diff --git a/vendor.conf b/vendor.conf index 235be017f..72df42c49 100644 --- a/vendor.conf +++ b/vendor.conf @@ -5,11 +5,12 @@ github.com/docker/docker 86f080cff0914e9694068ed78d503701667c4c00 github.com/docker/distribution 0d3efadf0154c2b8a4e7b6621fff9809655cc580 # containerd dependencies -go.etcd.io/bbolt 2eb7227adea1d5cf85f0bc2a82b7059b13c2fa68 -google.golang.org/grpc 25c4f928eaa6d96443009bd842389fb4fa48664e # v1.20.1 +go.opencensus.io v0.22.0 +go.etcd.io/bbolt v1.3.3 +google.golang.org/grpc 6eaf6f47437a6b4e2153a190160ef39a92c7eceb # v1.23.0 google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944 golang.org/x/text 19e51611da83d6be54ddafce4a4af510cb3e9ea4 -golang.org/x/sys 4c4f7f33c9ed00de01c4c741d2177abfcfe19307 https://github.com/golang/sys +golang.org/x/sys fb81701db80f1745f51259b1f286de3fe2ec80c8 https://github.com/golang/sys # TODO(windows): update this in containerd/containerd golang.org/x/sync 42b317875d0fa942474b76e1b46a6060d720ae6e golang.org/x/net f3200d17e092c607f615320ecaad13d87ad9a2b3 github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c @@ -26,6 +27,8 @@ github.com/opencontainers/image-spec v1.0.1 github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7 github.com/matttproud/golang_protobuf_extensions v1.0.1 github.com/konsorten/go-windows-terminal-sequences v1.0.1 +github.com/imdario/mergo v0.3.7 +github.com/hashicorp/golang-lru v0.5.3 github.com/grpc-ecosystem/go-grpc-prometheus v1.1 github.com/google/uuid v1.1.1 github.com/golang/protobuf v1.2.0 @@ -37,15 +40,15 @@ github.com/docker/go-metrics 4ea375f7759c82740c893fc030bc37088d2ec098 github.com/docker/go-events 9461782956ad83b30282bf90e31fa6a70c255ba9 github.com/coreos/go-systemd v14 github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40 -github.com/containerd/ttrpc 1fb3814edf44a76e0ccf503decf726d994919a9a +github.com/containerd/ttrpc 92c8520ef9f86600c650dd540266a007bf03670f github.com/containerd/go-runc 9007c2405372fe28918845901a3276c0915689a1 -github.com/containerd/fifo 3d5202aec260678c48179c56f40e6f38a095738c -github.com/containerd/continuity bd77b46c8352f74eb12c85bdc01f4b90f69d66b4 -github.com/containerd/containerd a3a30635ef713b544ea7feff0d12a768fd1ed636 +github.com/containerd/fifo bda0ff6ed73c67bfb5e62bc9c697f146b7fd7f13 +github.com/containerd/continuity f2a389ac0a02ce21c09edd7344677a601970f41c +github.com/containerd/containerd 59a625defb21c958c25424fa5cc806167e22382e github.com/containerd/console 0650fd9eeb50bab4fc99dceb9f2e14cf58f36e7f github.com/containerd/cgroups c4b9ac5c7601384c965b9646fc515884e091ebb9 github.com/beorn7/perks 4c0e84591b9aa9e6dcfdf3e020114cd81f89d5f9 -github.com/Microsoft/hcsshim 8abdbb8205e4192c68b5f84c31197156f31be517 +github.com/Microsoft/hcsshim 1354cb2e878d37d2f5c11595634290ea9e2600a1 # TODO(windows): update this in containerd/containerd github.com/Microsoft/go-winio v0.4.14 github.com/BurntSushi/toml v0.3.1 diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/doc.go b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/doc.go new file mode 100644 index 000000000..0684d0596 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/doc.go @@ -0,0 +1 @@ +package options diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go new file mode 100644 index 000000000..e805b3e5f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.pb.go @@ -0,0 +1,1143 @@ +// Code generated by protoc-gen-gogo. DO NOT EDIT. +// source: github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto + +package options + +import ( + fmt "fmt" + proto "github.com/gogo/protobuf/proto" + _ "github.com/gogo/protobuf/types" + github_com_gogo_protobuf_types "github.com/gogo/protobuf/types" + io "io" + math "math" + reflect "reflect" + strings "strings" + time "time" +) + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf +var _ = time.Kitchen + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type Options_DebugType int32 + +const ( + Options_NPIPE Options_DebugType = 0 + Options_FILE Options_DebugType = 1 + Options_ETW Options_DebugType = 2 +) + +var Options_DebugType_name = map[int32]string{ + 0: "NPIPE", + 1: "FILE", + 2: "ETW", +} + +var Options_DebugType_value = map[string]int32{ + "NPIPE": 0, + "FILE": 1, + "ETW": 2, +} + +func (x Options_DebugType) String() string { + return proto.EnumName(Options_DebugType_name, int32(x)) +} + +func (Options_DebugType) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0, 0} +} + +type Options_SandboxIsolation int32 + +const ( + Options_PROCESS Options_SandboxIsolation = 0 + Options_HYPERVISOR Options_SandboxIsolation = 1 +) + +var Options_SandboxIsolation_name = map[int32]string{ + 0: "PROCESS", + 1: "HYPERVISOR", +} + +var Options_SandboxIsolation_value = map[string]int32{ + "PROCESS": 0, + "HYPERVISOR": 1, +} + +func (x Options_SandboxIsolation) String() string { + return proto.EnumName(Options_SandboxIsolation_name, int32(x)) +} + +func (Options_SandboxIsolation) EnumDescriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0, 1} +} + +// Options are the set of customizations that can be passed at Create time. +type Options struct { + // enable debug tracing + Debug bool `protobuf:"varint,1,opt,name=debug,proto3" json:"debug,omitempty"` + // debug tracing output type + DebugType Options_DebugType `protobuf:"varint,2,opt,name=debug_type,json=debugType,proto3,enum=containerd.runhcs.v1.Options_DebugType" json:"debug_type,omitempty"` + // registry key root for storage of the runhcs container state + RegistryRoot string `protobuf:"bytes,3,opt,name=registry_root,json=registryRoot,proto3" json:"registry_root,omitempty"` + // sandbox_image is the image to use for the sandbox that matches the + // sandbox_platform. + SandboxImage string `protobuf:"bytes,4,opt,name=sandbox_image,json=sandboxImage,proto3" json:"sandbox_image,omitempty"` + // sandbox_platform is a CRI setting that specifies the platform + // architecture for all sandbox's in this runtime. Values are + // 'windows/amd64' and 'linux/amd64'. + SandboxPlatform string `protobuf:"bytes,5,opt,name=sandbox_platform,json=sandboxPlatform,proto3" json:"sandbox_platform,omitempty"` + // sandbox_isolation is a CRI setting that specifies the isolation level of + // the sandbox. For Windows runtime PROCESS and HYPERVISOR are valid. For + // LCOW only HYPERVISOR is valid and default if omitted. + SandboxIsolation Options_SandboxIsolation `protobuf:"varint,6,opt,name=sandbox_isolation,json=sandboxIsolation,proto3,enum=containerd.runhcs.v1.Options_SandboxIsolation" json:"sandbox_isolation,omitempty"` + // boot_files_root_path is the path to the directory containing the LCOW + // kernel and root FS files. + BootFilesRootPath string `protobuf:"bytes,7,opt,name=boot_files_root_path,json=bootFilesRootPath,proto3" json:"boot_files_root_path,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *Options) Reset() { *m = Options{} } +func (*Options) ProtoMessage() {} +func (*Options) Descriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{0} +} +func (m *Options) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *Options) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_Options.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *Options) XXX_Merge(src proto.Message) { + xxx_messageInfo_Options.Merge(m, src) +} +func (m *Options) XXX_Size() int { + return m.Size() +} +func (m *Options) XXX_DiscardUnknown() { + xxx_messageInfo_Options.DiscardUnknown(m) +} + +var xxx_messageInfo_Options proto.InternalMessageInfo + +// ProcessDetails contains additional information about a process. This is the additional +// info returned in the Pids query. +type ProcessDetails struct { + ImageName string `protobuf:"bytes,1,opt,name=image_name,json=imageName,proto3" json:"image_name,omitempty"` + CreatedAt time.Time `protobuf:"bytes,2,opt,name=created_at,json=createdAt,proto3,stdtime" json:"created_at"` + KernelTime_100Ns uint64 `protobuf:"varint,3,opt,name=kernel_time_100_ns,json=kernelTime100Ns,proto3" json:"kernel_time_100_ns,omitempty"` + MemoryCommitBytes uint64 `protobuf:"varint,4,opt,name=memory_commit_bytes,json=memoryCommitBytes,proto3" json:"memory_commit_bytes,omitempty"` + MemoryWorkingSetPrivateBytes uint64 `protobuf:"varint,5,opt,name=memory_working_set_private_bytes,json=memoryWorkingSetPrivateBytes,proto3" json:"memory_working_set_private_bytes,omitempty"` + MemoryWorkingSetSharedBytes uint64 `protobuf:"varint,6,opt,name=memory_working_set_shared_bytes,json=memoryWorkingSetSharedBytes,proto3" json:"memory_working_set_shared_bytes,omitempty"` + ProcessID uint32 `protobuf:"varint,7,opt,name=process_id,json=processId,proto3" json:"process_id,omitempty"` + UserTime_100Ns uint64 `protobuf:"varint,8,opt,name=user_time_100_ns,json=userTime100Ns,proto3" json:"user_time_100_ns,omitempty"` + ExecID string `protobuf:"bytes,9,opt,name=exec_id,json=execId,proto3" json:"exec_id,omitempty"` + XXX_NoUnkeyedLiteral struct{} `json:"-"` + XXX_unrecognized []byte `json:"-"` + XXX_sizecache int32 `json:"-"` +} + +func (m *ProcessDetails) Reset() { *m = ProcessDetails{} } +func (*ProcessDetails) ProtoMessage() {} +func (*ProcessDetails) Descriptor() ([]byte, []int) { + return fileDescriptor_b643df6839c75082, []int{1} +} +func (m *ProcessDetails) XXX_Unmarshal(b []byte) error { + return m.Unmarshal(b) +} +func (m *ProcessDetails) XXX_Marshal(b []byte, deterministic bool) ([]byte, error) { + if deterministic { + return xxx_messageInfo_ProcessDetails.Marshal(b, m, deterministic) + } else { + b = b[:cap(b)] + n, err := m.MarshalTo(b) + if err != nil { + return nil, err + } + return b[:n], nil + } +} +func (m *ProcessDetails) XXX_Merge(src proto.Message) { + xxx_messageInfo_ProcessDetails.Merge(m, src) +} +func (m *ProcessDetails) XXX_Size() int { + return m.Size() +} +func (m *ProcessDetails) XXX_DiscardUnknown() { + xxx_messageInfo_ProcessDetails.DiscardUnknown(m) +} + +var xxx_messageInfo_ProcessDetails proto.InternalMessageInfo + +func init() { + proto.RegisterEnum("containerd.runhcs.v1.Options_DebugType", Options_DebugType_name, Options_DebugType_value) + proto.RegisterEnum("containerd.runhcs.v1.Options_SandboxIsolation", Options_SandboxIsolation_name, Options_SandboxIsolation_value) + proto.RegisterType((*Options)(nil), "containerd.runhcs.v1.Options") + proto.RegisterType((*ProcessDetails)(nil), "containerd.runhcs.v1.ProcessDetails") +} + +func init() { + proto.RegisterFile("github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto", fileDescriptor_b643df6839c75082) +} + +var fileDescriptor_b643df6839c75082 = []byte{ + // 704 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x00, 0x00, 0x00, 0x02, 0xff, 0xa4, 0x54, 0x4d, 0x6f, 0xda, 0x48, + 0x18, 0xc6, 0xe1, 0xd3, 0x6f, 0x96, 0xc4, 0x99, 0xe5, 0x80, 0xb2, 0xbb, 0x80, 0xc8, 0x21, 0x89, + 0x76, 0x63, 0x43, 0xf6, 0xd8, 0x53, 0x09, 0xa0, 0xba, 0x6a, 0x83, 0x65, 0xa2, 0xa6, 0x1f, 0x07, + 0xcb, 0xd8, 0x83, 0xb1, 0x82, 0x3d, 0xd6, 0xcc, 0x90, 0x86, 0x5b, 0x7f, 0x42, 0x7f, 0x55, 0x95, + 0x63, 0x8f, 0x95, 0x2a, 0xa5, 0x0d, 0xbf, 0xa4, 0x9a, 0xb1, 0x49, 0xd4, 0x28, 0xea, 0xa5, 0x27, + 0xc6, 0xcf, 0xf3, 0xbc, 0xcf, 0xfb, 0x29, 0x60, 0x14, 0x84, 0x7c, 0xb6, 0x98, 0xe8, 0x1e, 0x89, + 0x8c, 0x97, 0xa1, 0x47, 0x09, 0x23, 0x53, 0x6e, 0xcc, 0x3c, 0xc6, 0x66, 0x61, 0x64, 0x78, 0x91, + 0x6f, 0x78, 0x24, 0xe6, 0x6e, 0x18, 0x63, 0xea, 0x1f, 0x09, 0xec, 0x88, 0x2e, 0xe2, 0x99, 0xc7, + 0x8e, 0x2e, 0xbb, 0x06, 0x49, 0x78, 0x48, 0x62, 0x66, 0xa4, 0x88, 0x9e, 0x50, 0xc2, 0x09, 0xaa, + 0xdd, 0xeb, 0xf5, 0x8c, 0xb8, 0xec, 0xee, 0xd6, 0x02, 0x12, 0x10, 0x29, 0x30, 0xc4, 0x2b, 0xd5, + 0xee, 0x36, 0x03, 0x42, 0x82, 0x39, 0x36, 0xe4, 0xd7, 0x64, 0x31, 0x35, 0x78, 0x18, 0x61, 0xc6, + 0xdd, 0x28, 0x49, 0x05, 0xed, 0x4f, 0x79, 0x28, 0x8f, 0xd2, 0x2c, 0xa8, 0x06, 0x45, 0x1f, 0x4f, + 0x16, 0x41, 0x5d, 0x69, 0x29, 0x07, 0x15, 0x3b, 0xfd, 0x40, 0x43, 0x00, 0xf9, 0x70, 0xf8, 0x32, + 0xc1, 0xf5, 0x8d, 0x96, 0x72, 0xb0, 0x75, 0xbc, 0xaf, 0x3f, 0x56, 0x83, 0x9e, 0x19, 0xe9, 0x7d, + 0xa1, 0x3f, 0x5b, 0x26, 0xd8, 0x56, 0xfd, 0xf5, 0x13, 0xed, 0x41, 0x95, 0xe2, 0x20, 0x64, 0x9c, + 0x2e, 0x1d, 0x4a, 0x08, 0xaf, 0xe7, 0x5b, 0xca, 0x81, 0x6a, 0xff, 0xb1, 0x06, 0x6d, 0x42, 0xb8, + 0x10, 0x31, 0x37, 0xf6, 0x27, 0xe4, 0xca, 0x09, 0x23, 0x37, 0xc0, 0xf5, 0x42, 0x2a, 0xca, 0x40, + 0x53, 0x60, 0xe8, 0x10, 0xb4, 0xb5, 0x28, 0x99, 0xbb, 0x7c, 0x4a, 0x68, 0x54, 0x2f, 0x4a, 0xdd, + 0x76, 0x86, 0x5b, 0x19, 0x8c, 0xde, 0xc1, 0xce, 0x9d, 0x1f, 0x23, 0x73, 0x57, 0xd4, 0x57, 0x2f, + 0xc9, 0x1e, 0xf4, 0x5f, 0xf7, 0x30, 0xce, 0x32, 0xae, 0xa3, 0xec, 0x75, 0xce, 0x3b, 0x04, 0x19, + 0x50, 0x9b, 0x10, 0xc2, 0x9d, 0x69, 0x38, 0xc7, 0x4c, 0xf6, 0xe4, 0x24, 0x2e, 0x9f, 0xd5, 0xcb, + 0xb2, 0x96, 0x1d, 0xc1, 0x0d, 0x05, 0x25, 0x3a, 0xb3, 0x5c, 0x3e, 0x6b, 0x1f, 0x82, 0x7a, 0x37, + 0x1a, 0xa4, 0x42, 0xf1, 0xd4, 0x32, 0xad, 0x81, 0x96, 0x43, 0x15, 0x28, 0x0c, 0xcd, 0x17, 0x03, + 0x4d, 0x41, 0x65, 0xc8, 0x0f, 0xce, 0xce, 0xb5, 0x8d, 0xb6, 0x01, 0xda, 0xc3, 0x0a, 0xd0, 0x26, + 0x94, 0x2d, 0x7b, 0x74, 0x32, 0x18, 0x8f, 0xb5, 0x1c, 0xda, 0x02, 0x78, 0xf6, 0xc6, 0x1a, 0xd8, + 0xaf, 0xcc, 0xf1, 0xc8, 0xd6, 0x94, 0xf6, 0xd7, 0x3c, 0x6c, 0x59, 0x94, 0x78, 0x98, 0xb1, 0x3e, + 0xe6, 0x6e, 0x38, 0x67, 0xe8, 0x1f, 0x00, 0x39, 0x44, 0x27, 0x76, 0x23, 0x2c, 0x97, 0xaa, 0xda, + 0xaa, 0x44, 0x4e, 0xdd, 0x08, 0xa3, 0x13, 0x00, 0x8f, 0x62, 0x97, 0x63, 0xdf, 0x71, 0xb9, 0x5c, + 0xec, 0xe6, 0xf1, 0xae, 0x9e, 0x1e, 0x8c, 0xbe, 0x3e, 0x18, 0xfd, 0x6c, 0x7d, 0x30, 0xbd, 0xca, + 0xf5, 0x4d, 0x33, 0xf7, 0xf1, 0x5b, 0x53, 0xb1, 0xd5, 0x2c, 0xee, 0x29, 0x47, 0xff, 0x02, 0xba, + 0xc0, 0x34, 0xc6, 0x73, 0x47, 0x5c, 0x96, 0xd3, 0xed, 0x74, 0x9c, 0x98, 0xc9, 0xd5, 0x16, 0xec, + 0xed, 0x94, 0x11, 0x0e, 0xdd, 0x4e, 0xe7, 0x94, 0x21, 0x1d, 0xfe, 0x8c, 0x70, 0x44, 0xe8, 0xd2, + 0xf1, 0x48, 0x14, 0x85, 0xdc, 0x99, 0x2c, 0x39, 0x66, 0x72, 0xc7, 0x05, 0x7b, 0x27, 0xa5, 0x4e, + 0x24, 0xd3, 0x13, 0x04, 0x1a, 0x42, 0x2b, 0xd3, 0xbf, 0x27, 0xf4, 0x22, 0x8c, 0x03, 0x87, 0x61, + 0xee, 0x24, 0x34, 0xbc, 0x74, 0x39, 0xce, 0x82, 0x8b, 0x32, 0xf8, 0xef, 0x54, 0x77, 0x9e, 0xca, + 0xc6, 0x98, 0x5b, 0xa9, 0x28, 0xf5, 0xe9, 0x43, 0xf3, 0x11, 0x1f, 0x36, 0x73, 0x29, 0xf6, 0x33, + 0x9b, 0x92, 0xb4, 0xf9, 0xeb, 0xa1, 0xcd, 0x58, 0x6a, 0x52, 0x97, 0xff, 0x00, 0x92, 0x74, 0xc0, + 0x4e, 0xe8, 0xcb, 0x25, 0x57, 0x7b, 0xd5, 0xd5, 0x4d, 0x53, 0xcd, 0xc6, 0x6e, 0xf6, 0x6d, 0x35, + 0x13, 0x98, 0x3e, 0xda, 0x07, 0x6d, 0xc1, 0x30, 0xfd, 0x69, 0x2c, 0x15, 0x99, 0xa4, 0x2a, 0xf0, + 0xfb, 0xa1, 0xec, 0x41, 0x19, 0x5f, 0x61, 0x4f, 0x78, 0xaa, 0x62, 0x45, 0x3d, 0x58, 0xdd, 0x34, + 0x4b, 0x83, 0x2b, 0xec, 0x99, 0x7d, 0xbb, 0x24, 0x28, 0xd3, 0xef, 0xf9, 0xd7, 0xb7, 0x8d, 0xdc, + 0x97, 0xdb, 0x46, 0xee, 0xc3, 0xaa, 0xa1, 0x5c, 0xaf, 0x1a, 0xca, 0xe7, 0x55, 0x43, 0xf9, 0xbe, + 0x6a, 0x28, 0x6f, 0x9f, 0xff, 0xfe, 0xdf, 0xcb, 0x93, 0xec, 0xf7, 0x75, 0x6e, 0x52, 0x92, 0x7b, + 0xff, 0xff, 0x47, 0x00, 0x00, 0x00, 0xff, 0xff, 0xa3, 0x9a, 0x54, 0x17, 0xb5, 0x04, 0x00, 0x00, +} + +func (m *Options) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *Options) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Debug { + dAtA[i] = 0x8 + i++ + if m.Debug { + dAtA[i] = 1 + } else { + dAtA[i] = 0 + } + i++ + } + if m.DebugType != 0 { + dAtA[i] = 0x10 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.DebugType)) + } + if len(m.RegistryRoot) > 0 { + dAtA[i] = 0x1a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.RegistryRoot))) + i += copy(dAtA[i:], m.RegistryRoot) + } + if len(m.SandboxImage) > 0 { + dAtA[i] = 0x22 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.SandboxImage))) + i += copy(dAtA[i:], m.SandboxImage) + } + if len(m.SandboxPlatform) > 0 { + dAtA[i] = 0x2a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.SandboxPlatform))) + i += copy(dAtA[i:], m.SandboxPlatform) + } + if m.SandboxIsolation != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.SandboxIsolation)) + } + if len(m.BootFilesRootPath) > 0 { + dAtA[i] = 0x3a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.BootFilesRootPath))) + i += copy(dAtA[i:], m.BootFilesRootPath) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func (m *ProcessDetails) Marshal() (dAtA []byte, err error) { + size := m.Size() + dAtA = make([]byte, size) + n, err := m.MarshalTo(dAtA) + if err != nil { + return nil, err + } + return dAtA[:n], nil +} + +func (m *ProcessDetails) MarshalTo(dAtA []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ImageName) > 0 { + dAtA[i] = 0xa + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.ImageName))) + i += copy(dAtA[i:], m.ImageName) + } + dAtA[i] = 0x12 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(github_com_gogo_protobuf_types.SizeOfStdTime(m.CreatedAt))) + n1, err := github_com_gogo_protobuf_types.StdTimeMarshalTo(m.CreatedAt, dAtA[i:]) + if err != nil { + return 0, err + } + i += n1 + if m.KernelTime_100Ns != 0 { + dAtA[i] = 0x18 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.KernelTime_100Ns)) + } + if m.MemoryCommitBytes != 0 { + dAtA[i] = 0x20 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.MemoryCommitBytes)) + } + if m.MemoryWorkingSetPrivateBytes != 0 { + dAtA[i] = 0x28 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.MemoryWorkingSetPrivateBytes)) + } + if m.MemoryWorkingSetSharedBytes != 0 { + dAtA[i] = 0x30 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.MemoryWorkingSetSharedBytes)) + } + if m.ProcessID != 0 { + dAtA[i] = 0x38 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.ProcessID)) + } + if m.UserTime_100Ns != 0 { + dAtA[i] = 0x40 + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(m.UserTime_100Ns)) + } + if len(m.ExecID) > 0 { + dAtA[i] = 0x4a + i++ + i = encodeVarintRunhcs(dAtA, i, uint64(len(m.ExecID))) + i += copy(dAtA[i:], m.ExecID) + } + if m.XXX_unrecognized != nil { + i += copy(dAtA[i:], m.XXX_unrecognized) + } + return i, nil +} + +func encodeVarintRunhcs(dAtA []byte, offset int, v uint64) int { + for v >= 1<<7 { + dAtA[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + dAtA[offset] = uint8(v) + return offset + 1 +} +func (m *Options) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + if m.Debug { + n += 2 + } + if m.DebugType != 0 { + n += 1 + sovRunhcs(uint64(m.DebugType)) + } + l = len(m.RegistryRoot) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + l = len(m.SandboxImage) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + l = len(m.SandboxPlatform) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + if m.SandboxIsolation != 0 { + n += 1 + sovRunhcs(uint64(m.SandboxIsolation)) + } + l = len(m.BootFilesRootPath) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func (m *ProcessDetails) Size() (n int) { + if m == nil { + return 0 + } + var l int + _ = l + l = len(m.ImageName) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + l = github_com_gogo_protobuf_types.SizeOfStdTime(m.CreatedAt) + n += 1 + l + sovRunhcs(uint64(l)) + if m.KernelTime_100Ns != 0 { + n += 1 + sovRunhcs(uint64(m.KernelTime_100Ns)) + } + if m.MemoryCommitBytes != 0 { + n += 1 + sovRunhcs(uint64(m.MemoryCommitBytes)) + } + if m.MemoryWorkingSetPrivateBytes != 0 { + n += 1 + sovRunhcs(uint64(m.MemoryWorkingSetPrivateBytes)) + } + if m.MemoryWorkingSetSharedBytes != 0 { + n += 1 + sovRunhcs(uint64(m.MemoryWorkingSetSharedBytes)) + } + if m.ProcessID != 0 { + n += 1 + sovRunhcs(uint64(m.ProcessID)) + } + if m.UserTime_100Ns != 0 { + n += 1 + sovRunhcs(uint64(m.UserTime_100Ns)) + } + l = len(m.ExecID) + if l > 0 { + n += 1 + l + sovRunhcs(uint64(l)) + } + if m.XXX_unrecognized != nil { + n += len(m.XXX_unrecognized) + } + return n +} + +func sovRunhcs(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozRunhcs(x uint64) (n int) { + return sovRunhcs(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (this *Options) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&Options{`, + `Debug:` + fmt.Sprintf("%v", this.Debug) + `,`, + `DebugType:` + fmt.Sprintf("%v", this.DebugType) + `,`, + `RegistryRoot:` + fmt.Sprintf("%v", this.RegistryRoot) + `,`, + `SandboxImage:` + fmt.Sprintf("%v", this.SandboxImage) + `,`, + `SandboxPlatform:` + fmt.Sprintf("%v", this.SandboxPlatform) + `,`, + `SandboxIsolation:` + fmt.Sprintf("%v", this.SandboxIsolation) + `,`, + `BootFilesRootPath:` + fmt.Sprintf("%v", this.BootFilesRootPath) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func (this *ProcessDetails) String() string { + if this == nil { + return "nil" + } + s := strings.Join([]string{`&ProcessDetails{`, + `ImageName:` + fmt.Sprintf("%v", this.ImageName) + `,`, + `CreatedAt:` + strings.Replace(strings.Replace(this.CreatedAt.String(), "Timestamp", "types.Timestamp", 1), `&`, ``, 1) + `,`, + `KernelTime_100Ns:` + fmt.Sprintf("%v", this.KernelTime_100Ns) + `,`, + `MemoryCommitBytes:` + fmt.Sprintf("%v", this.MemoryCommitBytes) + `,`, + `MemoryWorkingSetPrivateBytes:` + fmt.Sprintf("%v", this.MemoryWorkingSetPrivateBytes) + `,`, + `MemoryWorkingSetSharedBytes:` + fmt.Sprintf("%v", this.MemoryWorkingSetSharedBytes) + `,`, + `ProcessID:` + fmt.Sprintf("%v", this.ProcessID) + `,`, + `UserTime_100Ns:` + fmt.Sprintf("%v", this.UserTime_100Ns) + `,`, + `ExecID:` + fmt.Sprintf("%v", this.ExecID) + `,`, + `XXX_unrecognized:` + fmt.Sprintf("%v", this.XXX_unrecognized) + `,`, + `}`, + }, "") + return s +} +func valueToStringRunhcs(v interface{}) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("*%v", pv) +} +func (m *Options) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Options: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Options: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Debug", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + v |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + m.Debug = bool(v != 0) + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field DebugType", wireType) + } + m.DebugType = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.DebugType |= Options_DebugType(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field RegistryRoot", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.RegistryRoot = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SandboxImage", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SandboxImage = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SandboxPlatform", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SandboxPlatform = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field SandboxIsolation", wireType) + } + m.SandboxIsolation = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.SandboxIsolation |= Options_SandboxIsolation(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field BootFilesRootPath", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.BootFilesRootPath = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipRunhcs(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ProcessDetails) Unmarshal(dAtA []byte) error { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ProcessDetails: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ProcessDetails: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ImageName", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ImageName = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CreatedAt", wireType) + } + var msglen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + msglen |= int(b&0x7F) << shift + if b < 0x80 { + break + } + } + if msglen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + msglen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + if err := github_com_gogo_protobuf_types.StdTimeUnmarshal(&m.CreatedAt, dAtA[iNdEx:postIndex]); err != nil { + return err + } + iNdEx = postIndex + case 3: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field KernelTime_100Ns", wireType) + } + m.KernelTime_100Ns = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.KernelTime_100Ns |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 4: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryCommitBytes", wireType) + } + m.MemoryCommitBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MemoryCommitBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryWorkingSetPrivateBytes", wireType) + } + m.MemoryWorkingSetPrivateBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MemoryWorkingSetPrivateBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MemoryWorkingSetSharedBytes", wireType) + } + m.MemoryWorkingSetSharedBytes = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.MemoryWorkingSetSharedBytes |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field ProcessID", wireType) + } + m.ProcessID = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.ProcessID |= uint32(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 8: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field UserTime_100Ns", wireType) + } + m.UserTime_100Ns = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + m.UserTime_100Ns |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + case 9: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ExecID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowRunhcs + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + stringLen |= uint64(b&0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthRunhcs + } + postIndex := iNdEx + intStringLen + if postIndex < 0 { + return ErrInvalidLengthRunhcs + } + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ExecID = string(dAtA[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipRunhcs(dAtA[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) < 0 { + return ErrInvalidLengthRunhcs + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + m.XXX_unrecognized = append(m.XXX_unrecognized, dAtA[iNdEx:iNdEx+skippy]...) + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipRunhcs(dAtA []byte) (n int, err error) { + l := len(dAtA) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if dAtA[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if length < 0 { + return 0, ErrInvalidLengthRunhcs + } + iNdEx += length + if iNdEx < 0 { + return 0, ErrInvalidLengthRunhcs + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowRunhcs + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := dAtA[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipRunhcs(dAtA[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + if iNdEx < 0 { + return 0, ErrInvalidLengthRunhcs + } + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthRunhcs = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowRunhcs = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto new file mode 100644 index 000000000..9d6852a0a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options/runhcs.proto @@ -0,0 +1,63 @@ +syntax = "proto3"; + +package containerd.runhcs.v1; + +import weak "gogoproto/gogo.proto"; +import "google/protobuf/timestamp.proto"; + +option go_package = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options;options"; + +// Options are the set of customizations that can be passed at Create time. +message Options { + // enable debug tracing + bool debug = 1; + + enum DebugType { + NPIPE = 0; + FILE = 1; + ETW = 2; + } + + // debug tracing output type + DebugType debug_type = 2; + + // registry key root for storage of the runhcs container state + string registry_root = 3; + + // sandbox_image is the image to use for the sandbox that matches the + // sandbox_platform. + string sandbox_image = 4; + + // sandbox_platform is a CRI setting that specifies the platform + // architecture for all sandbox's in this runtime. Values are + // 'windows/amd64' and 'linux/amd64'. + string sandbox_platform = 5; + + enum SandboxIsolation { + PROCESS = 0; + HYPERVISOR = 1; + } + + // sandbox_isolation is a CRI setting that specifies the isolation level of + // the sandbox. For Windows runtime PROCESS and HYPERVISOR are valid. For + // LCOW only HYPERVISOR is valid and default if omitted. + SandboxIsolation sandbox_isolation = 6; + + // boot_files_root_path is the path to the directory containing the LCOW + // kernel and root FS files. + string boot_files_root_path = 7; +} + +// ProcessDetails contains additional information about a process. This is the additional +// info returned in the Pids query. +message ProcessDetails { + string image_name = 1; + google.protobuf.Timestamp created_at = 2 [(gogoproto.stdtime) = true, (gogoproto.nullable) = false]; + uint64 kernel_time_100_ns = 3; + uint64 memory_commit_bytes = 4; + uint64 memory_working_set_private_bytes = 5; + uint64 memory_working_set_shared_bytes = 6; + uint32 process_id = 7; + uint64 user_time_100_ns = 8; + string exec_id = 9; +} diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index e142c3154..53c0a3854 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,8 +1,10 @@ package hcsshim import ( + "context" "fmt" "os" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -52,7 +54,10 @@ const ( type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { - system *hcs.System + system *hcs.System + waitOnce sync.Once + waitErr error + waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation @@ -71,61 +76,87 @@ func CreateContainer(id string, c *ContainerConfig) (Container, error) { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - system, err := hcs.CreateComputeSystem(id, fullConfig) + system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - system, err := hcs.OpenComputeSystem(id) + system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } - return &container{system}, err + return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - return hcs.GetComputeSystems(q) + return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { - return convertSystemError(container.system.Start(), container) + return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - return convertSystemError(container.system.Shutdown(), container) + err := container.system.Shutdown(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - return convertSystemError(container.system.Terminate(), container) + err := container.system.Terminate(context.Background()) + if err != nil { + return convertSystemError(err, container) + } + return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - return convertSystemError(container.system.Wait(), container) + err := container.system.Wait() + if err == nil { + err = container.system.ExitError() + } + return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. -func (container *container) WaitTimeout(t time.Duration) error { - return convertSystemError(container.system.WaitTimeout(t), container) +func (container *container) WaitTimeout(timeout time.Duration) error { + container.waitOnce.Do(func() { + container.waitCh = make(chan struct{}) + go func() { + container.waitErr = container.Wait() + close(container.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} + case <-container.waitCh: + return container.waitErr + } } // Pause pauses the execution of a container. func (container *container) Pause() error { - return convertSystemError(container.system.Pause(), container) + return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { - return convertSystemError(container.system.Resume(), container) + return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install @@ -135,7 +166,7 @@ func (container *container) HasPendingUpdates() (bool, error) { // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - properties, err := container.system.Properties(schema1.PropertyTypeStatistics) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } @@ -145,7 +176,7 @@ func (container *container) Statistics() (Statistics, error) { // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - properties, err := container.system.Properties(schema1.PropertyTypeProcessList) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } @@ -155,7 +186,7 @@ func (container *container) ProcessList() ([]ProcessListItem, error) { // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) + properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } @@ -165,20 +196,20 @@ func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskContr // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - p, err := container.system.CreateProcess(c) + p, err := container.system.CreateProcessNoStdio(c) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - p, err := container.system.OpenProcess(pid) + p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } - return &process{p}, nil + return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. @@ -188,5 +219,5 @@ func (container *container) Close() error { // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - return convertSystemError(container.system.Modify(config), container) + return convertSystemError(container.system.Modify(context.Background(), config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/go.mod b/vendor/github.com/Microsoft/hcsshim/go.mod new file mode 100644 index 000000000..f86262702 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/go.mod @@ -0,0 +1,39 @@ +module github.com/Microsoft/hcsshim + +go 1.12 + +require ( + github.com/Microsoft/go-winio v0.4.14 + github.com/blang/semver v3.1.0+incompatible // indirect + github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 + github.com/containerd/containerd v1.3.0-beta.2.0.20190828155532-0293cbd26c69 + github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect + github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect + github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 + github.com/containerd/ttrpc v0.0.0-20190826154248-f969a7f076a2 + github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd + github.com/docker/distribution v2.7.1+incompatible // indirect + github.com/docker/go-events v0.0.0-20190806004212-e31b211e4f1c // indirect + github.com/gogo/googleapis v1.2.0 // indirect + github.com/gogo/protobuf v1.2.1 + github.com/hashicorp/errwrap v0.0.0-20141028054710-7554cd9344ce // indirect + github.com/hashicorp/go-multierror v0.0.0-20161216184304-ed905158d874 // indirect + github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect + github.com/opencontainers/image-spec v1.0.1 // indirect + github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect + github.com/opencontainers/runtime-spec v0.0.0-20190207185410-29686dbc5559 + github.com/opencontainers/runtime-tools v0.0.0-20181011054405-1d69bd0f9c39 + github.com/pkg/errors v0.8.1 + github.com/sirupsen/logrus v1.4.1 + github.com/syndtr/gocapability v0.0.0-20170704070218-db04d3cc01c8 // indirect + github.com/urfave/cli v0.0.0-20171014202726-7bc6a0acffa5 + github.com/xeipuuv/gojsonpointer v0.0.0-20180127040702-4e3ac2762d5f // indirect + github.com/xeipuuv/gojsonreference v0.0.0-20180127040603-bd5ef7bd5415 // indirect + github.com/xeipuuv/gojsonschema v0.0.0-20180618132009-1d523034197f // indirect + go.opencensus.io v0.22.0 + golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 + golang.org/x/sys v0.0.0-20190507160741-ecd444e8653b + google.golang.org/grpc v1.20.1 + gotest.tools v2.2.0+incompatible // indirect + k8s.io/kubernetes v1.13.0 +) diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go new file mode 100644 index 000000000..da741449b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcn.go @@ -0,0 +1,177 @@ +// Package hcn is a shim for the Host Compute Networking (HCN) service, which manages networking for Windows Server +// containers and Hyper-V containers. Previous to RS5, HCN was referred to as Host Networking Service (HNS). +package hcn + +import ( + "encoding/json" + "fmt" + "syscall" + + "github.com/Microsoft/go-winio/pkg/guid" +) + +//go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go hcn.go + +/// HNS V1 API + +//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +/// HCN V2 API + +// Network +//sys hcnEnumerateNetworks(query string, networks **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateNetworks? +//sys hcnCreateNetwork(id *_guid, settings string, network *hcnNetwork, result **uint16) (hr error) = computenetwork.HcnCreateNetwork? +//sys hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) = computenetwork.HcnOpenNetwork? +//sys hcnModifyNetwork(network hcnNetwork, settings string, result **uint16) (hr error) = computenetwork.HcnModifyNetwork? +//sys hcnQueryNetworkProperties(network hcnNetwork, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryNetworkProperties? +//sys hcnDeleteNetwork(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteNetwork? +//sys hcnCloseNetwork(network hcnNetwork) (hr error) = computenetwork.HcnCloseNetwork? + +// Endpoint +//sys hcnEnumerateEndpoints(query string, endpoints **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateEndpoints? +//sys hcnCreateEndpoint(network hcnNetwork, id *_guid, settings string, endpoint *hcnEndpoint, result **uint16) (hr error) = computenetwork.HcnCreateEndpoint? +//sys hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr error) = computenetwork.HcnOpenEndpoint? +//sys hcnModifyEndpoint(endpoint hcnEndpoint, settings string, result **uint16) (hr error) = computenetwork.HcnModifyEndpoint? +//sys hcnQueryEndpointProperties(endpoint hcnEndpoint, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryEndpointProperties? +//sys hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteEndpoint? +//sys hcnCloseEndpoint(endpoint hcnEndpoint) (hr error) = computenetwork.HcnCloseEndpoint? + +// Namespace +//sys hcnEnumerateNamespaces(query string, namespaces **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateNamespaces? +//sys hcnCreateNamespace(id *_guid, settings string, namespace *hcnNamespace, result **uint16) (hr error) = computenetwork.HcnCreateNamespace? +//sys hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr error) = computenetwork.HcnOpenNamespace? +//sys hcnModifyNamespace(namespace hcnNamespace, settings string, result **uint16) (hr error) = computenetwork.HcnModifyNamespace? +//sys hcnQueryNamespaceProperties(namespace hcnNamespace, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryNamespaceProperties? +//sys hcnDeleteNamespace(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteNamespace? +//sys hcnCloseNamespace(namespace hcnNamespace) (hr error) = computenetwork.HcnCloseNamespace? + +// LoadBalancer +//sys hcnEnumerateLoadBalancers(query string, loadBalancers **uint16, result **uint16) (hr error) = computenetwork.HcnEnumerateLoadBalancers? +//sys hcnCreateLoadBalancer(id *_guid, settings string, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) = computenetwork.HcnCreateLoadBalancer? +//sys hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) = computenetwork.HcnOpenLoadBalancer? +//sys hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings string, result **uint16) (hr error) = computenetwork.HcnModifyLoadBalancer? +//sys hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query string, properties **uint16, result **uint16) (hr error) = computenetwork.HcnQueryLoadBalancerProperties? +//sys hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) = computenetwork.HcnDeleteLoadBalancer? +//sys hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) = computenetwork.HcnCloseLoadBalancer? + +// Service +//sys hcnOpenService(service *hcnService, result **uint16) (hr error) = computenetwork.HcnOpenService? +//sys hcnRegisterServiceCallback(service hcnService, callback int32, context int32, callbackHandle *hcnCallbackHandle) (hr error) = computenetwork.HcnRegisterServiceCallback? +//sys hcnUnregisterServiceCallback(callbackHandle hcnCallbackHandle) (hr error) = computenetwork.HcnUnregisterServiceCallback? +//sys hcnCloseService(service hcnService) (hr error) = computenetwork.HcnCloseService? + +type _guid = guid.GUID + +type hcnNetwork syscall.Handle +type hcnEndpoint syscall.Handle +type hcnNamespace syscall.Handle +type hcnLoadBalancer syscall.Handle +type hcnService syscall.Handle +type hcnCallbackHandle syscall.Handle + +// SchemaVersion for HCN Objects/Queries. +type SchemaVersion = Version // hcnglobals.go + +// HostComputeQueryFlags are passed in to a HostComputeQuery to determine which +// properties of an object are returned. +type HostComputeQueryFlags uint32 + +var ( + // HostComputeQueryFlagsNone returns an object with the standard properties. + HostComputeQueryFlagsNone HostComputeQueryFlags + // HostComputeQueryFlagsDetailed returns an object with all properties. + HostComputeQueryFlagsDetailed HostComputeQueryFlags = 1 +) + +// HostComputeQuery is the format for HCN queries. +type HostComputeQuery struct { + SchemaVersion SchemaVersion `json:""` + Flags HostComputeQueryFlags `json:",omitempty"` + Filter string `json:",omitempty"` +} + +// defaultQuery generates HCN Query. +// Passed into get/enumerate calls to filter results. +func defaultQuery() HostComputeQuery { + query := HostComputeQuery{ + SchemaVersion: SchemaVersion{ + Major: 2, + Minor: 0, + }, + Flags: HostComputeQueryFlagsNone, + } + return query +} + +func defaultQueryJson() string { + query := defaultQuery() + queryJson, err := json.Marshal(query) + if err != nil { + return "" + } + return string(queryJson) +} + +// PlatformDoesNotSupportError happens when users are attempting to use a newer shim on an older OS +func platformDoesNotSupportError(featureName string) error { + return fmt.Errorf("Platform does not support feature %s", featureName) +} + +// V2ApiSupported returns an error if the HCN version does not support the V2 Apis. +func V2ApiSupported() error { + supported := GetSupportedFeatures() + if supported.Api.V2 { + return nil + } + return platformDoesNotSupportError("V2 Api/Schema") +} + +func V2SchemaVersion() SchemaVersion { + return SchemaVersion{ + Major: 2, + Minor: 0, + } +} + +// RemoteSubnetSupported returns an error if the HCN version does not support Remote Subnet policies. +func RemoteSubnetSupported() error { + supported := GetSupportedFeatures() + if supported.RemoteSubnet { + return nil + } + return platformDoesNotSupportError("Remote Subnet") +} + +// HostRouteSupported returns an error if the HCN version does not support Host Route policies. +func HostRouteSupported() error { + supported := GetSupportedFeatures() + if supported.HostRoute { + return nil + } + return platformDoesNotSupportError("Host Route") +} + +// DSRSupported returns an error if the HCN version does not support Direct Server Return. +func DSRSupported() error { + supported := GetSupportedFeatures() + if supported.DSR { + return nil + } + return platformDoesNotSupportError("Direct Server Return (DSR)") +} + +// RequestType are the different operations performed to settings. +// Used to update the settings of Endpoint/Namespace objects. +type RequestType string + +var ( + // RequestTypeAdd adds the provided settings object. + RequestTypeAdd RequestType = "Add" + // RequestTypeRemove removes the provided settings object. + RequestTypeRemove RequestType = "Remove" + // RequestTypeUpdate replaces settings with the ones provided. + RequestTypeUpdate RequestType = "Update" + // RequestTypeRefresh refreshes the settings provided. + RequestTypeRefresh RequestType = "Refresh" +) diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go new file mode 100644 index 000000000..e02146f8c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnendpoint.go @@ -0,0 +1,380 @@ +package hcn + +import ( + "encoding/json" + "errors" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// IpConfig is assoicated with an endpoint +type IpConfig struct { + IpAddress string `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` +} + +// EndpointFlags are special settings on an endpoint. +type EndpointFlags uint32 + +var ( + // EndpointFlagsNone is the default. + EndpointFlagsNone EndpointFlags + // EndpointFlagsRemoteEndpoint means that an endpoint is on another host. + EndpointFlagsRemoteEndpoint EndpointFlags = 1 +) + +// HostComputeEndpoint represents a network endpoint +type HostComputeEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + HostComputeNetwork string `json:",omitempty"` // GUID + HostComputeNamespace string `json:",omitempty"` // GUID + Policies []EndpointPolicy `json:",omitempty"` + IpConfigurations []IpConfig `json:",omitempty"` + Dns Dns `json:",omitempty"` + Routes []Route `json:",omitempty"` + MacAddress string `json:",omitempty"` + Flags EndpointFlags `json:",omitempty"` + SchemaVersion SchemaVersion `json:",omitempty"` +} + +// EndpointResourceType are the two different Endpoint settings resources. +type EndpointResourceType string + +var ( + // EndpointResourceTypePolicy is for Endpoint Policies. Ex: ACL, NAT + EndpointResourceTypePolicy EndpointResourceType = "Policy" + // EndpointResourceTypePort is for Endpoint Port settings. + EndpointResourceTypePort EndpointResourceType = "Port" +) + +// ModifyEndpointSettingRequest is the structure used to send request to modify an endpoint. +// Used to update policy/port on an endpoint. +type ModifyEndpointSettingRequest struct { + ResourceType EndpointResourceType `json:",omitempty"` // Policy, Port + RequestType RequestType `json:",omitempty"` // Add, Remove, Update, Refresh + Settings json.RawMessage `json:",omitempty"` +} + +type PolicyEndpointRequest struct { + Policies []EndpointPolicy `json:",omitempty"` +} + +func getEndpoint(endpointGuid guid.GUID, query string) (*HostComputeEndpoint, error) { + // Open endpoint. + var ( + endpointHandle hcnEndpoint + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenEndpoint(&endpointGuid, &endpointHandle, &resultBuffer) + if err := checkForErrors("hcnOpenEndpoint", hr, resultBuffer); err != nil { + return nil, err + } + // Query endpoint. + hr = hcnQueryEndpointProperties(endpointHandle, query, &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryEndpointProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close endpoint. + hr = hcnCloseEndpoint(endpointHandle) + if err := checkForErrors("hcnCloseEndpoint", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeEndpoint + var outputEndpoint HostComputeEndpoint + if err := json.Unmarshal([]byte(properties), &outputEndpoint); err != nil { + return nil, err + } + return &outputEndpoint, nil +} + +func enumerateEndpoints(query string) ([]HostComputeEndpoint, error) { + // Enumerate all Endpoint Guids + var ( + resultBuffer *uint16 + endpointBuffer *uint16 + ) + hr := hcnEnumerateEndpoints(query, &endpointBuffer, &resultBuffer) + if err := checkForErrors("hcnEnumerateEndpoints", hr, resultBuffer); err != nil { + return nil, err + } + + endpoints := interop.ConvertAndFreeCoTaskMemString(endpointBuffer) + var endpointIds []guid.GUID + err := json.Unmarshal([]byte(endpoints), &endpointIds) + if err != nil { + return nil, err + } + + var outputEndpoints []HostComputeEndpoint + for _, endpointGuid := range endpointIds { + endpoint, err := getEndpoint(endpointGuid, query) + if err != nil { + return nil, err + } + outputEndpoints = append(outputEndpoints, *endpoint) + } + return outputEndpoints, nil +} + +func createEndpoint(networkId string, endpointSettings string) (*HostComputeEndpoint, error) { + networkGuid, err := guid.FromString(networkId) + if err != nil { + return nil, errInvalidNetworkID + } + // Open network. + var networkHandle hcnNetwork + var resultBuffer *uint16 + hr := hcnOpenNetwork(&networkGuid, &networkHandle, &resultBuffer) + if err := checkForErrors("hcnOpenNetwork", hr, resultBuffer); err != nil { + return nil, err + } + // Create endpoint. + endpointId := guid.GUID{} + var endpointHandle hcnEndpoint + hr = hcnCreateEndpoint(networkHandle, &endpointId, endpointSettings, &endpointHandle, &resultBuffer) + if err := checkForErrors("hcnCreateEndpoint", hr, resultBuffer); err != nil { + return nil, err + } + // Query endpoint. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + var propertiesBuffer *uint16 + hr = hcnQueryEndpointProperties(endpointHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryEndpointProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close endpoint. + hr = hcnCloseEndpoint(endpointHandle) + if err := checkForErrors("hcnCloseEndpoint", hr, nil); err != nil { + return nil, err + } + // Close network. + hr = hcnCloseNetwork(networkHandle) + if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeEndpoint + var outputEndpoint HostComputeEndpoint + if err := json.Unmarshal([]byte(properties), &outputEndpoint); err != nil { + return nil, err + } + return &outputEndpoint, nil +} + +func modifyEndpoint(endpointId string, settings string) (*HostComputeEndpoint, error) { + endpointGuid, err := guid.FromString(endpointId) + if err != nil { + return nil, errInvalidEndpointID + } + // Open endpoint + var ( + endpointHandle hcnEndpoint + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenEndpoint(&endpointGuid, &endpointHandle, &resultBuffer) + if err := checkForErrors("hcnOpenEndpoint", hr, resultBuffer); err != nil { + return nil, err + } + // Modify endpoint + hr = hcnModifyEndpoint(endpointHandle, settings, &resultBuffer) + if err := checkForErrors("hcnModifyEndpoint", hr, resultBuffer); err != nil { + return nil, err + } + // Query endpoint. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryEndpointProperties(endpointHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryEndpointProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close endpoint. + hr = hcnCloseEndpoint(endpointHandle) + if err := checkForErrors("hcnCloseEndpoint", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeEndpoint + var outputEndpoint HostComputeEndpoint + if err := json.Unmarshal([]byte(properties), &outputEndpoint); err != nil { + return nil, err + } + return &outputEndpoint, nil +} + +func deleteEndpoint(endpointId string) error { + endpointGuid, err := guid.FromString(endpointId) + if err != nil { + return errInvalidEndpointID + } + var resultBuffer *uint16 + hr := hcnDeleteEndpoint(&endpointGuid, &resultBuffer) + if err := checkForErrors("hcnDeleteEndpoint", hr, resultBuffer); err != nil { + return err + } + return nil +} + +// ListEndpoints makes a call to list all available endpoints. +func ListEndpoints() ([]HostComputeEndpoint, error) { + hcnQuery := defaultQuery() + endpoints, err := ListEndpointsQuery(hcnQuery) + if err != nil { + return nil, err + } + return endpoints, nil +} + +// ListEndpointsQuery makes a call to query the list of available endpoints. +func ListEndpointsQuery(query HostComputeQuery) ([]HostComputeEndpoint, error) { + queryJson, err := json.Marshal(query) + if err != nil { + return nil, err + } + + endpoints, err := enumerateEndpoints(string(queryJson)) + if err != nil { + return nil, err + } + return endpoints, nil +} + +// ListEndpointsOfNetwork queries the list of endpoints on a network. +func ListEndpointsOfNetwork(networkId string) ([]HostComputeEndpoint, error) { + hcnQuery := defaultQuery() + // TODO: Once query can convert schema, change to {HostComputeNetwork:networkId} + mapA := map[string]string{"VirtualNetwork": networkId} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + return ListEndpointsQuery(hcnQuery) +} + +// GetEndpointByID returns an endpoint specified by Id +func GetEndpointByID(endpointId string) (*HostComputeEndpoint, error) { + hcnQuery := defaultQuery() + mapA := map[string]string{"ID": endpointId} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + endpoints, err := ListEndpointsQuery(hcnQuery) + if err != nil { + return nil, err + } + if len(endpoints) == 0 { + return nil, EndpointNotFoundError{EndpointID: endpointId} + } + return &endpoints[0], err +} + +// GetEndpointByName returns an endpoint specified by Name +func GetEndpointByName(endpointName string) (*HostComputeEndpoint, error) { + hcnQuery := defaultQuery() + mapA := map[string]string{"Name": endpointName} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + endpoints, err := ListEndpointsQuery(hcnQuery) + if err != nil { + return nil, err + } + if len(endpoints) == 0 { + return nil, EndpointNotFoundError{EndpointName: endpointName} + } + return &endpoints[0], err +} + +// Create Endpoint. +func (endpoint *HostComputeEndpoint) Create() (*HostComputeEndpoint, error) { + logrus.Debugf("hcn::HostComputeEndpoint::Create id=%s", endpoint.Id) + + if endpoint.HostComputeNamespace != "" { + return nil, errors.New("endpoint create error, endpoint json HostComputeNamespace is read only and should not be set") + } + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + + logrus.Debugf("hcn::HostComputeEndpoint::Create JSON: %s", jsonString) + endpoint, hcnErr := createEndpoint(endpoint.HostComputeNetwork, string(jsonString)) + if hcnErr != nil { + return nil, hcnErr + } + return endpoint, nil +} + +// Delete Endpoint. +func (endpoint *HostComputeEndpoint) Delete() error { + logrus.Debugf("hcn::HostComputeEndpoint::Delete id=%s", endpoint.Id) + + if err := deleteEndpoint(endpoint.Id); err != nil { + return err + } + return nil +} + +// ModifyEndpointSettings updates the Port/Policy of an Endpoint. +func ModifyEndpointSettings(endpointId string, request *ModifyEndpointSettingRequest) error { + logrus.Debugf("hcn::HostComputeEndpoint::ModifyEndpointSettings id=%s", endpointId) + + endpointSettingsRequest, err := json.Marshal(request) + if err != nil { + return err + } + + _, err = modifyEndpoint(endpointId, string(endpointSettingsRequest)) + if err != nil { + return err + } + return nil +} + +// ApplyPolicy applies a Policy (ex: ACL) on the Endpoint. +func (endpoint *HostComputeEndpoint) ApplyPolicy(requestType RequestType, endpointPolicy PolicyEndpointRequest) error { + logrus.Debugf("hcn::HostComputeEndpoint::ApplyPolicy id=%s", endpoint.Id) + + settingsJson, err := json.Marshal(endpointPolicy) + if err != nil { + return err + } + requestMessage := &ModifyEndpointSettingRequest{ + ResourceType: EndpointResourceTypePolicy, + RequestType: requestType, + Settings: settingsJson, + } + + return ModifyEndpointSettings(endpoint.Id, requestMessage) +} + +// NamespaceAttach modifies a Namespace to add an endpoint. +func (endpoint *HostComputeEndpoint) NamespaceAttach(namespaceId string) error { + return AddNamespaceEndpoint(namespaceId, endpoint.Id) +} + +// NamespaceDetach modifies a Namespace to remove an endpoint. +func (endpoint *HostComputeEndpoint) NamespaceDetach(namespaceId string) error { + return RemoveNamespaceEndpoint(namespaceId, endpoint.Id) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go new file mode 100644 index 000000000..dd029502e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnerrors.go @@ -0,0 +1,106 @@ +// Package hcn is a shim for the Host Compute Networking (HCN) service, which manages networking for Windows Server +// containers and Hyper-V containers. Previous to RS5, HCN was referred to as Host Networking Service (HNS). +package hcn + +import ( + "errors" + "fmt" + + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +var ( + errInvalidNetworkID = errors.New("invalid network ID") + errInvalidEndpointID = errors.New("invalid endpoint ID") + errInvalidNamespaceID = errors.New("invalid namespace ID") + errInvalidLoadBalancerID = errors.New("invalid load balancer ID") +) + +func checkForErrors(methodName string, hr error, resultBuffer *uint16) error { + errorFound := false + + if hr != nil { + errorFound = true + } + + result := "" + if resultBuffer != