diff --git a/hack/versions b/hack/versions index 1617b8628..7d2e831e3 100644 --- a/hack/versions +++ b/hack/versions @@ -1,6 +1,6 @@ RUNC_VERSION=9f9c96235cc97674e935002fc3d78361b696a69e CNI_VERSION=v0.6.0 -CONTAINERD_VERSION=12eaf13f6f12e5a4db52afe66876cf62fe7835cf +CONTAINERD_VERSION=ec15fe95aa8fd3abeb05d036e1579129c0ba7b1c CONTAINERD_REPO= CRITOOL_VERSION=v1.0.0-alpha.0 KUBERNETES_VERSION=v1.9.0 diff --git a/vendor.conf b/vendor.conf index ca4a7bc4a..bc709a487 100644 --- a/vendor.conf +++ b/vendor.conf @@ -1,7 +1,7 @@ github.com/blang/semver v3.1.0 github.com/BurntSushi/toml v0.2.0-21-g9906417 github.com/containerd/cgroups 29da22c6171a4316169f9205ab6c49f59b5b852f -github.com/containerd/containerd 12eaf13f6f12e5a4db52afe66876cf62fe7835cf +github.com/containerd/containerd ec15fe95aa8fd3abeb05d036e1579129c0ba7b1c github.com/containerd/continuity cf279e6ac893682272b4479d4c67fd3abf878b4e github.com/containerd/fifo fbfb6a11ec671efbe94ad1c12c2e98773f19e1e6 github.com/containerd/typeurl f6943554a7e7e88b3c14aad190bf05932da84788 @@ -32,10 +32,11 @@ github.com/gregjones/httpcache 787624de3eb7bd915c329cba748687a3b22666a6 github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f github.com/inconshreveable/mousetrap 76626ae9c91c4f2a10f34cad8ce83ea42c93bb75 -github.com/json-iterator/go 13f86432b882000a51c6e610c620974462691a97 +github.com/json-iterator/go 1.0.4 github.com/juju/ratelimit 5b9ff866471762aa2ab2dced63c9fb6f53921342 github.com/mailru/easyjson d5b7844b561a7bc640052f1b935f7b800330d7e0 github.com/Microsoft/go-winio v0.4.5 +github.com/Microsoft/hcsshim v0.6.7 github.com/opencontainers/go-digest 21dfd564fd89c944783d00d069f33e3e7123c448 github.com/opencontainers/image-spec v1.0.1 github.com/opencontainers/runc 9f9c96235cc97674e935002fc3d78361b696a69e @@ -53,7 +54,7 @@ github.com/sirupsen/logrus v1.0.0 github.com/spf13/cobra v0.0.1 github.com/spf13/pflag v1.0.0 github.com/stretchr/testify v1.1.4 -github.com/syndtr/gocapability e7cb7fa329f456b3855136a2642b197bad7366ba +github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 github.com/tchap/go-patricia 5ad6cdb7538b0097d5598c7e57f0a24072adf7dc golang.org/x/net 7dcfb8076726a3fdd9353b6b8a1f1b6be6811bd6 golang.org/x/sync 450f422ab23cf9881c94e2db30cac0eb1b7cf80c diff --git a/vendor/github.com/Microsoft/hcsshim/LICENSE b/vendor/github.com/Microsoft/hcsshim/LICENSE new file mode 100644 index 000000000..49d21669a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2015 Microsoft + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md new file mode 100644 index 000000000..30991a12e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -0,0 +1,12 @@ +# hcsshim + +This package supports launching Windows Server containers from Go. It is +primarily used in the [Docker Engine](https://github.com/docker/docker) project, +but it can be freely used by other projects as well. + +This project has adopted the [Microsoft Open Source Code of +Conduct](https://opensource.microsoft.com/codeofconduct/). For more information +see the [Code of Conduct +FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact +[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional +questions or comments. diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go new file mode 100644 index 000000000..6d824d7a7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/activatelayer.go @@ -0,0 +1,28 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(info DriverInfo, id string) error { + title := "hcsshim::ActivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = activateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/baselayer.go new file mode 100644 index 000000000..9babd4e18 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/baselayer.go @@ -0,0 +1,183 @@ +package hcsshim + +import ( + "errors" + "os" + "path/filepath" + "syscall" + + "github.com/Microsoft/go-winio" +) + +type baseLayerWriter struct { + root string + f *os.File + bw *winio.BackupFileWriter + err error + hasUtilityVM bool + dirInfo []dirInfo +} + +type dirInfo struct { + path string + fileInfo winio.FileBasicInfo +} + +// reapplyDirectoryTimes reapplies directory modification, creation, etc. times +// after processing of the directory tree has completed. The times are expected +// to be ordered such that parent directories come before child directories. +func reapplyDirectoryTimes(dis []dirInfo) error { + for i := range dis { + di := &dis[len(dis)-i-1] // reverse order: process child directories first + f, err := winio.OpenForBackup(di.path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, syscall.OPEN_EXISTING) + if err != nil { + return err + } + + err = winio.SetFileBasicInfo(f, &di.fileInfo) + f.Close() + if err != nil { + return err + } + } + return nil +} + +func (w *baseLayerWriter) closeCurrentFile() error { + if w.f != nil { + err := w.bw.Close() + err2 := w.f.Close() + w.f = nil + w.bw = nil + if err != nil { + return err + } + if err2 != nil { + return err2 + } + } + return nil +} + +func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + if filepath.ToSlash(name) == `UtilityVM/Files` { + w.hasUtilityVM = true + } + + path := filepath.Join(w.root, name) + path, err = makeLongAbsPath(path) + if err != nil { + return err + } + + var f *os.File + defer func() { + if f != nil { + f.Close() + } + }() + + createmode := uint32(syscall.CREATE_NEW) + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { + err := os.Mkdir(path, 0) + if err != nil && !os.IsExist(err) { + return err + } + createmode = syscall.OPEN_EXISTING + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.dirInfo = append(w.dirInfo, dirInfo{path, *fileInfo}) + } + } + + mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) + f, err = winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createmode) + if err != nil { + return makeError(err, "Failed to OpenForBackup", path) + } + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return makeError(err, "Failed to SetFileBasicInfo", path) + } + + w.f = f + w.bw = winio.NewBackupFileWriter(f, true) + f = nil + return nil +} + +func (w *baseLayerWriter) AddLink(name string, target string) (err error) { + defer func() { + if err != nil { + w.err = err + } + }() + + err = w.closeCurrentFile() + if err != nil { + return err + } + + linkpath, err := makeLongAbsPath(filepath.Join(w.root, name)) + if err != nil { + return err + } + + linktarget, err := makeLongAbsPath(filepath.Join(w.root, target)) + if err != nil { + return err + } + + return os.Link(linktarget, linkpath) +} + +func (w *baseLayerWriter) Remove(name string) error { + return errors.New("base layer cannot have tombstones") +} + +func (w *baseLayerWriter) Write(b []byte) (int, error) { + n, err := w.bw.Write(b) + if err != nil { + w.err = err + } + return n, err +} + +func (w *baseLayerWriter) Close() error { + err := w.closeCurrentFile() + if err != nil { + return err + } + if w.err == nil { + // Restore the file times of all the directories, since they may have + // been modified by creating child directories. + err = reapplyDirectoryTimes(w.dirInfo) + if err != nil { + return err + } + + err = ProcessBaseLayer(w.root) + if err != nil { + return err + } + + if w.hasUtilityVM { + err = ProcessUtilityVMImage(filepath.Join(w.root, "UtilityVM")) + if err != nil { + return err + } + } + } + return w.err +} diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/callback.go new file mode 100644 index 000000000..e8c2b00c8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/callback.go @@ -0,0 +1,79 @@ +package hcsshim + +import ( + "sync" + "syscall" +) + +var ( + nextCallback uintptr + callbackMap = map[uintptr]*notifcationWatcherContext{} + callbackMapLock = sync.RWMutex{} + + notificationWatcherCallback = syscall.NewCallback(notificationWatcher) + + // Notifications for HCS_SYSTEM handles + hcsNotificationSystemExited hcsNotification = 0x00000001 + hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002 + hcsNotificationSystemStartCompleted hcsNotification = 0x00000003 + hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004 + hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005 + + // Notifications for HCS_PROCESS handles + hcsNotificationProcessExited hcsNotification = 0x00010000 + + // Common notifications + hcsNotificationInvalid hcsNotification = 0x00000000 + hcsNotificationServiceDisconnect hcsNotification = 0x01000000 +) + +type hcsNotification uint32 +type notificationChannel chan error + +type notifcationWatcherContext struct { + channels notificationChannels + handle hcsCallback +} + +type notificationChannels map[hcsNotification]notificationChannel + +func newChannels() notificationChannels { + channels := make(notificationChannels) + + channels[hcsNotificationSystemExited] = make(notificationChannel, 1) + channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) + channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) + channels[hcsNotificationProcessExited] = make(notificationChannel, 1) + channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) + return channels +} +func closeChannels(channels notificationChannels) { + close(channels[hcsNotificationSystemExited]) + close(channels[hcsNotificationSystemCreateCompleted]) + close(channels[hcsNotificationSystemStartCompleted]) + close(channels[hcsNotificationSystemPauseCompleted]) + close(channels[hcsNotificationSystemResumeCompleted]) + close(channels[hcsNotificationProcessExited]) + close(channels[hcsNotificationServiceDisconnect]) +} + +func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { + var result error + if int32(notificationStatus) < 0 { + result = syscall.Errno(win32FromHresult(notificationStatus)) + } + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return 0 + } + + context.channels[notificationType] <- result + + return 0 +} diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/cgo.go new file mode 100644 index 000000000..200333233 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cgo.go @@ -0,0 +1,7 @@ +package hcsshim + +import "C" + +// This import is needed to make the library compile as CGO because HCSSHIM +// only works with CGO due to callbacks from HCS comming back from a C thread +// which is not supported without CGO. See https://github.com/golang/go/issues/10973 diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go new file mode 100644 index 000000000..3354f70ef --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -0,0 +1,800 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + "os" + "sync" + "syscall" + "time" + + "github.com/sirupsen/logrus" +) + +var ( + defaultTimeout = time.Minute * 4 +) + +const ( + pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}` + statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}` + processListQuery = `{ "PropertyTypes" : ["ProcessList"]}` + mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}` +) + +type container struct { + handleLock sync.RWMutex + handle hcsSystem + id string + callbackNumber uintptr +} + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties struct { + ID string `json:"Id"` + Name string + SystemType string + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + RuntimeID string `json:"RuntimeId,omitempty"` + IsRuntimeTemplate bool `json:",omitempty"` + RuntimeImagePath string `json:",omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` + MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController struct { + MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` +} + +// Type of Request Support in ModifySystem +type RequestType string + +// Type of Resource Support in ModifySystem +type ResourceType string + +// RequestType const +const ( + Add RequestType = "Add" + Remove RequestType = "Remove" + Network ResourceType = "Network" +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse struct { + Resource ResourceType `json:"ResourceType"` + Data interface{} `json:"Settings"` + Request RequestType `json:"RequestType,omitempty"` +} + +// createContainerAdditionalJSON is read from the environment at initialisation +// time. It allows an environment variable to define additional JSON which +// is merged in the CreateContainer call to HCS. +var createContainerAdditionalJSON string + +func init() { + createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON") +} + +// CreateContainer creates a new container with the given configuration but does not start it. +func CreateContainer(id string, c *ContainerConfig) (Container, error) { + return createContainerWithJSON(id, c, "") +} + +// CreateContainerWithJSON creates a new container with the given configuration but does not start it. +// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS. +func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { + return createContainerWithJSON(id, c, additionalJSON) +} + +func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { + operation := "CreateContainer" + title := "HCSShim::" + operation + + container := &container{ + id: id, + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, err + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", id, configuration) + + // Merge any additional JSON. Priority is given to what is passed in explicitly, + // falling back to what's set in the environment. + if additionalJSON == "" && createContainerAdditionalJSON != "" { + additionalJSON = createContainerAdditionalJSON + } + if additionalJSON != "" { + configurationMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil { + return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err) + } + + additionalMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil { + return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err) + } + + mergedMap := mergeMaps(additionalMap, configurationMap) + mergedJSON, err := json.Marshal(mergedMap) + if err != nil { + return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err) + } + + configuration = string(mergedJSON) + logrus.Debugf(title+" id=%s merged config=%s", id, configuration) + } + + var ( + resultp *uint16 + identity syscall.Handle + ) + createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp) + + if createError == nil || IsPending(createError) { + if err := container.registerCallback(); err != nil { + // Terminate the container if it still exists. We're okay to ignore a failure here. + container.Terminate() + return nil, makeContainerError(container, operation, "", err) + } + } + + err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout) + if err != nil { + if err == ErrTimeout { + // Terminate the container if it still exists. We're okay to ignore a failure here. + container.Terminate() + } + return nil, makeContainerError(container, operation, configuration, err) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle) + return container, nil +} + +// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values +// in ToMap are overwritten. Values in fromMap are added to ToMap. +// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang +func mergeMaps(fromMap, ToMap interface{}) interface{} { + switch fromMap := fromMap.(type) { + case map[string]interface{}: + ToMap, ok := ToMap.(map[string]interface{}) + if !ok { + return fromMap + } + for keyToMap, valueToMap := range ToMap { + if valueFromMap, ok := fromMap[keyToMap]; ok { + fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap) + } else { + fromMap[keyToMap] = valueToMap + } + } + case nil: + // merge(nil, map[string]interface{...}) -> map[string]interface{...} + ToMap, ok := ToMap.(map[string]interface{}) + if ok { + return ToMap + } + } + return fromMap +} + +// OpenContainer opens an existing container by ID. +func OpenContainer(id string) (Container, error) { + operation := "OpenContainer" + title := "HCSShim::" + operation + logrus.Debugf(title+" id=%s", id) + + container := &container{ + id: id, + } + + var ( + handle hcsSystem + resultp *uint16 + ) + err := hcsOpenComputeSystem(id, &handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + container.handle = handle + + if err := container.