diff --git a/vendor.conf b/vendor.conf index 0feeba16a..4bcc15bc9 100644 --- a/vendor.conf +++ b/vendor.conf @@ -34,7 +34,7 @@ golang.org/x/sync 42b317875d0fa942474b76e1b46a6060d720ae6e github.com/BurntSushi/toml v0.3.1 github.com/grpc-ecosystem/go-grpc-prometheus 6b7015e65d366bf3f19b2b2a000a831940f0f7e0 github.com/Microsoft/go-winio v0.4.14 -github.com/Microsoft/hcsshim 8abdbb8205e4192c68b5f84c31197156f31be517 +github.com/Microsoft/hcsshim 9e921883ac929bbe515b39793ece99ce3a9d7706 google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944 golang.org/x/text 19e51611da83d6be54ddafce4a4af510cb3e9ea4 github.com/containerd/ttrpc 1fb3814edf44a76e0ccf503decf726d994919a9a @@ -44,6 +44,8 @@ github.com/google/go-cmp v0.2.0 go.etcd.io/bbolt v1.3.3 github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f +github.com/hashicorp/golang-lru v0.5.1 +go.opencensus.io v0.22.0 # cri dependencies github.com/containerd/cri f1d492b0cdd14e76476ee4dd024696ce3634e501 # master diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go index 90398e40f..e805b3e5f 100644 --- a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go +++ b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go @@ -1,33 +1,19 @@ // Code generated by protoc-gen-gogo. DO NOT EDIT. // source: github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto -/* - Package options is a generated protocol buffer package. - - It is generated from these files: - github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto - - It has these top-level messages: - Options - ProcessDetails -*/ package options -import proto "github.com/gogo/protobuf/proto" -import fmt "fmt" -import math "math" - -// skipping weak import gogoproto "github.com/gogo/protobuf/gogoproto" -import _ "github.com/gogo/protobuf/types" - -import time "time" - -import types "github.com/gogo/protobuf/types" - -import strings "strings" -import reflect "reflect" - -import io "io" +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + _ "github.com/gogo/protobuf/types" + github_com_gogo_protobuf_types "github.com/gogo/protobuf/types" + io "io" + math "math" + reflect "reflect" + strings "strings" + time "time" +) // Reference imports to suppress errors if they are not otherwise used. var _ = proto.Marshal @@ -54,6 +40,7 @@ var Options_DebugType_name = map[int32]string{ 1: "FILE", 2: "ETW", } + var Options_DebugType_value = map[string]int32{ "NPIPE": 0, "FILE": 1, @@ -63,7 +50,10 @@ var Options_DebugType_value = map[string]int32{ func (x Options_DebugType) String() string { return proto.EnumName(Options_DebugType_name, int32(x)) } -func (Options_DebugType) EnumDescriptor() ([]byte, []int) { return fileDescriptorRunhcs, []int{0, 0} } + +func (Options_DebugType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0, 0} +} type Options_SandboxIsolation int32 @@ -76,6 +66,7 @@ var Options_SandboxIsolation_name = map[int32]string{ 0: "PROCESS", 1: "HYPERVISOR", } + var Options_SandboxIsolation_value = map[string]int32{ "PROCESS": 0, "HYPERVISOR": 1, @@ -84,8 +75,9 @@ var Options_SandboxIsolation_value = map[string]int32{ func (x Options_SandboxIsolation) String() string { return proto.EnumName(Options_SandboxIsolation_name, int32(x)) } + func (Options_SandboxIsolation) EnumDescriptor() ([]byte, []int) { - return fileDescriptorRunhcs, []int{0, 1} + return fileDescriptor_b643df6839c75082, []int{0, 1} } // Options are the set of customizations that can be passed at Create time. @@ -109,18 +101,49 @@ type Options struct { SandboxIsolation Options_SandboxIsolation `protobuf:"varint,6,opt,name=sandbox_isolation,json=sandboxIsolation,proto3,enum=containerd.runhcs.v1.Options_SandboxIsolation" json:"sandbox_isolation,omitempty"` // boot_files_root_path is the path to the directory containing the LCOW // kernel and root FS files. - BootFilesRootPath string `protobuf:"bytes,7,opt,name=boot_files_root_path,json=bootFilesRootPath,proto3" json:"boot_files_root_path,omitempty"` + BootFilesRootPath string `protobuf:"bytes,7,opt,name=boot_files_root_path,json=bootFilesRootPath,proto3" json:"boot_files_root_path,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *Options) Reset() { *m = Options{} } -func (*Options) ProtoMessage() {} -func (*Options) Descriptor() ([]byte, []int) { return fileDescriptorRunhcs, []int{0} } +func (m *Options) Reset() { *m = Options{} } +func (*Options) ProtoMessage() {} +func (*Options) Descriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0} +} +func (m *Options) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Options) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Options.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Options) XXX_Merge(src proto.Message) { + xxx_messageInfo_Options.Merge(m, src) +} +func (m *Options) XXX_Size() int { + return m.Size() +} +func (m *Options) XXX_DiscardUnknown() { + xxx_messageInfo_Options.DiscardUnknown(m) +} + +var xxx_messageInfo_Options proto.InternalMessageInfo // ProcessDetails contains additional information about a process. This is the additional // info returned in the Pids query. type ProcessDetails struct { ImageName string `protobuf:"bytes,1,opt,name=image_name,json=imageName,proto3" json:"image_name,omitempty"` - CreatedAt time.Time `protobuf:"bytes,2,opt,name=created_at,json=createdAt,stdtime" json:"created_at"` + CreatedAt time.Time `protobuf:"bytes,2,opt,name=created_at,json=createdAt,proto3,stdtime" json:"created_at"` KernelTime_100Ns uint64 `protobuf:"varint,3,opt,name=kernel_time_100_ns,json=kernelTime100Ns,proto3" json:"kernel_time_100_ns,omitempty"` MemoryCommitBytes uint64 `protobuf:"varint,4,opt,name=memory_commit_bytes,json=memoryCommitBytes,proto3" json:"memory_commit_bytes,omitempty"` MemoryWorkingSetPrivateBytes uint64 `protobuf:"varint,5,opt,name=memory_working_set_private_bytes,json=memoryWorkingSetPrivateBytes,proto3" json:"memory_working_set_private_bytes,omitempty"` @@ -128,18 +151,102 @@ type ProcessDetails struct { ProcessID uint32 `protobuf:"varint,7,opt,name=process_id,json=processId,proto3" json:"process_id,omitempty"` UserTime_100Ns uint64 `protobuf:"varint,8,opt,name=user_time_100_ns,json=userTime100Ns,proto3" json:"user_time_100_ns,omitempty"` ExecID string `protobuf:"bytes,9,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` } -func (m *ProcessDetails) Reset() { *m = ProcessDetails{} } -func (*ProcessDetails) ProtoMessage() {} -func (*ProcessDetails) Descriptor() ([]byte, []int) { return fileDescriptorRunhcs, []int{1} } +func (m *ProcessDetails) Reset() { *m = ProcessDetails{} } +func (*ProcessDetails) ProtoMessage() {} +func (*ProcessDetails) Descriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{1} +} +func (m *ProcessDetails) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *ProcessDetails) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_ProcessDetails.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *ProcessDetails) XXX_Merge(src proto.Message) { + xxx_messageInfo_ProcessDetails.Merge(m, src) +} +func (m *ProcessDetails) XXX_Size() int { + return m.Size() +} +func (m *ProcessDetails) XXX_DiscardUnknown() { + xxx_messageInfo_ProcessDetails.DiscardUnknown(m) +} + +var xxx_messageInfo_ProcessDetails proto.InternalMessageInfo func init() { - proto.RegisterType((*Options)(nil), "containerd.runhcs.v1.Options") - proto.RegisterType((*ProcessDetails)(nil), "containerd.runhcs.v1.ProcessDetails") proto.RegisterEnum("containerd.runhcs.v1.Options_DebugType", Options_DebugType_name, Options_DebugType_value) proto.RegisterEnum("containerd.runhcs.v1.Options_SandboxIsolation", Options_SandboxIsolation_name, Options_SandboxIsolation_value) + proto.RegisterType((*Options)(nil), "containerd.runhcs.v1.Options") + proto.RegisterType((*ProcessDetails)(nil), "containerd.runhcs.v1.ProcessDetails") } + +func init() { + proto.RegisterFile("github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto", fileDescriptor_b643df6839c75082) +} + +var fileDescriptor_b643df6839c75082 = []byte{ + // 704 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xa4, 0x54, 0x4d, 0x6f, 0xda, 0x48, + 0x18, 0xc6, 0xe1, 0xd3, 0x6f, 0x96, 0xc4, 0x99, 0xe5, 0x80, 0xb2, 0xbb, 0x80, 0xc8, 0x21, 0x89, + 0x76, 0x63, 0x43, 0xf6, 0xd8, 0x53, 0x09, 0xa0, 0xba, 0x6a, 0x83, 0x65, 0xa2, 0xa6, 0x1f, 0x07, + 0xcb, 0xd8, 0x83, 0xb1, 0x82, 0x3d, 0xd6, 0xcc, 0x90, 0x86, 0x5b, 0x7f, 0x42, 0x7f, 0x55, 0x95, + 0x63, 0x8f, 0x95, 0x2a, 0xa5, 0x0d, 0xbf, 0xa4, 0x9a, 0xb1, 0x49, 0xd4, 0x28, 0xea, 0xa5, 0x27, + 0xc6, 0xcf, 0xf3, 0xbc, 0xcf, 0xfb, 0x29, 0x60, 0x14, 0x84, 0x7c, 0xb6, 0x98, 0xe8, 0x1e, 0x89, + 0x8c, 0x97, 0xa1, 0x47, 0x09, 0x23, 0x53, 0x6e, 0xcc, 0x3c, 0xc6, 0x66, 0x61, 0x64, 0x78, 0x91, + 0x6f, 0x78, 0x24, 0xe6, 0x6e, 0x18, 0x63, 0xea, 0x1f, 0x09, 0xec, 0x88, 0x2e, 0xe2, 0x99, 0xc7, + 0x8e, 0x2e, 0xbb, 0x06, 0x49, 0x78, 0x48, 0x62, 0x66, 0xa4, 0x88, 0x9e, 0x50, 0xc2, 0x09, 0xaa, + 0xdd, 0xeb, 0xf5, 0x8c, 0xb8, 0xec, 0xee, 0xd6, 0x02, 0x12, 0x10, 0x29, 0x30, 0xc4, 0x2b, 0xd5, + 0xee, 0x36, 0x03, 0x42, 0x82, 0x39, 0x36, 0xe4, 0xd7, 0x64, 0x31, 0x35, 0x78, 0x18, 0x61, 0xc6, + 0xdd, 0x28, 0x49, 0x05, 0xed, 0x4f, 0x79, 0x28, 0x8f, 0xd2, 0x2c, 0xa8, 0x06, 0x45, 0x1f, 0x4f, + 0x16, 0x41, 0x5d, 0x69, 0x29, 0x07, 0x15, 0x3b, 0xfd, 0x40, 0x43, 0x00, 0xf9, 0x70, 0xf8, 0x32, + 0xc1, 0xf5, 0x8d, 0x96, 0x72, 0xb0, 0x75, 0xbc, 0xaf, 0x3f, 0x56, 0x83, 0x9e, 0x19, 0xe9, 0x7d, + 0xa1, 0x3f, 0x5b, 0x26, 0xd8, 0x56, 0xfd, 0xf5, 0x13, 0xed, 0x41, 0x95, 0xe2, 0x20, 0x64, 0x9c, + 0x2e, 0x1d, 0x4a, 0x08, 0xaf, 0xe7, 0x5b, 0xca, 0x81, 0x6a, 0xff, 0xb1, 0x06, 0x6d, 0x42, 0xb8, + 0x10, 0x31, 0x37, 0xf6, 0x27, 0xe4, 0xca, 0x09, 0x23, 0x37, 0xc0, 0xf5, 0x42, 0x2a, 0xca, 0x40, + 0x53, 0x60, 0xe8, 0x10, 0xb4, 0xb5, 0x28, 0x99, 0xbb, 0x7c, 0x4a, 0x68, 0x54, 0x2f, 0x4a, 0xdd, + 0x76, 0x86, 0x5b, 0x19, 0x8c, 0xde, 0xc1, 0xce, 0x9d, 0x1f, 0x23, 0x73, 0x57, 0xd4, 0x57, 0x2f, + 0xc9, 0x1e, 0xf4, 0x5f, 0xf7, 0x30, 0xce, 0x32, 0xae, 0xa3, 0xec, 0x75, 0xce, 0x3b, 0x04, 0x19, + 0x50, 0x9b, 0x10, 0xc2, 0x9d, 0x69, 0x38, 0xc7, 0x4c, 0xf6, 0xe4, 0x24, 0x2e, 0x9f, 0xd5, 0xcb, + 0xb2, 0x96, 0x1d, 0xc1, 0x0d, 0x05, 0x25, 0x3a, 0xb3, 0x5c, 0x3e, 0x6b, 0x1f, 0x82, 0x7a, 0x37, + 0x1a, 0xa4, 0x42, 0xf1, 0xd4, 0x32, 0xad, 0x81, 0x96, 0x43, 0x15, 0x28, 0x0c, 0xcd, 0x17, 0x03, + 0x4d, 0x41, 0x65, 0xc8, 0x0f, 0xce, 0xce, 0xb5, 0x8d, 0xb6, 0x01, 0xda, 0xc3, 0x0a, 0xd0, 0x26, + 0x94, 0x2d, 0x7b, 0x74, 0x32, 0x18, 0x8f, 0xb5, 0x1c, 0xda, 0x02, 0x78, 0xf6, 0xc6, 0x1a, 0xd8, + 0xaf, 0xcc, 0xf1, 0xc8, 0xd6, 0x94, 0xf6, 0xd7, 0x3c, 0x6c, 0x59, 0x94, 0x78, 0x98, 0xb1, 0x3e, + 0xe6, 0x6e, 0x38, 0x67, 0xe8, 0x1f, 0x00, 0x39, 0x44, 0x27, 0x76, 0x23, 0x2c, 0x97, 0xaa, 0xda, + 0xaa, 0x44, 0x4e, 0xdd, 0x08, 0xa3, 0x13, 0x00, 0x8f, 0x62, 0x97, 0x63, 0xdf, 0x71, 0xb9, 0x5c, + 0xec, 0xe6, 0xf1, 0xae, 0x9e, 0x1e, 0x8c, 0xbe, 0x3e, 0x18, 0xfd, 0x6c, 0x7d, 0x30, 0xbd, 0xca, + 0xf5, 0x4d, 0x33, 0xf7, 0xf1, 0x5b, 0x53, 0xb1, 0xd5, 0x2c, 0xee, 0x29, 0x47, 0xff, 0x02, 0xba, + 0xc0, 0x34, 0xc6, 0x73, 0x47, 0x5c, 0x96, 0xd3, 0xed, 0x74, 0x9c, 0x98, 0xc9, 0xd5, 0x16, 0xec, + 0xed, 0x94, 0x11, 0x0e, 0xdd, 0x4e, 0xe7, 0x94, 0x21, 0x1d, 0xfe, 0x8c, 0x70, 0x44, 0xe8, 0xd2, + 0xf1, 0x48, 0x14, 0x85, 0xdc, 0x99, 0x2c, 0x39, 0x66, 0x72, 0xc7, 0x05, 0x7b, 0x27, 0xa5, 0x4e, + 0x24, 0xd3, 0x13, 0x04, 0x1a, 0x42, 0x2b, 0xd3, 0xbf, 0x27, 0xf4, 0x22, 0x8c, 0x03, 0x87, 0x61, + 0xee, 0x24, 0x34, 0xbc, 0x74, 0x39, 0xce, 0x82, 0x8b, 0x32, 0xf8, 0xef, 0x54, 0x77, 0x9e, 0xca, + 0xc6, 0x98, 0x5b, 0xa9, 0x28, 0xf5, 0xe9, 0x43, 0xf3, 0x11, 0x1f, 0x36, 0x73, 0x29, 0xf6, 0x33, + 0x9b, 0x92, 0xb4, 0xf9, 0xeb, 0xa1, 0xcd, 0x58, 0x6a, 0x52, 0x97, 0xff, 0x00, 0x92, 0x74, 0xc0, + 0x4e, 0xe8, 0xcb, 0x25, 0x57, 0x7b, 0xd5, 0xd5, 0x4d, 0x53, 0xcd, 0xc6, 0x6e, 0xf6, 0x6d, 0x35, + 0x13, 0x98, 0x3e, 0xda, 0x07, 0x6d, 0xc1, 0x30, 0xfd, 0x69, 0x2c, 0x15, 0x99, 0xa4, 0x2a, 0xf0, + 0xfb, 0xa1, 0xec, 0x41, 0x19, 0x5f, 0x61, 0x4f, 0x78, 0xaa, 0x62, 0x45, 0x3d, 0x58, 0xdd, 0x34, + 0x4b, 0x83, 0x2b, 0xec, 0x99, 0x7d, 0xbb, 0x24, 0x28, 0xd3, 0xef, 0xf9, 0xd7, 0xb7, 0x8d, 0xdc, + 0x97, 0xdb, 0x46, 0xee, 0xc3, 0xaa, 0xa1, 0x5c, 0xaf, 0x1a, 0xca, 0xe7, 0x55, 0x43, 0xf9, 0xbe, + 0x6a, 0x28, 0x6f, 0x9f, 0xff, 0xfe, 0xdf, 0xcb, 0x93, 0xec, 0xf7, 0x75, 0x6e, 0x52, 0x92, 0x7b, + 0xff, 0xff, 0x47, 0x00, 0x00, 0x00, 0xff, 0xff, 0xa3, 0x9a, 0x54, 0x17, 0xb5, 0x04, 0x00, 0x00, +} + func (m *Options) Marshal() (dAtA []byte, err error) { size := m.Size() dAtA = make([]byte, size) @@ -199,6 +306,9 @@ func (m *Options) MarshalTo(dAtA []byte) (int, error) { i = encodeVarintRunhcs(dAtA, i, uint64(len(m.BootFilesRootPath))) i += copy(dAtA[i:], m.BootFilesRootPath) } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } return i, nil } @@ -225,8 +335,8 @@ func (m *ProcessDetails) MarshalTo(dAtA []byte) (int, error) { } dAtA[i] = 0x12 i++ - i = encodeVarintRunhcs(dAtA, i, uint64(types.SizeOfStdTime(m.CreatedAt))) - n1, err := types.StdTimeMarshalTo(m.CreatedAt, dAtA[i:]) + i = encodeVarintRunhcs(dAtA, i, uint64(github_com_gogo_protobuf_types.SizeOfStdTime(m.CreatedAt))) + n1, err := github_com_gogo_protobuf_types.StdTimeMarshalTo(m.CreatedAt, dAtA[i:]) if err != nil { return 0, err } @@ -267,6 +377,9 @@ func (m *ProcessDetails) MarshalTo(dAtA []byte) (int, error) { i = encodeVarintRunhcs(dAtA, i, uint64(len(m.ExecID))) i += copy(dAtA[i:], m.ExecID) } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } return i, nil } @@ -280,6 +393,9 @@ func encodeVarintRunhcs(dAtA []byte, offset int, v uint64) int { return offset + 1 } func (m *Options) Size() (n int) { + if m == nil { + return 0 + } var l int _ = l if m.Debug { @@ -307,17 +423,23 @@ func (m *Options) Size() (n int) { if l > 0 { n += 1 + l + sovRunhcs(uint64(l)) } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } return n } func (m *ProcessDetails) Size() (n int) { + if m == nil { + return 0 + } var l int _ = l l = len(m.ImageName) if l > 0 { n += 1 + l + sovRunhcs(uint64(l)) } - l = types.SizeOfStdTime(m.CreatedAt) + l = github_com_gogo_protobuf_types.SizeOfStdTime(m.CreatedAt) n += 1 + l + sovRunhcs(uint64(l)) if m.KernelTime_100Ns != 0 { n += 1 + sovRunhcs(uint64(m.KernelTime_100Ns)) @@ -341,6 +463,9 @@ func (m *ProcessDetails) Size() (n int) { if l > 0 { n += 1 + l + sovRunhcs(uint64(l)) } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } return n } @@ -369,6 +494,7 @@ func (this *Options) String() string { `SandboxPlatform:` + fmt.Sprintf("%v", this.SandboxPlatform) + `,`, `SandboxIsolation:` + fmt.Sprintf("%v", this.SandboxIsolation) + `,`, `BootFilesRootPath:` + fmt.Sprintf("%v", this.BootFilesRootPath) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, `}`, }, "") return s @@ -379,7 +505,7 @@ func (this *ProcessDetails) String() string { } s := strings.Join([]string{`&ProcessDetails{`, `ImageName:` + fmt.Sprintf("%v", this.ImageName) + `,`, - `CreatedAt:` + strings.Replace(strings.Replace(this.CreatedAt.String(), "Timestamp", "google_protobuf1.Timestamp", 1), `&`, ``, 1) + `,`, + `CreatedAt:` + strings.Replace(strings.Replace(this.CreatedAt.String(), "Timestamp", "types.Timestamp", 1), `&`, ``, 1) + `,`, `KernelTime_100Ns:` + fmt.Sprintf("%v", this.KernelTime_100Ns) + `,`, `MemoryCommitBytes:` + fmt.Sprintf("%v", this.MemoryCommitBytes) + `,`, `MemoryWorkingSetPrivateBytes:` + fmt.Sprintf("%v", this.MemoryWorkingSetPrivateBytes) + `,`, @@ -387,6 +513,7 @@ func (this *ProcessDetails) String() string { `ProcessID:` + fmt.Sprintf("%v", this.ProcessID) + `,`, `UserTime_100Ns:` + fmt.Sprintf("%v", this.UserTime_100Ns) + `,`, `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, `}`, }, "") return s @@ -414,7 +541,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - wire |= (uint64(b) & 0x7F) << shift + wire |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -442,7 +569,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - v |= (int(b) & 0x7F) << shift + v |= int(b&0x7F) << shift if b < 0x80 { break } @@ -462,7 +589,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.DebugType |= (Options_DebugType(b) & 0x7F) << shift + m.DebugType |= Options_DebugType(b&0x7F) << shift if b < 0x80 { break } @@ -481,7 +608,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - stringLen |= (uint64(b) & 0x7F) << shift + stringLen |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -491,6 +618,9 @@ func (m *Options) Unmarshal(dAtA []byte) error { return ErrInvalidLengthRunhcs } postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } if postIndex > l { return io.ErrUnexpectedEOF } @@ -510,7 +640,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - stringLen |= (uint64(b) & 0x7F) << shift + stringLen |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -520,6 +650,9 @@ func (m *Options) Unmarshal(dAtA []byte) error { return ErrInvalidLengthRunhcs } postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } if postIndex > l { return io.ErrUnexpectedEOF } @@ -539,7 +672,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - stringLen |= (uint64(b) & 0x7F) << shift + stringLen |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -549,6 +682,9 @@ func (m *Options) Unmarshal(dAtA []byte) error { return ErrInvalidLengthRunhcs } postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } if postIndex > l { return io.ErrUnexpectedEOF } @@ -568,7 +704,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.SandboxIsolation |= (Options_SandboxIsolation(b) & 0x7F) << shift + m.SandboxIsolation |= Options_SandboxIsolation(b&0x7F) << shift if b < 0x80 { break } @@ -587,7 +723,7 @@ func (m *Options) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - stringLen |= (uint64(b) & 0x7F) << shift + stringLen |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -597,6 +733,9 @@ func (m *Options) Unmarshal(dAtA []byte) error { return ErrInvalidLengthRunhcs } postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } if postIndex > l { return io.ErrUnexpectedEOF } @@ -611,9 +750,13 @@ func (m *Options) Unmarshal(dAtA []byte) error { if skippy < 0 { return ErrInvalidLengthRunhcs } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthRunhcs + } if (iNdEx + skippy) > l { return io.ErrUnexpectedEOF } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) iNdEx += skippy } } @@ -638,7 +781,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - wire |= (uint64(b) & 0x7F) << shift + wire |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -666,7 +809,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - stringLen |= (uint64(b) & 0x7F) << shift + stringLen |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -676,6 +819,9 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { return ErrInvalidLengthRunhcs } postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } if postIndex > l { return io.ErrUnexpectedEOF } @@ -695,7 +841,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - msglen |= (int(b) & 0x7F) << shift + msglen |= int(b&0x7F) << shift if b < 0x80 { break } @@ -704,10 +850,13 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { return ErrInvalidLengthRunhcs } postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } if postIndex > l { return io.ErrUnexpectedEOF } - if err := types.StdTimeUnmarshal(&m.CreatedAt, dAtA[iNdEx:postIndex]); err != nil { + if err := github_com_gogo_protobuf_types.StdTimeUnmarshal(&m.CreatedAt, dAtA[iNdEx:postIndex]); err != nil { return err } iNdEx = postIndex @@ -725,7 +874,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.KernelTime_100Ns |= (uint64(b) & 0x7F) << shift + m.KernelTime_100Ns |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -744,7 +893,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.MemoryCommitBytes |= (uint64(b) & 0x7F) << shift + m.MemoryCommitBytes |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -763,7 +912,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.MemoryWorkingSetPrivateBytes |= (uint64(b) & 0x7F) << shift + m.MemoryWorkingSetPrivateBytes |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -782,7 +931,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.MemoryWorkingSetSharedBytes |= (uint64(b) & 0x7F) << shift + m.MemoryWorkingSetSharedBytes |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -801,7 +950,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.ProcessID |= (uint32(b) & 0x7F) << shift + m.ProcessID |= uint32(b&0x7F) << shift if b < 0x80 { break } @@ -820,7 +969,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - m.UserTime_100Ns |= (uint64(b) & 0x7F) << shift + m.UserTime_100Ns |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -839,7 +988,7 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { } b := dAtA[iNdEx] iNdEx++ - stringLen |= (uint64(b) & 0x7F) << shift + stringLen |= uint64(b&0x7F) << shift if b < 0x80 { break } @@ -849,6 +998,9 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { return ErrInvalidLengthRunhcs } postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } if postIndex > l { return io.ErrUnexpectedEOF } @@ -863,9 +1015,13 @@ func (m *ProcessDetails) Unmarshal(dAtA []byte) error { if skippy < 0 { return ErrInvalidLengthRunhcs } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthRunhcs + } if (iNdEx + skippy) > l { return io.ErrUnexpectedEOF } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) iNdEx += skippy } } @@ -929,10 +1085,13 @@ func skipRunhcs(dAtA []byte) (n int, err error) { break } } - iNdEx += length if length < 0 { return 0, ErrInvalidLengthRunhcs } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthRunhcs + } return iNdEx, nil case 3: for { @@ -961,6 +1120,9 @@ func skipRunhcs(dAtA []byte) (n int, err error) { return 0, err } iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthRunhcs + } } return iNdEx, nil case 4: @@ -979,55 +1141,3 @@ var ( ErrInvalidLengthRunhcs = fmt.Errorf("proto: negative length found during unmarshaling") ErrIntOverflowRunhcs = fmt.Errorf("proto: integer overflow") ) - -func init() { - proto.RegisterFile("github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto", fileDescriptorRunhcs) -} - -var fileDescriptorRunhcs = []byte{ - // 704 bytes of a gzipped FileDescriptorProto - 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xa4, 0x54, 0x4d, 0x6f, 0xda, 0x48, - 0x18, 0xc6, 0xe1, 0xd3, 0x6f, 0x96, 0xc4, 0x99, 0xe5, 0x80, 0xb2, 0xbb, 0x80, 0xc8, 0x21, 0x89, - 0x76, 0x63, 0x43, 0xf6, 0xd8, 0x53, 0x09, 0xa0, 0xba, 0x6a, 0x83, 0x65, 0xa2, 0xa6, 0x1f, 0x07, - 0xcb, 0xd8, 0x83, 0xb1, 0x82, 0x3d, 0xd6, 0xcc, 0x90, 0x86, 0x5b, 0x7f, 0x42, 0x7f, 0x55, 0x95, - 0x63, 0x8f, 0x95, 0x2a, 0xa5, 0x0d, 0xbf, 0xa4, 0x9a, 0xb1, 0x49, 0xd4, 0x28, 0xea, 0xa5, 0x27, - 0xc6, 0xcf, 0xf3, 0xbc, 0xcf, 0xfb, 0x29, 0x60, 0x14, 0x84, 0x7c, 0xb6, 0x98, 0xe8, 0x1e, 0x89, - 0x8c, 0x97, 0xa1, 0x47, 0x09, 0x23, 0x53, 0x6e, 0xcc, 0x3c, 0xc6, 0x66, 0x61, 0x64, 0x78, 0x91, - 0x6f, 0x78, 0x24, 0xe6, 0x6e, 0x18, 0x63, 0xea, 0x1f, 0x09, 0xec, 0x88, 0x2e, 0xe2, 0x99, 0xc7, - 0x8e, 0x2e, 0xbb, 0x06, 0x49, 0x78, 0x48, 0x62, 0x66, 0xa4, 0x88, 0x9e, 0x50, 0xc2, 0x09, 0xaa, - 0xdd, 0xeb, 0xf5, 0x8c, 0xb8, 0xec, 0xee, 0xd6, 0x02, 0x12, 0x10, 0x29, 0x30, 0xc4, 0x2b, 0xd5, - 0xee, 0x36, 0x03, 0x42, 0x82, 0x39, 0x36, 0xe4, 0xd7, 0x64, 0x31, 0x35, 0x78, 0x18, 0x61, 0xc6, - 0xdd, 0x28, 0x49, 0x05, 0xed, 0x4f, 0x79, 0x28, 0x8f, 0xd2, 0x2c, 0xa8, 0x06, 0x45, 0x1f, 0x4f, - 0x16, 0x41, 0x5d, 0x69, 0x29, 0x07, 0x15, 0x3b, 0xfd, 0x40, 0x43, 0x00, 0xf9, 0x70, 0xf8, 0x32, - 0xc1, 0xf5, 0x8d, 0x96, 0x72, 0xb0, 0x75, 0xbc, 0xaf, 0x3f, 0x56, 0x83, 0x9e, 0x19, 0xe9, 0x7d, - 0xa1, 0x3f, 0x5b, 0x26, 0xd8, 0x56, 0xfd, 0xf5, 0x13, 0xed, 0x41, 0x95, 0xe2, 0x20, 0x64, 0x9c, - 0x2e, 0x1d, 0x4a, 0x08, 0xaf, 0xe7, 0x5b, 0xca, 0x81, 0x6a, 0xff, 0xb1, 0x06, 0x6d, 0x42, 0xb8, - 0x10, 0x31, 0x37, 0xf6, 0x27, 0xe4, 0xca, 0x09, 0x23, 0x37, 0xc0, 0xf5, 0x42, 0x2a, 0xca, 0x40, - 0x53, 0x60, 0xe8, 0x10, 0xb4, 0xb5, 0x28, 0x99, 0xbb, 0x7c, 0x4a, 0x68, 0x54, 0x2f, 0x4a, 0xdd, - 0x76, 0x86, 0x5b, 0x19, 0x8c, 0xde, 0xc1, 0xce, 0x9d, 0x1f, 0x23, 0x73, 0x57, 0xd4, 0x57, 0x2f, - 0xc9, 0x1e, 0xf4, 0x5f, 0xf7, 0x30, 0xce, 0x32, 0xae, 0xa3, 0xec, 0x75, 0xce, 0x3b, 0x04, 0x19, - 0x50, 0x9b, 0x10, 0xc2, 0x9d, 0x69, 0x38, 0xc7, 0x4c, 0xf6, 0xe4, 0x24, 0x2e, 0x9f, 0xd5, 0xcb, - 0xb2, 0x96, 0x1d, 0xc1, 0x0d, 0x05, 0x25, 0x3a, 0xb3, 0x5c, 0x3e, 0x6b, 0x1f, 0x82, 0x7a, 0x37, - 0x1a, 0xa4, 0x42, 0xf1, 0xd4, 0x32, 0xad, 0x81, 0x96, 0x43, 0x15, 0x28, 0x0c, 0xcd, 0x17, 0x03, - 0x4d, 0x41, 0x65, 0xc8, 0x0f, 0xce, 0xce, 0xb5, 0x8d, 0xb6, 0x01, 0xda, 0xc3, 0x0a, 0xd0, 0x26, - 0x94, 0x2d, 0x7b, 0x74, 0x32, 0x18, 0x8f, 0xb5, 0x1c, 0xda, 0x02, 0x78, 0xf6, 0xc6, 0x1a, 0xd8, - 0xaf, 0xcc, 0xf1, 0xc8, 0xd6, 0x94, 0xf6, 0xd7, 0x3c, 0x6c, 0x59, 0x94, 0x78, 0x98, 0xb1, 0x3e, - 0xe6, 0x6e, 0x38, 0x67, 0xe8, 0x1f, 0x00, 0x39, 0x44, 0x27, 0x76, 0x23, 0x2c, 0x97, 0xaa, 0xda, - 0xaa, 0x44, 0x4e, 0xdd, 0x08, 0xa3, 0x13, 0x00, 0x8f, 0x62, 0x97, 0x63, 0xdf, 0x71, 0xb9, 0x5c, - 0xec, 0xe6, 0xf1, 0xae, 0x9e, 0x1e, 0x8c, 0xbe, 0x3e, 0x18, 0xfd, 0x6c, 0x7d, 0x30, 0xbd, 0xca, - 0xf5, 0x4d, 0x33, 0xf7, 0xf1, 0x5b, 0x53, 0xb1, 0xd5, 0x2c, 0xee, 0x29, 0x47, 0xff, 0x02, 0xba, - 0xc0, 0x34, 0xc6, 0x73, 0x47, 0x5c, 0x96, 0xd3, 0xed, 0x74, 0x9c, 0x98, 0xc9, 0xd5, 0x16, 0xec, - 0xed, 0x94, 0x11, 0x0e, 0xdd, 0x4e, 0xe7, 0x94, 0x21, 0x1d, 0xfe, 0x8c, 0x70, 0x44, 0xe8, 0xd2, - 0xf1, 0x48, 0x14, 0x85, 0xdc, 0x99, 0x2c, 0x39, 0x66, 0x72, 0xc7, 0x05, 0x7b, 0x27, 0xa5, 0x4e, - 0x24, 0xd3, 0x13, 0x04, 0x1a, 0x42, 0x2b, 0xd3, 0xbf, 0x27, 0xf4, 0x22, 0x8c, 0x03, 0x87, 0x61, - 0xee, 0x24, 0x34, 0xbc, 0x74, 0x39, 0xce, 0x82, 0x8b, 0x32, 0xf8, 0xef, 0x54, 0x77, 0x9e, 0xca, - 0xc6, 0x98, 0x5b, 0xa9, 0x28, 0xf5, 0xe9, 0x43, 0xf3, 0x11, 0x1f, 0x36, 0x73, 0x29, 0xf6, 0x33, - 0x9b, 0x92, 0xb4, 0xf9, 0xeb, 0xa1, 0xcd, 0x58, 0x6a, 0x52, 0x97, 0xff, 0x00, 0x92, 0x74, 0xc0, - 0x4e, 0xe8, 0xcb, 0x25, 0x57, 0x7b, 0xd5, 0xd5, 0x4d, 0x53, 0xcd, 0xc6, 0x6e, 0xf6, 0x6d, 0x35, - 0x13, 0x98, 0x3e, 0xda, 0x07, 0x6d, 0xc1, 0x30, 0xfd, 0x69, 0x2c, 0x15, 0x99, 0xa4, 0x2a, 0xf0, - 0xfb, 0xa1, 0xec, 0x41, 0x19, 0x5f, 0x61, 0x4f, 0x78, 0xaa, 0x62, 0x45, 0x3d, 0x58, 0xdd, 0x34, - 0x4b, 0x83, 0x2b, 0xec, 0x99, 0x7d, 0xbb, 0x24, 0x28, 0xd3, 0xef, 0xf9, 0xd7, 0xb7, 0x8d, 0xdc, - 0x97, 0xdb, 0x46, 0xee, 0xc3, 0xaa, 0xa1, 0x5c, 0xaf, 0x1a, 0xca, 0xe7, 0x55, 0x43, 0xf9, 0xbe, - 0x6a, 0x28, 0x6f, 0x9f, 0xff, 0xfe, 0xdf, 0xcb, 0x93, 0xec, 0xf7, 0x75, 0x6e, 0x52, 0x92, 0x7b, - 0xff, 0xff, 0x47, 0x00, 0x00, 0x00, 0xff, 0xff, 0xa3, 0x9a, 0x54, 0x17, 0xb5, 0x04, 0x00, 0x00, -} diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c3154..53c0a3854 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcessNoStdio(c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 000000000..85c3ada77 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,35 @@ +module github.com/Microsoft/hcsshim + +go 1.12 + +require ( + github.com/Microsoft/go-winio v0.4.14 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v0.0.0-20190214164719-faec567304bb + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20180920185216-2a805f718635 + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.0.0-20190207185410-29686dbc5559 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c4..09b3860a7 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 000000000..c0158269f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,80 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfef..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c030..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4b..62ba81751 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b56535..9a4705a49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbcf..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a2..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 93a7831f4..d366f629f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,52 +1,45 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields - - waitBlock chan struct{} - waitError error + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -62,7 +55,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -90,134 +83,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // waitBackground waits for the process exit notification. Once received sets -// `process.waitError` (if any) and unblocks all `Wait` and `WaitTimeout` calls. +// `process.waitError` (if any) and unblocks all `Wait` calls. // -// This MUST be called exactly once per `process.handle` but `Wait` and -// `WaitTimeout` are safe to call multiple times. +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. func (process *Process) waitBackground() { - process.waitError = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) - close(process.waitBlock) + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) + + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } + } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") + + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) + }) + oc.SetSpanStatus(span, err) } // Wait waits for the process to exit. If the process has already exited returns // the pervious error (if any). -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - +func (process *Process) Wait() error { <-process.waitBlock - if process.waitError != nil { - return makeProcessError(process, operation, err, nil) - } - return nil -} - -// WaitTimeout waits for the process to exit or the duration to elapse. If the -// process has already exited returns the pervious error (if any). If a timeout -// occurs returns `ErrTimeout`. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - select { - case <-process.waitBlock: - if process.waitError != nil { - return makeProcessError(process, operation, process.waitError, nil) - } - return nil - case <-time.After(timeout): - return makeProcessError(process, operation, ErrTimeout, nil) - } + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -236,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -248,109 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return -1, makeProcessError(process, operation, err, nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - if properties.Exited == false { - return -1, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - logrus.WithFields(logrus.Fields{ - logfields.ContainerID: process.SystemID(), - logfields.ProcessID: process.processID, - "wait-result": properties.LastWaitResult, - }).Warn("hcsshim::Process::ExitCode - Non-zero last wait result") - return -1, nil - } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; but this function can only +// be called once on each Process. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -358,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -384,93 +334,113 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + if process.stdin != nil { + process.stdin.Close() + } return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + if process.stdin != nil { + process.stdin.Close() + } + if process.stdout != nil { + process.stdout.Close() + } + if process.stderr != nil { + process.stderr.Close() + } + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() delete(callbackMap, callbackNumber) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 4af30ae40..f7d4ba87a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,23 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,53 +43,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error - waitBlock chan struct{} - waitError error + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, + id: id, waitBlock: make(chan struct{}), } } -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) -} - // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -93,129 +82,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - go computeSystem.waitBackground() - + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() - - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } go computeSystem.waitBackground() - + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) + if err != nil { + return err + } + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" + } + return nil +} + +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" +} + // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -223,16 +197,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -261,13 +240,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -278,270 +254,258 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) || IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } // waitBackground waits for the compute system exit notification. Once received -// sets `computeSystem.waitError` (if any) and unblocks all `Wait`, -// `WaitExpectedError`, and `WaitTimeout` calls. +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. // -// This MUST be called exactly once per `computeSystem.handle` but `Wait`, -// `WaitExpectedError`, and `WaitTimeout` are safe to call multiple times. +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. func (computeSystem *System) waitBackground() { - computeSystem.waitError = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - close(computeSystem.waitBlock) + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) + }) + oc.SetSpanStatus(span, err) } // Wait synchronously waits for the compute system to shutdown or terminate. If // the compute system has already exited returns the previous error (if any). -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - +func (computeSystem *System) Wait() error { <-computeSystem.waitBlock - if computeSystem.waitError != nil { - return makeSystemError(computeSystem, "Wait", "", computeSystem.waitError, nil) - } - - return nil + return computeSystem.waitError } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate and returns the error (if any) as long as it does not match -// `expected`. If the compute system has already exited returns the previous -// error (if any) as long as it does not match `expected`. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - <-computeSystem.waitBlock - if computeSystem.waitError != nil && getInnerError(computeSystem.waitError) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", computeSystem.waitError, nil) - } - return nil -} - -// WaitTimeout synchronously waits for the compute system to terminate or the -// duration to elapse. If the timeout expires, `IsTimeout(err) == true`. If -// the compute system has already exited returns the previous error (if any). -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { select { case <-computeSystem.waitBlock: if computeSystem.waitError != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", computeSystem.waitError, nil) + return computeSystem.waitError } - return nil - case <-time.After(timeout): - return makeSystemError(computeSystem, "WaitTimeout", "", ErrTimeout, nil) + return computeSystem.exitError + default: + return errors.New("container not exited") } } -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Properties" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") - - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, +// CreateProcessNoStdio launches a new process within the computeSystem. The +// Stdio handles are not cached on the process struct. +func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) { + operation := "hcsshim::System::CreateProcessNoStdio" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + // We don't do anything with these handles. Close them so they don't leak. + syscall.Close(processInfo.StdInput) + syscall.Close(processInfo.StdOutput) + syscall.Close(processInfo.StdError) + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() + + return process, nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + process.Close() + } + }() + + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } go process.waitBackground() @@ -549,38 +513,25 @@ func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } go process.waitBackground() @@ -589,68 +540,72 @@ func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -658,12 +613,12 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() delete(callbackMap, callbackNumber) @@ -675,36 +630,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index c7d660cc7..f07f532c1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,25 +1,26 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() if _, ok := callbackMap[callbackNumber]; !ok { callbackMapLock.RUnlock() - logrus.Errorf("failed to waitForNotification: callbackNumber %d does not exist in callbackMap", callbackNumber) + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") return ErrHandleClose } channels := callbackMap[callbackNumber].channels @@ -27,7 +28,7 @@ func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotific expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed3187..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = (args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004c..6a1c41e15 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b263..2df4a57f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029e..922f7c679 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 000000000..ba6b1a4a5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 000000000..f428bdaf7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 000000000..fee4765cb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go index 3015c3640..2f39e5845 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go @@ -10,7 +10,7 @@ import ( "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // ContainerState represents the platform agnostic pieces relating to a diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ace..fb23617f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc2..bcfeb34d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779eab..c1ea3953b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707a..b4f9c315b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d5..8bf8cab60 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d285..10cea67e0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d9..1d5dfe68a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -} \ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe5..68aa04a57 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28bc..4fb231076 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e21..1fd7ca5d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c571..781a88401 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f71..85450c41e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe4..fe86cab65 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa76735..af8280048 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c3..8838519a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c5..ea3084bca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8dd..23b2ee9e7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c1..a017691f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef12..176c49d49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3b..9b86a4045 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604a..208074e9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3a..ec93d004e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dffd..b2c2a05a0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,7 +10,6 @@ package hcsschema type MemoryInformationForVm struct { - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f6..625bc8bbe 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,7 +11,6 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c2..a9c750b34 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827c..e5ea187a2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d179..d96c9501f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae2..21707a88e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e1..29d8c8012 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8f..e9a662dd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d0..e4ed095c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c55734..82b0d0532 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d150..ad9a4fa9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b0245..bb24e88da 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e7356..21fe46062 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e57..41f83a545 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,7 +11,6 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f6..ac7f87000 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -10,7 +10,6 @@ package hcsschema type Properties struct { - Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffdf..877e13503 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - PropertyTypes []string `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e453128..8d5f5c171 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc8..006906f6e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc60..26fde99c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f4841..3f203176c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6cd..df9baa921 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba7..825b71865 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7d..f67b08eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8a..5eaf6a7f4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93b..aedcd1c16 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,7 +15,6 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df1..9c5e6eb53 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d7..092ed6605 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,7 +11,6 @@ package hcsschema // Storage runtime statistics type StorageStats struct { - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c823..834869940 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f9..0e48ece50 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2bc..3ab409d82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d12..2abfccca3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e5606..ec5d0fb93 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8ec..91a3c83d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444a..70cf2d90d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a7..362df363e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a42..915e9b638 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279d..75196bd8c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f628667..6a09c0310 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,7 +10,6 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc8..8ed7e566d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 000000000..9e4f9d42b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,563 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go similarity index 81% rename from vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc87..0f2a69f6a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bedc..443596fba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a07..06671309d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf65..a259c1b82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd8..04cb4e7ab 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bbd..f60ba5501 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/runhcs_create-scratch.go b/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/runhcs_create-scratch.go index 3b53b3990..720386c27 100644 --- a/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/runhcs_create-scratch.go +++ b/vendor/github.com/Microsoft/hcsshim/pkg/go-runhcs/runhcs_create-scratch.go @@ -2,9 +2,53 @@ package runhcs import ( "context" + "errors" + "path/filepath" + "strconv" ) // CreateScratch creates a scratch vhdx at 'destpath' that is ext4 formatted. func (r *Runhcs) CreateScratch(context context.Context, destpath string) error { - return r.runOrError(r.command(context, "create-scratch", "--destpath", destpath)) + return r.CreateScratchWithOpts(context, destpath, nil) +} + +// CreateScratchOpts is the set of options that can be used with the +// `CreateScratchWithOpts` command. +type CreateScratchOpts struct { + // SizeGB is the size in GB of the scratch file to create. + SizeGB int + // CacheFile is the path to an existing `scratch.vhx` to copy. If + // `CacheFile` does not exit the scratch will be created. + CacheFile string +} + +func (opt *CreateScratchOpts) args() ([]string, error) { + var out []string + if opt.SizeGB < 0 { + return nil, errors.New("sizeGB must be >= 0") + } else if opt.SizeGB > 0 { + out = append(out, "--sizeGB", strconv.Itoa(opt.SizeGB)) + } + if opt.CacheFile != "" { + abs, err := filepath.Abs(opt.CacheFile) + if err != nil { + return nil, err + } + out = append(out, "--cache-path", abs) + } + return out, nil +} + +// CreateScratchWithOpts creates a scratch vhdx at 'destpath' that is ext4 +// formatted based on `opts`. +func (r *Runhcs) CreateScratchWithOpts(context context.Context, destpath string, opts *CreateScratchOpts) error { + args := []string{"create-scratch", "--destpath", destpath} + if opts != nil { + oargs, err := opts.args() + if err != nil { + return err + } + args = append(args, oargs...) + } + return r.runOrError(r.command(context, args...)) } diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7c..3362c6833 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index bb25ae707..000000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,33 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/containerd faec567304bbdf6864b1663d4f813641b5880a4a -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/containerd/ttrpc 2a805f71863501300ae1976d29f0454ae003e85a -github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40 -github.com/gogo/protobuf v1.0.0 -github.com/golang/protobuf v1.1.0 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio c599b533b43b1363d7d7c6cfda5ede70ed73ff13 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7 -github.com/opencontainers/runc 12f6a991201fdb8f82579582d5e00e28fba06d0a -github.com/opencontainers/runtime-spec 29686dbc5559d93fb1ef402eeda3e35c38d75af4 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/net ed066c81e75eba56dd9bd2139ade88125b855585 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb -golang.org/x/text d14c52b222ee852cdba8b07206ca0c614b389876 -google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944 -google.golang.org/grpc v1.12.0 -k8s.io/kubernetes v1.13.0 diff --git a/vendor/github.com/hashicorp/golang-lru/LICENSE b/vendor/github.com/hashicorp/golang-lru/LICENSE new file mode 100644 index 000000000..be2cc4dfb --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/LICENSE @@ -0,0 +1,362 @@ +Mozilla Public License, version 2.0 + +1. Definitions + +1.1. "Contributor" + + means each individual or legal entity that creates, contributes to the + creation of, or owns Covered Software. + +1.2. "Contributor Version" + + means the combination of the Contributions of others (if any) used by a + Contributor and that particular Contributor's Contribution. + +1.3. "Contribution" + + means Covered Software of a particular Contributor. + +1.4. "Covered Software" + + means Source Code Form to which the initial Contributor has attached the + notice in Exhibit A, the Executable Form of such Source Code Form, and + Modifications of such Source Code Form, in each case including portions + thereof. + +1.5. "Incompatible With Secondary Licenses" + means + + a. that the initial Contributor has attached the notice described in + Exhibit B to the Covered Software; or + + b. that the Covered Software was made available