE,
_FILE_DIRECTORY_FILE) FILE_DIRECTORY_FILE)
if err == nil { if err == nil {
f.Close() f.Close()
} else { } else {
@@ -391,16 +395,16 @@ func mkdirRelative(path string, root *os.File) error {
return err return err
} }
// lstatRelative performs a stat operation on a file relative to a root, failing // LstatRelative performs a stat operation on a file relative to a root, failing
// if any intermediate path components are reparse points. // if any intermediate path components are reparse points.
func lstatRelative(path string, root *os.File) (os.FileInfo, error) { func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
f, err := openRelativeInternal( f, err := openRelativeInternal(
path, path,
root, root,
_FILE_READ_ATTRIBUTES, FILE_READ_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN, FILE_OPEN,
_FILE_OPEN_REPARSE_POINT) FILE_OPEN_REPARSE_POINT)
if err != nil { if err != nil {
return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err} return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
} }
@@ -408,16 +412,16 @@ func lstatRelative(path string, root *os.File) (os.FileInfo, error) {
return f.Stat() return f.Stat()
} }
// ensureNotReparsePointRelative validates that a given file (relative to a // EnsureNotReparsePointRelative validates that a given file (relative to a
// root) and all intermediate path components are not a reparse points. // root) and all intermediate path components are not a reparse points.
func ensureNotReparsePointRelative(path string, root *os.File) error { func EnsureNotReparsePointRelative(path string, root *os.File) error {
// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT. // Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
f, err := openRelative( f, err := OpenRelative(
path, path,
root, root,
0, 0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
_FILE_OPEN, FILE_OPEN,
0) 0)
if err != nil { if err != nil {
return err return err

View File

@@ -0,0 +1,79 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package safefile
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modntdll = windows.NewLazySystemDLL("ntdll.dll")
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
procNtCreateFile = modntdll.NewProc("NtCreateFile")
procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile")
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
procLocalFree = modkernel32.NewProc("LocalFree")
)
func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
status = uint32(r0)
return
}
func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
status = uint32(r0)
return
}
func rtlNtStatusToDosError(status uint32) (winerr error) {
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
if r0 != 0 {
winerr = syscall.Errno(r0)
}
return
}
func localAlloc(flags uint32, size int) (ptr uintptr) {
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
ptr = uintptr(r0)
return
}
func localFree(ptr uintptr) {
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
return
}

View File

@@ -0,0 +1,228 @@
package schema1
import (
"encoding/json"
"time"
)
// ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig struct {
ApplicationName string `json:",omitempty"`
CommandLine string `json:",omitempty"`
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
User string `json:",omitempty"`
WorkingDirectory string `json:",omitempty"`
Environment map[string]string `json:",omitempty"`
EmulateConsole bool `json:",omitempty"`
CreateStdInPipe bool `json:",omitempty"`
CreateStdOutPipe bool `json:",omitempty"`
CreateStdErrPipe bool `json:",omitempty"`
ConsoleSize [2]uint `json:",omitempty"`
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
}
type Layer struct {
ID string
Path string
}
type MappedDir struct {
HostPath string
ContainerPath string
ReadOnly bool
BandwidthMaximum uint64
IOPSMaximum uint64
CreateInUtilityVM bool
// LinuxMetadata - Support added in 1803/RS4+.
LinuxMetadata bool `json:",omitempty"`
}
type MappedPipe struct {
HostPath string
ContainerPipeName string
}
type HvRuntime struct {
ImagePath string `json:",omitempty"`
SkipTemplate bool `json:",omitempty"`
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
}
type MappedVirtualDisk struct {
HostPath string `json:",omitempty"` // Path to VHD on the host
ContainerPath string // Platform-specific mount point path in the container
CreateInUtilityVM bool `json:",omitempty"`
ReadOnly bool `json:",omitempty"`
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
AttachOnly bool `json:",omitempty:`
}
// AssignedDevice represents a device that has been directly assigned to a container
//
// NOTE: Support added in RS5
type AssignedDevice struct {
// InterfaceClassGUID of the device to assign to container.
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
}
// ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig struct {
SystemType string // HCS requires this to be hard-coded to "Container"
Name string // Name of the container. We use the docker ID.
Owner string `json:",omitempty"` // The management platform that created this container
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
Credentials string `json:",omitempty"` // Credentials information
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
HostName string `json:",omitempty"` // Hostname
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
HvPartition bool // True if it a Hyper-V Container
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
Servicing bool `json:",omitempty"` // True if this container is for servicing
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
}
type ComputeSystemQuery struct {
IDs []string `json:"Ids,omitempty"`
Types []string `json:",omitempty"`
Names []string `json:",omitempty"`
Owners []string `json:",omitempty"`
}
type PropertyType string
const (
PropertyTypeStatistics PropertyType = "Statistics"
PropertyTypeProcessList = "ProcessList"
PropertyTypeMappedVirtualDisk = "MappedVirtualDisk"
)
type PropertyQuery struct {
PropertyTypes []PropertyType `json:",omitempty"`
}
// ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties struct {
ID string `json:"Id"`
State string
Name string
SystemType string
Owner string
SiloGUID string `json:"SiloGuid,omitempty"`
RuntimeID string `json:"RuntimeId,omitempty"`
IsRuntimeTemplate bool `json:",omitempty"`
RuntimeImagePath string `json:",omitempty"`
Stopped bool `json:",omitempty"`
ExitType string `json:",omitempty"`
AreUpdatesPending bool `json:",omitempty"`
ObRoot string `json:",omitempty"`
Statistics Statistics `json:",omitempty"`
ProcessList []ProcessListItem `json:",omitempty"`
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
}
// MemoryStats holds the memory statistics for a container
type MemoryStats struct {
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
}
// ProcessorStats holds the processor statistics for a container
type ProcessorStats struct {
TotalRuntime100ns uint64 `json:",omitempty"`
RuntimeUser100ns uint64 `json:",omitempty"`
RuntimeKernel100ns uint64 `json:",omitempty"`
}
// StorageStats holds the storage statistics for a container
type StorageStats struct {
ReadCountNormalized uint64 `json:",omitempty"`
ReadSizeBytes uint64 `json:",omitempty"`
WriteCountNormalized uint64 `json:",omitempty"`
WriteSizeBytes uint64 `json:",omitempty"`
}
// NetworkStats holds the network statistics for a container
type NetworkStats struct {
BytesReceived uint64 `json:",omitempty"`
BytesSent uint64 `json:",omitempty"`
PacketsReceived uint64 `json:",omitempty"`
PacketsSent uint64 `json:",omitempty"`
DroppedPacketsIncoming uint64 `json:",omitempty"`
DroppedPacketsOutgoing uint64 `json:",omitempty"`
EndpointId string `json:",omitempty"`
InstanceId string `json:",omitempty"`
}
// Statistics is the structure returned by a statistics call on a container
type Statistics struct {
Timestamp time.Time `json:",omitempty"`
ContainerStartTime time.Time `json:",omitempty"`
Uptime100ns uint64 `json:",omitempty"`
Memory MemoryStats `json:",omitempty"`
Processor ProcessorStats `json:",omitempty"`
Storage StorageStats `json:",omitempty"`
Network []NetworkStats `json:",omitempty"`
}
// ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem struct {
CreateTimestamp time.Time `json:",omitempty"`
ImageName string `json:",omitempty"`
KernelTime100ns uint64 `json:",omitempty"`
MemoryCommitBytes uint64 `json:",omitempty"`
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
ProcessId uint32 `json:",omitempty"`
UserTime100ns uint64 `json:",omitempty"`
}
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController struct {
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
}
// Type of Request Support in ModifySystem
type RequestType string
// Type of Resource Support in ModifySystem
type ResourceType string
// RequestType const
const (
Add RequestType = "Add"
Remove RequestType = "Remove"
Network ResourceType = "Network"
)
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse struct {
Resource ResourceType `json:"ResourceType"`
Data interface{} `json:"Settings"`
Request RequestType `json:"RequestType,omitempty"`
}