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) + return container, nil +} + +// GetContainers gets a list of the containers on the system that match the query +func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { + operation := "GetContainers" + title := "HCSShim::" + operation + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + + query := string(queryb) + logrus.Debugf(title+" query=%s", query) + + var ( + resultp *uint16 + computeSystemsp *uint16 + ) + err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if computeSystemsp == nil { + return nil, ErrUnexpectedValue + } + computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp) + computeSystems := []ContainerProperties{} + if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + return nil, err + } + + logrus.Debugf(title + " succeeded") + return computeSystems, nil +} + +// Start synchronously starts the container. +func (container *container) Start() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Start" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsStartComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Shutdown requests a container shutdown, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Shutdown() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Shutdown" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsShutdownComputeSystem(container.handle, "", &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Terminate requests a container terminate, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (container *container) Terminate() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Terminate" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsTerminateComputeSystem(container.handle, "", &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Wait synchronously waits for the container to shutdown or terminate. +func (container *container) Wait() error { + operation := "Wait" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. +// If the timeout expires, IsTimeout(err) == true +func (container *container) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) properties(query string) (*ContainerProperties, error) { + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + properties := &ContainerProperties{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + return properties, nil +} + +// HasPendingUpdates returns true if the container has updates pending to install +func (container *container) HasPendingUpdates() (bool, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "HasPendingUpdates" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return false, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(pendingUpdatesQuery) + if err != nil { + return false, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.AreUpdatesPending, nil +} + +// Statistics returns statistics for the container +func (container *container) Statistics() (Statistics, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Statistics" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(statisticsQuery) + if err != nil { + return Statistics{}, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.Statistics, nil +} + +// ProcessList returns an array of ProcessListItems for the container +func (container *container) ProcessList() ([]ProcessListItem, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "ProcessList" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(processListQuery) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.ProcessList, nil +} + +// MappedVirtualDisks returns a map of the controllers and the disks mapped +// to a container. +// +// Example of JSON returned by the query. +//{ +// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm", +// "SystemType":"Container", +// "RuntimeOsType":"Linux", +// "RuntimeId":"00000000-0000-0000-0000-000000000000", +// "State":"Running", +// "MappedVirtualDiskControllers":{ +// "0":{ +// "MappedVirtualDisks":{ +// "2":{ +// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx", +// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch", +// "Lun":2, +// "CreateInUtilityVM":true +// }, +// "3":{ +// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx", +// "Lun":3, +// "CreateInUtilityVM":true, +// "AttachOnly":true +// } +// } +// } +// } +//} +func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "MappedVirtualDiskList" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + properties, err := container.properties(mappedVirtualDiskQuery) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return properties.MappedVirtualDiskControllers, nil +} + +// Pause pauses the execution of the container. This feature is not enabled in TP5. +func (container *container) Pause() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Pause" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsPauseComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// Resume resumes the execution of the container. This feature is not enabled in TP5. +func (container *container) Resume() error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Resume" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsResumeComputeSystem(container.handle, "", &resultp) + err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout) + if err != nil { + return makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +// CreateProcess launches a new process within the container. +func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "CreateProcess" + title := "HCSShim::Container::" + operation + var ( + processInfo hcsProcessInformation + processHandle hcsProcess + resultp *uint16 + ) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + // If we are not emulating a console, ignore any console size passed to us + if !c.EmulateConsole { + c.ConsoleSize[0] = 0 + c.ConsoleSize[1] = 0 + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + configuration := string(configurationb) + logrus.Debugf(title+" id=%s config=%s", container.id, configuration) + + err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, configuration, err) + } + + process := &process{ + handle: processHandle, + processID: int(processInfo.ProcessId), + container: container, + cachedPipes: &cachedPipes{ + stdIn: processInfo.StdInput, + stdOut: processInfo.StdOutput, + stdErr: processInfo.StdError, + }, + } + + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID) + return process, nil +} + +// OpenProcess gets an interface to an existing process within the container. +func (container *container) OpenProcess(pid int) (Process, error) { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "OpenProcess" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s, processid=%d", container.id, pid) + var ( + processHandle hcsProcess + resultp *uint16 + ) + + if container.handle == 0 { + return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + process := &process{ + handle: processHandle, + processID: pid, + container: container, + } + + if err := process.registerCallback(); err != nil { + return nil, makeContainerError(container, operation, "", err) + } + + logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID) + return process, nil +} + +// Close cleans up any state associated with the container but does not terminate or wait for it. +func (container *container) Close() error { + container.handleLock.Lock() + defer container.handleLock.Unlock() + operation := "Close" + title := "HCSShim::Container::" + operation + logrus.Debugf(title+" id=%s", container.id) + + // Don't double free this + if container.handle == 0 { + return nil + } + + if err := container.unregisterCallback(); err != nil { + return makeContainerError(container, operation, "", err) + } + + if err := hcsCloseComputeSystem(container.handle); err != nil { + return makeContainerError(container, operation, "", err) + } + + container.handle = 0 + + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} + +func (container *container) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + container.callbackNumber = callbackNumber + + return nil +} + +func (container *container) unregisterCallback() error { + callbackNumber := container.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterComputeSystemCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} + +// Modifies the System by sending a request to HCS +func (container *container) Modify(config *ResourceModificationRequestResponse) error { + container.handleLock.RLock() + defer container.handleLock.RUnlock() + operation := "Modify" + title := "HCSShim::Container::" + operation + + if container.handle == 0 { + return makeContainerError(container, operation, "", ErrAlreadyClosed) + } + + requestJSON, err := json.Marshal(config) + if err != nil { + return err + } + + requestString := string(requestJSON) + logrus.Debugf(title+" id=%s request=%s", container.id, requestString) + + var resultp *uint16 + err = hcsModifyComputeSystem(container.handle, requestString, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeContainerError(container, operation, "", err) + } + logrus.Debugf(title+" succeeded id=%s", container.id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go new file mode 100644 index 000000000..035d9c394 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createlayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(info DriverInfo, id, parent string) error { + title := "hcsshim::CreateLayer " + logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createLayer(&infop, id, parent) + if err != nil { + err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go new file mode 100644 index 000000000..7a6a8854c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go @@ -0,0 +1,35 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// CreateSandboxLayer creates and populates new read-write layer for use by a container. +// This requires both the id of the direct parent layer, as well as the full list +// of paths to all parent layers up to the base (and including the direct parent +// whose id was provided). +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + title := "hcsshim::CreateSandboxLayer " + logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = createSandboxLayer(&infop, layerId, parentId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go new file mode 100644 index 000000000..fd785030f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(info DriverInfo, id string) error { + title := "hcsshim::DeactivateLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = deactivateLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go new file mode 100644 index 000000000..b1e3b89fc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/destroylayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// DestroyLayer will remove the on-disk files representing the layer with the given +// id, including that layer's containing folder, if any. +func DestroyLayer(info DriverInfo, id string) error { + title := "hcsshim::DestroyLayer " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = destroyLayer(&infop, id) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go new file mode 100644 index 000000000..c0c6cac87 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -0,0 +1,261 @@ +package hcsshim + +import ( + "errors" + "fmt" + "syscall" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = syscall.Errno(0x32) + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = syscall.Errno(0xd) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = syscall.Errno(0x7f) + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = errors.New("unsupported platform request") +) + +type EndpointNotFoundError struct { + EndpointName string +} + +func (e EndpointNotFoundError) Error() string { + return fmt.Sprintf("Endpoint %s not found", e.EndpointName) +} + +type NetworkNotFoundError struct { + NetworkName string +} + +func (e NetworkNotFoundError) Error() string { + return fmt.Sprintf("Network %s not found", e.NetworkName) +} + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + Process *process + Operation string + ExtraInfo string + Err error +} + +// ContainerError is an error encountered in HCS during an operation on a Container object +type ContainerError struct { + Container *container + Operation string + ExtraInfo string + Err error +} + +func (e *ContainerError) Error() string { + if e == nil { + return "" + } + + if e.Container == nil { + return "unexpected nil container for error: " + e.Err.Error() + } + + s := "container " + e.Container.id + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + if e.ExtraInfo != "" { + s += " extra info: " + e.ExtraInfo + } + + return s +} + +func makeContainerError(container *container, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ContainerError); ok { + return err + } + containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err} + return containerError +} + +func (e *ProcessError) Error() string { + if e == nil { + return "" + } + + if e.Process == nil { + return "Unexpected nil process for error: " + e.Err.Error() + } + + s := fmt.Sprintf("process %d", e.Process.processID) + + if e.Process.container != nil { + s += " in container " + e.Process.container.id + } + + if e.Operation != "" { + s += " encountered an error during " + e.Operation + } + + switch e.Err.(type) { + case nil: + break + case syscall.Errno: + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + default: + s += fmt.Sprintf(": %s", e.Err.Error()) + } + + return s +} + +func makeProcessError(process *process, operation string, extraInfo string, err error) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err} + return processError +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + if _, ok := err.(EndpointNotFoundError); ok { + return true + } + if _, ok := err.(NetworkNotFoundError); ok { + return true + } + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + err = getInnerError(err) + return err == ErrAlreadyClosed +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + err = getInnerError(err) + // If Platform doesn't recognize or support the request sent, below errors are seen + return err == ErrVmcomputeInvalidJSON || + err == ErrInvalidData || + err == ErrNotSupported || + err == ErrVmcomputeUnknownMessage +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *ContainerError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go new file mode 100644 index 000000000..6946c6a84 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go @@ -0,0 +1,26 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// ExpandSandboxSize expands the size of a layer to at least size bytes. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + title := "hcsshim::ExpandSandboxSize " + logrus.Debugf(title+"layerId=%s size=%d", layerId, size) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = expandSandboxSize(&infop, layerId, size) + if err != nil { + err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/exportlayer.go new file mode 100644 index 000000000..d7025f20b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/exportlayer.go @@ -0,0 +1,156 @@ +package hcsshim + +import ( + "io" + "io/ioutil" + "os" + "syscall" + + "github.com/Microsoft/go-winio" + "github.com/sirupsen/logrus" +) + +// ExportLayer will create a folder at exportFolderPath and fill that folder with +// the transport format version of the layer identified by layerId. This transport +// format includes any metadata required for later importing the layer (using +// ImportLayer), and requires the full list of parent layer paths in order to +// perform the export. +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ExportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = exportLayer(&infop, layerId, exportFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath) + return nil +} + +type LayerReader interface { + Next() (string, int64, *winio.FileBasicInfo, error) + Read(b []byte) (int, error) + Close() error +} + +// FilterLayerReader provides an interface for extracting the contents of an on-disk layer. +type FilterLayerReader struct { + context uintptr +} + +// Next reads the next available file from a layer, ensuring that parent directories are always read +// before child files and directories. +// +// Next returns the file's relative path, size, and basic file metadata. Read() should be used to +// extract a Win32 backup stream with the remainder of the metadata and the data. +func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) { + var fileNamep *uint16 + fileInfo := &winio.FileBasicInfo{} + var deleted uint32 + var fileSize int64 + err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted) + if err != nil { + if err == syscall.ERROR_NO_MORE_FILES { + err = io.EOF + } else { + err = makeError(err, "ExportLayerNext", "") + } + return "", 0, nil, err + } + fileName := convertAndFreeCoTaskMemString(fileNamep) + if deleted != 0 { + fileInfo = nil + } + if fileName[0] == '\\' { + fileName = fileName[1:] + } + return fileName, fileSize, fileInfo, nil +} + +// Read reads from the current file's Win32 backup stream. +func (r *FilterLayerReader) Read(b []byte) (int, error) { + var bytesRead uint32 + err := exportLayerRead(r.context, b, &bytesRead) + if err != nil { + return 0, makeError(err, "ExportLayerRead", "") + } + if bytesRead == 0 { + return 0, io.EOF + } + return int(bytesRead), nil +} + +// Close frees resources associated with the layer reader. It will return an +// error if there was an error while reading the layer or of the layer was not +// completely read. +func (r *FilterLayerReader) Close() (err error) { + if r.context != 0 { + err = exportLayerEnd(r.context) + if err != nil { + err = makeError(err, "ExportLayerEnd", "") + } + r.context = 0 + } + return +} + +// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. +// The caller must have taken the SeBackupPrivilege privilege +// to call this and any methods on the resulting LayerReader. +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + if procExportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + err = ExportLayer(info, layerID, path, parentLayerPaths) + if err != nil { + os.RemoveAll(path) + return nil, err + } + return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil + } + + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + r := &FilterLayerReader{} + err = exportLayerBegin(&infop, layerID, layers, &r.context) + if err != nil { + return nil, makeError(err, "ExportLayerBegin", "") + } + return r, err +} + +type legacyLayerReaderWrapper struct { + *legacyLayerReader +} + +func (r *legacyLayerReaderWrapper) Close() error { + err := r.legacyLayerReader.Close() + os.RemoveAll(r.root) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go new file mode 100644 index 000000000..89f8079d0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go @@ -0,0 +1,55 @@ +package hcsshim + +import ( + "syscall" + + "github.com/sirupsen/logrus" +) + +// GetLayerMountPath will look for a mounted layer with the given id and return +// the path at which that layer can be accessed. This path may be a volume path +// if the layer is a mounted read-write layer, otherwise it is expected to be the +// folder path at which the layer is stored. +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + title := "hcsshim::GetLayerMountPath " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return "", err + } + + var mountPathLength uintptr + mountPathLength = 0 + + // Call the procedure itself. + logrus.Debugf("Calling proc (1)") + err = getLayerMountPath(&infop, id, &mountPathLength, nil) + if err != nil { + err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + // Allocate a mount path of the returned length. + if mountPathLength == 0 { + return "", nil + } + mountPathp := make([]uint16, mountPathLength) + mountPathp[0] = 0 + + // Call the procedure again + logrus.Debugf("Calling proc (2)") + err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0]) + if err != nil { + err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return "", err + } + + path := syscall.UTF16ToString(mountPathp[0:]) + logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path) + return path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go new file mode 100644 index 000000000..05d3d9532 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go @@ -0,0 +1,22 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// GetSharedBaseImages will enumerate the images stored in the common central +// image store and return descriptive info about those images for the purpose +// of registering them with the graphdriver, graph, and tagstore. +func GetSharedBaseImages() (imageData string, err error) { + title := "hcsshim::GetSharedBaseImages " + + logrus.Debugf("Calling proc") + var buffer *uint16 + err = getBaseImages(&buffer) + if err != nil { + err = makeError(err, title, "") + logrus.Error(err) + return + } + imageData = convertAndFreeCoTaskMemString(buffer) + logrus.Debugf(title+" - succeeded output=%s", imageData) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go new file mode 100644 index 000000000..620aba123 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/guid.go @@ -0,0 +1,19 @@ +package hcsshim + +import ( + "crypto/sha1" + "fmt" +) + +type GUID [16]byte + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go new file mode 100644 index 000000000..236ba1fa3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -0,0 +1,166 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcsshim + +import ( + "fmt" + "syscall" + "unsafe" + + "github.com/sirupsen/logrus" +) + +//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree +//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? +//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? +//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? +//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? + +//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? +//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? +//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? +//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +const ( + // Specific user-visible exit codes + WaitErrExecFailed = 32767 + + ERROR_GEN_FAILURE = syscall.Errno(31) + ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) + WSAEINVAL = syscall.Errno(10022) + + // Timeout on wait calls + TimeoutInfinite = 0xFFFFFFFF +) + +type HcsError struct { + title string + rest string + Err error +} + +type hcsSystem syscall.Handle +type hcsProcess syscall.Handle +type hcsCallback syscall.Handle + +type hcsProcessInformation struct { + ProcessId uint32 + Reserved uint32 + StdInput syscall.Handle + StdOutput syscall.Handle + StdError syscall.Handle +} + +func makeError(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func makeErrorf(err error, title, format string, a ...interface{}) error { + return makeError(err, title, fmt.Sprintf(format, a...)) +} + +func win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} + +func win32FromHresult(hr uintptr) uintptr { + if hr&0x1fff0000 == 0x00070000 { + return hr & 0xffff + } + return hr +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func convertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte { + return []byte(convertAndFreeCoTaskMemString(buffer)) +} + +func processHcsResult(err error, resultp *uint16) error { + if resultp != nil { + result := convertAndFreeCoTaskMemString(resultp) + logrus.Debugf("Result: %s", result) + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go new file mode 100644 index 000000000..7e516f8a2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -0,0 +1,323 @@ +package hcsshim + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + DisableICC bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` + IsRemoteEndpoint bool `json:",omitempty"` +} + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest struct { + ContainerID string `json:"ContainerId,omitempty"` + SystemType SystemType `json:"SystemType"` + CompartmentID uint16 `json:"CompartmentId,omitempty"` + VirtualNICName string `json:"VirtualNicName,omitempty"` +} + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse struct { + Success bool + Error string +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + var endpoint []HNSEndpoint + err := hnsCall("GET", "/endpoints/", "", &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container +func HotAttachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Add) +} + +// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container +func HotDetachEndpoint(containerID string, endpointID string) error { + return modifyNetworkEndpoint(containerID, endpointID, Remove) +} + +// ModifyContainer corresponding to the container id, by sending a request +func modifyContainer(id string, request *ResourceModificationRequestResponse) error { + container, err := OpenContainer(id) + if err != nil { + if IsNotExist(err) { + return ErrComputeSystemDoesNotExist + } + return getInnerError(err) + } + defer container.Close() + err = container.Modify(request) + if err != nil { + if IsNotSupported(err) { + return ErrPlatformNotSupported + } + return getInnerError(err) + } + + return nil +} + +func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error { + requestMessage := &ResourceModificationRequestResponse{ + Resource: Network, + Request: request, + Data: endpointID, + } + err := modifyContainer(containerID, requestMessage) + + if err != nil { + return err + } + + return nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return HNSEndpointRequest("GET", endpointID, "") +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + hnsResponse, err := HNSListEndpointRequest() + if err != nil { + return nil, err + } + for _, hnsEndpoint := range hnsResponse { + if hnsEndpoint.Name == endpointName { + return &hnsEndpoint, nil + } + } + return nil, EndpointNotFoundError{EndpointName: endpointName} +} + +// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods +func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { + operation := "Create" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + return HNSEndpointRequest("POST", "", string(jsonString)) +} + +// Delete Endpoint by sending EndpointRequest to HNS +func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { + operation := "Delete" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + return HNSEndpointRequest("DELETE", endpoint.Id, "") +} + +// Update Endpoint +func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { + operation := "Update" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) + + return endpoint, err +} + +// ContainerHotAttach attaches an endpoint to a running container +func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error { + operation := "ContainerHotAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) + + return modifyNetworkEndpoint(containerID, endpoint.Id, Add) +} + +// ContainerHotDetach detaches an endpoint from a running container +func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error { + operation := "ContainerHotDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) + + return modifyNetworkEndpoint(containerID, endpoint.Id, Remove) +} + +// ApplyACLPolicy applies a set of ACL Policies on the Endpoint +func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error { + operation := "ApplyACLPolicy" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + for _, policy := range policies { + if policy == nil { + continue + } + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies = append(endpoint.Policies, jsonString) + } + + _, err := endpoint.Update() + return err +} + +// ContainerAttach attaches an endpoint to container +func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { + operation := "ContainerAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + CompartmentID: compartmentID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// ContainerDetach detaches an endpoint from container +func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { + operation := "ContainerDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// HostAttach attaches a nic on the host +func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { + operation := "HostAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + CompartmentID: compartmentID, + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) + +} + +// HostDetach detaches a nic on the host +func (endpoint *HNSEndpoint) HostDetach() error { + operation := "HostDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// VirtualMachineNICAttach attaches a endpoint to a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { + operation := "VirtualMachineNicAttach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + VirtualNICName: virtualMachineNICName, + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// VirtualMachineNICDetach detaches a endpoint from a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { + operation := "VirtualMachineNicDetach" + title := "HCSShim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go new file mode 100644 index 000000000..2c1b979ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go @@ -0,0 +1,40 @@ +package hcsshim + +import ( + "encoding/json" + "fmt" + + "github.com/sirupsen/logrus" +) + +func hnsCall(method, path, request string, returnResponse interface{}) error { + var responseBuffer *uint16 + logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) + + err := _hnsCall(method, path, request, &responseBuffer) + if err != nil { + return makeError(err, "hnsCall ", "") + } + response := convertAndFreeCoTaskMemString(responseBuffer) + + hnsresponse := &hnsResponse{} + if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { + return err + } + + if !hnsresponse.Success { + return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + } + + if len(hnsresponse.Output) == 0 { + return nil + } + + logrus.Debugf("Network Response : %s", hnsresponse.Output) + err = json.Unmarshal(hnsresponse.Output, returnResponse) + if err != nil { + return err + } + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go new file mode 100644 index 000000000..04c1b5919 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -0,0 +1,141 @@ +package hcsshim + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` + ManagementIP string `json:",omitempty"` + AutomaticDNS bool `json:",omitempty"` +} + +type hnsNetworkResponse struct { + Success bool + Error string + Output HNSNetwork +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return HNSNetworkRequest("GET", networkID, "") +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + hsnnetworks, err := HNSListNetworkRequest("GET", "", "") + if err != nil { + return nil, err + } + for _, hnsnetwork := range hsnnetworks { + if hnsnetwork.Name == networkName { + return &hnsnetwork, nil + } + } + return nil, NetworkNotFoundError{NetworkName: networkName} +} + +// Create Network by sending NetworkRequest to HNS. +func (network *HNSNetwork) Create() (*HNSNetwork, error) { + operation := "Create" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + return HNSNetworkRequest("POST", "", string(jsonString)) +} + +// Delete Network by sending NetworkRequest to HNS +func (network *HNSNetwork) Delete() (*HNSNetwork, error) { + operation := "Delete" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + return HNSNetworkRequest("DELETE", network.Id, "") +} + +// Creates an endpoint on the Network. +func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { + return &HNSEndpoint{ + VirtualNetwork: network.Id, + IPAddress: ipAddress, + MacAddress: string(macAddress), + } +} + +func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateEndpoint" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) + + endpoint.VirtualNetwork = network.Id + return endpoint.Create() +} + +func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateRemoteEndpoint" + title := "HCSShim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + endpoint.IsRemoteEndpoint = true + return network.CreateEndpoint(endpoint) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go new file mode 100644 index 000000000..65b8e93d9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -0,0 +1,94 @@ +package hcsshim + +// Type of Request Support in ModifySystem +type PolicyType string + +// RequestType const +const ( + Nat PolicyType = "NAT" + ACL PolicyType = "ACL" + PA PolicyType = "PA" + VLAN PolicyType = "VLAN" + VSID PolicyType = "VSID" + VNet PolicyType = "VNET" + L2Driver PolicyType = "L2Driver" + Isolation PolicyType = "Isolation" + QOS PolicyType = "QOS" + OutboundNat PolicyType = "OutBoundNAT" + ExternalLoadBalancer PolicyType = "ELB" + Route PolicyType = "ROUTE" +) + +type NatPolicy struct { + Type PolicyType `json:"Type"` + Protocol string + InternalPort uint16 + ExternalPort uint16 +} + +type QosPolicy struct { + Type PolicyType `json:"Type"` + MaximumOutgoingBandwidthInBytes uint64 +} + +type IsolationPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint + VSID uint + InDefaultIsolation bool +} + +type VlanPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint +} + +type VsidPolicy struct { + Type PolicyType `json:"Type"` + VSID uint +} + +type PaPolicy struct { + Type PolicyType `json:"Type"` + PA string `json:"PA"` +} + +type OutboundNatPolicy struct { + Policy + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` +} + +type ActionType string +type DirectionType string +type RuleType string + +const ( + Allow ActionType = "Allow" + Block ActionType = "Block" + + In DirectionType = "In" + Out DirectionType = "Out" + + Host RuleType = "Host" + Switch RuleType = "Switch" +) + +type ACLPolicy struct { + Type PolicyType `json:"Type"` + Protocol uint16 + InternalPort uint16 + Action ActionType + Direction DirectionType + LocalAddresses string + RemoteAddresses string + LocalPort uint16 + RemotePort uint16 + RuleType RuleType `json:"RuleType,omitempty"` + Priority uint16 + ServiceName string +} + +type Policy struct { + Type PolicyType `json:"Type"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go new file mode 100644 index 000000000..bbd7e1edb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -0,0 +1,200 @@ +package hcsshim + +import ( + "encoding/json" + + "github.com/sirupsen/logrus" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy struct { + Policy + DestinationPrefix string `json:"DestinationPrefix,omitempty"` + NextHop string `json:"NextHop,omitempty"` + EncapEnabled bool `json:"NeedEncap,omitempty"` +} + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy struct { + LBPolicy + SourceVIP string `json:"SourceVIP,omitempty"` + VIPs []string `json:"VIPs,omitempty"` + ILB bool `json:"ILB,omitempty"` +} + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy struct { + Policy + Protocol uint16 `json:"Protocol,omitempty"` + InternalPort uint16 + ExternalPort uint16 +} + +// PolicyList is a structure defining schema for Policy list request +type PolicyList struct { + ID string `json:"ID,omitempty"` + EndpointReferences []string `json:"References,omitempty"` + Policies []json.RawMessage `json:"Policies,omitempty"` +} + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + var policy PolicyList + err := hnsCall(method, "/policylists/"+path, request, &policy) + if err != nil { + return nil, err + } + + return &policy, nil +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + var plist []PolicyList + err := hnsCall("GET", "/policylists/", "", &plist) + if err != nil { + return nil, err + } + + return plist, nil +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + policylist := &PolicyList{} + err := hnsCall(method, "/policylists/"+path, request, &policylist) + if err != nil { + return nil, err + } + + return policylist, nil +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return PolicyListRequest("GET", policyListID, "") +} + +// Create PolicyList by sending PolicyListRequest to HNS. +func (policylist *PolicyList) Create() (*PolicyList, error) { + operation := "Create" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + jsonString, err := json.Marshal(policylist) + if err != nil { + return nil, err + } + return PolicyListRequest("POST", "", string(jsonString)) +} + +// Delete deletes PolicyList +func (policylist *PolicyList) Delete() (*PolicyList, error) { + operation := "Delete" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + + return PolicyListRequest("DELETE", policylist.ID, "") +} + +// AddEndpoint add an endpoint to a Policy List +func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "AddEndpoint" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + + return policylist.Create() +} + +// RemoveEndpoint removes an endpoint from the Policy List +func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "RemoveEndpoint" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + elementToRemove := "/endpoints/" + endpoint.Id + + var references []string + + for _, endpointReference := range policylist.EndpointReferences { + if endpointReference == elementToRemove { + continue + } + references = append(references, endpointReference) + } + policylist.EndpointReferences = references + return policylist.Create() +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + operation := "AddLoadBalancer" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) + + policylist := &PolicyList{} + + elbPolicy := &ELBPolicy{ + SourceVIP: sourceVIP, + ILB: isILB, + } + + if len(vip) > 0 { + elbPolicy.VIPs = []string{vip} + } + elbPolicy.Type = ExternalLoadBalancer + elbPolicy.Protocol = protocol + elbPolicy.InternalPort = internalPort + elbPolicy.ExternalPort = externalPort + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(elbPolicy) + if err != nil { + return nil, err + } + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + operation := "AddRoute" + title := "HCSShim::PolicyList::" + operation + logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) + + policylist := &PolicyList{} + + rPolicy := &RoutePolicy{ + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + EncapEnabled: encapEnabled, + } + rPolicy.Type = Route + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(rPolicy) + if err != nil { + return nil, err + } + + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/importlayer.go new file mode 100644 index 000000000..3aed14376 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/importlayer.go @@ -0,0 +1,212 @@ +package hcsshim + +import ( + "errors" + "io/ioutil" + "os" + "path/filepath" + + "github.com/Microsoft/go-winio" + "github.com/sirupsen/logrus" +) + +// ImportLayer will take the contents of the folder at importFolderPath and import +// that into a layer with the id layerId. Note that in order to correctly populate +// the layer and interperet the transport format, all parent layers must already +// be present on the system at the paths provided in parentLayerPaths. +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + title := "hcsshim::ImportLayer " + logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = importLayer(&infop, layerID, importFolderPath, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath) + return nil +} + +// LayerWriter is an interface that supports writing a new container image layer. +type LayerWriter interface { + // Add adds a file to the layer with given metadata. + Add(name string, fileInfo *winio.FileBasicInfo) error + // AddLink adds a hard link to the layer. The target must already have been added. + AddLink(name string, target string) error + // Remove removes a file that was present in a parent layer from the layer. + Remove(name string) error + // Write writes data to the current file. The data must be in the format of a Win32 + // backup stream. + Write(b []byte) (int, error) + // Close finishes the layer writing process and releases any resources. + Close() error +} + +// FilterLayerWriter provides an interface to write the contents of a layer to the file system. +type FilterLayerWriter struct { + context uintptr +} + +// Add adds a file or directory to the layer. The file's parent directory must have already been added. +// +// name contains the file's relative path. fileInfo contains file times and file attributes; the rest +// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method. +// winio.BackupStreamWriter can be used to facilitate this. +func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, fileInfo) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// AddLink adds a hard link to the layer. The target of the link must have already been added. +func (w *FilterLayerWriter) AddLink(name string, target string) error { + return errors.New("hard links not yet supported") +} + +// Remove removes a file from the layer. The file must have been present in the parent layer. +// +// name contains the file's relative path. +func (w *FilterLayerWriter) Remove(name string) error { + if name[0] != '\\' { + name = `\` + name + } + err := importLayerNext(w.context, name, nil) + if err != nil { + return makeError(err, "ImportLayerNext", "") + } + return nil +} + +// Write writes more backup stream data to the current file. +func (w *FilterLayerWriter) Write(b []byte) (int, error) { + err := importLayerWrite(w.context, b) + if err != nil { + err = makeError(err, "ImportLayerWrite", "") + return 0, err + } + return len(b), err +} + +// Close completes the layer write operation. The error must be checked to ensure that the +// operation was successful. +func (w *FilterLayerWriter) Close() (err error) { + if w.context != 0 { + err = importLayerEnd(w.context) + if err != nil { + err = makeError(err, "ImportLayerEnd", "") + } + w.context = 0 + } + return +} + +type legacyLayerWriterWrapper struct { + *legacyLayerWriter + info DriverInfo + layerID string + path string + parentLayerPaths []string +} + +func (r *legacyLayerWriterWrapper) Close() error { + defer os.RemoveAll(r.root) + err := r.legacyLayerWriter.Close() + if err != nil { + return err + } + + // Use the original path here because ImportLayer does not support long paths for the source in TP5. + // But do use a long path for the destination to work around another bug with directories + // with MAX_PATH - 12 < length < MAX_PATH. + info := r.info + fullPath, err := makeLongAbsPath(filepath.Join(info.HomeDir, r.layerID)) + if err != nil { + return err + } + + info.HomeDir = "" + if err = ImportLayer(info, fullPath, r.path, r.parentLayerPaths); err != nil { + return err + } + // Add any hard links that were collected. + for _, lnk := range r.PendingLinks { + if err = os.Remove(lnk.Path); err != nil && !os.IsNotExist(err) { + return err + } + if err = os.Link(lnk.Target, lnk.Path); err != nil { + return err + } + } + // Prepare the utility VM for use if one is present in the layer. + if r.HasUtilityVM { + err = ProcessUtilityVMImage(filepath.Join(fullPath, "UtilityVM")) + if err != nil { + return err + } + } + return nil +} + +// NewLayerWriter returns a new layer writer for creating a layer on disk. +// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges +// to call this and any methods on the resulting LayerWriter. +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + if len(parentLayerPaths) == 0 { + // This is a base layer. It gets imported differently. + return &baseLayerWriter{ + root: filepath.Join(info.HomeDir, layerID), + }, nil + } + + if procImportLayerBegin.Find() != nil { + // The new layer reader is not available on this Windows build. Fall back to the + // legacy export code path. + path, err := ioutil.TempDir("", "hcs") + if err != nil { + return nil, err + } + return &legacyLayerWriterWrapper{ + legacyLayerWriter: newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)), + info: info, + layerID: layerID, + path: path, + parentLayerPaths: parentLayerPaths, + }, nil + } + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return nil, err + } + + infop, err := convertDriverInfo(info) + if err != nil { + return nil, err + } + + w := &FilterLayerWriter{} + err = importLayerBegin(&infop, layerID, layers, &w.context) + if err != nil { + return nil, makeError(err, "ImportLayerStart", "") + } + return w, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go new file mode 100644 index 000000000..e21f30025 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -0,0 +1,188 @@ +package hcsshim + +import ( + "encoding/json" + "io" + "time" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string `json:",omitempty"` + CommandLine string `json:",omitempty"` + CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows + User string `json:",omitempty"` + WorkingDirectory string `json:",omitempty"` + Environment map[string]string `json:",omitempty"` + EmulateConsole bool `json:",omitempty"` + CreateStdInPipe bool `json:",omitempty"` + CreateStdOutPipe bool `json:",omitempty"` + CreateStdErrPipe bool `json:",omitempty"` + ConsoleSize [2]uint `json:",omitempty"` + CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows + OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 + CreateInUtilityVM bool +} + +type MappedPipe struct { + HostPath string + ContainerPipeName string +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` + LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM + LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM + LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode + BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD + WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD +} + +type MappedVirtualDisk struct { + HostPath string `json:",omitempty"` // Path to VHD on the host + ContainerPath string // Platform-specific mount point path in the container + CreateInUtilityVM bool `json:",omitempty"` + ReadOnly bool `json:",omitempty"` + Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" + AttachOnly bool `json:",omitempty:` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string `json:",omitempty"` // The management platform that created this container + VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} + IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows + LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID + Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. + ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string `json:",omitempty"` // Hostname + MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) + MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes + HvPartition bool // True if it a Hyper-V Container + NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. + EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container + HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM + Servicing bool `json:",omitempty"` // True if this container is for servicing + AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution + DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. + TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed + MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start +} + +type ComputeSystemQuery struct { + IDs []string `json:"Ids,omitempty"` + Types []string `json:",omitempty"` + Names []string `json:",omitempty"` + Owners []string `json:",omitempty"` +} + +// Container represents a created (but not necessarily running) container. +type Container interface { + // Start synchronously starts the container. + Start() error + + // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. + Shutdown() error + + // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. + Terminate() error + + // Waits synchronously waits for the container to shutdown or terminate. + Wait() error + + // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It + // returns false if timeout occurs. + WaitTimeout(time.Duration) error + + // Pause pauses the execution of a container. + Pause() error + + // Resume resumes the execution of a container. + Resume() error + + // HasPendingUpdates returns true if the container has updates pending to install. + HasPendingUpdates() (bool, error) + + // Statistics returns statistics for a container. + Statistics() (Statistics, error) + + // ProcessList returns details for the processes in a container. + ProcessList() ([]ProcessListItem, error) + + // MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller + MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) + + // CreateProcess launches a new process within the container. + CreateProcess(c *ProcessConfig) (Process, error) + + // OpenProcess gets an interface to an existing process within the container. + OpenProcess(pid int) (Process, error) + + // Close cleans up any state associated with the container but does not terminate or wait for it. + Close() error + + // Modify the System + Modify(config *ResourceModificationRequestResponse) error +} + +// Process represents a running or exited process. +type Process interface { + // Pid returns the process ID of the process within the container. + Pid() int + + // Kill signals the process to terminate but does not wait for it to finish terminating. + Kill() error + + // Wait waits for the process to exit. + Wait() error + + // WaitTimeout waits for the process to exit or the duration to elapse. It returns + // false if timeout occurs. + WaitTimeout(time.Duration) error + + // ExitCode returns the exit code of the process. The process must have + // already terminated. + ExitCode() (int, error) + + // ResizeConsole resizes the console of the process. + ResizeConsole(width, height