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultBuffer) + if result != "" { + errorFound = true + } + } + + if errorFound { + returnError := hcserror.New(hr, methodName, result) + logrus.Debugf(returnError.Error()) // HCN errors logged for debugging. + return returnError + } + + return nil +} + +// NetworkNotFoundError results from a failed seach for a network by Id or Name +type NetworkNotFoundError struct { + NetworkName string + NetworkID string +} + +func (e NetworkNotFoundError) Error() string { + if e.NetworkName == "" { + return fmt.Sprintf("Network Name %s not found", e.NetworkName) + } + return fmt.Sprintf("Network Id %s not found", e.NetworkID) +} + +// EndpointNotFoundError results from a failed seach for an endpoint by Id or Name +type EndpointNotFoundError struct { + EndpointName string + EndpointID string +} + +func (e EndpointNotFoundError) Error() string { + if e.EndpointName == "" { + return fmt.Sprintf("Endpoint Name %s not found", e.EndpointName) + } + return fmt.Sprintf("Endpoint Id %s not found", e.EndpointID) +} + +// NamespaceNotFoundError results from a failed seach for a namsepace by Id +type NamespaceNotFoundError struct { + NamespaceID string +} + +func (e NamespaceNotFoundError) Error() string { + return fmt.Sprintf("Namespace %s not found", e.NamespaceID) +} + +// LoadBalancerNotFoundError results from a failed seach for a loadbalancer by Id +type LoadBalancerNotFoundError struct { + LoadBalancerId string +} + +func (e LoadBalancerNotFoundError) Error() string { + return fmt.Sprintf("LoadBalancer %s not found", e.LoadBalancerId) +} + +// IsNotFoundError returns a boolean indicating whether the error was caused by +// a resource not being found. +func IsNotFoundError(err error) bool { + switch pe := err.(type) { + case NetworkNotFoundError: + return true + case EndpointNotFoundError: + return true + case NamespaceNotFoundError: + return true + case LoadBalancerNotFoundError: + return true + case *hcserror.HcsError: + return pe.Err == hcs.ErrElementNotFound + } + return false +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go new file mode 100644 index 000000000..5ac0ed565 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnglobals.go @@ -0,0 +1,87 @@ +package hcn + +import ( + "encoding/json" + "fmt" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// Globals are all global properties of the HCN Service. +type Globals struct { + Version Version `json:"Version"` +} + +// Version is the HCN Service version. +type Version struct { + Major int `json:"Major"` + Minor int `json:"Minor"` +} + +var ( + // HNSVersion1803 added ACL functionality. + HNSVersion1803 = Version{Major: 7, Minor: 2} + // V2ApiSupport allows the use of V2 Api calls and V2 Schema. + V2ApiSupport = Version{Major: 9, Minor: 2} + // Remote Subnet allows for Remote Subnet policies on Overlay networks + RemoteSubnetVersion = Version{Major: 9, Minor: 2} + // A Host Route policy allows for local container to local host communication Overlay networks + HostRouteVersion = Version{Major: 9, Minor: 2} + // HNS 10.2 allows for Direct Server Return for loadbalancing + DSRVersion = Version{Major: 10, Minor: 2} +) + +// GetGlobals returns the global properties of the HCN Service. +func GetGlobals() (*Globals, error) { + var version Version + err := hnsCall("GET", "/globals/version", "", &version) + if err != nil { + return nil, err + } + + globals := &Globals{ + Version: version, + } + + return globals, nil +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +func hnsCall(method, path, request string, returnResponse interface{}) error { + var responseBuffer *uint16 + logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) + + err := _hnsCall(method, path, request, &responseBuffer) + if err != nil { + return hcserror.New(err, "hnsCall ", "") + } + response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) + + hnsresponse := &hnsResponse{} + if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { + return err + } + + if !hnsresponse.Success { + return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + } + + if len(hnsresponse.Output) == 0 { + return nil + } + + logrus.Debugf("Network Response : %s", hnsresponse.Output) + err = json.Unmarshal(hnsresponse.Output, returnResponse) + if err != nil { + return err + } + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go new file mode 100644 index 000000000..898e02a80 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnloadbalancer.go @@ -0,0 +1,341 @@ +package hcn + +import ( + "encoding/json" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// LoadBalancerPortMapping is associated with HostComputeLoadBalancer +type LoadBalancerPortMapping struct { + Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 + InternalPort uint16 `json:",omitempty"` + ExternalPort uint16 `json:",omitempty"` + Flags LoadBalancerPortMappingFlags `json:",omitempty"` +} + +// HostComputeLoadBalancer represents software load balancer. +type HostComputeLoadBalancer struct { + Id string `json:"ID,omitempty"` + HostComputeEndpoints []string `json:",omitempty"` + SourceVIP string `json:",omitempty"` + FrontendVIPs []string `json:",omitempty"` + PortMappings []LoadBalancerPortMapping `json:",omitempty"` + SchemaVersion SchemaVersion `json:",omitempty"` + Flags LoadBalancerFlags `json:",omitempty"` // 0: None, 1: EnableDirectServerReturn +} + +//LoadBalancerFlags modify settings for a loadbalancer. +type LoadBalancerFlags uint32 + +var ( + // LoadBalancerFlagsNone is the default. + LoadBalancerFlagsNone LoadBalancerFlags = 0 + // LoadBalancerFlagsDSR enables Direct Server Return (DSR) + LoadBalancerFlagsDSR LoadBalancerFlags = 1 +) + +// LoadBalancerPortMappingFlags are special settings on a loadbalancer. +type LoadBalancerPortMappingFlags uint32 + +var ( + // LoadBalancerPortMappingFlagsNone is the default. + LoadBalancerPortMappingFlagsNone LoadBalancerPortMappingFlags + // LoadBalancerPortMappingFlagsILB enables internal loadbalancing. + LoadBalancerPortMappingFlagsILB LoadBalancerPortMappingFlags = 1 + // LoadBalancerPortMappingFlagsLocalRoutedVIP enables VIP access from the host. + LoadBalancerPortMappingFlagsLocalRoutedVIP LoadBalancerPortMappingFlags = 2 + // LoadBalancerPortMappingFlagsUseMux enables DSR for NodePort access of VIP. + LoadBalancerPortMappingFlagsUseMux LoadBalancerPortMappingFlags = 4 + // LoadBalancerPortMappingFlagsPreserveDIP delivers packets with destination IP as the VIP. + LoadBalancerPortMappingFlagsPreserveDIP LoadBalancerPortMappingFlags = 8 +) + +func getLoadBalancer(loadBalancerGuid guid.GUID, query string) (*HostComputeLoadBalancer, error) { + // Open loadBalancer. + var ( + loadBalancerHandle hcnLoadBalancer + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenLoadBalancer(&loadBalancerGuid, &loadBalancerHandle, &resultBuffer) + if err := checkForErrors("hcnOpenLoadBalancer", hr, resultBuffer); err != nil { + return nil, err + } + // Query loadBalancer. + hr = hcnQueryLoadBalancerProperties(loadBalancerHandle, query, &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryLoadBalancerProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close loadBalancer. + hr = hcnCloseLoadBalancer(loadBalancerHandle) + if err := checkForErrors("hcnCloseLoadBalancer", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeLoadBalancer + var outputLoadBalancer HostComputeLoadBalancer + if err := json.Unmarshal([]byte(properties), &outputLoadBalancer); err != nil { + return nil, err + } + return &outputLoadBalancer, nil +} + +func enumerateLoadBalancers(query string) ([]HostComputeLoadBalancer, error) { + // Enumerate all LoadBalancer Guids + var ( + resultBuffer *uint16 + loadBalancerBuffer *uint16 + ) + hr := hcnEnumerateLoadBalancers(query, &loadBalancerBuffer, &resultBuffer) + if err := checkForErrors("hcnEnumerateLoadBalancers", hr, resultBuffer); err != nil { + return nil, err + } + + loadBalancers := interop.ConvertAndFreeCoTaskMemString(loadBalancerBuffer) + var loadBalancerIds []guid.GUID + if err := json.Unmarshal([]byte(loadBalancers), &loadBalancerIds); err != nil { + return nil, err + } + + var outputLoadBalancers []HostComputeLoadBalancer + for _, loadBalancerGuid := range loadBalancerIds { + loadBalancer, err := getLoadBalancer(loadBalancerGuid, query) + if err != nil { + return nil, err + } + outputLoadBalancers = append(outputLoadBalancers, *loadBalancer) + } + return outputLoadBalancers, nil +} + +func createLoadBalancer(settings string) (*HostComputeLoadBalancer, error) { + // Create new loadBalancer. + var ( + loadBalancerHandle hcnLoadBalancer + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + loadBalancerGuid := guid.GUID{} + hr := hcnCreateLoadBalancer(&loadBalancerGuid, settings, &loadBalancerHandle, &resultBuffer) + if err := checkForErrors("hcnCreateLoadBalancer", hr, resultBuffer); err != nil { + return nil, err + } + // Query loadBalancer. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryLoadBalancerProperties(loadBalancerHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryLoadBalancerProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close loadBalancer. + hr = hcnCloseLoadBalancer(loadBalancerHandle) + if err := checkForErrors("hcnCloseLoadBalancer", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeLoadBalancer + var outputLoadBalancer HostComputeLoadBalancer + if err := json.Unmarshal([]byte(properties), &outputLoadBalancer); err != nil { + return nil, err + } + return &outputLoadBalancer, nil +} + +func modifyLoadBalancer(loadBalancerId string, settings string) (*HostComputeLoadBalancer, error) { + loadBalancerGuid, err := guid.FromString(loadBalancerId) + if err != nil { + return nil, errInvalidLoadBalancerID + } + // Open loadBalancer. + var ( + loadBalancerHandle hcnLoadBalancer + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenLoadBalancer(&loadBalancerGuid, &loadBalancerHandle, &resultBuffer) + if err := checkForErrors("hcnOpenLoadBalancer", hr, resultBuffer); err != nil { + return nil, err + } + // Modify loadBalancer. + hr = hcnModifyLoadBalancer(loadBalancerHandle, settings, &resultBuffer) + if err := checkForErrors("hcnModifyLoadBalancer", hr, resultBuffer); err != nil { + return nil, err + } + // Query loadBalancer. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryLoadBalancerProperties(loadBalancerHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryLoadBalancerProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close loadBalancer. + hr = hcnCloseLoadBalancer(loadBalancerHandle) + if err := checkForErrors("hcnCloseLoadBalancer", hr, nil); err != nil { + return nil, err + } + // Convert output to LoadBalancer + var outputLoadBalancer HostComputeLoadBalancer + if err := json.Unmarshal([]byte(properties), &outputLoadBalancer); err != nil { + return nil, err + } + return &outputLoadBalancer, nil +} + +func deleteLoadBalancer(loadBalancerId string) error { + loadBalancerGuid, err := guid.FromString(loadBalancerId) + if err != nil { + return errInvalidLoadBalancerID + } + var resultBuffer *uint16 + hr := hcnDeleteLoadBalancer(&loadBalancerGuid, &resultBuffer) + if err := checkForErrors("hcnDeleteLoadBalancer", hr, resultBuffer); err != nil { + return err + } + return nil +} + +// ListLoadBalancers makes a call to list all available loadBalancers. +func ListLoadBalancers() ([]HostComputeLoadBalancer, error) { + hcnQuery := defaultQuery() + loadBalancers, err := ListLoadBalancersQuery(hcnQuery) + if err != nil { + return nil, err + } + return loadBalancers, nil +} + +// ListLoadBalancersQuery makes a call to query the list of available loadBalancers. +func ListLoadBalancersQuery(query HostComputeQuery) ([]HostComputeLoadBalancer, error) { + queryJson, err := json.Marshal(query) + if err != nil { + return nil, err + } + + loadBalancers, err := enumerateLoadBalancers(string(queryJson)) + if err != nil { + return nil, err + } + return loadBalancers, nil +} + +// GetLoadBalancerByID returns the LoadBalancer specified by Id. +func GetLoadBalancerByID(loadBalancerId string) (*HostComputeLoadBalancer, error) { + hcnQuery := defaultQuery() + mapA := map[string]string{"ID": loadBalancerId} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + loadBalancers, err := ListLoadBalancersQuery(hcnQuery) + if err != nil { + return nil, err + } + if len(loadBalancers) == 0 { + return nil, LoadBalancerNotFoundError{LoadBalancerId: loadBalancerId} + } + return &loadBalancers[0], err +} + +// Create LoadBalancer. +func (loadBalancer *HostComputeLoadBalancer) Create() (*HostComputeLoadBalancer, error) { + logrus.Debugf("hcn::HostComputeLoadBalancer::Create id=%s", loadBalancer.Id) + + jsonString, err := json.Marshal(loadBalancer) + if err != nil { + return nil, err + } + + logrus.Debugf("hcn::HostComputeLoadBalancer::Create JSON: %s", jsonString) + loadBalancer, hcnErr := createLoadBalancer(string(jsonString)) + if hcnErr != nil { + return nil, hcnErr + } + return loadBalancer, nil +} + +// Delete LoadBalancer. +func (loadBalancer *HostComputeLoadBalancer) Delete() error { + logrus.Debugf("hcn::HostComputeLoadBalancer::Delete id=%s", loadBalancer.Id) + + if err := deleteLoadBalancer(loadBalancer.Id); err != nil { + return err + } + return nil +} + +// AddEndpoint add an endpoint to a LoadBalancer +func (loadBalancer *HostComputeLoadBalancer) AddEndpoint(endpoint *HostComputeEndpoint) (*HostComputeLoadBalancer, error) { + logrus.Debugf("hcn::HostComputeLoadBalancer::AddEndpoint loadBalancer=%s endpoint=%s", loadBalancer.Id, endpoint.Id) + + err := loadBalancer.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + loadBalancer.HostComputeEndpoints = append(loadBalancer.HostComputeEndpoints, endpoint.Id) + + return loadBalancer.Create() +} + +// RemoveEndpoint removes an endpoint from a LoadBalancer +func (loadBalancer *HostComputeLoadBalancer) RemoveEndpoint(endpoint *HostComputeEndpoint) (*HostComputeLoadBalancer, error) { + logrus.Debugf("hcn::HostComputeLoadBalancer::RemoveEndpoint loadBalancer=%s endpoint=%s", loadBalancer.Id, endpoint.Id) + + err := loadBalancer.Delete() + if err != nil { + return nil, err + } + + // Create a list of all the endpoints besides the one being removed + var endpoints []string + for _, endpointReference := range loadBalancer.HostComputeEndpoints { + if endpointReference == endpoint.Id { + continue + } + endpoints = append(endpoints, endpointReference) + } + loadBalancer.HostComputeEndpoints = endpoints + return loadBalancer.Create() +} + +// AddLoadBalancer for the specified endpoints +func AddLoadBalancer(endpoints []HostComputeEndpoint, flags LoadBalancerFlags, portMappingFlags LoadBalancerPortMappingFlags, sourceVIP string, frontendVIPs []string, protocol uint16, internalPort uint16, externalPort uint16) (*HostComputeLoadBalancer, error) { + logrus.Debugf("hcn::HostComputeLoadBalancer::AddLoadBalancer endpointId=%v, LoadBalancerFlags=%v, LoadBalancerPortMappingFlags=%v, sourceVIP=%s, frontendVIPs=%v, protocol=%v, internalPort=%v, externalPort=%v", endpoints, flags, portMappingFlags, sourceVIP, frontendVIPs, protocol, internalPort, externalPort) + + loadBalancer := &HostComputeLoadBalancer{ + SourceVIP: sourceVIP, + PortMappings: []LoadBalancerPortMapping{ + { + Protocol: uint32(protocol), + InternalPort: internalPort, + ExternalPort: externalPort, + Flags: portMappingFlags, + }, + }, + FrontendVIPs: frontendVIPs, + SchemaVersion: SchemaVersion{ + Major: 2, + Minor: 0, + }, + Flags: flags, + } + + for _, endpoint := range endpoints { + loadBalancer.HostComputeEndpoints = append(loadBalancer.HostComputeEndpoints, endpoint.Id) + } + + return loadBalancer.Create() +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go new file mode 100644 index 000000000..f99ff8754 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnamespace.go @@ -0,0 +1,434 @@ +package hcn + +import ( + "encoding/json" + "os" + "syscall" + + "github.com/Microsoft/go-winio/pkg/guid" + icni "github.com/Microsoft/hcsshim/internal/cni" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/regstate" + "github.com/Microsoft/hcsshim/internal/runhcs" + "github.com/sirupsen/logrus" +) + +// NamespaceResourceEndpoint represents an Endpoint attached to a Namespace. +type NamespaceResourceEndpoint struct { + Id string `json:"ID,"` +} + +// NamespaceResourceContainer represents a Container attached to a Namespace. +type NamespaceResourceContainer struct { + Id string `json:"ID,"` +} + +// NamespaceResourceType determines whether the Namespace resource is a Container or Endpoint. +type NamespaceResourceType string + +var ( + // NamespaceResourceTypeContainer are contianers associated with a Namespace. + NamespaceResourceTypeContainer NamespaceResourceType = "Container" + // NamespaceResourceTypeEndpoint are endpoints associated with a Namespace. + NamespaceResourceTypeEndpoint NamespaceResourceType = "Endpoint" +) + +// NamespaceResource is associated with a namespace +type NamespaceResource struct { + Type NamespaceResourceType `json:","` // Container, Endpoint + Data json.RawMessage `json:","` +} + +// NamespaceType determines whether the Namespace is for a Host or Guest +type NamespaceType string + +var ( + // NamespaceTypeHost are host namespaces. + NamespaceTypeHost NamespaceType = "Host" + // NamespaceTypeHostDefault are host namespaces in the default compartment. + NamespaceTypeHostDefault NamespaceType = "HostDefault" + // NamespaceTypeGuest are guest namespaces. + NamespaceTypeGuest NamespaceType = "Guest" + // NamespaceTypeGuestDefault are guest namespaces in the default compartment. + NamespaceTypeGuestDefault NamespaceType = "GuestDefault" +) + +// HostComputeNamespace represents a namespace (AKA compartment) in +type HostComputeNamespace struct { + Id string `json:"ID,omitempty"` + NamespaceId uint32 `json:",omitempty"` + Type NamespaceType `json:",omitempty"` // Host, HostDefault, Guest, GuestDefault + Resources []NamespaceResource `json:",omitempty"` + SchemaVersion SchemaVersion `json:",omitempty"` +} + +// ModifyNamespaceSettingRequest is the structure used to send request to modify a namespace. +// Used to Add/Remove an endpoints and containers to/from a namespace. +type ModifyNamespaceSettingRequest struct { + ResourceType NamespaceResourceType `json:",omitempty"` // Container, Endpoint + RequestType RequestType `json:",omitempty"` // Add, Remove, Update, Refresh + Settings json.RawMessage `json:",omitempty"` +} + +func getNamespace(namespaceGuid guid.GUID, query string) (*HostComputeNamespace, error) { + // Open namespace. + var ( + namespaceHandle hcnNamespace + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenNamespace(&namespaceGuid, &namespaceHandle, &resultBuffer) + if err := checkForErrors("hcnOpenNamespace", hr, resultBuffer); err != nil { + return nil, err + } + // Query namespace. + hr = hcnQueryNamespaceProperties(namespaceHandle, query, &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryNamespaceProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close namespace. + hr = hcnCloseNamespace(namespaceHandle) + if err := checkForErrors("hcnCloseNamespace", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeNamespace + var outputNamespace HostComputeNamespace + if err := json.Unmarshal([]byte(properties), &outputNamespace); err != nil { + return nil, err + } + return &outputNamespace, nil +} + +func enumerateNamespaces(query string) ([]HostComputeNamespace, error) { + // Enumerate all Namespace Guids + var ( + resultBuffer *uint16 + namespaceBuffer *uint16 + ) + hr := hcnEnumerateNamespaces(query, &namespaceBuffer, &resultBuffer) + if err := checkForErrors("hcnEnumerateNamespaces", hr, resultBuffer); err != nil { + return nil, err + } + + namespaces := interop.ConvertAndFreeCoTaskMemString(namespaceBuffer) + var namespaceIds []guid.GUID + if err := json.Unmarshal([]byte(namespaces), &namespaceIds); err != nil { + return nil, err + } + + var outputNamespaces []HostComputeNamespace + for _, namespaceGuid := range namespaceIds { + namespace, err := getNamespace(namespaceGuid, query) + if err != nil { + return nil, err + } + outputNamespaces = append(outputNamespaces, *namespace) + } + return outputNamespaces, nil +} + +func createNamespace(settings string) (*HostComputeNamespace, error) { + // Create new namespace. + var ( + namespaceHandle hcnNamespace + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + namespaceGuid := guid.GUID{} + hr := hcnCreateNamespace(&namespaceGuid, settings, &namespaceHandle, &resultBuffer) + if err := checkForErrors("hcnCreateNamespace", hr, resultBuffer); err != nil { + return nil, err + } + // Query namespace. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryNamespaceProperties(namespaceHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryNamespaceProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close namespace. + hr = hcnCloseNamespace(namespaceHandle) + if err := checkForErrors("hcnCloseNamespace", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeNamespace + var outputNamespace HostComputeNamespace + if err := json.Unmarshal([]byte(properties), &outputNamespace); err != nil { + return nil, err + } + return &outputNamespace, nil +} + +func modifyNamespace(namespaceId string, settings string) (*HostComputeNamespace, error) { + namespaceGuid, err := guid.FromString(namespaceId) + if err != nil { + return nil, errInvalidNamespaceID + } + // Open namespace. + var ( + namespaceHandle hcnNamespace + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenNamespace(&namespaceGuid, &namespaceHandle, &resultBuffer) + if err := checkForErrors("hcnOpenNamespace", hr, resultBuffer); err != nil { + return nil, err + } + // Modify namespace. + hr = hcnModifyNamespace(namespaceHandle, settings, &resultBuffer) + if err := checkForErrors("hcnModifyNamespace", hr, resultBuffer); err != nil { + return nil, err + } + // Query namespace. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryNamespaceProperties(namespaceHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryNamespaceProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close namespace. + hr = hcnCloseNamespace(namespaceHandle) + if err := checkForErrors("hcnCloseNamespace", hr, nil); err != nil { + return nil, err + } + // Convert output to Namespace + var outputNamespace HostComputeNamespace + if err := json.Unmarshal([]byte(properties), &outputNamespace); err != nil { + return nil, err + } + return &outputNamespace, nil +} + +func deleteNamespace(namespaceId string) error { + namespaceGuid, err := guid.FromString(namespaceId) + if err != nil { + return errInvalidNamespaceID + } + var resultBuffer *uint16 + hr := hcnDeleteNamespace(&namespaceGuid, &resultBuffer) + if err := checkForErrors("hcnDeleteNamespace", hr, resultBuffer); err != nil { + return err + } + return nil +} + +// ListNamespaces makes a call to list all available namespaces. +func ListNamespaces() ([]HostComputeNamespace, error) { + hcnQuery := defaultQuery() + namespaces, err := ListNamespacesQuery(hcnQuery) + if err != nil { + return nil, err + } + return namespaces, nil +} + +// ListNamespacesQuery makes a call to query the list of available namespaces. +func ListNamespacesQuery(query HostComputeQuery) ([]HostComputeNamespace, error) { + queryJson, err := json.Marshal(query) + if err != nil { + return nil, err + } + + namespaces, err := enumerateNamespaces(string(queryJson)) + if err != nil { + return nil, err + } + return namespaces, nil +} + +// GetNamespaceByID returns the Namespace specified by Id. +func GetNamespaceByID(namespaceId string) (*HostComputeNamespace, error) { + g, err := guid.FromString(namespaceId) + if err != nil { + return nil, errInvalidNamespaceID + } + return getNamespace(g, defaultQueryJson()) +} + +// GetNamespaceEndpointIds returns the endpoints of the Namespace specified by Id. +func GetNamespaceEndpointIds(namespaceId string) ([]string, error) { + namespace, err := GetNamespaceByID(namespaceId) + if err != nil { + return nil, err + } + var endpointsIds []string + for _, resource := range namespace.Resources { + if resource.Type == "Endpoint" { + var endpointResource NamespaceResourceEndpoint + if err := json.Unmarshal([]byte(resource.Data), &endpointResource); err != nil { + return nil, err + } + endpointsIds = append(endpointsIds, endpointResource.Id) + } + } + return endpointsIds, nil +} + +// GetNamespaceContainerIds returns the containers of the Namespace specified by Id. +func GetNamespaceContainerIds(namespaceId string) ([]string, error) { + namespace, err := GetNamespaceByID(namespaceId) + if err != nil { + return nil, err + } + var containerIds []string + for _, resource := range namespace.Resources { + if resource.Type == "Container" { + var contaienrResource NamespaceResourceContainer + if err := json.Unmarshal([]byte(resource.Data), &contaienrResource); err != nil { + return nil, err + } + containerIds = append(containerIds, contaienrResource.Id) + } + } + return containerIds, nil +} + +// NewNamespace creates a new Namespace object +func NewNamespace(nsType NamespaceType) *HostComputeNamespace { + return &HostComputeNamespace{ + Type: nsType, + SchemaVersion: V2SchemaVersion(), + } +} + +// Create Namespace. +func (namespace *HostComputeNamespace) Create() (*HostComputeNamespace, error) { + logrus.Debugf("hcn::HostComputeNamespace::Create id=%s", namespace.Id) + + jsonString, err := json.Marshal(namespace) + if err != nil { + return nil, err + } + + logrus.Debugf("hcn::HostComputeNamespace::Create JSON: %s", jsonString) + namespace, hcnErr := createNamespace(string(jsonString)) + if hcnErr != nil { + return nil, hcnErr + } + return namespace, nil +} + +// Delete Namespace. +func (namespace *HostComputeNamespace) Delete() error { + logrus.Debugf("hcn::HostComputeNamespace::Delete id=%s", namespace.Id) + + if err := deleteNamespace(namespace.Id); err != nil { + return err + } + return nil +} + +// Sync Namespace endpoints with the appropriate sandbox container holding the +// network namespace open. If no sandbox container is found for this namespace +// this method is determined to be a success and will not return an error in +// this case. If the sandbox container is found and a sync is initiated any +// failures will be returned via this method. +// +// This call initiates a sync between endpoints and the matching UtilityVM +// hosting those endpoints. It is safe to call for any `NamespaceType` but +// `NamespaceTypeGuest` is the only case when a sync will actually occur. For +// `NamespaceTypeHost` the process container will be automatically synchronized +// when the the endpoint is added via `AddNamespaceEndpoint`. +// +// Note: This method sync's both additions and removals of endpoints from a +// `NamespaceTypeGuest` namespace. +func (namespace *HostComputeNamespace) Sync() error { + logrus.WithField("id", namespace.Id).Debugf("hcs::HostComputeNamespace::Sync") + + // We only attempt a sync for namespace guest. + if namespace.Type != NamespaceTypeGuest { + return nil + } + + // Look in the registry for the key to map from namespace id to pod-id + cfg, err := icni.LoadPersistedNamespaceConfig(namespace.Id) + if err != nil { + if regstate.IsNotFoundError(err) { + return nil + } + return err + } + req := runhcs.VMRequest{ + ID: cfg.ContainerID, + Op: runhcs.OpSyncNamespace, + } + shimPath := runhcs.VMPipePath(cfg.HostUniqueID) + if err := runhcs.IssueVMRequest(shimPath, &req); err != nil { + // The shim is likey gone. Simply ignore the sync as if it didn't exist. + if perr, ok := err.(*os.PathError); ok && perr.Err == syscall.ERROR_FILE_NOT_FOUND { + // Remove the reg key there is no point to try again + cfg.Remove() + return nil + } + f := map[string]interface{}{ + "id": namespace.Id, + "container-id": cfg.ContainerID, + } + logrus.WithFields(f). + WithError(err). + Debugf("hcs::HostComputeNamespace::Sync failed to connect to shim pipe: '%s'", shimPath) + return err + } + return nil +} + +// ModifyNamespaceSettings updates the Endpoints/Containers of a Namespace. +func ModifyNamespaceSettings(namespaceId string, request *ModifyNamespaceSettingRequest) error { + logrus.Debugf("hcn::HostComputeNamespace::ModifyNamespaceSettings id=%s", namespaceId) + + namespaceSettings, err := json.Marshal(request) + if err != nil { + return err + } + + _, err = modifyNamespace(namespaceId, string(namespaceSettings)) + if err != nil { + return err + } + return nil +} + +// AddNamespaceEndpoint adds an endpoint to a Namespace. +func AddNamespaceEndpoint(namespaceId string, endpointId string) error { + logrus.Debugf("hcn::HostComputeEndpoint::AddNamespaceEndpoint id=%s", endpointId) + + mapA := map[string]string{"EndpointId": endpointId} + settingsJson, err := json.Marshal(mapA) + if err != nil { + return err + } + requestMessage := &ModifyNamespaceSettingRequest{ + ResourceType: NamespaceResourceTypeEndpoint, + RequestType: RequestTypeAdd, + Settings: settingsJson, + } + + return ModifyNamespaceSettings(namespaceId, requestMessage) +} + +// RemoveNamespaceEndpoint removes an endpoint from a Namespace. +func RemoveNamespaceEndpoint(namespaceId string, endpointId string) error { + logrus.Debugf("hcn::HostComputeNamespace::RemoveNamespaceEndpoint id=%s", endpointId) + + mapA := map[string]string{"EndpointId": endpointId} + settingsJson, err := json.Marshal(mapA) + if err != nil { + return err + } + requestMessage := &ModifyNamespaceSettingRequest{ + ResourceType: NamespaceResourceTypeEndpoint, + RequestType: RequestTypeRemove, + Settings: settingsJson, + } + + return ModifyNamespaceSettings(namespaceId, requestMessage) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go new file mode 100644 index 000000000..a95fc1d75 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnnetwork.go @@ -0,0 +1,461 @@ +package hcn + +import ( + "encoding/json" + "errors" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// Route is assoicated with a subnet. +type Route struct { + NextHop string `json:",omitempty"` + DestinationPrefix string `json:",omitempty"` + Metric uint16 `json:",omitempty"` +} + +// Subnet is assoicated with a Ipam. +type Subnet struct { + IpAddressPrefix string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + Routes []Route `json:",omitempty"` +} + +// Ipam (Internet Protocol Addres Management) is assoicated with a network +// and represents the address space(s) of a network. +type Ipam struct { + Type string `json:",omitempty"` // Ex: Static, DHCP + Subnets []Subnet `json:",omitempty"` +} + +// MacRange is associated with MacPool and respresents the start and end addresses. +type MacRange struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents pool of MacRanges. +type MacPool struct { + Ranges []MacRange `json:",omitempty"` +} + +// Dns (Domain Name System is associated with a network. +type Dns struct { + Domain string `json:",omitempty"` + Search []string `json:",omitempty"` + ServerList []string `json:",omitempty"` + Options []string `json:",omitempty"` +} + +// NetworkType are various networks. +type NetworkType string + +// NetworkType const +const ( + NAT NetworkType = "NAT" + Transparent NetworkType = "Transparent" + L2Bridge NetworkType = "L2Bridge" + L2Tunnel NetworkType = "L2Tunnel" + ICS NetworkType = "ICS" + Private NetworkType = "Private" + Overlay NetworkType = "Overlay" +) + +// NetworkFlags are various network flags. +type NetworkFlags uint32 + +// NetworkFlags const +const ( + None NetworkFlags = 0 + EnableNonPersistent NetworkFlags = 8 +) + +// HostComputeNetwork represents a network +type HostComputeNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type NetworkType `json:",omitempty"` + Policies []NetworkPolicy `json:",omitempty"` + MacPool MacPool `json:",omitempty"` + Dns Dns `json:",omitempty"` + Ipams []Ipam `json:",omitempty"` + Flags NetworkFlags `json:",omitempty"` // 0: None + SchemaVersion SchemaVersion `json:",omitempty"` +} + +// NetworkResourceType are the 3 different Network settings resources. +type NetworkResourceType string + +var ( + // NetworkResourceTypePolicy is for Network's policies. Ex: RemoteSubnet + NetworkResourceTypePolicy NetworkResourceType = "Policy" + // NetworkResourceTypeDNS is for Network's DNS settings. + NetworkResourceTypeDNS NetworkResourceType = "DNS" + // NetworkResourceTypeExtension is for Network's extension settings. + NetworkResourceTypeExtension NetworkResourceType = "Extension" +) + +// ModifyNetworkSettingRequest is the structure used to send request to modify an network. +// Used to update DNS/extension/policy on an network. +type ModifyNetworkSettingRequest struct { + ResourceType NetworkResourceType `json:",omitempty"` // Policy, DNS, Extension + RequestType RequestType `json:",omitempty"` // Add, Remove, Update, Refresh + Settings json.RawMessage `json:",omitempty"` +} + +type PolicyNetworkRequest struct { + Policies []NetworkPolicy `json:",omitempty"` +} + +func getNetwork(networkGuid guid.GUID, query string) (*HostComputeNetwork, error) { + // Open network. + var ( + networkHandle hcnNetwork + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenNetwork(&networkGuid, &networkHandle, &resultBuffer) + if err := checkForErrors("hcnOpenNetwork", hr, resultBuffer); err != nil { + return nil, err + } + // Query network. + hr = hcnQueryNetworkProperties(networkHandle, query, &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryNetworkProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close network. + hr = hcnCloseNetwork(networkHandle) + if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeNetwork + var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { + return nil, err + } + return &outputNetwork, nil +} + +func enumerateNetworks(query string) ([]HostComputeNetwork, error) { + // Enumerate all Network Guids + var ( + resultBuffer *uint16 + networkBuffer *uint16 + ) + hr := hcnEnumerateNetworks(query, &networkBuffer, &resultBuffer) + if err := checkForErrors("hcnEnumerateNetworks", hr, resultBuffer); err != nil { + return nil, err + } + + networks := interop.ConvertAndFreeCoTaskMemString(networkBuffer) + var networkIds []guid.GUID + if err := json.Unmarshal([]byte(networks), &networkIds); err != nil { + return nil, err + } + + var outputNetworks []HostComputeNetwork + for _, networkGuid := range networkIds { + network, err := getNetwork(networkGuid, query) + if err != nil { + return nil, err + } + outputNetworks = append(outputNetworks, *network) + } + return outputNetworks, nil +} + +func createNetwork(settings string) (*HostComputeNetwork, error) { + // Create new network. + var ( + networkHandle hcnNetwork + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + networkGuid := guid.GUID{} + hr := hcnCreateNetwork(&networkGuid, settings, &networkHandle, &resultBuffer) + if err := checkForErrors("hcnCreateNetwork", hr, resultBuffer); err != nil { + return nil, err + } + // Query network. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryNetworkProperties(networkHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryNetworkProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close network. + hr = hcnCloseNetwork(networkHandle) + if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeNetwork + var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { + return nil, err + } + return &outputNetwork, nil +} + +func modifyNetwork(networkId string, settings string) (*HostComputeNetwork, error) { + networkGuid, err := guid.FromString(networkId) + if err != nil { + return nil, errInvalidNetworkID + } + // Open Network + var ( + networkHandle hcnNetwork + resultBuffer *uint16 + propertiesBuffer *uint16 + ) + hr := hcnOpenNetwork(&networkGuid, &networkHandle, &resultBuffer) + if err := checkForErrors("hcnOpenNetwork", hr, resultBuffer); err != nil { + return nil, err + } + // Modify Network + hr = hcnModifyNetwork(networkHandle, settings, &resultBuffer) + if err := checkForErrors("hcnModifyNetwork", hr, resultBuffer); err != nil { + return nil, err + } + // Query network. + hcnQuery := defaultQuery() + query, err := json.Marshal(hcnQuery) + if err != nil { + return nil, err + } + hr = hcnQueryNetworkProperties(networkHandle, string(query), &propertiesBuffer, &resultBuffer) + if err := checkForErrors("hcnQueryNetworkProperties", hr, resultBuffer); err != nil { + return nil, err + } + properties := interop.ConvertAndFreeCoTaskMemString(propertiesBuffer) + // Close network. + hr = hcnCloseNetwork(networkHandle) + if err := checkForErrors("hcnCloseNetwork", hr, nil); err != nil { + return nil, err + } + // Convert output to HostComputeNetwork + var outputNetwork HostComputeNetwork + + // If HNS sets the network type to NAT (i.e. '0' in HNS.Schema.Network.NetworkMode), + // the value will be omitted from the JSON blob. We therefore need to initialize NAT here before + // unmarshaling the JSON blob. + outputNetwork.Type = NAT + + if err := json.Unmarshal([]byte(properties), &outputNetwork); err != nil { + return nil, err + } + return &outputNetwork, nil +} + +func deleteNetwork(networkId string) error { + networkGuid, err := guid.FromString(networkId) + if err != nil { + return errInvalidNetworkID + } + var resultBuffer *uint16 + hr := hcnDeleteNetwork(&networkGuid, &resultBuffer) + if err := checkForErrors("hcnDeleteNetwork", hr, resultBuffer); err != nil { + return err + } + return nil +} + +// ListNetworks makes a call to list all available networks. +func ListNetworks() ([]HostComputeNetwork, error) { + hcnQuery := defaultQuery() + networks, err := ListNetworksQuery(hcnQuery) + if err != nil { + return nil, err + } + return networks, nil +} + +// ListNetworksQuery makes a call to query the list of available networks. +func ListNetworksQuery(query HostComputeQuery) ([]HostComputeNetwork, error) { + queryJson, err := json.Marshal(query) + if err != nil { + return nil, err + } + + networks, err := enumerateNetworks(string(queryJson)) + if err != nil { + return nil, err + } + return networks, nil +} + +// GetNetworkByID returns the network specified by Id. +func GetNetworkByID(networkID string) (*HostComputeNetwork, error) { + hcnQuery := defaultQuery() + mapA := map[string]string{"ID": networkID} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + networks, err := ListNetworksQuery(hcnQuery) + if err != nil { + return nil, err + } + if len(networks) == 0 { + return nil, NetworkNotFoundError{NetworkID: networkID} + } + return &networks[0], err +} + +// GetNetworkByName returns the network specified by Name. +func GetNetworkByName(networkName string) (*HostComputeNetwork, error) { + hcnQuery := defaultQuery() + mapA := map[string]string{"Name": networkName} + filter, err := json.Marshal(mapA) + if err != nil { + return nil, err + } + hcnQuery.Filter = string(filter) + + networks, err := ListNetworksQuery(hcnQuery) + if err != nil { + return nil, err + } + if len(networks) == 0 { + return nil, NetworkNotFoundError{NetworkName: networkName} + } + return &networks[0], err +} + +// Create Network. +func (network *HostComputeNetwork) Create() (*HostComputeNetwork, error) { + logrus.Debugf("hcn::HostComputeNetwork::Create id=%s", network.Id) + for _, ipam := range network.Ipams { + for _, subnet := range ipam.Subnets { + if subnet.IpAddressPrefix != "" { + hasDefault := false + for _, route := range subnet.Routes { + if route.NextHop == "" { + return nil, errors.New("network create error, subnet has address prefix but no gateway specified") + } + if route.DestinationPrefix == "0.0.0.0/0" || route.DestinationPrefix == "::/0" { + hasDefault = true + } + } + if !hasDefault { + return nil, errors.New("network create error, no default gateway") + } + } + } + } + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + + logrus.Debugf("hcn::HostComputeNetwork::Create JSON: %s", jsonString) + network, hcnErr := createNetwork(string(jsonString)) + if hcnErr != nil { + return nil, hcnErr + } + return network, nil +} + +// Delete Network. +func (network *HostComputeNetwork) Delete() error { + logrus.Debugf("hcn::HostComputeNetwork::Delete id=%s", network.Id) + + if err := deleteNetwork(network.Id); err != nil { + return err + } + return nil +} + +// ModifyNetworkSettings updates the Policy for a network. +func (network *HostComputeNetwork) ModifyNetworkSettings(request *ModifyNetworkSettingRequest) error { + logrus.Debugf("hcn::HostComputeNetwork::ModifyNetworkSettings id=%s", network.Id) + + networkSettingsRequest, err := json.Marshal(request) + if err != nil { + return err + } + + _, err = modifyNetwork(network.Id, string(networkSettingsRequest)) + if err != nil { + return err + } + return nil +} + +// AddPolicy applies a Policy (ex: RemoteSubnet) on the Network. +func (network *HostComputeNetwork) AddPolicy(networkPolicy PolicyNetworkRequest) error { + logrus.Debugf("hcn::HostComputeNetwork::AddPolicy id=%s", network.Id) + + settingsJson, err := json.Marshal(networkPolicy) + if err != nil { + return err + } + requestMessage := &ModifyNetworkSettingRequest{ + ResourceType: NetworkResourceTypePolicy, + RequestType: RequestTypeAdd, + Settings: settingsJson, + } + + return network.ModifyNetworkSettings(requestMessage) +} + +// RemovePolicy removes a Policy (ex: RemoteSubnet) from the Network. +func (network *HostComputeNetwork) RemovePolicy(networkPolicy PolicyNetworkRequest) error { + logrus.Debugf("hcn::HostComputeNetwork::RemovePolicy id=%s", network.Id) + + settingsJson, err := json.Marshal(networkPolicy) + if err != nil { + return err + } + requestMessage := &ModifyNetworkSettingRequest{ + ResourceType: NetworkResourceTypePolicy, + RequestType: RequestTypeRemove, + Settings: settingsJson, + } + + return network.ModifyNetworkSettings(requestMessage) +} + +// CreateEndpoint creates an endpoint on the Network. +func (network *HostComputeNetwork) CreateEndpoint(endpoint *HostComputeEndpoint) (*HostComputeEndpoint, error) { + isRemote := endpoint.Flags&EndpointFlagsRemoteEndpoint != 0 + logrus.Debugf("hcn::HostComputeNetwork::CreatEndpoint, networkId=%s remote=%t", network.Id, isRemote) + + endpoint.HostComputeNetwork = network.Id + endpointSettings, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + newEndpoint, err := createEndpoint(network.Id, string(endpointSettings)) + if err != nil { + return nil, err + } + return newEndpoint, nil +} + +// CreateRemoteEndpoint creates a remote endpoint on the Network. +func (network *HostComputeNetwork) CreateRemoteEndpoint(endpoint *HostComputeEndpoint) (*HostComputeEndpoint, error) { + endpoint.Flags = EndpointFlagsRemoteEndpoint | endpoint.Flags + return network.CreateEndpoint(endpoint) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go new file mode 100644 index 000000000..d05398f25 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnpolicy.go @@ -0,0 +1,249 @@ +package hcn + +import ( + "encoding/json" +) + +// EndpointPolicyType are the potential Policies that apply to Endpoints. +type EndpointPolicyType string + +// EndpointPolicyType const +const ( + PortMapping EndpointPolicyType = "PortMapping" + ACL EndpointPolicyType = "ACL" + QOS EndpointPolicyType = "QOS" + L2Driver EndpointPolicyType = "L2Driver" + OutBoundNAT EndpointPolicyType = "OutBoundNAT" + SDNRoute EndpointPolicyType = "SDNRoute" + L4Proxy EndpointPolicyType = "L4Proxy" + PortName EndpointPolicyType = "PortName" + EncapOverhead EndpointPolicyType = "EncapOverhead" + // Endpoint and Network have InterfaceConstraint and ProviderAddress + NetworkProviderAddress EndpointPolicyType = "ProviderAddress" + NetworkInterfaceConstraint EndpointPolicyType = "InterfaceConstraint" +) + +// EndpointPolicy is a collection of Policy settings for an Endpoint. +type EndpointPolicy struct { + Type EndpointPolicyType `json:""` + Settings json.RawMessage `json:",omitempty"` +} + +// NetworkPolicyType are the potential Policies that apply to Networks. +type NetworkPolicyType string + +// NetworkPolicyType const +const ( + SourceMacAddress NetworkPolicyType = "SourceMacAddress" + NetAdapterName NetworkPolicyType = "NetAdapterName" + VSwitchExtension NetworkPolicyType = "VSwitchExtension" + DrMacAddress NetworkPolicyType = "DrMacAddress" + AutomaticDNS NetworkPolicyType = "AutomaticDNS" + InterfaceConstraint NetworkPolicyType = "InterfaceConstraint" + ProviderAddress NetworkPolicyType = "ProviderAddress" + RemoteSubnetRoute NetworkPolicyType = "RemoteSubnetRoute" + HostRoute NetworkPolicyType = "HostRoute" +) + +// NetworkPolicy is a collection of Policy settings for a Network. +type NetworkPolicy struct { + Type NetworkPolicyType `json:""` + Settings json.RawMessage `json:",omitempty"` +} + +// SubnetPolicyType are the potential Policies that apply to Subnets. +type SubnetPolicyType string + +// SubnetPolicyType const +const ( + VLAN SubnetPolicyType = "VLAN" + VSID SubnetPolicyType = "VSID" +) + +// SubnetPolicy is a collection of Policy settings for a Subnet. +type SubnetPolicy struct { + Type SubnetPolicyType `json:""` + Settings json.RawMessage `json:",omitempty"` +} + +// NatFlags are flags for portmappings. +type NatFlags uint32 + +/// Endpoint Policy objects + +// PortMappingPolicySetting defines Port Mapping (NAT) +type PortMappingPolicySetting struct { + Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 + InternalPort uint16 `json:",omitempty"` + ExternalPort uint16 `json:",omitempty"` + VIP string `json:",omitempty"` + Flags NatFlags `json:",omitempty"` +} + +// ActionType associated with ACLs. Value is either Allow or Block. +type ActionType string + +// DirectionType associated with ACLs. Value is either In or Out. +type DirectionType string + +// RuleType associated with ACLs. Value is either Host (WFP) or Switch (VFP). +type RuleType string + +const ( + // Allow traffic + ActionTypeAllow ActionType = "Allow" + // Block traffic + ActionTypeBlock ActionType = "Block" + + // In is traffic coming to the Endpoint + DirectionTypeIn DirectionType = "In" + // Out is traffic leaving the Endpoint + DirectionTypeOut DirectionType = "Out" + + // Host creates WFP (Windows Firewall) rules + RuleTypeHost RuleType = "Host" + // Switch creates VFP (Virtual Filter Platform) rules + RuleTypeSwitch RuleType = "Switch" +) + +// AclPolicySetting creates firewall rules on an endpoint +type AclPolicySetting struct { + Protocols string `json:",omitempty"` // EX: 6 (TCP), 17 (UDP), 1 (ICMPv4), 58 (ICMPv6), 2 (IGMP) + Action ActionType `json:","` + Direction DirectionType `json:","` + LocalAddresses string `json:",omitempty"` + RemoteAddresses string `json:",omitempty"` + LocalPorts string `json:",omitempty"` + RemotePorts string `json:",omitempty"` + RuleType RuleType `json:",omitempty"` + Priority uint16 `json:",omitempty"` +} + +// QosPolicySetting sets Quality of Service bandwidth caps on an Endpoint. +type QosPolicySetting struct { + MaximumOutgoingBandwidthInBytes uint64 +} + +// OutboundNatPolicySetting sets outbound Network Address Translation on an Endpoint. +type OutboundNatPolicySetting struct { + VirtualIP string `json:",omitempty"` + Exceptions []string `json:",omitempty"` +} + +// SDNRoutePolicySetting sets SDN Route on an Endpoint. +type SDNRoutePolicySetting struct { + DestinationPrefix string `json:",omitempty"` + NextHop string `json:",omitempty"` + NeedEncap bool `json:",omitempty"` +} + +// A ProxyType is a type of proxy used by the L4 proxy policy. +type ProxyType int + +const ( + // ProxyTypeVFP specifies a Virtual Filtering Protocol proxy. + ProxyTypeVFP ProxyType = iota + // ProxyTypeWFP specifies a Windows Filtering Platform proxy. + ProxyTypeWFP +) + +// FiveTuple is nested in L4ProxyPolicySetting for WFP support. +type FiveTuple struct { + Protocols string `json:",omitempty"` + LocalAddresses string `json:",omitempty"` + RemoteAddresses string `json:",omitempty"` + LocalPorts string `json:",omitempty"` + RemotePorts string `json:",omitempty"` + Priority uint16 `json:",omitempty"` +} + +// L4ProxyPolicySetting sets Layer-4 Proxy on an endpoint. +type L4ProxyPolicySetting struct { + IP string `json:",omitempty"` + Port string `json:",omitempty"` + Protocol uint32 `json:",omitempty"` // EX: TCP = 6, UDP = 17 + ExceptionList []string `json:",omitempty"` + Destination string `json:","` + OutboundNat bool `json:",omitempty"` + + // For the WFP proxy + FilterTuple FiveTuple `json:",omitempty"` + ProxyType ProxyType `json:",omitempty"` + UserSID string `json:",omitempty"` + CompartmentID uint32 `json:",omitempty"` +} + +// PortnameEndpointPolicySetting sets the port name for an endpoint. +type PortnameEndpointPolicySetting struct { + Name string `json:",omitempty"` +} + +// EncapOverheadEndpointPolicySetting sets the encap overhead for an endpoint. +type EncapOverheadEndpointPolicySetting struct { + Overhead uint16 `json:",omitempty"` +} + +/// Endpoint and Network Policy objects + +// ProviderAddressEndpointPolicySetting sets the PA for an endpoint. +type ProviderAddressEndpointPolicySetting struct { + ProviderAddress string `json:",omitempty"` +} + +// InterfaceConstraintPolicySetting limits an Endpoint or Network to a specific Nic. +type InterfaceConstraintPolicySetting struct { + InterfaceGuid string `json:",omitempty"` + InterfaceLuid uint64 `json:",omitempty"` + InterfaceIndex uint32 `json:",omitempty"` + InterfaceMediaType uint32 `json:",omitempty"` + InterfaceAlias string `json:",omitempty"` + InterfaceDescription string `json:",omitempty"` +} + +/// Network Policy objects + +// SourceMacAddressNetworkPolicySetting sets source MAC for a network. +type SourceMacAddressNetworkPolicySetting struct { + SourceMacAddress string `json:",omitempty"` +} + +// NetAdapterNameNetworkPolicySetting sets network adapter of a network. +type NetAdapterNameNetworkPolicySetting struct { + NetworkAdapterName string `json:",omitempty"` +} + +// VSwitchExtensionNetworkPolicySetting enables/disabled VSwitch extensions for a network. +type VSwitchExtensionNetworkPolicySetting struct { + ExtensionID string `json:",omitempty"` + Enable bool `json:",omitempty"` +} + +// DrMacAddressNetworkPolicySetting sets the DR MAC for a network. +type DrMacAddressNetworkPolicySetting struct { + Address string `json:",omitempty"` +} + +// AutomaticDNSNetworkPolicySetting enables/disables automatic DNS on a network. +type AutomaticDNSNetworkPolicySetting struct { + Enable bool `json:",omitempty"` +} + +/// Subnet Policy objects + +// VlanPolicySetting isolates a subnet with VLAN tagging. +type VlanPolicySetting struct { + IsolationId uint32 `json:","` +} + +// VsidPolicySetting isolates a subnet with VSID tagging. +type VsidPolicySetting struct { + IsolationId uint32 `json:","` +} + +// RemoteSubnetRoutePolicySetting creates remote subnet route rules on a network +type RemoteSubnetRoutePolicySetting struct { + DestinationPrefix string + IsolationId uint16 + ProviderAddress string + DistributedRouterMacAddress string +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go b/vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go new file mode 100644 index 000000000..9b5df2030 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/hcnsupport.go @@ -0,0 +1,71 @@ +package hcn + +import ( + "github.com/sirupsen/logrus" +) + +// SupportedFeatures are the features provided by the Service. +type SupportedFeatures struct { + Acl AclFeatures `json:"ACL"` + Api ApiSupport `json:"API"` + RemoteSubnet bool `json:"RemoteSubnet"` + HostRoute bool `json:"HostRoute"` + DSR bool `json:"DSR"` +} + +// AclFeatures are the supported ACL possibilities. +type AclFeatures struct { + AclAddressLists bool `json:"AclAddressLists"` + AclNoHostRulePriority bool `json:"AclHostRulePriority"` + AclPortRanges bool `json:"AclPortRanges"` + AclRuleId bool `json:"AclRuleId"` +} + +// ApiSupport lists the supported API versions. +type ApiSupport struct { + V1 bool `json:"V1"` + V2 bool `json:"V2"` +} + +// GetSupportedFeatures returns the features supported by the Service. +func GetSupportedFeatures() SupportedFeatures { + var features SupportedFeatures + + globals, err := GetGlobals() + if err != nil { + // Expected on pre-1803 builds, all features will be false/unsupported + logrus.Debugf("Unable to obtain globals: %s", err) + return features + } + + features.Acl = AclFeatures{ + AclAddressLists: isFeatureSupported(globals.Version, HNSVersion1803), + AclNoHostRulePriority: isFeatureSupported(globals.Version, HNSVersion1803), + AclPortRanges: isFeatureSupported(globals.Version, HNSVersion1803), + AclRuleId: isFeatureSupported(globals.Version, HNSVersion1803), + } + + features.Api = ApiSupport{ + V2: isFeatureSupported(globals.Version, V2ApiSupport), + V1: true, // HNSCall is still available. + } + + features.RemoteSubnet = isFeatureSupported(globals.Version, RemoteSubnetVersion) + features.HostRoute = isFeatureSupported(globals.Version, HostRouteVersion) + features.DSR = isFeatureSupported(globals.Version, DSRVersion) + + return features +} + +func isFeatureSupported(currentVersion Version, minVersionSupported Version) bool { + if currentVersion.Major < minVersionSupported.Major { + return false + } + if currentVersion.Major > minVersionSupported.Major { + return true + } + if currentVersion.Minor < minVersionSupported.Minor { + return false + } + return true +} diff --git a/vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go new file mode 100644 index 000000000..856b2c140 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hcn/zsyscall_windows.go @@ -0,0 +1,714 @@ +// Code generated mksyscall_windows.exe DO NOT EDIT + +package hcn + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + modcomputenetwork = windows.NewLazySystemDLL("computenetwork.dll") + + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") + procHNSCall = modvmcompute.NewProc("HNSCall") + procHcnEnumerateNetworks = modcomputenetwork.NewProc("HcnEnumerateNetworks") + procHcnCreateNetwork = modcomputenetwork.NewProc("HcnCreateNetwork") + procHcnOpenNetwork = modcomputenetwork.NewProc("HcnOpenNetwork") + procHcnModifyNetwork = modcomputenetwork.NewProc("HcnModifyNetwork") + procHcnQueryNetworkProperties = modcomputenetwork.NewProc("HcnQueryNetworkProperties") + procHcnDeleteNetwork = modcomputenetwork.NewProc("HcnDeleteNetwork") + procHcnCloseNetwork = modcomputenetwork.NewProc("HcnCloseNetwork") + procHcnEnumerateEndpoints = modcomputenetwork.NewProc("HcnEnumerateEndpoints") + procHcnCreateEndpoint = modcomputenetwork.NewProc("HcnCreateEndpoint") + procHcnOpenEndpoint = modcomputenetwork.NewProc("HcnOpenEndpoint") + procHcnModifyEndpoint = modcomputenetwork.NewProc("HcnModifyEndpoint") + procHcnQueryEndpointProperties = modcomputenetwork.NewProc("HcnQueryEndpointProperties") + procHcnDeleteEndpoint = modcomputenetwork.NewProc("HcnDeleteEndpoint") + procHcnCloseEndpoint = modcomputenetwork.NewProc("HcnCloseEndpoint") + procHcnEnumerateNamespaces = modcomputenetwork.NewProc("HcnEnumerateNamespaces") + procHcnCreateNamespace = modcomputenetwork.NewProc("HcnCreateNamespace") + procHcnOpenNamespace = modcomputenetwork.NewProc("HcnOpenNamespace") + procHcnModifyNamespace = modcomputenetwork.NewProc("HcnModifyNamespace") + procHcnQueryNamespaceProperties = modcomputenetwork.NewProc("HcnQueryNamespaceProperties") + procHcnDeleteNamespace = modcomputenetwork.NewProc("HcnDeleteNamespace") + procHcnCloseNamespace = modcomputenetwork.NewProc("HcnCloseNamespace") + procHcnEnumerateLoadBalancers = modcomputenetwork.NewProc("HcnEnumerateLoadBalancers") + procHcnCreateLoadBalancer = modcomputenetwork.NewProc("HcnCreateLoadBalancer") + procHcnOpenLoadBalancer = modcomputenetwork.NewProc("HcnOpenLoadBalancer") + procHcnModifyLoadBalancer = modcomputenetwork.NewProc("HcnModifyLoadBalancer") + procHcnQueryLoadBalancerProperties = modcomputenetwork.NewProc("HcnQueryLoadBalancerProperties") + procHcnDeleteLoadBalancer = modcomputenetwork.NewProc("HcnDeleteLoadBalancer") + procHcnCloseLoadBalancer = modcomputenetwork.NewProc("HcnCloseLoadBalancer") + procHcnOpenService = modcomputenetwork.NewProc("HcnOpenService") + procHcnRegisterServiceCallback = modcomputenetwork.NewProc("HcnRegisterServiceCallback") + procHcnUnregisterServiceCallback = modcomputenetwork.NewProc("HcnUnregisterServiceCallback") + procHcnCloseService = modcomputenetwork.NewProc("HcnCloseService") +) + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnEnumerateNetworks(query string, networks **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnEnumerateNetworks(_p0, networks, result) +} + +func _hcnEnumerateNetworks(query *uint16, networks **uint16, result **uint16) (hr error) { + if hr = procHcnEnumerateNetworks.