under the terms of + version 1.1 or earlier of the License, but not also under the terms of + a Secondary License. + +1.6. "Executable Form" + + means any form of the work other than Source Code Form. + +1.7. "Larger Work" + + means a work that combines Covered Software with other material, in a + separate file or files, that is not Covered Software. + +1.8. "License" + + means this document. + +1.9. "Licensable" + + means having the right to grant, to the maximum extent possible, whether + at the time of the initial grant or subsequently, any and all of the + rights conveyed by this License. + +1.10. "Modifications" + + means any of the following: + + a. any file in Source Code Form that results from an addition to, + deletion from, or modification of the contents of Covered Software; or + + b. any new file in Source Code Form that contains any Covered Software. + +1.11. "Patent Claims" of a Contributor + + means any patent claim(s), including without limitation, method, + process, and apparatus claims, in any patent Licensable by such + Contributor that would be infringed, but for the grant of the License, + by the making, using, selling, offering for sale, having made, import, + or transfer of either its Contributions or its Contributor Version. + +1.12. "Secondary License" + + means either the GNU General Public License, Version 2.0, the GNU Lesser + General Public License, Version 2.1, the GNU Affero General Public + License, Version 3.0, or any later versions of those licenses. + +1.13. "Source Code Form" + + means the form of the work preferred for making modifications. + +1.14. "You" (or "Your") + + means an individual or a legal entity exercising rights under this + License. For legal entities, "You" includes any entity that controls, is + controlled by, or is under common control with You. For purposes of this + definition, "control" means (a) the power, direct or indirect, to cause + the direction or management of such entity, whether by contract or + otherwise, or (b) ownership of more than fifty percent (50%) of the + outstanding shares or beneficial ownership of such entity. + + +2. License Grants and Conditions + +2.1. Grants + + Each Contributor hereby grants You a world-wide, royalty-free, + non-exclusive license: + + a. under intellectual property rights (other than patent or trademark) + Licensable by such Contributor to use, reproduce, make available, + modify, display, perform, distribute, and otherwise exploit its + Contributions, either on an unmodified basis, with Modifications, or + as part of a Larger Work; and + + b. under Patent Claims of such Contributor to make, use, sell, offer for + sale, have made, import, and otherwise transfer either its + Contributions or its Contributor Version. + +2.2. Effective Date + + The licenses granted in Section 2.1 with respect to any Contribution + become effective for each Contribution on the date the Contributor first + distributes such Contribution. + +2.3. Limitations on Grant Scope + + The licenses granted in this Section 2 are the only rights granted under + this License. No additional rights or licenses will be implied from the + distribution or licensing of Covered Software under this License. + Notwithstanding Section 2.1(b) above, no patent license is granted by a + Contributor: + + a. for any code that a Contributor has removed from Covered Software; or + + b. for infringements caused by: (i) Your and any other third party's + modifications of Covered Software, or (ii) the combination of its + Contributions with other software (except as part of its Contributor + Version); or + + c. under Patent Claims infringed by Covered Software in the absence of + its Contributions. + + This License does not grant any rights in the trademarks, service marks, + or logos of any Contributor (except as may be necessary to comply with + the notice requirements in Section 3.4). + +2.4. Subsequent Licenses + + No Contributor makes additional grants as a result of Your choice to + distribute the Covered Software under a subsequent version of this + License (see Section 10.2) or under the terms of a Secondary License (if + permitted under the terms of Section 3.3). + +2.5. Representation + + Each Contributor represents that the Contributor believes its + Contributions are its original creation(s) or it has sufficient rights to + grant the rights to its Contributions conveyed by this License. + +2.6. Fair Use + + This License is not intended to limit any rights You have under + applicable copyright doctrines of fair use, fair dealing, or other + equivalents. + +2.7. Conditions + + Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted in + Section 2.1. + + +3. Responsibilities + +3.1. Distribution of Source Form + + All distribution of Covered Software in Source Code Form, including any + Modifications that You create or to which You contribute, must be under + the terms of this License. You must inform recipients that the Source + Code Form of the Covered Software is governed by the terms of this + License, and how they can obtain a copy of this License. You may not + attempt to alter or restrict the recipients' rights in the Source Code + Form. + +3.2. Distribution of Executable Form + + If You distribute Covered Software in Executable Form then: + + a. such Covered Software must also be made available in Source Code Form, + as described in Section 3.1, and You must inform recipients of the + Executable Form how they can obtain a copy of such Source Code Form by + reasonable means in a timely manner, at a charge no more than the cost + of distribution to the recipient; and + + b. You may distribute such Executable Form under the terms of this + License, or sublicense it under different terms, provided that the + license for the Executable Form does not attempt to limit or alter the + recipients' rights in the Source Code Form under this License. + +3.3. Distribution of a Larger Work + + You may create and distribute a Larger Work under terms of Your choice, + provided that You also comply with the requirements of this License for + the Covered Software. If the Larger Work is a combination of Covered + Software with a work governed by one or more Secondary Licenses, and the + Covered Software is not Incompatible With Secondary Licenses, this + License permits You to additionally distribute such Covered Software + under the terms of such Secondary License(s), so that the recipient of + the Larger Work may, at their option, further distribute the Covered + Software under the terms of either this License or such Secondary + License(s). + +3.4. Notices + + You may not remove or alter the substance of any license notices + (including copyright notices, patent notices, disclaimers of warranty, or + limitations of liability) contained within the Source Code Form of the + Covered Software, except that You may alter any license notices to the + extent required to remedy known factual inaccuracies. + +3.5. Application of Additional Terms + + You may choose to offer, and to charge a fee for, warranty, support, + indemnity or liability obligations to one or more recipients of Covered + Software. However, You may do so only on Your own behalf, and not on + behalf of any Contributor. You must make it absolutely clear that any + such warranty, support, indemnity, or liability obligation is offered by + You alone, and You hereby agree to indemnify every Contributor for any + liability incurred by such Contributor as a result of warranty, support, + indemnity or liability terms You offer. You may include additional + disclaimers of warranty and limitations of liability specific to any + jurisdiction. + +4. Inability to Comply Due to Statute or Regulation + + If it is impossible for You to comply with any of the terms of this License + with respect to some or all of the Covered Software due to statute, + judicial order, or regulation then You must: (a) comply with the terms of + this License to the maximum extent possible; and (b) describe the + limitations and the code they affect. Such description must be placed in a + text file included with all distributions of the Covered Software under + this License. Except to the extent prohibited by statute or regulation, + such description must be sufficiently detailed for a recipient of ordinary + skill to be able to understand it. + +5. Termination + +5.1. The rights granted under this License will terminate automatically if You + fail to comply with any of its terms. However, if You become compliant, + then the rights granted under this License from a particular Contributor + are reinstated (a) provisionally, unless and until such Contributor + explicitly and finally terminates Your grants, and (b) on an ongoing + basis, if such Contributor fails to notify You of the non-compliance by + some reasonable means prior to 60 days after You have come back into + compliance. Moreover, Your grants from a particular Contributor are + reinstated on an ongoing basis if such Contributor notifies You of the + non-compliance by some reasonable means, this is the first time You have + received notice of non-compliance with this License from such + Contributor, and You become compliant prior to 30 days after Your receipt + of the notice. + +5.2. If You initiate litigation against any entity by asserting a patent + infringement claim (excluding declaratory judgment actions, + counter-claims, and cross-claims) alleging that a Contributor Version + directly or indirectly infringes any patent, then the rights granted to + You by any and all Contributors for the Covered Software under Section + 2.1 of this License shall terminate. + +5.3. In the event of termination under Sections 5.1 or 5.2 above, all end user + license agreements (excluding distributors and resellers) which have been + validly granted by You or Your distributors under this License prior to + termination shall survive termination. + +6. Disclaimer of Warranty + + Covered Software is provided under this License on an "as is" basis, + without warranty of any kind, either expressed, implied, or statutory, + including, without limitation, warranties that the Covered Software is free + of defects, merchantable, fit for a particular purpose or non-infringing. + The entire risk as to the quality and performance of the Covered Software + is with You. Should any Covered Software prove defective in any respect, + You (not any Contributor) assume the cost of any necessary servicing, + repair, or correction. This disclaimer of warranty constitutes an essential + part of this License. No use of any Covered Software is authorized under + this License except under this disclaimer. + +7. Limitation of Liability + + Under no circumstances and under no legal theory, whether tort (including + negligence), contract, or otherwise, shall any Contributor, or anyone who + distributes Covered Software as permitted above, be liable to You for any + direct, indirect, special, incidental, or consequential damages of any + character including, without limitation, damages for lost profits, loss of + goodwill, work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses, even if such party shall have been + informed of the possibility of such damages. This limitation of liability + shall not apply to liability for death or personal injury resulting from + such party's negligence to the extent applicable law prohibits such + limitation. Some jurisdictions do not allow the exclusion or limitation of + incidental or consequential damages, so this exclusion and limitation may + not apply to You. + +8. Litigation + + Any litigation relating to this License may be brought only in the courts + of a jurisdiction where the defendant maintains its principal place of + business and such litigation shall be governed by laws of that + jurisdiction, without reference to its conflict-of-law provisions. Nothing + in this Section shall prevent a party's ability to bring cross-claims or + counter-claims. + +9. Miscellaneous + + This License represents the complete agreement concerning the subject + matter hereof. If any provision of this License is held to be + unenforceable, such provision shall be reformed only to the extent + necessary to make it enforceable. Any law or regulation which provides that + the language of a contract shall be construed against the drafter shall not + be used to construe this License against a Contributor. + + +10. Versions of the License + +10.1. New Versions + + Mozilla Foundation is the license steward. Except as provided in Section + 10.3, no one other than the license steward has the right to modify or + publish new versions of this License. Each version will be given a + distinguishing version number. + +10.2. Effect of New Versions + + You may distribute the Covered Software under the terms of the version + of the License under which You originally received the Covered Software, + or under the terms of any subsequent version published by the license + steward. + +10.3. Modified Versions + + If you create software not governed by this License, and you want to + create a new license for such software, you may create and use a + modified version of this License if you rename the license and remove + any references to the name of the license steward (except to note that + such modified license differs from this License). + +10.4. Distributing Source Code Form that is Incompatible With Secondary + Licenses If You choose to distribute Source Code Form that is + Incompatible With Secondary Licenses under the terms of this version of + the License, the notice described in Exhibit B of this License must be + attached. + +Exhibit A - Source Code Form License Notice + + This Source Code Form is subject to the + terms of the Mozilla Public License, v. + 2.0. If a copy of the MPL was not + distributed with this file, You can + obtain one at + http://mozilla.org/MPL/2.0/. + +If it is not possible or desirable to put the notice in a particular file, +then You may include the notice in a location (such as a LICENSE file in a +relevant directory) where a recipient would be likely to look for such a +notice. + +You may add additional accurate notices of copyright ownership. + +Exhibit B - "Incompatible With Secondary Licenses" Notice + + This Source Code Form is "Incompatible + With Secondary Licenses", as defined by + the Mozilla Public License, v. 2.0. diff --git a/vendor/github.com/hashicorp/golang-lru/README.md b/vendor/github.com/hashicorp/golang-lru/README.md new file mode 100644 index 000000000..33e58cfaf --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/README.md @@ -0,0 +1,25 @@ +golang-lru +========== + +This provides the `lru` package which implements a fixed-size +thread safe LRU cache. It is based on the cache in Groupcache. + +Documentation +============= + +Full docs are available on [Godoc](http://godoc.org/github.com/hashicorp/golang-lru) + +Example +======= + +Using the LRU is very simple: + +```go +l, _ := New(128) +for i := 0; i < 256; i++ { + l.Add(i, nil) +} +if l.Len() != 128 { + panic(fmt.Sprintf("bad len: %v", l.Len())) +} +``` diff --git a/vendor/github.com/hashicorp/golang-lru/go.mod b/vendor/github.com/hashicorp/golang-lru/go.mod new file mode 100644 index 000000000..824cb97e8 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/go.mod @@ -0,0 +1 @@ +module github.com/hashicorp/golang-lru diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go new file mode 100644 index 000000000..5673773b2 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go @@ -0,0 +1,161 @@ +package simplelru + +import ( + "container/list" + "errors" +) + +// EvictCallback is used to get a callback when a cache entry is evicted +type EvictCallback func(key interface{}, value interface{}) + +// LRU implements a non-thread safe fixed size LRU cache +type LRU struct { + size int + evictList *list.List + items map[interface{}]*list.Element + onEvict EvictCallback +} + +// entry is used to hold a value in the evictList +type entry struct { + key interface{} + value interface{} +} + +// NewLRU constructs an LRU of the given size +func NewLRU(size int, onEvict EvictCallback) (*LRU, error) { + if size <= 0 { + return nil, errors.New("Must provide a positive size") + } + c := &LRU{ + size: size, + evictList: list.New(), + items: make(map[interface{}]*list.Element), + onEvict: onEvict, + } + return c, nil +} + +// Purge is used to completely clear the cache. +func (c *LRU) Purge() { + for k, v := range c.items { + if c.onEvict != nil { + c.onEvict(k, v.Value.