uint16) error + + // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing + // these pipes does not close the underlying pipes; it should be possible to + // call this multiple times to get multiple interfaces. + Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) + + // CloseStdin closes the write side of the stdin pipe so that the process is + // notified on the read side that there is no more data in stdin. + CloseStdin() error + + // Close cleans up any state associated with the process but does not kill + // or wait on it. + Close() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go new file mode 100644 index 000000000..fe46f404c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerexists.go @@ -0,0 +1,30 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(info DriverInfo, id string) (bool, error) { + title := "hcsshim::LayerExists " + logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return false, err + } + + // Call the procedure itself. + var exists uint32 + + err = layerExists(&infop, id, &exists) + if err != nil { + err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) + logrus.Error(err) + return false, err + } + + logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists) + return exists != 0, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/layerutils.go new file mode 100644 index 000000000..c0e550377 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layerutils.go @@ -0,0 +1,111 @@ +package hcsshim + +// This file contains utility functions to support storage (graph) related +// functionality. + +import ( + "path/filepath" + "syscall" + + "github.com/sirupsen/logrus" +) + +/* To pass into syscall, we need a struct matching the following: +enum GraphDriverType +{ + DiffDriver, + FilterDriver +}; + +struct DriverInfo { + GraphDriverType Flavour; + LPCWSTR HomeDir; +}; +*/ +type DriverInfo struct { + Flavour int + HomeDir string +} + +type driverInfo struct { + Flavour int + HomeDirp *uint16 +} + +func convertDriverInfo(info DriverInfo) (driverInfo, error) { + homedirp, err := syscall.UTF16PtrFromString(info.HomeDir) + if err != nil { + logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error()) + return driverInfo{}, err + } + + return driverInfo{ + Flavour: info.Flavour, + HomeDirp: homedirp, + }, nil +} + +/* To pass into syscall, we need a struct matching the following: +typedef struct _WC_LAYER_DESCRIPTOR { + + // + // The ID of the layer + // + + GUID LayerId; + + // + // Additional flags + // + + union { + struct { + ULONG Reserved : 31; + ULONG Dirty : 1; // Created from sandbox as a result of snapshot + }; + ULONG Value; + } Flags; + + // + // Path to the layer root directory, null-terminated + // + + PCWSTR Path; + +} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; +*/ +type WC_LAYER_DESCRIPTOR struct { + LayerId GUID + Flags uint32 + Pathp *uint16 +} + +func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) { + // Array of descriptors that gets constructed. + var layers []WC_LAYER_DESCRIPTOR + + for i := 0; i < len(parentLayerPaths); i++ { + // Create a layer descriptor, using the folder name + // as the source for a GUID LayerId + _, folderName := filepath.Split(parentLayerPaths[i]) + g, err := NameToGuid(folderName) + if err != nil { + logrus.Debugf("Failed to convert name to guid %s", err) + return nil, err + } + + p, err := syscall.UTF16PtrFromString(parentLayerPaths[i]) + if err != nil { + logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err) + return nil, err + } + + layers = append(layers, WC_LAYER_DESCRIPTOR{ + LayerId: g, + Flags: 0, + Pathp: p, + }) + } + + return layers, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/legacy.go new file mode 100644 index 000000000..a0a97d7c7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/legacy.go @@ -0,0 +1,748 @@ +package hcsshim + +import ( + "bufio" + "encoding/binary" + "errors" + "fmt" + "io" + "os" + "path/filepath" + "strings" + "syscall" + + "github.com/Microsoft/go-winio" +) + +var errorIterationCanceled = errors.New("") + +var mutatedUtilityVMFiles = map[string]bool{ + `EFI\Microsoft\Boot\BCD`: true, + `EFI\Microsoft\Boot\BCD.LOG`: true, + `EFI\Microsoft\Boot\BCD.LOG1`: true, + `EFI\Microsoft\Boot\BCD.LOG2`: true, +} + +const ( + filesPath = `Files` + hivesPath = `Hives` + utilityVMPath = `UtilityVM` + utilityVMFilesPath = `UtilityVM\Files` +) + +func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) { + return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) +} + +func makeLongAbsPath(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} + +func hasPathPrefix(p, prefix string) bool { + return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' +} + +type fileEntry struct { + path string + fi os.FileInfo + err error +} + +type legacyLayerReader struct { + root string + result chan *fileEntry + proceed chan bool + currentFile *os.File + backupReader *winio.BackupFileReader +} + +// newLegacyLayerReader returns a new LayerReader that can read the Windows +// container layer transport format from disk. +func newLegacyLayerReader(root string) *legacyLayerReader { + r := &legacyLayerReader{ + root: root, + result: make(chan *fileEntry), + proceed: make(chan bool), + } + go r.walk() + return r +} + +func readTombstones(path string) (map[string]([]string), error) { + tf, err := os.Open(filepath.Join(path, "tombstones.txt")) + if err != nil { + return nil, err + } + defer tf.Close() + s := bufio.NewScanner(tf) + if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" { + return nil, errors.New("Invalid tombstones file") + } + + ts := make(map[string]([]string)) + for s.Scan() { + t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\` + dir := filepath.Dir(t) + ts[dir] = append(ts[dir], t) + } + if err = s.Err(); err != nil { + return nil, err + } + + return ts, nil +} + +func (r *legacyLayerReader) walkUntilCancelled() error { + root, err := makeLongAbsPath(r.root) + if err != nil { + return err + } + + r.root = root + ts, err := readTombstones(r.root) + if err != nil { + return err + } + + err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error { + if err != nil { + return err + } + if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") { + return nil + } + + r.result <- &fileEntry{path, info, nil} + if !<-r.proceed { + return errorIterationCanceled + } + + // List all the tombstones. + if info.IsDir() { + relPath, err := filepath.Rel(r.root, path) + if err != nil { + return err + } + if dts, ok := ts[relPath]; ok { + for _, t := range dts { + r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil} + if !<-r.proceed { + return errorIterationCanceled + } + } + } + } + return nil + }) + if err == errorIterationCanceled { + return nil + } + if err == nil { + return io.EOF + } + return err +} + +func (r *legacyLayerReader) walk() { + defer close(r.result) + if !<-r.proceed { + return + } + + err := r.walkUntilCancelled() + if err != nil { + for { + r.result <- &fileEntry{err: err} + if !<-r.proceed { + return + } + } + } +} + +func (r *legacyLayerReader) reset() { + if r.backupReader != nil { + r.backupReader.Close() + r.backupReader = nil + } + if r.currentFile != nil { + r.currentFile.Close() + r.currentFile = nil + } +} + +func findBackupStreamSize(r io.Reader) (int64, error) { + br := winio.NewBackupStreamReader(r) + for { + hdr, err := br.Next() + if err != nil { + if err == io.EOF { + err = nil + } + return 0, err + } + if hdr.Id == winio.BackupData { + return hdr.Size, nil + } + } +} + +func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) { + r.reset() + r.proceed <- true + fe := <-r.result + if fe == nil { + err = errors.New("LegacyLayerReader closed") + return + } + if fe.err != nil { + err = fe.err + return + } + + path, err = filepath.Rel(r.root, fe.path) + if err != nil { + return + } + + if fe.fi == nil { + // This is a tombstone. Return a nil fileInfo. + return + } + + if fe.fi.IsDir() && hasPathPrefix(path, filesPath) { + fe.path += ".$wcidirs$" + } + + f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING) + if err != nil { + return + } + defer func() { + if f != nil { + f.Close() + } + }() + + fileInfo, err = winio.GetFileBasicInfo(f) + if err != nil { + return + } + + if !hasPathPrefix(path, filesPath) { + size = fe.fi.Size() + r.backupReader = winio.NewBackupFileReader(f, false) + if path == hivesPath || path == filesPath { + // The Hives directory has a non-deterministic file time because of the + // nature of the import process. Use the times from System_Delta. + var g *os.File + g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`)) + if err != nil { + return + } + attr := fileInfo.FileAttributes + fileInfo, err = winio.GetFileBasicInfo(g) + g.Close() + if err != nil { + return + } + fileInfo.FileAttributes = attr + } + + // The creation time and access time get reset for files outside of the Files path. + fileInfo.CreationTime = fileInfo.LastWriteTime + fileInfo.LastAccessTime = fileInfo.LastWriteTime + + } else { + // The file attributes are written before the backup stream. + var attr uint32 + err = binary.Read(f, binary.LittleEndian, &attr) + if err != nil { + return + } + fileInfo.FileAttributes = uintptr(attr) + beginning := int64(4) + + // Find the accurate file size. + if !fe.fi.IsDir() { + size, err = findBackupStreamSize(f) + if err != nil { + err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err} + return + } + } + + // Return back to the beginning of the backup stream. + _, err = f.Seek(beginning, 0) + if err != nil { + return + } + } + + r.currentFile = f + f = nil + return +} + +func (r *legacyLayerReader) Read(b []byte) (int, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, io.EOF + } + return r.currentFile.Read(b) + } + return r.backupReader.Read(b) +} + +func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) { + if r.backupReader == nil { + if r.currentFile == nil { + return 0, errors.New("no current file") + } + return r.currentFile.Seek(offset, whence) + } + return 0, errors.New("seek not supported on this stream") +} + +func (r *legacyLayerReader) Close() error { + r.proceed <- false + <-r.result + r.reset() + return nil +} + +type pendingLink struct { + Path, Target string +} + +type legacyLayerWriter struct { + root string + parentRoots []string + destRoot string + currentFile *os.File + backupWriter *winio.BackupFileWriter + tombstones []string + pathFixed bool + HasUtilityVM bool + uvmDi []dirInfo + addedFiles map[string]bool + PendingLinks []pendingLink +} + +// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer +// transport format to disk. +func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) *legacyLayerWriter { + return &legacyLayerWriter{ + root: root, + parentRoots: parentRoots, + destRoot: destRoot, + addedFiles: make(map[string]bool), + } +} + +func (w *legacyLayerWriter) init() error { + if !w.pathFixed { + path, err := makeLongAbsPath(w.root) + if err != nil { + return err + } + for i, p := range w.parentRoots { + w.parentRoots[i], err = makeLongAbsPath(p) + if err != nil { + return err + } + } + destPath, err := makeLongAbsPath(w.destRoot) + if err != nil { + return err + } + w.root = path + w.destRoot = destPath + w.pathFixed = true + } + return nil +} + +func (w *legacyLayerWriter) initUtilityVM() error { + if !w.HasUtilityVM { + err := os.Mkdir(filepath.Join(w.destRoot, utilityVMPath), 0) + if err != nil { + return err + } + // Server 2016 does not support multiple layers for the utility VM, so + // clone the utility VM from the parent layer into this layer. Use hard + // links to avoid unnecessary copying, since most of the files are + // immutable. + err = cloneTree(filepath.Join(w.parentRoots[0], utilityVMFilesPath), filepath.Join(w.destRoot, utilityVMFilesPath), mutatedUtilityVMFiles) + if err != nil { + return fmt.Errorf("cloning the parent utility VM image failed: %s", err) + } + w.HasUtilityVM = true + } + return nil +} + +func (w *legacyLayerWriter) reset() { + if w.backupWriter != nil { + w.backupWriter.Close() + w.backupWriter = nil + } + if w.currentFile != nil { + w.currentFile.Close() + w.currentFile = nil + } +} + +// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata +func copyFileWithMetadata(srcPath, destPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { + createDisposition := uint32(syscall.CREATE_NEW) + if isDir { + err = os.Mkdir(destPath, 0) + if err != nil { + return nil, err + } + createDisposition = syscall.OPEN_EXISTING + } + + src, err := openFileOrDir(srcPath, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.OPEN_EXISTING) + if err != nil { + return nil, err + } + defer src.Close() + srcr := winio.NewBackupFileReader(src, true) + defer srcr.Close() + + fileInfo, err = winio.GetFileBasicInfo(src) + if err != nil { + return nil, err + } + + dest, err := openFileOrDir(destPath, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + if err != nil { + return nil, err + } + defer dest.Close() + + err = winio.SetFileBasicInfo(dest, fileInfo) + if err != nil { + return nil, err + } + + destw := winio.NewBackupFileWriter(dest, true) + defer func() { + cerr := destw.Close() + if err == nil { + err = cerr + } + }() + + _, err = io.Copy(destw, srcr) + if err != nil { + return nil, err + } + + return fileInfo, nil +} + +// cloneTree clones a directory tree using hard links. It skips hard links for +// the file names in the provided map and just copies those files. +func cloneTree(srcPath, destPath string, mutatedFiles map[string]bool) error { + var di []dirInfo + err := filepath.Walk(srcPath, func(srcFilePath string, info os.FileInfo, err error) error { + if err != nil { + return err + } + + relPath, err := filepath.Rel(srcPath, srcFilePath) + if err != nil { + return err + } + destFilePath := filepath.Join(destPath, relPath) + + fileAttributes := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes + // Directories, reparse points, and files that will be mutated during + // utility VM import must be copied. All other files can be hard linked. + isReparsePoint := fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 + // In go1.9, FileInfo.IsDir() returns false if the directory is also a symlink. + // See: https://github.com/golang/go/commit/1989921aef60c83e6f9127a8448fb5ede10e9acc + // Fixes the problem by checking syscall.FILE_ATTRIBUTE_DIRECTORY directly + isDir := fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 + + if isDir || isReparsePoint || mutatedFiles[relPath] { + fi, err := copyFileWithMetadata(srcFilePath, destFilePath, isDir) + if err != nil { + return err + } + if isDir && !isReparsePoint { + di = append(di, dirInfo{path: destFilePath, fileInfo: *fi}) + } + } else { + err = os.Link(srcFilePath, destFilePath) + if err != nil { + return err + } + } + + // Don't recurse on reparse points in go1.8 and older. Filepath.Walk + // handles this in go1.9 and newer. + if isDir && isReparsePoint && shouldSkipDirectoryReparse { + return filepath.SkipDir + } + + return nil + }) + if err != nil { + return err + } + + return reapplyDirectoryTimes(di) +} + +func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error { + w.reset() + err := w.init() + if err != nil { + return err + } + + if name == utilityVMPath { + return w.initUtilityVM() + } + + if hasPathPrefix(name, utilityVMPath) { + if !w.HasUtilityVM { + return errors.New("missing UtilityVM directory") + } + if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { + return errors.New("invalid UtilityVM layer") + } + path := filepath.Join(w.destRoot, name) + createDisposition := uint32(syscall.OPEN_EXISTING) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + st, err := os.Lstat(path) + if err != nil && !os.IsNotExist(err) { + return err + } + if st != nil { + // Delete the existing file/directory if it is not the same type as this directory. + existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes + if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { + if err = os.RemoveAll(path); err != nil { + return err + } + st = nil + } + } + if st == nil { + if err = os.Mkdir(path, 0); err != nil { + return err + } + } + if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { + w.uvmDi = append(w.uvmDi, dirInfo{path: path, fileInfo: *fileInfo}) + } + } else { + // Overwrite any existing hard link. + err = os.Remove(path) + if err != nil && !os.IsNotExist(err) { + return err + } + createDisposition = syscall.CREATE_NEW + } + + f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, createDisposition) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + os.Remove(path) + } + }() + + err = winio.SetFileBasicInfo(f, fileInfo) + if err != nil { + return err + } + + w.backupWriter = winio.NewBackupFileWriter(f, true) + w.currentFile = f + w.addedFiles[name] = true + f = nil + return nil + } + + path := filepath.Join(w.root, name) + if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { + err := os.Mkdir(path, 0) + if err != nil { + return err + } + path += ".