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnEnumerateNetworks.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(networks)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCreateNetwork(id *_guid, settings string, network *hcnNetwork, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnCreateNetwork(id, _p0, network, result) +} + +func _hcnCreateNetwork(id *_guid, settings *uint16, network *hcnNetwork, result **uint16) (hr error) { + if hr = procHcnCreateNetwork.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnCreateNetwork.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnOpenNetwork(id *_guid, network *hcnNetwork, result **uint16) (hr error) { + if hr = procHcnOpenNetwork.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnOpenNetwork.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(network)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnModifyNetwork(network hcnNetwork, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnModifyNetwork(network, _p0, result) +} + +func _hcnModifyNetwork(network hcnNetwork, settings *uint16, result **uint16) (hr error) { + if hr = procHcnModifyNetwork.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnModifyNetwork.Addr(), 3, uintptr(network), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnQueryNetworkProperties(network hcnNetwork, query string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnQueryNetworkProperties(network, _p0, properties, result) +} + +func _hcnQueryNetworkProperties(network hcnNetwork, query *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcnQueryNetworkProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnQueryNetworkProperties.Addr(), 4, uintptr(network), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnDeleteNetwork(id *_guid, result **uint16) (hr error) { + if hr = procHcnDeleteNetwork.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnDeleteNetwork.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCloseNetwork(network hcnNetwork) (hr error) { + if hr = procHcnCloseNetwork.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnCloseNetwork.Addr(), 1, uintptr(network), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnEnumerateEndpoints(query string, endpoints **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnEnumerateEndpoints(_p0, endpoints, result) +} + +func _hcnEnumerateEndpoints(query *uint16, endpoints **uint16, result **uint16) (hr error) { + if hr = procHcnEnumerateEndpoints.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnEnumerateEndpoints.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(endpoints)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCreateEndpoint(network hcnNetwork, id *_guid, settings string, endpoint *hcnEndpoint, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnCreateEndpoint(network, id, _p0, endpoint, result) +} + +func _hcnCreateEndpoint(network hcnNetwork, id *_guid, settings *uint16, endpoint *hcnEndpoint, result **uint16) (hr error) { + if hr = procHcnCreateEndpoint.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnCreateEndpoint.Addr(), 5, uintptr(network), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnOpenEndpoint(id *_guid, endpoint *hcnEndpoint, result **uint16) (hr error) { + if hr = procHcnOpenEndpoint.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnOpenEndpoint.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(endpoint)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnModifyEndpoint(endpoint hcnEndpoint, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnModifyEndpoint(endpoint, _p0, result) +} + +func _hcnModifyEndpoint(endpoint hcnEndpoint, settings *uint16, result **uint16) (hr error) { + if hr = procHcnModifyEndpoint.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnModifyEndpoint.Addr(), 3, uintptr(endpoint), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnQueryEndpointProperties(endpoint hcnEndpoint, query string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnQueryEndpointProperties(endpoint, _p0, properties, result) +} + +func _hcnQueryEndpointProperties(endpoint hcnEndpoint, query *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcnQueryEndpointProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnQueryEndpointProperties.Addr(), 4, uintptr(endpoint), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnDeleteEndpoint(id *_guid, result **uint16) (hr error) { + if hr = procHcnDeleteEndpoint.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnDeleteEndpoint.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCloseEndpoint(endpoint hcnEndpoint) (hr error) { + if hr = procHcnCloseEndpoint.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnCloseEndpoint.Addr(), 1, uintptr(endpoint), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnEnumerateNamespaces(query string, namespaces **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnEnumerateNamespaces(_p0, namespaces, result) +} + +func _hcnEnumerateNamespaces(query *uint16, namespaces **uint16, result **uint16) (hr error) { + if hr = procHcnEnumerateNamespaces.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnEnumerateNamespaces.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(namespaces)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCreateNamespace(id *_guid, settings string, namespace *hcnNamespace, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnCreateNamespace(id, _p0, namespace, result) +} + +func _hcnCreateNamespace(id *_guid, settings *uint16, namespace *hcnNamespace, result **uint16) (hr error) { + if hr = procHcnCreateNamespace.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnCreateNamespace.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnOpenNamespace(id *_guid, namespace *hcnNamespace, result **uint16) (hr error) { + if hr = procHcnOpenNamespace.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnOpenNamespace.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(namespace)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnModifyNamespace(namespace hcnNamespace, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnModifyNamespace(namespace, _p0, result) +} + +func _hcnModifyNamespace(namespace hcnNamespace, settings *uint16, result **uint16) (hr error) { + if hr = procHcnModifyNamespace.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnModifyNamespace.Addr(), 3, uintptr(namespace), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnQueryNamespaceProperties(namespace hcnNamespace, query string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnQueryNamespaceProperties(namespace, _p0, properties, result) +} + +func _hcnQueryNamespaceProperties(namespace hcnNamespace, query *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcnQueryNamespaceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnQueryNamespaceProperties.Addr(), 4, uintptr(namespace), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnDeleteNamespace(id *_guid, result **uint16) (hr error) { + if hr = procHcnDeleteNamespace.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnDeleteNamespace.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCloseNamespace(namespace hcnNamespace) (hr error) { + if hr = procHcnCloseNamespace.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnCloseNamespace.Addr(), 1, uintptr(namespace), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnEnumerateLoadBalancers(query string, loadBalancers **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnEnumerateLoadBalancers(_p0, loadBalancers, result) +} + +func _hcnEnumerateLoadBalancers(query *uint16, loadBalancers **uint16, result **uint16) (hr error) { + if hr = procHcnEnumerateLoadBalancers.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnEnumerateLoadBalancers.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(loadBalancers)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCreateLoadBalancer(id *_guid, settings string, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnCreateLoadBalancer(id, _p0, loadBalancer, result) +} + +func _hcnCreateLoadBalancer(id *_guid, settings *uint16, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { + if hr = procHcnCreateLoadBalancer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnCreateLoadBalancer.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnOpenLoadBalancer(id *_guid, loadBalancer *hcnLoadBalancer, result **uint16) (hr error) { + if hr = procHcnOpenLoadBalancer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnOpenLoadBalancer.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(loadBalancer)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcnModifyLoadBalancer(loadBalancer, _p0, result) +} + +func _hcnModifyLoadBalancer(loadBalancer hcnLoadBalancer, settings *uint16, result **uint16) (hr error) { + if hr = procHcnModifyLoadBalancer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnModifyLoadBalancer.Addr(), 3, uintptr(loadBalancer), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcnQueryLoadBalancerProperties(loadBalancer, _p0, properties, result) +} + +func _hcnQueryLoadBalancerProperties(loadBalancer hcnLoadBalancer, query *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcnQueryLoadBalancerProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnQueryLoadBalancerProperties.Addr(), 4, uintptr(loadBalancer), uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnDeleteLoadBalancer(id *_guid, result **uint16) (hr error) { + if hr = procHcnDeleteLoadBalancer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnDeleteLoadBalancer.Addr(), 2, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCloseLoadBalancer(loadBalancer hcnLoadBalancer) (hr error) { + if hr = procHcnCloseLoadBalancer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnCloseLoadBalancer.Addr(), 1, uintptr(loadBalancer), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnOpenService(service *hcnService, result **uint16) (hr error) { + if hr = procHcnOpenService.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnOpenService.Addr(), 2, uintptr(unsafe.Pointer(service)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnRegisterServiceCallback(service hcnService, callback int32, context int32, callbackHandle *hcnCallbackHandle) (hr error) { + if hr = procHcnRegisterServiceCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcnRegisterServiceCallback.Addr(), 4, uintptr(service), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnUnregisterServiceCallback(callbackHandle hcnCallbackHandle) (hr error) { + if hr = procHcnUnregisterServiceCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnUnregisterServiceCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} + +func hcnCloseService(service hcnService) (hr error) { + if hr = procHcnCloseService.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcnCloseService.Addr(), 1, uintptr(service), 0, 0) + if int32(r0) < 0 { + if r0&0x1fff0000 == 0x00070000 { + r0 &= 0xffff + } + hr = syscall.Errno(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index eb013d2c4..09b3860a7 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -39,11 +39,21 @@ func HNSListEndpointRequest() ([]HNSEndpoint, error) { // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { + endpoint, err := GetHNSEndpointByID(endpointID) + isAttached, err := endpoint.IsAttached(containerID) + if !isAttached { + return err + } return modifyNetworkEndpoint(containerID, endpointID, Remove) } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go b/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go new file mode 100644 index 000000000..4a4fcea84 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cni/registry.go @@ -0,0 +1,110 @@ +package cni + +import ( + "errors" + + "github.com/Microsoft/go-winio/pkg/guid" + "github.com/Microsoft/hcsshim/internal/regstate" +) + +const ( + cniRoot = "cni" + cniKey = "cfg" +) + +// PersistedNamespaceConfig is the registry version of the `NamespaceID` to UVM +// map. +type PersistedNamespaceConfig struct { + namespaceID string + stored bool + + ContainerID string + HostUniqueID guid.GUID +} + +// NewPersistedNamespaceConfig creates an in-memory namespace config that can be +// persisted to the registry. +func NewPersistedNamespaceConfig(namespaceID, containerID string, containerHostUniqueID guid.GUID) *PersistedNamespaceConfig { + return &PersistedNamespaceConfig{ + namespaceID: namespaceID, + ContainerID: containerID, + HostUniqueID: containerHostUniqueID, + } +} + +// LoadPersistedNamespaceConfig loads a persisted config from the registry that matches +// `namespaceID`. If not found returns `regstate.NotFoundError` +func LoadPersistedNamespaceConfig(namespaceID string) (*PersistedNamespaceConfig, error) { + sk, err := regstate.Open(cniRoot, false) + if err != nil { + return nil, err + } + defer sk.Close() + + pnc := PersistedNamespaceConfig{ + namespaceID: namespaceID, + stored: true, + } + if err := sk.Get(namespaceID, cniKey, &pnc); err != nil { + return nil, err + } + return &pnc, nil +} + +// Store stores or updates the in-memory config to its registry state. If the +// store failes returns the store error. +func (pnc *PersistedNamespaceConfig) Store() error { + if pnc.namespaceID == "" { + return errors.New("invalid namespaceID ''") + } + if pnc.ContainerID == "" { + return errors.New("invalid containerID ''") + } + empty := guid.GUID{} + if pnc.HostUniqueID == empty { + return errors.New("invalid containerHostUniqueID 'empy'") + } + sk, err := regstate.Open(cniRoot, false) + if err != nil { + return err + } + defer sk.Close() + + if pnc.stored { + if err := sk.Set(pnc.namespaceID, cniKey, pnc); err != nil { + return err + } + } else { + if err := sk.Create(pnc.namespaceID, cniKey, pnc); err != nil { + return err + } + } + pnc.stored = true + return nil +} + +// Remove removes any persisted state associated with this config. If the config +// is not found in the registery `Remove` returns no error. +func (pnc *PersistedNamespaceConfig) Remove() error { + if pnc.stored { + sk, err := regstate.Open(cniRoot, false) + if err != nil { + if regstate.IsNotFoundError(err) { + pnc.stored = false + return nil + } + return err + } + defer sk.Close() + + if err := sk.Remove(pnc.namespaceID); err != nil { + if regstate.IsNotFoundError(err) { + pnc.stored = false + return nil + } + return err + } + } + pnc.stored = false + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go new file mode 100644 index 000000000..c0158269f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go @@ -0,0 +1,80 @@ +package cow + +import ( + "context" + "io" + + "github.com/Microsoft/hcsshim/internal/schema1" +) + +// Process is the interface for an OS process running in a container or utility VM. +type Process interface { + // Close releases resources associated with the process and closes the + // writer and readers returned by Stdio. Depending on the implementation, + // this may also terminate the process. + Close() error + // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever + // is appropriate to indicate that no more data is available. + CloseStdin(ctx context.Context) error + // Pid returns the process ID. + Pid() int + // Stdio returns the stdio streams for a process. These may be nil if a stream + // was not requested during CreateProcess. + Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) + // ResizeConsole resizes the virtual terminal associated with the process. + ResizeConsole(ctx context.Context, width, height uint16) error + // Kill sends a SIGKILL or equivalent signal to the process and returns whether + // the signal was delivered. It does not wait for the process to terminate. + Kill(ctx context.Context) (bool, error) + // Signal sends a signal to the process and returns whether the signal was + // delivered. The input is OS specific (either + // guestrequest.SignalProcessOptionsWCOW or + // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process + // to terminate. + Signal(ctx context.Context, options interface{}) (bool, error) + // Wait waits for the process to complete, or for a connection to the process to be + // terminated by some error condition (including calling Close). + Wait() error + // ExitCode returns the exit code of the process. Returns an error if the process is + // not running. + ExitCode() (int, error) +} + +// ProcessHost is the interface for creating processes. +type ProcessHost interface { + // CreateProcess creates a process. The configuration is host specific + // (either hcsschema.ProcessParameters or lcow.ProcessParameters). + CreateProcess(ctx context.Context, config interface{}) (Process, error) + // OS returns the host's operating system, "linux" or "windows". + OS() string + // IsOCI specifies whether this is an OCI-compliant process host. If true, + // then the configuration passed to CreateProcess should have an OCI process + // spec (or nil if this is the initial process in an OCI container). + // Otherwise, it should have the HCS-specific process parameters. + IsOCI() bool +} + +// Container is the interface for container objects, either running on the host or +// in a utility VM. +type Container interface { + ProcessHost + // Close releases the resources associated with the container. Depending on + // the implementation, this may also terminate the container. + Close() error + // ID returns the container ID. + ID() string + // Properties returns the requested container properties. + Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) + // Start starts a container. + Start(ctx context.Context) error + // Shutdown sends a shutdown request to the container (but does not wait for + // the shutdown to complete). + Shutdown(ctx context.Context) error + // Terminate sends a terminate request to the container (but does not wait + // for the terminate to complete). + Terminate(ctx context.Context) error + // Wait waits for the container to terminate, or for the connection to the + // container to be terminated by some error condition (including calling + // Close). + Wait() error +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go deleted file mode 100644 index 5d3d0dfef..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go +++ /dev/null @@ -1,100 +0,0 @@ -package guestrequest - -import ( - "github.com/Microsoft/hcsshim/internal/schema2" -) - -// Arguably, many of these (at least CombinedLayers) should have been generated -// by swagger. -// -// This will also change package name due to an inbound breaking change. - -// This class is used by a modify request to add or remove a combined layers -// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath -// using the specified layers as the parent content. Ignores property ScratchPath -// since the container path is already the scratch path. For linux, the GCS unions -// the specified layers and ScratchPath together, placing the resulting union -// filesystem at ContainerRootPath. -type CombinedLayers struct { - ContainerRootPath string `json:"ContainerRootPath,omitempty"` - Layers []hcsschema.Layer `json:"Layers,omitempty"` - ScratchPath string `json:"ScratchPath,omitempty"` -} - -// Defines the schema for hosted settings passed to GCS and/or OpenGCS - -// SCSI. Scratch space for remote file-system commands, or R/W layer for containers -type LCOWMappedVirtualDisk struct { - MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM - Lun uint8 `json:"Lun,omitempty"` - Controller uint8 `json:"Controller,omitempty"` - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -type WCOWMappedVirtualDisk struct { - ContainerPath string `json:"ContainerPath,omitempty"` - Lun int32 `json:"Lun,omitempty"` -} - -type LCOWMappedDirectory struct { - MountPath string `json:"MountPath,omitempty"` - Port int32 `json:"Port,omitempty"` - ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) - ReadOnly bool `json:"ReadOnly,omitempty"` -} - -// Read-only layers over VPMem -type LCOWMappedVPMemDevice struct { - DeviceNumber uint32 `json:"DeviceNumber,omitempty"` - MountPath string `json:"MountPath,omitempty"` // /tmp/pN -} - -type LCOWNetworkAdapter struct { - NamespaceID string `json:",omitempty"` - ID string `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress string `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - EnableLowMetric bool `json:",omitempty"` - EncapOverhead uint16 `json:",omitempty"` -} - -type ResourceType string - -const ( - // These are constants for v2 schema modify guest requests. - ResourceTypeMappedDirectory ResourceType = "MappedDirectory" - ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" - ResourceTypeNetwork ResourceType = "Network" - ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" - ResourceTypeCombinedLayers ResourceType = "CombinedLayers" - ResourceTypeVPMemDevice ResourceType = "VPMemDevice" -) - -// GuestRequest is for modify commands passed to the guest. -type GuestRequest struct { - RequestType string `json:"RequestType,omitempty"` - ResourceType ResourceType `json:"ResourceType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type NetworkModifyRequest struct { - AdapterId string `json:"AdapterId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -type RS4NetworkModifyRequest struct { - AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` - RequestType string `json:"RequestType,omitempty"` - Settings interface{} `json:"Settings,omitempty"` -} - -// SignalProcessOptions is the options passed to either WCOW or LCOW -// to signal a given process. -type SignalProcessOptions struct { - Signal int `json:,omitempty` -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go deleted file mode 100644 index e9e45c030..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go +++ /dev/null @@ -1,69 +0,0 @@ -package guid - -import ( - "crypto/rand" - "encoding/json" - "fmt" - "io" - "strconv" - "strings" -) - -var _ = (json.Marshaler)(&GUID{}) -var _ = (json.Unmarshaler)(&GUID{}) - -type GUID [16]byte - -func New() GUID { - g := GUID{} - _, err := io.ReadFull(rand.Reader, g[:]) - if err != nil { - panic(err) - } - return g -} - -func (g GUID) String() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} - -func FromString(s string) GUID { - if len(s) != 36 { - panic(fmt.Sprintf("invalid GUID length: %d", len(s))) - } - if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { - panic("invalid GUID format") - } - indexOrder := [16]int{ - 0, 2, 4, 6, - 9, 11, - 14, 16, - 19, 21, - 24, 26, 28, 30, 32, 34, - } - byteOrder := [16]int{ - 3, 2, 1, 0, - 5, 4, - 7, 6, - 8, 9, - 10, 11, 12, 13, 14, 15, - } - var g GUID - for i, x := range indexOrder { - b, err := strconv.ParseInt(s[x:x+2], 16, 16) - if err != nil { - panic(err) - } - g[byteOrder[i]] = byte(b) - } - return g -} - -func (g GUID) MarshalJSON() ([]byte, error) { - return json.Marshal(g.String()) -} - -func (g *GUID) UnmarshalJSON(data []byte) error { - *g = FromString(strings.Trim(string(data), "\"")) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index f9a922a4b..62ba81751 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,10 +1,13 @@ package hcs import ( + "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) @@ -40,35 +43,83 @@ var ( ) type hcsNotification uint32 + +func (hn hcsNotification) String() string { + switch hn { + case hcsNotificationSystemExited: + return "SystemExited" + case hcsNotificationSystemCreateCompleted: + return "SystemCreateCompleted" + case hcsNotificationSystemStartCompleted: + return "SystemStartCompleted" + case hcsNotificationSystemPauseCompleted: + return "SystemPauseCompleted" + case hcsNotificationSystemResumeCompleted: + return "SystemResumeCompleted" + case hcsNotificationSystemCrashReport: + return "SystemCrashReport" + case hcsNotificationSystemSiloJobCreated: + return "SystemSiloJobCreated" + case hcsNotificationSystemSaveCompleted: + return "SystemSaveCompleted" + case hcsNotificationSystemRdpEnhancedModeStateChanged: + return "SystemRdpEnhancedModeStateChanged" + case hcsNotificationSystemShutdownFailed: + return "SystemShutdownFailed" + case hcsNotificationSystemGetPropertiesCompleted: + return "SystemGetPropertiesCompleted" + case hcsNotificationSystemModifyCompleted: + return "SystemModifyCompleted" + case hcsNotificationSystemCrashInitiated: + return "SystemCrashInitiated" + case hcsNotificationSystemGuestConnectionClosed: + return "SystemGuestConnectionClosed" + case hcsNotificationProcessExited: + return "ProcessExited" + case hcsNotificationInvalid: + return "Invalid" + case hcsNotificationServiceDisconnect: + return "ServiceDisconnect" + default: + return fmt.Sprintf("Unknown: %d", hn) + } +} + type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels - handle hcsCallback + handle vmcompute.HcsCallback + + systemID string + processID int } type notificationChannels map[hcsNotification]notificationChannel -func newChannels() notificationChannels { +func newSystemChannels() notificationChannels { channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationSystemExited, + hcsNotificationSystemCreateCompleted, + hcsNotificationSystemStartCompleted, + hcsNotificationSystemPauseCompleted, + hcsNotificationSystemResumeCompleted, + } { + channels[notif] = make(notificationChannel, 1) + } + return channels +} - channels[hcsNotificationSystemExited] = make(notificationChannel, 1) - channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1) - channels[hcsNotificationProcessExited] = make(notificationChannel, 1) - channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1) - channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1) - channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1) - channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1) - channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1) - channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1) - channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1) - +func newProcessChannels() notificationChannels { + channels := make(notificationChannels) + for _, notif := range []hcsNotification{ + hcsNotificationServiceDisconnect, + hcsNotificationProcessExited, + } { + channels[notif] = make(notificationChannel, 1) + } return channels } @@ -92,12 +143,17 @@ func notificationWatcher(notificationType hcsNotification, callbackNumber uintpt return 0 } + log := logrus.WithFields(logrus.Fields{ + "notification-type": notificationType.String(), + "system-id": context.systemID, + }) + if context.processID != 0 { + log.Data[logfields.ProcessID] = context.processID + } + log.Debug("HCS notification") + if channel, ok := context.channels[notificationType]; ok { channel <- result - } else { - logrus.WithFields(logrus.Fields{ - "notification-type": notificationType, - }).Warn("Received a callback of an unsupported type") } return 0 diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go index 079b56535..9a4705a49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -1,14 +1,14 @@ package hcs import ( + "context" "encoding/json" "errors" "fmt" + "net" "syscall" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) var ( @@ -117,17 +117,11 @@ func (ev *ErrorEvent) String() string { return evs } -func processHcsResult(resultp *uint16) []ErrorEvent { - if resultp != nil { - resultj := interop.ConvertAndFreeCoTaskMemString(resultp) - logrus.WithField(logfields.JSON, resultj). - Debug("HCS Result") +func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { + if resultJSON != "" { result := &hcsResult{} - if err := json.Unmarshal([]byte(resultj), result); err != nil { - logrus.WithFields(logrus.Fields{ - logfields.JSON: resultj, - logrus.ErrorKey: err, - }).Warning("Could not unmarshal HCS result") + if err := json.Unmarshal([]byte(resultJSON), result); err != nil { + log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents @@ -141,6 +135,8 @@ type HcsError struct { Events []ErrorEvent } +var _ net.Error = &HcsError{} + func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { @@ -149,6 +145,16 @@ func (e *HcsError) Error() string { return s } +func (e *HcsError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *HcsError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string @@ -158,6 +164,8 @@ type ProcessError struct { Events []ErrorEvent } +var _ net.Error = &ProcessError{} + // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string @@ -167,6 +175,8 @@ type SystemError struct { Events []ErrorEvent } +var _ net.Error = &SystemError{} + func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { @@ -178,6 +188,16 @@ func (e *SystemError) Error() string { return s } +func (e *SystemError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *SystemError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { @@ -200,6 +220,16 @@ func (e *ProcessError) Error() string { return s } +func (e *ProcessError) Temporary() bool { + err, ok := e.Err.(net.Error) + return ok && err.Temporary() +} + +func (e *ProcessError) Timeout() bool { + err, ok := e.Err.(net.Error) + return ok && err.Timeout() +} + func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { @@ -242,6 +272,9 @@ func IsPending(err error) bool { // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { + if err, ok := err.(net.Error); ok && err.Timeout() { + return true + } err = getInnerError(err) return err == ErrTimeout } @@ -272,6 +305,13 @@ func IsNotSupported(err error) bool { err == ErrVmcomputeUnknownMessage } +// IsOperationInvalidState returns true when err is caused by +// `ErrVmcomputeOperationInvalidState`. +func IsOperationInvalidState(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationInvalidState +} + func getInnerError(err error) error { switch pe := err.(type) { case nil: @@ -285,3 +325,12 @@ func getInnerError(err error) error { } return err } + +func getOperationLogResult(err error) (string, error) { + switch err { + case nil: + return "Success", nil + default: + return "Error", err + } +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go deleted file mode 100644 index b0d49cbcf..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go +++ /dev/null @@ -1,48 +0,0 @@ -// Shim for the Host Compute Service (HCS) to manage Windows Server -// containers and Hyper-V containers. - -package hcs - -import ( - "syscall" -) - -//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go deleted file mode 100644 index 6d03b17a2..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcs - -import "github.com/sirupsen/logrus" - -func logOperationBegin(ctx logrus.Fields, msg string) { - logrus.WithFields(ctx).Debug(msg) -} - -func logOperationEnd(ctx logrus.Fields, msg string, err error) { - // Copy the log and fields first. - log := logrus.WithFields(ctx) - if err == nil { - log.Debug(msg) - } else { - // Edit only the copied field data to avoid race conditions on the - // write. - log.Data[logrus.ErrorKey] = err - log.Error(msg) - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go index 93a7831f4..d366f629f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -1,52 +1,45 @@ package hcs import ( + "context" "encoding/json" "io" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/guestrequest" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex - handle hcsProcess + handle vmcompute.HcsProcess processID int system *System - cachedPipes *cachedPipes + stdin io.WriteCloser + stdout io.ReadCloser + stderr io.ReadCloser callbackNumber uintptr - logctx logrus.Fields - - waitBlock chan struct{} - waitError error + closedWaitOnce sync.Once + waitBlock chan struct{} + exitCode int + waitError error } -func newProcess(process hcsProcess, processID int, computeSystem *System) *Process { +func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, - logctx: logrus.Fields{ - logfields.ContainerID: computeSystem.ID(), - logfields.ProcessID: processID, - }, waitBlock: make(chan struct{}), } } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` @@ -62,7 +55,7 @@ type closeHandle struct { Handle string } -type ProcessStatus struct { +type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 @@ -90,134 +83,153 @@ func (process *Process) SystemID() string { return process.system.ID() } -func (process *Process) logOperationBegin(operation string) { - logOperationBegin( - process.logctx, - operation+" - Begin Operation") -} - -func (process *Process) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" +func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { + switch err { + case nil: + return true, nil + case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: + select { + case <-process.waitBlock: + // The process exit notification has already arrived. + default: + // The process should be gone, but we have not received the notification. + // After a second, force unblock the process wait to work around a possible + // deadlock in the HCS. + go func() { + time.Sleep(time.Second) + process.closedWaitOnce.Do(func() { + log.G(ctx).WithError(err).Warn("force unblocking process waits") + process.exitCode = -1 + process.waitError = err + close(process.waitBlock) + }) + }() + } + return false, nil + default: + return false, err } - - logOperationEnd( - process.logctx, - operation+" - End Operation - "+result, - err) } // Signal signals the process with `options`. -func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) { +// +// For LCOW `guestrequest.SignalProcessOptionsLCOW`. +// +// For WCOW `guestrequest.SignalProcessOptionsWCOW`. +func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { - return err + return false, err } - optionsStr := string(optionsb) - - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsSignalProcess(process.handle, optionsStr, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. -func (process *Process) Kill() (err error) { +func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { - return makeProcessError(process, operation, ErrAlreadyClosed, nil) + return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(process.logctx, func() { - err = hcsTerminateProcess(process.handle, &resultp) - }) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + delivered, err := process.processSignalResult(ctx, err) if err != nil { - return makeProcessError(process, operation, err, events) + err = makeProcessError(process, operation, err, events) } - - return nil + return delivered, err } // waitBackground waits for the process exit notification. Once received sets -// `process.waitError` (if any) and unblocks all `Wait` and `WaitTimeout` calls. +// `process.waitError` (if any) and unblocks all `Wait` calls. // -// This MUST be called exactly once per `process.handle` but `Wait` and -// `WaitTimeout` are safe to call multiple times. +// This MUST be called exactly once per `process.handle` but `Wait` is safe to +// call multiple times. func (process *Process) waitBackground() { - process.waitError = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) - close(process.waitBlock) + operation := "hcsshim::Process::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + + var ( + err error + exitCode = -1 + ) + + err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + err = makeProcessError(process, operation, err, nil) + log.G(ctx).WithError(err).Error("failed wait") + } else { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + + // Make sure we didnt race with Close() here + if process.handle != 0 { + propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + err = makeProcessError(process, operation, err, events) + } else { + properties := &processStatus{} + err = json.Unmarshal([]byte(propertiesJSON), properties) + if err != nil { + err = makeProcessError(process, operation, err, nil) + } else { + if properties.LastWaitResult != 0 { + log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") + } else { + exitCode = int(properties.ExitCode) + } + } + } + } + } + log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") + + process.closedWaitOnce.Do(func() { + process.exitCode = exitCode + process.waitError = err + close(process.waitBlock) + }) + oc.SetSpanStatus(span, err) } // Wait waits for the process to exit. If the process has already exited returns // the pervious error (if any). -func (process *Process) Wait() (err error) { - operation := "hcsshim::Process::Wait" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - +func (process *Process) Wait() error { <-process.waitBlock - if process.waitError != nil { - return makeProcessError(process, operation, err, nil) - } - return nil -} - -// WaitTimeout waits for the process to exit or the duration to elapse. If the -// process has already exited returns the pervious error (if any). If a timeout -// occurs returns `ErrTimeout`. -func (process *Process) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcssshim::Process::WaitTimeout" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - select { - case <-process.waitBlock: - if process.waitError != nil { - return makeProcessError(process, operation, process.waitError, nil) - } - return nil - case <-time.After(timeout): - return makeProcessError(process, operation, ErrTimeout, nil) - } + return process.waitError } // ResizeConsole resizes the console of the process. -func (process *Process) ResizeConsole(width, height uint16) (err error) { +func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -236,11 +248,8 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } @@ -248,109 +257,46 @@ func (process *Process) ResizeConsole(width, height uint16) (err error) { return nil } -func (process *Process) Properties() (_ *ProcessStatus, err error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - - operation := "hcsshim::Process::Properties" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - if process.handle == 0 { - return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) - } - - var ( - resultp *uint16 - propertiesp *uint16 - ) - syscallWatcher(process.logctx, func() { - err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return nil, makeProcessError(process, operation, err, events) - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) - - properties := &ProcessStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeProcessError(process, operation, err, nil) - } - - return properties, nil -} - // ExitCode returns the exit code of the process. The process must have // already terminated. -func (process *Process) ExitCode() (_ int, err error) { - operation := "hcsshim::Process::ExitCode" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - - properties, err := process.Properties() - if err != nil { - return -1, makeProcessError(process, operation, err, nil) +func (process *Process) ExitCode() (int, error) { + select { + case <-process.waitBlock: + if process.waitError != nil { + return -1, process.waitError + } + return process.exitCode, nil + default: + return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } - - if properties.Exited == false { - return -1, makeProcessError(process, operation, ErrInvalidProcessState, nil) - } - - if properties.LastWaitResult != 0 { - logrus.WithFields(logrus.Fields{ - logfields.ContainerID: process.SystemID(), - logfields.ProcessID: process.processID, - "wait-result": properties.LastWaitResult, - }).Warn("hcsshim::Process::ExitCode - Non-zero last wait result") - return -1, nil - } - - return int(properties.ExitCode), nil } -// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing -// these pipes does not close the underlying pipes; it should be possible to -// call this multiple times to get multiple interfaces. -func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { +// StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; but this function can only +// be called once on each Process. +func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { + operation := "hcsshim::Process::StdioLegacy" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.RLock() defer process.handleLock.RUnlock() - operation := "hcsshim::Process::Stdio" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err = hcsGetProcessInfo(process.handle, &processInfo, &resultp) - events := processHcsResult(resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, err, events) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil + processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) + events := processHcsResult(ctx, resultJSON) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) } - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } @@ -358,15 +304,19 @@ func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadClo return pipes[0], pipes[1], pipes[2], nil } +// Stdio returns the stdin, stdout, and stderr pipes, respectively. +// To close them, close the process handle. +func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { + return process.stdin, process.stdout, process.stderr +} + // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. -func (process *Process) CloseStdin() (err error) { +func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) @@ -384,93 +334,113 @@ func (process *Process) CloseStdin() (err error) { return err } - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - events := processHcsResult(resultp) + resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } + if process.stdin != nil { + process.stdin.Close() + } return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { + operation := "hcsshim::Process::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes( + trace.StringAttribute("cid", process.SystemID()), + trace.Int64Attribute("pid", int64(process.processID))) + process.handleLock.Lock() defer process.handleLock.Unlock() - operation := "hcsshim::Process::Close" - process.logOperationBegin(operation) - defer func() { process.logOperationEnd(operation, err) }() - // Don't double free this if process.handle == 0 { return nil } - if err = process.unregisterCallback(); err != nil { + if process.stdin != nil { + process.stdin.Close() + } + if process.stdout != nil { + process.stdout.Close() + } + if process.stderr != nil { + process.stderr.Close() + } + + if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } - if err = hcsCloseProcess(process.handle); err != nil { + if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 + process.closedWaitOnce.Do(func() { + process.exitCode = -1 + process.waitError = ErrAlreadyClosed + close(process.waitBlock) + }) return nil } -func (process *Process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (process *Process) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newProcessChannels(), + systemID: process.SystemID(), + processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } -func (process *Process) unregisterCallback() error { +func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil } - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) + // vmcompute.HcsUnregisterProcessCallback has its own synchronization to + // wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() delete(callbackMap, callbackNumber) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go index 4af30ae40..f7d4ba87a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -1,18 +1,23 @@ package hcs import ( + "context" "encoding/json" + "errors" "os" "strconv" + "strings" "sync" "syscall" "time" - "github.com/Microsoft/hcsshim/internal/interop" - "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/cow" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/vmcompute" + "go.opencensus.io/trace" ) // currentContainerStarts is used to limit the number of concurrent container @@ -38,53 +43,37 @@ func init() { type System struct { handleLock sync.RWMutex - handle hcsSystem + handle vmcompute.HcsSystem id string callbackNumber uintptr - logctx logrus.Fields + closedWaitOnce sync.Once + waitBlock chan struct{} + waitError error + exitError error - waitBlock chan struct{} - waitError error + os, typ string } func newSystem(id string) *System { return &System{ - id: id, - logctx: logrus.Fields{ - logfields.ContainerID: id, - }, + id: id, waitBlock: make(chan struct{}), } } -func (computeSystem *System) logOperationBegin(operation string) { - logOperationBegin( - computeSystem.logctx, - operation+" - Begin Operation") -} - -func (computeSystem *System) logOperationEnd(operation string, err error) { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - computeSystem.logctx, - operation+" - End Operation - "+result, - err) -} - // CreateComputeSystem creates a new compute system with the given configuration but does not start it. -func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) { +func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" + // hcsCreateComputeSystemContext is an async operation. Start the outer span + // here to measure the full create time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", id)) + computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { @@ -93,129 +82,114 @@ func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System hcsDocument := string(hcsDocumentB) - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, hcsDocument). - Debug("HCS ComputeSystem Document") - var ( - resultp *uint16 identity syscall.Handle + resultJSON string createError error ) - syscallWatcher(computeSystem.logctx, func() { - createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) - }) - + computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } - events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. - computeSystem.Terminate() + computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } - go computeSystem.waitBackground() - + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. -func OpenComputeSystem(id string) (_ *System, err error) { +func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) - computeSystem.logOperationBegin(operation) - defer func() { - if IsNotExist(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() - - var ( - handle hcsSystem - resultp *uint16 - ) - err = hcsOpenComputeSystem(id, &handle, &resultp) - events := processHcsResult(resultp) + handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } - computeSystem.handle = handle - - if err = computeSystem.registerCallback(); err != nil { + defer func() { + if err != nil { + computeSystem.Close() + } + }() + if err = computeSystem.registerCallback(ctx); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } go computeSystem.waitBackground() - + if err = computeSystem.getCachedProperties(ctx); err != nil { + return nil, err + } return computeSystem, nil } +func (computeSystem *System) getCachedProperties(ctx context.Context) error { + props, err := computeSystem.Properties(ctx) + if err != nil { + return err + } + computeSystem.typ = strings.ToLower(props.SystemType) + computeSystem.os = strings.ToLower(props.RuntimeOSType) + if computeSystem.os == "" && computeSystem.typ == "container" { + // Pre-RS5 HCS did not return the OS, but it only supported containers + // that ran Windows. + computeSystem.os = "windows" + } + return nil +} + +// OS returns the operating system of the compute system, "linux" or "windows". +func (computeSystem *System) OS() string { + return computeSystem.os +} + +// IsOCI returns whether processes in the compute system should be created via +// OCI. +func (computeSystem *System) IsOCI() bool { + return computeSystem.os == "linux" && computeSystem.typ == "container" +} + // GetComputeSystems gets a list of the compute systems on the system that match the query -func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) { +func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" - fields := logrus.Fields{} - logOperationBegin( - fields, - operation+" - Begin Operation") - - defer func() { - var result string - if err == nil { - result = "Success" - } else { - result = "Error" - } - - logOperationEnd( - fields, - operation+" - End Operation - "+result, - err) - }() queryb, err := json.Marshal(q) if err != nil { return nil, err } - query := string(queryb) - - logrus.WithFields(fields). - WithField(logfields.JSON, query). - Debug("HCS ComputeSystem Query") - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - - syscallWatcher(fields, func() { - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - }) - events := processHcsResult(resultp) + computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) + events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } - if computeSystemsp == nil { + if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } - computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) computeSystems := []schema1.ContainerProperties{} - if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } @@ -223,16 +197,21 @@ func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerPrope } // Start synchronously starts the computeSystem. -func (computeSystem *System) Start() (err error) { +func (computeSystem *System) Start(ctx context.Context) (err error) { + operation := "hcsshim::System::Start" + + // hcsStartComputeSystemContext is an async operation. Start the outer span + // here to measure the full start time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Start" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } // This is a very simple backoff-retry loop to limit the number @@ -261,13 +240,10 @@ func (computeSystem *System) Start() (err error) { }() } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsStartComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { - return makeSystemError(computeSystem, "Start", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil @@ -278,270 +254,258 @@ func (computeSystem *System) ID() string { return computeSystem.id } -// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Shutdown() (err error) { +// Shutdown requests a compute system shutdown. +func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Shutdown" - computeSystem.logOperationBegin(operation) - defer func() { - if IsAlreadyStopped(err) || IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil { - return makeSystemError(computeSystem, "Shutdown", "", err, events) + resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } -// Terminate requests a compute system terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. -func (computeSystem *System) Terminate() (err error) { +// Terminate requests a compute system terminate. +func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Terminate" - computeSystem.logOperationBegin(operation) - defer func() { - if IsPending(err) { - computeSystem.logOperationEnd(operation, nil) - } else { - computeSystem.logOperationEnd(operation, err) - } - }() + operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + return nil } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) - }) - events := processHcsResult(resultp) - if err != nil && err != ErrVmcomputeAlreadyStopped { - return makeSystemError(computeSystem, "Terminate", "", err, events) + resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") + events := processHcsResult(ctx, resultJSON) + switch err { + case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: + default: + return makeSystemError(computeSystem, operation, "", err, events) } - return nil } // waitBackground waits for the compute system exit notification. Once received -// sets `computeSystem.waitError` (if any) and unblocks all `Wait`, -// `WaitExpectedError`, and `WaitTimeout` calls. +// sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. // -// This MUST be called exactly once per `computeSystem.handle` but `Wait`, -// `WaitExpectedError`, and `WaitTimeout` are safe to call multiple times. +// This MUST be called exactly once per `computeSystem.handle` but `Wait` is +// safe to call multiple times. func (computeSystem *System) waitBackground() { - computeSystem.waitError = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) - close(computeSystem.waitBlock) + operation := "hcsshim::System::waitBackground" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + switch err { + case nil: + log.G(ctx).Debug("system exited") + case ErrVmcomputeUnexpectedExit: + log.G(ctx).Debug("unexpected system exit") + computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) + err = nil + default: + err = makeSystemError(computeSystem, operation, "", err, nil) + } + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = err + close(computeSystem.waitBlock) + }) + oc.SetSpanStatus(span, err) } // Wait synchronously waits for the compute system to shutdown or terminate. If // the compute system has already exited returns the previous error (if any). -func (computeSystem *System) Wait() (err error) { - operation := "hcsshim::ComputeSystem::Wait" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - +func (computeSystem *System) Wait() error { <-computeSystem.waitBlock - if computeSystem.waitError != nil { - return makeSystemError(computeSystem, "Wait", "", computeSystem.waitError, nil) - } - - return nil + return computeSystem.waitError } -// WaitExpectedError synchronously waits for the compute system to shutdown or -// terminate and returns the error (if any) as long as it does not match -// `expected`. If the compute system has already exited returns the previous -// error (if any) as long as it does not match `expected`. -func (computeSystem *System) WaitExpectedError(expected error) (err error) { - operation := "hcsshim::ComputeSystem::WaitExpectedError" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - <-computeSystem.waitBlock - if computeSystem.waitError != nil && getInnerError(computeSystem.waitError) != expected { - return makeSystemError(computeSystem, "WaitExpectedError", "", computeSystem.waitError, nil) - } - return nil -} - -// WaitTimeout synchronously waits for the compute system to terminate or the -// duration to elapse. If the timeout expires, `IsTimeout(err) == true`. If -// the compute system has already exited returns the previous error (if any). -func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) { - operation := "hcsshim::ComputeSystem::WaitTimeout" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - +// ExitError returns an error describing the reason the compute system terminated. +func (computeSystem *System) ExitError() error { select { case <-computeSystem.waitBlock: if computeSystem.waitError != nil { - return makeSystemError(computeSystem, "WaitTimeout", "", computeSystem.waitError, nil) + return computeSystem.waitError } - return nil - case <-time.After(timeout): - return makeSystemError(computeSystem, "WaitTimeout", "", ErrTimeout, nil) + return computeSystem.exitError + default: + return errors.New("container not exited") } } -func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) { +func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Properties" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Properties" - queryj, err := json.Marshal(schema1.PropertyQuery{types}) + queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + return nil, makeSystemError(computeSystem, operation, "", err, nil) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, queryj). - Debug("HCS ComputeSystem Properties Query") - - var resultp, propertiesp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) - }) - events := processHcsResult(resultp) + propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } - if propertiesp == nil { + if propertiesJSON == "" { return nil, ErrUnexpectedValue } - propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) properties := &schema1.ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Pause() (err error) { +func (computeSystem *System) Pause(ctx context.Context) (err error) { + operation := "hcsshim::System::Pause" + + // hcsPauseComputeSystemContext is an async peration. Start the outer span + // here to measure the full pause time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Pause" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { - return makeSystemError(computeSystem, "Pause", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. -func (computeSystem *System) Resume() (err error) { +func (computeSystem *System) Resume(ctx context.Context) (err error) { + operation := "hcsshim::System::Resume" + + // hcsResumeComputeSystemContext is an async operation. Start the outer span + // here to measure the full restore time. + ctx, span := trace.StartSpan(ctx, operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Resume" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp) - }) - events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") + events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { - return makeSystemError(computeSystem, "Resume", "", err, events) + return makeSystemError(computeSystem, operation, "", err, events) } return nil } -// CreateProcess launches a new process within the computeSystem. -func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) { +func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::CreateProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, configuration). - Debug("HCS ComputeSystem Process Document") - - syscallWatcher(computeSystem.logctx, func() { - err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) } - logrus.WithFields(computeSystem.logctx). - WithField(logfields.ProcessID, processInfo.ProcessId). - Debug("HCS ComputeSystem CreateProcess PID") + log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") + return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil +} - process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem) - process.cachedPipes = &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, +// CreateProcessNoStdio launches a new process within the computeSystem. The +// Stdio handles are not cached on the process struct. +func (computeSystem *System) CreateProcessNoStdio(c interface{}) (_ cow.Process, err error) { + operation := "hcsshim::System::CreateProcessNoStdio" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err } + defer func() { + if err != nil { + process.Close() + } + }() - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + // We don't do anything with these handles. Close them so they don't leak. + syscall.Close(processInfo.StdInput) + syscall.Close(processInfo.StdOutput) + syscall.Close(processInfo.StdError) + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + go process.waitBackground() + + return process, nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { + operation := "hcsshim::System::CreateProcess" + process, processInfo, err := computeSystem.createProcess(ctx, operation, c) + if err != nil { + return nil, err + } + defer func() { + if err != nil { + process.Close() + } + }() + + pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + process.stdin = pipes[0] + process.stdout = pipes[1] + process.stderr = pipes[2] + + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } go process.waitBackground() @@ -549,38 +513,25 @@ func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error } // OpenProcess gets an interface to an existing process within the computeSystem. -func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { +func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - // Add PID for the context of this operation - computeSystem.logctx[logfields.ProcessID] = pid - defer delete(computeSystem.logctx, logfields.ProcessID) - - operation := "hcsshim::ComputeSystem::OpenProcess" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - - var ( - processHandle hcsProcess - resultp *uint16 - ) + operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { - return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) - }) - events := processHcsResult(resultp) + processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) + events := processHcsResult(ctx, resultJSON) if err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) - if err = process.registerCallback(); err != nil { - return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + if err = process.registerCallback(ctx); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) } go process.waitBackground() @@ -589,68 +540,72 @@ func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) { // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { + operation := "hcsshim::System::Close" + ctx, span := trace.StartSpan(context.Background(), operation) + defer span.End() + defer func() { oc.SetSpanStatus(span, err) }() + span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) + computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() - operation := "hcsshim::ComputeSystem::Close" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() - // Don't double free this if computeSystem.handle == 0 { return nil } - if err = computeSystem.unregisterCallback(); err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + if err = computeSystem.unregisterCallback(ctx); err != nil { + return makeSystemError(computeSystem, operation, "", err, nil) } - syscallWatcher(computeSystem.logctx, func() { - err = hcsCloseComputeSystem(computeSystem.handle) - }) + err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { - return makeSystemError(computeSystem, "Close", "", err, nil) + return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 + computeSystem.closedWaitOnce.Do(func() { + computeSystem.waitError = ErrAlreadyClosed + close(computeSystem.waitBlock) + }) return nil } -func (computeSystem *System) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), +func (computeSystem *System) registerCallback(ctx context.Context) error { + callbackContext := ¬ifcationWatcherContext{ + channels: newSystemChannels(), + systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ - callbackMap[callbackNumber] = context + callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } - context.handle = callbackHandle + callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } -func (computeSystem *System) unregisterCallback() error { +func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() - context := callbackMap[callbackNumber] + callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() - if context == nil { + if callbackContext == nil { return nil } - handle := context.handle + handle := callbackContext.handle if handle == 0 { return nil @@ -658,12 +613,12 @@ func (computeSystem *System) unregisterCallback() error { // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) + err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } - closeChannels(context.channels) + closeChannels(callbackContext.channels) callbackMapLock.Lock() delete(callbackMap, callbackNumber) @@ -675,36 +630,26 @@ func (computeSystem *System) unregisterCallback() error { } // Modify the System by sending a request to HCS -func (computeSystem *System) Modify(config interface{}) (err error) { +func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() - operation := "hcsshim::ComputeSystem::Modify" - computeSystem.logOperationBegin(operation) - defer func() { computeSystem.logOperationEnd(operation, err) }() + operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { - return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } - requestJSON, err := json.Marshal(config) + requestBytes, err := json.Marshal(config) if err != nil { return err } - requestString := string(requestJSON) - - logrus.WithFields(computeSystem.logctx). - WithField(logfields.JSON, requestString). - Debug("HCS ComputeSystem Modify Document") - - var resultp *uint16 - syscallWatcher(computeSystem.logctx, func() { - err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) - }) - events := processHcsResult(resultp) + requestJSON := string(requestBytes) + resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) + events := processHcsResult(ctx, resultJSON) if err != nil { - return makeSystemError(computeSystem, "Modify", requestString, err, events) + return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index c7d660cc7..f07f532c1 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,25 +1,26 @@ package hcs import ( + "context" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/log" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { - events := processHcsResult(resultp) +func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(ctx, resultJSON) if IsPending(err) { - return nil, waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } -func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { +func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() if _, ok := callbackMap[callbackNumber]; !ok { callbackMapLock.RUnlock() - logrus.Errorf("failed to waitForNotification: callbackNumber %d does not exist in callbackMap", callbackNumber) + log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") return ErrHandleClose } channels := callbackMap[callbackNumber].channels @@ -27,7 +28,7 @@ func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotific expectedChannel := channels[expectedNotification] if expectedChannel == nil { - logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification) + log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go deleted file mode 100644 index f85ed3187..000000000 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go +++ /dev/null @@ -1,41 +0,0 @@ -package hcs - -import ( - "context" - - "github.com/Microsoft/hcsshim/internal/logfields" - "github.com/Microsoft/hcsshim/internal/timeout" - "github.com/sirupsen/logrus" -) - -// syscallWatcher is used as a very simple goroutine around calls into -// the platform. In some cases, we have seen HCS APIs not returning due to -// various bugs, and the goroutine making the syscall ends up not returning, -// prior to its async callback. By spinning up a syscallWatcher, it allows -// us to at least log a warning if a syscall doesn't complete in a reasonable -// amount of time. -// -// Usage is: -// -// syscallWatcher(logContext, func() { -// err = (args...) -// }) -// - -func syscallWatcher(logContext logrus.Fields, syscallLambda func()) { - ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher) - defer cancel() - go watchFunc(ctx, logContext) - syscallLambda() -} - -func watchFunc(ctx context.Context, logContext logrus.Fields) { - select { - case <-ctx.Done(): - if ctx.Err() != context.Canceled { - logrus.WithFields(logContext). - WithField(logfields.Timeout, timeout.SyscallWatcher). - Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") - } - } -} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go index 59ec7004c..6a1c41e15 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -3,6 +3,7 @@ package hns import ( "encoding/json" "net" + "strings" "github.com/sirupsen/logrus" ) @@ -94,6 +95,27 @@ func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return nil, EndpointNotFoundError{EndpointName: endpointName} } +type endpointAttachInfo struct { + SharedContainers json.RawMessage `json:",omitempty"` +} + +func (endpoint *HNSEndpoint) IsAttached(vID string) (bool, error) { + attachInfo := endpointAttachInfo{} + err := hnsCall("GET", "/endpoints/"+endpoint.Id, "", &attachInfo) + + // Return false allows us to just return the err + if err != nil { + return false, err + } + + if strings.Contains(strings.ToLower(string(attachInfo.SharedContainers)), strings.ToLower(vID)) { + return true, nil + } + + return false, nil + +} + // Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { operation := "Create" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 969d1b263..2df4a57f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -9,23 +9,30 @@ import ( "github.com/sirupsen/logrus" ) -func hnsCall(method, path, request string, returnResponse interface{}) error { +func hnsCallRawResponse(method, path, request string) (*hnsResponse, error) { var responseBuffer *uint16 logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request) err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return hcserror.New(err, "hnsCall ", "") + return nil, hcserror.New(err, "hnsCall ", "") } response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { - return err + return nil, err } + return hnsresponse, nil +} +func hnsCall(method, path, request string, returnResponse interface{}) error { + hnsresponse, err := hnsCallRawResponse(method, path, request) + if err != nil { + return fmt.Errorf("failed during hnsCallRawResponse: %v", err) + } if !hnsresponse.Success { - return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error) + return fmt.Errorf("hns failed with error : %s", hnsresponse.Error) } if len(hnsresponse.Output) == 0 { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go index 2f6ec029e..922f7c679 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -15,10 +15,6 @@ func ConvertAndFreeCoTaskMemString(buffer *uint16) string { return str } -func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(ConvertAndFreeCoTaskMemString(buffer)) -} - func Win32FromHresult(hr uintptr) syscall.Errno { if hr&0x1fff0000 == 0x00070000 { return syscall.Errno(hr & 0xffff) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/log/g.go b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go new file mode 100644 index 000000000..ba6b1a4a5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/log/g.go @@ -0,0 +1,23 @@ +package log + +import ( + "context" + + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +// G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` +// contains an OpenCensus `trace.Span`. +func G(ctx context.Context) *logrus.Entry { + span := trace.FromContext(ctx) + if span != nil { + sctx := span.SpanContext() + return logrus.WithFields(logrus.Fields{ + "traceID": sctx.TraceID.String(), + "spanID": sctx.SpanID.String(), + // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? + }) + } + return logrus.NewEntry(logrus.StandardLogger()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go new file mode 100644 index 000000000..f428bdaf7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go @@ -0,0 +1,43 @@ +package oc + +import ( + "github.com/sirupsen/logrus" + "go.opencensus.io/trace" +) + +var _ = (trace.Exporter)(&LogrusExporter{}) + +// LogrusExporter is an OpenCensus `trace.Exporter` that exports +// `trace.SpanData` to logrus output. +type LogrusExporter struct { +} + +// ExportSpan exports `s` based on the the following rules: +// +// 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, +// `s.ParentSpanID` for correlation +// +// 2. Any calls to .Annotate will not be supported. +// +// 3. The span itself will be written at `logrus.InfoLevel` unless +// `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` +// providing `s.Status.Message` as the error value. +func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { + // Combine all span annotations with traceID, spanID, parentSpanID + baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) + baseEntry.Data["traceID"] = s.TraceID.String() + baseEntry.Data["spanID"] = s.SpanID.String() + baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() + baseEntry.Data["startTime"] = s.StartTime + baseEntry.Data["endTime"] = s.EndTime + baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() + baseEntry.Data["name"] = s.Name + baseEntry.Time = s.StartTime + + level := logrus.InfoLevel + if s.Status.Code != 0 { + level = logrus.ErrorLevel + baseEntry.Data[logrus.ErrorKey] = s.Status.Message + } + baseEntry.Log(level, "Span") +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go new file mode 100644 index 000000000..fee4765cb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go @@ -0,0 +1,17 @@ +package oc + +import ( + "go.opencensus.io/trace" +) + +// SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If +// `err` is `nil` assumes `trace.StatusCodeOk`. +func SetSpanStatus(span *trace.Span, err error) { + status := trace.Status{} + if err != nil { + // TODO: JTERRY75 - Handle errors in a non-generic way + status.Code = trace.StatusCodeUnknown + status.Message = err.Error() + } + span.SetStatus(status) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go b/vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go new file mode 100644 index 000000000..6c4a64156 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/regstate/regstate.go @@ -0,0 +1,287 @@ +package regstate + +import ( + "encoding/json" + "fmt" + "net/url" + "os" + "path/filepath" + "reflect" + "syscall" + + "golang.org/x/sys/windows/registry" +) + +//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go regstate.go + +//sys regCreateKeyEx(key syscall.Handle, subkey *uint16, reserved uint32, class *uint16, options uint32, desired uint32, sa *syscall.SecurityAttributes, result *syscall.Handle, disposition *uint32) (regerrno error) = advapi32.RegCreateKeyExW + +const ( + _REG_OPTION_VOLATILE = 1 + + _REG_CREATED_NEW_KEY = 1 + _REG_OPENED_EXISTING_KEY = 2 +) + +type Key struct { + registry.Key + Name string +} + +var localMachine = &Key{registry.LOCAL_MACHINE, "HKEY_LOCAL_MACHINE"} +var localUser = &Key{registry.CURRENT_USER, "HKEY_CURRENT_USER"} + +var rootPath = `SOFTWARE\Microsoft\runhcs` + +type NotFoundError struct { + Id string +} + +func (err *NotFoundError) Error() string { + return fmt.Sprintf("ID '%s' was not found", err.Id) +} + +func IsNotFoundError(err error) bool { + _, ok := err.(*NotFoundError) + return ok +} + +type NoStateError struct { + ID string + Key string +} + +func (err *NoStateError) Error() string { + return fmt.Sprintf("state '%s' is not present for ID '%s'", err.Key, err.ID) +} + +func createVolatileKey(k *Key, path string, access uint32) (newk *Key, openedExisting bool, err error) { + var ( + h syscall.Handle + d uint32 + ) + fullpath := filepath.Join(k.Name, path) + err = regCreateKeyEx(syscall.Handle(k.Key), syscall.StringToUTF16Ptr(path), 0, nil, _REG_OPTION_VOLATILE, access, nil, &h, &d) + if err != nil { + return nil, false, &os.PathError{Op: "RegCreateKeyEx", Path: fullpath, Err: err} + } + return &Key{registry.Key(h), fullpath}, d == _REG_OPENED_EXISTING_KEY, nil +} + +func hive(perUser bool) *Key { + r := localMachine + if perUser { + r = localUser + } + return r +} + +func Open(root string, perUser bool) (*Key, error) { + k, _, err := createVolatileKey(hive(perUser), rootPath, registry.ALL_ACCESS) + if err != nil { + return nil, err + } + defer k.Close() + + k2, _, err := createVolatileKey(k, url.PathEscape(root), registry.ALL_ACCESS) + if err != nil { + return nil, err + } + return k2, nil +} + +func RemoveAll(root string, perUser bool) error { + k, err := hive(perUser).open(rootPath) + if err != nil { + return err + } + defer k.Close() + r, err := k.open(url.PathEscape(root)) + if err != nil { + return err + } + defer r.Close() + ids, err := r.Enumerate() + if err != nil { + return err + } + for _, id := range ids { + err = r.Remove(id) + if err != nil { + return err + } + } + r.Close() + return k.Remove(root) +} + +func (k *Key) Close() error { + err := k.Key.Close() + k.Key = 0 + return err +} + +func (k *Key) Enumerate() ([]string, error) { + escapedIDs, err := k.ReadSubKeyNames(0) + if err != nil { + return nil, err + } + var ids []string + for _, e := range escapedIDs { + id, err := url.PathUnescape(e) + if err == nil { + ids = append(ids, id) + } + } + return ids, nil +} + +func (k *Key) open(name string) (*Key, error) { + fullpath := filepath.Join(k.Name, name) + nk, err := registry.OpenKey(k.Key, name, registry.ALL_ACCESS) + if err != nil { + return nil, &os.PathError{Op: "RegOpenKey", Path: fullpath, Err: err} + } + return &Key{nk, fullpath}, nil +} + +func (k *Key) openid(id string) (*Key, error) { + escaped := url.PathEscape(id) + fullpath := filepath.Join(k.Name, escaped) + nk, err := k.open(escaped) + if perr, ok := err.(*os.PathError); ok && perr.Err == syscall.ERROR_FILE_NOT_FOUND { + return nil, &NotFoundError{id} + } + if err != nil { + return nil, &os.PathError{Op: "RegOpenKey", Path: fullpath, Err: err} + } + return nk, nil +} + +func (k *Key) Remove(id string) error { + escaped := url.PathEscape(id) + err := registry.DeleteKey(k.Key, escaped) + if err != nil { + if err == syscall.ERROR_FILE_NOT_FOUND { + return &NotFoundError{id} + } + return &os.PathError{Op: "RegDeleteKey", Path: filepath.Join(k.Name, escaped), Err: err} + } + return nil +} + +func (k *Key) set(id string, create bool, key string, state interface{}) error { + var sk *Key + var err error + if create { + var existing bool + eid := url.PathEscape(id) + sk, existing, err = createVolatileKey(k, eid, registry.ALL_ACCESS) + if err != nil { + return err + } + defer sk.Close() + if existing { + sk.Close() + return fmt.Errorf("container %s already exists", id) + } + } else { + sk, err = k.openid(id) + if err != nil { + return err + } + defer sk.Close() + } + switch reflect.TypeOf(state).Kind() { + case reflect.Bool: + v := uint32(0) + if state.(bool) { + v = 1 + } + err = sk.SetDWordValue(key, v) + case reflect.Int: + err = sk.SetQWordValue(key, uint64(state.(int))) + case reflect.String: + err = sk.SetStringValue(key, state.(string)) + default: + var js []byte + js, err = json.Marshal(state) + if err != nil { + return err + } + err = sk.SetBinaryValue(key, js) + } + if err != nil { + if err == syscall.ERROR_FILE_NOT_FOUND { + return &NoStateError{id, key} + } + return &os.PathError{Op: "RegSetValueEx", Path: sk.Name + ":" + key, Err: err} + } + return nil +} + +func (k *Key) Create(id, key string, state interface{}) error { + return k.set(id, true, key, state) +} + +func (k *Key) Set(id, key string, state interface{}) error { + return k.set(id, false, key, state) +} + +func (k *Key) Clear(id, key string) error { + sk, err := k.openid(id) + if err != nil { + return err + } + defer sk.Close() + err = sk.DeleteValue(key) + if err != nil { + if err == syscall.ERROR_FILE_NOT_FOUND { + return &NoStateError{id, key} + } + return &os.PathError{Op: "RegDeleteValue", Path: sk.Name + ":" + key, Err: err} + } + return nil +} + +func (k *Key) Get(id, key string, state interface{}) error { + sk, err := k.openid(id) + if err != nil { + return err + } + defer sk.Close() + + var js []byte + switch reflect.TypeOf(state).Elem().Kind() { + case reflect.Bool: + var v uint64 + v, _, err = sk.GetIntegerValue(key) + if err == nil { + *state.(*bool) = v != 0 + } + case reflect.Int: + var v uint64 + v, _, err = sk.GetIntegerValue(key) + if err == nil { + *state.(*int) = int(v) + } + case reflect.String: + var v string + v, _, err = sk.GetStringValue(key) + if err == nil { + *state.(*string) = string(v) + } + default: + js, _, err = sk.GetBinaryValue(key) + } + if err != nil { + if err == syscall.ERROR_FILE_NOT_FOUND { + return &NoStateError{id, key} + } + return &os.PathError{Op: "RegQueryValueEx", Path: sk.Name + ":" + key, Err: err} + } + if js != nil { + err = json.Unmarshal(js, state) + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/regstate/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/regstate/zsyscall_windows.go new file mode 100644 index 000000000..4e349ad49 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/regstate/zsyscall_windows.go @@ -0,0 +1,51 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package regstate + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + + procRegCreateKeyExW = modadvapi32.NewProc("RegCreateKeyExW") +) + +func regCreateKeyEx(key syscall.Handle, subkey *uint16, reserved uint32, class *uint16, options uint32, desired uint32, sa *syscall.SecurityAttributes, result *syscall.Handle, disposition *uint32) (regerrno error) { + r0, _, _ := syscall.Syscall9(procRegCreateKeyExW.Addr(), 9, uintptr(key), uintptr(unsafe.Pointer(subkey)), uintptr(reserved), uintptr(unsafe.Pointer(class)), uintptr(options), uintptr(desired), uintptr(unsafe.Pointer(sa)), uintptr(unsafe.Pointer(result)), uintptr(unsafe.Pointer(disposition))) + if r0 != 0 { + regerrno = syscall.Errno(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go new file mode 100644 index 000000000..2f39e5845 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/container.go @@ -0,0 +1,71 @@ +package runhcs + +import ( + "bytes" + "errors" + "fmt" + "io" + "io/ioutil" + "os" + "syscall" + "time" + + "github.com/Microsoft/go-winio/pkg/guid" +) + +// ContainerState represents the platform agnostic pieces relating to a +// running container's status and state +type ContainerState struct { + // Version is the OCI version for the container + Version string `json:"ociVersion"` + // ID is the container ID + ID string `json:"id"` + // InitProcessPid is the init process id in the parent namespace + InitProcessPid int `json:"pid"` + // Status is the current status of the container, running, paused, ... + Status string `json:"status"` + // Bundle is the path on the filesystem to the bundle + Bundle string `json:"bundle"` + // Rootfs is a path to a directory containing the container's root filesystem. + Rootfs string `json:"rootfs"` + // Created is the unix timestamp for the creation time of the container in UTC + Created time.Time `json:"created"` + // Annotations is the user defined annotations added to the config. + Annotations map[string]string `json:"annotations,omitempty"` + // The owner of the state directory (the owner of the container). + Owner string `json:"owner"` +} + +// GetErrorFromPipe returns reads from `pipe` and verifies if the operation +// returned success or error. If error converts that to an error and returns. If +// `p` is not nill will issue a `Kill` and `Wait` for exit. +func GetErrorFromPipe(pipe io.Reader, p *os.Process) error { + serr, err := ioutil.ReadAll(pipe) + if err != nil { + return err + } + + if bytes.Equal(serr, ShimSuccess) { + return nil + } + + extra := "" + if p != nil { + p.Kill() + state, err := p.Wait() + if err != nil { + panic(err) + } + extra = fmt.Sprintf(", exit code %d", state.Sys().(syscall.WaitStatus).ExitCode) + } + if len(serr) == 0 { + return fmt.Errorf("unknown shim failure%s", extra) + } + + return errors.New(string(serr)) +} + +// VMPipePath returns the named pipe path for the vm shim. +func VMPipePath(hostUniqueID guid.GUID) string { + return SafePipePath("runhcs-vm-" + hostUniqueID.String()) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/util.go b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/util.go new file mode 100644 index 000000000..dcbb1903b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/util.go @@ -0,0 +1,16 @@ +package runhcs + +import "net/url" + +const ( + SafePipePrefix = `\\.\pipe\ProtectedPrefix\Administrators\` +) + +// ShimSuccess is the byte stream returned on a successful operation. +var ShimSuccess = []byte{0, 'O', 'K', 0} + +func SafePipePath(name string) string { + // Use a pipe in the Administrators protected prefixed to prevent malicious + // squatting. + return SafePipePrefix + url.PathEscape(name) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/runhcs/vm.go b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/vm.go new file mode 100644 index 000000000..2c8957b88 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/runhcs/vm.go @@ -0,0 +1,43 @@ +package runhcs + +import ( + "encoding/json" + + "github.com/Microsoft/go-winio" +) + +// VMRequestOp is an operation that can be issued to a VM shim. +type VMRequestOp string + +const ( + // OpCreateContainer is a create container request. + OpCreateContainer VMRequestOp = "create" + // OpSyncNamespace is a `cni.NamespaceTypeGuest` sync request with the UVM. + OpSyncNamespace VMRequestOp = "sync" + // OpUnmountContainer is a container unmount request. + OpUnmountContainer VMRequestOp = "unmount" + // OpUnmountContainerDiskOnly is a container unmount disk request. + OpUnmountContainerDiskOnly VMRequestOp = "unmount-disk" +) + +// VMRequest is an operation request that is issued to a VM shim. +type VMRequest struct { + ID string + Op VMRequestOp +} + +// IssueVMRequest issues a request to a shim at the given pipe. +func IssueVMRequest(pipepath string, req *VMRequest) error { + pipe, err := winio.DialPipe(pipepath, nil) + if err != nil { + return err + } + defer pipe.Close() + if err := json.NewEncoder(pipe).Encode(req); err != nil { + return err + } + if err := GetErrorFromPipe(pipe, nil); err != nil { + return err + } + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go index 995433ace..fb23617f5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -4,7 +4,8 @@ import ( "encoding/json" "time" - "github.com/Microsoft/hcsshim/internal/schema2" + "github.com/Microsoft/go-winio/pkg/guid" + hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // ProcessConfig is used as both the input of Container.CreateProcess @@ -62,7 +63,7 @@ type MappedVirtualDisk struct { CreateInUtilityVM bool `json:",omitempty"` ReadOnly bool `json:",omitempty"` Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` + AttachOnly bool `json:",omitempty"` } // AssignedDevice represents a device that has been directly assigned to a container @@ -133,9 +134,10 @@ type ContainerProperties struct { State string Name string SystemType string + RuntimeOSType string `json:"RuntimeOsType,omitempty"` Owner string SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` + RuntimeID guid.GUID `json:"RuntimeId,omitempty"` IsRuntimeTemplate bool `json:",omitempty"` RuntimeImagePath string `json:",omitempty"` Stopped bool `json:",omitempty"` @@ -214,6 +216,7 @@ type MappedVirtualDiskController struct { type GuestDefinedCapabilities struct { NamespaceAddRequestSupported bool `json:",omitempty"` SignalProcessSupported bool `json:",omitempty"` + DumpStacksSupported bool `json:",omitempty"` } // GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go index 09456cbc2..bcfeb34d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -10,7 +10,6 @@ package hcsschema type Attachment struct { - Type_ string `json:"Type,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go index 243779eab..c1ea3953b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -10,7 +10,6 @@ package hcsschema type CacheQueryStatsResponse struct { - L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go index 88f01707a..b4f9c315b 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -10,6 +10,5 @@ package hcsschema type CloseHandle struct { - Handle string `json:"Handle,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go index c665be3d5..8bf8cab60 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -11,7 +11,6 @@ package hcsschema // ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. type ComPort struct { - NamedPipe string `json:"NamedPipe,omitempty"` OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go index 85785d285..10cea67e0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -10,14 +10,13 @@ package hcsschema type ComputeSystem struct { - Owner string `json:"Owner,omitempty"` SchemaVersion *Version `json:"SchemaVersion,omitempty"` HostingSystemId string `json:"HostingSystemId,omitempty"` - HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + HostedSystem interface{} `json:"HostedSystem,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go index 1a47db7d9..1d5dfe68a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -25,37 +25,37 @@ func (c contextKey) String() string { var ( // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. - ContextOAuth2 = contextKey("token") + ContextOAuth2 = contextKey("token") // ContextBasicAuth takes BasicAuth as authentication for the request. - ContextBasicAuth = contextKey("basic") + ContextBasicAuth = contextKey("basic") // ContextAccessToken takes a string oauth2 access token as authentication for the request. - ContextAccessToken = contextKey("accesstoken") + ContextAccessToken = contextKey("accesstoken") // ContextAPIKey takes an APIKey as authentication for the request - ContextAPIKey = contextKey("apikey") + ContextAPIKey = contextKey("apikey") ) -// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth type BasicAuth struct { - UserName string `json:"userName,omitempty"` - Password string `json:"password,omitempty"` + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` } // APIKey provides API key based authentication to a request passed via context using ContextAPIKey type APIKey struct { - Key string - Prefix string + Key string + Prefix string } type Configuration struct { - BasePath string `json:"basePath,omitempty"` - Host string `json:"host,omitempty"` - Scheme string `json:"scheme,omitempty"` - DefaultHeader map[string]string `json:"defaultHeader,omitempty"` - UserAgent string `json:"userAgent,omitempty"` - HTTPClient *http.Client + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client } func NewConfiguration() *Configuration { @@ -69,4 +69,4 @@ func NewConfiguration() *Configuration { func (c *Configuration) AddDefaultHeader(key string, value string) { c.DefaultHeader[key] = value -} \ No newline at end of file +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go index adbe07fe5..68aa04a57 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -10,7 +10,6 @@ package hcsschema type ConsoleSize struct { - Height int32 `json:"Height,omitempty"` Width int32 `json:"Width,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go index 17dce28bc..4fb231076 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -10,7 +10,6 @@ package hcsschema type Container struct { - GuestOs *GuestOs `json:"GuestOs,omitempty"` Storage *Storage `json:"Storage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go index 754797e21..1fd7ca5d5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -11,7 +11,6 @@ package hcsschema // memory usage as viewed from within the container type ContainerMemoryInformation struct { - TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` TotalUsage int32 `json:"TotalUsage,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go index b2191c571..781a88401 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -10,7 +10,6 @@ package hcsschema type Devices struct { - ComPorts map[string]ComPort `json:"ComPorts,omitempty"` Scsi map[string]Scsi `json:"Scsi,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go index 4fe592f71..85450c41e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -10,6 +10,5 @@ package hcsschema type EnhancedModeVideo struct { - ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go index 51011afe4..fe86cab65 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -10,7 +10,6 @@ package hcsschema type FlexibleIoDevice struct { - EmulatorId string `json:"EmulatorId,omitempty"` HostingModel string `json:"HostingModel,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go index c5fa76735..af8280048 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -10,6 +10,5 @@ package hcsschema type GuestCrashReporting struct { - WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go index c708fc7c3..8838519a3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -10,6 +10,5 @@ package hcsschema type GuestOs struct { - HostName string `json:"HostName,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go index 0797584c5..ea3084bca 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -10,7 +10,6 @@ package hcsschema type HostedSystem struct { - SchemaVersion *Version `json:"SchemaVersion,omitempty"` Container *Container `json:"Container,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go index ef9ffb8dd..23b2ee9e7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -10,7 +10,6 @@ package hcsschema type HvSocket struct { - Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go index a19ba15c1..a017691f0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -11,6 +11,5 @@ package hcsschema // HvSocket configuration for a VM type HvSocket2 struct { - HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go index b63b8ef12..176c49d49 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -10,7 +10,6 @@ package hcsschema type Layer struct { - Id string `json:"Id,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go index a823a6d3b..9b86a4045 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -10,7 +10,6 @@ package hcsschema type MappedDirectory struct { - HostPath string `json:"HostPath,omitempty"` HostPathType string `json:"HostPathType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go index 2d1d2604a..208074e9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -10,7 +10,6 @@ package hcsschema type MappedPipe struct { - ContainerPipeName string `json:"ContainerPipeName,omitempty"` HostPath string `json:"HostPath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go index e1d135a3a..ec93d004e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -10,6 +10,5 @@ package hcsschema type Memory struct { - SizeInMB int32 `json:"SizeInMB,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go index bdd87dffd..b2c2a05a0 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -10,7 +10,6 @@ package hcsschema type MemoryInformationForVm struct { - VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go index 6214970f6..625bc8bbe 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -11,7 +11,6 @@ package hcsschema // Memory runtime statistics type MemoryStats struct { - MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go index c586f66c2..a9c750b34 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -10,7 +10,6 @@ package hcsschema type NetworkAdapter struct { - EndpointId string `json:"EndpointId,omitempty"` MacAddress string `json:"MacAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go index 12c47827c..e5ea187a2 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -10,7 +10,6 @@ package hcsschema type Networking struct { - AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` DnsSearchList string `json:"DnsSearchList,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go index 1cd70d179..d96c9501f 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -11,6 +11,5 @@ package hcsschema // Notification data that is indicated to components running in the Virtual Machine. type PauseNotification struct { - Reason string `json:"Reason,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go index 780a5cae2..21707a88e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -11,7 +11,6 @@ package hcsschema // Options for HcsPauseComputeSystem type PauseOptions struct { - SuspensionLevel string `json:"SuspensionLevel,omitempty"` HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go index 705c677e1..29d8c8012 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -10,6 +10,5 @@ package hcsschema type Plan9 struct { - Shares []Plan9Share `json:"Shares,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go index 63e0b7f8f..e9a662dd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -15,7 +15,6 @@ import ( // Information about a process running in a container type ProcessDetails struct { - ProcessId int32 `json:"ProcessId,omitempty"` ImageName string `json:"ImageName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go index 29bc2e3d0..e4ed095c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -11,7 +11,6 @@ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { - Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go index 470c55734..82b0d0532 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -10,7 +10,6 @@ package hcsschema type ProcessParameters struct { - ApplicationName string `json:"ApplicationName,omitempty"` CommandLine string `json:"CommandLine,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go index 20793d150..ad9a4fa9a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -11,7 +11,6 @@ package hcsschema // Status of a process running in a container type ProcessStatus struct { - ProcessId int32 `json:"ProcessId,omitempty"` Exited bool `json:"Exited,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go index 7a60b0245..bb24e88da 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -10,7 +10,6 @@ package hcsschema type Processor struct { - Count int32 `json:"Count,omitempty"` Maximum int32 `json:"Maximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go index 40d3e7356..21fe46062 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -10,7 +10,6 @@ package hcsschema type Processor2 struct { - Count int32 `json:"Count,omitempty"` Limit int32 `json:"Limit,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go index 9d3b77e57..41f83a545 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -11,7 +11,6 @@ package hcsschema // CPU runtime statistics type ProcessorStats struct { - TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go index 6db2a48f6..ac7f87000 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -10,7 +10,6 @@ package hcsschema type Properties struct { - Id string `json:"Id,omitempty"` SystemType string `json:"SystemType,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go index 22b92ffdf..877e13503 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -9,8 +9,7 @@ package hcsschema -// By default the basic properties will be returned. This query provides a way to request specific properties. +// By default the basic properties will be returned. This query provides a way to request specific properties. type PropertyQuery struct { - PropertyTypes []string `json:"PropertyTypes,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go index 97e453128..8d5f5c171 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -10,7 +10,6 @@ package hcsschema type RdpConnectionOptions struct { - AccessSids []string `json:"AccessSids,omitempty"` NamedPipe string `json:"NamedPipe,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go index fa574ccc8..006906f6e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -10,7 +10,6 @@ package hcsschema type RegistryChanges struct { - AddValues []RegistryValue `json:"AddValues,omitempty"` DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go index fab03bc60..26fde99c7 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -10,7 +10,6 @@ package hcsschema type RegistryKey struct { - Hive string `json:"Hive,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go index 1589f4841..3f203176c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -10,7 +10,6 @@ package hcsschema type RegistryValue struct { - Key *RegistryKey `json:"Key,omitempty"` Name string `json:"Name,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go index bd573f6cd..df9baa921 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -10,6 +10,5 @@ package hcsschema type SharedMemoryConfiguration struct { - Regions []SharedMemoryRegion `json:"Regions,omitempty"` } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go index a57b2cba7..825b71865 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegion struct { - SectionName string `json:"SectionName,omitempty"` StartOffset int32 `json:"StartOffset,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go index d9a50cc7d..f67b08eb5 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -10,7 +10,6 @@ package hcsschema type SharedMemoryRegionInfo struct { - SectionName string `json:"SectionName,omitempty"` GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go index 599c06e8a..5eaf6a7f4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -11,7 +11,6 @@ package hcsschema // Silo job information type SiloProperties struct { - Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go index 5cb3ed93b..aedcd1c16 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -15,7 +15,6 @@ import ( // Runtime statistics for a container type Statistics struct { - Timestamp time.Time `json:"Timestamp,omitempty"` ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go index 8c5255df1..9c5e6eb53 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -10,7 +10,6 @@ package hcsschema type StorageQoS struct { - IopsMaximum int32 `json:"IopsMaximum,omitempty"` BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go index 198ea57d7..092ed6605 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -11,7 +11,6 @@ package hcsschema // Storage runtime statistics type StorageStats struct { - ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go index af2e3c823..834869940 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -10,7 +10,6 @@ package hcsschema type Topology struct { - Memory *Memory2 `json:"Memory,omitempty"` Processor *Processor2 `json:"Processor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go index ba91178f9..0e48ece50 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -10,7 +10,6 @@ package hcsschema type Uefi struct { - EnableDebugger bool `json:"EnableDebugger,omitempty"` SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go index 6620fb2bc..3ab409d82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -10,7 +10,6 @@ package hcsschema type UefiBootEntry struct { - DeviceType string `json:"DeviceType,omitempty"` DevicePath string `json:"DevicePath,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go index 62c0e4d12..2abfccca3 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -10,7 +10,6 @@ package hcsschema type Version struct { - Major int32 `json:"Major,omitempty"` Minor int32 `json:"Minor,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go index 0958e5606..ec5d0fb93 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -10,7 +10,6 @@ package hcsschema type VideoMonitor struct { - HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` VerticalResolution int32 `json:"VerticalResolution,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go index 48402d8ec..91a3c83d4 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -10,7 +10,6 @@ package hcsschema type VirtualNodeInfo struct { - VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go index 47714444a..70cf2d90d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -10,7 +10,6 @@ package hcsschema type VirtualPMemDevice struct { - HostPath string `json:"HostPath,omitempty"` ReadOnly bool `json:"ReadOnly,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go index 76131b3a7..362df363e 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmb struct { - Shares []VirtualSmbShare `json:"Shares,omitempty"` DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go index b50098a42..915e9b638 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShare struct { - Name string `json:"Name,omitempty"` Path string `json:"Path,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go index c1894279d..75196bd8c 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -10,7 +10,6 @@ package hcsschema type VirtualSmbShareOptions struct { - ReadOnly bool `json:"ReadOnly,omitempty"` // convert exclusive access to shared read access diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go index 39f628667..6a09c0310 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -10,7 +10,6 @@ package hcsschema type VmMemory struct { - AvailableMemory int32 `json:"AvailableMemory,omitempty"` AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go index cf632bbc8..8ed7e566d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -10,7 +10,6 @@ package hcsschema type WindowsCrashReporting struct { - DumpFileName string `json:"DumpFileName,omitempty"` MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` diff --git a/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go new file mode 100644 index 000000000..9e4f9d42b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go @@ -0,0 +1,563 @@ +package vmcompute + +import ( + gcontext "context" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/log" + "github.com/Microsoft/hcsshim/internal/logfields" + "github.com/Microsoft/hcsshim/internal/oc" + "github.com/Microsoft/hcsshim/internal/timeout" + "go.opencensus.io/trace" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? +//sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +// errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously +const errVmcomputeOperationPending = syscall.Errno(0xC0370103) + +// HcsSystem is the handle associated with a created compute system. +type HcsSystem syscall.Handle + +// HcsProcess is the handle associated with a created process in a compute +// system. +type HcsProcess syscall.Handle + +// HcsCallback is the handle associated with the function to call when events +// occur. +type HcsCallback syscall.Handle + +// HcsProcessInformation is the structure used when creating or getting process +// info. +type HcsProcessInformation struct { + // ProcessId is the pid of the created process. + ProcessId uint32 + reserved uint32 + // StdInput is the handle associated with the stdin of the process. + StdInput syscall.Handle + // StdOutput is the handle associated with the stdout of the process. + StdOutput syscall.Handle + // StdError is the handle associated with the stderr of the process. + StdError syscall.Handle +} + +func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { + if timeout > 0 { + var cancel gcontext.CancelFunc + ctx, cancel = gcontext.WithTimeout(ctx, timeout) + defer cancel() + } + + done := make(chan error, 1) + go func() { + done <- f() + }() + select { + case <-ctx.Done(): + if ctx.Err() == gcontext.DeadlineExceeded { + log.G(ctx).WithField(logfields.Timeout, timeout). + Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") + } + return ctx.Err() + case err := <-done: + return err + } +} + +func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("query", query)) + + return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + computeSystemsp *uint16 + resultp *uint16 + ) + err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + if computeSystemsp != nil { + computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes( + trace.StringAttribute("id", id), + trace.StringAttribute("configuration", configuration)) + + return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { + var resultp *uint16 + err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenComputeSystem(id, &computeSystem, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseComputeSystem(computeSystem) + }) +} + +func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemStart, func() error { + var resultp *uint16 + err := hcsStartComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsShutdownComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemPause, func() error { + var resultp *uint16 + err := hcsPauseComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + if hr != errVmcomputeOperationPending { + oc.SetSpanStatus(span, hr) + } + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SystemResume, func() error { + var resultp *uint16 + err := hcsResumeComputeSystem(computeSystem, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("configuration", configuration)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterComputeSystemCallback(callbackHandle) + }) +} + +func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) + + return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) + + return process, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsOpenProcess(computeSystem, pid, &process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsCloseProcess(process) + }) +} + +func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsTerminateProcess(process, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("options", options)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsSignalProcess(process, options, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsGetProcessInfo(process, &processInformation, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + + return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + processPropertiesp *uint16 + resultp *uint16 + ) + err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) + if processPropertiesp != nil { + processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("settings", settings)) + + return result, execute(ctx, timeout.SyscallWatcher, func() error { + var resultp *uint16 + err := hcsModifyProcess(process, settings, &resultp) + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") + defer span.End() + defer func() { + if result != "" { + span.AddAttributes(trace.StringAttribute("result", result)) + } + oc.SetSpanStatus(span, hr) + }() + span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) + + return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { + var ( + propertiesp *uint16 + resultp *uint16 + ) + err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) + if propertiesp != nil { + properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) + } + if resultp != nil { + result = interop.ConvertAndFreeCoTaskMemString(resultp) + } + return err + }) +} + +func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { + ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { + return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) + }) +} + +func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { + ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") + defer span.End() + defer func() { oc.SetSpanStatus(span, hr) }() + + return execute(ctx, timeout.SyscallWatcher, func() error { + return hcsUnregisterProcessCallback(callbackHandle) + }) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go similarity index 81% rename from vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go rename to vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go index fcd5cdc87..0f2a69f6a 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go @@ -1,6 +1,6 @@ // Code generated mksyscall_windows.exe DO NOT EDIT -package hcs +package vmcompute import ( "syscall" @@ -56,13 +56,13 @@ var ( procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") + procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { @@ -88,7 +88,7 @@ func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result return } -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -102,7 +102,7 @@ func hcsCreateComputeSystem(id string, configuration string, identity syscall.Ha return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } @@ -116,7 +116,7 @@ func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall return } -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { +func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { @@ -125,7 +125,7 @@ func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) return _hcsOpenComputeSystem(_p0, computeSystem, result) } -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { +func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } @@ -139,7 +139,7 @@ func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16 return } -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { +func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } @@ -153,7 +153,7 @@ func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { return } -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -162,7 +162,7 @@ func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsStartComputeSystem(computeSystem, _p0, result) } -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } @@ -176,7 +176,7 @@ func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -185,7 +185,7 @@ func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result ** return _hcsShutdownComputeSystem(computeSystem, _p0, result) } -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } @@ -199,7 +199,7 @@ func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -208,7 +208,7 @@ func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result * return _hcsTerminateComputeSystem(computeSystem, _p0, result) } -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } @@ -222,7 +222,7 @@ func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result return } -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -231,7 +231,7 @@ func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uin return _hcsPauseComputeSystem(computeSystem, _p0, result) } -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } @@ -245,7 +245,7 @@ func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **u return } -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { +func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -254,7 +254,7 @@ func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **ui return _hcsResumeComputeSystem(computeSystem, _p0, result) } -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { +func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } @@ -268,7 +268,7 @@ func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result ** return } -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { +func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { @@ -277,7 +277,7 @@ func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { +func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } @@ -291,7 +291,7 @@ func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint return } -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { +func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { @@ -300,7 +300,7 @@ func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, resul return _hcsModifyComputeSystem(computeSystem, _p0, result) } -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { +func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } @@ -314,7 +314,7 @@ func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, res return } -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } @@ -328,7 +328,7 @@ func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, return } -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } @@ -342,7 +342,7 @@ func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { return } -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { @@ -351,7 +351,7 @@ func hcsCreateProcess(computeSystem hcsSystem, processParameters string, process return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { +func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } @@ -365,7 +365,7 @@ func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, proce return } -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { +func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } @@ -379,7 +379,7 @@ func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, re return } -func hcsCloseProcess(process hcsProcess) (hr error) { +func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } @@ -393,7 +393,7 @@ func hcsCloseProcess(process hcsProcess) (hr error) { return } -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { +func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } @@ -407,7 +407,7 @@ func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { return } -func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { +func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { @@ -416,11 +416,11 @@ func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr e return _hcsSignalProcess(process, _p0, result) } -func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { +func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsSignalProcess.Find(); hr != nil { return } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff @@ -430,7 +430,7 @@ func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr return } -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { +func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } @@ -444,7 +444,7 @@ func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInforma return } -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { +func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } @@ -458,7 +458,7 @@ func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, res return } -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { +func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { @@ -467,7 +467,7 @@ func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr return _hcsModifyProcess(process, _p0, result) } -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { +func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } @@ -504,7 +504,7 @@ func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result return } -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { +func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } @@ -518,7 +518,7 @@ func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context ui return } -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { +func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go index 90df3bedc..443596fba 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -3,7 +3,7 @@ package wclayer import ( "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" ) // LayerID returns the layer ID of a layer on disk. diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index 6d0ae8a07..06671309d 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -6,7 +6,7 @@ package wclayer import ( "syscall" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go index 45a63cf65..a259c1b82 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -1,7 +1,7 @@ package wclayer import ( - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go index 78f2aacd8..04cb4e7ab 100644 --- a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -1,6 +1,6 @@ package wclayer -import "github.com/Microsoft/hcsshim/internal/guid" +import "github.com/Microsoft/go-winio/pkg/guid" //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go wclayer.go diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go index df0e63bbd..f60ba5501 100644 --- a/vendor/github.com/Microsoft/hcsshim/layer.go +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -4,7 +4,7 @@ import ( "crypto/sha1" "path/filepath" - "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) @@ -77,7 +77,7 @@ type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(name) - return GUID(g), err + return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { @@ -88,7 +88,7 @@ func NewGUID(source string) *GUID { } func (g *GUID) ToString() string { - return (guid.GUID)(*g).String() + return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index ca8acbb7c..3362c6833 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,7 +1,9 @@ package hcsshim import ( + "context" "io" + "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" @@ -9,7 +11,10 @@ import ( // ContainerError is an error encountered in HCS type process struct { - p *hcs.Process + p *hcs.Process + waitOnce sync.Once + waitCh chan struct{} + waitErr error } // Pid returns the process ID of the process within the container. @@ -19,7 +24,14 @@ func (process *process) Pid() int { // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - return convertProcessError(process.p.Kill(), process) + found, err := process.p.Kill(context.Background()) + if err != nil { + return convertProcessError(err, process) + } + if !found { + return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} + } + return nil } // Wait waits for the process to exit. @@ -30,7 +42,21 @@ func (process *process) Wait() error { // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - return convertProcessError(process.p.WaitTimeout(timeout), process) + process.waitOnce.Do(func() { + process.waitCh = make(chan struct{}) + go func() { + process.waitErr = process.Wait() + close(process.waitCh) + }() + }) + t := time.NewTimer(timeout) + defer t.Stop() + select { + case <-t.C: + return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} + case <-process.waitCh: + return process.waitErr + } } // ExitCode returns the exit code of the process. The process must have @@ -45,14 +71,14 @@ func (process *process) ExitCode() (int, error) { // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - return convertProcessError(process.p.ResizeConsole(width, height), process) + return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - stdin, stdout, stderr, err := process.p.Stdio() + stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } @@ -62,7 +88,7 @@ func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, e // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - return convertProcessError(process.p.CloseStdin(), process) + return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill diff --git a/vendor/github.com/Microsoft/hcsshim/vendor.conf b/vendor/github.com/Microsoft/hcsshim/vendor.conf deleted file mode 100644 index bb25ae707..000000000 --- a/vendor/github.com/Microsoft/hcsshim/vendor.conf +++ /dev/null @@ -1,33 +0,0 @@ -github.com/blang/semver v3.1.0 -github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 -github.com/containerd/containerd faec567304bbdf6864b1663d4f813641b5880a4a -github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 -github.com/containerd/ttrpc 2a805f71863501300ae1976d29f0454ae003e85a -github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40 -github.com/gogo/protobuf v1.0.0 -github.com/golang/protobuf v1.1.0 -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f -github.com/konsorten/go-windows-terminal-sequences v1.0.1 -github.com/linuxkit/virtsock 8e79449dea0735c1c056d814934dd035734cc97c -github.com/Microsoft/go-winio c599b533b43b1363d7d7c6cfda5ede70ed73ff13 -github.com/Microsoft/opengcs v0.3.9 -github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7 -github.com/opencontainers/runc 12f6a991201fdb8f82579582d5e00e28fba06d0a -github.com/opencontainers/runtime-spec 29686dbc5559d93fb1ef402eeda3e35c38d75af4 -github.com/opencontainers/runtime-tools 1d69bd0f9c39677d0630e50664fbc3154ae61b88 -github.com/pkg/errors v0.8.1 -github.com/sirupsen/logrus v1.3.0 -github.com/syndtr/gocapability db04d3cc01c8b54962a58ec7e491717d06cfcc16 -github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c -github.com/xeipuuv/gojsonpointer 4e3ac2762d5f479393488629ee9370b50873b3a6 -github.com/xeipuuv/gojsonreference bd5ef7bd5415a7ac448318e64f11a24cd21e594b -github.com/xeipuuv/gojsonschema 1d523034197ff1f222f6429836dd36a2457a1874 -golang.org/x/crypto ff983b9c42bc9fbf91556e191cc8efb585c16908 -golang.org/x/net ed066c81e75eba56dd9bd2139ade88125b855585 -golang.org/x/sync 37e7f081c4d4c64e13b10787722085407fe5d15f -golang.org/x/sys e5ecc2a6747ce8d4af18ed98b3de5ae30eb3a5bb -golang.org/x/text d14c52b222ee852cdba8b07206ca0c614b389876 -google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944 -google.golang.org/grpc v1.12.0 -k8s.io/kubernetes v1.13.0 diff --git a/vendor/github.com/containerd/containerd/archive/tar.go b/vendor/github.com/containerd/containerd/archive/tar.go index fae023c55..7ec465756 100644 --- a/vendor/github.com/containerd/containerd/archive/tar.go +++ b/vendor/github.com/containerd/containerd/archive/tar.go @@ -19,9 +19,7 @@ package archive import ( "archive/tar" "context" - "fmt" "io" - "io/ioutil" "os" "path/filepath" "runtime" @@ -91,11 +89,6 @@ const ( // archives. whiteoutMetaPrefix = whiteoutPrefix + whiteoutPrefix - // whiteoutLinkDir is a directory AUFS uses for storing hardlink links to other - // layers. Normally these should not go into exported archives and all changed - // hardlinks should be copied to the top layer. - whiteoutLinkDir = whiteoutMetaPrefix + "plnk" - // whiteoutOpaqueDir file means directory has been made opaque - meaning // readdir calls to this directory do not follow to lower layers. whiteoutOpaqueDir = whiteoutMetaPrefix + ".opq" @@ -117,11 +110,15 @@ func Apply(ctx context.Context, root string, r io.Reader, opts ...ApplyOpt) (int if options.Filter == nil { options.Filter = all } + if options.applyFunc == nil { + options.applyFunc = applyNaive + } - return apply(ctx, root, tar.NewReader(r), options) + return options.applyFunc(ctx, root, tar.NewReader(r), options) } -// applyNaive applies a tar stream of an OCI style diff tar. +// applyNaive applies a tar stream of an OCI style diff tar to a directory +// applying each file as either a whole file or whiteout. // See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { var ( @@ -131,11 +128,49 @@ func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyO // may occur out of order unpackedPaths = make(map[string]struct{}) - // Used for aufs plink directory - aufsTempdir = "" - aufsHardlinks = make(map[string]*tar.Header) + convertWhiteout = options.ConvertWhiteout ) + if convertWhiteout == nil { + // handle whiteouts by removing the target files + convertWhiteout = func(hdr *tar.Header, path string) (bool, error) { + base := filepath.Base(path) + dir := filepath.Dir(path) + if base == whiteoutOpaqueDir { + _, err := os.Lstat(dir) + if err != nil { + return false, err + } + err = filepath.Walk(dir, func(path string, info os.FileInfo, err error) error { + if err != nil { + if os.IsNotExist(err) { + err = nil // parent was deleted + } + return err + } + if path == dir { + return nil + } + if _, exists := unpackedPaths[path]; !exists { + err := os.RemoveAll(path) + return err + } + return nil + }) + return false, err + } + + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + return false, os.RemoveAll(originalPath) + } + + return true, nil + } + } + // Iterate through the files in the archive. for { select { @@ -193,85 +228,21 @@ func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyO if base == "" { parentPath = filepath.Dir(path) } - if _, err := os.Lstat(parentPath); err != nil && os.IsNotExist(err) { - err = mkdirAll(parentPath, 0755) - if err != nil { - return 0, err - } - } - } - - // Skip AUFS metadata dirs - if strings.HasPrefix(hdr.Name, whiteoutMetaPrefix) { - // Regular files inside /.wh..wh.plnk can be used as hardlink targets - // We don't want this directory, but we need the files in them so that - // such hardlinks can be resolved. - if strings.HasPrefix(hdr.Name, whiteoutLinkDir) && hdr.Typeflag == tar.TypeReg { - basename := filepath.Base(hdr.Name) - aufsHardlinks[basename] = hdr - if aufsTempdir == "" { - if aufsTempdir, err = ioutil.TempDir(os.Getenv("XDG_RUNTIME_DIR"), "dockerplnk"); err != nil { - return 0, err - } - defer os.RemoveAll(aufsTempdir) - } - p, err := fs.RootPath(aufsTempdir, basename) - if err != nil { - return 0, err - } - if err := createTarFile(ctx, p, root, hdr, tr); err != nil { - return 0, err - } - } - - if hdr.Name != whiteoutOpaqueDir { - continue - } - } - - if strings.HasPrefix(base, whiteoutPrefix) { - dir := filepath.Dir(path) - if base == whiteoutOpaqueDir { - _, err := os.Lstat(dir) - if err != nil { - return 0, err - } - err = filepath.Walk(dir, func(path string, info os.FileInfo, err error) error { - if err != nil { - if os.IsNotExist(err) { - err = nil // parent was deleted - } - return err - } - if path == dir { - return nil - } - if _, exists := unpackedPaths[path]; !exists { - err := os.RemoveAll(path) - return err - } - return nil - }) - if err != nil { - return 0, err - } - continue - } - - originalBase := base[len(whiteoutPrefix):] - originalPath := filepath.Join(dir, originalBase) - - // Ensure originalPath is under dir - if dir[len(dir)-1] != filepath.Separator { - dir += string(filepath.Separator) - } - if !strings.HasPrefix(originalPath, dir) { - return 0, errors.Wrapf(errInvalidArchive, "invalid whiteout name: %v", base) - } - - if err := os.RemoveAll(originalPath); err != nil { + if err := mkparent(ctx, parentPath, root, options.Parents); err != nil { return 0, err } + } + + // Naive whiteout convert function which handles whiteout files by + // removing the target files. + if err := validateWhiteout(path); err != nil { + return 0, err + } + writeFile, err := convertWhiteout(hdr, path) + if err != nil { + return 0, errors.Wrapf(err, "failed to convert whiteout file %q", hdr.Name) + } + if !writeFile { continue } // If path exits we almost always just want to remove and replace it. @@ -289,26 +260,6 @@ func applyNaive(ctx context.Context, root string, tr *tar.Reader, options ApplyO srcData := io.Reader(tr) srcHdr := hdr - // Hard links into /.wh..wh.plnk don't work, as we don't extract that directory, so - // we manually retarget these into the temporary files we extracted them into - if hdr.Typeflag == tar.TypeLink && strings.HasPrefix(filepath.Clean(hdr.Linkname), whiteoutLinkDir) { - linkBasename := filepath.Base(hdr.Linkname) - srcHdr = aufsHardlinks[linkBasename] - if srcHdr == nil { - return 0, fmt.Errorf("invalid aufs hardlink") - } - p, err := fs.RootPath(aufsTempdir, linkBasename) - if err != nil { - return 0, err - } - tmpFile, err := os.Open(p) - if err != nil { - return 0, err - } - defer tmpFile.Close() - srcData = tmpFile - } - if err := createTarFile(ctx, path, root, srcHdr, srcData); err != nil { return 0, err } @@ -428,6 +379,66 @@ func createTarFile(ctx context.Context, path, extractDir string, hdr *tar.Header return chtimes(path, boundTime(latestTime(hdr.AccessTime, hdr.ModTime)), boundTime(hdr.ModTime)) } +func mkparent(ctx context.Context, path, root string, parents []string) error { + if dir, err := os.Lstat(path); err == nil { + if dir.IsDir() { + return nil + } + return &os.PathError{ + Op: "mkparent", + Path: path, + Err: syscall.ENOTDIR, + } + } else if !os.IsNotExist(err) { + return err + } + + i := len(path) + for i > len(root) && !os.IsPathSeparator(path[i-1]) { + i-- + } + + if i > len(root)+1 { + if err := mkparent(ctx, path[:i-1], root, parents); err != nil { + return err + } + } + + if err := mkdir(path, 0755); err != nil { + // Check that still doesn't exist + dir, err1 := os.Lstat(path) + if err1 == nil && dir.IsDir() { + return nil + } + return err + } + + for _, p := range parents { + ppath, err := fs.RootPath(p, path[len(root):]) + if err != nil { + return err + } + + dir, err := os.Lstat(ppath) + if err == nil { + if !dir.IsDir() { + // Replaced, do not copy attributes + break + } + if err := copyDirInfo(dir, path); err != nil { + return err + } + return copyUpXAttrs(path, ppath) + } else if !os.IsNotExist(err) { + return err + } + } + + log.G(ctx).Debugf("parent directory %q not found: default permissions(0755) used", path) + + return nil +} + type changeWriter struct { tw *tar.Writer source string @@ -493,6 +504,12 @@ func (cw *changeWriter) HandleChange(k fs.ChangeKind, p string, f os.FileInfo, e hdr.Mode = int64(chmodTarEntry(os.FileMode(hdr.Mode))) + // truncate timestamp for compatibility. without PAX stdlib rounds timestamps instead + hdr.Format = tar.FormatPAX + hdr.ModTime = hdr.ModTime.Truncate(time.Second) + hdr.AccessTime = time.Time{} + hdr.ChangeTime = time.Time{} + name := p if strings.HasPrefix(name, string(filepath.Separator)) { name, err = filepath.Rel(string(filepath.Separator), name) @@ -598,6 +615,9 @@ func (cw *changeWriter) Close() error { } func (cw *changeWriter) includeParents(hdr *tar.Header) error { + if cw.addedDirs == nil { + return nil + } name := strings.TrimRight(hdr.Name, "/") fname := filepath.Join(cw.source, name) parent := filepath.Dir(name) @@ -684,3 +704,26 @@ func hardlinkRootPath(root, linkname string) (string, error) { } return targetPath, nil } + +func validateWhiteout(path string) error { + base := filepath.Base(path) + dir := filepath.Dir(path) + + if base == whiteoutOpaqueDir { + return nil + } + + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + // Ensure originalPath is under dir + if dir[len(dir)-1] != filepath.Separator { + dir += string(filepath.Separator) + } + if !strings.HasPrefix(originalPath, dir) { + return errors.Wrapf(errInvalidArchive, "invalid whiteout name: %v", base) + } + } + return nil +} diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts.go b/vendor/github.com/containerd/containerd/archive/tar_opts.go index a08bc102a..ca419e112 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_opts.go +++ b/vendor/github.com/containerd/containerd/archive/tar_opts.go @@ -16,7 +16,19 @@ package archive -import "archive/tar" +import ( + "archive/tar" + "context" +) + +// ApplyOptions provides additional options for an Apply operation +type ApplyOptions struct { + Filter Filter // Filter tar headers + ConvertWhiteout ConvertWhiteout // Convert whiteout files + Parents []string // Parent directories to handle inherited attributes without CoW + + applyFunc func(context.Context, string, *tar.Reader, ApplyOptions) (int64, error) +} // ApplyOpt allows setting mutable archive apply properties on creation type ApplyOpt func(options *ApplyOptions) error @@ -24,6 +36,9 @@ type ApplyOpt func(options *ApplyOptions) error // Filter specific files from the archive type Filter func(*tar.Header) (bool, error) +// ConvertWhiteout converts whiteout files from the archive +type ConvertWhiteout func(*tar.Header, string) (bool, error) + // all allows all files func all(_ *tar.Header) (bool, error) { return true, nil @@ -36,3 +51,24 @@ func WithFilter(f Filter) ApplyOpt { return nil } } + +// WithConvertWhiteout uses the convert function to convert the whiteout files. +func WithConvertWhiteout(c ConvertWhiteout) ApplyOpt { + return func(options *ApplyOptions) error { + options.ConvertWhiteout = c + return nil + } +} + +// WithParents provides parent directories for resolving inherited attributes +// directory from the filesystem. +// Inherited attributes are searched from first to last, making the first +// element in the list the most immediate parent directory. +// NOTE: When applying to a filesystem which supports CoW, file attributes +// should be inherited by the filesystem. +func WithParents(p []string) ApplyOpt { + return func(options *ApplyOptions) error { + options.Parents = p + return nil + } +} diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go b/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go new file mode 100644 index 000000000..38ef9e9bc --- /dev/null +++ b/vendor/github.com/containerd/containerd/archive/tar_opts_linux.go @@ -0,0 +1,59 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package archive + +import ( + "archive/tar" + "os" + "path/filepath" + "strings" + + "golang.org/x/sys/unix" +) + +// AufsConvertWhiteout converts whiteout files for aufs. +func AufsConvertWhiteout(_ *tar.Header, _ string) (bool, error) { + return true, nil +} + +// OverlayConvertWhiteout converts whiteout files for overlay. +func OverlayConvertWhiteout(hdr *tar.Header, path string) (bool, error) { + base := filepath.Base(path) + dir := filepath.Dir(path) + + // if a directory is marked as opaque, we need to translate that to overlay + if base == whiteoutOpaqueDir { + // don't write the file itself + return false, unix.Setxattr(dir, "trusted.overlay.opaque", []byte{'y'}, 0) + } + + // if a file was deleted and we are using overlay, we need to create a character device + if strings.HasPrefix(base, whiteoutPrefix) { + originalBase := base[len(whiteoutPrefix):] + originalPath := filepath.Join(dir, originalBase) + + if err := unix.Mknod(originalPath, unix.S_IFCHR, 0); err != nil { + return false, err + } + // don't write the file itself + return false, os.Chown(originalPath, hdr.Uid, hdr.Gid) + } + + return true, nil +} diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go b/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go index e4b15a163..f472013bc 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go +++ b/vendor/github.com/containerd/containerd/archive/tar_opts_windows.go @@ -18,28 +18,12 @@ package archive -// ApplyOptions provides additional options for an Apply operation -type ApplyOptions struct { - ParentLayerPaths []string // Parent layer paths used for Windows layer apply - IsWindowsContainerLayer bool // True if the tar stream to be applied is a Windows Container Layer - Filter Filter // Filter tar headers -} - -// WithParentLayers adds parent layers to the apply process this is required -// for all Windows layers except the base layer. -func WithParentLayers(parentPaths []string) ApplyOpt { - return func(options *ApplyOptions) error { - options.ParentLayerPaths = parentPaths - return nil - } -} - // AsWindowsContainerLayer indicates that the tar stream to apply is that of // a Windows Container Layer. The caller must be holding SeBackupPrivilege and // SeRestorePrivilege. func AsWindowsContainerLayer() ApplyOpt { return func(options *ApplyOptions) error { - options.IsWindowsContainerLayer = true + options.applyFunc = applyWindowsLayer return nil } } diff --git a/vendor/github.com/containerd/containerd/archive/tar_unix.go b/vendor/github.com/containerd/containerd/archive/tar_unix.go index 022dd6d4f..e87218753 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_unix.go +++ b/vendor/github.com/containerd/containerd/archive/tar_unix.go @@ -20,11 +20,12 @@ package archive import ( "archive/tar" - "context" "os" + "strings" "sync" "syscall" + "github.com/containerd/continuity/fs" "github.com/containerd/continuity/sysx" "github.com/opencontainers/runc/libcontainer/system" "github.com/pkg/errors" @@ -74,10 +75,6 @@ func openFile(name string, flag int, perm os.FileMode) (*os.File, error) { return f, err } -func mkdirAll(path string, perm os.FileMode) error { - return os.MkdirAll(path, perm) -} - func mkdir(path string, perm os.FileMode) error { if err := os.Mkdir(path, perm); err != nil { return err @@ -149,11 +146,71 @@ func getxattr(path, attr string) ([]byte, error) { } func setxattr(path, key, value string) error { - return sysx.LSetxattr(path, key, []byte(value), 0) + // Do not set trusted attributes + if strings.HasPrefix(key, "trusted.") { + return errors.Wrap(unix.ENOTSUP, "admin attributes from archive not supported") + } + return unix.Lsetxattr(path, key, []byte(value), 0) } -// apply applies a tar stream of an OCI style diff tar. -// See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets -func apply(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { - return applyNaive(ctx, root, tr, options) +func copyDirInfo(fi os.FileInfo, path string) error { + st := fi.Sys().(*syscall.Stat_t) + if err := os.Lchown(path, int(st.Uid), int(st.Gid)); err != nil { + if os.IsPermission(err) { + // Normally if uid/gid are the same this would be a no-op, but some + // filesystems may still return EPERM... for instance NFS does this. + // In such a case, this is not an error. + if dstStat, err2 := os.Lstat(path); err2 == nil { + st2 := dstStat.Sys().(*syscall.Stat_t) + if st.Uid == st2.Uid && st.Gid == st2.Gid { + err = nil + } + } + } + if err != nil { + return errors.Wrapf(err, "failed to chown %s", path) + } + } + + if err := os.Chmod(path, fi.Mode()); err != nil { + return errors.Wrapf(err, "failed to chmod %s", path) + } + + timespec := []unix.Timespec{unix.Timespec(fs.StatAtime(st)), unix.Timespec(fs.StatMtime(st))} + if err := unix.UtimesNanoAt(unix.AT_FDCWD, path, timespec, unix.AT_SYMLINK_NOFOLLOW); err != nil { + return errors.Wrapf(err, "failed to utime %s", path) + } + + return nil +} + +func copyUpXAttrs(dst, src string) error { + xattrKeys, err := sysx.LListxattr(src) + if err != nil { + if err == unix.ENOTSUP || err == sysx.ENODATA { + return nil + } + return errors.Wrapf(err, "failed to list xattrs on %s", src) + } + for _, xattr := range xattrKeys { + // Do not copy up trusted attributes + if strings.HasPrefix(xattr, "trusted.") { + continue + } + data, err := sysx.LGetxattr(src, xattr) + if err != nil { + if err == unix.ENOTSUP || err == sysx.ENODATA { + continue + } + return errors.Wrapf(err, "failed to get xattr %q on %s", xattr, src) + } + if err := unix.Lsetxattr(dst, xattr, data, unix.XATTR_CREATE); err != nil { + if err == unix.ENOTSUP || err == unix.ENODATA || err == unix.EEXIST { + continue + } + return errors.Wrapf(err, "failed to set xattr %q on %s", xattr, dst) + } + } + + return nil } diff --git a/vendor/github.com/containerd/containerd/archive/tar_windows.go b/vendor/github.com/containerd/containerd/archive/tar_windows.go index b97631fcc..a5c6da694 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_windows.go +++ b/vendor/github.com/containerd/containerd/archive/tar_windows.go @@ -23,7 +23,6 @@ import ( "bufio" "context" "encoding/base64" - "errors" "fmt" "io" "os" @@ -36,6 +35,7 @@ import ( "github.com/Microsoft/go-winio" "github.com/Microsoft/hcsshim" "github.com/containerd/containerd/sys" + "github.com/pkg/errors" ) const ( @@ -107,10 +107,6 @@ func openFile(name string, flag int, perm os.FileMode) (*os.File, error) { return sys.OpenFileSequential(name, flag, perm) } -func mkdirAll(path string, perm os.FileMode) error { - return sys.MkdirAll(path, perm) -} - func mkdir(path string, perm os.FileMode) error { return os.Mkdir(path, perm) } @@ -153,16 +149,8 @@ func setxattr(path, key, value string) error { return errors.New("xattrs not supported on Windows") } -// apply applies a tar stream of an OCI style diff tar of a Windows layer. -// See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets -func apply(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { - if options.IsWindowsContainerLayer { - return applyWindowsLayer(ctx, root, tr, options) - } - return applyNaive(ctx, root, tr, options) -} - -// applyWindowsLayer applies a tar stream of an OCI style diff tar of a Windows layer. +// applyWindowsLayer applies a tar stream of an OCI style diff tar of a Windows +// layer using the hcsshim layer writer and backup streams. // See https://github.com/opencontainers/image-spec/blob/master/layer.md#applying-changesets func applyWindowsLayer(ctx context.Context, root string, tr *tar.Reader, options ApplyOptions) (size int64, err error) { home, id := filepath.Split(root) @@ -170,7 +158,7 @@ func applyWindowsLayer(ctx context.Context, root string, tr *tar.Reader, options HomeDir: home, } - w, err := hcsshim.NewLayerWriter(info, id, options.ParentLayerPaths) + w, err := hcsshim.NewLayerWriter(info, id, options.Parents) if err != nil { return 0, err } @@ -443,3 +431,14 @@ func writeBackupStreamFromTarFile(w io.Writer, t *tar.Reader, hdr *tar.Header) ( } } } + +func copyDirInfo(fi os.FileInfo, path string) error { + if err := os.Chmod(path, fi.Mode()); err != nil { + return errors.Wrapf(err, "failed to chmod %s", path) + } + return nil +} + +func copyUpXAttrs(dst, src string) error { + return nil +} diff --git a/vendor/github.com/containerd/containerd/cio/io_unix.go b/vendor/github.com/containerd/containerd/cio/io_unix.go index eb2ada80b..42d320933 100644 --- a/vendor/github.com/containerd/containerd/cio/io_unix.go +++ b/vendor/github.com/containerd/containerd/cio/io_unix.go @@ -72,17 +72,19 @@ func copyIO(fifos *FIFOSet, ioset *Streams) (*cio, error) { } var wg = &sync.WaitGroup{} - wg.Add(1) - go func() { - p := bufPool.Get().(*[]byte) - defer bufPool.Put(p) + if fifos.Stdout != "" { + wg.Add(1) + go func() { + p := bufPool.Get().(*[]byte) + defer bufPool.Put(p) - io.CopyBuffer(ioset.Stdout, pipes.Stdout, *p) - pipes.Stdout.Close() - wg.Done() - }() + io.CopyBuffer(ioset.Stdout, pipes.Stdout, *p) + pipes.Stdout.Close() + wg.Done() + }() + } - if !fifos.Terminal { + if !fifos.Terminal && fifos.Stderr != "" { wg.Add(1) go func() { p := bufPool.Get().(*[]byte) diff --git a/vendor/github.com/containerd/containerd/client.go b/vendor/github.com/containerd/containerd/client.go index 76abed6c7..99141e2db 100644 --- a/vendor/github.com/containerd/containerd/client.go +++ b/vendor/github.com/containerd/containerd/client.go @@ -99,6 +99,12 @@ func New(address string, opts ...ClientOpt) (*Client, error) { c.runtime = defaults.DefaultRuntime } + if copts.defaultPlatform != nil { + c.platform = copts.defaultPlatform + } else { + c.platform = platforms.Default() + } + if copts.services != nil { c.services = *copts.services } @@ -193,6 +199,7 @@ type Client struct { conn *grpc.ClientConn runtime string defaultns string + platform platforms.MatchComparer connector func() (*grpc.ClientConn, error) } @@ -294,10 +301,14 @@ type RemoteContext struct { PlatformMatcher platforms.MatchComparer // Unpack is done after an image is pulled to extract into a snapshotter. + // It is done simultaneously for schema 2 images when they are pulled. // If an image is not unpacked on pull, it can be unpacked any time // afterwards. Unpacking is required to run an image. Unpack bool + // UnpackOpts handles options to the unpack call. + UnpackOpts []UnpackOpt + // Snapshotter used for unpacking Snapshotter string @@ -329,9 +340,8 @@ type RemoteContext struct { // MaxConcurrentDownloads is the max concurrent content downloads for each pull. MaxConcurrentDownloads int - // AppendDistributionSourceLabel allows fetcher to add distribute source - // label for each blob content, which doesn't work for legacy schema1. - AppendDistributionSourceLabel bool + // AllMetadata downloads all manifests and known-configuration files + AllMetadata bool } func defaultRemoteContext() *RemoteContext { diff --git a/vendor/github.com/containerd/containerd/client_opts.go b/vendor/github.com/containerd/containerd/client_opts.go index ed2ff05d5..6f485c18d 100644 --- a/vendor/github.com/containerd/containerd/client_opts.go +++ b/vendor/github.com/containerd/containerd/client_opts.go @@ -26,11 +26,12 @@ import ( ) type clientOpts struct { - defaultns string - defaultRuntime string - services *services - dialOptions []grpc.DialOption - timeout time.Duration + defaultns string + defaultRuntime string + defaultPlatform platforms.MatchComparer + services *services + dialOptions []grpc.DialOption + timeout time.Duration } // ClientOpt allows callers to set options on the containerd client @@ -55,6 +56,14 @@ func WithDefaultRuntime(rt string) ClientOpt { } } +// WithDefaultPlatform sets the default platform matcher on the client +func WithDefaultPlatform(platform platforms.MatchComparer) ClientOpt { + return func(c *clientOpts) error { + c.defaultPlatform = platform + return nil + } +} + // WithDialOpts allows grpc.DialOptions to be set on the connection func WithDialOpts(opts []grpc.DialOption) ClientOpt { return func(c *clientOpts) error { @@ -195,11 +204,10 @@ func WithMaxConcurrentDownloads(max int) RemoteOpt { } } -// WithAppendDistributionSourceLabel allows fetcher to add distribute source -// label for each blob content, which doesn't work for legacy schema1. -func WithAppendDistributionSourceLabel() RemoteOpt { +// WithAllMetadata downloads all manifests and known-configuration files +func WithAllMetadata() RemoteOpt { return func(_ *Client, c *RemoteContext) error { - c.AppendDistributionSourceLabel = true + c.AllMetadata = true return nil } } diff --git a/vendor/github.com/containerd/containerd/cmd/containerd/command/config.go b/vendor/github.com/containerd/containerd/cmd/containerd/command/config.go index 6eec996cb..1e5710d42 100644 --- a/vendor/github.com/containerd/containerd/cmd/containerd/command/config.go +++ b/vendor/github.com/containerd/containerd/cmd/containerd/command/config.go @@ -22,6 +22,7 @@ import ( "os" "github.com/BurntSushi/toml" + "github.com/containerd/containerd/pkg/timeout" "github.com/containerd/containerd/services/server" srvconfig "github.com/containerd/containerd/services/server/config" "github.com/urfave/cli" @@ -39,6 +40,50 @@ func (c *Config) WriteTo(w io.Writer) (int64, error) { return 0, toml.NewEncoder(w).Encode(c) } +func outputConfig(cfg *srvconfig.Config) error { + config := &Config{ + Config: cfg, + } + + plugins, err := server.LoadPlugins(gocontext.Background(), config.Config) + if err != nil { + return err + } + if len(plugins) != 0 { + config.Plugins = make(map[string]interface{}) + for _, p := range plugins { + if p.Config == nil { + continue + } + + pc, err := config.Decode(p) + if err != nil { + return err + } + + config.Plugins[p.URI()] = pc + } + } + + timeouts := timeout.All() + config.Timeouts = make(map[string]string) + for k, v := range timeouts { + config.Timeouts[k] = v.String() + } + + // for the time being, keep the defaultConfig's version set at 1 so that + // when a config without a version is loaded from disk and has no version + // set, we assume it's a v1 config. But when generating new configs via + // this command, generate the v2 config + config.Config.Version = 2 + + // remove overridden Plugins type to avoid duplication in output + config.Config.Plugins = nil + + _, err = config.WriteTo(os.Stdout) + return err +} + var configCommand = cli.Command{ Name: "config", Usage: "information on the containerd config", @@ -47,29 +92,19 @@ var configCommand = cli.Command{ Name: "default", Usage: "see the output of the default config", Action: func(context *cli.Context) error { - config := &Config{ - Config: defaultConfig(), - } - // for the time being, keep the defaultConfig's version set at 1 so that - // when a config without a version is loaded from disk and has no version - // set, we assume it's a v1 config. But when generating new configs via - // this command, generate the v2 config - config.Config.Version = 2 - plugins, err := server.LoadPlugins(gocontext.Background(), config.Config) - if err != nil { + return outputConfig(defaultConfig()) + }, + }, + { + Name: "dump", + Usage: "see the output of the final main config with imported in subconfig files", + Action: func(context *cli.Context) error { + config := defaultConfig() + if err := srvconfig.LoadConfig(context.GlobalString("config"), config); err != nil && !os.IsNotExist(err) { return err } - if len(plugins) != 0 { - config.Plugins = make(map[string]interface{}) - for _, p := range plugins { - if p.Config == nil { - continue - } - config.Plugins[p.URI()] = p.Config - } - } - _, err = config.WriteTo(os.Stdout) - return err + + return outputConfig(config) }, }, }, diff --git a/vendor/github.com/containerd/containerd/cmd/containerd/command/main.go b/vendor/github.com/containerd/containerd/cmd/containerd/command/main.go index d4e3dfee5..727b29f4d 100644 --- a/vendor/github.com/containerd/containerd/cmd/containerd/command/main.go +++ b/vendor/github.com/containerd/containerd/cmd/containerd/command/main.go @@ -148,13 +148,16 @@ func App() *cli.App { for _, w := range warnings { log.G(ctx).WithError(w).Warn("cleanup temp mount") } - var ( - address = config.GRPC.Address - ttrpcAddress = fmt.Sprintf("%s.ttrpc", config.GRPC.Address) - ) - if address == "" { + + if config.GRPC.Address == "" { return errors.Wrap(errdefs.ErrInvalidArgument, "grpc address cannot be empty") } + if config.TTRPC.Address == "" { + // If TTRPC was not explicitly configured, use defaults based on GRPC. + config.TTRPC.Address = fmt.Sprintf("%s.ttrpc", config.GRPC.Address) + config.TTRPC.UID = config.GRPC.UID + config.TTRPC.GID = config.GRPC.GID + } log.G(ctx).WithFields(logrus.Fields{ "version": version.Version, "revision": version.Revision, @@ -193,7 +196,7 @@ func App() *cli.App { serve(ctx, l, server.ServeMetrics) } // setup the ttrpc endpoint - tl, err := sys.GetLocalListener(ttrpcAddress, config.GRPC.UID, config.GRPC.GID) + tl, err := sys.GetLocalListener(config.TTRPC.Address, config.TTRPC.UID, config.TTRPC.GID) if err != nil { return errors.Wrapf(err, "failed to get listener for main ttrpc endpoint") } @@ -207,7 +210,7 @@ func App() *cli.App { serve(ctx, l, server.ServeTCP) } // setup the main grpc endpoint - l, err := sys.GetLocalListener(address, config.GRPC.UID, config.GRPC.GID) + l, err := sys.GetLocalListener(config.GRPC.Address, config.GRPC.UID, config.GRPC.GID) if err != nil { return errors.Wrapf(err, "failed to get listener for main endpoint") } diff --git a/vendor/github.com/containerd/containerd/cmd/containerd/command/main_unix.go b/vendor/github.com/containerd/containerd/cmd/containerd/command/main_unix.go index 90de40eaa..c9081eeef 100644 --- a/vendor/github.com/containerd/containerd/cmd/containerd/command/main_unix.go +++ b/vendor/github.com/containerd/containerd/cmd/containerd/command/main_unix.go @@ -58,6 +58,7 @@ func handleSignals(ctx context.Context, signals chan os.Signal, serverC chan *se } server.Stop() close(done) + return } } } diff --git a/vendor/github.com/containerd/containerd/cmd/containerd/command/service_windows.go b/vendor/github.com/containerd/containerd/cmd/containerd/command/service_windows.go index 7b417ba57..f759a7131 100644 --- a/vendor/github.com/containerd/containerd/cmd/containerd/command/service_windows.go +++ b/vendor/github.com/containerd/containerd/cmd/containerd/command/service_windows.go @@ -17,7 +17,6 @@ package command import ( - "bytes" "fmt" "io/ioutil" "log" @@ -35,7 +34,6 @@ import ( "golang.org/x/sys/windows" "golang.org/x/sys/windows/svc" "golang.org/x/sys/windows/svc/debug" - "golang.org/x/sys/windows/svc/eventlog" "golang.org/x/sys/windows/svc/mgr" ) @@ -54,18 +52,6 @@ var ( service *handler ) -const ( - // These should match the values in event_messages.mc. - eventInfo = 1 - eventWarn = 1 - eventError = 1 - eventDebug = 2 - eventPanic = 3 - eventFatal = 4 - - eventExtraOffset = 10 // Add this to any event to get a string that supports extended data -) - // serviceFlags returns an array of flags for configuring containerd to run // as a Windows service under control of SCM. func serviceFlags() []cli.Flag { @@ -124,93 +110,6 @@ type handler struct { done chan struct{} // Indicates back to app main to quit } -type etwHook struct { - log *eventlog.Log -} - -func (h *etwHook) Levels() []logrus.Level { - return []logrus.Level{ - logrus.PanicLevel, - logrus.FatalLevel, - logrus.ErrorLevel, - logrus.WarnLevel, - logrus.InfoLevel, - logrus.DebugLevel, - } -} - -func (h *etwHook) Fire(e *logrus.Entry) error { - var ( - etype uint16 - eid uint32 - ) - - switch e.Level { - case logrus.PanicLevel: - etype = windows.EVENTLOG_ERROR_TYPE - eid = eventPanic - case logrus.FatalLevel: - etype = windows.EVENTLOG_ERROR_TYPE - eid = eventFatal - case logrus.ErrorLevel: - etype = windows.EVENTLOG_ERROR_TYPE - eid = eventError - case logrus.WarnLevel: - etype = windows.EVENTLOG_WARNING_TYPE - eid = eventWarn - case logrus.InfoLevel: - etype = windows.EVENTLOG_INFORMATION_TYPE - eid = eventInfo - case logrus.DebugLevel: - etype = windows.EVENTLOG_INFORMATION_TYPE - eid = eventDebug - default: - return errors.Wrap(errdefs.ErrInvalidArgument, "unknown level") - } - - // If there is additional data, include it as a second string. - exts := "" - if len(e.Data) > 0 { - fs := bytes.Buffer{} - for k, v := range e.Data { - fs.WriteString(k) - fs.WriteByte('=') - fmt.Fprint(&fs, v) - fs.WriteByte(' ') - } - - exts = fs.String()[:fs.Len()-1] - eid += eventExtraOffset - } - - if h.log == nil { - fmt.Fprintf(os.Stderr, "%s [%s]\n", e.Message, exts) - return nil - } - - var ( - ss [2]*uint16 - err error - ) - - ss[0], err = windows.UTF16PtrFromString(e.Message) - if err != nil { - return err - } - - count := uint16(1) - if exts != "" { - ss[1], err = windows.UTF16PtrFromString(exts) - if err != nil { - return err - } - - count++ - } - - return windows.ReportEvent(h.log.Handle, etype, 0, eid, 0, count, 0, &ss[0], nil) -} - func getServicePath() (string, error) { p, err := exec.LookPath(os.Args[0]) if err != nil { @@ -283,7 +182,7 @@ func registerService() error { return err } - return eventlog.Install(serviceNameFlag, p, false, eventlog.Info|eventlog.Warning|eventlog.Error) + return nil } func unregisterService() error { @@ -299,7 +198,6 @@ func unregisterService() error { } defer s.Close() - eventlog.Remove(serviceNameFlag) err = s.Delete() if err != nil { return err @@ -345,20 +243,6 @@ func registerUnregisterService(root string) (bool, error) { return true, err } - interactive, err := svc.IsAnInteractiveSession() - if err != nil { - return true, err - } - - var log *eventlog.Log - if !interactive { - log, err = eventlog.Open(serviceNameFlag) - if err != nil { - return true, err - } - } - - logrus.AddHook(&etwHook{log}) logrus.SetOutput(ioutil.Discard) } return false, nil diff --git a/vendor/github.com/containerd/containerd/container.go b/vendor/github.com/containerd/containerd/container.go index 46d51ecd9..fd880d0e0 100644 --- a/vendor/github.com/containerd/containerd/container.go +++ b/vendor/github.com/containerd/containerd/container.go @@ -25,6 +25,7 @@ import ( "github.com/containerd/containerd/api/services/tasks/v1" "github.com/containerd/containerd/api/types" + tasktypes "github.com/containerd/containerd/api/types/task" "github.com/containerd/containerd/cio" "github.com/containerd/containerd/containers" "github.com/containerd/containerd/errdefs" @@ -382,7 +383,9 @@ func (c *container) loadTask(ctx context.Context, ioAttach cio.Attach) (Task, er return nil, err } var i cio.IO - if ioAttach != nil { + if ioAttach != nil && response.Process.Status != tasktypes.StatusUnknown { + // Do not attach IO for task in unknown state, because there + // are no fifo paths anyway. if i, err = attachExistingIO(response, ioAttach); err != nil { return nil, err } diff --git a/vendor/github.com/containerd/containerd/container_opts.go b/vendor/github.com/containerd/containerd/container_opts.go index e36b47e2e..895484023 100644 --- a/vendor/github.com/containerd/containerd/container_opts.go +++ b/vendor/github.com/containerd/containerd/container_opts.go @@ -22,7 +22,6 @@ import ( "github.com/containerd/containerd/containers" "github.com/containerd/containerd/errdefs" "github.com/containerd/containerd/oci" - "github.com/containerd/containerd/platforms" "github.com/containerd/containerd/snapshots" "github.com/containerd/typeurl" "github.com/gogo/protobuf/types" @@ -78,6 +77,14 @@ func WithImage(i Image) NewContainerOpts { } } +// WithImageName allows setting the image name as the base for the container +func WithImageName(n string) NewContainerOpts { + return func(ctx context.Context, _ *Client, c *containers.Container) error { + c.Image = n + return nil + } +} + // WithContainerLabels adds the provided labels to the container func WithContainerLabels(labels map[string]string) NewContainerOpts { return func(_ context.Context, _ *Client, c *containers.Container) error { @@ -182,7 +189,7 @@ func WithSnapshotCleanup(ctx context.Context, client *Client, c containers.Conta // root filesystem in read-only mode func WithNewSnapshotView(id string, i Image, opts ...snapshots.Opt) NewContainerOpts { return func(ctx context.Context, client *Client, c *containers.Container) error { - diffIDs, err := i.