View File

@@ -0,0 +1,26 @@
package timeout
import (
"os"
"strconv"
"time"
)
// Duration is the default time to wait for various operations.
// - Waiting for async notifications from HCS
// - Waiting for processes to launch through
// - Waiting to copy data to/from a launched processes stdio pipes.
//
// This can be overridden through environment variable `HCS_TIMEOUT_SECONDS`
var Duration = 4 * time.Minute
func init() {
envTimeout := os.Getenv("HCSSHIM_TIMEOUT_SECONDS")
if len(envTimeout) > 0 {
e, err := strconv.Atoi(envTimeout)
if err == nil && e > 0 {
Duration = time.Second * time.Duration(e)
}
}
}

View File

@@ -0,0 +1,25 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// ActivateLayer will find the layer with the given id and mount it's filesystem.
// For a read/write layer, the mounted filesystem will appear as a volume on the
// host, while a read-only layer is generally expected to be a no-op.
// An activated layer must later be deactivated via DeactivateLayer.
func ActivateLayer(path string) error {
title := "hcsshim::ActivateLayer "
logrus.Debugf(title+"path %s", path)
err := activateLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded path=%s", path)
return nil
}

View File

@@ -1,4 +1,4 @@
package hcsshim package wclayer
import ( import (
"errors" "errors"
@@ -7,6 +7,8 @@ import (
"syscall" "syscall"
"github.com/Microsoft/go-winio" "github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/safefile"
) )
type baseLayerWriter struct { type baseLayerWriter struct {
@@ -29,7 +31,7 @@ type dirInfo struct {
func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error {
for i := range dis { for i := range dis {
di := &dis[len(dis)-i-1] // reverse order: process child directories first di := &dis[len(dis)-i-1] // reverse order: process child directories first
f, err := openRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, _FILE_OPEN, _FILE_DIRECTORY_FILE) f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE)
if err != nil { if err != nil {
return err return err
} }
@@ -84,21 +86,21 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e
extraFlags := uint32(0) extraFlags := uint32(0)
if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 {
extraFlags |= _FILE_DIRECTORY_FILE extraFlags |= safefile.FILE_DIRECTORY_FILE
if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo}) w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo})
} }
} }
mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY)
f, err = openRelative(name, w.root, mode, syscall.FILE_SHARE_READ, _FILE_CREATE, extraFlags) f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags)
if err != nil { if err != nil {
return makeError(err, "Failed to openRelative", name) return hcserror.New(err, "Failed to safefile.OpenRelative", name)
} }
err = winio.SetFileBasicInfo(f, fileInfo) err = winio.SetFileBasicInfo(f, fileInfo)
if err != nil { if err != nil {
return makeError(err, "Failed to SetFileBasicInfo", name) return hcserror.New(err, "Failed to SetFileBasicInfo", name)
} }
w.f = f w.f = f
@@ -119,7 +121,7 @@ func (w *baseLayerWriter) AddLink(name string, target string) (err error) {
return err return err
} }
return linkRelative(target, w.root, name, w.root) return safefile.LinkRelative(target, w.root, name, w.root)
} }
func (w *baseLayerWriter) Remove(name string) error { func (w *baseLayerWriter) Remove(name string) error {
@@ -157,7 +159,7 @@ func (w *baseLayerWriter) Close() error {
} }
if w.hasUtilityVM { if w.hasUtilityVM {
err := ensureNotReparsePointRelative("UtilityVM", w.root) err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root)
if err != nil { if err != nil {
return err return err
} }

View File

@@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
// the parent layer provided.
func CreateLayer(path, parent string) error {
title := "hcsshim::CreateLayer "
logrus.Debugf(title+"Flavour %d ID %s parent %s", path, parent)
err := createLayer(&stdDriverInfo, path, parent)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s parent=%s flavour=%d", path, parent)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded path=%s parent=%s flavour=%d", path, parent)
return nil
}

View File

@@ -0,0 +1,31 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// CreateScratchLayer creates and populates new read-write layer for use by a container.
// This requires both the id of the direct parent layer, as well as the full list
// of paths to all parent layers up to the base (and including the direct parent
// whose id was provided).
func CreateScratchLayer(path string, parentLayerPaths []string) error {
title := "hcsshim::CreateScratchLayer "
logrus.Debugf(title+"path %s", path)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
err = createSandboxLayer(&stdDriverInfo, path, 0, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,22 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
func DeactivateLayer(path string) error {
title := "hcsshim::DeactivateLayer "
logrus.Debugf(title+"path %s", path)
err := deactivateLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// DestroyLayer will remove the on-disk files representing the layer with the given
// path, including that layer's containing folder, if any.
func DestroyLayer(path string) error {
title := "hcsshim::DestroyLayer "
logrus.Debugf(title+"path %s", path)
err := destroyLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,22 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// ExpandScratchSize expands the size of a layer to at least size bytes.
func ExpandScratchSize(path string, size uint64) error {
title := "hcsshim::ExpandScratchSize "
logrus.Debugf(title+"path=%s size=%d", path, size)
err := expandSandboxSize(&stdDriverInfo, path, size)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s size=%d", path, size)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded path=%s size=%d", path, size)
return nil
}

View File

@@ -1,4 +1,4 @@
package hcsshim package wclayer
import ( import (
"io" "io"
@@ -7,6 +7,8 @@ import (
"syscall" "syscall"
"github.com/Microsoft/go-winio" "github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
) )
@@ -15,9 +17,9 @@ import (
// format includes any metadata required for later importing the layer (using // format includes any metadata required for later importing the layer (using
// ImportLayer), and requires the full list of parent layer paths in order to // ImportLayer), and requires the full list of parent layer paths in order to
// perform the export. // perform the export.
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ExportLayer " title := "hcsshim::ExportLayer "
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath) logrus.Debugf(title+"path %s folder %s", path, exportFolderPath)
// Generate layer descriptors // Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths) layers, err := layerPathsToDescriptors(parentLayerPaths)
@@ -25,21 +27,14 @@ func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, paren
return err return err
} }
// Convert info to API calling convention err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers)
infop, err := convertDriverInfo(info)
if err != nil { if err != nil {
err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath)
logrus.Error(err) logrus.Error(err)
return err return err
} }
err = exportLayer(&infop, layerId, exportFolderPath, layers) logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath)
return nil return nil
} }
@@ -69,11 +64,11 @@ func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error)
if err == syscall.ERROR_NO_MORE_FILES { if err == syscall.ERROR_NO_MORE_FILES {
err = io.EOF err = io.EOF
} else { } else {
err = makeError(err, "ExportLayerNext", "") err = hcserror.New(err, "ExportLayerNext", "")
} }
return "", 0, nil, err return "", 0, nil, err
} }
fileName := convertAndFreeCoTaskMemString(fileNamep) fileName := interop.ConvertAndFreeCoTaskMemString(fileNamep)
if deleted != 0 { if deleted != 0 {
fileInfo = nil fileInfo = nil
} }
@@ -88,7 +83,7 @@ func (r *FilterLayerReader) Read(b []byte) (int, error) {
var bytesRead uint32 var bytesRead uint32
err := exportLayerRead(r.context, b, &bytesRead) err := exportLayerRead(r.context, b, &bytesRead)
if err != nil { if err != nil {
return 0, makeError(err, "ExportLayerRead", "") return 0, hcserror.New(err, "ExportLayerRead", "")
} }
if bytesRead == 0 { if bytesRead == 0 {
return 0, io.EOF return 0, io.EOF
@@ -103,7 +98,7 @@ func (r *FilterLayerReader) Close() (err error) {
if r.context != 0 { if r.context != 0 {
err = exportLayerEnd(r.context) err = exportLayerEnd(r.context)
if err != nil { if err != nil {
err = makeError(err, "ExportLayerEnd", "") err = hcserror.New(err, "ExportLayerEnd", "")
} }
r.context = 0 r.context = 0
} }
@@ -113,34 +108,30 @@ func (r *FilterLayerReader) Close() (err error) {
// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. // NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
// The caller must have taken the SeBackupPrivilege privilege // The caller must have taken the SeBackupPrivilege privilege
// to call this and any methods on the resulting LayerReader. // to call this and any methods on the resulting LayerReader.
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) {
if procExportLayerBegin.Find() != nil { if procExportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the // The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path. // legacy export code path.
path, err := ioutil.TempDir("", "hcs") exportPath, err := ioutil.TempDir("", "hcs")
if err != nil { if err != nil {
return nil, err return nil, err
} }
err = ExportLayer(info, layerID, path, parentLayerPaths) err = ExportLayer(path, exportPath, parentLayerPaths)
if err != nil { if err != nil {
os.RemoveAll(path) os.RemoveAll(exportPath)
return nil, err return nil, err
} }
return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil
} }
layers, err := layerPathsToDescriptors(parentLayerPaths) layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil { if err != nil {
return nil, err return nil, err
} }
infop, err := convertDriverInfo(info)
if err != nil {
return nil, err
}
r := &FilterLayerReader{} r := &FilterLayerReader{}
err = exportLayerBegin(&infop, layerID, layers, &r.context) err = exportLayerBegin(&stdDriverInfo, path, layers, &r.context)
if err != nil { if err != nil {
return nil, makeError(err, "ExportLayerBegin", "") return nil, hcserror.New(err, "ExportLayerBegin", "")
} }
return r, err return r, err
} }