(*entry).value) + } + delete(c.items, k) + } + c.evictList.Init() +} + +// Add adds a value to the cache. Returns true if an eviction occurred. +func (c *LRU) Add(key, value interface{}) (evicted bool) { + // Check for existing item + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + ent.Value.(*entry).value = value + return false + } + + // Add new item + ent := &entry{key, value} + entry := c.evictList.PushFront(ent) + c.items[key] = entry + + evict := c.evictList.Len() > c.size + // Verify size not exceeded + if evict { + c.removeOldest() + } + return evict +} + +// Get looks up a key's value from the cache. +func (c *LRU) Get(key interface{}) (value interface{}, ok bool) { + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + return ent.Value.(*entry).value, true + } + return +} + +// Contains checks if a key is in the cache, without updating the recent-ness +// or deleting it for being stale. +func (c *LRU) Contains(key interface{}) (ok bool) { + _, ok = c.items[key] + return ok +} + +// Peek returns the key value (or undefined if not found) without updating +// the "recently used"-ness of the key. +func (c *LRU) Peek(key interface{}) (value interface{}, ok bool) { + var ent *list.Element + if ent, ok = c.items[key]; ok { + return ent.Value.(*entry).value, true + } + return nil, ok +} + +// Remove removes the provided key from the cache, returning if the +// key was contained. +func (c *LRU) Remove(key interface{}) (present bool) { + if ent, ok := c.items[key]; ok { + c.removeElement(ent) + return true + } + return false +} + +// RemoveOldest removes the oldest item from the cache. +func (c *LRU) RemoveOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// GetOldest returns the oldest entry +func (c *LRU) GetOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// Keys returns a slice of the keys in the cache, from oldest to newest. +func (c *LRU) Keys() []interface{} { + keys := make([]interface{}, len(c.items)) + i := 0 + for ent := c.evictList.Back(); ent != nil; ent = ent.Prev() { + keys[i] = ent.Value.(*entry).key + i++ + } + return keys +} + +// Len returns the number of items in the cache. +func (c *LRU) Len() int { + return c.evictList.Len() +} + +// removeOldest removes the oldest item from the cache. +func (c *LRU) removeOldest() { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + } +} + +// removeElement is used to remove a given list element from the cache +func (c *LRU) removeElement(e *list.Element) { + c.evictList.Remove(e) + kv := e.Value.(*entry) + delete(c.items, kv.key) + if c.onEvict != nil { + c.onEvict(kv.key, kv.value) + } +} diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go new file mode 100644 index 000000000..74c707744 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go @@ -0,0 +1,36 @@ +package simplelru + +// LRUCache is the interface for simple LRU cache. +type LRUCache interface { + // Adds a value to the cache, returns true if an eviction occurred and + // updates the "recently used"-ness of the key. + Add(key, value interface{}) bool + + // Returns key's value from the cache and + // updates the "recently used"-ness of the key. #value, isFound + Get(key interface{}) (value interface{}, ok bool) + + // Check if a key exsists in cache without updating the recent-ness. + Contains(key interface{}) (ok bool) + + // Returns key's value without updating the "recently used"-ness of the key. + Peek(key interface{}) (value interface{}, ok bool) + + // Removes a key from the cache. + Remove(key interface{}) bool + + // Removes the oldest entry from cache. + RemoveOldest() (interface{}, interface{}, bool) + + // Returns the oldest entry from the cache. #key, value, isFound + GetOldest() (interface{}, interface{}, bool) + + // Returns a slice of the keys in the cache, from oldest to newest. + Keys() []interface{} + + // Returns the number of items in the cache. + Len() int + + // Clear all cache entries + Purge() +} diff --git a/vendor/go.opencensus.io/LICENSE b/vendor/go.opencensus.io/LICENSE new file mode 100644 index 000000000..7a4a3ea24 --- /dev/null +++ b/vendor/go.opencensus.io/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md new file mode 100644 index 000000000..fabab2e06 --- /dev/null +++ b/vendor/go.opencensus.io/README.md @@ -0,0 +1,263 @@ +# OpenCensus Libraries for Go + +[![Build Status][travis-image]][travis-url] +[![Windows Build Status][appveyor-image]][appveyor-url] +[![GoDoc][godoc-image]][godoc-url] +[![Gitter chat][gitter-image]][gitter-url] + +OpenCensus Go is a Go implementation of OpenCensus, a toolkit for +collecting application performance and behavior monitoring data. +Currently it consists of three major components: tags, stats and tracing. + +## Installation + +``` +$ go get -u go.opencensus.io +``` + +The API of this project is still evolving, see: [Deprecation Policy](#deprecation-policy). +The use of vendoring or a dependency management tool is recommended. + +## Prerequisites + +OpenCensus Go libraries require Go 1.8 or later. + +## Getting Started + +The easiest way to get started using OpenCensus in your application is to use an existing +integration with your RPC framework: + +* [net/http](https://godoc.org/go.opencensus.io/plugin/ochttp) +* [gRPC](https://godoc.org/go.opencensus.io/plugin/ocgrpc) +* [database/sql](https://godoc.org/github.com/opencensus-integrations/ocsql) +* [Go kit](https://godoc.org/github.com/go-kit/kit/tracing/opencensus) +* [Groupcache](https://godoc.org/github.com/orijtech/groupcache) +* [Caddy webserver](https://godoc.org/github.com/orijtech/caddy) +* [MongoDB](https://godoc.org/github.com/orijtech/mongo-go-driver) +* [Redis gomodule/redigo](https://godoc.org/github.com/orijtech/redigo) +* [Redis goredis/redis](https://godoc.org/github.com/orijtech/redis) +* [Memcache](https://godoc.org/github.com/orijtech/gomemcache) + +If you're using a framework not listed here, you could either implement your own middleware for your +framework or use [custom stats](#stats) and [spans](#spans) directly in your application. + +## Exporters + +OpenCensus can export instrumentation data to various backends. +OpenCensus has exporter implementations for the following, users +can implement their own exporters by implementing the exporter interfaces +([stats](https://godoc.org/go.opencensus.io/stats/view#Exporter), +[trace](https://godoc.org/go.opencensus.io/trace#Exporter)): + +* [Prometheus][exporter-prom] for stats +* [OpenZipkin][exporter-zipkin] for traces +* [Stackdriver][exporter-stackdriver] Monitoring for stats and Trace for traces +* [Jaeger][exporter-jaeger] for traces +* [AWS X-Ray][exporter-xray] for traces +* [Datadog][exporter-datadog] for stats and traces +* [Graphite][exporter-graphite] for stats +* [Honeycomb][exporter-honeycomb] for traces + +## Overview + +![OpenCensus Overview](https://i.imgur.com/cf4ElHE.jpg) + +In a microservices environment, a user request may go through +multiple services until there is a response. OpenCensus allows +you to instrument your services and collect diagnostics data all +through your services end-to-end. + +## Tags + +Tags represent propagated key-value pairs. They are propagated using `context.Context` +in the same process or can be encoded to be transmitted on the wire. Usually, this will +be handled by an integration plugin, e.g. `ocgrpc.ServerHandler` and `ocgrpc.ClientHandler` +for gRPC. + +Package `tag` allows adding or modifying tags in the current context. + +[embedmd]:# (internal/readme/tags.go new) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Upsert(userIDKey, "cde36753ed"), +) +if err != nil { + log.Fatal(err) +} +``` + +## Stats + +OpenCensus is a low-overhead framework even if instrumentation is always enabled. +In order to be so, it is optimized to make recording of data points fast +and separate from the data aggregation. + +OpenCensus stats collection happens in two stages: + +* Definition of measures and recording of data points +* Definition of views and aggregation of the recorded data + +### Recording + +Measurements are data points associated with a measure. +Recording implicitly tags the set of Measurements with the tags from the +provided context: + +[embedmd]:# (internal/readme/stats.go record) +```go +stats.Record(ctx, videoSize.M(102478)) +``` + +### Views + +Views are how Measures are aggregated. You can think of them as queries over the +set of recorded data points (measurements). + +Views have two parts: the tags to group by and the aggregation type used. + +Currently three types of aggregations are supported: +* CountAggregation is used to count the number of times a sample was recorded. +* DistributionAggregation is used to provide a histogram of the values of the samples. +* SumAggregation is used to sum up all sample values. + +[embedmd]:# (internal/readme/stats.go aggs) +```go +distAgg := view.Distribution(1<<32, 2<<32, 3<<32) +countAgg := view.Count() +sumAgg := view.Sum() +``` + +Here we create a view with the DistributionAggregation over our measure. + +[embedmd]:# (internal/readme/stats.go view) +```go +if err := view.Register(&view.View{ + Name: "example.com/video_size_distribution", + Description: "distribution of processed video size over time", + Measure: videoSize, + Aggregation: view.Distribution(1<<32, 2<<32, 3<<32), +}); err != nil { + log.Fatalf("Failed to register view: %v", err) +} +``` + +Register begins collecting data for the view. Registered views' data will be +exported via the registered exporters. + +## Traces + +A distributed trace tracks the progression of a single user request as +it is handled by the services and processes that make up an application. +Each step is called a span in the trace. Spans include metadata about the step, +including especially the time spent in the step, called the span’s latency. + +Below you see a trace and several spans underneath it. + +![Traces and spans](https://i.imgur.com/7hZwRVj.png) + +### Spans + +Span is the unit step in a trace. Each span has a name, latency, status and +additional metadata. + +Below we are starting a span for a cache read and ending it +when we are done: + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +### Propagation + +Spans can have parents or can be root spans if they don't have any parents. +The current span is propagated in-process and across the network to allow associating +new child spans with the parent. + +In the same process, `context.Context` is used to propagate spans. +`trace.StartSpan` creates a new span as a root if the current context +doesn't contain a span. Or, it creates a child of the span that is +already in current context. The returned context can be used to keep +propagating the newly created span in the current context. + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +Across the network, OpenCensus provides different propagation +methods for different protocols. + +* gRPC integrations use the OpenCensus' [binary propagation format](https://godoc.org/go.opencensus.io/trace/propagation). +* HTTP integrations use Zipkin's [B3](https://github.com/openzipkin/b3-propagation) + by default but can be configured to use a custom propagation method by setting another + [propagation.HTTPFormat](https://godoc.org/go.opencensus.io/trace/propagation#HTTPFormat). + +## Execution Tracer + +With Go 1.11, OpenCensus Go will support integration with the Go execution tracer. +See [Debugging Latency in Go](https://medium.com/observability/debugging-latency-in-go-1-11-9f97a7910d68) +for an example of their mutual use. + +## Profiles + +OpenCensus tags can be applied as profiler labels +for users who are on Go 1.9 and above. + +[embedmd]:# (internal/readme/tags.go profiler) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Insert(userIDKey, "fff0989878"), +) +if err != nil { + log.Fatal(err) +} +tag.Do(ctx, func(ctx context.Context) { + // Do work. + // When profiling is on, samples will be + // recorded with the key/values from the tag map. +}) +``` + +A screenshot of the CPU profile from the program above: + +![CPU profile](https://i.imgur.com/jBKjlkw.png) + +## Deprecation Policy + +Before version 1.0.0, the following deprecation policy will be observed: + +No backwards-incompatible changes will be made except for the removal of symbols that have +been marked as *Deprecated* for at least one minor release (e.g. 0.9.0 to 0.10.0). A release +removing the *Deprecated* functionality will be made no sooner than 28 days after the first +release in which the functionality was marked *Deprecated*. + +[travis-image]: https://travis-ci.org/census-instrumentation/opencensus-go.svg?branch=master +[travis-url]: https://travis-ci.org/census-instrumentation/opencensus-go +[appveyor-image]: https://ci.appveyor.com/api/projects/status/vgtt29ps1783ig38?svg=true +[appveyor-url]: https://ci.appveyor.com/project/opencensusgoteam/opencensus-go/branch/master +[godoc-image]: https://godoc.org/go.opencensus.io?status.svg +[godoc-url]: https://godoc.org/go.opencensus.io +[gitter-image]: https://badges.gitter.im/census-instrumentation/lobby.svg +[gitter-url]: https://gitter.im/census-instrumentation/lobby?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge + + +[new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap +[new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace + +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus +[exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger +[exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws +[exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog +[exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite +[exporter-honeycomb]: https://github.com/honeycombio/opencensus-exporter diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod new file mode 100644 index 000000000..cb4de80f3 --- /dev/null +++ b/vendor/go.opencensus.io/go.mod @@ -0,0 +1,12 @@ +module go.opencensus.io + +require ( + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/hashicorp/golang-lru v0.5.1 + golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 +) diff --git a/vendor/go.opencensus.io/internal/internal.go b/vendor/go.opencensus.io/internal/internal.go new file mode 100644 index 000000000..9a638781c --- /dev/null +++ b/vendor/go.opencensus.io/internal/internal.go @@ -0,0 +1,37 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal // import "go.opencensus.io/internal" + +import ( + "fmt" + "time" + + opencensus "go.opencensus.io" +) + +// UserAgent is the user agent to be added to the outgoing +// requests from the exporters. +var UserAgent = fmt.Sprintf("opencensus-go/%s", opencensus.Version()) + +// MonotonicEndTime returns the end time at present +// but offset from start, monotonically. +// +// The monotonic clock is used in subtractions hence +// the duration since start added back to start gives +// end as a monotonic time. +// See https://golang.org/pkg/time/#hdr-Monotonic_Clocks +func MonotonicEndTime(start time.Time) time.Time { + return start.Add(time.Now().Sub(start)) +} diff --git a/vendor/go.opencensus.io/internal/sanitize.go b/vendor/go.opencensus.io/internal/sanitize.go new file mode 100644 index 000000000..de8ccf236 --- /dev/null +++ b/vendor/go.opencensus.io/internal/sanitize.go @@ -0,0 +1,50 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "strings" + "unicode" +) + +const labelKeySizeLimit = 100 + +// Sanitize returns a string that is trunacated to 100 characters if it's too +// long, and replaces non-alphanumeric characters to underscores. +func Sanitize(s string) string { + if len(s) == 0 { + return s + } + if len(s) > labelKeySizeLimit { + s = s[:labelKeySizeLimit] + } + s = strings.Map(sanitizeRune, s) + if unicode.IsDigit(rune(s[0])) { + s = "key_" + s + } + if s[0] == '_' { + s = "key" + s + } + return s +} + +// converts anything that is not a letter or digit to an underscore +func sanitizeRune(r rune) rune { + if unicode.IsLetter(r) || unicode.IsDigit(r) { + return r + } + // Everything else turns into an underscore + return '_' +} diff --git a/vendor/go.opencensus.io/internal/traceinternals.go b/vendor/go.opencensus.io/internal/traceinternals.go new file mode 100644 index 000000000..073af7b47 --- /dev/null +++ b/vendor/go.opencensus.io/internal/traceinternals.