(*image).i.RootFS(ctx, client.ContentStore(), platforms.Default()) + diffIDs, err := i.(*image).i.RootFS(ctx, client.ContentStore(), client.platform) if err != nil { return err } diff --git a/vendor/github.com/containerd/containerd/container_opts_unix.go b/vendor/github.com/containerd/containerd/container_opts_unix.go index af52d0422..b109a10ec 100644 --- a/vendor/github.com/containerd/containerd/container_opts_unix.go +++ b/vendor/github.com/containerd/containerd/container_opts_unix.go @@ -28,7 +28,6 @@ import ( "github.com/containerd/containerd/containers" "github.com/containerd/containerd/errdefs" "github.com/containerd/containerd/mount" - "github.com/containerd/containerd/platforms" "github.com/opencontainers/image-spec/identity" ) @@ -45,7 +44,7 @@ func WithRemappedSnapshotView(id string, i Image, uid, gid uint32) NewContainerO func withRemappedSnapshotBase(id string, i Image, uid, gid uint32, readonly bool) NewContainerOpts { return func(ctx context.Context, client *Client, c *containers.Container) error { - diffIDs, err := i.(*image).i.RootFS(ctx, client.ContentStore(), platforms.Default()) + diffIDs, err := i.(*image).i.RootFS(ctx, client.ContentStore(), client.platform) if err != nil { return err } diff --git a/vendor/github.com/containerd/containerd/container_restore_opts.go b/vendor/github.com/containerd/containerd/container_restore_opts.go index 4f251c4a6..03722dba1 100644 --- a/vendor/github.com/containerd/containerd/container_restore_opts.go +++ b/vendor/github.com/containerd/containerd/container_restore_opts.go @@ -22,7 +22,6 @@ import ( "github.com/containerd/containerd/containers" "github.com/containerd/containerd/content" "github.com/containerd/containerd/images" - "github.com/containerd/containerd/platforms" "github.com/gogo/protobuf/proto" ptypes "github.com/gogo/protobuf/types" "github.com/opencontainers/image-spec/identity" @@ -58,7 +57,7 @@ func WithRestoreImage(ctx context.Context, id string, client *Client, checkpoint return err } - diffIDs, err := i.(*image).i.RootFS(ctx, client.ContentStore(), platforms.Default()) + diffIDs, err := i.(*image).i.RootFS(ctx, client.ContentStore(), client.platform) if err != nil { return err } diff --git a/vendor/github.com/containerd/containerd/containers/containers.go b/vendor/github.com/containerd/containerd/containers/containers.go index c7ad2bfaa..7174bbd6a 100644 --- a/vendor/github.com/containerd/containerd/containers/containers.go +++ b/vendor/github.com/containerd/containerd/containers/containers.go @@ -49,7 +49,7 @@ type Container struct { // This property is required and immutable. Runtime RuntimeInfo - // Spec should carry the the runtime specification used to implement the + // Spec should carry the runtime specification used to implement the // container. // // This field is required but mutable. diff --git a/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go index 275a4c3e6..b7cf1765d 100644 --- a/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go +++ b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp.go @@ -1,5 +1,3 @@ -// +build linux - /* Copyright The containerd Authors. diff --git a/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp_default.go b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp_default.go index 042052792..af40395de 100644 --- a/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp_default.go +++ b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp_default.go @@ -312,6 +312,7 @@ func DefaultProfile(sp *specs.Spec) *specs.LinuxSeccomp { "sigaltstack", "signalfd", "signalfd4", + "sigprocmask", "sigreturn", "socket", "socketcall", diff --git a/vendor/github.com/containerd/containerd/archive/tar_opts_unix.go b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp_default_unsupported.go similarity index 69% rename from vendor/github.com/containerd/containerd/archive/tar_opts_unix.go rename to vendor/github.com/containerd/containerd/contrib/seccomp/seccomp_default_unsupported.go index 173826967..14d7b75e1 100644 --- a/vendor/github.com/containerd/containerd/archive/tar_opts_unix.go +++ b/vendor/github.com/containerd/containerd/contrib/seccomp/seccomp_default_unsupported.go @@ -1,4 +1,4 @@ -// +build !windows +// +build !linux /* Copyright The containerd Authors. @@ -16,9 +16,11 @@ limitations under the License. */ -package archive +package seccomp -// ApplyOptions provides additional options for an Apply operation -type ApplyOptions struct { - Filter Filter // Filter tar headers +import specs "github.com/opencontainers/runtime-spec/specs-go" + +// DefaultProfile defines the whitelist for the default seccomp profile. +func DefaultProfile(sp *specs.Spec) *specs.LinuxSeccomp { + return &specs.LinuxSeccomp{} } diff --git a/vendor/github.com/containerd/containerd/diff/apply/apply.go b/vendor/github.com/containerd/containerd/diff/apply/apply.go index 7a6b65c3e..ce89daaf2 100644 --- a/vendor/github.com/containerd/containerd/diff/apply/apply.go +++ b/vendor/github.com/containerd/containerd/diff/apply/apply.go @@ -22,7 +22,6 @@ import ( "io/ioutil" "time" - "github.com/containerd/containerd/archive" "github.com/containerd/containerd/content" "github.com/containerd/containerd/diff" "github.com/containerd/containerd/log" @@ -94,15 +93,13 @@ func (s *fsApplier) Apply(ctx context.Context, desc ocispec.Descriptor, mounts [ rc := &readCounter{ r: io.TeeReader(processor, digester.Hash()), } - if err := mount.WithTempMount(ctx, mounts, func(root string) error { - if _, err := archive.Apply(ctx, root, rc); err != nil { - return err - } - // Read any trailing data - _, err := io.Copy(ioutil.Discard, rc) - return err - }); err != nil { + if err := apply(ctx, mounts, rc); err != nil { + return emptyDesc, err + } + + // Read any trailing data + if _, err := io.Copy(ioutil.Discard, rc); err != nil { return emptyDesc, err } diff --git a/vendor/github.com/containerd/containerd/diff/apply/apply_linux.go b/vendor/github.com/containerd/containerd/diff/apply/apply_linux.go new file mode 100644 index 000000000..c36b6090c --- /dev/null +++ b/vendor/github.com/containerd/containerd/diff/apply/apply_linux.go @@ -0,0 +1,128 @@ +// +build linux + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package apply + +import ( + "context" + "io" + "strings" + + "github.com/containerd/containerd/archive" + "github.com/containerd/containerd/errdefs" + "github.com/containerd/containerd/mount" + "github.com/pkg/errors" +) + +func apply(ctx context.Context, mounts []mount.Mount, r io.Reader) error { + switch { + case len(mounts) == 1 && mounts[0].Type == "overlay": + path, parents, err := getOverlayPath(mounts[0].Options) + if err != nil { + if errdefs.IsInvalidArgument(err) { + break + } + return err + } + opts := []archive.ApplyOpt{ + archive.WithConvertWhiteout(archive.OverlayConvertWhiteout), + } + if len(parents) > 0 { + opts = append(opts, archive.WithParents(parents)) + } + _, err = archive.Apply(ctx, path, r, opts...) + return err + case len(mounts) == 1 && mounts[0].Type == "aufs": + path, parents, err := getAufsPath(mounts[0].Options) + if err != nil { + if errdefs.IsInvalidArgument(err) { + break + } + return err + } + opts := []archive.ApplyOpt{ + archive.WithConvertWhiteout(archive.AufsConvertWhiteout), + } + if len(parents) > 0 { + opts = append(opts, archive.WithParents(parents)) + } + _, err = archive.Apply(ctx, path, r, opts...) + return err + } + return mount.WithTempMount(ctx, mounts, func(root string) error { + _, err := archive.Apply(ctx, root, r) + return err + }) +} + +func getOverlayPath(options []string) (upper string, lower []string, err error) { + const upperdirPrefix = "upperdir=" + const lowerdirPrefix = "lowerdir=" + + for _, o := range options { + if strings.HasPrefix(o, upperdirPrefix) { + upper = strings.TrimPrefix(o, upperdirPrefix) + } else if strings.HasPrefix(o, lowerdirPrefix) { + lower = strings.Split(strings.TrimPrefix(o, lowerdirPrefix), ":") + } + } + if upper == "" { + return "", nil, errors.Wrap(errdefs.ErrInvalidArgument, "upperdir not found") + } + + return +} + +// getAufsPath handles options as given by the containerd aufs package only, +// formatted as "br:=rw[:=ro+wh]*" +func getAufsPath(options []string) (upper string, lower []string, err error) { + const ( + sep = ":" + brPrefix = "br:" + rwSuffix = "=rw" + roSuffix = "=ro+wh" + ) + for _, o := range options { + if strings.HasPrefix(o, brPrefix) { + o = strings.TrimPrefix(o, brPrefix) + } else { + continue + } + + for _, b := range strings.Split(o, sep) { + if strings.HasSuffix(b, rwSuffix) { + if upper != "" { + return "", nil, errors.Wrap(errdefs.ErrInvalidArgument, "multiple rw branch found") + } + upper = strings.TrimSuffix(b, rwSuffix) + } else if strings.HasSuffix(b, roSuffix) { + if upper == "" { + return "", nil, errors.Wrap(errdefs.ErrInvalidArgument, "rw branch be first") + } + lower = append(lower, strings.TrimSuffix(b, roSuffix)) + } else { + return "", nil, errors.Wrap(errdefs.ErrInvalidArgument, "unhandled aufs suffix") + } + + } + } + if upper == "" { + return "", nil, errors.Wrap(errdefs.ErrInvalidArgument, "rw branch not found") + } + return +} diff --git a/vendor/github.com/containerd/containerd/namespaces_opts_linux.go b/vendor/github.com/containerd/containerd/diff/apply/apply_other.go similarity index 58% rename from vendor/github.com/containerd/containerd/namespaces_opts_linux.go rename to vendor/github.com/containerd/containerd/diff/apply/apply_other.go index 6b8cc8f85..01e0f11bb 100644 --- a/vendor/github.com/containerd/containerd/namespaces_opts_linux.go +++ b/vendor/github.com/containerd/containerd/diff/apply/apply_other.go @@ -1,3 +1,5 @@ +// +build !linux + /* Copyright The containerd Authors. @@ -14,23 +16,19 @@ limitations under the License. */ -package containerd +package apply import ( "context" + "io" - "github.com/containerd/cgroups" - "github.com/containerd/containerd/namespaces" + "github.com/containerd/containerd/archive" + "github.com/containerd/containerd/mount" ) -// WithNamespaceCgroupDeletion removes the cgroup directory that was created for the namespace -func WithNamespaceCgroupDeletion(ctx context.Context, i *namespaces.DeleteInfo) error { - cg, err := cgroups.Load(cgroups.V1, cgroups.StaticPath(i.Name)) - if err != nil { - if err == cgroups.ErrCgroupDeleted { - return nil - } +func apply(ctx context.Context, mounts []mount.Mount, r io.Reader) error { + return mount.WithTempMount(ctx, mounts, func(root string) error { + _, err := archive.Apply(ctx, root, r) return err - } - return cg.Delete() + }) } diff --git a/vendor/github.com/containerd/containerd/diff/windows/windows.go b/vendor/github.com/containerd/containerd/diff/windows/windows.go index ce584dc27..af193516b 100644 --- a/vendor/github.com/containerd/containerd/diff/windows/windows.go +++ b/vendor/github.com/containerd/containerd/diff/windows/windows.go @@ -139,7 +139,7 @@ func (s windowsDiff) Apply(ctx context.Context, desc ocispec.Descriptor, mounts return emptyDesc, err } - if _, err := archive.Apply(ctx, layer, rc, archive.WithParentLayers(parentLayerPaths), archive.AsWindowsContainerLayer()); err != nil { + if _, err := archive.Apply(ctx, layer, rc, archive.WithParents(parentLayerPaths), archive.AsWindowsContainerLayer()); err != nil { return emptyDesc, err } diff --git a/vendor/github.com/containerd/containerd/events/exchange/exchange.go b/vendor/github.com/containerd/containerd/events/exchange/exchange.go index 39972d74b..59273c952 100644 --- a/vendor/github.com/containerd/containerd/events/exchange/exchange.go +++ b/vendor/github.com/containerd/containerd/events/exchange/exchange.go @@ -50,7 +50,7 @@ var _ events.Publisher = &Exchange{} var _ events.Forwarder = &Exchange{} var _ events.Subscriber = &Exchange{} -// Forward accepts an envelope to be direcly distributed on the exchange. +// Forward accepts an envelope to be directly distributed on the exchange. // // This is useful when an event is forwarded on behalf of another namespace or // when the event is propagated on behalf of another publisher. diff --git a/vendor/github.com/containerd/containerd/image.go b/vendor/github.com/containerd/containerd/image.go index 9cfc03a30..9ef09ac2f 100644 --- a/vendor/github.com/containerd/containerd/image.go +++ b/vendor/github.com/containerd/containerd/image.go @@ -19,6 +19,8 @@ package containerd import ( "context" "fmt" + "strings" + "sync/atomic" "github.com/containerd/containerd/content" "github.com/containerd/containerd/diff" @@ -31,6 +33,7 @@ import ( "github.com/opencontainers/image-spec/identity" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "github.com/pkg/errors" + "golang.org/x/sync/semaphore" ) // Image describes an image used by containers @@ -47,6 +50,8 @@ type Image interface { RootFS(ctx context.Context) ([]digest.Digest, error) // Size returns the total size of the image's packed resources. Size(ctx context.Context) (int64, error) + // Usage returns a usage calculation for the image. + Usage(context.Context, ...UsageOpt) (int64, error) // Config descriptor for the image. Config(ctx context.Context) (ocispec.Descriptor, error) // IsUnpacked returns whether or not an image is unpacked. @@ -55,6 +60,49 @@ type Image interface { ContentStore() content.Store } +type usageOptions struct { + manifestLimit *int + manifestOnly bool + snapshots bool +} + +// UsageOpt is used to configure the usage calculation +type UsageOpt func(*usageOptions) error + +// WithUsageManifestLimit sets the limit to the number of manifests which will +// be walked for usage. Setting this value to 0 will require all manifests to +// be walked, returning ErrNotFound if manifests are missing. +// NOTE: By default all manifests which exist will be walked +// and any non-existent manifests and their subobjects will be ignored. +func WithUsageManifestLimit(i int) UsageOpt { + // If 0 then don't filter any manifests + // By default limits to current platform + return func(o *usageOptions) error { + o.manifestLimit = &i + return nil + } +} + +// WithSnapshotUsage will check for referenced snapshots from the image objects +// and include the snapshot size in the total usage. +func WithSnapshotUsage() UsageOpt { + return func(o *usageOptions) error { + o.snapshots = true + return nil + } +} + +// WithManifestUsage is used to get the usage for an image based on what is +// reported by the manifests rather than what exists in the content store. +// NOTE: This function is best used with the manifest limit set to get a +// consistent value, otherwise non-existent manifests will be excluded. +func WithManifestUsage() UsageOpt { + return func(o *usageOptions) error { + o.manifestOnly = true + return nil + } +} + var _ = (Image)(&image{}) // NewImage returns a client image object from the metadata image @@ -62,7 +110,7 @@ func NewImage(client *Client, i images.Image) Image { return &image{ client: client, i: i, - platform: platforms.Default(), + platform: client.platform, } } @@ -100,8 +148,95 @@ func (i *image) RootFS(ctx context.Context) ([]digest.Digest, error) { } func (i *image) Size(ctx context.Context) (int64, error) { - provider := i.client.ContentStore() - return i.i.Size(ctx, provider, i.platform) + return i.Usage(ctx, WithUsageManifestLimit(1), WithManifestUsage()) +} + +func (i *image) Usage(ctx context.Context, opts ...UsageOpt) (int64, error) { + var config usageOptions + for _, opt := range opts { + if err := opt(&config); err != nil { + return 0, err + } + } + + var ( + provider = i.client.ContentStore() + handler = images.ChildrenHandler(provider) + size int64 + mustExist bool + ) + + if config.manifestLimit != nil { + handler = images.LimitManifests(handler, i.platform, *config.manifestLimit) + mustExist = true + } + + var wh images.HandlerFunc = func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { + var usage int64 + children, err := handler(ctx, desc) + if err != nil { + if !errdefs.IsNotFound(err) || mustExist { + return nil, err + } + if !config.manifestOnly { + // Do not count size of non-existent objects + desc.Size = 0 + } + } else if config.snapshots || !config.manifestOnly { + info, err := provider.Info(ctx, desc.Digest) + if err != nil { + if !errdefs.IsNotFound(err) { + return nil, err + } + if !config.manifestOnly { + // Do not count size of non-existent objects + desc.Size = 0 + } + } else if info.Size > desc.Size { + // Count actual usage, Size may be unset or -1 + desc.Size = info.Size + } + + for k, v := range info.Labels { + const prefix = "containerd.io/gc.ref.snapshot." + if !strings.HasPrefix(k, prefix) { + continue + } + + sn := i.client.SnapshotService(k[len(prefix):]) + if sn == nil { + continue + } + + u, err := sn.Usage(ctx, v) + if err != nil { + if !errdefs.IsNotFound(err) && !errdefs.IsInvalidArgument(err) { + return nil, err + } + } else { + usage += u.Size + } + } + } + + // Ignore unknown sizes. Generally unknown sizes should + // never be set in manifests, however, the usage + // calculation does not need to enforce this. + if desc.Size >= 0 { + usage += desc.Size + } + + atomic.AddInt64(&size, usage) + + return children, nil + } + + l := semaphore.NewWeighted(3) + if err := images.Dispatch(ctx, wh, l, i.i.Target); err != nil { + return 0, err + } + + return size, nil } func (i *image) Config(ctx context.Context) (ocispec.Descriptor, error) { diff --git a/vendor/github.com/containerd/containerd/images/handlers.go b/vendor/github.com/containerd/containerd/images/handlers.go index dac701bb8..04c2d5a60 100644 --- a/vendor/github.com/containerd/containerd/images/handlers.go +++ b/vendor/github.com/containerd/containerd/images/handlers.go @@ -117,7 +117,7 @@ func Walk(ctx context.Context, handler Handler, descs ...ocispec.Descriptor) err // // If any handler returns an error, the dispatch session will be canceled. func Dispatch(ctx context.Context, handler Handler, limiter *semaphore.Weighted, descs ...ocispec.Descriptor) error { - eg, ctx := errgroup.WithContext(ctx) + eg, ctx2 := errgroup.WithContext(ctx) for _, desc := range descs { desc := desc @@ -126,10 +126,11 @@ func Dispatch(ctx context.Context, handler Handler, limiter *semaphore.Weighted, return err } } + eg.Go(func() error { desc := desc - children, err := handler.Handle(ctx, desc) + children, err := handler.Handle(ctx2, desc) if limiter != nil { limiter.Release(1) } @@ -141,7 +142,7 @@ func Dispatch(ctx context.Context, handler Handler, limiter *semaphore.Weighted, } if len(children) > 0 { - return Dispatch(ctx, handler, limiter, children...) + return Dispatch(ctx2, handler, limiter, children...) } return nil diff --git a/vendor/github.com/containerd/containerd/images/image.go b/vendor/github.com/containerd/containerd/images/image.go index 81c92ee4f..7d4f39c0a 100644 --- a/vendor/github.com/containerd/containerd/images/image.go +++ b/vendor/github.com/containerd/containerd/images/image.go @@ -119,7 +119,7 @@ func (image *Image) Size(ctx context.Context, provider content.Provider, platfor } size += desc.Size return nil, nil - }), FilterPlatforms(ChildrenHandler(provider), platform)), image.Target) + }), LimitManifests(FilterPlatforms(ChildrenHandler(provider), platform), platform, 1)), image.Target) } type platformManifest struct { diff --git a/vendor/github.com/containerd/containerd/import.go b/vendor/github.com/containerd/containerd/import.go index 8dc61218c..6080161f8 100644 --- a/vendor/github.com/containerd/containerd/import.go +++ b/vendor/github.com/containerd/containerd/import.go @@ -86,7 +86,7 @@ func WithImportCompression() ImportOpt { // Import imports an image from a Tar stream using reader. // Caller needs to specify importer. Future version may use oci.v1 as the default. -// Note that unreferrenced blobs may be imported to the content store as well. +// Note that unreferenced blobs may be imported to the content store as well. func (c *Client) Import(ctx context.Context, reader io.Reader, opts ...ImportOpt) ([]images.Image, error) { var iopts importOpts for _, o := range opts { @@ -125,7 +125,7 @@ func (c *Client) Import(ctx context.Context, reader io.Reader, opts ...ImportOpt } var platformMatcher = platforms.All if !iopts.allPlatforms { - platformMatcher = platforms.Default() + platformMatcher = c.platform } var handler images.HandlerFunc = func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { diff --git a/vendor/github.com/containerd/containerd/install.go b/vendor/github.com/containerd/containerd/install.go index 4545d4554..5b8b735de 100644 --- a/vendor/github.com/containerd/containerd/install.go +++ b/vendor/github.com/containerd/containerd/install.go @@ -27,7 +27,6 @@ import ( "github.com/containerd/containerd/archive/compression" "github.com/containerd/containerd/content" "github.com/containerd/containerd/images" - "github.com/containerd/containerd/platforms" "github.com/pkg/errors" ) @@ -43,7 +42,7 @@ func (c *Client) Install(ctx context.Context, image Image, opts ...InstallOpts) } var ( cs = image.ContentStore() - platform = platforms.Default() + platform = c.platform ) manifest, err := images.Manifest(ctx, cs, image.Target(), platform) if err != nil { diff --git a/vendor/github.com/containerd/containerd/log/context.go b/vendor/github.com/containerd/containerd/log/context.go index 3fab96b85..31f1a3ac0 100644 --- a/vendor/github.com/containerd/containerd/log/context.go +++ b/vendor/github.com/containerd/containerd/log/context.go @@ -30,7 +30,7 @@ var ( // messages. G = GetLogger - // L is an alias for the the standard logger. + // L is an alias for the standard logger. L = logrus.NewEntry(logrus.StandardLogger()) ) diff --git a/vendor/github.com/containerd/containerd/metadata/leases.go b/vendor/github.com/containerd/containerd/metadata/leases.go index 3050d78bf..cd8809f4c 100644 --- a/vendor/github.com/containerd/containerd/metadata/leases.go +++ b/vendor/github.com/containerd/containerd/metadata/leases.go @@ -32,7 +32,7 @@ import ( bolt "go.etcd.io/bbolt" ) -// LeaseManager manages the create/delete lifecyle of leases +// LeaseManager manages the create/delete lifecycle of leases // and also returns existing leases type LeaseManager struct { tx *bolt.Tx @@ -95,7 +95,7 @@ func (lm *LeaseManager) Create(ctx context.Context, opts ...leases.Opt) (leases. return l, nil } -// Delete delets the lease with the provided lease ID +// Delete deletes the lease with the provided lease ID func (lm *LeaseManager) Delete(ctx context.Context, lease leases.Lease, _ ...leases.DeleteOpt) error { namespace, err := namespaces.NamespaceRequired(ctx) if err != nil { diff --git a/vendor/github.com/containerd/containerd/metrics/cgroups/blkio.go b/vendor/github.com/containerd/containerd/metrics/cgroups/blkio.go index 9d2adabe5..feffaf0d1 100644 --- a/vendor/github.com/containerd/containerd/metrics/cgroups/blkio.go +++ b/vendor/github.com/containerd/containerd/metrics/cgroups/blkio.go @@ -68,7 +68,7 @@ var blkioMetrics = []*metric{ }, { name: "blkio_io_service_time_recursive", - help: "The blkio io servie time recursive", + help: "The blkio io service time recursive", unit: metrics.Total, vt: prometheus.GaugeValue, labels: []string{"op", "device", "major", "minor"}, @@ -81,7 +81,7 @@ var blkioMetrics = []*metric{ }, { name: "blkio_io_serviced_recursive", - help: "The blkio io servied recursive", + help: "The blkio io serviced recursive", unit: metrics.Total, vt: prometheus.GaugeValue, labels: []string{"op", "device", "major", "minor"}, diff --git a/vendor/github.com/containerd/containerd/oci/spec.go b/vendor/github.com/containerd/containerd/oci/spec.go index 3e7b5492a..dad87411c 100644 --- a/vendor/github.com/containerd/containerd/oci/spec.go +++ b/vendor/github.com/containerd/containerd/oci/spec.go @@ -141,7 +141,6 @@ func populateDefaultUnixSpec(ctx context.Context, s *Spec, id string) error { Path: defaultRootfsPath, }, Process: &specs.Process{ - Env: defaultUnixEnv, Cwd: "/", NoNewPrivileges: true, User: specs.User{ diff --git a/vendor/github.com/containerd/containerd/oci/spec_opts.go b/vendor/github.com/containerd/containerd/oci/spec_opts.go index 8fe3247b5..a18c6b214 100644 --- a/vendor/github.com/containerd/containerd/oci/spec_opts.go +++ b/vendor/github.com/containerd/containerd/oci/spec_opts.go @@ -118,7 +118,7 @@ func WithDefaultSpecForPlatform(platform string) SpecOpts { } } -// WithSpecFromBytes loads the the spec from the provided byte slice. +// WithSpecFromBytes loads the spec from the provided byte slice. func WithSpecFromBytes(p []byte) SpecOpts { return func(_ context.Context, _ Client, _ *containers.Container, s *Spec) error { *s = Spec{} // make sure spec is cleared. @@ -151,6 +151,13 @@ func WithEnv(environmentVariables []string) SpecOpts { } } +// WithDefaultPathEnv sets the $PATH environment variable to the +// default PATH defined in this package. +func WithDefaultPathEnv(_ context.Context, _ Client, _ *containers.Container, s *Spec) error { + s.Process.Env = replaceOrAppendEnvValues(s.Process.Env, defaultUnixEnv) + return nil +} + // replaceOrAppendEnvValues returns the defaults with the overrides either // replaced by env key or appended to the list func replaceOrAppendEnvValues(defaults, overrides []string) []string { @@ -326,7 +333,11 @@ func WithImageConfigArgs(image Image, args []string) SpecOpts { setProcess(s) if s.Linux != nil { - s.Process.Env = replaceOrAppendEnvValues(s.Process.Env, config.Env) + defaults := config.Env + if len(defaults) == 0 { + defaults = defaultUnixEnv + } + s.Process.Env = replaceOrAppendEnvValues(defaults, s.Process.Env) cmd := config.Cmd if len(args) > 0 { cmd = args @@ -348,7 +359,7 @@ func WithImageConfigArgs(image Image, args []string) SpecOpts { // even if there is no specified user in the image config return WithAdditionalGIDs("root")(ctx, client, c, s) } else if s.Windows != nil { - s.Process.Env = replaceOrAppendEnvValues(s.Process.Env, config.Env) + s.Process.Env = replaceOrAppendEnvValues(config.Env, s.Process.Env) cmd := config.Cmd if len(args) > 0 { cmd = args @@ -621,7 +632,7 @@ func WithUserID(uid uint32) SpecOpts { } // WithUsername sets the correct UID and GID for the container -// based on the the image's /etc/passwd contents. If /etc/passwd +// based on the image's /etc/passwd contents. If /etc/passwd // does not exist, or the username is not found in /etc/passwd, // it returns error. func WithUsername(username string) SpecOpts { diff --git a/vendor/github.com/containerd/containerd/pkg/timeout/timeout.go b/vendor/github.com/containerd/containerd/pkg/timeout/timeout.go new file mode 100644 index 000000000..2b9af8593 --- /dev/null +++ b/vendor/github.com/containerd/containerd/pkg/timeout/timeout.go @@ -0,0 +1,66 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package timeout + +import ( + "context" + "sync" + "time" +) + +var ( + mu sync.Mutex + timeouts = make(map[string]time.Duration) + + // DefaultTimeout of the timeout package + DefaultTimeout = 1 * time.Second +) + +// Set the timeout for the key +func Set(key string, t time.Duration) { + mu.Lock() + timeouts[key] = t + mu.Unlock() +} + +// Get returns the timeout for the provided key +func Get(key string) time.Duration { + mu.Lock() + t, ok := timeouts[key] + mu.Unlock() + if !ok { + t = DefaultTimeout + } + return t +} + +// WithContext returns a context with the specified timeout for the provided key +func WithContext(ctx context.Context, key string) (context.Context, func()) { + t := Get(key) + return context.WithTimeout(ctx, t) +} + +// All returns all keys and their timeouts +func All() map[string]time.Duration { + out := make(map[string]time.Duration) + mu.Lock() + defer mu.Unlock() + for k, v := range timeouts { + out[k] = v + } + return out +} diff --git a/vendor/github.com/containerd/containerd/platforms/platforms.go b/vendor/github.com/containerd/containerd/platforms/platforms.go index 2c2cc1102..d2b73ac3d 100644 --- a/vendor/github.com/containerd/containerd/platforms/platforms.go +++ b/vendor/github.com/containerd/containerd/platforms/platforms.go @@ -130,7 +130,7 @@ type Matcher interface { // specification. The returned matcher only looks for equality based on os, // architecture and variant. // -// One may implement their own matcher if this doesn't provide the the required +// One may implement their own matcher if this doesn't provide the required // functionality. // // Applications should opt to use `Match` over directly parsing specifiers. diff --git a/vendor/github.com/containerd/containerd/plugin/context.go b/vendor/github.com/containerd/containerd/plugin/context.go index 1211c907e..75b7366fc 100644 --- a/vendor/github.com/containerd/containerd/plugin/context.go +++ b/vendor/github.com/containerd/containerd/plugin/context.go @@ -28,12 +28,13 @@ import ( // InitContext is used for plugin inititalization type InitContext struct { - Context context.Context - Root string - State string - Config interface{} - Address string - Events *exchange.Exchange + Context context.Context + Root string + State string + Config interface{} + Address string + TTRPCAddress string + Events *exchange.Exchange Meta *Meta // plugins can fill in metadata at init. diff --git a/vendor/github.com/containerd/containerd/process.go b/vendor/github.com/containerd/containerd/process.go index 14732d99b..3a890b514 100644 --- a/vendor/github.com/containerd/containerd/process.go +++ b/vendor/github.com/containerd/containerd/process.go @@ -44,7 +44,7 @@ type Process interface { Wait(context.Context) (<-chan ExitStatus, error) // CloseIO allows various pipes to be closed on the process CloseIO(context.Context, ...IOCloserOpts) error - // Resize changes the width and heigh of the process's terminal + // Resize changes the width and height of the process's terminal Resize(ctx context.Context, w, h uint32) error // IO returns the io set for the process IO() cio.IO diff --git a/vendor/github.com/containerd/containerd/pull.go b/vendor/github.com/containerd/containerd/pull.go index 693dcafe1..2520639df 100644 --- a/vendor/github.com/containerd/containerd/pull.go +++ b/vendor/github.com/containerd/containerd/pull.go @@ -32,7 +32,7 @@ import ( // Pull downloads the provided content into containerd's content store // and returns a platform specific image object -func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (Image, error) { +func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (_ Image, retErr error) { pullCtx := defaultRemoteContext() for _, o := range opts { if err := o(c, pullCtx); err != nil { @@ -44,7 +44,7 @@ func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (Image if len(pullCtx.Platforms) > 1 { return nil, errors.New("cannot pull multiplatform image locally, try Fetch") } else if len(pullCtx.Platforms) == 0 { - pullCtx.PlatformMatcher = platforms.Default() + pullCtx.PlatformMatcher = c.platform } else { p, err := platforms.Parse(pullCtx.Platforms[0]) if err != nil { @@ -61,6 +61,30 @@ func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (Image } defer done(ctx) + var unpacks int32 + if pullCtx.Unpack { + // unpacker only supports schema 2 image, for schema 1 this is noop. + u, err := c.newUnpacker(ctx, pullCtx) + if err != nil { + return nil, errors.Wrap(err, "create unpacker") + } + unpackWrapper, eg := u.handlerWrapper(ctx, &unpacks) + defer func() { + if err := eg.Wait(); err != nil { + if retErr == nil { + retErr = errors.Wrap(err, "unpack") + } + } + }() + wrapper := pullCtx.HandlerWrapper + pullCtx.HandlerWrapper = func(h images.Handler) images.Handler { + if wrapper == nil { + return unpackWrapper(h) + } + return wrapper(unpackWrapper(h)) + } + } + img, err := c.fetch(ctx, pullCtx, ref, 1) if err != nil { return nil, err @@ -69,8 +93,12 @@ func (c *Client) Pull(ctx context.Context, ref string, opts ...RemoteOpt) (Image i := NewImageWithPlatform(c, img, pullCtx.PlatformMatcher) if pullCtx.Unpack { - if err := i.Unpack(ctx, pullCtx.Snapshotter); err != nil { - return nil, errors.Wrapf(err, "failed to unpack image on snapshotter %s", pullCtx.Snapshotter) + if unpacks == 0 { + // Try to unpack is none is done previously. + // This is at least required for schema 1 image. + if err := i.Unpack(ctx, pullCtx.Snapshotter, pullCtx.UnpackOpts...); err != nil { + return nil, errors.Wrapf(err, "failed to unpack image on snapshotter %s", pullCtx.Snapshotter) + } } } @@ -112,9 +140,14 @@ func (c *Client) fetch(ctx context.Context, rCtx *RemoteContext, ref string, lim childrenHandler := images.ChildrenHandler(store) // Set any children labels for that content childrenHandler = images.SetChildrenLabels(store, childrenHandler) - // Filter manifests by platforms but allow to handle manifest - // and configuration for not-target platforms - childrenHandler = remotes.FilterManifestByPlatformHandler(childrenHandler, rCtx.PlatformMatcher) + if rCtx.AllMetadata { + // Filter manifests by platforms but allow to handle manifest + // and configuration for not-target platforms + childrenHandler = remotes.FilterManifestByPlatformHandler(childrenHandler, rCtx.PlatformMatcher) + } else { + // Filter children by platforms if specified. + childrenHandler = images.FilterPlatforms(childrenHandler, rCtx.PlatformMatcher) + } // Sort and limit manifests if a finite number is needed if limit > 0 { childrenHandler = images.LimitManifests(childrenHandler, rCtx.PlatformMatcher, limit) @@ -131,22 +164,18 @@ func (c *Client) fetch(ctx context.Context, rCtx *RemoteContext, ref string, lim }, ) + appendDistSrcLabelHandler, err := docker.AppendDistributionSourceLabel(store, ref) + if err != nil { + return images.Image{}, err + } + handlers := append(rCtx.BaseHandlers, remotes.FetchHandler(store, fetcher), convertibleHandler, childrenHandler, + appendDistSrcLabelHandler, ) - // append distribution source label to blob data - if rCtx.AppendDistributionSourceLabel { - appendDistSrcLabelHandler, err := docker.AppendDistributionSourceLabel(store, ref) - if err != nil { - return images.Image{}, err - } - - handlers = append(handlers, appendDistSrcLabelHandler) - } - handler = images.Handlers(handlers...) converterFunc = func(ctx context.Context, desc ocispec.Descriptor) (ocispec.Descriptor, error) { diff --git a/vendor/github.com/containerd/containerd/remotes/docker/pusher.go b/vendor/github.com/containerd/containerd/remotes/docker/pusher.go index 7100e11c6..600868467 100644 --- a/vendor/github.com/containerd/containerd/remotes/docker/pusher.go +++ b/vendor/github.com/containerd/containerd/remotes/docker/pusher.go @@ -137,7 +137,6 @@ func (p dockerPusher) Push(ctx context.Context, desc ocispec.Descriptor) (conten // for the private repo, we should remove mount-from // query and send the request again. resp, err = preq.do(pctx) - //resp, err = p.doRequest(pctx, req) if err != nil { return nil, err } diff --git a/vendor/github.com/containerd/containerd/rootfs/diff.go b/vendor/github.com/containerd/containerd/rootfs/diff.go index b3e6ba8a3..f396c73ab 100644 --- a/vendor/github.com/containerd/containerd/rootfs/diff.go +++ b/vendor/github.com/containerd/containerd/rootfs/diff.go @@ -22,6 +22,7 @@ import ( "github.com/containerd/containerd/diff" "github.com/containerd/containerd/mount" + "github.com/containerd/containerd/namespaces" "github.com/containerd/containerd/snapshots" ocispec "github.com/opencontainers/image-spec/specs-go/v1" ) @@ -31,6 +32,13 @@ import ( // the content creation and the provided snapshotter and mount differ are used // for calculating the diff. The descriptor for the layer diff is returned. func CreateDiff(ctx context.Context, snapshotID string, sn snapshots.Snapshotter, d diff.Comparer, opts ...diff.Opt) (ocispec.Descriptor, error) { + // dctx is used to handle cleanup things just in case the param ctx + // has been canceled, which causes that the defer cleanup fails. + dctx := context.Background() + if ns, ok := namespaces.Namespace(ctx); ok { + dctx = namespaces.WithNamespace(dctx, ns) + } + info, err := sn.Stat(ctx, snapshotID) if err != nil { return ocispec.Descriptor{}, err @@ -41,7 +49,7 @@ func CreateDiff(ctx context.Context, snapshotID string, sn snapshots.Snapshotter if err != nil { return ocispec.Descriptor{}, err } - defer sn.Remove(ctx, lowerKey) + defer sn.Remove(dctx, lowerKey) var upper []mount.Mount if info.Kind == snapshots.KindActive { @@ -55,7 +63,7 @@ func CreateDiff(ctx context.Context, snapshotID string, sn snapshots.Snapshotter if err != nil { return ocispec.Descriptor{}, err } - defer sn.Remove(ctx, upperKey) + defer sn.Remove(dctx, upperKey) } return d.Compare(ctx, lower, upper, opts...) diff --git a/vendor/github.com/containerd/containerd/runtime/v1/shim/reaper.go b/vendor/github.com/containerd/containerd/runtime/v1/shim/reaper.go deleted file mode 100644 index 45a88db12..000000000 --- a/vendor/github.com/containerd/containerd/runtime/v1/shim/reaper.go +++ /dev/null @@ -1,109 +0,0 @@ -// +build !windows - -/* - Copyright The containerd Authors. - - Licensed under the Apache License, Version 2.0 (the "License"); - you may not use this file except in compliance with the License. - You may obtain a copy of the License at - - http://www.apache.org/licenses/LICENSE-2.0 - - Unless required by applicable law or agreed to in writing, software - distributed under the License is distributed on an "AS IS" BASIS, - WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. - See the License for the specific language governing permissions and - limitations under the License. -*/ - -package shim - -import ( - "os/exec" - "sync" - "time" - - "github.com/containerd/containerd/sys" - runc "github.com/containerd/go-runc" - "github.com/pkg/errors" -) - -// ErrNoSuchProcess is returned when the process no longer exists -var ErrNoSuchProcess = errors.New("no such process") - -const bufferSize = 2048 - -// Reap should be called when the process receives an SIGCHLD. Reap will reap -// all exited processes and close their wait channels -func Reap() error { - now := time.Now() - exits, err := sys.Reap(false) - Default.Lock() - for c := range Default.subscribers { - for _, e := range exits { - c <- runc.Exit{ - Timestamp: now, - Pid: e.Pid, - Status: e.Status, - } - } - } - Default.Unlock() - return err -} - -// Default is the default monitor initialized for the package -var Default = &Monitor{ - subscribers: make(map[chan runc.Exit]struct{}), -} - -// Monitor monitors the underlying system for process status changes -type Monitor struct { - sync.Mutex - - subscribers map[chan runc.Exit]struct{} -} - -// Start starts the command a registers the process with the reaper -func (m *Monitor) Start(c *exec.Cmd) (chan runc.Exit, error) { - ec := m.Subscribe() - if err := c.Start(); err != nil { - m.Unsubscribe(ec) - return nil, err - } - return ec, nil -} - -// Wait blocks until a process is signal as dead. -// User should rely on the value of the exit status to determine if the -// command was successful or not. -func (m *Monitor) Wait(c *exec.Cmd, ec chan runc.Exit) (int, error) { - for e := range ec { - if e.Pid == c.Process.Pid { - // make sure we flush all IO - c.Wait() - m.Unsubscribe(ec) - return e.Status, nil - } - } - // return no such process if the ec channel is closed and no more exit - // events will be sent - return -1, ErrNoSuchProcess -} - -// Subscribe to process exit changes -func (m *Monitor) Subscribe() chan runc.Exit { - c := make(chan runc.Exit, bufferSize) - m.Lock() - m.subscribers[c] = struct{}{} - m.Unlock() - return c -} - -// Unsubscribe to process exit changes -func (m *Monitor) Unsubscribe(c chan runc.Exit) { - m.Lock() - delete(m.subscribers, c) - close(c) - m.Unlock() -} diff --git a/vendor/github.com/containerd/containerd/runtime/v1/shim/service.go b/vendor/github.com/containerd/containerd/runtime/v1/shim/service.go index f55700135..a722ea1c2 100644 --- a/vendor/github.com/containerd/containerd/runtime/v1/shim/service.go +++ b/vendor/github.com/containerd/containerd/runtime/v1/shim/service.go @@ -40,6 +40,7 @@ import ( "github.com/containerd/containerd/runtime" "github.com/containerd/containerd/runtime/linux/runctypes" shimapi "github.com/containerd/containerd/runtime/v1/shim/v1" + "github.com/containerd/containerd/sys/reaper" runc "github.com/containerd/go-runc" "github.com/containerd/typeurl" ptypes "github.com/gogo/protobuf/types" @@ -86,7 +87,7 @@ func NewService(config Config, publisher events.Publisher) (*Service, error) { context: ctx, processes: make(map[string]process.Process), events: make(chan interface{}, 128), - ec: Default.Subscribe(), + ec: reaper.Default.Subscribe(), } go s.processExits() if err := s.initPlatform(); err != nil { @@ -514,33 +515,35 @@ func (s *Service) allProcesses() []process.Process { } func (s *Service) checkProcesses(e runc.Exit) { - shouldKillAll, err := shouldKillAllOnExit(s.bundle) - if err != nil { - log.G(s.context).WithError(err).Error("failed to check shouldKillAll") - } - for _, p := range s.allProcesses() { - if p.Pid() == e.Pid { + if p.Pid() != e.Pid { + continue + } + if ip, ok := p.(*process.Init); ok { + shouldKillAll, err := shouldKillAllOnExit(s.bundle) + if err != nil { + log.G(s.context).WithError(err).Error("failed to check shouldKillAll") + } + + // Ensure all children are killed if shouldKillAll { - if ip, ok := p.(*process.Init); ok { - // Ensure all children are killed - if err := ip.KillAll(s.context); err != nil { - log.G(s.context).WithError(err).WithField("id", ip.ID()). - Error("failed to kill init's children") - } + if err := ip.KillAll(s.context); err != nil { + log.G(s.context).WithError(err).WithField("id", ip.ID()). + Error("failed to kill init's children") } } - p.SetExited(e.Status) - s.events <- &eventstypes.TaskExit{ - ContainerID: s.id, - ID: p.ID(), - Pid: uint32(e.Pid), - ExitStatus: uint32(e.Status), - ExitedAt: p.ExitedAt(), - } - return } + + p.SetExited(e.Status) + s.events <- &eventstypes.TaskExit{ + ContainerID: s.id, + ID: p.ID(), + Pid: uint32(e.Pid), + ExitStatus: uint32(e.Status), + ExitedAt: p.ExitedAt(), + } + return } } diff --git a/vendor/github.com/containerd/containerd/runtime/v2/README.md b/vendor/github.com/containerd/containerd/runtime/v2/README.md index 51dcafafa..76d30373f 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/README.md +++ b/vendor/github.com/containerd/containerd/runtime/v2/README.md @@ -183,7 +183,7 @@ Current supported schemes for logging are: * file - Linux & Windows * npipe - Windows -Binary logging has the abilty to forward a container's STDIO to an external binary for consumption. +Binary logging has the ability to forward a container's STDIO to an external binary for consumption. A sample logging driver that forwards the container's STDOUT and STDERR to `journald` is: ```go diff --git a/vendor/github.com/containerd/containerd/runtime/v2/binary.go b/vendor/github.com/containerd/containerd/runtime/v2/binary.go index 22869a25c..5e4b85f6a 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/binary.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/binary.go @@ -35,22 +35,24 @@ import ( "github.com/sirupsen/logrus" ) -func shimBinary(ctx context.Context, bundle *Bundle, runtime, containerdAddress string, events *exchange.Exchange, rt *runtime.TaskList) *binary { +func shimBinary(ctx context.Context, bundle *Bundle, runtime, containerdAddress string, containerdTTRPCAddress string, events *exchange.Exchange, rt *runtime.TaskList) *binary { return &binary{ - bundle: bundle, - runtime: runtime, - containerdAddress: containerdAddress, - events: events, - rtTasks: rt, + bundle: bundle, + runtime: runtime, + containerdAddress: containerdAddress, + containerdTTRPCAddress: containerdTTRPCAddress, + events: events, + rtTasks: rt, } } type binary struct { - runtime string - containerdAddress string - bundle *Bundle - events *exchange.Exchange - rtTasks *runtime.TaskList + runtime string + containerdAddress string + containerdTTRPCAddress string + bundle *Bundle + events *exchange.Exchange + rtTasks *runtime.TaskList } func (b *binary) Start(ctx context.Context, opts *types.Any, onClose func()) (_ *shim, err error) { @@ -64,6 +66,7 @@ func (b *binary) Start(ctx context.Context, opts *types.Any, onClose func()) (_ ctx, b.runtime, b.containerdAddress, + b.containerdTTRPCAddress, b.bundle.Path, opts, args..., @@ -85,13 +88,10 @@ func (b *binary) Start(ctx context.Context, opts *types.Any, onClose func()) (_ // copy the shim's logs to containerd's output go func() { defer f.Close() - if _, err := io.Copy(os.Stderr, f); err != nil { - // When using a multi-container shim the 2nd to Nth container in the - // shim will not have a separate log pipe. Ignore the failure log - // message here when the shim connect times out. - if !os.IsNotExist(errors.Cause(err)) { - log.G(ctx).WithError(err).Error("copy shim log") - } + _, err := io.Copy(os.Stderr, f) + err = checkCopyShimLogError(ctx, err) + if err != nil { + log.G(ctx).WithError(err).Error("copy shim log") } }() out, err := cmd.CombinedOutput() @@ -127,6 +127,7 @@ func (b *binary) Delete(ctx context.Context) (*runtime.Exit, error) { cmd, err := client.Command(ctx, b.runtime, b.containerdAddress, + b.containerdTTRPCAddress, bundlePath, nil, "-id", b.bundle.ID, diff --git a/vendor/github.com/containerd/containerd/runtime/v2/manager.go b/vendor/github.com/containerd/containerd/runtime/v2/manager.go index 481a44033..5bd986641 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/manager.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/manager.go @@ -69,25 +69,26 @@ func init() { if err != nil { return nil, err } - return New(ic.Context, ic.Root, ic.State, ic.Address, ic.Events, m.(*metadata.DB)) + return New(ic.Context, ic.Root, ic.State, ic.Address, ic.TTRPCAddress, ic.Events, m.(*metadata.DB)) }, }) } // New task manager for v2 shims -func New(ctx context.Context, root, state, containerdAddress string, events *exchange.Exchange, db *metadata.DB) (*TaskManager, error) { +func New(ctx context.Context, root, state, containerdAddress, containerdTTRPCAddress string, events *exchange.Exchange, db *metadata.DB) (*TaskManager, error) { for _, d := range []string{root, state} { if err := os.MkdirAll(d, 0711); err != nil { return nil, err } } m := &TaskManager{ - root: root, - state: state, - containerdAddress: containerdAddress, - tasks: runtime.NewTaskList(), - events: events, - db: db, + root: root, + state: state, + containerdAddress: containerdAddress, + containerdTTRPCAddress: containerdTTRPCAddress, + tasks: runtime.NewTaskList(), + events: events, + db: db, } if err := m.loadExistingTasks(ctx); err != nil { return nil, err @@ -97,9 +98,10 @@ func New(ctx context.Context, root, state, containerdAddress string, events *exc // TaskManager manages v2 shim's and their tasks type TaskManager struct { - root string - state string - containerdAddress string + root string + state string + containerdAddress string + containerdTTRPCAddress string tasks *runtime.TaskList events *exchange.Exchange @@ -131,7 +133,7 @@ func (m *TaskManager) Create(ctx context.Context, id string, opts runtime.Create topts = opts.RuntimeOptions } - b := shimBinary(ctx, bundle, opts.Runtime, m.containerdAddress, m.events, m.tasks) + b := shimBinary(ctx, bundle, opts.Runtime, m.containerdAddress, m.containerdTTRPCAddress, m.events, m.tasks) shim, err := b.Start(ctx, topts, func() { log.G(ctx).WithField("id", id).Info("shim disconnected") _, err := m.tasks.Get(ctx, id) @@ -254,7 +256,7 @@ func (m *TaskManager) loadTasks(ctx context.Context) error { bundle.Delete() continue } - binaryCall := shimBinary(ctx, bundle, container.Runtime.Name, m.containerdAddress, m.events, m.tasks) + binaryCall := shimBinary(ctx, bundle, container.Runtime.Name, m.containerdAddress, m.containerdTTRPCAddress, m.events, m.tasks) shim, err := loadShim(ctx, bundle, m.events, m.tasks, func() { log.G(ctx).WithField("id", id).Info("shim disconnected") _, err := m.tasks.Get(ctx, id) diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim.go b/vendor/github.com/containerd/containerd/runtime/v2/shim.go index 7014de9ff..6635008dc 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim.go @@ -32,6 +32,7 @@ import ( "github.com/containerd/containerd/identifiers" "github.com/containerd/containerd/log" "github.com/containerd/containerd/namespaces" + "github.com/containerd/containerd/pkg/timeout" "github.com/containerd/containerd/runtime" client "github.com/containerd/containerd/runtime/v2/shim" "github.com/containerd/containerd/runtime/v2/task" @@ -41,6 +42,18 @@ import ( "github.com/sirupsen/logrus" ) +const ( + loadTimeout = "io.containerd.timeout.shim.load" + cleanupTimeout = "io.containerd.timeout.shim.cleanup" + shutdownTimeout = "io.containerd.timeout.shim.shutdown" +) + +func init() { + timeout.Set(loadTimeout, 5*time.Second) + timeout.Set(cleanupTimeout, 5*time.Second) + timeout.Set(shutdownTimeout, 3*time.Second) +} + func loadAddress(path string) (string, error) { data, err := ioutil.ReadFile(path) if err != nil { @@ -100,7 +113,7 @@ func loadShim(ctx context.Context, bundle *Bundle, events *exchange.Exchange, rt events: events, rtTasks: rt, } - ctx, cancel := context.WithTimeout(ctx, 5*time.Second) + ctx, cancel := timeout.WithContext(ctx, loadTimeout) defer cancel() if err := s.Connect(ctx); err != nil { return nil, err @@ -110,7 +123,7 @@ func loadShim(ctx context.Context, bundle *Bundle, events *exchange.Exchange, rt func cleanupAfterDeadShim(ctx context.Context, id, ns string, events *exchange.Exchange, binaryCall *binary) { ctx = namespaces.WithNamespace(ctx, ns) - ctx, cancel := context.WithTimeout(ctx, 5*time.Second) + ctx, cancel := timeout.WithContext(ctx, cleanupTimeout) defer cancel() log.G(ctx).WithFields(logrus.Fields{ @@ -185,7 +198,7 @@ func (s *shim) Shutdown(ctx context.Context) error { } func (s *shim) waitShutdown(ctx context.Context) error { - ctx, cancel := context.WithTimeout(ctx, 3*time.Second) + ctx, cancel := timeout.WithContext(ctx, shutdownTimeout) defer cancel() return s.Shutdown(ctx) } diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/publisher.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/publisher.go index d1f2a0c28..3dbd0e045 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim/publisher.