View File

@@ -1,34 +1,28 @@
package hcsshim package wclayer
import ( import (
"syscall" "syscall"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
) )
// GetLayerMountPath will look for a mounted layer with the given id and return // GetLayerMountPath will look for a mounted layer with the given path and return
// the path at which that layer can be accessed. This path may be a volume path // the path at which that layer can be accessed. This path may be a volume path
// if the layer is a mounted read-write layer, otherwise it is expected to be the // if the layer is a mounted read-write layer, otherwise it is expected to be the
// folder path at which the layer is stored. // folder path at which the layer is stored.
func GetLayerMountPath(info DriverInfo, id string) (string, error) { func GetLayerMountPath(path string) (string, error) {
title := "hcsshim::GetLayerMountPath " title := "hcsshim::GetLayerMountPath "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) logrus.Debugf(title+"path %s", path)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return "", err
}
var mountPathLength uintptr var mountPathLength uintptr
mountPathLength = 0 mountPathLength = 0
// Call the procedure itself. // Call the procedure itself.
logrus.Debugf("Calling proc (1)") logrus.Debugf("Calling proc (1)")
err = getLayerMountPath(&infop, id, &mountPathLength, nil) err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil)
if err != nil { if err != nil {
err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour) err = hcserror.Errorf(err, title, "(first call) path=%s", path)
logrus.Error(err) logrus.Error(err)
return "", err return "", err
} }
@@ -42,14 +36,14 @@ func GetLayerMountPath(info DriverInfo, id string) (string, error) {
// Call the procedure again // Call the procedure again
logrus.Debugf("Calling proc (2)") logrus.Debugf("Calling proc (2)")
err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0]) err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0])
if err != nil { if err != nil {
err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour) err = hcserror.Errorf(err, title, "(second call) path=%s", path)
logrus.Error(err) logrus.Error(err)
return "", err return "", err
} }
path := syscall.UTF16ToString(mountPathp[0:]) mountPath := syscall.UTF16ToString(mountPathp[0:])
logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path) logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath)
return path, nil return mountPath, nil
} }

View File

@@ -1,6 +1,10 @@
package hcsshim package wclayer
import "github.com/sirupsen/logrus" import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
// GetSharedBaseImages will enumerate the images stored in the common central // GetSharedBaseImages will enumerate the images stored in the common central
// image store and return descriptive info about those images for the purpose // image store and return descriptive info about those images for the purpose
@@ -12,11 +16,11 @@ func GetSharedBaseImages() (imageData string, err error) {
var buffer *uint16 var buffer *uint16
err = getBaseImages(&buffer) err = getBaseImages(&buffer)
if err != nil { if err != nil {
err = makeError(err, title, "") err = hcserror.New(err, title, "")
logrus.Error(err) logrus.Error(err)
return return
} }
imageData = convertAndFreeCoTaskMemString(buffer) imageData = interop.ConvertAndFreeCoTaskMemString(buffer)
logrus.Debugf(title+" - succeeded output=%s", imageData) logrus.Debugf(title+" - succeeded output=%s", imageData)
return return
} }

View File

@@ -0,0 +1,24 @@
package wclayer
import (
"fmt"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// GrantVmAccess adds access to a file for a given VM
func GrantVmAccess(vmid string, filepath string) error {
title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath)
logrus.Debugf(title)
err := grantVmAccess(vmid, filepath)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", filepath)
logrus.Error(err)
return err
}
logrus.Debugf(title + " - succeeded")
return nil
}

View File

@@ -1,4 +1,4 @@
package hcsshim package wclayer
import ( import (
"errors" "errors"
@@ -7,6 +7,8 @@ import (
"path/filepath" "path/filepath"
"github.com/Microsoft/go-winio" "github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/safefile"
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
) )
@@ -14,9 +16,9 @@ import (
// that into a layer with the id layerId. Note that in order to correctly populate // that into a layer with the id layerId. Note that in order to correctly populate
// the layer and interperet the transport format, all parent layers must already // the layer and interperet the transport format, all parent layers must already
// be present on the system at the paths provided in parentLayerPaths. // be present on the system at the paths provided in parentLayerPaths.
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ImportLayer " title := "hcsshim::ImportLayer "
logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath) logrus.Debugf(title+"path %s folder %s", path, importFolderPath)
// Generate layer descriptors // Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths) layers, err := layerPathsToDescriptors(parentLayerPaths)
@@ -24,21 +26,14 @@ func ImportLayer(info DriverInfo, layerID string, importFolderPath string, paren
return err return err
} }
// Convert info to API calling convention err = importLayer(&stdDriverInfo, path, importFolderPath, layers)
infop, err := convertDriverInfo(info)
if err != nil { if err != nil {
err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath)
logrus.Error(err) logrus.Error(err)
return err return err
} }
err = importLayer(&infop, layerID, importFolderPath, layers) logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath)
return nil return nil
} }
@@ -73,7 +68,7 @@ func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
} }
err := importLayerNext(w.context, name, fileInfo) err := importLayerNext(w.context, name, fileInfo)
if err != nil { if err != nil {
return makeError(err, "ImportLayerNext", "") return hcserror.New(err, "ImportLayerNext", "")
} }
return nil return nil
} }
@@ -92,7 +87,7 @@ func (w *FilterLayerWriter) Remove(name string) error {
} }
err := importLayerNext(w.context, name, nil) err := importLayerNext(w.context, name, nil)
if err != nil { if err != nil {
return makeError(err, "ImportLayerNext", "") return hcserror.New(err, "ImportLayerNext", "")
} }
return nil return nil
} }
@@ -101,7 +96,7 @@ func (w *FilterLayerWriter) Remove(name string) error {
func (w *FilterLayerWriter) Write(b []byte) (int, error) { func (w *FilterLayerWriter) Write(b []byte) (int, error) {
err := importLayerWrite(w.context, b) err := importLayerWrite(w.context, b)
if err != nil { if err != nil {
err = makeError(err, "ImportLayerWrite", "") err = hcserror.New(err, "ImportLayerWrite", "")
return 0, err return 0, err
} }
return len(b), err return len(b), err
@@ -113,7 +108,7 @@ func (w *FilterLayerWriter) Close() (err error) {
if w.context != 0 { if w.context != 0 {
err = importLayerEnd(w.context) err = importLayerEnd(w.context)
if err != nil { if err != nil {
err = makeError(err, "ImportLayerEnd", "") err = hcserror.New(err, "ImportLayerEnd", "")
} }
w.context = 0 w.context = 0
} }
@@ -122,8 +117,6 @@ func (w *FilterLayerWriter) Close() (err error) {
type legacyLayerWriterWrapper struct { type legacyLayerWriterWrapper struct {
*legacyLayerWriter *legacyLayerWriter
info DriverInfo
layerID string
path string path string
parentLayerPaths []string parentLayerPaths []string
} }
@@ -136,28 +129,26 @@ func (r *legacyLayerWriterWrapper) Close() error {
return err return err
} }
info := r.info if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
info.HomeDir = ""
if err = ImportLayer(info, r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
return err return err
} }
for _, name := range r.Tombstones { for _, name := range r.Tombstones {
if err = removeRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) { if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) {
return err return err
} }
} }
// Add any hard links that were collected. // Add any hard links that were collected.
for _, lnk := range r.PendingLinks { for _, lnk := range r.PendingLinks {
if err = removeRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) { if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) {
return err return err
} }
if err = linkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil { if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil {
return err return err
} }
} }
// Prepare the utility VM for use if one is present in the layer. // Prepare the utility VM for use if one is present in the layer.
if r.HasUtilityVM { if r.HasUtilityVM {
err := ensureNotReparsePointRelative("UtilityVM", r.destRoot) err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot)
if err != nil { if err != nil {
return err return err
} }
@@ -172,10 +163,10 @@ func (r *legacyLayerWriterWrapper) Close() error {
// NewLayerWriter returns a new layer writer for creating a layer on disk. // NewLayerWriter returns a new layer writer for creating a layer on disk.
// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges // The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
// to call this and any methods on the resulting LayerWriter. // to call this and any methods on the resulting LayerWriter.
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) {
if len(parentLayerPaths) == 0 { if len(parentLayerPaths) == 0 {
// This is a base layer. It gets imported differently. // This is a base layer. It gets imported differently.
f, err := openRoot(filepath.Join(info.HomeDir, layerID)) f, err := safefile.OpenRoot(path)
if err != nil { if err != nil {
return nil, err return nil, err
} }
@@ -187,19 +178,17 @@ func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string)
if procImportLayerBegin.Find() != nil { if procImportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the // The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path. // legacy export code path.
path, err := ioutil.TempDir("", "hcs") importPath, err := ioutil.TempDir("", "hcs")
if err != nil { if err != nil {
return nil, err return nil, err
} }
w, err := newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)) w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path)
if err != nil { if err != nil {
return nil, err return nil, err
} }
return &legacyLayerWriterWrapper{ return &legacyLayerWriterWrapper{
legacyLayerWriter: w, legacyLayerWriter: w,
info: info, path: importPath,
layerID: layerID,
path: path,
parentLayerPaths: parentLayerPaths, parentLayerPaths: parentLayerPaths,
}, nil }, nil
} }
@@ -208,15 +197,10 @@ func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string)
return nil, err return nil, err
} }
infop, err := convertDriverInfo(info)
if err != nil {
return nil, err
}
w := &FilterLayerWriter{} w := &FilterLayerWriter{}
err = importLayerBegin(&infop, layerID, layers, &w.context) err = importLayerBegin(&stdDriverInfo, path, layers, &w.context)
if err != nil { if err != nil {
return nil, makeError(err, "ImportLayerStart", "") return nil, hcserror.New(err, "ImportLayerStart", "")
} }
return w, nil return w, nil
} }