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "time" +) + +// Trace allows internal access to some trace functionality. +// TODO(#412): remove this +var Trace interface{} + +// LocalSpanStoreEnabled true if the local span store is enabled. +var LocalSpanStoreEnabled bool + +// BucketConfiguration stores the number of samples to store for span buckets +// for successful and failed spans for a particular span name. +type BucketConfiguration struct { + Name string + MaxRequestsSucceeded int + MaxRequestsErrors int +} + +// PerMethodSummary is a summary of the spans stored for a single span name. +type PerMethodSummary struct { + Active int + LatencyBuckets []LatencyBucketSummary + ErrorBuckets []ErrorBucketSummary +} + +// LatencyBucketSummary is a summary of a latency bucket. +type LatencyBucketSummary struct { + MinLatency, MaxLatency time.Duration + Size int +} + +// ErrorBucketSummary is a summary of an error bucket. +type ErrorBucketSummary struct { + ErrorCode int32 + Size int +} diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go new file mode 100644 index 000000000..626d73645 --- /dev/null +++ b/vendor/go.opencensus.io/opencensus.go @@ -0,0 +1,21 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package opencensus contains Go support for OpenCensus. +package opencensus // import "go.opencensus.io" + +// Version is the current release version of OpenCensus in use. +func Version() string { + return "0.22.0" +} diff --git a/vendor/go.opencensus.io/trace/basetypes.go b/vendor/go.opencensus.io/trace/basetypes.go new file mode 100644 index 000000000..0c54492a2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/basetypes.go @@ -0,0 +1,119 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "fmt" + "time" +) + +type ( + // TraceID is a 16-byte identifier for a set of spans. + TraceID [16]byte + + // SpanID is an 8-byte identifier for a single span. + SpanID [8]byte +) + +func (t TraceID) String() string { + return fmt.Sprintf("%02x", t[:]) +} + +func (s SpanID) String() string { + return fmt.Sprintf("%02x", s[:]) +} + +// Annotation represents a text annotation with a set of attributes and a timestamp. +type Annotation struct { + Time time.Time + Message string + Attributes map[string]interface{} +} + +// Attribute represents a key-value pair on a span, link or annotation. +// Construct with one of: BoolAttribute, Int64Attribute, or StringAttribute. +type Attribute struct { + key string + value interface{} +} + +// BoolAttribute returns a bool-valued attribute. +func BoolAttribute(key string, value bool) Attribute { + return Attribute{key: key, value: value} +} + +// Int64Attribute returns an int64-valued attribute. +func Int64Attribute(key string, value int64) Attribute { + return Attribute{key: key, value: value} +} + +// Float64Attribute returns a float64-valued attribute. +func Float64Attribute(key string, value float64) Attribute { + return Attribute{key: key, value: value} +} + +// StringAttribute returns a string-valued attribute. +func StringAttribute(key string, value string) Attribute { + return Attribute{key: key, value: value} +} + +// LinkType specifies the relationship between the span that had the link +// added, and the linked span. +type LinkType int32 + +// LinkType values. +const ( + LinkTypeUnspecified LinkType = iota // The relationship of the two spans is unknown. + LinkTypeChild // The linked span is a child of the current span. + LinkTypeParent // The linked span is the parent of the current span. +) + +// Link represents a reference from one span to another span. +type Link struct { + TraceID TraceID + SpanID SpanID + Type LinkType + // Attributes is a set of attributes on the link. + Attributes map[string]interface{} +} + +// MessageEventType specifies the type of message event. +type MessageEventType int32 + +// MessageEventType values. +const ( + MessageEventTypeUnspecified MessageEventType = iota // Unknown event type. + MessageEventTypeSent // Indicates a sent RPC message. + MessageEventTypeRecv // Indicates a received RPC message. +) + +// MessageEvent represents an event describing a message sent or received on the network. +type MessageEvent struct { + Time time.Time + EventType MessageEventType + MessageID int64 + UncompressedByteSize int64 + CompressedByteSize int64 +} + +// Status is the status of a Span. +type Status struct { + // Code is a status code. Zero indicates success. + // + // If Code will be propagated to Google APIs, it ideally should be a value from + // https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto . + Code int32 + Message string +} diff --git a/vendor/go.opencensus.io/trace/config.go b/vendor/go.opencensus.io/trace/config.go new file mode 100644 index 000000000..775f8274f --- /dev/null +++ b/vendor/go.opencensus.io/trace/config.go @@ -0,0 +1,86 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + + "go.opencensus.io/trace/internal" +) + +// Config represents the global tracing configuration. +type Config struct { + // DefaultSampler is the default sampler used when creating new spans. + DefaultSampler Sampler + + // IDGenerator is for internal use only. + IDGenerator internal.IDGenerator + + // MaxAnnotationEventsPerSpan is max number of annotation events per span + MaxAnnotationEventsPerSpan int + + // MaxMessageEventsPerSpan is max number of message events per span + MaxMessageEventsPerSpan int + + // MaxAnnotationEventsPerSpan is max number of attributes per span + MaxAttributesPerSpan int + + // MaxLinksPerSpan is max number of links per span + MaxLinksPerSpan int +} + +var configWriteMu sync.Mutex + +const ( + // DefaultMaxAnnotationEventsPerSpan is default max number of annotation events per span + DefaultMaxAnnotationEventsPerSpan = 32 + + // DefaultMaxMessageEventsPerSpan is default max number of message events per span + DefaultMaxMessageEventsPerSpan = 128 + + // DefaultMaxAttributesPerSpan is default max number of attributes per span + DefaultMaxAttributesPerSpan = 32 + + // DefaultMaxLinksPerSpan is default max number of links per span + DefaultMaxLinksPerSpan = 32 +) + +// ApplyConfig applies changes to the global tracing configuration. +// +// Fields not provided in the given config are going to be preserved. +func ApplyConfig(cfg Config) { + configWriteMu.Lock() + defer configWriteMu.Unlock() + c := *config.Load().(*Config) + if cfg.DefaultSampler != nil { + c.DefaultSampler = cfg.DefaultSampler + } + if cfg.IDGenerator != nil { + c.IDGenerator = cfg.IDGenerator + } + if cfg.MaxAnnotationEventsPerSpan > 0 { + c.MaxAnnotationEventsPerSpan = cfg.MaxAnnotationEventsPerSpan + } + if cfg.MaxMessageEventsPerSpan > 0 { + c.MaxMessageEventsPerSpan = cfg.MaxMessageEventsPerSpan + } + if cfg.MaxAttributesPerSpan > 0 { + c.MaxAttributesPerSpan = cfg.MaxAttributesPerSpan + } + if cfg.MaxLinksPerSpan > 0 { + c.MaxLinksPerSpan = cfg.MaxLinksPerSpan + } + config.Store(&c) +} diff --git a/vendor/go.opencensus.io/trace/doc.go b/vendor/go.opencensus.io/trace/doc.go new file mode 100644 index 000000000..04b1ee4f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/doc.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/* +Package trace contains support for OpenCensus distributed tracing. + +The following assumes a basic familiarity with OpenCensus concepts. +See http://opencensus.io + + +Exporting Traces + +To export collected tracing data, register at least one exporter. You can use +one of the provided exporters or write your own. + + trace.RegisterExporter(exporter) + +By default, traces will be sampled relatively rarely. To change the sampling +frequency for your entire program, call ApplyConfig. Use a ProbabilitySampler +to sample a subset of traces, or use AlwaysSample to collect a trace on every run: + + trace.ApplyConfig(trace.Config{DefaultSampler: trace.AlwaysSample()}) + +Be careful about using trace.AlwaysSample in a production application with +significant traffic: a new trace will be started and exported for every request. + +Adding Spans to a Trace + +A trace consists of a tree of spans. In Go, the current span is carried in a +context.Context. + +It is common to want to capture all the activity of a function call in a span. For +this to work, the function must take a context.Context as a parameter. Add these two +lines to the top of the function: + + ctx, span := trace.StartSpan(ctx, "example.com/Run") + defer span.End() + +StartSpan will create a new top-level span if the context +doesn't contain another span, otherwise it will create a child span. +*/ +package trace // import "go.opencensus.io/trace" diff --git a/vendor/go.opencensus.io/trace/evictedqueue.go b/vendor/go.opencensus.io/trace/evictedqueue.go new file mode 100644 index 000000000..ffc264f23 --- /dev/null +++ b/vendor/go.opencensus.io/trace/evictedqueue.go @@ -0,0 +1,38 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +type evictedQueue struct { + queue []interface{} + capacity int + droppedCount int +} + +func newEvictedQueue(capacity int) *evictedQueue { + eq := &evictedQueue{ + capacity: capacity, + queue: make([]interface{}, 0), + } + + return eq +} + +func (eq *evictedQueue) add(value interface{}) { + if len(eq.queue) == eq.capacity { + eq.queue = eq.queue[1:] + eq.droppedCount++ + } + eq.queue = append(eq.queue, value) +} diff --git a/vendor/go.opencensus.io/trace/export.go b/vendor/go.opencensus.io/trace/export.go new file mode 100644 index 000000000..e0d9a4b99 --- /dev/null +++ b/vendor/go.opencensus.io/trace/export.go @@ -0,0 +1,97 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "sync/atomic" + "time" +) + +// Exporter is a type for functions that receive sampled trace spans. +// +// The ExportSpan method should be safe for concurrent use and should return +// quickly; if an Exporter takes a significant amount of time to process a +// SpanData, that work should be done on another goroutine. +// +// The SpanData should not be modified, but a pointer to it can be kept. +type Exporter interface { + ExportSpan(s *SpanData) +} + +type exportersMap map[Exporter]struct{} + +var ( + exporterMu sync.Mutex + exporters atomic.Value +) + +// RegisterExporter adds to the list of Exporters that will receive sampled +// trace spans. +// +// Binaries can register exporters, libraries shouldn't register exporters. +func RegisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + new[e] = struct{}{} + exporters.Store(new) + exporterMu.Unlock() +} + +// UnregisterExporter removes from the list of Exporters the Exporter that was +// registered with the given name. +func UnregisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + delete(new, e) + exporters.Store(new) + exporterMu.Unlock() +} + +// SpanData contains all the information collected by a Span. +type SpanData struct { + SpanContext + ParentSpanID SpanID + SpanKind int + Name string + StartTime time.Time + // The wall clock time of EndTime will be adjusted to always be offset + // from StartTime by the duration of the span. + EndTime time.Time + // The values of Attributes each have type string, bool, or int64. + Attributes map[string]interface{} + Annotations []Annotation + MessageEvents []MessageEvent + Status + Links []Link + HasRemoteParent bool + DroppedAttributeCount int + DroppedAnnotationCount int + DroppedMessageEventCount int + DroppedLinkCount int + + // ChildSpanCount holds the number of child span created for this span. + ChildSpanCount int +} diff --git a/vendor/go.opencensus.io/trace/internal/internal.go b/vendor/go.opencensus.io/trace/internal/internal.go new file mode 100644 index 000000000..7e808d8f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/internal/internal.go @@ -0,0 +1,22 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package internal provides trace internals. +package internal + +// IDGenerator allows custom generators for TraceId and SpanId. +type IDGenerator interface { + NewTraceID() [16]byte + NewSpanID() [8]byte +} diff --git a/vendor/go.opencensus.io/trace/lrumap.go b/vendor/go.opencensus.io/trace/lrumap.go new file mode 100644 index 000000000..3f80a3368 --- /dev/null +++ b/vendor/go.opencensus.io/trace/lrumap.go @@ -0,0 +1,37 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "github.com/hashicorp/golang-lru/simplelru" +) + +type lruMap struct { + simpleLruMap *simplelru.LRU + droppedCount int +} + +func newLruMap(size int) *lruMap { + lm := &lruMap{} + lm.simpleLruMap, _ = simplelru.NewLRU(size, nil) + return lm +} + +func (lm *lruMap) add(key, value interface{}) { + evicted := lm.simpleLruMap.Add(key, value) + if evicted { + lm.droppedCount++ + } +} diff --git a/vendor/go.opencensus.io/trace/sampling.go b/vendor/go.opencensus.io/trace/sampling.go new file mode 100644 index 000000000..71c10f9e3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/sampling.go @@ -0,0 +1,75 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "encoding/binary" +) + +const defaultSamplingProbability = 1e-4 + +// Sampler decides whether a trace should be sampled and exported. +type Sampler func(SamplingParameters) SamplingDecision + +// SamplingParameters contains the values passed to a Sampler. +type SamplingParameters struct { + ParentContext SpanContext + TraceID TraceID + SpanID SpanID + Name string + HasRemoteParent bool +} + +// SamplingDecision is the value returned by a Sampler. +type SamplingDecision struct { + Sample bool +} + +// ProbabilitySampler returns a Sampler that samples a given fraction of traces. +// +// It also samples spans whose parents are sampled. +func ProbabilitySampler(fraction float64) Sampler { + if !