$wcidirs$" + } + + f, err := openFileOrDir(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.CREATE_NEW) + if err != nil { + return err + } + defer func() { + if f != nil { + f.Close() + os.Remove(path) + } + }() + + strippedFi := *fileInfo + strippedFi.FileAttributes = 0 + err = winio.SetFileBasicInfo(f, &strippedFi) + if err != nil { + return err + } + + if hasPathPrefix(name, hivesPath) { + w.backupWriter = winio.NewBackupFileWriter(f, false) + } else { + // The file attributes are written before the stream. + err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + if err != nil { + return err + } + } + + w.currentFile = f + w.addedFiles[name] = true + f = nil + return nil +} + +func (w *legacyLayerWriter) AddLink(name string, target string) error { + w.reset() + err := w.init() + if err != nil { + return err + } + + var roots []string + if hasPathPrefix(target, filesPath) { + // Look for cross-layer hard link targets in the parent layers, since + // nothing is in the destination path yet. + roots = w.parentRoots + } else if hasPathPrefix(target, utilityVMFilesPath) { + // Since the utility VM is fully cloned into the destination path + // already, look for cross-layer hard link targets directly in the + // destination path. + roots = []string{w.destRoot} + } + + if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) { + return errors.New("invalid hard link in layer") + } + + // Find to try the target of the link in a previously added file. If that + // fails, search in parent layers. + var selectedRoot string + if _, ok := w.addedFiles[target]; ok { + selectedRoot = w.destRoot + } else { + for _, r := range roots { + if _, err = os.Lstat(filepath.Join(r, target)); err != nil { + if !os.IsNotExist(err) { + return err + } + } else { + selectedRoot = r + break + } + } + if selectedRoot == "" { + return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target) + } + } + // The link can't be written until after the ImportLayer call. + w.PendingLinks = append(w.PendingLinks, pendingLink{ + Path: filepath.Join(w.destRoot, name), + Target: filepath.Join(selectedRoot, target), + }) + w.addedFiles[name] = true + return nil +} + +func (w *legacyLayerWriter) Remove(name string) error { + if hasPathPrefix(name, filesPath) { + w.tombstones = append(w.tombstones, name[len(filesPath)+1:]) + } else if hasPathPrefix(name, utilityVMFilesPath) { + err := w.initUtilityVM() + if err != nil { + return err + } + // Make sure the path exists; os.RemoveAll will not fail if the file is + // already gone, and this needs to be a fatal error for diagnostics + // purposes. + path := filepath.Join(w.destRoot, name) + if _, err := os.Lstat(path); err != nil { + return err + } + err = os.RemoveAll(path) + if err != nil { + return err + } + } else { + return fmt.Errorf("invalid tombstone %s", name) + } + + return nil +} + +func (w *legacyLayerWriter) Write(b []byte) (int, error) { + if w.backupWriter == nil { + if w.currentFile == nil { + return 0, errors.New("closed") + } + return w.currentFile.Write(b) + } + return w.backupWriter.Write(b) +} + +func (w *legacyLayerWriter) Close() error { + w.reset() + err := w.init() + if err != nil { + return err + } + tf, err := os.Create(filepath.Join(w.root, "tombstones.txt")) + if err != nil { + return err + } + defer tf.Close() + _, err = tf.Write([]byte("\xef\xbb\xbfVersion 1.0\n")) + if err != nil { + return err + } + for _, t := range w.tombstones { + _, err = tf.Write([]byte(filepath.Join(`\`, t) + "\n")) + if err != nil { + return err + } + } + if w.HasUtilityVM { + err = reapplyDirectoryTimes(w.uvmDi) + if err != nil { + return err + } + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/legacy18.go b/vendor/github.com/Microsoft/hcsshim/legacy18.go new file mode 100644 index 000000000..578552f91 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/legacy18.go @@ -0,0 +1,7 @@ +// +build !go1.9 + +package hcsshim + +// Due to a bug in go1.8 and before, directory reparse points need to be skipped +// during filepath.Walk. This is fixed in go1.9 +var shouldSkipDirectoryReparse = true diff --git a/vendor/github.com/Microsoft/hcsshim/legacy19.go b/vendor/github.com/Microsoft/hcsshim/legacy19.go new file mode 100644 index 000000000..6aa1dc058 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/legacy19.go @@ -0,0 +1,7 @@ +// +build go1.9 + +package hcsshim + +// Due to a bug in go1.8 and before, directory reparse points need to be skipped +// during filepath.Walk. This is fixed in go1.9 +var shouldSkipDirectoryReparse = false diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go new file mode 100644 index 000000000..b7c6d020c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/nametoguid.go @@ -0,0 +1,20 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(name string) (id GUID, err error) { + title := "hcsshim::NameToGuid " + logrus.Debugf(title+"Name %s", name) + + err = nameToGuid(name, &id) + if err != nil { + err = makeErrorf(err, title, "name=%s", name) + logrus.Error(err) + return + } + + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/preparelayer.go new file mode 100644 index 000000000..5c5b61841 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/preparelayer.go @@ -0,0 +1,46 @@ +package hcsshim + +import ( + "sync" + + "github.com/sirupsen/logrus" +) + +var prepareLayerLock sync.Mutex + +// PrepareLayer finds a mounted read-write layer matching layerId and enables the +// the filesystem filter for use on that layer. This requires the paths to all +// parent layers, and is necessary in order to view or interact with the layer +// as an actual filesystem (reading and writing files, creating directories, etc). +// Disabling the filter must be done via UnprepareLayer. +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + title := "hcsshim::PrepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + // This lock is a temporary workaround for a Windows bug. Only allowing one + // call to prepareLayer at a time vastly reduces the chance of a timeout. + prepareLayerLock.Lock() + defer prepareLayerLock.Unlock() + err = prepareLayer(&infop, layerId, layers) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go new file mode 100644 index 000000000..faee2cfee --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -0,0 +1,384 @@ +package hcsshim + +import ( + "encoding/json" + "io" + "sync" + "syscall" + "time" + + "github.com/sirupsen/logrus" +) + +// ContainerError is an error encountered in HCS +type process struct { + handleLock sync.RWMutex + handle hcsProcess + processID int + container *container + cachedPipes *cachedPipes + callbackNumber uintptr +} + +type cachedPipes struct { + stdIn syscall.Handle + stdOut syscall.Handle + stdErr syscall.Handle +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type processStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const ( + stdIn string = "StdIn" + stdOut string = "StdOut" + stdErr string = "StdErr" +) + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *process) Pid() int { + return process.processID +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *process) Kill() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Kill" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + var resultp *uint16 + err := hcsTerminateProcess(process.handle, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Wait waits for the process to exit. +func (process *process) Wait() error { + operation := "Wait" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *process) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *process) ExitCode() (int, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ExitCode" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return 0, makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + properties, err := process.properties() + if err != nil { + return 0, makeProcessError(process, operation, "", err) + } + + if properties.Exited == false { + return 0, makeProcessError(process, operation, "", ErrInvalidProcessState) + } + + if properties.LastWaitResult != 0 { + return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult)) + } + + logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode) + return int(properties.ExitCode), nil +} + +// ResizeConsole resizes the console of the process. +func (process *process) ResizeConsole(width, height uint16) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ResizeConsole" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) properties() (*processStatus, error) { + operation := "properties" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + var ( + resultp *uint16 + propertiesp *uint16 + ) + err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, err + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) + + properties := &processStatus{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, err + } + + logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) + return properties, nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Stdio" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + var stdIn, stdOut, stdErr syscall.Handle + + if process.cachedPipes == nil { + var ( + processInfo hcsProcessInformation + resultp *uint16 + ) + err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError + } else { + // Use cached pipes + stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + + // Invalidate the cache + process.cachedPipes = nil + } + + pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return pipes[0], pipes[1], pipes[2], nil +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *process) CloseStdin() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "CloseStdin" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, "", ErrAlreadyClosed) + } + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + err = processHcsResult(err, resultp) + if err != nil { + return makeProcessError(process, operation, "", err) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *process) Close() error { + process.handleLock.Lock() + defer process.handleLock.Unlock() + operation := "Close" + title := "HCSShim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + // Don't double free this + if process.handle == 0 { + return nil + } + + if err := process.unregisterCallback(); err != nil { + return makeProcessError(process, operation, "", err) + } + + if err := hcsCloseProcess(process.handle); err != nil { + return makeProcessError(process, operation, "", err) + } + + process.handle = 0 + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *process) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *process) unregisterCallback() error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterProcessCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterProcessCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/processimage.go new file mode 100644 index 000000000..fadb1b92c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/processimage.go @@ -0,0 +1,23 @@ +package hcsshim + +import "os" + +// ProcessBaseLayer post-processes a base layer that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessBaseLayer(path string) error { + err := processBaseImage(path) + if err != nil { + return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err} + } + return nil +} + +// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted. +// The files should have been extracted to \Files. +func ProcessUtilityVMImage(path string) error { + err := processUtilityImage(path) + if err != nil { + return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err} + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go new file mode 100644 index 000000000..e8a3b507b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go @@ -0,0 +1,27 @@ +package hcsshim + +import "github.com/sirupsen/logrus" + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(info DriverInfo, layerId string) error { + title := "hcsshim::UnprepareLayer " + logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + + // Convert info to API calling convention + infop, err := convertDriverInfo(info) + if err != nil { + logrus.Error(err) + return err + } + + err = unprepareLayer(&infop, layerId) + if err != nil { + err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/utils.go new file mode 100644 index 000000000..bd6e2d94a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/utils.go @@ -0,0 +1,33 @@ +package hcsshim + +import ( + "io" + "syscall" + + "github.com/Microsoft/go-winio" +) + +// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles +// if there is an error. +func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { + fs := make([]io.ReadWriteCloser, len(hs)) + for i, h := range hs { + if h != syscall.Handle(0) { + if err == nil { + fs[i], err = winio.MakeOpenFile(h) + } + if err != nil { + syscall.Close(h) + } + } + } + if err != nil { + for _, f := range fs { + if f != nil { + f.Close() + } + } + return nil, err + } + return fs, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go new file mode 100644 index 000000000..ae10c23d4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/version.go @@ -0,0 +1,7 @@ +package hcsshim + +// IsTP4 returns whether the currently running Windows build is at least TP4. +func IsTP4() bool { + // HNSCall was not present in TP4 + return procHNSCall.Find() != nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/waithelper.go new file mode 100644 index 000000000..b7be20ea0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/waithelper.go @@ -0,0 +1,63 @@ +package hcsshim + +import ( + "time" + + "github.com/sirupsen/logrus" +) + +func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + err = processHcsResult(err, resultp) + if IsPending(err) { + return waitForNotification(callbackNumber, expectedNotification, timeout) + } + + return err +} + +func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { + callbackMapLock.RLock() + channels := callbackMap[callbackNumber].channels + callbackMapLock.RUnlock() + + expectedChannel := channels[expectedNotification] + if expectedChannel == nil { + logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + return ErrInvalidNotificationType + } + + var c <-chan time.Time + if timeout != nil { + timer := time.NewTimer(*timeout) + c = timer.C + defer timer.Stop() + } + + select { + case err, ok := <-expectedChannel: + if !ok { + return ErrHandleClose + } + return err + case err, ok := <-channels[hcsNotificationSystemExited]: + if !ok { + return ErrHandleClose + } + // If the expected notification is hcsNotificationSystemExited which of the two selects + // chosen is random. Return the raw error if hcsNotificationSystemExited is expected + if channels[hcsNotificationSystemExited] == expectedChannel { + return err + } + return ErrUnexpectedContainerExit + case _, ok := <-channels[hcsNotificationServiceDisconnect]: + if !ok { + return ErrHandleClose + } + // hcsNotificationServiceDisconnect should never be an expected notification + // it does not need the same handling as hcsNotificationSystemExited + return ErrUnexpectedProcessAbort + case <-c: + return ErrTimeout + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go new file mode 100644 index 000000000..5d1a851ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go @@ -0,0 +1,1042 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcsshim + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modole32 = windows.NewLazySystemDLL("ole32.dll") + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") + procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") + procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") + procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") + procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") + procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") + procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") + procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, _p1, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func nameToGuid(name string, guid *GUID) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *GUID) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _importLayerBegin(info, _p0, descriptors, context) +} + +func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procImportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(fileName) + if hr != nil { + return + } + return _importLayerNext(context, _p0, fileInfo) +} + +func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { + if hr = procImportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerWrite(context uintptr, buffer []byte) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procImportLayerWrite.