View File

@@ -0,0 +1,25 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// LayerExists will return true if a layer with the given id exists and is known
// to the system.
func LayerExists(path string) (bool, error) {
title := "hcsshim::LayerExists "
logrus.Debugf(title+"path %s", path)
// Call the procedure itself.
var exists uint32
err := layerExists(&stdDriverInfo, path, &exists)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return false, err
}
logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists)
return exists != 0, nil
}

View File

@@ -0,0 +1,13 @@
package wclayer
import (
"path/filepath"
"github.com/Microsoft/hcsshim/internal/guid"
)
// LayerID returns the layer ID of a layer on disk.
func LayerID(path string) (guid.GUID, error) {
_, file := filepath.Split(path)
return NameToGuid(file)
}

View File

@@ -1,12 +1,12 @@
package hcsshim package wclayer
// This file contains utility functions to support storage (graph) related // This file contains utility functions to support storage (graph) related
// functionality. // functionality.
import ( import (
"path/filepath"
"syscall" "syscall"
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
) )
@@ -22,28 +22,16 @@ struct DriverInfo {
LPCWSTR HomeDir; LPCWSTR HomeDir;
}; };
*/ */
type DriverInfo struct {
Flavour int
HomeDir string
}
type driverInfo struct { type driverInfo struct {
Flavour int Flavour int
HomeDirp *uint16 HomeDirp *uint16
} }
func convertDriverInfo(info DriverInfo) (driverInfo, error) { var (
homedirp, err := syscall.UTF16PtrFromString(info.HomeDir) utf16EmptyString uint16
if err != nil { stdDriverInfo = driverInfo{1, &utf16EmptyString}
logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error()) )
return driverInfo{}, err
}
return driverInfo{
Flavour: info.Flavour,
HomeDirp: homedirp,
}, nil
}
/* To pass into syscall, we need a struct matching the following: /* To pass into syscall, we need a struct matching the following:
typedef struct _WC_LAYER_DESCRIPTOR { typedef struct _WC_LAYER_DESCRIPTOR {
@@ -75,7 +63,7 @@ typedef struct _WC_LAYER_DESCRIPTOR {
} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; } WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR;
*/ */
type WC_LAYER_DESCRIPTOR struct { type WC_LAYER_DESCRIPTOR struct {
LayerId GUID LayerId guid.GUID
Flags uint32 Flags uint32
Pathp *uint16 Pathp *uint16
} }
@@ -85,10 +73,7 @@ func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR,
var layers []WC_LAYER_DESCRIPTOR var layers []WC_LAYER_DESCRIPTOR
for i := 0; i < len(parentLayerPaths); i++ { for i := 0; i < len(parentLayerPaths); i++ {
// Create a layer descriptor, using the folder name g, err := LayerID(parentLayerPaths[i])
// as the source for a GUID LayerId
_, folderName := filepath.Split(parentLayerPaths[i])
g, err := NameToGuid(folderName)
if err != nil { if err != nil {
logrus.Debugf("Failed to convert name to guid %s", err) logrus.Debugf("Failed to convert name to guid %s", err)
return nil, err return nil, err