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/publisher.go @@ -41,13 +41,13 @@ type item struct { count int } -func newPublisher(address string) (*remoteEventsPublisher, error) { +func NewPublisher(address string) (*RemoteEventsPublisher, error) { client, err := ttrpcutil.NewClient(address) if err != nil { return nil, err } - l := &remoteEventsPublisher{ + l := &RemoteEventsPublisher{ client: client, closed: make(chan struct{}), requeue: make(chan *item, queueSize), @@ -57,18 +57,18 @@ func newPublisher(address string) (*remoteEventsPublisher, error) { return l, nil } -type remoteEventsPublisher struct { +type RemoteEventsPublisher struct { client *ttrpcutil.Client closed chan struct{} closer sync.Once requeue chan *item } -func (l *remoteEventsPublisher) Done() <-chan struct{} { +func (l *RemoteEventsPublisher) Done() <-chan struct{} { return l.closed } -func (l *remoteEventsPublisher) Close() (err error) { +func (l *RemoteEventsPublisher) Close() (err error) { err = l.client.Close() l.closer.Do(func() { close(l.closed) @@ -76,7 +76,7 @@ func (l *remoteEventsPublisher) Close() (err error) { return err } -func (l *remoteEventsPublisher) processQueue() { +func (l *RemoteEventsPublisher) processQueue() { for i := range l.requeue { if i.count > maxRequeue { logrus.Errorf("evicting %s from queue because of retry count", i.ev.Topic) @@ -91,7 +91,7 @@ func (l *remoteEventsPublisher) processQueue() { } } -func (l *remoteEventsPublisher) queue(i *item) { +func (l *RemoteEventsPublisher) queue(i *item) { go func() { i.count++ // re-queue after a short delay @@ -100,7 +100,7 @@ func (l *remoteEventsPublisher) queue(i *item) { }() } -func (l *remoteEventsPublisher) Publish(ctx context.Context, topic string, event events.Event) error { +func (l *RemoteEventsPublisher) Publish(ctx context.Context, topic string, event events.Event) error { ns, err := namespaces.NamespaceRequired(ctx) if err != nil { return err @@ -127,7 +127,7 @@ func (l *remoteEventsPublisher) Publish(ctx context.Context, topic string, event return nil } -func (l *remoteEventsPublisher) forwardRequest(ctx context.Context, req *v1.ForwardRequest) error { +func (l *RemoteEventsPublisher) forwardRequest(ctx context.Context, req *v1.ForwardRequest) error { _, err := l.client.EventsService().Forward(ctx, req) if err == nil { return nil diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go index 09d3b6018..d540aa87e 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim.go @@ -57,7 +57,7 @@ type Init func(context.Context, string, Publisher, func()) (Shim, error) type Shim interface { shimapi.TaskService Cleanup(ctx context.Context) (*shimapi.DeleteResponse, error) - StartShim(ctx context.Context, id, containerdBinary, containerdAddress string) (string, error) + StartShim(ctx context.Context, id, containerdBinary, containerdAddress, containerdTTRPCAddress string) (string, error) } // OptsKey is the context key for the Opts value. @@ -93,6 +93,10 @@ var ( action string ) +const ( + ttrpcAddressEnv = "TTRPC_ADDRESS" +) + func parseFlags() { flag.BoolVar(&debugFlag, "debug", false, "enable debug output in logs") flag.StringVar(&namespaceFlag, "namespace", "", "namespace that owns the shim") @@ -163,8 +167,9 @@ func run(id string, initFunc Init, config Config) error { } } - address := fmt.Sprintf("%s.ttrpc", addressFlag) - publisher, err := newPublisher(address) + ttrpcAddress := os.Getenv(ttrpcAddressEnv) + + publisher, err := NewPublisher(ttrpcAddress) if err != nil { return err } @@ -203,7 +208,7 @@ func run(id string, initFunc Init, config Config) error { } return nil case "start": - address, err := service.StartShim(ctx, idFlag, containerdBinaryFlag, addressFlag) + address, err := service.StartShim(ctx, idFlag, containerdBinaryFlag, addressFlag, ttrpcAddress) if err != nil { return err } diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go index dc3e6a891..e6dc3e02f 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/shim_unix.go @@ -26,6 +26,7 @@ import ( "os/signal" "syscall" + "github.com/containerd/containerd/sys/reaper" "github.com/containerd/fifo" "github.com/pkg/errors" "github.com/sirupsen/logrus" @@ -79,7 +80,7 @@ func handleSignals(ctx context.Context, logger *logrus.Entry, signals chan os.Si case s := <-signals: switch s { case unix.SIGCHLD: - if err := Reap(); err != nil { + if err := reaper.Reap(); err != nil { logger.WithError(err).Error("reap exit status") } case unix.SIGPIPE: diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/util.go b/vendor/github.com/containerd/containerd/runtime/v2/shim/util.go index 48e1e66d9..c8efd0dac 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim/util.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim/util.go @@ -38,7 +38,7 @@ import ( var runtimePaths sync.Map // Command returns the shim command with the provided args and configuration -func Command(ctx context.Context, runtime, containerdAddress, path string, opts *types.Any, cmdArgs ...string) (*exec.Cmd, error) { +func Command(ctx context.Context, runtime, containerdAddress, containerdTTRPCAddress, path string, opts *types.Any, cmdArgs ...string) (*exec.Cmd, error) { ns, err := namespaces.NamespaceRequired(ctx) if err != nil { return nil, err @@ -95,7 +95,11 @@ func Command(ctx context.Context, runtime, containerdAddress, path string, opts cmd := exec.Command(cmdPath, args...) cmd.Dir = path - cmd.Env = append(os.Environ(), "GOMAXPROCS=2") + cmd.Env = append( + os.Environ(), + "GOMAXPROCS=2", + fmt.Sprintf("%s=%s", ttrpcAddressEnv, containerdTTRPCAddress), + ) cmd.SysProcAttr = getSysProcAttr() if opts != nil { d, err := proto.Marshal(opts) diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim_unix.go b/vendor/github.com/containerd/containerd/runtime/v2/shim_unix.go index 1a08be5d1..242a29d35 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim_unix.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim_unix.go @@ -30,3 +30,17 @@ import ( func openShimLog(ctx context.Context, bundle *Bundle) (io.ReadCloser, error) { return fifo.OpenFifo(ctx, filepath.Join(bundle.Path, "log"), unix.O_RDONLY|unix.O_CREAT|unix.O_NONBLOCK, 0700) } + +func checkCopyShimLogError(ctx context.Context, err error) error { + // When using a multi-container shim, the fifo of the 2nd to Nth + // container will not be opened when the ctx is done. This will + // cause an ErrReadClosed that can be ignored. + select { + case <-ctx.Done(): + if err == fifo.ErrReadClosed { + return nil + } + default: + } + return err +} diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim_windows.go b/vendor/github.com/containerd/containerd/runtime/v2/shim_windows.go index 60a89f1a7..12baef637 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim_windows.go +++ b/vendor/github.com/containerd/containerd/runtime/v2/shim_windows.go @@ -21,6 +21,7 @@ import ( "fmt" "io" "net" + "os" "sync" "time" @@ -85,3 +86,13 @@ func openShimLog(ctx context.Context, bundle *Bundle) (io.ReadCloser, error) { }() return dpc, nil } + +func checkCopyShimLogError(ctx context.Context, err error) error { + // When using a multi-container shim the 2nd to Nth container in the + // shim will not have a separate log pipe. Ignore the failure log + // message here when the shim connect times out. + if os.IsNotExist(errors.Cause(err)) { + return nil + } + return err +} diff --git a/vendor/github.com/containerd/containerd/services/server/config/config.go b/vendor/github.com/containerd/containerd/services/server/config/config.go index 365dfa0fd..ff3771608 100644 --- a/vendor/github.com/containerd/containerd/services/server/config/config.go +++ b/vendor/github.com/containerd/containerd/services/server/config/config.go @@ -17,12 +17,15 @@ package config import ( + "path/filepath" "strings" "github.com/BurntSushi/toml" + "github.com/imdario/mergo" + "github.com/pkg/errors" + "github.com/containerd/containerd/errdefs" "github.com/containerd/containerd/plugin" - "github.com/pkg/errors" ) // Config provides containerd configuration data for the server @@ -37,6 +40,8 @@ type Config struct { PluginDir string `toml:"plugin_dir"` // GRPC configuration settings GRPC GRPCConfig `toml:"grpc"` + // TTRPC configuration settings + TTRPC TTRPCConfig `toml:"ttrpc"` // Debug and profiling settings Debug Debug `toml:"debug"` // Metrics and monitoring settings @@ -55,16 +60,16 @@ type Config struct { Cgroup CgroupConfig `toml:"cgroup"` // ProxyPlugins configures plugins which are communicated to over GRPC ProxyPlugins map[string]ProxyPlugin `toml:"proxy_plugins"` + // Timeouts specified as a duration + Timeouts map[string]string `toml:"timeouts"` + // Imports are additional file path list to config files that can overwrite main config file fields + Imports []string `toml:"imports"` - StreamProcessors []StreamProcessor `toml:"stream_processors"` - - md toml.MetaData + StreamProcessors map[string]StreamProcessor `toml:"stream_processors"` } // StreamProcessor provides configuration for diff content processors type StreamProcessor struct { - // ID of the processor, also used to fetch the specific payload - ID string `toml:"id"` // Accepts specific media-types Accepts []string `toml:"accepts"` // Returns the media-type @@ -103,11 +108,6 @@ func (c *Config) ValidateV2() error { return errors.Errorf("invalid plugin key URI %q expect io.containerd.x.vx", p) } } - for p := range c.ProxyPlugins { - if len(strings.Split(p, ".")) < 4 { - return errors.Errorf("invalid proxy plugin key URI %q expect io.containerd.x.vx", p) - } - } return nil } @@ -123,6 +123,13 @@ type GRPCConfig struct { MaxSendMsgSize int `toml:"max_send_message_size"` } +// TTRPCConfig provides TTRPC configuration for the socket +type TTRPCConfig struct { + Address string `toml:"address"` + UID int `toml:"uid"` + GID int `toml:"gid"` +} + // Debug provides debug configuration type Debug struct { Address string `toml:"address"` @@ -196,23 +203,125 @@ func (c *Config) Decode(p *plugin.Registration) (interface{}, error) { if !ok { return p.Config, nil } - if err := c.md.PrimitiveDecode(data, p.Config); err != nil { + if err := toml.PrimitiveDecode(data, p.Config); err != nil { return nil, err } return p.Config, nil } // LoadConfig loads the containerd server config from the provided path -func LoadConfig(path string, v *Config) error { - if v == nil { - return errors.Wrapf(errdefs.ErrInvalidArgument, "argument v must not be nil") +func LoadConfig(path string, out *Config) error { + if out == nil { + return errors.Wrapf(errdefs.ErrInvalidArgument, "argument out must not be nil") } - md, err := toml.DecodeFile(path, v) + + var ( + loaded = map[string]bool{} + pending = []string{path} + ) + + for len(pending) > 0 { + path, pending = pending[0], pending[1:] + + // Check if a file at the given path already loaded to prevent circular imports + if _, ok := loaded[path]; ok { + continue + } + + config, err := loadConfigFile(path) + if err != nil { + return err + } + + if err := mergeConfig(out, config); err != nil { + return err + } + + imports, err := resolveImports(path, config.Imports) + if err != nil { + return err + } + + loaded[path] = true + pending = append(pending, imports...) + } + + // Fix up the list of config files loaded + out.Imports = []string{} + for path := range loaded { + out.Imports = append(out.Imports, path) + } + + return out.ValidateV2() +} + +// loadConfigFile decodes a TOML file at the given path +func loadConfigFile(path string) (*Config, error) { + config := &Config{} + _, err := toml.DecodeFile(path, &config) + if err != nil { + return nil, err + } + return config, nil +} + +// resolveImports resolves import strings list to absolute paths list: +// - If path contains *, glob pattern matching applied +// - Non abs path is relative to parent config file directory +// - Abs paths returned as is +func resolveImports(parent string, imports []string) ([]string, error) { + var out []string + + for _, path := range imports { + if strings.Contains(path, "*") { + matches, err := filepath.Glob(path) + if err != nil { + return nil, err + } + + out = append(out, matches...) + } else { + path = filepath.Clean(path) + if !filepath.IsAbs(path) { + path = filepath.Join(filepath.Dir(parent), path) + } + + out = append(out, path) + } + } + + return out, nil +} + +// mergeConfig merges Config structs with the following rules: +// 'to' 'from' 'result' +// "" "value" "value" +// "value" "" "value" +// 1 0 1 +// 0 1 1 +// []{"1"} []{"2"} []{"1","2"} +// []{"1"} []{} []{"1"} +// Maps merged by keys, but values are replaced entirely. +func mergeConfig(to, from *Config) error { + err := mergo.Merge(to, from, mergo.WithOverride, mergo.WithAppendSlice) if err != nil { return err } - v.md = md - return v.ValidateV2() + + // Replace entire sections instead of merging map's values. + for k, v := range from.Plugins { + to.Plugins[k] = v + } + + for k, v := range from.StreamProcessors { + to.StreamProcessors[k] = v + } + + for k, v := range from.ProxyPlugins { + to.ProxyPlugins[k] = v + } + + return nil } // V1DisabledFilter matches based on ID diff --git a/vendor/github.com/containerd/containerd/services/server/server.go b/vendor/github.com/containerd/containerd/services/server/server.go index 0e6923918..e31fec5df 100644 --- a/vendor/github.com/containerd/containerd/services/server/server.go +++ b/vendor/github.com/containerd/containerd/services/server/server.go @@ -40,6 +40,7 @@ import ( "github.com/containerd/containerd/log" "github.com/containerd/containerd/metadata" "github.com/containerd/containerd/pkg/dialer" + "github.com/containerd/containerd/pkg/timeout" "github.com/containerd/containerd/plugin" srvconfig "github.com/containerd/containerd/services/server/config" "github.com/containerd/containerd/snapshots" @@ -77,12 +78,19 @@ func New(ctx context.Context, config *srvconfig.Config) (*Server, error) { if err := apply(ctx, config); err != nil { return nil, err } + for key, sec := range config.Timeouts { + d, err := time.ParseDuration(sec) + if err != nil { + return nil, errors.Errorf("unable to parse %s into a time duration", sec) + } + timeout.Set(key, d) + } plugins, err := LoadPlugins(ctx, config) if err != nil { return nil, err } - for _, p := range config.StreamProcessors { - diff.RegisterProcessor(diff.BinaryHandler(p.ID, p.Returns, p.Accepts, p.Path, p.Args)) + for id, p := range config.StreamProcessors { + diff.RegisterProcessor(diff.BinaryHandler(id, p.Returns, p.Accepts, p.Path, p.Args)) } serverOpts := []grpc.ServerOption{ @@ -146,6 +154,7 @@ func New(ctx context.Context, config *srvconfig.Config) (*Server, error) { ) initContext.Events = s.events initContext.Address = config.GRPC.Address + initContext.TTRPCAddress = config.TTRPC.Address // load the plugin specific configuration if it is provided if p.Config != nil { diff --git a/vendor/github.com/containerd/containerd/services/tasks/local.go b/vendor/github.com/containerd/containerd/services/tasks/local.go index 2f17b158c..fc59936de 100644 --- a/vendor/github.com/containerd/containerd/services/tasks/local.go +++ b/vendor/github.com/containerd/containerd/services/tasks/local.go @@ -40,6 +40,7 @@ import ( "github.com/containerd/containerd/log" "github.com/containerd/containerd/metadata" "github.com/containerd/containerd/mount" + "github.com/containerd/containerd/pkg/timeout" "github.com/containerd/containerd/plugin" "github.com/containerd/containerd/runtime" "github.com/containerd/containerd/runtime/linux/runctypes" @@ -61,6 +62,10 @@ var ( empty = &ptypes.Empty{} ) +const ( + stateTimeout = "io.containerd.timeout.task.state" +) + func init() { plugin.Register(&plugin.Registration{ Type: plugin.ServicePlugin, @@ -68,6 +73,8 @@ func init() { Requires: tasksServiceRequires, InitFn: initFunc, }) + + timeout.Set(stateTimeout, 2*time.Second) } func initFunc(ic *plugin.InitContext) (interface{}, error) { @@ -266,7 +273,7 @@ func (l *local) DeleteProcess(ctx context.Context, r *api.DeleteProcessRequest, } func getProcessState(ctx context.Context, p runtime.Process) (*task.Process, error) { - ctx, cancel := context.WithTimeout(ctx, 2*time.Second) + ctx, cancel := timeout.WithContext(ctx, stateTimeout) defer cancel() state, err := p.State(ctx) diff --git a/vendor/github.com/containerd/containerd/runtime/v2/shim/reaper_unix.go b/vendor/github.com/containerd/containerd/sys/reaper/reaper_unix.go similarity index 56% rename from vendor/github.com/containerd/containerd/runtime/v2/shim/reaper_unix.go rename to vendor/github.com/containerd/containerd/sys/reaper/reaper_unix.go index 45a88db12..baab9740b 100644 --- a/vendor/github.com/containerd/containerd/runtime/v2/shim/reaper_unix.go +++ b/vendor/github.com/containerd/containerd/sys/reaper/reaper_unix.go @@ -16,7 +16,7 @@ limitations under the License. */ -package shim +package reaper import ( "os/exec" @@ -31,37 +31,61 @@ import ( // ErrNoSuchProcess is returned when the process no longer exists var ErrNoSuchProcess = errors.New("no such process") -const bufferSize = 2048 +const bufferSize = 32 + +type subscriber struct { + sync.Mutex + c chan runc.Exit + closed bool +} + +func (s *subscriber) close() { + s.Lock() + if s.closed { + s.Unlock() + return + } + close(s.c) + s.closed = true + s.Unlock() +} + +func (s *subscriber) do(fn func()) { + s.Lock() + fn() + s.Unlock() +} // Reap should be called when the process receives an SIGCHLD. Reap will reap // all exited processes and close their wait channels func Reap() error { now := time.Now() exits, err := sys.Reap(false) - Default.Lock() - for c := range Default.subscribers { - for _, e := range exits { - c <- runc.Exit{ - Timestamp: now, - Pid: e.Pid, - Status: e.Status, - } + for _, e := range exits { + done := Default.notify(runc.Exit{ + Timestamp: now, + Pid: e.Pid, + Status: e.Status, + }) + + select { + case <-done: + case <-time.After(1 * time.Second): } } - Default.Unlock() return err } // Default is the default monitor initialized for the package var Default = &Monitor{ - subscribers: make(map[chan runc.Exit]struct{}), + subscribers: make(map[chan runc.Exit]*subscriber), } // Monitor monitors the underlying system for process status changes type Monitor struct { sync.Mutex - subscribers map[chan runc.Exit]struct{} + subscribers map[chan runc.Exit]*subscriber } // Start starts the command a registers the process with the reaper @@ -95,7 +119,9 @@ func (m *Monitor) Wait(c *exec.Cmd, ec chan runc.Exit) (int, error) { func (m *Monitor) Subscribe() chan runc.Exit { c := make(chan runc.Exit, bufferSize) m.Lock() - m.subscribers[c] = struct{}{} + m.subscribers[c] = &subscriber{ + c: c, + } m.Unlock() return c } @@ -103,7 +129,74 @@ func (m *Monitor) Subscribe() chan runc.Exit { // Unsubscribe to process exit changes func (m *Monitor) Unsubscribe(c chan runc.Exit) { m.Lock() + s, ok := m.subscribers[c] + if !ok { + m.Unlock() + return + } + s.close() delete(m.subscribers, c) - close(c) m.Unlock() } + +func (m *Monitor) getSubscribers() map[chan runc.Exit]*subscriber { + out := make(map[chan runc.Exit]*subscriber) + m.Lock() + for k, v := range m.subscribers { + out[k] = v + } + m.Unlock() + return out +} + +func (m *Monitor) notify(e runc.Exit) chan struct{} { + const timeout = 1 * time.Millisecond + var ( + done = make(chan struct{}, 1) + timer = time.NewTimer(timeout) + success = make(map[chan runc.Exit]struct{}) + ) + stop(timer, true) + + go func() { + defer close(done) + + for { + var ( + failed int + subscribers = m.getSubscribers() + ) + for _, s := range subscribers { + s.do(func() { + if s.closed { + return + } + if _, ok := success[s.c]; ok { + return + } + timer.Reset(timeout) + recv := true + select { + case s.c <- e: + success[s.c] = struct{}{} + case <-timer.C: + recv = false + failed++ + } + stop(timer, recv) + }) + } + // all subscribers received the message + if failed == 0 { + return + } + } + }() + return done +} + +func stop(timer *time.Timer, recv bool) { + if !timer.Stop() && recv { + <-timer.C + } +} diff --git a/vendor/github.com/containerd/containerd/unpacker.go b/vendor/github.com/containerd/containerd/unpacker.go new file mode 100644 index 000000000..790c06c8d --- /dev/null +++ b/vendor/github.com/containerd/containerd/unpacker.go @@ -0,0 +1,247 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package containerd + +import ( + "context" + "encoding/json" + "fmt" + "sync" + "sync/atomic" + + "github.com/containerd/containerd/content" + "github.com/containerd/containerd/images" + "github.com/containerd/containerd/log" + "github.com/containerd/containerd/rootfs" + "github.com/opencontainers/go-digest" + "github.com/opencontainers/image-spec/identity" + ocispec "github.com/opencontainers/image-spec/specs-go/v1" + "github.com/pkg/errors" + "github.com/sirupsen/logrus" + "golang.org/x/sync/errgroup" +) + +type layerState struct { + layer rootfs.Layer + downloaded bool + unpacked bool +} + +type unpacker struct { + updateCh chan ocispec.Descriptor + snapshotter string + config UnpackConfig + c *Client +} + +func (c *Client) newUnpacker(ctx context.Context, rCtx *RemoteContext) (*unpacker, error) { + snapshotter, err := c.resolveSnapshotterName(ctx, rCtx.Snapshotter) + if err != nil { + return nil, err + } + var config UnpackConfig + for _, o := range rCtx.UnpackOpts { + if err := o(ctx, &config); err != nil { + return nil, err + } + } + return &unpacker{ + updateCh: make(chan ocispec.Descriptor, 128), + snapshotter: snapshotter, + config: config, + c: c, + }, nil +} + +func (u *unpacker) unpack(ctx context.Context, config ocispec.Descriptor, layers []ocispec.Descriptor) error { + p, err := content.ReadBlob(ctx, u.c.ContentStore(), config) + if err != nil { + return err + } + + var i ocispec.Image + if err := json.Unmarshal(p, &i); err != nil { + return errors.Wrap(err, "unmarshal image config") + } + diffIDs := i.RootFS.DiffIDs + if len(layers) != len(diffIDs) { + return errors.Errorf("number of layers and diffIDs don't match: %d != %d", len(layers), len(diffIDs)) + } + + var ( + sn = u.c.SnapshotService(u.snapshotter) + a = u.c.DiffService() + cs = u.c.ContentStore() + + states []layerState + chain []digest.Digest + ) + for i, desc := range layers { + states = append(states, layerState{ + layer: rootfs.Layer{ + Blob: desc, + Diff: ocispec.Descriptor{ + MediaType: ocispec.MediaTypeImageLayer, + Digest: diffIDs[i], + }, + }, + }) + } + for { + var layer ocispec.Descriptor + select { + case layer = <-u.updateCh: + case <-ctx.Done(): + return ctx.Err() + } + log.G(ctx).WithField("desc", layer).Debug("layer downloaded") + for i := range states { + if states[i].layer.Blob.Digest != layer.Digest { + continue + } + // Different layers may have the same digest. When that + // happens, we should continue marking the next layer + // as downloaded. + if states[i].downloaded { + continue + } + states[i].downloaded = true + break + } + for i := range states { + if !states[i].downloaded { + break + } + if states[i].unpacked { + continue + } + + log.G(ctx).WithFields(logrus.Fields{ + "desc": states[i].layer.Blob, + "diff": states[i].layer.Diff, + }).Debug("unpack layer") + + unpacked, err := rootfs.ApplyLayerWithOpts(ctx, states[i].layer, chain, sn, a, + u.config.SnapshotOpts, u.config.ApplyOpts) + if err != nil { + return err + } + + if unpacked { + // Set the uncompressed label after the uncompressed + // digest has been verified through apply. + cinfo := content.Info{ + Digest: states[i].layer.Blob.Digest, + Labels: map[string]string{ + "containerd.io/uncompressed": states[i].layer.Diff.Digest.String(), + }, + } + if _, err := cs.Update(ctx, cinfo, "labels.containerd.io/uncompressed"); err != nil { + return err + } + } + + chain = append(chain, states[i].layer.Diff.Digest) + states[i].unpacked = true + log.G(ctx).WithFields(logrus.Fields{ + "desc": states[i].layer.Blob, + "diff": states[i].layer.Diff, + }).Debug("layer unpacked") + } + // Check whether all layers are unpacked. + if states[len(states)-1].unpacked { + break + } + } + + chainID := identity.ChainID(chain).String() + cinfo := content.Info{ + Digest: config.Digest, + Labels: map[string]string{ + fmt.Sprintf("containerd.io/gc.ref.snapshot.%s", u.snapshotter): chainID, + }, + } + _, err = cs.Update(ctx, cinfo, fmt.Sprintf("labels.containerd.io/gc.ref.snapshot.%s", u.snapshotter)) + if err != nil { + return err + } + log.G(ctx).WithFields(logrus.Fields{ + "config": config.Digest, + "chainID": chainID, + }).Debug("image unpacked") + return nil +} + +func (u *unpacker) handlerWrapper(uctx context.Context, unpacks *int32) (func(images.Handler) images.Handler, *errgroup.Group) { + eg, uctx := errgroup.WithContext(uctx) + return func(f images.Handler) images.Handler { + var ( + lock sync.Mutex + layers []ocispec.Descriptor + schema1 bool + ) + return images.HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { + children, err := f.Handle(ctx, desc) + if err != nil { + return children, err + } + + // `Pull` only supports one platform, so there is only + // one manifest to handle, and manifest list can be + // safely skipped. + // TODO: support multi-platform unpack. + switch desc.MediaType { + case images.MediaTypeDockerSchema1Manifest: + lock.Lock() + schema1 = true + lock.Unlock() + case images.MediaTypeDockerSchema2Manifest, ocispec.MediaTypeImageManifest: + lock.Lock() + for _, child := range children { + if child.MediaType == images.MediaTypeDockerSchema2Config || + child.MediaType == ocispec.MediaTypeImageConfig { + continue + } + layers = append(layers, child) + } + lock.Unlock() + case images.MediaTypeDockerSchema2Config, ocispec.MediaTypeImageConfig: + lock.Lock() + l := append([]ocispec.Descriptor{}, layers...) + lock.Unlock() + if len(l) > 0 { + atomic.AddInt32(unpacks, 1) + eg.Go(func() error { + return u.unpack(uctx, desc, l) + }) + } + case images.MediaTypeDockerSchema2Layer, images.MediaTypeDockerSchema2LayerGzip, + images.MediaTypeDockerSchema2LayerForeign, images.MediaTypeDockerSchema2LayerForeignGzip, + ocispec.MediaTypeImageLayer, ocispec.MediaTypeImageLayerGzip, + ocispec.MediaTypeImageLayerNonDistributable, ocispec.MediaTypeImageLayerNonDistributableGzip, + images.MediaTypeDockerSchema2LayerEnc, images.MediaTypeDockerSchema2LayerGzipEnc: + lock.Lock() + update := !schema1 + lock.Unlock() + if update { + u.updateCh <- desc + } + } + return children, nil + }) + }, eg +} diff --git a/vendor/github.com/containerd/containerd/vendor.conf b/vendor/github.com/containerd/containerd/vendor.conf index edb2f4ea3..0ebeca571 100644 --- a/vendor/github.com/containerd/containerd/vendor.conf +++ b/vendor/github.com/containerd/containerd/vendor.conf @@ -2,9 +2,9 @@ github.com/containerd/go-runc 9007c2405372fe28918845901a3276c0915689a1 github.com/containerd/console 0650fd9eeb50bab4fc99dceb9f2e14cf58f36e7f github.com/containerd/cgroups c4b9ac5c7601384c965b9646fc515884e091ebb9 github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40 -github.com/containerd/fifo 3d5202aec260678c48179c56f40e6f38a095738c +github.com/containerd/fifo bda0ff6ed73c67bfb5e62bc9c697f146b7fd7f13 github.com/containerd/btrfs af5082808c833de0e79c1e72eea9fea239364877 -github.com/containerd/continuity bd77b46c8352f74eb12c85bdc01f4b90f69d66b4 +github.com/containerd/continuity f2a389ac0a02ce21c09edd7344677a601970f41c github.com/coreos/go-systemd 48702e0da86bd25e76cfef347e2adeb434a0d0a6 github.com/docker/go-metrics 4ea375f7759c82740c893fc030bc37088d2ec098 github.com/docker/go-events 9461782956ad83b30282bf90e31fa6a70c255ba9 @@ -25,37 +25,40 @@ github.com/konsorten/go-windows-terminal-sequences v1.0.1 github.com/sirupsen/logrus v1.4.1 github.com/urfave/cli 7bc6a0acffa589f415f88aca16cc1de5ffd66f9c golang.org/x/net f3200d17e092c607f615320ecaad13d87ad9a2b3 -google.golang.org/grpc 25c4f928eaa6d96443009bd842389fb4fa48664e # v1.20.1 +google.golang.org/grpc 6eaf6f47437a6b4e2153a190160ef39a92c7eceb # v1.23.0 github.com/pkg/errors v0.8.1 github.com/opencontainers/go-digest c9281466c8b2f606084ac71339773efd177436e7 -golang.org/x/sys 4c4f7f33c9ed00de01c4c741d2177abfcfe19307 https://github.com/golang/sys +golang.org/x/sys 9eafafc0a87e0fd0aeeba439a4573537970c44c7 https://github.com/golang/sys github.com/opencontainers/image-spec v1.0.1 golang.org/x/sync 42b317875d0fa942474b76e1b46a6060d720ae6e github.com/BurntSushi/toml v0.3.1 github.com/grpc-ecosystem/go-grpc-prometheus 6b7015e65d366bf3f19b2b2a000a831940f0f7e0 github.com/Microsoft/go-winio v0.4.14 -github.com/Microsoft/hcsshim 8abdbb8205e4192c68b5f84c31197156f31be517 +github.com/Microsoft/hcsshim 9e921883ac929bbe515b39793ece99ce3a9d7706 google.golang.org/genproto d80a6e20e776b0b17a324d0ba1ab50a39c8e8944 golang.org/x/text 19e51611da83d6be54ddafce4a4af510cb3e9ea4 -github.com/containerd/ttrpc 1fb3814edf44a76e0ccf503decf726d994919a9a +github.com/containerd/ttrpc 92c8520ef9f86600c650dd540266a007bf03670f github.com/syndtr/gocapability d98352740cb2c55f81556b63d4a1ec64c5a319c2 gotest.tools v2.3.0 github.com/google/go-cmp v0.2.0 -go.etcd.io/bbolt 2eb7227adea1d5cf85f0bc2a82b7059b13c2fa68 +go.etcd.io/bbolt v1.3.3 +github.com/hashicorp/errwrap v1.0.0 +github.com/hashicorp/go-multierror v1.0.0 +github.com/hashicorp/golang-lru v0.5.3 +go.opencensus.io v0.22.0 +github.com/imdario/mergo v0.3.7 # cri dependencies -github.com/containerd/cri b213648c5bd0a1d2ee42709c10dff63fbfee3ad7 # master -github.com/containerd/go-cni 22460c018b64cf8bf4151b3ff9c4d077e6a88cbf -github.com/containernetworking/cni v0.6.0 -github.com/containernetworking/plugins v0.7.0 -github.com/davecgh/go-spew v1.1.0 +github.com/containerd/cri 0165d516161e25e52b4ab52a404a00823f8f0ef6 # master +github.com/containerd/go-cni 49fbd9b210f3c8ee3b7fd3cd797aabaf364627c1 +github.com/containernetworking/cni v0.7.1 +github.com/containernetworking/plugins v0.7.6 +github.com/davecgh/go-spew v1.1.1 github.com/docker/distribution 0d3efadf0154c2b8a4e7b6621fff9809655cc580 github.com/docker/docker 86f080cff0914e9694068ed78d503701667c4c00 github.com/docker/spdystream 449fdfce4d962303d702fec724ef0ad181c92528 github.com/emicklei/go-restful v2.2.1 -github.com/google/gofuzz 44d81051d367757e1c7c6a5a86423ece9afcf63c -github.com/hashicorp/errwrap 7554cd9344cec97297fa6649b055a8c98c2a1e55 -github.com/hashicorp/go-multierror ed905158d87462226a13fe39ddf685ea65f1c11f +github.com/google/gofuzz 24818f796faf91cd76ec7bddd72458fbced7a6c1 github.com/json-iterator/go 1.1.5 github.com/modern-go/reflect2 1.0.1 github.com/modern-go/concurrent 1.0.3 @@ -63,9 +66,9 @@ github.com/opencontainers/selinux v1.2.2 github.com/seccomp/libseccomp-golang v0.9.1 github.com/tchap/go-patricia v2.2.6 golang.org/x/crypto 88737f569e3a9c7ab309cdc09a07fe7fc87233c3 -golang.org/x/oauth2 a6bd8cefa1811bd24b86f8902872e4e8225f74c4 +golang.org/x/oauth2 9f3314589c9a9136388751d9adae6b0ed400978a golang.org/x/time f51c12702a4d776e4c1fa9b0fabab841babae631 -gopkg.in/inf.v0 3887ee99ecf07df5b447e9b00d9c0b2adaa9f3e4 +gopkg.in/inf.v0 v0.9.0 gopkg.in/yaml.v2 v2.2.1 k8s.io/api kubernetes-1.15.0 k8s.io/apimachinery kubernetes-1.15.0 @@ -78,14 +81,9 @@ k8s.io/utils c2654d5206da6b7b6ace12841e8f359bb89b443c sigs.k8s.io/yaml v1.1.0 # zfs dependencies -github.com/containerd/zfs 31af176f2ae84fe142ef2655bf7bb2aa618b3b1f +github.com/containerd/zfs 2ceb2dbb8154202ed1b8fd32e4ea25b491d7b251 github.com/mistifyio/go-zfs f784269be439d704d3dfa1906f45dd848fed2beb github.com/google/uuid v1.1.1 # aufs dependencies github.com/containerd/aufs f894a800659b6e11c1a13084abd1712f346e349c - -# image encryption dependencies -gopkg.in/square/go-jose.v2 8254d6c783765f38c8675fae4427a1fe73fbd09d https://github.com/square/go-jose.git -github.com/fullsailor/pkcs7 8306686428a5fe132eac8cb7c4848af725098bd4 -github.com/miscreant/miscreant-go 325cbd69228b6af571a635f7502586a920a2749a https://github.com/miscreant/miscreant.go diff --git a/vendor/github.com/containerd/continuity/LICENSE b/vendor/github.com/containerd/continuity/LICENSE index 8f71f43fe..584149b6e 100644 --- a/vendor/github.com/containerd/continuity/LICENSE +++ b/vendor/github.com/containerd/continuity/LICENSE @@ -1,6 +1,7 @@ + Apache License Version 2.0, January 2004 - http://www.apache.org/licenses/ + https://www.apache.org/licenses/ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION @@ -175,28 +176,16 @@ END OF TERMS AND CONDITIONS - APPENDIX: How to apply the Apache License to your work. - - To apply the Apache License to your work, attach the following - boilerplate notice, with the fields enclosed by brackets "{}" - replaced with your own identifying information. (Don't include - the brackets!) The text should be enclosed in the appropriate - comment syntax for the file format. We also recommend that a - file or class name and description of purpose be included on the - same "printed page" as the copyright notice for easier - identification within third-party archives. - - Copyright {yyyy} {name of copyright owner} + Copyright The containerd Authors Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at - http://www.apache.org/licenses/LICENSE-2.0 + https://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. - diff --git a/vendor/github.com/containerd/continuity/README.md b/vendor/github.com/containerd/continuity/README.md index 0e91ce07b..f9f9ef0f9 100644 --- a/vendor/github.com/containerd/continuity/README.md +++ b/vendor/github.com/containerd/continuity/README.md @@ -72,3 +72,13 @@ If you change the proto file you will need to rebuild the generated Go with `go ```console $ go generate ./proto ``` + +## Project details + +continuity is a containerd sub-project, licensed under the [Apache 2.0 license](./LICENSE). +As a containerd sub-project, you will find the: + * [Project governance](https://github.com/containerd/project/blob/master/GOVERNANCE.md), + * [Maintainers](https://github.com/containerd/project/blob/master/MAINTAINERS), + * and [Contributing guidelines](https://github.com/containerd/project/blob/master/CONTRIBUTING.md) + +information in our [`containerd/project`](https://github.com/containerd/project) repository. diff --git a/vendor/github.com/containerd/continuity/fs/copy.go b/vendor/github.com/containerd/continuity/fs/copy.go index 42df6a9a5..ad61022ad 100644 --- a/vendor/github.com/containerd/continuity/fs/copy.go +++ b/vendor/github.com/containerd/continuity/fs/copy.go @@ -32,14 +32,49 @@ var bufferPool = &sync.Pool{ }, } -// CopyDir copies the directory from src to dst. -// Most efficient copy of files is attempted. -func CopyDir(dst, src string) error { - inodes := map[uint64]string{} - return copyDirectory(dst, src, inodes) +// XAttrErrorHandlers transform a non-nil xattr error. +// Return nil to ignore an error. +// xattrKey can be empty for listxattr operation. +type XAttrErrorHandler func(dst, src, xattrKey string, err error) error + +type copyDirOpts struct { + xeh XAttrErrorHandler } -func copyDirectory(dst, src string, inodes map[uint64]string) error { +type CopyDirOpt func(*copyDirOpts) error + +// WithXAttrErrorHandler allows specifying XAttrErrorHandler +// If nil XAttrErrorHandler is specified (default), CopyDir stops +// on a non-nil xattr error. +func WithXAttrErrorHandler(xeh XAttrErrorHandler) CopyDirOpt { + return func(o *copyDirOpts) error { + o.xeh = xeh + return nil + } +} + +// WithAllowXAttrErrors allows ignoring xattr errors. +func WithAllowXAttrErrors() CopyDirOpt { + xeh := func(dst, src, xattrKey string, err error) error { + return nil + } + return WithXAttrErrorHandler(xeh) +} + +// CopyDir copies the directory from src to dst. +// Most efficient copy of files is attempted. +func CopyDir(dst, src string, opts ...CopyDirOpt) error { + var o copyDirOpts + for _, opt := range opts { + if err := opt(&o); err != nil { + return err + } + } + inodes := map[uint64]string{} + return copyDirectory(dst, src, inodes, &o) +} + +func copyDirectory(dst, src string, inodes map[uint64]string, o *copyDirOpts) error { stat, err := os.Stat(src) if err != nil { return errors.Wrapf(err, "failed to stat %s", src) @@ -75,7 +110,7 @@ func copyDirectory(dst, src string, inodes map[uint64]string) error { switch { case fi.IsDir(): - if err := copyDirectory(target, source, inodes); err != nil { + if err := copyDirectory(target, source, inodes, o); err != nil { return err } continue @@ -111,7 +146,7 @@ func copyDirectory(dst, src string, inodes map[uint64]string) error { return errors.Wrap(err, "failed to copy file info") } - if err := copyXAttrs(target, source); err != nil { + if err := copyXAttrs(target, source, o.xeh); err != nil { return errors.Wrap(err, "failed to copy xattrs") } } diff --git a/vendor/github.com/containerd/continuity/fs/copy_linux.go b/vendor/github.com/containerd/continuity/fs/copy_linux.go index e041b5661..81c71522a 100644 --- a/vendor/github.com/containerd/continuity/fs/copy_linux.go +++ b/vendor/github.com/containerd/continuity/fs/copy_linux.go @@ -59,6 +59,8 @@ func copyFileInfo(fi os.FileInfo, name string) error { return nil } +const maxSSizeT = int64(^uint(0) >> 1) + func copyFileContent(dst, src *os.File) error { st, err := src.Stat() if err != nil { @@ -71,7 +73,16 @@ func copyFileContent(dst, src *os.File) error { dstFd := int(dst.Fd()) for size > 0 { - n, err := unix.CopyFileRange(srcFd, nil, dstFd, nil, int(size), 0) + // Ensure that we are never trying to copy more than SSIZE_MAX at a + // time and at the same time avoids overflows when the file is larger + // than 4GB on 32-bit systems. + var copySize int + if size > maxSSizeT { + copySize = int(maxSSizeT) + } else { + copySize = int(size) + } + n, err := unix.CopyFileRange(srcFd, nil, dstFd, nil, copySize, 0) if err != nil { if (err != unix.ENOSYS && err != unix.EXDEV) || !first { return errors.Wrap(err, "copy file range failed") @@ -90,18 +101,34 @@ func copyFileContent(dst, src *os.File) error { return nil } -func copyXAttrs(dst, src string) error { +func copyXAttrs(dst, src string, xeh XAttrErrorHandler) error { xattrKeys, err := sysx.LListxattr(src) if err != nil { - return errors.Wrapf(err, "failed to list xattrs on %s", src) + e := errors.Wrapf(err, "failed to list xattrs on %s", src) + if xeh != nil { + e = xeh(dst, src, "", e) + } + return e } for _, xattr := range xattrKeys { data, err := sysx.LGetxattr(src, xattr) if err != nil { - return errors.Wrapf(err, "failed to get xattr %q on %s", xattr, src) + e := errors.Wrapf(err, "failed to get xattr %q on %s", xattr, src) + if xeh != nil { + if e = xeh(dst, src, xattr, e); e == nil { + continue + } + } + return e } if err := sysx.LSetxattr(dst, xattr, data, 0); err != nil { - return errors.Wrapf(err, "failed to set xattr %q on %s", xattr, dst) + e := errors.Wrapf(err, "failed to set xattr %q on %s", xattr, dst) + if xeh != nil { + if e = xeh(dst, src, xattr, e); e == nil { + continue + } + } + return e } } diff --git a/vendor/github.com/containerd/continuity/fs/copy_unix.go b/vendor/github.com/containerd/continuity/fs/copy_unix.go index 1a8ae5ebd..73c01a46d 100644 --- a/vendor/github.com/containerd/continuity/fs/copy_unix.go +++ b/vendor/github.com/containerd/continuity/fs/copy_unix.go @@ -69,18 +69,34 @@ func copyFileContent(dst, src *os.File) error { return err } -func copyXAttrs(dst, src string) error { +func copyXAttrs(dst, src string, xeh XAttrErrorHandler) error { xattrKeys, err := sysx.LListxattr(src) if err != nil { - return errors.Wrapf(err, "failed to list xattrs on %s", src) + e := errors.Wrapf(err, "failed to list xattrs on %s", src) + if xeh != nil { + e = xeh(dst, src, "", e) + } + return e } for _, xattr := range xattrKeys { data, err := sysx.LGetxattr(src, xattr) if err != nil { - return errors.Wrapf(err, "failed to get xattr %q on %s", xattr, src) + e := errors.Wrapf(err, "failed to get xattr %q on %s", xattr, src) + if xeh != nil { + if e = xeh(dst, src, xattr, e); e == nil { + continue + } + } + return e } if err := sysx.LSetxattr(dst, xattr, data, 0); err != nil { - return errors.Wrapf(err, "failed to set xattr %q on %s", xattr, dst) + e := errors.Wrapf(err, "failed to set xattr %q on %s", xattr, dst) + if xeh != nil { + if e = xeh(dst, src, xattr, e); e == nil { + continue + } + } + return e } } diff --git a/vendor/github.com/containerd/continuity/fs/copy_windows.go b/vendor/github.com/containerd/continuity/fs/copy_windows.go index be8e6489b..27c7d7dbb 100644 --- a/vendor/github.com/containerd/continuity/fs/copy_windows.go +++ b/vendor/github.com/containerd/continuity/fs/copy_windows.go @@ -40,7 +40,7 @@ func copyFileContent(dst, src *os.File) error { return err } -func copyXAttrs(dst, src string) error { +func copyXAttrs(dst, src string, xeh XAttrErrorHandler) error { return nil } diff --git a/vendor/github.com/containerd/continuity/fs/path.go b/vendor/github.com/containerd/continuity/fs/path.go index 995981780..8863caa9d 100644 --- a/vendor/github.com/containerd/continuity/fs/path.go +++ b/vendor/github.com/containerd/continuity/fs/path.go @@ -22,7 +22,6 @@ import ( "io" "os" "path/filepath" - "strings" "github.com/pkg/errors" ) @@ -47,9 +46,8 @@ func pathChange(lower, upper *currentPath) (ChangeKind, string) { if upper == nil { return ChangeKindDelete, lower.path } - // TODO: compare by directory - switch i := strings.Compare(lower.path, upper.path); { + switch i := directoryCompare(lower.path, upper.path); { case i < 0: // File in lower that is not in upper return ChangeKindDelete, lower.path @@ -61,6 +59,35 @@ func pathChange(lower, upper *currentPath) (ChangeKind, string) { } } +func directoryCompare(a, b string) int { + l := len(a) + if len(b) < l { + l = len(b) + } + for i := 0; i < l; i++ { + c1, c2 := a[i], b[i] + if c1 == filepath.Separator { + c1 = byte(0) + } + if c2 == filepath.Separator { + c2 = byte(0) + } + if c1 < c2 { + return -1 + } + if c1 > c2 { + return +1 + } + } + if len(a) < len(b) { + return -1 + } + if len(a) > len(b) { + return +1 + } + return 0 +} + func sameFile(f1, f2 *currentPath) (bool, error) { if os.SameFile(f1.f, f2.f) { return true, nil diff --git a/vendor/github.com/containerd/fifo/errors.go b/vendor/github.com/containerd/fifo/errors.go new file mode 100644 index 000000000..d2ff3e8b6 --- /dev/null +++ b/vendor/github.com/containerd/fifo/errors.go @@ -0,0 +1,30 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "errors" +) + +var ( + ErrClosed = errors.New("fifo closed") + ErrCtrlClosed = errors.New("control of closed fifo") + ErrRdFrmWRONLY = errors.New("reading from write-only fifo") + ErrReadClosed = errors.New("reading from a closed fifo") + ErrWrToRDONLY = errors.New("writing to read-only fifo") + ErrWriteClosed = errors.New("writing to a closed fifo") +) diff --git a/vendor/github.com/containerd/fifo/fifo.go b/vendor/github.com/containerd/fifo/fifo.go index e79813da7..7a2d18c74 100644 --- a/vendor/github.com/containerd/fifo/fifo.go +++ b/vendor/github.com/containerd/fifo/fifo.go @@ -147,7 +147,7 @@ func OpenFifo(ctx context.Context, fn string, flag int, perm os.FileMode) (io.Re // Read from a fifo to a byte array. func (f *fifo) Read(b []byte) (int, error) { if f.flag&syscall.O_WRONLY > 0 { - return 0, errors.New("reading from write-only fifo") + return 0, ErrRdFrmWRONLY } select { case <-f.opened: @@ -158,14 +158,14 @@ func (f *fifo) Read(b []byte) (int, error) { case <-f.opened: return f.file.Read(b) case <-f.closed: - return 0, errors.New("reading from a closed fifo") + return 0, ErrReadClosed } } // Write from byte array to a fifo. func (f *fifo) Write(b []byte) (int, error) { if f.flag&(syscall.O_WRONLY|syscall.O_RDWR) == 0 { - return 0, errors.New("writing to read-only fifo") + return 0, ErrWrToRDONLY } select { case <-f.opened: @@ -176,7 +176,7 @@ func (f *fifo) Write(b []byte) (int, error) { case <-f.opened: return f.file.Write(b) case <-f.closed: - return 0, errors.New("writing to a closed fifo") + return 0, ErrWriteClosed } } diff --git a/vendor/github.com/containerd/fifo/raw.go b/vendor/github.com/containerd/fifo/raw.go new file mode 100644 index 000000000..27b8976cd --- /dev/null +++ b/vendor/github.com/containerd/fifo/raw.go @@ -0,0 +1,114 @@ +// +build go1.12 + +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + +package fifo + +import ( + "syscall" +) + +// SyscallConn provides raw access to the fifo's underlying filedescrptor. +// See syscall.Conn for guarentees provided by this interface. +func (f *fifo) SyscallConn() (syscall.RawConn, error) { + // deterministic check for closed + select { + case <-f.closed: + return nil, ErrClosed + default: + } + + select { + case <-f.closed: + return nil, ErrClosed + case <-f.opened: + return f.file.SyscallConn() + default: + } + + // Not opened and not closed, this means open is non-blocking AND it's not open yet + // Use rawConn to deal with non-blocking open. + rc := &rawConn{f: f, ready: make(chan struct{})} + go func() { + select { + case <-f.closed: + return + case <-f.opened: + rc.raw, rc.err = f.file.SyscallConn() + close(rc.ready) + } + }() + + return rc, nil +} + +type rawConn struct { + f *fifo + ready chan struct{} + raw syscall.RawConn + err error +} + +func (r *rawConn) Control(f func(fd uintptr)) error { + select { + case <-r.f.closed: + return ErrCtrlClosed + case <-r.ready: + } + + if r.err != nil { + return r.err + } + + return r.raw.Control(f) +} + +func (r *rawConn) Read(f func(fd uintptr) (done bool)) error { + if r.f.flag&syscall.O_WRONLY > 0 { + return ErrRdFrmWRONLY + } + + select { + case <-r.f.closed: + return ErrReadClosed + case <-r.ready: + } + + if r.err != nil { + return r.err + } + + return r.raw.Read(f) +} + +func (r *rawConn) Write(f func(fd uintptr) (done bool)) error { + if r.f.flag&(syscall.O_WRONLY|syscall.O_RDWR) == 0 { + return ErrWrToRDONLY + } + + select { + case <-r.f.closed: + return ErrWriteClosed + case <-r.ready: + } + + if r.err != nil { + return r.err + } + + return r.raw.Write(f) +} diff --git a/vendor/github.com/containerd/fifo/readme.md b/vendor/github.com/containerd/fifo/readme.md index 2b41b3b1c..30e233cc6 100644 --- a/vendor/github.com/containerd/fifo/readme.md +++ b/vendor/github.com/containerd/fifo/readme.md @@ -1,6 +1,7 @@ ### fifo [![Build Status](https://travis-ci.org/containerd/fifo.svg?branch=master)](https://travis-ci.org/containerd/fifo) +[![codecov](https://codecov.io/gh/containerd/fifo/branch/master/graph/badge.svg)](https://codecov.io/gh/containerd/fifo) Go package for handling fifos in a sane way. @@ -30,3 +31,14 @@ func (f *fifo) Write(b []byte) (int, error) // before open(2) has returned and fifo was never opened. func (f *fifo) Close() error ``` + +## Project details + +The fifo is a containerd sub-project, licensed under the [Apache 2.0 license](./LICENSE). +As a containerd sub-project, you will find the: + + * [Project governance](https://github.com/containerd/project/blob/master/GOVERNANCE.md), + * [Maintainers](https://github.com/containerd/project/blob/master/MAINTAINERS), + * and [Contributing guidelines](https://github.com/containerd/project/blob/master/CONTRIBUTING.md) + +information in our [`containerd/project`](https://github.com/containerd/project) repository. diff --git a/vendor/github.com/containerd/ttrpc/client.go b/vendor/github.com/containerd/ttrpc/client.go index 9db15fe69..bdd1d12e7 100644 --- a/vendor/github.com/containerd/ttrpc/client.go +++ b/vendor/github.com/containerd/ttrpc/client.go @@ -29,6 +29,7 @@ import ( "github.com/gogo/protobuf/proto" "github.com/pkg/errors" "github.com/sirupsen/logrus" + "google.golang.org/grpc/codes" "google.golang.org/grpc/status" ) @@ -134,11 +135,10 @@ func (c *Client) Call(ctx context.Context, service, method string, req, resp int return err } - if cresp.Status == nil { - return errors.New("no status provided on response") + if cresp.Status != nil && cresp.Status.Code != int32(codes.OK) { + return status.ErrorProto(cresp.Status) } - - return status.ErrorProto(cresp.Status) + return nil } func (c *Client) dispatch(ctx context.Context, req *Request, resp *Response) error { diff --git a/vendor/github.com/containerd/ttrpc/services.go b/vendor/github.com/containerd/ttrpc/services.go index 655b2caea..0eacfd79a 100644 --- a/vendor/github.com/containerd/ttrpc/services.go +++ b/vendor/github.com/containerd/ttrpc/services.go @@ -152,5 +152,5 @@ func convertCode(err error) codes.Code { } func fullPath(service, method string) string { - return "/" + path.Join("/", service, method) + return "/" + path.Join(service, method) } diff --git a/vendor/github.com/hashicorp/golang-lru/LICENSE b/vendor/github.com/hashicorp/golang-lru/LICENSE new file mode 100644 index 000000000..be2cc4dfb --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/LICENSE @@ -0,0 +1,362 @@ +Mozilla Public License, version 2.0 + +1. Definitions + +1.1. "Contributor" + + means each individual or legal entity that creates, contributes to the + creation of, or owns Covered Software. + +1.2. "Contributor Version" + + means the combination of the Contributions of others (if any) used by a + Contributor and that particular Contributor's Contribution. + +1.3. "Contribution" + + means Covered Software of a particular Contributor. + +1.4. "Covered Software" + + means Source Code Form to which the initial Contributor has attached the + notice in Exhibit A, the Executable Form of such Source Code Form, and + Modifications of such Source Code Form, in each case including portions + thereof. + +1.5. "Incompatible With Secondary Licenses" + means + + a. that the initial Contributor has attached the notice described in + Exhibit B to the Covered Software; or + + b. that the Covered Software was made available under the terms of + version 1.1 or earlier of the License, but not also under the terms of + a Secondary License. + +1.6. "Executable Form" + + means any form of the work other than Source Code Form. + +1.7. "Larger Work" + + means a work that combines Covered Software with other material, in a + separate file or files, that is not Covered Software. + +1.8. "License" + + means this document. + +1.9. "Licensable" + + means having the right to grant, to the maximum extent possible, whether + at the time of the initial grant or subsequently, any and all of the + rights conveyed by this License. + +1.10. "Modifications" + + means any of the following: + + a. any file in Source Code Form that results from an addition to, + deletion from, or modification of the contents of Covered Software; or + + b. any new file in Source Code Form that contains any Covered Software. + +1.11. "Patent Claims" of a Contributor + + means any patent claim(s), including without limitation, method, + process, and apparatus claims, in any patent Licensable by such + Contributor that would be infringed, but for the grant of the License, + by the making, using, selling, offering for sale, having made, import, + or transfer of either its Contributions or its Contributor Version. + +1.12. "Secondary License" + + means either the GNU General Public License, Version 2.0, the GNU Lesser + General Public License, Version 2.1, the GNU Affero General Public + License, Version 3.0, or any later versions of those licenses. + +1.13. "Source Code Form" + + means the form of the work preferred for making modifications. + +1.14. "You" (or "Your") + + means an individual or a legal entity exercising rights under this + License. For legal entities, "You" includes any entity that controls, is + controlled by, or is under common control with You. For purposes of this + definition, "control" means (a) the power, direct or indirect, to cause + the direction or management of such entity, whether by contract or + otherwise, or (b) ownership of more than fifty percent (50%) of the + outstanding shares or beneficial ownership of such entity. + + +2. License Grants and Conditions + +2.1. Grants + + Each Contributor hereby grants You a world-wide, royalty-free, + non-exclusive license: + + a. under intellectual property rights (other than patent or trademark) + Licensable by such Contributor to use, reproduce, make available, + modify, display, perform, distribute, and otherwise exploit its + Contributions, either on an unmodified basis, with Modifications, or + as part of a Larger Work; and + + b. under Patent Claims of such Contributor to make, use, sell, offer for + sale, have made, import, and otherwise transfer either its + Contributions or its Contributor Version. + +2.2. Effective Date + + The licenses granted in Section 2.1 with respect to any Contribution + become effective for each Contribution on the date the Contributor first + distributes such Contribution. + +2.3. Limitations on Grant Scope + + The licenses granted in this Section 2 are the only rights granted under + this License. No additional rights or licenses will be implied from the + distribution or licensing of Covered Software under this License. + Notwithstanding Section 2.1(b) above, no patent license is granted by a + Contributor: + + a. for any code that a Contributor has removed from Covered Software; or + + b. for infringements caused by: (i) Your and any other third party's + modifications of Covered Software, or (ii) the combination of its + Contributions with other software (except as part of its Contributor + Version); or + + c. under Patent Claims infringed by Covered Software in the absence of + its Contributions. + + This License does not grant any rights in the trademarks, service marks, + or logos of any Contributor (except as may be necessary to comply with + the notice requirements in Section 3.4). + +2.4. Subsequent Licenses + + No Contributor makes additional grants as a result of Your choice to + distribute the Covered Software under a subsequent version of this + License (see Section 10.2) or under the terms of a Secondary License (if + permitted under the terms of Section 3.3). + +2.5. Representation + + Each Contributor represents that the Contributor believes its + Contributions are its original creation(s) or it has sufficient rights to + grant the rights to its Contributions conveyed by this License. + +2.6. Fair Use + + This License is not intended to limit any rights You have under + applicable copyright doctrines of fair use, fair dealing, or other + equivalents. + +2.7. Conditions + + Sections 3.1, 3.2, 3.3, and 3.4 are conditions of the licenses granted in + Section 2.1. + + +3. Responsibilities + +3.1. Distribution of Source Form + + All