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func importLayerEnd(context uintptr) (hr error) { + if hr = procImportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _exportLayerBegin(info, _p0, descriptors, context) +} + +func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procExportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { + if hr = procExportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procExportLayerRead.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func exportLayerEnd(context uintptr) (hr error) { + if hr = procExportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsCloseProcess(process hcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyServiceSettings(_p0, result) +} + +func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyServiceSettings.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + hr = syscall.Errno(win32FromHresult(r0)) + } + return +} diff --git a/vendor/github.com/containerd/containerd/container.go b/vendor/github.com/containerd/containerd/container.go index ad60c69ea..c29e15463 100644 --- a/vendor/github.com/containerd/containerd/container.go +++ b/vendor/github.com/containerd/containerd/container.go @@ -2,7 +2,6 @@ package containerd import ( "context" - "encoding/json" "os" "path/filepath" "strings" @@ -14,6 +13,7 @@ import ( "github.com/containerd/containerd/errdefs" "github.com/containerd/typeurl" prototypes "github.com/gogo/protobuf/types" + jsoniter "github.com/json-iterator/go" specs "github.com/opencontainers/runtime-spec/specs-go" "github.com/pkg/errors" ) @@ -115,6 +115,7 @@ func (c *container) Spec(ctx context.Context) (*specs.Spec, error) { if err != nil { return nil, err } + json := jsoniter.ConfigCompatibleWithStandardLibrary var s specs.Spec if err := json.Unmarshal(r.Spec.Value, &s); err != nil { return nil, err diff --git a/vendor/github.com/containerd/containerd/container_opts_unix.go b/vendor/github.com/containerd/containerd/container_opts_unix.go index deda0f70f..40e53c70a 100644 --- a/vendor/github.com/containerd/containerd/container_opts_unix.go +++ b/vendor/github.com/containerd/containerd/container_opts_unix.go @@ -4,7 +4,6 @@ package containerd import ( "context" - "encoding/json" "fmt" "os" "path/filepath" @@ -20,6 +19,7 @@ import ( "github.com/containerd/containerd/platforms" "github.com/gogo/protobuf/proto" protobuf "github.com/gogo/protobuf/types" + jsoniter "github.com/json-iterator/go" digest "github.com/opencontainers/go-digest" "github.com/opencontainers/image-spec/identity" "github.com/opencontainers/image-spec/specs-go/v1" @@ -121,6 +121,7 @@ func decodeIndex(ctx context.Context, store content.Store, id digest.Digest) (*v if err != nil { return nil, err } + json := jsoniter.ConfigCompatibleWithStandardLibrary if err := json.Unmarshal(p, &index); err != nil { return nil, err } diff --git a/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go index 1d4b1bfba..60cda71d3 100644 --- a/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go +++ b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go @@ -4,12 +4,12 @@ package seccomp import ( "context" - "encoding/json" "fmt" "io/ioutil" "github.com/containerd/containerd/containers" "github.com/containerd/containerd/oci" + jsoniter "github.com/json-iterator/go" "github.com/opencontainers/runtime-spec/specs-go" ) @@ -23,6 +23,7 @@ func WithProfile(profile string) oci.SpecOpts { if err != nil { return fmt.Errorf("Cannot load seccomp profile %q: %v", profile, err) } + json := jsoniter.ConfigCompatibleWithStandardLibrary if err := json.Unmarshal(f, s.Linux.Seccomp); err != nil { return fmt.Errorf("Decoding seccomp profile failed %q: %v", profile, err) } diff --git a/vendor/github.com/containerd/containerd/images/image.go b/vendor/github.com/containerd/containerd/images/image.go index 3f58e0620..6f813d80b 100644 --- a/vendor/github.com/containerd/containerd/images/image.go +++ b/vendor/github.com/containerd/containerd/images/image.go @@ -2,13 +2,14 @@ package images import ( "context" - "encoding/json" + "strings" "time" "github.com/containerd/containerd/content" "github.com/containerd/containerd/errdefs" "github.com/containerd/containerd/log" "github.com/containerd/containerd/platforms" + jsoniter "github.com/json-iterator/go" digest "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "github.com/pkg/errors" @@ -122,6 +123,7 @@ func Manifest(ctx context.Context, provider content.Provider, image ocispec.Desc return ocispec.Manifest{}, err } } + json := jsoniter.ConfigCompatibleWithStandardLibrary if err := Walk(ctx, HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { switch desc.MediaType { @@ -215,6 +217,7 @@ func Config(ctx context.Context, provider content.Provider, image ocispec.Descri // Platforms returns one or more platforms supported by the image. func Platforms(ctx context.Context, provider content.Provider, image ocispec.Descriptor) ([]ocispec.Platform, error) { var platformSpecs []ocispec.Platform + json := jsoniter.ConfigCompatibleWithStandardLibrary return platformSpecs, Walk(ctx, Handlers(HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { if desc.Platform != nil { platformSpecs = append(platformSpecs, *desc.Platform) @@ -285,6 +288,7 @@ func Check(ctx context.Context, provider content.Provider, image ocispec.Descrip // Children returns the immediate children of content described by the descriptor. func Children(ctx context.Context, provider content.Provider, desc ocispec.Descriptor, platform string) ([]ocispec.Descriptor, error) { + json := jsoniter.ConfigCompatibleWithStandardLibrary var descs []ocispec.Descriptor switch desc.MediaType { case MediaTypeDockerSchema2Manifest, ocispec.MediaTypeImageManifest: @@ -353,9 +357,29 @@ func RootFS(ctx context.Context, provider content.Provider, configDesc ocispec.D return nil, err } + json := jsoniter.ConfigCompatibleWithStandardLibrary var config ocispec.Image if err := json.Unmarshal(p, &config); err != nil { return nil, err } return config.RootFS.DiffIDs, nil } + +// IsCompressedDiff returns true if mediaType is a known compressed diff media type. +// It returns false if the media type is a diff, but not compressed. If the media type +// is not a known diff type, it returns errdefs.ErrNotImplemented +func IsCompressedDiff(ctx context.Context, mediaType string) (bool, error) { + switch mediaType { + case ocispec.MediaTypeImageLayer, MediaTypeDockerSchema2Layer: + case ocispec.MediaTypeImageLayerGzip, MediaTypeDockerSchema2LayerGzip: + return true, nil + default: + // Still apply all generic media types *.tar[.+]gzip and *.tar + if strings.HasSuffix(mediaType, ".tar.gzip") || strings.HasSuffix(mediaType, ".tar+gzip") { + return true, nil + } else if !strings.HasSuffix(mediaType, ".tar") { + return false, errdefs.ErrNotImplemented + } + } + return false, nil +} diff --git a/vendor/github.com/containerd/containerd/mount/mount_windows.go b/vendor/github.com/containerd/containerd/mount/mount_windows.go index 8ad7eab12..940473d26 100644 --- a/vendor/github.com/containerd/containerd/mount/mount_windows.go +++ b/vendor/github.com/containerd/containerd/mount/mount_windows.go @@ -1,6 +1,13 @@ package mount -import "github.com/pkg/errors" +import ( + "path/filepath" + "strings" + + "github.com/Microsoft/hcsshim" + jsoniter "github.com/json-iterator/go" + "github.com/pkg/errors" +) var ( // ErrNotImplementOnWindows is returned when an action is not implemented for windows @@ -9,15 +16,71 @@ var ( // Mount to the provided target func (m *Mount) Mount(target string) error { - return ErrNotImplementOnWindows + home, layerID := filepath.Split(m.Source) + + parentLayerPaths, err := m.GetParentPaths() + if err != nil { + return err + } + + var di = hcsshim.DriverInfo{ + HomeDir: home, + } + + if err = hcsshim.ActivateLayer(di, layerID); err != nil { + return errors.Wrapf(err, "failed to activate layer %s", m.Source) + } + defer func() { + if err != nil { + hcsshim.DeactivateLayer(di, layerID) + } + }() + + if err = hcsshim.PrepareLayer(di, layerID, parentLayerPaths); err != nil { + return errors.Wrapf(err, "failed to prepare layer %s", m.Source) + } + return nil +} + +// ParentLayerPathsFlag is the options flag used to represent the JSON encoded +// list of parent layers required to use the layer +const ParentLayerPathsFlag = "parentLayerPaths=" + +// GetParentPaths of the mount +func (m *Mount) GetParentPaths() ([]string, error) { + var parentLayerPaths []string + json := jsoniter.ConfigCompatibleWithStandardLibrary + for _, option := range m.Options { + if strings.HasPrefix(option, ParentLayerPathsFlag) { + err := json.Unmarshal([]byte(option[len(ParentLayerPathsFlag):]), &parentLayerPaths) + if err != nil { + return nil, errors.Wrap(err, "failed to unmarshal parent layer paths from mount") + } + } + } + return parentLayerPaths, nil } // Unmount the mount at the provided path func Unmount(mount string, flags int) error { - return ErrNotImplementOnWindows + var ( + home, layerID = filepath.Split(mount) + di = hcsshim.DriverInfo{ + HomeDir: home, + } + ) + + if err := hcsshim.UnprepareLayer(di, layerID); err != nil { + return errors.Wrapf(err, "failed to unprepare layer %s", mount) + } + if err := hcsshim.DeactivateLayer(di, layerID); err != nil { + return errors.Wrapf(err, "failed to deactivate layer %s", mount) + } + + return nil } -// UnmountAll mounts at the provided path +// UnmountAll unmounts from the provided path func UnmountAll(mount string, flags int) error { - return ErrNotImplementOnWindows + return Unmount(mount, flags) } diff --git a/vendor/github.com/containerd/containerd/oci/spec_opts_unix.go b/vendor/github.com/containerd/containerd/oci/spec_opts_unix.go index 2c31b35c3..40f33753d 100644 --- a/vendor/github.com/containerd/containerd/oci/spec_opts_unix.go +++ b/vendor/github.com/containerd/containerd/oci/spec_opts_unix.go @@ -4,7 +4,6 @@ package oci import ( "context" - "encoding/json" "fmt" "os" "path/filepath" @@ -17,10 +16,12 @@ import ( "github.com/containerd/containerd/images" "github.com/containerd/containerd/mount" "github.com/containerd/containerd/namespaces" + jsoniter "github.com/json-iterator/go" "github.com/opencontainers/image-spec/specs-go/v1" "github.com/opencontainers/runc/libcontainer/user" specs "github.com/opencontainers/runtime-spec/specs-go" "github.com/pkg/errors" + "github.com/syndtr/gocapability/capability" ) // WithTTY sets the information on the spec as well as the environment variables for @@ -65,6 +66,7 @@ func WithLinuxNamespace(ns specs.LinuxNamespace) SpecOpts { // WithImageConfig configures the spec to from the configuration of an Image func WithImageConfig(image Image) SpecOpts { return func(ctx context.Context, client Client, c *containers.Container, s *specs.Spec) error { + json := jsoniter.ConfigCompatibleWithStandardLibrary ic, err := image.Config(ctx) if err != nil { return err @@ -346,6 +348,34 @@ func WithUsername(username string) SpecOpts { } } +// WithAllCapabilities set all linux capabilities for the process +func WithAllCapabilities(_ context.Context, _ Client, _ *containers.Container, s *specs.Spec) error { + caps := getAllCapabilities() + + s.Process.Capabilities.Bounding = caps + s.Process.Capabilities.Effective = caps + s.Process.Capabilities.Permitted = caps + s.Process.Capabilities.Inheritable = caps + + return nil +} + +func getAllCapabilities() []string { + last := capability.CAP_LAST_CAP + // hack for RHEL6 which has no /proc/sys/kernel/cap_last_cap + if last == capability.Cap(63) { + last = capability.CAP_BLOCK_SUSPEND + } + var caps []string + for _, cap := range capability.List() { + if cap > last { + continue + } + caps = append(caps, "CAP_"+strings.ToUpper(cap.String())) + } + return caps +} + var errNoUsersFound = errors.New("no users found") func getUIDGIDFromPath(root string, filter func(user.User) bool) (uid, gid uint32, err error) { diff --git a/vendor/github.com/containerd/containerd/oci/spec_opts_windows.go b/vendor/github.com/containerd/containerd/oci/spec_opts_windows.go index 796ad5598..e8751caed 100644 --- a/vendor/github.com/containerd/containerd/oci/spec_opts_windows.go +++ b/vendor/github.com/containerd/containerd/oci/spec_opts_windows.go @@ -4,12 +4,12 @@ package oci import ( "context" - "encoding/json" "fmt" "github.com/containerd/containerd/containers" "github.com/containerd/containerd/content" "github.com/containerd/containerd/images" + jsoniter "github.com/json-iterator/go" "github.com/opencontainers/image-spec/specs-go/v1" specs "github.com/opencontainers/runtime-spec/specs-go" ) @@ -24,6 +24,7 @@ func WithImageConfig(image Image) SpecOpts { var ( ociimage v1.Image config v1.ImageConfig + json = jsoniter.ConfigCompatibleWithStandardLibrary ) switch ic.MediaType { case v1.MediaTypeImageConfig, images.MediaTypeDockerSchema2Config: diff --git a/vendor/github.com/containerd/containerd/remotes/docker/resolver.go b/vendor/github.com/containerd/containerd/remotes/docker/resolver.go index 57a18b664..edc994158 100644 --- a/vendor/github.com/containerd/containerd/remotes/docker/resolver.go +++ b/vendor/github.com/containerd/containerd/remotes/docker/resolver.go @@ -136,6 +136,9 @@ func (r *dockerResolver) Resolve(ctx context.Context, ref string) (string, ocisp log.G(ctx).Debug("resolving") resp, err := fetcher.doRequestWithRetries(ctx, req, nil) if err != nil { + if errors.Cause(err) == ErrInvalidAuthorization { + err = errors.Wrapf(err, "pull access denied, repository does not exist or may require authorization") + } return "", ocispec.Descriptor{}, err } resp.Body.Close() // don't care about body contents. diff --git a/vendor/github.com/containerd/containerd/remotes/docker/schema1/converter.go b/vendor/github.com/containerd/containerd/remotes/docker/schema1/converter.go index 6b74cd67e..6cebd7a1f 100644 --- a/vendor/github.com/containerd/containerd/remotes/docker/schema1/converter.go +++ b/vendor/github.com/containerd/containerd/remotes/docker/schema1/converter.go @@ -5,7 +5,6 @@ import ( "compress/gzip" "context" "encoding/base64" - "encoding/json" "fmt" "io" "io/ioutil" @@ -21,6 +20,7 @@ import ( "github.com/containerd/containerd/images" "github.com/containerd/containerd/log" "github.com/containerd/containerd/remotes" + jsoniter "github.com/json-iterator/go" digest "github.com/opencontainers/go-digest" specs "github.com/opencontainers/image-spec/specs-go" ocispec "github.com/opencontainers/image-spec/specs-go/v1" @@ -110,6 +110,7 @@ func (c *Converter) Convert(ctx context.Context) (ocispec.Descriptor, error) { return ocispec.Descriptor{}, errors.Wrap(err, "schema 1 conversion failed") } + json := jsoniter.ConfigCompatibleWithStandardLibrary var img ocispec.Image if err := json.Unmarshal([]byte(c.pulledManifest.History[0].V1Compatibility), &img); err != nil { return ocispec.Descriptor{}, errors.Wrap(err, "failed to unmarshal image from schema 1 history") @@ -194,6 +195,7 @@ func (c *Converter) fetchManifest(ctx context.Context, desc ocispec.Descriptor) return err } + json := jsoniter.ConfigCompatibleWithStandardLibrary var m manifest if err := json.Unmarshal(b, &m); err != nil { return err @@ -316,6 +318,7 @@ func (c *Converter) schema1ManifestHistory() ([]ocispec.History, []digest.Digest return nil, nil, errors.New("no history") } + json := jsoniter.ConfigCompatibleWithStandardLibrary history := make([]ocispec.History, len(m.History)) diffIDs := []digest.Digest{} for i := range m.History { @@ -373,6 +376,7 @@ type v1History struct { // empty layer. A return value of true indicates the layer is empty, // however false does not indicate non-empty. func isEmptyLayer(compatHistory []byte) (bool, error) { + json := jsoniter.ConfigCompatibleWithStandardLibrary var h v1History if err := json.Unmarshal(compatHistory, &h); err != nil { return false, err @@ -422,6 +426,7 @@ func joseBase64UrlDecode(s string) ([]byte, error) { } func stripSignature(b []byte) ([]byte, error) { + json := jsoniter.ConfigCompatibleWithStandardLibrary var sig signature if err := json.Unmarshal(b, &sig); err != nil { return nil, err diff --git a/vendor/github.com/containerd/containerd/sys/filesys_unix.go b/vendor/github.com/containerd/containerd/sys/filesys_unix.go new file mode 100644 index 000000000..ed23609c5 --- /dev/null +++ b/vendor/github.com/containerd/containerd/sys/filesys_unix.go @@ -0,0 +1,10 @@ +// +build !windows + +package sys + +import "os" + +// ForceRemoveAll on unix is just a wrapper for os.RemoveAll +func ForceRemoveAll(path string) error { + return os.RemoveAll(path) +} diff --git a/vendor/github.com/containerd/containerd/sys/filesys_windows.go b/vendor/github.com/containerd/containerd/sys/filesys_windows.go index b5ce13579..36395c556 100644 --- a/vendor/github.com/containerd/containerd/sys/filesys_windows.go +++ b/vendor/github.com/containerd/containerd/sys/filesys_windows.go @@ -11,6 +11,7 @@ import ( "unsafe" winio "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim" ) // MkdirAllWithACL is a wrapper for MkdirAll that creates a directory @@ -234,3 +235,13 @@ func syscallOpenSequential(path string, mode int, _ uint32) (fd syscall.Handle, h, e := syscall.CreateFile(pathp, access, sharemode, sa, createmode, fileFlagSequentialScan, 0) return h, e } + +// ForceRemoveAll is the same as os.RemoveAll, but uses hcsshim.DestroyLayer in order +// to delete container layers. +func ForceRemoveAll(path string) error { + info := hcsshim.DriverInfo{ + HomeDir: filepath.Dir(path), + } + + return hcsshim.DestroyLayer(info, filepath.Base(path)) +} diff --git a/vendor/github.com/containerd/containerd/vendor.conf b/vendor/github.com/containerd/containerd/vendor.conf index 12c3ffc0a..6b05adba5 100644 --- a/vendor/github.com/containerd/containerd/vendor.conf +++ b/vendor/github.com/containerd/containerd/vendor.conf @@ -1,5 +1,5 @@ github.com/coreos/go-systemd 48702e0da86bd25e76cfef347e2adeb434a0d0a6 -github.com/containerd/go-runc ed1cbe1fc31f5fb2359d3a54b6330d1a097858b7 +github.com/containerd/go-runc 4f6e87ae043f859a38255247b49c9abc262d002f github.com/containerd/console 84eeaae905fa414d03e07bcd6c8d3f19e7cf180e github.com/containerd/cgroups 29da22c6171a4316169f9205ab6c49f59b5b852f github.com/containerd/typeurl f6943554a7e7e88b3c14aad190bf05932da84788 @@ -41,3 +41,5 @@ google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944 golang.org/x/text 19e51611da83d6be54ddafce4a4af510cb3e9ea4 github.com/dmcgowan/go-tar go1.10 github.com/stevvooe/ttrpc d2710463e497617f16f26d1e715a3308609e7982 +github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 +github.com/json-iterator/go 1.0.4 diff --git a/vendor/github.com/json-iterator/go/feature_config.go b/vendor/github.com/json-iterator/go/feature_config.go index 78a2ce1a5..140679536 100644 --- a/vendor/github.com/json-iterator/go/feature_config.go +++ b/vendor/github.com/json-iterator/go/feature_config.go @@ -48,7 +48,6 @@ type API interface { NewEncoder(writer io.Writer) *Encoder NewDecoder(reader io.Reader) *Decoder Valid(data []byte) bool - RegisterExtension(extension Extension) } // ConfigDefault the default API @@ -133,7 +132,7 @@ func (cfg *frozenConfig) getTagKey() string { return tagKey } -func (cfg *frozenConfig) RegisterExtension(extension Extension) { +func (cfg *frozenConfig) registerExtension(extension Extension) { cfg.extensions = append(cfg.extensions, extension) } diff --git a/vendor/github.com/json-iterator/go/feature_iter_int.go b/vendor/github.com/json-iterator/go/feature_iter_int.go index 4781c6393..6137348cd 100644 --- a/vendor/github.com/json-iterator/go/feature_iter_int.go +++ b/vendor/github.com/json-iterator/go/feature_iter_int.go @@ -113,9 +113,13 @@ func (iter *Iterator) ReadUint32() (ret uint32) { } func (iter *Iterator) readUint32(c byte) (ret uint32) { + defer func() { + if iter.head < len(iter.buf) && iter.buf[iter.head] == '.' { + iter.ReportError("readUint32", "can not decode float as int") + } + }() ind := intDigits[c] if ind == 0 { - iter.assertInteger() return 0 // single zero } if ind == invalidCharForNumber { @@ -128,14 +132,12 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { ind2 := intDigits[iter.buf[i]] if ind2 == invalidCharForNumber { iter.head = i - iter.assertInteger() return value } i++ ind3 := intDigits[iter.buf[i]] if ind3 == invalidCharForNumber { iter.head = i - iter.assertInteger() return value*10 + uint32(ind2) } //iter.head = i + 1 @@ -144,35 +146,30 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { ind4 := intDigits[iter.buf[i]] if ind4 == invalidCharForNumber { iter.head = i - iter.assertInteger() return value*100 + uint32(ind2)*10 + uint32(ind3) } i++ ind5 := intDigits[iter.buf[i]] if ind5 == invalidCharForNumber { iter.head = i - iter.assertInteger() return value*1000 + uint32(ind2)*100 + uint32(ind3)*10 + uint32(ind4) } i++ ind6 := intDigits[iter.buf[i]] if ind6 == invalidCharForNumber { iter.head = i - iter.assertInteger() return value*10000 + uint32(ind2)*1000 + uint32(ind3)*100 + uint32(ind4)*10 + uint32(ind5) } i++ ind7 := intDigits[iter.buf[i]] if ind7 == invalidCharForNumber { iter.head = i - iter.assertInteger() return value*100000 + uint32(ind2)*10000 + uint32(ind3)*1000 + uint32(ind4)*100 + uint32(ind5)*10 + uint32(ind6) } i++ ind8 := intDigits[iter.buf[i]] if ind8 == invalidCharForNumber { iter.head = i - iter.assertInteger() return value*1000000 + uint32(ind2)*100000 + uint32(ind3)*10000 + uint32(ind4)*1000 + uint32(ind5)*100 + uint32(ind6)*10 + uint32(ind7) } i++ @@ -180,7 +177,6 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { value = value*10000000 + uint32(ind2)*1000000 + uint32(ind3)*100000 + uint32(ind4)*10000 + uint32(ind5)*1000 + uint32(ind6)*100 + uint32(ind7)*10 + uint32(ind8) iter.head = i if ind9 == invalidCharForNumber { - iter.assertInteger() return value } } @@ -189,7 +185,6 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { ind = intDigits[iter.buf[i]] if ind == invalidCharForNumber { iter.head = i - iter.assertInteger() return value } if value > uint32SafeToMultiply10 { @@ -204,7 +199,6 @@ func (iter *Iterator) readUint32(c byte) (ret uint32) { value = (value << 3) + (value << 1) + uint32(ind) } if !iter.loadMore() { - iter.assertInteger() return value } } @@ -235,9 +229,13 @@ func (iter *Iterator) ReadUint64() uint64 { } func (iter *Iterator) readUint64(c byte) (ret uint64) { + defer func() { + if iter.head < len(iter.buf) && iter.buf[iter.head] == '.' { + iter.ReportError("readUint64", "can not decode float as int") + } + }() ind := intDigits[c] if ind == 0 { - iter.assertInteger() return 0 // single zero } if ind == invalidCharForNumber { @@ -245,73 +243,11 @@ func (iter *Iterator) readUint64(c byte) (ret uint64) { return } value := uint64(ind) - if iter.tail-iter.head > 10 { - i := iter.head - ind2 := intDigits[iter.buf[i]] - if ind2 == invalidCharForNumber { - iter.head = i - iter.assertInteger() - return value - } - i++ - ind3 := intDigits[iter.buf[i]] - if ind3 == invalidCharForNumber { - iter.head = i - iter.assertInteger() - return value*10 + uint64(ind2) - } - //iter.head = i + 1 - //value = value * 100 + uint32(ind2) * 10 + uint32(ind3) - i++ - ind4 := intDigits[iter.buf[i]] - if ind4 == invalidCharForNumber { - iter.head = i - iter.assertInteger() - return value*100 + uint64(ind2)*10 + uint64(ind3) - } - i++ - ind5 := intDigits[iter.buf[i]] - if ind5 == invalidCharForNumber { - iter.head = i - iter.assertInteger() - return value*1000 + uint64(ind2)*100 + uint64(ind3)*10 + uint64(ind4) - } - i++ - ind6 := intDigits[iter.buf[i]] - if ind6 == invalidCharForNumber { - iter.head = i - iter.assertInteger() - return value*10000 + uint64(ind2)*1000 + uint64(ind3)*100 + uint64(ind4)*10 + uint64(ind5) - } - i++ - ind7 := intDigits[iter.buf[i]] - if ind7 == invalidCharForNumber { - iter.head = i - iter.assertInteger() - return value*100000 + uint64(ind2)*10000 + uint64(ind3)*1000 + uint64(ind4)*100 + uint64(ind5)*10 + uint64(ind6) - } - i++ - ind8 := intDigits[iter.buf[i]] - if ind8 == invalidCharForNumber { - iter.head = i - iter.assertInteger() - return value*1000000 + uint64(ind2)*100000 + uint64(ind3)*10000 + uint64(ind4)*1000 + uint64(ind5)*100 + uint64(ind6)*10 + uint64(ind7) - } - i++ - ind9 := intDigits[iter.buf[i]] - value = value*10000000 + uint64(ind2)*1000000 + uint64(ind3)*100000 + uint64(ind4)*10000 + uint64(ind5)*1000 + uint64(ind6)*100 + uint64(ind7)*10 + uint64(ind8) - iter.head = i - if ind9 == invalidCharForNumber { - iter.assertInteger() - return value - } - } for { for i := iter.head; i < iter.tail; i++ { ind = intDigits[iter.buf[i]] if ind == invalidCharForNumber { iter.head = i - iter.assertInteger() return value } if value > uint64SafeToMultiple10 { @@ -326,14 +262,7 @@ func (iter *Iterator) readUint64(c byte) (ret uint64) { value = (value << 3) + (value << 1) + uint64(ind) } if !iter.loadMore() { - iter.assertInteger() return value } } } - -func (iter *Iterator) assertInteger() { - if iter.head < len(iter.buf) && iter.buf[iter.head] == '.' { - iter.ReportError("assertInteger", "can not decode float as int") - } -} diff --git a/vendor/github.com/json-iterator/go/feature_reflect.go b/vendor/github.com/json-iterator/go/feature_reflect.go index bed7764ed..1bd8987f2 100644 --- a/vendor/github.com/json-iterator/go/feature_reflect.go +++ b/vendor/github.com/json-iterator/go/feature_reflect.go @@ -274,7 +274,7 @@ func decoderOfType(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { if decoder != nil { return decoder, nil } - decoder = getTypeDecoderFromExtension(cfg, typ) + decoder = getTypeDecoderFromExtension(typ) if decoder != nil { cfg.addDecoderToCache(cacheKey, decoder) return decoder, nil @@ -285,9 +285,6 @@ func decoderOfType(cfg *frozenConfig, typ reflect.Type) (ValDecoder, error) { for _, extension := range extensions { decoder = extension.DecorateDecoder(typ, decoder) } - for _, extension := range cfg.extensions { - decoder = extension.DecorateDecoder(typ, decoder) - } cfg.addDecoderToCache(cacheKey, decoder) return decoder, err } @@ -444,7 +441,7 @@ func encoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { if encoder != nil { return encoder, nil } - encoder = getTypeEncoderFromExtension(cfg, typ) + encoder = getTypeEncoderFromExtension(typ) if encoder != nil { cfg.addEncoderToCache(cacheKey, encoder) return encoder, nil @@ -455,9 +452,6 @@ func encoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error) { for _, extension := range extensions { encoder = extension.DecorateEncoder(typ, encoder) } - for _, extension := range cfg.extensions { - encoder = extension.DecorateEncoder(typ, encoder) - } cfg.addEncoderToCache(cacheKey, encoder) return encoder, err } @@ -476,7 +470,7 @@ func createEncoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error return &jsoniterNumberCodec{}, nil } if typ.Implements(marshalerType) { - checkIsEmpty, err := createCheckIsEmpty(cfg, typ) + checkIsEmpty, err := createCheckIsEmpty(typ) if err != nil { return nil, err } @@ -491,7 +485,7 @@ func createEncoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error return encoder, nil } if reflect.PtrTo(typ).Implements(marshalerType) { - checkIsEmpty, err := createCheckIsEmpty(cfg, reflect.PtrTo(typ)) + checkIsEmpty, err := createCheckIsEmpty(reflect.PtrTo(typ)) if err != nil { return nil, err } @@ -503,7 +497,7 @@ func createEncoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error return encoder, nil } if typ.Implements(textMarshalerType) { - checkIsEmpty, err := createCheckIsEmpty(cfg, typ) + checkIsEmpty, err := createCheckIsEmpty(typ) if err != nil { return nil, err } @@ -526,7 +520,7 @@ func createEncoderOfType(cfg *frozenConfig, typ reflect.Type) (ValEncoder, error return createEncoderOfSimpleType(cfg, typ) } -func createCheckIsEmpty(cfg *frozenConfig, typ reflect.Type) (checkIsEmpty, error) { +func createCheckIsEmpty(typ reflect.Type) (checkIsEmpty, error) { kind := typ.Kind() switch kind { case reflect.String: @@ -571,7 +565,7 @@ func createCheckIsEmpty(cfg *frozenConfig, typ reflect.Type) (checkIsEmpty, erro case reflect.Slice: return &sliceEncoder{}, nil case reflect.Map: - return encoderOfMap(cfg, typ) + return &mapEncoder{}, nil case reflect.Ptr: return &OptionalEncoder{}, nil default: diff --git a/vendor/github.com/json-iterator/go/feature_reflect_extension.go b/vendor/github.com/json-iterator/go/feature_reflect_extension.go index c129076bc..177df2c81 100644 --- a/vendor/github.com/json-iterator/go/feature_reflect_extension.go +++ b/vendor/github.com/json-iterator/go/feature_reflect_extension.go @@ -161,31 +161,22 @@ func RegisterExtension(extension Extension) { extensions = append(extensions, extension) } -func getTypeDecoderFromExtension(cfg *frozenConfig, typ reflect.Type) ValDecoder { - decoder := _getTypeDecoderFromExtension(cfg, typ) +func getTypeDecoderFromExtension(typ reflect.Type) ValDecoder { + decoder := _getTypeDecoderFromExtension(typ) if decoder != nil { for _, extension := range extensions { decoder = extension.DecorateDecoder(typ, decoder) } - for _, extension := range cfg.extensions { - decoder = extension.DecorateDecoder(typ, decoder) - } } return decoder } -func _getTypeDecoderFromExtension(cfg *frozenConfig, typ reflect.Type) ValDecoder { +func _getTypeDecoderFromExtension(typ reflect.Type) ValDecoder { for _, extension := range extensions { decoder := extension.CreateDecoder(typ) if decoder != nil { return decoder } } - for _, extension := range cfg.extensions { - decoder := extension.CreateDecoder(typ) - if decoder != nil { - return decoder - } - } typeName := typ.String() decoder := typeDecoders[typeName] if decoder != nil { @@ -200,32 +191,23 @@ func _getTypeDecoderFromExtension(cfg *frozenConfig, typ reflect.Type) ValDecode return nil } -func getTypeEncoderFromExtension(cfg *frozenConfig, typ reflect.Type) ValEncoder { - encoder := _getTypeEncoderFromExtension(cfg, typ) +func getTypeEncoderFromExtension(typ reflect.Type) ValEncoder { + encoder := _getTypeEncoderFromExtension(typ) if encoder != nil { for _, extension := range extensions { encoder = extension.DecorateEncoder(typ, encoder) } - for _, extension := range cfg.extensions { - encoder = extension.DecorateEncoder(typ, encoder) - } } return encoder } -func _getTypeEncoderFromExtension(cfg *frozenConfig, typ reflect.Type) ValEncoder { +func _getTypeEncoderFromExtension(typ reflect.Type) ValEncoder { for _, extension := range extensions { encoder := extension.CreateEncoder(typ) if encoder != nil { return encoder } } - for _, extension := range cfg.extensions { - encoder := extension.CreateEncoder(typ) - if encoder != nil { - return encoder - } - } typeName := typ.String() encoder := typeEncoders[typeName] if encoder != nil { @@ -342,9 +324,6 @@ func createStructDescriptor(cfg *frozenConfig, typ reflect.Type, bindings []*Bin for _, extension := range extensions { extension.UpdateStructDescriptor(structDescriptor) } - for _, extension := range cfg.extensions { - extension.UpdateStructDescriptor(structDescriptor) - } processTags(structDescriptor, cfg) // merge normal & embedded bindings & sort with original order allBindings := sortableBindings(append(embeddedBindings, structDescriptor.Fields...)) diff --git a/vendor/github.com/syndtr/gocapability/capability/capability_linux.go b/vendor/github.com/syndtr/gocapability/capability/capability_linux.go index 6d2135ac5..205e0f701 100644 --- a/vendor/github.com/syndtr/gocapability/capability/capability_linux.go +++ b/vendor/github.com/syndtr/gocapability/capability/capability_linux.go @@ -428,11 +428,11 @@ func (c *capsV3) Load() (err error) { } if strings.HasPrefix(line, "CapB") { fmt.Sscanf(line[4:], "nd: %08x%08x", &c.bounds[1], &c.bounds[0]) - break + continue } if strings.HasPrefix(line, "CapA") { fmt.Sscanf(line[4:], "mb: %08x%08x", &c.ambient[1], &c.ambient[0]) - break + continue } } f.Close()