View File

@@ -1,4 +1,4 @@
package hcsshim package wclayer
import ( import (
"bufio" "bufio"
@@ -6,12 +6,15 @@ import (
"errors" "errors"
"fmt" "fmt"
"io" "io"
"io/ioutil"
"os" "os"
"path/filepath" "path/filepath"
"strings" "strings"
"syscall" "syscall"
"github.com/Microsoft/go-winio" "github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/longpath"
"github.com/Microsoft/hcsshim/internal/safefile"
) )
var errorIterationCanceled = errors.New("") var errorIterationCanceled = errors.New("")
@@ -34,23 +37,6 @@ func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os
return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition)
} }
func makeLongAbsPath(path string) (string, error) {
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
return path, nil
}
if !filepath.IsAbs(path) {
absPath, err := filepath.Abs(path)
if err != nil {
return "", err
}
path = absPath
}
if strings.HasPrefix(path, `\\`) {
return `\\?\UNC\` + path[2:], nil
}
return `\\?\` + path, nil
}
func hasPathPrefix(p, prefix string) bool { func hasPathPrefix(p, prefix string) bool {
return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\'
} }
@@ -106,7 +92,7 @@ func readTombstones(path string) (map[string]([]string), error) {
} }
func (r *legacyLayerReader) walkUntilCancelled() error { func (r *legacyLayerReader) walkUntilCancelled() error {
root, err := makeLongAbsPath(r.root) root, err := longpath.LongAbs(r.root)
if err != nil { if err != nil {
return err return err
} }
@@ -349,6 +335,7 @@ type legacyLayerWriter struct {
destRoot *os.File destRoot *os.File
parentRoots []*os.File parentRoots []*os.File
currentFile *os.File currentFile *os.File
bufWriter *bufio.Writer
currentFileName string currentFileName string
currentFileRoot *os.File currentFileRoot *os.File
backupWriter *winio.BackupFileWriter backupWriter *winio.BackupFileWriter
@@ -373,21 +360,22 @@ func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w
w = nil w = nil
} }
}() }()
w.root, err = openRoot(root) w.root, err = safefile.OpenRoot(root)
if err != nil { if err != nil {
return return
} }
w.destRoot, err = openRoot(destRoot) w.destRoot, err = safefile.OpenRoot(destRoot)
if err != nil { if err != nil {
return return
} }
for _, r := range parentRoots { for _, r := range parentRoots {
f, err := openRoot(r) f, err := safefile.OpenRoot(r)
if err != nil { if err != nil {
return w, err return w, err
} }
w.parentRoots = append(w.parentRoots, f) w.parentRoots = append(w.parentRoots, f)
} }
w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536)
return return
} }
@@ -408,7 +396,7 @@ func (w *legacyLayerWriter) CloseRoots() {
func (w *legacyLayerWriter) initUtilityVM() error { func (w *legacyLayerWriter) initUtilityVM() error {
if !w.HasUtilityVM { if !w.HasUtilityVM {
err := mkdirRelative(utilityVMPath, w.destRoot) err := safefile.MkdirRelative(utilityVMPath, w.destRoot)
if err != nil { if err != nil {
return err return err
} }
@@ -426,6 +414,11 @@ func (w *legacyLayerWriter) initUtilityVM() error {
} }
func (w *legacyLayerWriter) reset() error { func (w *legacyLayerWriter) reset() error {
err := w.bufWriter.Flush()
if err != nil {
return err
}
w.bufWriter.Reset(ioutil.Discard)
if w.currentIsDir { if w.currentIsDir {
r := w.currentFile r := w.currentFile
br := winio.NewBackupStreamReader(r) br := winio.NewBackupStreamReader(r)
@@ -449,7 +442,7 @@ func (w *legacyLayerWriter) reset() error {
// describes a directory reparse point. Delete the placeholder // describes a directory reparse point. Delete the placeholder
// directory to prevent future files being added into the // directory to prevent future files being added into the
// destination of the reparse point during the ImportLayer call // destination of the reparse point during the ImportLayer call
if err := removeRelative(w.currentFileName, w.currentFileRoot); err != nil { if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil {
return err return err
} }
w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot}) w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot})
@@ -474,13 +467,13 @@ func (w *legacyLayerWriter) reset() error {
// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata // copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata
func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) {
src, err := openRelative( src, err := safefile.OpenRelative(
subPath, subPath,
srcRoot, srcRoot,
syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ, syscall.FILE_SHARE_READ,
_FILE_OPEN, safefile.FILE_OPEN,
_FILE_OPEN_REPARSE_POINT) safefile.FILE_OPEN_REPARSE_POINT)
if err != nil { if err != nil {
return nil, err return nil, err
} }
@@ -495,14 +488,14 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool
extraFlags := uint32(0) extraFlags := uint32(0)
if isDir { if isDir {
extraFlags |= _FILE_DIRECTORY_FILE extraFlags |= safefile.FILE_DIRECTORY_FILE
} }
dest, err := openRelative( dest, err := safefile.OpenRelative(
subPath, subPath,
destRoot, destRoot,
syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ, syscall.FILE_SHARE_READ,
_FILE_CREATE, safefile.FILE_CREATE,
extraFlags) extraFlags)
if err != nil { if err != nil {
return nil, err return nil, err
@@ -534,7 +527,7 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool
// the file names in the provided map and just copies those files. // the file names in the provided map and just copies those files.
func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error { func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error {
var di []dirInfo var di []dirInfo
err := ensureNotReparsePointRelative(subPath, srcRoot) err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot)
if err != nil { if err != nil {
return err return err
} }
@@ -566,18 +559,12 @@ func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles
di = append(di, dirInfo{path: relPath, fileInfo: *fi}) di = append(di, dirInfo{path: relPath, fileInfo: *fi})
} }
} else { } else {
err = linkRelative(relPath, srcRoot, relPath, destRoot) err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot)
if err != nil { if err != nil {
return err return err
} }
} }
// Don't recurse on reparse points in go1.8 and older. Filepath.Walk
// handles this in go1.9 and newer.
if isDir && isReparsePoint && shouldSkipDirectoryReparse {
return filepath.SkipDir
}
return nil return nil
}) })
if err != nil { if err != nil {
@@ -604,9 +591,9 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath {
return errors.New("invalid UtilityVM layer") return errors.New("invalid UtilityVM layer")
} }
createDisposition := uint32(_FILE_OPEN) createDisposition := uint32(safefile.FILE_OPEN)
if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
st, err := lstatRelative(name, w.destRoot) st, err := safefile.LstatRelative(name, w.destRoot)
if err != nil && !os.IsNotExist(err) { if err != nil && !os.IsNotExist(err) {
return err return err
} }
@@ -614,14 +601,14 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
// Delete the existing file/directory if it is not the same type as this directory. // Delete the existing file/directory if it is not the same type as this directory.
existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes
if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
if err = removeAllRelative(name, w.destRoot); err != nil { if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil {
return err return err
} }
st = nil st = nil
} }
} }
if st == nil { if st == nil {
if err = mkdirRelative(name, w.destRoot); err != nil { if err = safefile.MkdirRelative(name, w.destRoot); err != nil {
return err return err
} }
} }
@@ -630,20 +617,20 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
} }
} else { } else {
// Overwrite any existing hard link. // Overwrite any existing hard link.
err := removeRelative(name, w.destRoot) err := safefile.RemoveRelative(name, w.destRoot)
if err != nil && !os.IsNotExist(err) { if err != nil && !os.IsNotExist(err) {
return err return err
} }
createDisposition = _FILE_CREATE createDisposition = safefile.FILE_CREATE
} }
f, err := openRelative( f, err := safefile.OpenRelative(
name, name,
w.destRoot, w.destRoot,
syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ, syscall.FILE_SHARE_READ,
createDisposition, createDisposition,
_FILE_OPEN_REPARSE_POINT, safefile.FILE_OPEN_REPARSE_POINT,
) )
if err != nil { if err != nil {
return err return err
@@ -651,7 +638,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
defer func() { defer func() {
if f != nil { if f != nil {
f.Close() f.Close()
removeRelative(name, w.destRoot) safefile.RemoveRelative(name, w.destRoot)
} }
}() }()
@@ -661,6 +648,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
} }
w.backupWriter = winio.NewBackupFileWriter(f, true) w.backupWriter = winio.NewBackupFileWriter(f, true)
w.bufWriter.Reset(w.backupWriter)
w.currentFile = f w.currentFile = f
w.currentFileName = name w.currentFileName = name
w.currentFileRoot = w.destRoot w.currentFileRoot = w.destRoot
@@ -671,7 +659,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
fname := name fname := name
if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
err := mkdirRelative(name, w.root) err := safefile.MkdirRelative(name, w.root)
if err != nil { if err != nil {
return err return err
} }
@@ -679,14 +667,14 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
w.currentIsDir = true w.currentIsDir = true
} }
f, err := openRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, _FILE_CREATE, 0) f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0)
if err != nil { if err != nil {
return err return err
} }
defer func() { defer func() {
if f != nil { if f != nil {
f.Close() f.Close()
removeRelative(fname, w.root) safefile.RemoveRelative(fname, w.root)
} }
}() }()
@@ -699,10 +687,13 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro
if hasPathPrefix(name, hivesPath) { if hasPathPrefix(name, hivesPath) {
w.backupWriter = winio.NewBackupFileWriter(f, false) w.backupWriter = winio.NewBackupFileWriter(f, false)
w.bufWriter.Reset(w.backupWriter)
} else { } else {
w.bufWriter.Reset(f)
// The file attributes are written before the stream. // The file attributes are written before the stream.
err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes)) err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes))
if err != nil { if err != nil {
w.bufWriter.Reset(ioutil.Discard)
return err return err
} }
} }
@@ -744,7 +735,7 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error {
selectedRoot = w.destRoot selectedRoot = w.destRoot
} else { } else {
for _, r := range roots { for _, r := range roots {
if _, err := lstatRelative(target, r); err != nil { if _, err := safefile.LstatRelative(target, r); err != nil {
if !os.IsNotExist(err) { if !os.IsNotExist(err) {
return err return err
} }
@@ -780,10 +771,10 @@ func (w *legacyLayerWriter) Remove(name string) error {
// Make sure the path exists; os.RemoveAll will not fail if the file is // Make sure the path exists; os.RemoveAll will not fail if the file is
// already gone, and this needs to be a fatal error for diagnostics // already gone, and this needs to be a fatal error for diagnostics
// purposes. // purposes.
if _, err := lstatRelative(name, w.destRoot); err != nil { if _, err := safefile.LstatRelative(name, w.destRoot); err != nil {
return err return err
} }
err = removeAllRelative(name, w.destRoot) err = safefile.RemoveAllRelative(name, w.destRoot)
if err != nil { if err != nil {
return err return err
} }
@@ -795,24 +786,21 @@ func (w *legacyLayerWriter) Remove(name string) error {
} }
func (w *legacyLayerWriter) Write(b []byte) (int, error) { func (w *legacyLayerWriter) Write(b []byte) (int, error) {
if w.backupWriter == nil { if w.backupWriter == nil && w.currentFile == nil {
if w.currentFile == nil {
return 0, errors.New("closed") return 0, errors.New("closed")
} }
return w.currentFile.Write(b) return w.bufWriter.Write(b)
}
return w.backupWriter.Write(b)
} }
func (w *legacyLayerWriter) Close() error { func (w *legacyLayerWriter) Close() error {
if err := w.reset(); err != nil { if err := w.reset(); err != nil {
return err return err
} }
if err := removeRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) { if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) {
return err return err
} }
for _, pd := range w.pendingDirs { for _, pd := range w.pendingDirs {
err := mkdirRelative(pd.Path, pd.Root) err := safefile.MkdirRelative(pd.Path, pd.Root)
if err != nil { if err != nil {
return err return err
} }