(fraction >= 0) { + fraction = 0 + } else if fraction >= 1 { + return AlwaysSample() + } + + traceIDUpperBound := uint64(fraction * (1 << 63)) + return Sampler(func(p SamplingParameters) SamplingDecision { + if p.ParentContext.IsSampled() { + return SamplingDecision{Sample: true} + } + x := binary.BigEndian.Uint64(p.TraceID[0:8]) >> 1 + return SamplingDecision{Sample: x < traceIDUpperBound} + }) +} + +// AlwaysSample returns a Sampler that samples every trace. +// Be careful about using this sampler in a production application with +// significant traffic: a new trace will be started and exported for every +// request. +func AlwaysSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: true} + } +} + +// NeverSample returns a Sampler that samples no traces. +func NeverSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: false} + } +} diff --git a/vendor/go.opencensus.io/trace/spanbucket.go b/vendor/go.opencensus.io/trace/spanbucket.go new file mode 100644 index 000000000..fbabad34c --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanbucket.go @@ -0,0 +1,130 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "time" +) + +// samplePeriod is the minimum time between accepting spans in a single bucket. +const samplePeriod = time.Second + +// defaultLatencies contains the default latency bucket bounds. +// TODO: consider defaults, make configurable +var defaultLatencies = [...]time.Duration{ + 10 * time.Microsecond, + 100 * time.Microsecond, + time.Millisecond, + 10 * time.Millisecond, + 100 * time.Millisecond, + time.Second, + 10 * time.Second, + time.Minute, +} + +// bucket is a container for a set of spans for a particular error code or latency range. +type bucket struct { + nextTime time.Time // next time we can accept a span + buffer []*SpanData // circular buffer of spans + nextIndex int // location next SpanData should be placed in buffer + overflow bool // whether the circular buffer has wrapped around +} + +func makeBucket(bufferSize int) bucket { + return bucket{ + buffer: make([]*SpanData, bufferSize), + } +} + +// add adds a span to the bucket, if nextTime has been reached. +func (b *bucket) add(s *SpanData) { + if s.EndTime.Before(b.nextTime) { + return + } + if len(b.buffer) == 0 { + return + } + b.nextTime = s.EndTime.Add(samplePeriod) + b.buffer[b.nextIndex] = s + b.nextIndex++ + if b.nextIndex == len(b.buffer) { + b.nextIndex = 0 + b.overflow = true + } +} + +// size returns the number of spans in the bucket. +func (b *bucket) size() int { + if b.overflow { + return len(b.buffer) + } + return b.nextIndex +} + +// span returns the ith span in the bucket. +func (b *bucket) span(i int) *SpanData { + if !b.overflow { + return b.buffer[i] + } + if i < len(b.buffer)-b.nextIndex { + return b.buffer[b.nextIndex+i] + } + return b.buffer[b.nextIndex+i-len(b.buffer)] +} + +// resize changes the size of the bucket to n, keeping up to n existing spans. +func (b *bucket) resize(n int) { + cur := b.size() + newBuffer := make([]*SpanData, n) + if cur < n { + for i := 0; i < cur; i++ { + newBuffer[i] = b.span(i) + } + b.buffer = newBuffer + b.nextIndex = cur + b.overflow = false + return + } + for i := 0; i < n; i++ { + newBuffer[i] = b.span(i + cur - n) + } + b.buffer = newBuffer + b.nextIndex = 0 + b.overflow = true +} + +// latencyBucket returns the appropriate bucket number for a given latency. +func latencyBucket(latency time.Duration) int { + i := 0 + for i < len(defaultLatencies) && latency >= defaultLatencies[i] { + i++ + } + return i +} + +// latencyBucketBounds returns the lower and upper bounds for a latency bucket +// number. +// +// The lower bound is inclusive, the upper bound is exclusive (except for the +// last bucket.) +func latencyBucketBounds(index int) (lower time.Duration, upper time.Duration) { + if index == 0 { + return 0, defaultLatencies[index] + } + if index == len(defaultLatencies) { + return defaultLatencies[index-1], 1<<63 - 1 + } + return defaultLatencies[index-1], defaultLatencies[index] +} diff --git a/vendor/go.opencensus.io/trace/spanstore.go b/vendor/go.opencensus.io/trace/spanstore.go new file mode 100644 index 000000000..c442d9902 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanstore.go @@ -0,0 +1,306 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "time" + + "go.opencensus.io/internal" +) + +const ( + maxBucketSize = 100000 + defaultBucketSize = 10 +) + +var ( + ssmu sync.RWMutex // protects spanStores + spanStores = make(map[string]*spanStore) +) + +// This exists purely to avoid exposing internal methods used by z-Pages externally. +type internalOnly struct{} + +func init() { + //TODO(#412): remove + internal.Trace = &internalOnly{} +} + +// ReportActiveSpans returns the active spans for the given name. +func (i internalOnly) ReportActiveSpans(name string) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for span := range s.active { + out = append(out, span.makeSpanData()) + } + return out +} + +// ReportSpansByError returns a sample of error spans. +// +// If code is nonzero, only spans with that status code are returned. +func (i internalOnly) ReportSpansByError(name string, code int32) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + if code != 0 { + if b, ok := s.errors[code]; ok { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } else { + for _, b := range s.errors { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } + return out +} + +// ConfigureBucketSizes sets the number of spans to keep per latency and error +// bucket for different span names. +func (i internalOnly) ConfigureBucketSizes(bcs []internal.BucketConfiguration) { + for _, bc := range bcs { + latencyBucketSize := bc.MaxRequestsSucceeded + if latencyBucketSize < 0 { + latencyBucketSize = 0 + } + if latencyBucketSize > maxBucketSize { + latencyBucketSize = maxBucketSize + } + errorBucketSize := bc.MaxRequestsErrors + if errorBucketSize < 0 { + errorBucketSize = 0 + } + if errorBucketSize > maxBucketSize { + errorBucketSize = maxBucketSize + } + spanStoreSetSize(bc.Name, latencyBucketSize, errorBucketSize) + } +} + +// ReportSpansPerMethod returns a summary of what spans are being stored for each span name. +func (i internalOnly) ReportSpansPerMethod() map[string]internal.PerMethodSummary { + out := make(map[string]internal.PerMethodSummary) + ssmu.RLock() + defer ssmu.RUnlock() + for name, s := range spanStores { + s.mu.Lock() + p := internal.PerMethodSummary{ + Active: len(s.active), + } + for code, b := range s.errors { + p.ErrorBuckets = append(p.ErrorBuckets, internal.ErrorBucketSummary{ + ErrorCode: code, + Size: b.size(), + }) + } + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + p.LatencyBuckets = append(p.LatencyBuckets, internal.LatencyBucketSummary{ + MinLatency: min, + MaxLatency: max, + Size: b.size(), + }) + } + s.mu.Unlock() + out[name] = p + } + return out +} + +// ReportSpansByLatency returns a sample of successful spans. +// +// minLatency is the minimum latency of spans to be returned. +// maxLatency, if nonzero, is the maximum latency of spans to be returned. +func (i internalOnly) ReportSpansByLatency(name string, minLatency, maxLatency time.Duration) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + if i+1 != len(s.latency) && max <= minLatency { + continue + } + if maxLatency != 0 && maxLatency < min { + continue + } + for _, sd := range b.buffer { + if sd == nil { + break + } + if minLatency != 0 || maxLatency != 0 { + d := sd.EndTime.Sub(sd.StartTime) + if d < minLatency { + continue + } + if maxLatency != 0 && d > maxLatency { + continue + } + } + out = append(out, sd) + } + } + return out +} + +// spanStore keeps track of spans stored for a particular span name. +// +// It contains all active spans; a sample of spans for failed requests, +// categorized by error code; and a sample of spans for successful requests, +// bucketed by latency. +type spanStore struct { + mu sync.Mutex // protects everything below. + active map[*Span]struct{} + errors map[int32]*bucket + latency []bucket + maxSpansPerErrorBucket int +} + +// newSpanStore creates a span store. +func newSpanStore(name string, latencyBucketSize int, errorBucketSize int) *spanStore { + s := &spanStore{ + active: make(map[*Span]struct{}), + latency: make([]bucket, len(defaultLatencies)+1), + maxSpansPerErrorBucket: errorBucketSize, + } + for i := range s.latency { + s.latency[i] = makeBucket(latencyBucketSize) + } + return s +} + +// spanStoreForName returns the spanStore for the given name. +// +// It returns nil if it doesn't exist. +func spanStoreForName(name string) *spanStore { + var s *spanStore + ssmu.RLock() + s, _ = spanStores[name] + ssmu.RUnlock() + return s +} + +// spanStoreForNameCreateIfNew returns the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreForNameCreateIfNew(name string) *spanStore { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + return s + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + return s + } + s = newSpanStore(name, defaultBucketSize, defaultBucketSize) + spanStores[name] = s + return s +} + +// spanStoreSetSize resizes the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreSetSize(name string, latencyBucketSize int, errorBucketSize int) { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + s = newSpanStore(name, latencyBucketSize, errorBucketSize) + spanStores[name] = s +} + +func (s *spanStore) resize(latencyBucketSize int, errorBucketSize int) { + s.mu.Lock() + for i := range s.latency { + s.latency[i].resize(latencyBucketSize) + } + for _, b := range s.errors { + b.resize(errorBucketSize) + } + s.maxSpansPerErrorBucket = errorBucketSize + s.mu.Unlock() +} + +// add adds a span to the active bucket of the spanStore. +func (s *spanStore) add(span *Span) { + s.mu.Lock() + s.active[span] = struct{}{} + s.mu.Unlock() +} + +// finished removes a span from the active set, and adds a corresponding +// SpanData to a latency or error bucket. +func (s *spanStore) finished(span *Span, sd *SpanData) { + latency := sd.EndTime.Sub(sd.StartTime) + if latency < 0 { + latency = 0 + } + code := sd.Status.Code + + s.mu.Lock() + delete(s.active, span) + if code == 0 { + s.latency[latencyBucket(latency)].add(sd) + } else { + if s.errors == nil { + s.errors = make(map[int32]*bucket) + } + if b := s.errors[code]; b != nil { + b.add(sd) + } else { + b := makeBucket(s.maxSpansPerErrorBucket) + s.errors[code] = &b + b.add(sd) + } + } + s.mu.Unlock() +} diff --git a/vendor/go.opencensus.io/trace/status_codes.go b/vendor/go.opencensus.io/trace/status_codes.go new file mode 100644 index 000000000..ec60effd1 --- /dev/null +++ b/vendor/go.opencensus.io/trace/status_codes.go @@ -0,0 +1,37 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +// Status codes for use with Span.SetStatus. These correspond to the status +// codes used by gRPC defined here: https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto +const ( + StatusCodeOK = 0 + StatusCodeCancelled = 1 + StatusCodeUnknown = 2 + StatusCodeInvalidArgument = 3 + StatusCodeDeadlineExceeded = 4 + StatusCodeNotFound = 5 + StatusCodeAlreadyExists = 6 + StatusCodePermissionDenied = 7 + StatusCodeResourceExhausted = 8 + StatusCodeFailedPrecondition = 9 + StatusCodeAborted = 10 + StatusCodeOutOfRange = 11 + StatusCodeUnimplemented = 12 + StatusCodeInternal = 13 + StatusCodeUnavailable = 14 + StatusCodeDataLoss = 15 + StatusCodeUnauthenticated = 16 +) diff --git a/vendor/go.opencensus.io/trace/trace.go b/vendor/go.opencensus.io/trace/trace.go new file mode 100644 index 000000000..38ead7bf0 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace.go @@ -0,0 +1,598 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "context" + crand "crypto/rand" + "encoding/binary" + "fmt" + "math/rand" + "sync" + "sync/atomic" + "time" + + "go.opencensus.io/internal" + "go.opencensus.io/trace/tracestate" +) + +// Span represents a span of a trace. It has an associated SpanContext, and +// stores data accumulated while the span is active. +// +// Ideally users should interact with Spans by calling the functions in this +// package that take a Context parameter. +type Span struct { + // data contains information recorded about the span. + // + // It will be non-nil if we are exporting the span or recording events for it. + // Otherwise, data is nil, and the Span is simply a carrier for the + // SpanContext, so that the trace ID is propagated. + data *SpanData + mu sync.Mutex // protects the contents of *data (but not the pointer value.) + spanContext SpanContext + + // lruAttributes are capped at configured limit. When the capacity is reached an oldest entry + // is removed to create room for a new entry. + lruAttributes *lruMap + + // annotations are stored in FIFO queue capped by configured limit. + annotations *evictedQueue + + // messageEvents are stored in FIFO queue capped by configured limit. + messageEvents *evictedQueue + + // links are stored in FIFO queue capped by configured limit. + links *evictedQueue + + // spanStore is the spanStore this span belongs to, if any, otherwise it is nil. + *spanStore + endOnce sync.Once + + executionTracerTaskEnd func() // ends the execution tracer span +} + +// IsRecordingEvents returns true if events are being recorded for this span. +// Use this check to avoid computing expensive annotations when they will never +// be used. +func (s *Span) IsRecordingEvents() bool { + if s == nil { + return false + } + return s.data != nil +} + +// TraceOptions contains options associated with a trace span. +type TraceOptions uint32 + +// IsSampled returns true if the span will be exported. +func (sc SpanContext) IsSampled() bool { + return sc.TraceOptions.IsSampled() +} + +// setIsSampled sets the TraceOptions bit that determines whether the span will be exported. +func (sc *SpanContext) setIsSampled(sampled bool) { + if sampled { + sc.TraceOptions |= 1 + } else { + sc.TraceOptions &= ^TraceOptions(1) + } +} + +// IsSampled returns true if the span will be exported. +func (t TraceOptions) IsSampled() bool { + return t&1 == 1 +} + +// SpanContext contains the state that must propagate across process boundaries. +// +// SpanContext is not an implementation of context.Context. +// TODO: add reference to external Census docs for SpanContext. +type SpanContext struct { + TraceID TraceID + SpanID SpanID + TraceOptions TraceOptions + Tracestate *tracestate.Tracestate +} + +type contextKey struct{} + +// FromContext returns the Span stored in a context, or nil if there isn't one. +func FromContext(ctx context.Context) *Span { + s, _ := ctx.Value(contextKey{}).(*Span) + return s +} + +// NewContext returns a new context with the given Span attached. +func NewContext(parent context.Context, s *Span) context.Context { + return context.WithValue(parent, contextKey{}, s) +} + +// All available span kinds. Span kind must be either one of these values. +const ( + SpanKindUnspecified = iota + SpanKindServer + SpanKindClient +) + +// StartOptions contains options concerning how a span is started. +type StartOptions struct { + // Sampler to consult for this Span. If provided, it is always consulted. + // + // If not provided, then the behavior differs based on whether + // the parent of this Span is remote, local, or there is no parent. + // In the case of a remote parent or no parent, the + // default sampler (see Config) will be consulted. Otherwise, + // when there is a non-remote parent, no new sampling decision will be made: + // we will preserve the sampling of the parent. + Sampler Sampler + + // SpanKind represents the kind of a span. If none is set, + // SpanKindUnspecified is used. + SpanKind int +} + +// StartOption apply changes to StartOptions. +type StartOption func(*StartOptions) + +// WithSpanKind makes new spans to be created with the given kind. +func WithSpanKind(spanKind int) StartOption { + return func(o *StartOptions) { + o.SpanKind = spanKind + } +} + +// WithSampler makes new spans to be be created with a custom sampler. +// Otherwise, the global sampler is used. +func WithSampler(sampler Sampler) StartOption { + return func(o *StartOptions) { + o.Sampler = sampler + } +} + +// StartSpan starts a new child span of the current span in the context. If +// there is no span in the context, creates a new trace and span. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpan(ctx context.Context, name string, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + var parent SpanContext + if p := FromContext(ctx); p != nil { + p.addChild() + parent = p.spanContext + } + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, false, opts) + + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +// StartSpanWithRemoteParent starts a new child span of the span from the given parent. +// +// If the incoming context contains a parent, it ignores. StartSpanWithRemoteParent is +// preferred for cases where the parent is propagated via an incoming request. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent SpanContext, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, true, opts) + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +func startSpanInternal(name string, hasParent bool, parent SpanContext, remoteParent bool, o StartOptions) *Span { + span := &Span{} + span.spanContext = parent + + cfg := config.Load().(*Config) + + if !hasParent { + span.spanContext.TraceID = cfg.IDGenerator.NewTraceID() + } + span.spanContext.SpanID = cfg.IDGenerator.NewSpanID() + sampler := cfg.DefaultSampler + + if !hasParent || remoteParent || o.Sampler != nil { + // If this span is the child of a local span and no Sampler is set in the + // options, keep the parent's TraceOptions. + // + // Otherwise, consult the Sampler in the options if it is non-nil, otherwise + // the default sampler. + if o.Sampler != nil { + sampler = o.Sampler + } + span.spanContext.setIsSampled(sampler(SamplingParameters{ + ParentContext: parent, + TraceID: span.spanContext.TraceID, + SpanID: span.spanContext.SpanID, + Name: name, + HasRemoteParent: remoteParent}).Sample) + } + + if !internal.LocalSpanStoreEnabled && !span.spanContext.IsSampled() { + return span + } + + span.data = &SpanData{ + SpanContext: span.spanContext, + StartTime: time.Now(), + SpanKind: o.SpanKind, + Name: name, + HasRemoteParent: remoteParent, + } + span.lruAttributes = newLruMap(cfg.MaxAttributesPerSpan) + span.annotations = newEvictedQueue(cfg.MaxAnnotationEventsPerSpan) + span.messageEvents = newEvictedQueue(cfg.MaxMessageEventsPerSpan) + span.links = newEvictedQueue(cfg.MaxLinksPerSpan) + + if hasParent { + span.data.ParentSpanID = parent.SpanID + } + if internal.LocalSpanStoreEnabled { + var ss *spanStore + ss = spanStoreForNameCreateIfNew(name) + if ss != nil { + span.spanStore = ss + ss.add(span) + } + } + + return span +} + +// End ends the span. +func (s *Span) End() { + if s == nil { + return + } + if s.executionTracerTaskEnd != nil { + s.executionTracerTaskEnd() + } + if !s.IsRecordingEvents() { + return + } + s.endOnce.Do(func() { + exp, _ := exporters.Load().(exportersMap) + mustExport := s.spanContext.IsSampled() && len(exp) > 0 + if s.spanStore != nil || mustExport { + sd := s.makeSpanData() + sd.EndTime = internal.MonotonicEndTime(sd.StartTime) + if s.spanStore != nil { + s.spanStore.finished(s, sd) + } + if mustExport { + for e := range exp { + e.ExportSpan(sd) + } + } + } + }) +} + +// makeSpanData produces a SpanData representing the current state of the Span. +// It requires that s.data is non-nil. +func (s *Span) makeSpanData() *SpanData { + var sd SpanData + s.mu.Lock() + sd = *s.data + if s.lruAttributes.simpleLruMap.Len() > 0 { + sd.Attributes = s.lruAttributesToAttributeMap() + sd.DroppedAttributeCount = s.lruAttributes.droppedCount + } + if len(s.annotations.queue) > 0 { + sd.Annotations = s.interfaceArrayToAnnotationArray() + sd.DroppedAnnotationCount = s.annotations.droppedCount + } + if len(s.messageEvents.queue) > 0 { + sd.MessageEvents = s.interfaceArrayToMessageEventArray() + sd.DroppedMessageEventCount = s.messageEvents.droppedCount + } + if len(s.links.queue) > 0 { + sd.Links = s.interfaceArrayToLinksArray() + sd.DroppedLinkCount = s.links.droppedCount + } + s.mu.Unlock() + return &sd +} + +// SpanContext returns the SpanContext of the span. +func (s *Span) SpanContext() SpanContext { + if s == nil { + return SpanContext{} + } + return s.spanContext +} + +// SetName sets the name of the span, if it is recording events. +func (s *Span) SetName(name string) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Name = name + s.mu.Unlock() +} + +// SetStatus sets the status of the span, if it is recording events. +func (s *Span) SetStatus(status Status) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Status = status + s.mu.Unlock() +} + +func (s *Span) interfaceArrayToLinksArray() []Link { + linksArr := make([]Link, 0) + for _, value := range s.links.queue { + linksArr = append(linksArr, value.(Link)) + } + return linksArr +} + +func (s *Span) interfaceArrayToMessageEventArray() []MessageEvent { + messageEventArr := make([]MessageEvent, 0) + for _, value := range s.messageEvents.queue { + messageEventArr = append(messageEventArr, value.(MessageEvent)) + } + return messageEventArr +} + +func (s *Span) interfaceArrayToAnnotationArray() []Annotation { + annotationArr := make([]Annotation, 0) + for _, value := range s.annotations.queue { + annotationArr = append(annotationArr, value.(Annotation)) + } + return annotationArr +} + +func (s *Span) lruAttributesToAttributeMap() map[string]interface{} { + attributes := make(map[string]interface{}) + for _, key := range s.lruAttributes.simpleLruMap.Keys() { + value, ok := s.lruAttributes.simpleLruMap.Get(key) + if ok { + keyStr := key.(string) + attributes[keyStr] = value + } + } + return attributes +} + +func (s *Span) copyToCappedAttributes(attributes []Attribute) { + for _, a := range attributes { + s.lruAttributes.add(a.key, a.value) + } +} + +func (s *Span) addChild() { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.ChildSpanCount++ + s.mu.Unlock() +} + +// AddAttributes sets attributes in the span. +// +// Existing attributes whose keys appear in the attributes parameter are overwritten. +func (s *Span) AddAttributes(attributes ...Attribute) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.copyToCappedAttributes(attributes) + s.mu.Unlock() +} + +// copyAttributes copies a slice of Attributes into a map. +func copyAttributes(m map[string]interface{}, attributes []Attribute) { + for _, a := range attributes { + m[a.key] = a.value + } +} + +func (s *Span) lazyPrintfInternal(attributes []Attribute, format string, a ...interface{}) { + now := time.Now() + msg := fmt.Sprintf(format, a...) + var m map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + m = make(map[string]interface{}) + copyAttributes(m, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: msg, + Attributes: m, + }) + s.mu.Unlock() +} + +func (s *Span) printStringInternal(attributes []Attribute, str string) { + now := time.Now() + var a map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + a = make(map[string]interface{}) + copyAttributes(a, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: str, + Attributes: a, + }) + s.mu.Unlock() +} + +// Annotate adds an annotation with attributes. +// Attributes can be nil. +func (s *Span) Annotate(attributes []Attribute, str string) { + if !s.IsRecordingEvents() { + return + } + s.printStringInternal(attributes, str) +} + +// Annotatef adds an annotation with attributes. +func (s *Span) Annotatef(attributes []Attribute, format string, a ...interface{}) { + if !s.IsRecordingEvents() { + return + } + s.lazyPrintfInternal(attributes, format, a...) +} + +// AddMessageSendEvent adds a message send event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageSendEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeSent, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddMessageReceiveEvent adds a message receive event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageReceiveEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeRecv, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddLink adds a link to the span. +func (s *Span) AddLink(l Link) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.links.add(l) + s.mu.Unlock() +} + +func (s *Span) String() string { + if s == nil { + return "" + } + if s.data == nil { + return fmt.Sprintf("span %s", s.spanContext.SpanID) + } + s.mu.Lock() + str := fmt.Sprintf("span %s %q", s.spanContext.SpanID, s.data.Name) + s.mu.Unlock() + return str +} + +var config atomic.Value // access atomically + +func init() { + gen := &defaultIDGenerator{} + // initialize traceID and spanID generators. + var rngSeed int64 + for _, p := range []interface{}{ + &rngSeed, &gen.traceIDAdd, &gen.nextSpanID, &gen.spanIDInc, + } { + binary.Read(crand.Reader, binary.LittleEndian, p) + } + gen.traceIDRand = rand.New(rand.NewSource(rngSeed)) + gen.spanIDInc |= 1 + + config.Store(&Config{ + DefaultSampler: ProbabilitySampler(defaultSamplingProbability), + IDGenerator: gen, + MaxAttributesPerSpan: DefaultMaxAttributesPerSpan, + MaxAnnotationEventsPerSpan: DefaultMaxAnnotationEventsPerSpan, + MaxMessageEventsPerSpan: DefaultMaxMessageEventsPerSpan, + MaxLinksPerSpan: DefaultMaxLinksPerSpan, + }) +} + +type defaultIDGenerator struct { + sync.Mutex + + // Please keep these as the first fields + // so that these 8 byte fields will be aligned on addresses + // divisible by 8, on both 32-bit and 64-bit machines when + // performing atomic increments and accesses. + // See: + // * https://github.com/census-instrumentation/opencensus-go/issues/587 + // * https://github.com/census-instrumentation/opencensus-go/issues/865 + // * https://golang.org/pkg/sync/atomic/#pkg-note-BUG + nextSpanID uint64 + spanIDInc uint64 + + traceIDAdd [2]uint64 + traceIDRand *rand.Rand +} + +// NewSpanID returns a non-zero span ID from a randomly-chosen sequence. +func (gen *defaultIDGenerator) NewSpanID() [8]byte { + var id uint64 + for id == 0 { + id = atomic.AddUint64(&gen.nextSpanID, gen.spanIDInc) + } + var sid [8]byte + binary.LittleEndian.PutUint64(sid[:], id) + return sid +} + +// NewTraceID returns a non-zero trace ID from a randomly-chosen sequence. +// mu should be held while this function is called. +func (gen *defaultIDGenerator) NewTraceID() [16]byte { + var tid [16]byte + // Construct the trace ID from two outputs of traceIDRand, with a constant + // added to each half for additional entropy. + gen.Lock() + binary.LittleEndian.PutUint64(tid[0:8], gen.traceIDRand.Uint64()+gen.traceIDAdd[0]) + binary.LittleEndian.PutUint64(tid[8:16], gen.traceIDRand.Uint64()+gen.traceIDAdd[1]) + gen.Unlock() + return tid +} diff --git a/vendor/go.opencensus.io/trace/trace_go11.go b/vendor/go.opencensus.io/trace/trace_go11.go new file mode 100644 index 000000000..b7d8aaf28 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_go11.go @@ -0,0 +1,32 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.11 + +package trace + +import ( + "context" + t "runtime/trace" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + if !t.IsEnabled() { + // Avoid additional overhead if + // runtime/trace is not enabled. + return ctx, func() {} + } + nctx, task := t.NewTask(ctx, name) + return nctx, task.End +} diff --git a/vendor/go.opencensus.io/trace/trace_nongo11.go b/vendor/go.opencensus.io/trace/trace_nongo11.go new file mode 100644 index 000000000..e25419859 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_nongo11.go @@ -0,0 +1,25 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !go1.11 + +package trace + +import ( + "context" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + return ctx, func() {} +} diff --git a/vendor/go.opencensus.io/trace/tracestate/tracestate.go b/vendor/go.opencensus.io/trace/tracestate/tracestate.go new file mode 100644 index 000000000..2d6c713eb --- /dev/null +++ b/vendor/go.opencensus.io/trace/tracestate/tracestate.go @@ -0,0 +1,147 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package tracestate implements support for the Tracestate header of the +// W3C TraceContext propagation format. +package tracestate + +import ( + "fmt" + "regexp" +) + +const ( + keyMaxSize = 256 + valueMaxSize = 256 + maxKeyValuePairs = 32 +) + +const ( + keyWithoutVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,255}` + keyWithVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,240}@[a-z][_0-9a-z\-\*\/]{0,13}` + keyFormat = `(` + keyWithoutVendorFormat + `)|(` + keyWithVendorFormat + `)` + valueFormat = `[\x20-\x2b\x2d-\x3c\x3e-\x7e]{0,255}[\x21-\x2b\x2d-\x3c\x3e-\x7e]` +) + +var keyValidationRegExp = regexp.MustCompile(`^(` + keyFormat + `)$`) +var valueValidationRegExp = regexp.MustCompile(`^(` + valueFormat + `)$`) + +// Tracestate represents tracing-system specific context in a list of key-value pairs. Tracestate allows different +// vendors propagate additional information and inter-operate with their legacy Id formats. +type Tracestate struct { + entries []Entry +} + +// Entry represents one key-value pair in a list of key-value pair of Tracestate. +type Entry struct { + // Key is an opaque string up to 256 characters printable. It MUST begin with a lowercase letter, + // and can only contain lowercase letters a-z, digits 0-9, underscores _, dashes -, asterisks *, and + // forward slashes /. + Key string + + // Value is an opaque string up to 256 characters printable ASCII RFC0020 characters (i.e., the + // range 0x20 to 0x7E) except comma , and =. + Value string +} + +// Entries returns a slice of Entry. +func (ts *Tracestate) Entries() []Entry { + if ts == nil { + return nil + } + return ts.entries +} + +func (ts *Tracestate) remove(key string) *Entry { + for index, entry := range ts.entries { + if entry.Key == key { + ts.entries = append(ts.entries[:index], ts.entries[index+1:]...) + return &entry + } + } + return nil +} + +func (ts *Tracestate) add(entries []Entry) error { + for _, entry := range entries { + ts.remove(entry.Key) + } + if len(ts.entries)+len(entries) > maxKeyValuePairs { + return fmt.Errorf("adding %d key-value pairs to current %d pairs exceeds the limit of %d", + len(entries), len(ts.entries), maxKeyValuePairs) + } + ts.entries = append(entries, ts.entries...) + return nil +} + +func isValid(entry Entry) bool { + return keyValidationRegExp.MatchString(entry.Key) && + valueValidationRegExp.MatchString(entry.Value) +} + +func containsDuplicateKey(entries ...Entry) (string, bool) { + keyMap := make(map[string]int) + for _, entry := range entries { + if _, ok := keyMap[entry.Key]; ok { + return entry.Key, true + } + keyMap[entry.Key] = 1 + } + return "", false +} + +func areEntriesValid(entries ...Entry) (*Entry, bool) { + for _, entry := range entries { + if !isValid(entry) { + return &entry, false + } + } + return nil, true +} + +// New creates a Tracestate object from a parent and/or entries (key-value pair). +// Entries from the parent are copied if present. The entries passed to this function +// are inserted in front of those copied from the parent. If an entry copied from the +// parent contains the same key as one of the entry in entries then the entry copied +// from the parent is removed. See add func. +// +// An error is returned with nil Tracestate if +// 1. one or more entry in entries is invalid. +// 2. two or more entries in the input entries have the same key. +// 3. the number of entries combined from the parent and the input entries exceeds maxKeyValuePairs. +// (duplicate entry is counted only once). +func New(parent *Tracestate, entries ...Entry) (*Tracestate, error) { + if parent == nil && len(entries) == 0 { + return nil, nil + } + if entry, ok := areEntriesValid(entries...); !ok { + return nil, fmt.Errorf("key-value pair {%s, %s} is invalid", entry.Key, entry.Value) + } + + if key, duplicate := containsDuplicateKey(entries...); duplicate { + return nil, fmt.Errorf("contains duplicate keys (%s)", key) + } + + tracestate := Tracestate{} + + if parent != nil && len(parent.entries) > 0 { + tracestate.entries = append([]Entry{}, parent.entries...) + } + + err := tracestate.add(entries) + if err != nil { + return nil, err + } + return &tracestate, nil +}