View File

@@ -0,0 +1,24 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// NameToGuid converts the given string into a GUID using the algorithm in the
// Host Compute Service, ensuring GUIDs generated with the same string are common
// across all clients.
func NameToGuid(name string) (id guid.GUID, err error) {
title := "hcsshim::NameToGuid "
err = nameToGuid(name, &id)
if err != nil {
err = hcserror.Errorf(err, title, "name=%s", name)
logrus.Error(err)
return
}
logrus.Debugf(title+"name:%s guid:%s", name, id.String())
return
}

View File

@@ -1,21 +1,22 @@
package hcsshim package wclayer
import ( import (
"sync" "sync"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus" "github.com/sirupsen/logrus"
) )
var prepareLayerLock sync.Mutex var prepareLayerLock sync.Mutex
// PrepareLayer finds a mounted read-write layer matching layerId and enables the // PrepareLayer finds a mounted read-write layer matching path and enables the
// the filesystem filter for use on that layer. This requires the paths to all // the filesystem filter for use on that layer. This requires the paths to all
// parent layers, and is necessary in order to view or interact with the layer // parent layers, and is necessary in order to view or interact with the layer
// as an actual filesystem (reading and writing files, creating directories, etc). // as an actual filesystem (reading and writing files, creating directories, etc).
// Disabling the filter must be done via UnprepareLayer. // Disabling the filter must be done via UnprepareLayer.
func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { func PrepareLayer(path string, parentLayerPaths []string) error {
title := "hcsshim::PrepareLayer " title := "hcsshim::PrepareLayer "
logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) logrus.Debugf(title+"path %s", path)
// Generate layer descriptors // Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths) layers, err := layerPathsToDescriptors(parentLayerPaths)
@@ -23,24 +24,17 @@ func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) er
return err return err
} }
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
// This lock is a temporary workaround for a Windows bug. Only allowing one // This lock is a temporary workaround for a Windows bug. Only allowing one
// call to prepareLayer at a time vastly reduces the chance of a timeout. // call to prepareLayer at a time vastly reduces the chance of a timeout.
prepareLayerLock.Lock() prepareLayerLock.Lock()
defer prepareLayerLock.Unlock() defer prepareLayerLock.Unlock()
err = prepareLayer(&infop, layerId, layers) err = prepareLayer(&stdDriverInfo, path, layers)
if err != nil { if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err) logrus.Error(err)
return err return err
} }
logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId) logrus.Debugf(title+"succeeded path=%s", path)
return nil return nil
} }

View File

@@ -1,4 +1,4 @@
package hcsshim package wclayer
import "os" import "os"

View File

@@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// UnprepareLayer disables the filesystem filter for the read-write layer with
// the given id.
func UnprepareLayer(path string) error {
title := "hcsshim::UnprepareLayer "
logrus.Debugf(title+"path %s", path)
err := unprepareLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,37 @@
package wclayer
import "github.com/Microsoft/hcsshim/internal/guid"
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go -winio wclayer.go
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid?
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess?
type _guid = guid.GUID

View File

@@ -0,0 +1,597 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package wclayer
import (
"syscall"
"unsafe"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procActivateLayer = modvmcompute.NewProc("ActivateLayer")
procCopyLayer = modvmcompute.NewProc("CopyLayer")
procCreateLayer = modvmcompute.NewProc("CreateLayer")
procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer")
procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize")
procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer")
procDestroyLayer = modvmcompute.NewProc("DestroyLayer")
procExportLayer = modvmcompute.NewProc("ExportLayer")
procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath")
procGetBaseImages = modvmcompute.NewProc("GetBaseImages")
procImportLayer = modvmcompute.NewProc("ImportLayer")
procLayerExists = modvmcompute.NewProc("LayerExists")
procNameToGuid = modvmcompute.NewProc("NameToGuid")
procPrepareLayer = modvmcompute.NewProc("PrepareLayer")
procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer")
procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage")
procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage")
procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin")
procImportLayerNext = modvmcompute.NewProc("ImportLayerNext")
procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite")
procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd")
procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin")
procExportLayerNext = modvmcompute.NewProc("ExportLayerNext")
procExportLayerRead = modvmcompute.NewProc("ExportLayerRead")
procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd")
procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess")
)
func activateLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _activateLayer(info, _p0)
}
func _activateLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procActivateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(srcId)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(dstId)
if hr != nil {
return
}
return _copyLayer(info, _p0, _p1, descriptors)
}
func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procCopyLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func createLayer(info *driverInfo, id string, parent string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(parent)
if hr != nil {
return
}
return _createLayer(info, _p0, _p1)
}
func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) {
if hr = procCreateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _createSandboxLayer(info, _p0, parent, descriptors)
}
func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procCreateSandboxLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _expandSandboxSize(info, _p0, size)
}
func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) {
if hr = procExpandSandboxSize.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func deactivateLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _deactivateLayer(info, _p0)
}
func _deactivateLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procDeactivateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func destroyLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _destroyLayer(info, _p0)
}
func _destroyLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procDestroyLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _exportLayer(info, _p0, _p1, descriptors)
}
func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procExportLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _getLayerMountPath(info, _p0, length, buffer)
}
func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) {
if hr = procGetLayerMountPath.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func getBaseImages(buffer **uint16) (hr error) {
if hr = procGetBaseImages.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _importLayer(info, _p0, _p1, descriptors)
}
func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procImportLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func layerExists(info *driverInfo, id string, exists *uint32) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _layerExists(info, _p0, exists)
}
func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) {
if hr = procLayerExists.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func nameToGuid(name string, guid *_guid) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(name)
if hr != nil {
return
}
return _nameToGuid(_p0, guid)
}
func _nameToGuid(name *uint16, guid *_guid) (hr error) {
if hr = procNameToGuid.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _prepareLayer(info, _p0, descriptors)
}
func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procPrepareLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func unprepareLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _unprepareLayer(info, _p0)
}
func _unprepareLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procUnprepareLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func processBaseImage(path string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _processBaseImage(_p0)
}
func _processBaseImage(path *uint16) (hr error) {
if hr = procProcessBaseImage.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func processUtilityImage(path string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _processUtilityImage(_p0)
}
func _processUtilityImage(path *uint16) (hr error) {
if hr = procProcessUtilityImage.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _importLayerBegin(info, _p0, descriptors, context)
}
func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procImportLayerBegin.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(fileName)
if hr != nil {
return
}
return _importLayerNext(context, _p0, fileInfo)
}
func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) {
if hr = procImportLayerNext.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerWrite(context uintptr, buffer []byte) (hr error) {
var _p0 *byte
if len(buffer) > 0 {
_p0 = &buffer[0]
}
if hr = procImportLayerWrite.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerEnd(context uintptr) (hr error) {
if hr = procImportLayerEnd.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _exportLayerBegin(info, _p0, descriptors, context)
}
func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procExportLayerBegin.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) {
if hr = procExportLayerNext.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) {
var _p0 *byte
if len(buffer) > 0 {
_p0 = &buffer[0]
}
if hr = procExportLayerRead.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerEnd(context uintptr) (hr error) {
if hr = procExportLayerEnd.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func grantVmAccess(vmid string, filepath string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(vmid)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(filepath)
if hr != nil {
return
}
return _grantVmAccess(_p0, _p1)
}
func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) {
if hr = procGrantVmAccess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

108
vendor/github.com/Microsoft/hcsshim/layer.go generated vendored Normal file
View File

@@ -0,0 +1,108 @@
package hcsshim
import (
"crypto/sha1"
"path/filepath"
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/Microsoft/hcsshim/internal/wclayer"
)
func layerPath(info *DriverInfo, id string) string {
return filepath.Join(info.HomeDir, id)
}
func ActivateLayer(info DriverInfo, id string) error {
return wclayer.ActivateLayer(layerPath(&info, id))
}
func CreateLayer(info DriverInfo, id, parent string) error {
return wclayer.CreateLayer(layerPath(&info, id), parent)
}
// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility.
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
}
func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
}
func DeactivateLayer(info DriverInfo, id string) error {
return wclayer.DeactivateLayer(layerPath(&info, id))
}
func DestroyLayer(info DriverInfo, id string) error {
return wclayer.DestroyLayer(layerPath(&info, id))
}
// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility.
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
}
func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error {
return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
}
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths)
}
func GetLayerMountPath(info DriverInfo, id string) (string, error) {
return wclayer.GetLayerMountPath(layerPath(&info, id))
}
func GetSharedBaseImages() (imageData string, err error) {
return wclayer.GetSharedBaseImages()
}
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths)
}
func LayerExists(info DriverInfo, id string) (bool, error) {
return wclayer.LayerExists(layerPath(&info, id))
}
func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error {
return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths)
}
func ProcessBaseLayer(path string) error {
return wclayer.ProcessBaseLayer(path)
}
func ProcessUtilityVMImage(path string) error {
return wclayer.ProcessUtilityVMImage(path)
}
func UnprepareLayer(info DriverInfo, layerId string) error {
return wclayer.UnprepareLayer(layerPath(&info, layerId))
}
type DriverInfo struct {
Flavour int
HomeDir string
}
type FilterLayerReader = wclayer.FilterLayerReader
type FilterLayerWriter = wclayer.FilterLayerWriter
type GUID [16]byte
func NameToGuid(name string) (id GUID, err error) {
g, err := wclayer.NameToGuid(name)
return GUID(g), err
}
func NewGUID(source string) *GUID {
h := sha1.Sum([]byte(source))
var g GUID
copy(g[0:], h[0:16])
return &g
}
func (g *GUID) ToString() string {
return (guid.GUID)(*g).String()
}
type LayerReader = wclayer.LayerReader
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths)
}
type LayerWriter = wclayer.LayerWriter
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths)
}
type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR

View File

@@ -1,30 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// LayerExists will return true if a layer with the given id exists and is known
// to the system.
func LayerExists(info DriverInfo, id string) (bool, error) {
title := "hcsshim::LayerExists "
logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return false, err
}
// Call the procedure itself.
var exists uint32
err = layerExists(&infop, id, &exists)
if err != nil {
err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour)
logrus.Error(err)
return false, err
}
logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists)
return exists != 0, nil
}

View File

@@ -1,7 +0,0 @@
// +build !go1.9
package hcsshim
// Due to a bug in go1.8 and before, directory reparse points need to be skipped
// during filepath.Walk. This is fixed in go1.9
var shouldSkipDirectoryReparse = true

View File

@@ -1,7 +0,0 @@
// +build go1.9
package hcsshim
// Due to a bug in go1.8 and before, directory reparse points need to be skipped
// during filepath.Walk. This is fixed in go1.9
var shouldSkipDirectoryReparse = false

View File

@@ -1,20 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// NameToGuid converts the given string into a GUID using the algorithm in the
// Host Compute Service, ensuring GUIDs generated with the same string are common
// across all clients.
func NameToGuid(name string) (id GUID, err error) {
title := "hcsshim::NameToGuid "
logrus.Debugf(title+"Name %s", name)
err = nameToGuid(name, &id)
if err != nil {
err = makeErrorf(err, title, "name=%s", name)
logrus.Error(err)
return
}
return
}

View File

@@ -1,384 +1,72 @@
package hcsshim package hcsshim
import ( import (
"encoding/json"
"io" "io"
"sync"
"syscall"
"time" "time"
"github.com/sirupsen/logrus" "github.com/Microsoft/hcsshim/internal/hcs"
) )
// ContainerError is an error encountered in HCS // ContainerError is an error encountered in HCS
type process struct { type process struct {
handleLock sync.RWMutex p *hcs.Process
handle hcsProcess
processID int
container *container
cachedPipes *cachedPipes
callbackNumber uintptr
} }
type cachedPipes struct {
stdIn syscall.Handle
stdOut syscall.Handle
stdErr syscall.Handle
}
type processModifyRequest struct {
Operation string
ConsoleSize *consoleSize `json:",omitempty"`
CloseHandle *closeHandle `json:",omitempty"`
}
type consoleSize struct {
Height uint16
Width uint16
}
type closeHandle struct {
Handle string
}
type processStatus struct {
ProcessID uint32
Exited bool
ExitCode uint32
LastWaitResult int32
}
const (
stdIn string = "StdIn"
stdOut string = "StdOut"
stdErr string = "StdErr"
)
const (
modifyConsoleSize string = "ConsoleSize"
modifyCloseHandle string = "CloseHandle"
)
// Pid returns the process ID of the process within the container. // Pid returns the process ID of the process within the container.
func (process *process) Pid() int { func (process *process) Pid() int {
return process.processID return process.p.Pid()
} }
// Kill signals the process to terminate but does not wait for it to finish terminating. // Kill signals the process to terminate but does not wait for it to finish terminating.
func (process *process) Kill() error { func (process *process) Kill() error {
process.handleLock.RLock() return convertProcessError(process.p.Kill(), process)
defer process.handleLock.RUnlock()
operation := "Kill"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, "", ErrAlreadyClosed)
}
var resultp *uint16
err := hcsTerminateProcess(process.handle, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
} }
// Wait waits for the process to exit. // Wait waits for the process to exit.
func (process *process) Wait() error { func (process *process) Wait() error {
operation := "Wait" return convertProcessError(process.p.Wait(), process)
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
} }
// WaitTimeout waits for the process to exit or the duration to elapse. It returns // WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs. // false if timeout occurs.
func (process *process) WaitTimeout(timeout time.Duration) error { func (process *process) WaitTimeout(timeout time.Duration) error {
operation := "WaitTimeout" return convertProcessError(process.p.WaitTimeout(timeout), process)
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
} }
// ExitCode returns the exit code of the process. The process must have // ExitCode returns the exit code of the process. The process must have
// already terminated. // already terminated.
func (process *process) ExitCode() (int, error) { func (process *process) ExitCode() (int, error) {
process.handleLock.RLock() code, err := process.p.ExitCode()
defer process.handleLock.RUnlock()
operation := "ExitCode"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return 0, makeProcessError(process, operation, "", ErrAlreadyClosed)
}
properties, err := process.properties()
if err != nil { if err != nil {
return 0, makeProcessError(process, operation, "", err) err = convertProcessError(err, process)
} }
return code, err
if properties.Exited == false {
return 0, makeProcessError(process, operation, "", ErrInvalidProcessState)
}
if properties.LastWaitResult != 0 {
return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult))
}
logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode)
return int(properties.ExitCode), nil
} }
// ResizeConsole resizes the console of the process. // ResizeConsole resizes the console of the process.
func (process *process) ResizeConsole(width, height uint16) error { func (process *process) ResizeConsole(width, height uint16) error {
process.handleLock.RLock() return convertProcessError(process.p.ResizeConsole(width, height), process)
defer process.handleLock.RUnlock()
operation := "ResizeConsole"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, "", ErrAlreadyClosed)
}
modifyRequest := processModifyRequest{
Operation: modifyConsoleSize,
ConsoleSize: &consoleSize{
Height: height,
Width: width,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *process) properties() (*processStatus, error) {
operation := "properties"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
var (
resultp *uint16
propertiesp *uint16
)
err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return nil, err
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp)
properties := &processStatus{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, err
}
logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
return properties, nil
} }
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to // these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces. // call this multiple times to get multiple interfaces.
func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
process.handleLock.RLock() stdin, stdout, stderr, err := process.p.Stdio()
defer process.handleLock.RUnlock()
operation := "Stdio"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed)
}
var stdIn, stdOut, stdErr syscall.Handle
if process.cachedPipes == nil {
var (
processInfo hcsProcessInformation
resultp *uint16
)
err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
err = processHcsResult(err, resultp)
if err != nil { if err != nil {
return nil, nil, nil, makeProcessError(process, operation, "", err) err = convertProcessError(err, process)
} }
return stdin, stdout, stderr, err
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
} else {
// Use cached pipes
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
// Invalidate the cache
process.cachedPipes = nil
}
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return pipes[0], pipes[1], pipes[2], nil
} }
// CloseStdin closes the write side of the stdin pipe so that the process is // CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin. // notified on the read side that there is no more data in stdin.
func (process *process) CloseStdin() error { func (process *process) CloseStdin() error {
process.handleLock.RLock() return convertProcessError(process.p.CloseStdin(), process)
defer process.handleLock.RUnlock()
operation := "CloseStdin"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, "", ErrAlreadyClosed)
}
modifyRequest := processModifyRequest{
Operation: modifyCloseHandle,
CloseHandle: &closeHandle{
Handle: stdIn,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
err = processHcsResult(err, resultp)
if err != nil {
return makeProcessError(process, operation, "", err)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
} }
// Close cleans up any state associated with the process but does not kill // Close cleans up any state associated with the process but does not kill
// or wait on it. // or wait on it.
func (process *process) Close() error { func (process *process) Close() error {
process.handleLock.Lock() return convertProcessError(process.p.Close(), process)
defer process.handleLock.Unlock()
operation := "Close"
title := "HCSShim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
// Don't double free this
if process.handle == 0 {
return nil
}
if err := process.unregisterCallback(); err != nil {
return makeProcessError(process, operation, "", err)
}
if err := hcsCloseProcess(process.handle); err != nil {
return makeProcessError(process, operation, "", err)
}
process.handle = 0
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *process) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
process.callbackNumber = callbackNumber
return nil
}
func (process *process) unregisterCallback() error {
callbackNumber := process.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterProcessCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterProcessCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
} }

View File

@@ -1,27 +0,0 @@
package hcsshim
import "github.com/sirupsen/logrus"
// UnprepareLayer disables the filesystem filter for the read-write layer with
// the given id.
func UnprepareLayer(info DriverInfo, layerId string) error {
title := "hcsshim::UnprepareLayer "
logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId)
// Convert info to API calling convention
infop, err := convertDriverInfo(info)
if err != nil {
logrus.Error(err)
return err
}
err = unprepareLayer(&infop, layerId)
if err != nil {
err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId)
return nil
}

View File

@@ -2,6 +2,5 @@ package hcsshim
// IsTP4 returns whether the currently running Windows build is at least TP4. // IsTP4 returns whether the currently running Windows build is at least TP4.
func IsTP4() bool { func IsTP4() bool {
// HNSCall was not present in TP4 return false
return procHNSCall.Find() != nil
} }

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,52 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hcsshim
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll")
procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId")
)
func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) {
r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@@ -1,3 +1,5 @@
// +build !windows
/* /*
Copyright The containerd Authors. Copyright The containerd Authors.

View File

@@ -20,9 +20,6 @@ import (
"io" "io"
"os" "os"
"os/exec" "os/exec"
"github.com/pkg/errors"
"golang.org/x/sys/unix"
) )
type IO interface { type IO interface {
@@ -37,51 +34,6 @@ type StartCloser interface {
CloseAfterStart() error CloseAfterStart() error
} }
// NewPipeIO creates pipe pairs to be used with runc
func NewPipeIO(uid, gid int) (i IO, err error) {
var pipes []*pipe
// cleanup in case of an error
defer func() {
if err != nil {
for _, p := range pipes {
p.Close()
}
}
}()
stdin, err := newPipe()
if err != nil {
return nil, err
}
pipes = append(pipes, stdin)
if err = unix.Fchown(int(stdin.r.Fd()), uid, gid); err != nil {
return nil, errors.Wrap(err, "failed to chown stdin")
}
stdout, err := newPipe()
if err != nil {
return nil, err
}
pipes = append(pipes, stdout)
if err = unix.Fchown(int(stdout.w.Fd()), uid, gid); err != nil {
return nil, errors.Wrap(err, "failed to chown stdout")
}
stderr, err := newPipe()
if err != nil {
return nil, err
}
pipes = append(pipes, stderr)
if err = unix.Fchown(int(stderr.w.Fd()), uid, gid); err != nil {
return nil, errors.Wrap(err, "failed to chown stderr")
}
return &pipeIO{
in: stdin,
out: stdout,
err: stderr,
}, nil
}
func newPipe() (*pipe, error) { func newPipe() (*pipe, error) {
r, w, err := os.Pipe() r, w, err := os.Pipe()
if err != nil { if err != nil {

69
vendor/github.com/containerd/go-runc/io_unix.go generated vendored Normal file
View File

@@ -0,0 +1,69 @@
// +build !windows
/*
Copyright The containerd Authors.
Licensed under the Apache License, Version 2.0 (the "License");
you may not use this file except in compliance with the License.
You may obtain a copy of the License at
http://www.apache.org/licenses/LICENSE-2.0
Unless required by applicable law or agreed to in writing, software
distributed under the License is distributed on an "AS IS" BASIS,
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
See the License for the specific language governing permissions and
limitations under the License.
*/
package runc
import (
"github.com/pkg/errors"
"golang.org/x/sys/unix"
)
// NewPipeIO creates pipe pairs to be used with runc
func NewPipeIO(uid, gid int) (i IO, err error) {
var pipes []*pipe
// cleanup in case of an error
defer func() {
if err != nil {
for _, p := range pipes {
p.Close()
}
}
}()
stdin, err := newPipe()
if err != nil {
return nil, err
}
pipes = append(pipes, stdin)
if err = unix.Fchown(int(stdin.r.Fd()), uid, gid); err != nil {
return nil, errors.Wrap(err, "failed to chown stdin")
}
stdout, err := newPipe()
if err != nil {
return nil, err
}
pipes = append(pipes, stdout)
if err = unix.Fchown(int(stdout.w.Fd()), uid, gid); err != nil {
return nil, errors.Wrap(err, "failed to chown stdout")
}
stderr, err := newPipe()
if err != nil {
return nil, err
}
pipes = append(pipes, stderr)
if err = unix.Fchown(int(stderr.w.Fd()), uid, gid); err != nil {
return nil, errors.Wrap(err, "failed to chown stderr")
}
return &pipeIO{
in: stdin,
out: stdout,
err: stderr,
}, nil
}

Some files were not shown because too many files have changed in this diff Show More