distribution of Covered Software in Source Code Form, including any + Modifications that You create or to which You contribute, must be under + the terms of this License. You must inform recipients that the Source + Code Form of the Covered Software is governed by the terms of this + License, and how they can obtain a copy of this License. You may not + attempt to alter or restrict the recipients' rights in the Source Code + Form. + +3.2. Distribution of Executable Form + + If You distribute Covered Software in Executable Form then: + + a. such Covered Software must also be made available in Source Code Form, + as described in Section 3.1, and You must inform recipients of the + Executable Form how they can obtain a copy of such Source Code Form by + reasonable means in a timely manner, at a charge no more than the cost + of distribution to the recipient; and + + b. You may distribute such Executable Form under the terms of this + License, or sublicense it under different terms, provided that the + license for the Executable Form does not attempt to limit or alter the + recipients' rights in the Source Code Form under this License. + +3.3. Distribution of a Larger Work + + You may create and distribute a Larger Work under terms of Your choice, + provided that You also comply with the requirements of this License for + the Covered Software. If the Larger Work is a combination of Covered + Software with a work governed by one or more Secondary Licenses, and the + Covered Software is not Incompatible With Secondary Licenses, this + License permits You to additionally distribute such Covered Software + under the terms of such Secondary License(s), so that the recipient of + the Larger Work may, at their option, further distribute the Covered + Software under the terms of either this License or such Secondary + License(s). + +3.4. Notices + + You may not remove or alter the substance of any license notices + (including copyright notices, patent notices, disclaimers of warranty, or + limitations of liability) contained within the Source Code Form of the + Covered Software, except that You may alter any license notices to the + extent required to remedy known factual inaccuracies. + +3.5. Application of Additional Terms + + You may choose to offer, and to charge a fee for, warranty, support, + indemnity or liability obligations to one or more recipients of Covered + Software. However, You may do so only on Your own behalf, and not on + behalf of any Contributor. You must make it absolutely clear that any + such warranty, support, indemnity, or liability obligation is offered by + You alone, and You hereby agree to indemnify every Contributor for any + liability incurred by such Contributor as a result of warranty, support, + indemnity or liability terms You offer. You may include additional + disclaimers of warranty and limitations of liability specific to any + jurisdiction. + +4. Inability to Comply Due to Statute or Regulation + + If it is impossible for You to comply with any of the terms of this License + with respect to some or all of the Covered Software due to statute, + judicial order, or regulation then You must: (a) comply with the terms of + this License to the maximum extent possible; and (b) describe the + limitations and the code they affect. Such description must be placed in a + text file included with all distributions of the Covered Software under + this License. Except to the extent prohibited by statute or regulation, + such description must be sufficiently detailed for a recipient of ordinary + skill to be able to understand it. + +5. Termination + +5.1. The rights granted under this License will terminate automatically if You + fail to comply with any of its terms. However, if You become compliant, + then the rights granted under this License from a particular Contributor + are reinstated (a) provisionally, unless and until such Contributor + explicitly and finally terminates Your grants, and (b) on an ongoing + basis, if such Contributor fails to notify You of the non-compliance by + some reasonable means prior to 60 days after You have come back into + compliance. Moreover, Your grants from a particular Contributor are + reinstated on an ongoing basis if such Contributor notifies You of the + non-compliance by some reasonable means, this is the first time You have + received notice of non-compliance with this License from such + Contributor, and You become compliant prior to 30 days after Your receipt + of the notice. + +5.2. If You initiate litigation against any entity by asserting a patent + infringement claim (excluding declaratory judgment actions, + counter-claims, and cross-claims) alleging that a Contributor Version + directly or indirectly infringes any patent, then the rights granted to + You by any and all Contributors for the Covered Software under Section + 2.1 of this License shall terminate. + +5.3. In the event of termination under Sections 5.1 or 5.2 above, all end user + license agreements (excluding distributors and resellers) which have been + validly granted by You or Your distributors under this License prior to + termination shall survive termination. + +6. Disclaimer of Warranty + + Covered Software is provided under this License on an "as is" basis, + without warranty of any kind, either expressed, implied, or statutory, + including, without limitation, warranties that the Covered Software is free + of defects, merchantable, fit for a particular purpose or non-infringing. + The entire risk as to the quality and performance of the Covered Software + is with You. Should any Covered Software prove defective in any respect, + You (not any Contributor) assume the cost of any necessary servicing, + repair, or correction. This disclaimer of warranty constitutes an essential + part of this License. No use of any Covered Software is authorized under + this License except under this disclaimer. + +7. Limitation of Liability + + Under no circumstances and under no legal theory, whether tort (including + negligence), contract, or otherwise, shall any Contributor, or anyone who + distributes Covered Software as permitted above, be liable to You for any + direct, indirect, special, incidental, or consequential damages of any + character including, without limitation, damages for lost profits, loss of + goodwill, work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses, even if such party shall have been + informed of the possibility of such damages. This limitation of liability + shall not apply to liability for death or personal injury resulting from + such party's negligence to the extent applicable law prohibits such + limitation. Some jurisdictions do not allow the exclusion or limitation of + incidental or consequential damages, so this exclusion and limitation may + not apply to You. + +8. Litigation + + Any litigation relating to this License may be brought only in the courts + of a jurisdiction where the defendant maintains its principal place of + business and such litigation shall be governed by laws of that + jurisdiction, without reference to its conflict-of-law provisions. Nothing + in this Section shall prevent a party's ability to bring cross-claims or + counter-claims. + +9. Miscellaneous + + This License represents the complete agreement concerning the subject + matter hereof. If any provision of this License is held to be + unenforceable, such provision shall be reformed only to the extent + necessary to make it enforceable. Any law or regulation which provides that + the language of a contract shall be construed against the drafter shall not + be used to construe this License against a Contributor. + + +10. Versions of the License + +10.1. New Versions + + Mozilla Foundation is the license steward. Except as provided in Section + 10.3, no one other than the license steward has the right to modify or + publish new versions of this License. Each version will be given a + distinguishing version number. + +10.2. Effect of New Versions + + You may distribute the Covered Software under the terms of the version + of the License under which You originally received the Covered Software, + or under the terms of any subsequent version published by the license + steward. + +10.3. Modified Versions + + If you create software not governed by this License, and you want to + create a new license for such software, you may create and use a + modified version of this License if you rename the license and remove + any references to the name of the license steward (except to note that + such modified license differs from this License). + +10.4. Distributing Source Code Form that is Incompatible With Secondary + Licenses If You choose to distribute Source Code Form that is + Incompatible With Secondary Licenses under the terms of this version of + the License, the notice described in Exhibit B of this License must be + attached. + +Exhibit A - Source Code Form License Notice + + This Source Code Form is subject to the + terms of the Mozilla Public License, v. + 2.0. If a copy of the MPL was not + distributed with this file, You can + obtain one at + http://mozilla.org/MPL/2.0/. + +If it is not possible or desirable to put the notice in a particular file, +then You may include the notice in a location (such as a LICENSE file in a +relevant directory) where a recipient would be likely to look for such a +notice. + +You may add additional accurate notices of copyright ownership. + +Exhibit B - "Incompatible With Secondary Licenses" Notice + + This Source Code Form is "Incompatible + With Secondary Licenses", as defined by + the Mozilla Public License, v. 2.0. diff --git a/vendor/github.com/hashicorp/golang-lru/README.md b/vendor/github.com/hashicorp/golang-lru/README.md new file mode 100644 index 000000000..33e58cfaf --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/README.md @@ -0,0 +1,25 @@ +golang-lru +========== + +This provides the `lru` package which implements a fixed-size +thread safe LRU cache. It is based on the cache in Groupcache. + +Documentation +============= + +Full docs are available on [Godoc](http://godoc.org/github.com/hashicorp/golang-lru) + +Example +======= + +Using the LRU is very simple: + +```go +l, _ := New(128) +for i := 0; i < 256; i++ { + l.Add(i, nil) +} +if l.Len() != 128 { + panic(fmt.Sprintf("bad len: %v", l.Len())) +} +``` diff --git a/vendor/github.com/hashicorp/golang-lru/go.mod b/vendor/github.com/hashicorp/golang-lru/go.mod new file mode 100644 index 000000000..8ad8826b3 --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/go.mod @@ -0,0 +1,3 @@ +module github.com/hashicorp/golang-lru + +go 1.12 diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go new file mode 100644 index 000000000..a86c8539e --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru.go @@ -0,0 +1,177 @@ +package simplelru + +import ( + "container/list" + "errors" +) + +// EvictCallback is used to get a callback when a cache entry is evicted +type EvictCallback func(key interface{}, value interface{}) + +// LRU implements a non-thread safe fixed size LRU cache +type LRU struct { + size int + evictList *list.List + items map[interface{}]*list.Element + onEvict EvictCallback +} + +// entry is used to hold a value in the evictList +type entry struct { + key interface{} + value interface{} +} + +// NewLRU constructs an LRU of the given size +func NewLRU(size int, onEvict EvictCallback) (*LRU, error) { + if size <= 0 { + return nil, errors.New("Must provide a positive size") + } + c := &LRU{ + size: size, + evictList: list.New(), + items: make(map[interface{}]*list.Element), + onEvict: onEvict, + } + return c, nil +} + +// Purge is used to completely clear the cache. +func (c *LRU) Purge() { + for k, v := range c.items { + if c.onEvict != nil { + c.onEvict(k, v.Value.(*entry).value) + } + delete(c.items, k) + } + c.evictList.Init() +} + +// Add adds a value to the cache. Returns true if an eviction occurred. +func (c *LRU) Add(key, value interface{}) (evicted bool) { + // Check for existing item + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + ent.Value.(*entry).value = value + return false + } + + // Add new item + ent := &entry{key, value} + entry := c.evictList.PushFront(ent) + c.items[key] = entry + + evict := c.evictList.Len() > c.size + // Verify size not exceeded + if evict { + c.removeOldest() + } + return evict +} + +// Get looks up a key's value from the cache. +func (c *LRU) Get(key interface{}) (value interface{}, ok bool) { + if ent, ok := c.items[key]; ok { + c.evictList.MoveToFront(ent) + if ent.Value.(*entry) == nil { + return nil, false + } + return ent.Value.(*entry).value, true + } + return +} + +// Contains checks if a key is in the cache, without updating the recent-ness +// or deleting it for being stale. +func (c *LRU) Contains(key interface{}) (ok bool) { + _, ok = c.items[key] + return ok +} + +// Peek returns the key value (or undefined if not found) without updating +// the "recently used"-ness of the key. +func (c *LRU) Peek(key interface{}) (value interface{}, ok bool) { + var ent *list.Element + if ent, ok = c.items[key]; ok { + return ent.Value.(*entry).value, true + } + return nil, ok +} + +// Remove removes the provided key from the cache, returning if the +// key was contained. +func (c *LRU) Remove(key interface{}) (present bool) { + if ent, ok := c.items[key]; ok { + c.removeElement(ent) + return true + } + return false +} + +// RemoveOldest removes the oldest item from the cache. +func (c *LRU) RemoveOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// GetOldest returns the oldest entry +func (c *LRU) GetOldest() (key interface{}, value interface{}, ok bool) { + ent := c.evictList.Back() + if ent != nil { + kv := ent.Value.(*entry) + return kv.key, kv.value, true + } + return nil, nil, false +} + +// Keys returns a slice of the keys in the cache, from oldest to newest. +func (c *LRU) Keys() []interface{} { + keys := make([]interface{}, len(c.items)) + i := 0 + for ent := c.evictList.Back(); ent != nil; ent = ent.Prev() { + keys[i] = ent.Value.(*entry).key + i++ + } + return keys +} + +// Len returns the number of items in the cache. +func (c *LRU) Len() int { + return c.evictList.Len() +} + +// Resize changes the cache size. +func (c *LRU) Resize(size int) (evicted int) { + diff := c.Len() - size + if diff < 0 { + diff = 0 + } + for i := 0; i < diff; i++ { + c.removeOldest() + } + c.size = size + return diff +} + +// removeOldest removes the oldest item from the cache. +func (c *LRU) removeOldest() { + ent := c.evictList.Back() + if ent != nil { + c.removeElement(ent) + } +} + +// removeElement is used to remove a given list element from the cache +func (c *LRU) removeElement(e *list.Element) { + c.evictList.Remove(e) + kv := e.Value.(*entry) + delete(c.items, kv.key) + if c.onEvict != nil { + c.onEvict(kv.key, kv.value) + } +} diff --git a/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go new file mode 100644 index 000000000..92d70934d --- /dev/null +++ b/vendor/github.com/hashicorp/golang-lru/simplelru/lru_interface.go @@ -0,0 +1,39 @@ +package simplelru + +// LRUCache is the interface for simple LRU cache. +type LRUCache interface { + // Adds a value to the cache, returns true if an eviction occurred and + // updates the "recently used"-ness of the key. + Add(key, value interface{}) bool + + // Returns key's value from the cache and + // updates the "recently used"-ness of the key. #value, isFound + Get(key interface{}) (value interface{}, ok bool) + + // Checks if a key exists in cache without updating the recent-ness. + Contains(key interface{}) (ok bool) + + // Returns key's value without updating the "recently used"-ness of the key. + Peek(key interface{}) (value interface{}, ok bool) + + // Removes a key from the cache. + Remove(key interface{}) bool + + // Removes the oldest entry from cache. + RemoveOldest() (interface{}, interface{}, bool) + + // Returns the oldest entry from the cache. #key, value, isFound + GetOldest() (interface{}, interface{}, bool) + + // Returns a slice of the keys in the cache, from oldest to newest. + Keys() []interface{} + + // Returns the number of items in the cache. + Len() int + + // Clears all cache entries. + Purge() + + // Resizes cache, returning number evicted + Resize(int) int +} diff --git a/vendor/github.com/imdario/mergo/LICENSE b/vendor/github.com/imdario/mergo/LICENSE new file mode 100644 index 000000000..686680298 --- /dev/null +++ b/vendor/github.com/imdario/mergo/LICENSE @@ -0,0 +1,28 @@ +Copyright (c) 2013 Dario Castañé. All rights reserved. +Copyright (c) 2012 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/imdario/mergo/README.md b/vendor/github.com/imdario/mergo/README.md new file mode 100644 index 000000000..02fc81e06 --- /dev/null +++ b/vendor/github.com/imdario/mergo/README.md @@ -0,0 +1,238 @@ +# Mergo + +A helper to merge structs and maps in Golang. Useful for configuration default values, avoiding messy if-statements. + +Also a lovely [comune](http://en.wikipedia.org/wiki/Mergo) (municipality) in the Province of Ancona in the Italian region of Marche. + +## Status + +It is ready for production use. [It is used in several projects by Docker, Google, The Linux Foundation, VMWare, Shopify, etc](https://github.com/imdario/mergo#mergo-in-the-wild). + +[![GoDoc][3]][4] +[![GoCard][5]][6] +[![Build Status][1]][2] +[![Coverage Status][7]][8] +[![Sourcegraph][9]][10] +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fimdario%2Fmergo.svg?type=shield)](https://app.fossa.io/projects/git%2Bgithub.com%2Fimdario%2Fmergo?ref=badge_shield) + +[1]: https://travis-ci.org/imdario/mergo.png +[2]: https://travis-ci.org/imdario/mergo +[3]: https://godoc.org/github.com/imdario/mergo?status.svg +[4]: https://godoc.org/github.com/imdario/mergo +[5]: https://goreportcard.com/badge/imdario/mergo +[6]: https://goreportcard.com/report/github.com/imdario/mergo +[7]: https://coveralls.io/repos/github/imdario/mergo/badge.svg?branch=master +[8]: https://coveralls.io/github/imdario/mergo?branch=master +[9]: https://sourcegraph.com/github.com/imdario/mergo/-/badge.svg +[10]: https://sourcegraph.com/github.com/imdario/mergo?badge + +### Latest release + +[Release v0.3.7](https://github.com/imdario/mergo/releases/tag/v0.3.7). + +### Important note + +Please keep in mind that in [0.3.2](//github.com/imdario/mergo/releases/tag/0.3.2) Mergo changed `Merge()`and `Map()` signatures to support [transformers](#transformers). An optional/variadic argument has been added, so it won't break existing code. + +If you were using Mergo **before** April 6th 2015, please check your project works as intended after updating your local copy with ```go get -u github.com/imdario/mergo```. I apologize for any issue caused by its previous behavior and any future bug that Mergo could cause (I hope it won't!) in existing projects after the change (release 0.2.0). + +### Donations + +If Mergo is useful to you, consider buying me a coffee, a beer or making a monthly donation so I can keep building great free software. :heart_eyes: + +Buy Me a Coffee at ko-fi.com +[![Beerpay](https://beerpay.io/imdario/mergo/badge.svg)](https://beerpay.io/imdario/mergo) +[![Beerpay](https://beerpay.io/imdario/mergo/make-wish.svg)](https://beerpay.io/imdario/mergo) +Donate using Liberapay + +### Mergo in the wild + +- [moby/moby](https://github.com/moby/moby) +- [kubernetes/kubernetes](https://github.com/kubernetes/kubernetes) +- [vmware/dispatch](https://github.com/vmware/dispatch) +- [Shopify/themekit](https://github.com/Shopify/themekit) +- [imdario/zas](https://github.com/imdario/zas) +- [matcornic/hermes](https://github.com/matcornic/hermes) +- [OpenBazaar/openbazaar-go](https://github.com/OpenBazaar/openbazaar-go) +- [kataras/iris](https://github.com/kataras/iris) +- [michaelsauter/crane](https://github.com/michaelsauter/crane) +- [go-task/task](https://github.com/go-task/task) +- [sensu/uchiwa](https://github.com/sensu/uchiwa) +- [ory/hydra](https://github.com/ory/hydra) +- [sisatech/vcli](https://github.com/sisatech/vcli) +- [dairycart/dairycart](https://github.com/dairycart/dairycart) +- [projectcalico/felix](https://github.com/projectcalico/felix) +- [resin-os/balena](https://github.com/resin-os/balena) +- [go-kivik/kivik](https://github.com/go-kivik/kivik) +- [Telefonica/govice](https://github.com/Telefonica/govice) +- [supergiant/supergiant](supergiant/supergiant) +- [SergeyTsalkov/brooce](https://github.com/SergeyTsalkov/brooce) +- [soniah/dnsmadeeasy](https://github.com/soniah/dnsmadeeasy) +- [ohsu-comp-bio/funnel](https://github.com/ohsu-comp-bio/funnel) +- [EagerIO/Stout](https://github.com/EagerIO/Stout) +- [lynndylanhurley/defsynth-api](https://github.com/lynndylanhurley/defsynth-api) +- [russross/canvasassignments](https://github.com/russross/canvasassignments) +- [rdegges/cryptly-api](https://github.com/rdegges/cryptly-api) +- [casualjim/exeggutor](https://github.com/casualjim/exeggutor) +- [divshot/gitling](https://github.com/divshot/gitling) +- [RWJMurphy/gorl](https://github.com/RWJMurphy/gorl) +- [andrerocker/deploy42](https://github.com/andrerocker/deploy42) +- [elwinar/rambler](https://github.com/elwinar/rambler) +- [tmaiaroto/gopartman](https://github.com/tmaiaroto/gopartman) +- [jfbus/impressionist](https://github.com/jfbus/impressionist) +- [Jmeyering/zealot](https://github.com/Jmeyering/zealot) +- [godep-migrator/rigger-host](https://github.com/godep-migrator/rigger-host) +- [Dronevery/MultiwaySwitch-Go](https://github.com/Dronevery/MultiwaySwitch-Go) +- [thoas/picfit](https://github.com/thoas/picfit) +- [mantasmatelis/whooplist-server](https://github.com/mantasmatelis/whooplist-server) +- [jnuthong/item_search](https://github.com/jnuthong/item_search) +- [bukalapak/snowboard](https://github.com/bukalapak/snowboard) + +## Installation + + go get github.com/imdario/mergo + + // use in your .go code + import ( + "github.com/imdario/mergo" + ) + +## Usage + +You can only merge same-type structs with exported fields initialized as zero value of their type and same-types maps. Mergo won't merge unexported (private) fields but will do recursively any exported one. It won't merge empty structs value as [they are not considered zero values](https://golang.org/ref/spec#The_zero_value) either. Also maps will be merged recursively except for structs inside maps (because they are not addressable using Go reflection). + +```go +if err := mergo.Merge(&dst, src); err != nil { + // ... +} +``` + +Also, you can merge overwriting values using the transformer `WithOverride`. + +```go +if err := mergo.Merge(&dst, src, mergo.WithOverride); err != nil { + // ... +} +``` + +Additionally, you can map a `map[string]interface{}` to a struct (and otherwise, from struct to map), following the same restrictions as in `Merge()`. Keys are capitalized to find each corresponding exported field. + +```go +if err := mergo.Map(&dst, srcMap); err != nil { + // ... +} +``` + +Warning: if you map a struct to map, it won't do it recursively. Don't expect Mergo to map struct members of your struct as `map[string]interface{}`. They will be just assigned as values. + +More information and examples in [godoc documentation](http://godoc.org/github.com/imdario/mergo). + +### Nice example + +```go +package main + +import ( + "fmt" + "github.com/imdario/mergo" +) + +type Foo struct { + A string + B int64 +} + +func main() { + src := Foo{ + A: "one", + B: 2, + } + dest := Foo{ + A: "two", + } + mergo.Merge(&dest, src) + fmt.Println(dest) + // Will print + // {two 2} +} +``` + +Note: if test are failing due missing package, please execute: + + go get gopkg.in/yaml.v2 + +### Transformers + +Transformers allow to merge specific types differently than in the default behavior. In other words, now you can customize how some types are merged. For example, `time.Time` is a struct; it doesn't have zero value but IsZero can return true because it has fields with zero value. How can we merge a non-zero `time.Time`? + +```go +package main + +import ( + "fmt" + "github.com/imdario/mergo" + "reflect" + "time" +) + +type timeTransfomer struct { +} + +func (t timeTransfomer) Transformer(typ reflect.Type) func(dst, src reflect.Value) error { + if typ == reflect.TypeOf(time.Time{}) { + return func(dst, src reflect.Value) error { + if dst.CanSet() { + isZero := dst.MethodByName("IsZero") + result := isZero.Call([]reflect.Value{}) + if result[0].Bool() { + dst.Set(src) + } + } + return nil + } + } + return nil +} + +type Snapshot struct { + Time time.Time + // ... +} + +func main() { + src := Snapshot{time.Now()} + dest := Snapshot{} + mergo.Merge(&dest, src, mergo.WithTransformers(timeTransfomer{})) + fmt.Println(dest) + // Will print + // { 2018-01-12 01:15:00 +0000 UTC m=+0.000000001 } +} +``` + + +## Contact me + +If I can help you, you have an idea or you are using Mergo in your projects, don't hesitate to drop me a line (or a pull request): [@im_dario](https://twitter.com/im_dario) + +## About + +Written by [Dario Castañé](http://dario.im). + +## Top Contributors + +[![0](https://sourcerer.io/fame/imdario/imdario/mergo/images/0)](https://sourcerer.io/fame/imdario/imdario/mergo/links/0) +[![1](https://sourcerer.io/fame/imdario/imdario/mergo/images/1)](https://sourcerer.io/fame/imdario/imdario/mergo/links/1) +[![2](https://sourcerer.io/fame/imdario/imdario/mergo/images/2)](https://sourcerer.io/fame/imdario/imdario/mergo/links/2) +[![3](https://sourcerer.io/fame/imdario/imdario/mergo/images/3)](https://sourcerer.io/fame/imdario/imdario/mergo/links/3) +[![4](https://sourcerer.io/fame/imdario/imdario/mergo/images/4)](https://sourcerer.io/fame/imdario/imdario/mergo/links/4) +[![5](https://sourcerer.io/fame/imdario/imdario/mergo/images/5)](https://sourcerer.io/fame/imdario/imdario/mergo/links/5) +[![6](https://sourcerer.io/fame/imdario/imdario/mergo/images/6)](https://sourcerer.io/fame/imdario/imdario/mergo/links/6) +[![7](https://sourcerer.io/fame/imdario/imdario/mergo/images/7)](https://sourcerer.io/fame/imdario/imdario/mergo/links/7) + + +## License + +[BSD 3-Clause](http://opensource.org/licenses/BSD-3-Clause) license, as [Go language](http://golang.org/LICENSE). + + +[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bgithub.com%2Fimdario%2Fmergo.svg?type=large)](https://app.fossa.io/projects/git%2Bgithub.com%2Fimdario%2Fmergo?ref=badge_large) diff --git a/vendor/github.com/imdario/mergo/doc.go b/vendor/github.com/imdario/mergo/doc.go new file mode 100644 index 000000000..6e9aa7baf --- /dev/null +++ b/vendor/github.com/imdario/mergo/doc.go @@ -0,0 +1,44 @@ +// Copyright 2013 Dario Castañé. All rights reserved. +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +/* +Package mergo merges same-type structs and maps by setting default values in zero-value fields. + +Mergo won't merge unexported (private) fields but will do recursively any exported one. It also won't merge structs inside maps (because they are not addressable using Go reflection). + +Usage + +From my own work-in-progress project: + + type networkConfig struct { + Protocol string + Address string + ServerType string `json: "server_type"` + Port uint16 + } + + type FssnConfig struct { + Network networkConfig + } + + var fssnDefault = FssnConfig { + networkConfig { + "tcp", + "127.0.0.1", + "http", + 31560, + }, + } + + // Inside a function [...] + + if err := mergo.Merge(&config, fssnDefault); err != nil { + log.Fatal(err) + } + + // More code [...] + +*/ +package mergo diff --git a/vendor/github.com/imdario/mergo/map.go b/vendor/github.com/imdario/mergo/map.go new file mode 100644 index 000000000..3f5afa83a --- /dev/null +++ b/vendor/github.com/imdario/mergo/map.go @@ -0,0 +1,175 @@ +// Copyright 2014 Dario Castañé. All rights reserved. +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Based on src/pkg/reflect/deepequal.go from official +// golang's stdlib. + +package mergo + +import ( + "fmt" + "reflect" + "unicode" + "unicode/utf8" +) + +func changeInitialCase(s string, mapper func(rune) rune) string { + if s == "" { + return s + } + r, n := utf8.DecodeRuneInString(s) + return string(mapper(r)) + s[n:] +} + +func isExported(field reflect.StructField) bool { + r, _ := utf8.DecodeRuneInString(field.Name) + return r >= 'A' && r <= 'Z' +} + +// Traverses recursively both values, assigning src's fields values to dst. +// The map argument tracks comparisons that have already been seen, which allows +// short circuiting on recursive types. +func deepMap(dst, src reflect.Value, visited map[uintptr]*visit, depth int, config *Config) (err error) { + overwrite := config.Overwrite + if dst.CanAddr() { + addr := dst.UnsafeAddr() + h := 17 * addr + seen := visited[h] + typ := dst.Type() + for p := seen; p != nil; p = p.next { + if p.ptr == addr && p.typ == typ { + return nil + } + } + // Remember, remember... + visited[h] = &visit{addr, typ, seen} + } + zeroValue := reflect.Value{} + switch dst.Kind() { + case reflect.Map: + dstMap := dst.Interface().(map[string]interface{}) + for i, n := 0, src.NumField(); i < n; i++ { + srcType := src.Type() + field := srcType.Field(i) + if !isExported(field) { + continue + } + fieldName := field.Name + fieldName = changeInitialCase(fieldName, unicode.ToLower) + if v, ok := dstMap[fieldName]; !ok || (isEmptyValue(reflect.ValueOf(v)) || overwrite) { + dstMap[fieldName] = src.Field(i).Interface() + } + } + case reflect.Ptr: + if dst.IsNil() { + v := reflect.New(dst.Type().Elem()) + dst.Set(v) + } + dst = dst.Elem() + fallthrough + case reflect.Struct: + srcMap := src.Interface().(map[string]interface{}) + for key := range srcMap { + config.overwriteWithEmptyValue = true + srcValue := srcMap[key] + fieldName := changeInitialCase(key, unicode.ToUpper) + dstElement := dst.FieldByName(fieldName) + if dstElement == zeroValue { + // We discard it because the field doesn't exist. + continue + } + srcElement := reflect.ValueOf(srcValue) + dstKind := dstElement.Kind() + srcKind := srcElement.Kind() + if srcKind == reflect.Ptr && dstKind != reflect.Ptr { + srcElement = srcElement.Elem() + srcKind = reflect.TypeOf(srcElement.Interface()).Kind() + } else if dstKind == reflect.Ptr { + // Can this work? I guess it can't. + if srcKind != reflect.Ptr && srcElement.CanAddr() { + srcPtr := srcElement.Addr() + srcElement = reflect.ValueOf(srcPtr) + srcKind = reflect.Ptr + } + } + + if !srcElement.IsValid() { + continue + } + if srcKind == dstKind { + if err = deepMerge(dstElement, srcElement, visited, depth+1, config); err != nil { + return + } + } else if dstKind == reflect.Interface && dstElement.Kind() == reflect.Interface { + if err = deepMerge(dstElement, srcElement, visited, depth+1, config); err != nil { + return + } + } else if srcKind == reflect.Map { + if err = deepMap(dstElement, srcElement, visited, depth+1, config); err != nil { + return + } + } else { + return fmt.Errorf("type mismatch on %s field: found %v, expected %v", fieldName, srcKind, dstKind) + } + } + } + return +} + +// Map sets fields' values in dst from src. +// src can be a map with string keys or a struct. dst must be the opposite: +// if src is a map, dst must be a valid pointer to struct. If src is a struct, +// dst must be map[string]interface{}. +// It won't merge unexported (private) fields and will do recursively +// any exported field. +// If dst is a map, keys will be src fields' names in lower camel case. +// Missing key in src that doesn't match a field in dst will be skipped. This +// doesn't apply if dst is a map. +// This is separated method from Merge because it is cleaner and it keeps sane +// semantics: merging equal types, mapping different (restricted) types. +func Map(dst, src interface{}, opts ...func(*Config)) error { + return _map(dst, src, opts...) +} + +// MapWithOverwrite will do the same as Map except that non-empty dst attributes will be overridden by +// non-empty src attribute values. +// Deprecated: Use Map(…) with WithOverride +func MapWithOverwrite(dst, src interface{}, opts ...func(*Config)) error { + return _map(dst, src, append(opts, WithOverride)...) +} + +func _map(dst, src interface{}, opts ...func(*Config)) error { + var ( + vDst, vSrc reflect.Value + err error + ) + config := &Config{} + + for _, opt := range opts { + opt(config) + } + + if vDst, vSrc, err = resolveValues(dst, src); err != nil { + return err + } + // To be friction-less, we redirect equal-type arguments + // to deepMerge. Only because arguments can be anything. + if vSrc.Kind() == vDst.Kind() { + return deepMerge(vDst, vSrc, make(map[uintptr]*visit), 0, config) + } + switch vSrc.Kind() { + case reflect.Struct: + if vDst.Kind() != reflect.Map { + return ErrExpectedMapAsDestination + } + case reflect.Map: + if vDst.Kind() != reflect.Struct { + return ErrExpectedStructAsDestination + } + default: + return ErrNotSupported + } + return deepMap(vDst, vSrc, make(map[uintptr]*visit), 0, config) +} diff --git a/vendor/github.com/imdario/mergo/merge.go b/vendor/github.com/imdario/mergo/merge.go new file mode 100644 index 000000000..f8de6c543 --- /dev/null +++ b/vendor/github.com/imdario/mergo/merge.go @@ -0,0 +1,255 @@ +// Copyright 2013 Dario Castañé. All rights reserved. +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Based on src/pkg/reflect/deepequal.go from official +// golang's stdlib. + +package mergo + +import ( + "fmt" + "reflect" +) + +func hasExportedField(dst reflect.Value) (exported bool) { + for i, n := 0, dst.NumField(); i < n; i++ { + field := dst.Type().Field(i) + if field.Anonymous && dst.Field(i).Kind() == reflect.Struct { + exported = exported || hasExportedField(dst.Field(i)) + } else { + exported = exported || len(field.PkgPath) == 0 + } + } + return +} + +type Config struct { + Overwrite bool + AppendSlice bool + Transformers Transformers + overwriteWithEmptyValue bool +} + +type Transformers interface { + Transformer(reflect.Type) func(dst, src reflect.Value) error +} + +// Traverses recursively both values, assigning src's fields values to dst. +// The map argument tracks comparisons that have already been seen, which allows +// short circuiting on recursive types. +func deepMerge(dst, src reflect.Value, visited map[uintptr]*visit, depth int, config *Config) (err error) { + overwrite := config.Overwrite + overwriteWithEmptySrc := config.overwriteWithEmptyValue + config.overwriteWithEmptyValue = false + + if !src.IsValid() { + return + } + if dst.CanAddr() { + addr := dst.UnsafeAddr() + h := 17 * addr + seen := visited[h] + typ := dst.Type() + for p := seen; p != nil; p = p.next { + if p.ptr == addr && p.typ == typ { + return nil + } + } + // Remember, remember... + visited[h] = &visit{addr, typ, seen} + } + + if config.Transformers != nil && !isEmptyValue(dst) { + if fn := config.Transformers.Transformer(dst.Type()); fn != nil { + err = fn(dst, src) + return + } + } + + switch dst.Kind() { + case reflect.Struct: + if hasExportedField(dst) { + for i, n := 0, dst.NumField(); i < n; i++ { + if err = deepMerge(dst.Field(i), src.Field(i), visited, depth+1, config); err != nil { + return + } + } + } else { + if dst.CanSet() && (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) { + dst.Set(src) + } + } + case reflect.Map: + if dst.IsNil() && !src.IsNil() { + dst.Set(reflect.MakeMap(dst.Type())) + } + for _, key := range src.MapKeys() { + srcElement := src.MapIndex(key) + if !srcElement.IsValid() { + continue + } + dstElement := dst.MapIndex(key) + switch srcElement.Kind() { + case reflect.Chan, reflect.Func, reflect.Map, reflect.Interface, reflect.Slice: + if srcElement.IsNil() { + continue + } + fallthrough + default: + if !srcElement.CanInterface() { + continue + } + switch reflect.TypeOf(srcElement.Interface()).Kind() { + case reflect.Struct: + fallthrough + case reflect.Ptr: + fallthrough + case reflect.Map: + srcMapElm := srcElement + dstMapElm := dstElement + if srcMapElm.CanInterface() { + srcMapElm = reflect.ValueOf(srcMapElm.Interface()) + if dstMapElm.IsValid() { + dstMapElm = reflect.ValueOf(dstMapElm.Interface()) + } + } + if err = deepMerge(dstMapElm, srcMapElm, visited, depth+1, config); err != nil { + return + } + case reflect.Slice: + srcSlice := reflect.ValueOf(srcElement.Interface()) + + var dstSlice reflect.Value + if !dstElement.IsValid() || dstElement.IsNil() { + dstSlice = reflect.MakeSlice(srcSlice.Type(), 0, srcSlice.Len()) + } else { + dstSlice = reflect.ValueOf(dstElement.Interface()) + } + + if (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) && !config.AppendSlice { + dstSlice = srcSlice + } else if config.AppendSlice { + if srcSlice.Type() != dstSlice.Type() { + return fmt.Errorf("cannot append two slice with different type (%s, %s)", srcSlice.Type(), dstSlice.Type()) + } + dstSlice = reflect.AppendSlice(dstSlice, srcSlice) + } + dst.SetMapIndex(key, dstSlice) + } + } + if dstElement.IsValid() && !isEmptyValue(dstElement) && (reflect.TypeOf(srcElement.Interface()).Kind() == reflect.Map || reflect.TypeOf(srcElement.Interface()).Kind() == reflect.Slice) { + continue + } + + if srcElement.IsValid() && (overwrite || (!dstElement.IsValid() || isEmptyValue(dstElement))) { + if dst.IsNil() { + dst.Set(reflect.MakeMap(dst.Type())) + } + dst.SetMapIndex(key, srcElement) + } + } + case reflect.Slice: + if !dst.CanSet() { + break + } + if (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) && !config.AppendSlice { + dst.Set(src) + } else if config.AppendSlice { + if src.Type() != dst.Type() { + return fmt.Errorf("cannot append two slice with different type (%s, %s)", src.Type(), dst.Type()) + } + dst.Set(reflect.AppendSlice(dst, src)) + } + case reflect.Ptr: + fallthrough + case reflect.Interface: + if src.IsNil() { + break + } + if src.Kind() != reflect.Interface { + if dst.IsNil() || overwrite { + if dst.CanSet() && (overwrite || isEmptyValue(dst)) { + dst.Set(src) + } + } else if src.Kind() == reflect.Ptr { + if err = deepMerge(dst.Elem(), src.Elem(), visited, depth+1, config); err != nil { + return + } + } else if dst.Elem().Type() == src.Type() { + if err = deepMerge(dst.Elem(), src, visited, depth+1, config); err != nil { + return + } + } else { + return ErrDifferentArgumentsTypes + } + break + } + if dst.IsNil() || overwrite { + if dst.CanSet() && (overwrite || isEmptyValue(dst)) { + dst.Set(src) + } + } else if err = deepMerge(dst.Elem(), src.Elem(), visited, depth+1, config); err != nil { + return + } + default: + if dst.CanSet() && (!isEmptyValue(src) || overwriteWithEmptySrc) && (overwrite || isEmptyValue(dst)) { + dst.Set(src) + } + } + return +} + +// Merge will fill any empty for value type attributes on the dst struct using corresponding +// src attributes if they themselves are not empty. dst and src must be valid same-type structs +// and dst must be a pointer to struct. +// It won't merge unexported (private) fields and will do recursively any exported field. +func Merge(dst, src interface{}, opts ...func(*Config)) error { + return merge(dst, src, opts...) +} + +// MergeWithOverwrite will do the same as Merge except that non-empty dst attributes will be overriden by +// non-empty src attribute values. +// Deprecated: use Merge(…) with WithOverride +func MergeWithOverwrite(dst, src interface{}, opts ...func(*Config)) error { + return merge(dst, src, append(opts, WithOverride)...) +} + +// WithTransformers adds transformers to merge, allowing to customize the merging of some types. +func WithTransformers(transformers Transformers) func(*Config) { + return func(config *Config) { + config.Transformers = transformers + } +} + +// WithOverride will make merge override non-empty dst attributes with non-empty src attributes values. +func WithOverride(config *Config) { + config.Overwrite = true +} + +// WithAppendSlice will make merge append slices instead of overwriting it +func WithAppendSlice(config *Config) { + config.AppendSlice = true +} + +func merge(dst, src interface{}, opts ...func(*Config)) error { + var ( + vDst, vSrc reflect.Value + err error + ) + + config := &Config{} + + for _, opt := range opts { + opt(config) + } + + if vDst, vSrc, err = resolveValues(dst, src); err != nil { + return err + } + if vDst.Type() != vSrc.Type() { + return ErrDifferentArgumentsTypes + } + return deepMerge(vDst, vSrc, make(map[uintptr]*visit), 0, config) +} diff --git a/vendor/github.com/imdario/mergo/mergo.go b/vendor/github.com/imdario/mergo/mergo.go new file mode 100644 index 000000000..a82fea2fd --- /dev/null +++ b/vendor/github.com/imdario/mergo/mergo.go @@ -0,0 +1,97 @@ +// Copyright 2013 Dario Castañé. All rights reserved. +// Copyright 2009 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Based on src/pkg/reflect/deepequal.go from official +// golang's stdlib. + +package mergo + +import ( + "errors" + "reflect" +) + +// Errors reported by Mergo when it finds invalid arguments. +var ( + ErrNilArguments = errors.New("src and dst must not be nil") + ErrDifferentArgumentsTypes = errors.New("src and dst must be of same type") + ErrNotSupported = errors.New("only structs and maps are supported") + ErrExpectedMapAsDestination = errors.New("dst was expected to be a map") + ErrExpectedStructAsDestination = errors.New("dst was expected to be a struct") +) + +// During deepMerge, must keep track of checks that are +// in progress. The comparison algorithm assumes that all +// checks in progress are true when it reencounters them. +// Visited are stored in a map indexed by 17 * a1 + a2; +type visit struct { + ptr uintptr + typ reflect.Type + next *visit +} + +// From src/pkg/encoding/json/encode.go. +func isEmptyValue(v reflect.Value) bool { + switch v.Kind() { + case reflect.Array, reflect.Map, reflect.Slice, reflect.String: + return v.Len() == 0 + case reflect.Bool: + return !v.Bool() + case reflect.Int, reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64: + return v.Int() == 0 + case reflect.Uint, reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uintptr: + return v.Uint() == 0 + case reflect.Float32, reflect.Float64: + return v.Float() == 0 + case reflect.Interface, reflect.Ptr: + if v.IsNil() { + return true + } + return isEmptyValue(v.Elem()) + case reflect.Func: + return v.IsNil() + case reflect.Invalid: + return true + } + return false +} + +func resolveValues(dst, src interface{}) (vDst, vSrc reflect.Value, err error) { + if dst == nil || src == nil { + err = ErrNilArguments + return + } + vDst = reflect.ValueOf(dst).Elem() + if vDst.Kind() != reflect.Struct && vDst.Kind() != reflect.Map { + err = ErrNotSupported + return + } + vSrc = reflect.ValueOf(src) + // We check if vSrc is a pointer to dereference it. + if vSrc.Kind() == reflect.Ptr { + vSrc = vSrc.Elem() + } + return +} + +// Traverses recursively both values, assigning src's fields values to dst. +// The map argument tracks comparisons that have already been seen, which allows +// short circuiting on recursive types. +func deeper(dst, src reflect.Value, visited map[uintptr]*visit, depth int) (err error) { + if dst.CanAddr() { + addr := dst.UnsafeAddr() + h := 17 * addr + seen := visited[h] + typ := dst.Type() + for p := seen; p != nil; p = p.next { + if p.ptr == addr && p.typ == typ { + return nil + } + } + // Remember, remember... + visited[h] = &visit{addr, typ, seen} + } + return // TODO refactor +} diff --git a/vendor/go.etcd.io/bbolt/freelist.go b/vendor/go.etcd.io/bbolt/freelist.go index 93fd85d50..587b8cc02 100644 --- a/vendor/go.etcd.io/bbolt/freelist.go +++ b/vendor/go.etcd.io/bbolt/freelist.go @@ -349,6 +349,28 @@ func (f *freelist) reload(p *page) { f.readIDs(a) } +// noSyncReload reads the freelist from pgids and filters out pending items. +func (f *freelist) noSyncReload(pgids []pgid) { + // Build a cache of only pending pages. + pcache := make(map[pgid]bool) + for _, txp := range f.pending { + for _, pendingID := range txp.ids { + pcache[pendingID] = true + } + } + + // Check each page in the freelist and build a new available freelist + // with any pages not in the pending lists. + var a []pgid + for _, id := range pgids { + if !pcache[id] { + a = append(a, id) + } + } + + f.readIDs(a) +} + // reindex rebuilds the free cache based on available and pending free lists. func (f *freelist) reindex() { ids := f.getFreePageIDs() diff --git a/vendor/go.etcd.io/bbolt/tx.go b/vendor/go.etcd.io/bbolt/tx.go index 52ab139e0..2df7688c2 100644 --- a/vendor/go.etcd.io/bbolt/tx.go +++ b/vendor/go.etcd.io/bbolt/tx.go @@ -254,17 +254,36 @@ func (tx *Tx) Rollback() error { if tx.db == nil { return ErrTxClosed } - tx.rollback() + tx.nonPhysicalRollback() return nil } +// nonPhysicalRollback is called when user calls Rollback directly, in this case we do not need to reload the free pages from disk. +func (tx *Tx) nonPhysicalRollback() { + if tx.db == nil { + return + } + if tx.writable { + tx.db.freelist.rollback(tx.meta.txid) + } + tx.close() +} + +// rollback needs to reload the free pages from disk in case some system error happens like fsync error. func (tx *Tx) rollback() { if tx.db == nil { return } if tx.writable { tx.db.freelist.rollback(tx.meta.txid) - tx.db.freelist.reload(tx.db.page(tx.db.meta().freelist)) + if !tx.db.hasSyncedFreelist() { + // Reconstruct free page list by scanning the DB to get the whole free page list. + // Note: scaning the whole db is heavy if your db size is large in NoSyncFreeList mode. + tx.db.freelist.noSyncReload(tx.db.freepages()) + } else { + // Read free page list from freelist page. + tx.db.freelist.reload(tx.db.page(tx.db.meta().freelist)) + } } tx.close() } diff --git a/vendor/go.opencensus.io/LICENSE b/vendor/go.opencensus.io/LICENSE new file mode 100644 index 000000000..7a4a3ea24 --- /dev/null +++ b/vendor/go.opencensus.io/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/vendor/go.opencensus.io/README.md b/vendor/go.opencensus.io/README.md new file mode 100644 index 000000000..fabab2e06 --- /dev/null +++ b/vendor/go.opencensus.io/README.md @@ -0,0 +1,263 @@ +# OpenCensus Libraries for Go + +[![Build Status][travis-image]][travis-url] +[![Windows Build Status][appveyor-image]][appveyor-url] +[![GoDoc][godoc-image]][godoc-url] +[![Gitter chat][gitter-image]][gitter-url] + +OpenCensus Go is a Go implementation of OpenCensus, a toolkit for +collecting application performance and behavior monitoring data. +Currently it consists of three major components: tags, stats and tracing. + +## Installation + +``` +$ go get -u go.opencensus.io +``` + +The API of this project is still evolving, see: [Deprecation Policy](#deprecation-policy). +The use of vendoring or a dependency management tool is recommended. + +## Prerequisites + +OpenCensus Go libraries require Go 1.8 or later. + +## Getting Started + +The easiest way to get started using OpenCensus in your application is to use an existing +integration with your RPC framework: + +* [net/http](https://godoc.org/go.opencensus.io/plugin/ochttp) +* [gRPC](https://godoc.org/go.opencensus.io/plugin/ocgrpc) +* [database/sql](https://godoc.org/github.com/opencensus-integrations/ocsql) +* [Go kit](https://godoc.org/github.com/go-kit/kit/tracing/opencensus) +* [Groupcache](https://godoc.org/github.com/orijtech/groupcache) +* [Caddy webserver](https://godoc.org/github.com/orijtech/caddy) +* [MongoDB](https://godoc.org/github.com/orijtech/mongo-go-driver) +* [Redis gomodule/redigo](https://godoc.org/github.com/orijtech/redigo) +* [Redis goredis/redis](https://godoc.org/github.com/orijtech/redis) +* [Memcache](https://godoc.org/github.com/orijtech/gomemcache) + +If you're using a framework not listed here, you could either implement your own middleware for your +framework or use [custom stats](#stats) and [spans](#spans) directly in your application. + +## Exporters + +OpenCensus can export instrumentation data to various backends. +OpenCensus has exporter implementations for the following, users +can implement their own exporters by implementing the exporter interfaces +([stats](https://godoc.org/go.opencensus.io/stats/view#Exporter), +[trace](https://godoc.org/go.opencensus.io/trace#Exporter)): + +* [Prometheus][exporter-prom] for stats +* [OpenZipkin][exporter-zipkin] for traces +* [Stackdriver][exporter-stackdriver] Monitoring for stats and Trace for traces +* [Jaeger][exporter-jaeger] for traces +* [AWS X-Ray][exporter-xray] for traces +* [Datadog][exporter-datadog] for stats and traces +* [Graphite][exporter-graphite] for stats +* [Honeycomb][exporter-honeycomb] for traces + +## Overview + +![OpenCensus Overview](https://i.imgur.com/cf4ElHE.jpg) + +In a microservices environment, a user request may go through +multiple services until there is a response. OpenCensus allows +you to instrument your services and collect diagnostics data all +through your services end-to-end. + +## Tags + +Tags represent propagated key-value pairs. They are propagated using `context.Context` +in the same process or can be encoded to be transmitted on the wire. Usually, this will +be handled by an integration plugin, e.g. `ocgrpc.ServerHandler` and `ocgrpc.ClientHandler` +for gRPC. + +Package `tag` allows adding or modifying tags in the current context. + +[embedmd]:# (internal/readme/tags.go new) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Upsert(userIDKey, "cde36753ed"), +) +if err != nil { + log.Fatal(err) +} +``` + +## Stats + +OpenCensus is a low-overhead framework even if instrumentation is always enabled. +In order to be so, it is optimized to make recording of data points fast +and separate from the data aggregation. + +OpenCensus stats collection happens in two stages: + +* Definition of measures and recording of data points +* Definition of views and aggregation of the recorded data + +### Recording + +Measurements are data points associated with a measure. +Recording implicitly tags the set of Measurements with the tags from the +provided context: + +[embedmd]:# (internal/readme/stats.go record) +```go +stats.Record(ctx, videoSize.M(102478)) +``` + +### Views + +Views are how Measures are aggregated. You can think of them as queries over the +set of recorded data points (measurements). + +Views have two parts: the tags to group by and the aggregation type used. + +Currently three types of aggregations are supported: +* CountAggregation is used to count the number of times a sample was recorded. +* DistributionAggregation is used to provide a histogram of the values of the samples. +* SumAggregation is used to sum up all sample values. + +[embedmd]:# (internal/readme/stats.go aggs) +```go +distAgg := view.Distribution(1<<32, 2<<32, 3<<32) +countAgg := view.Count() +sumAgg := view.Sum() +``` + +Here we create a view with the DistributionAggregation over our measure. + +[embedmd]:# (internal/readme/stats.go view) +```go +if err := view.Register(&view.View{ + Name: "example.com/video_size_distribution", + Description: "distribution of processed video size over time", + Measure: videoSize, + Aggregation: view.Distribution(1<<32, 2<<32, 3<<32), +}); err != nil { + log.Fatalf("Failed to register view: %v", err) +} +``` + +Register begins collecting data for the view. Registered views' data will be +exported via the registered exporters. + +## Traces + +A distributed trace tracks the progression of a single user request as +it is handled by the services and processes that make up an application. +Each step is called a span in the trace. Spans include metadata about the step, +including especially the time spent in the step, called the span’s latency. + +Below you see a trace and several spans underneath it. + +![Traces and spans](https://i.imgur.com/7hZwRVj.png) + +### Spans + +Span is the unit step in a trace. Each span has a name, latency, status and +additional metadata. + +Below we are starting a span for a cache read and ending it +when we are done: + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +### Propagation + +Spans can have parents or can be root spans if they don't have any parents. +The current span is propagated in-process and across the network to allow associating +new child spans with the parent. + +In the same process, `context.Context` is used to propagate spans. +`trace.StartSpan` creates a new span as a root if the current context +doesn't contain a span. Or, it creates a child of the span that is +already in current context. The returned context can be used to keep +propagating the newly created span in the current context. + +[embedmd]:# (internal/readme/trace.go startend) +```go +ctx, span := trace.StartSpan(ctx, "cache.Get") +defer span.End() + +// Do work to get from cache. +``` + +Across the network, OpenCensus provides different propagation +methods for different protocols. + +* gRPC integrations use the OpenCensus' [binary propagation format](https://godoc.org/go.opencensus.io/trace/propagation). +* HTTP integrations use Zipkin's [B3](https://github.com/openzipkin/b3-propagation) + by default but can be configured to use a custom propagation method by setting another + [propagation.HTTPFormat](https://godoc.org/go.opencensus.io/trace/propagation#HTTPFormat). + +## Execution Tracer + +With Go 1.11, OpenCensus Go will support integration with the Go execution tracer. +See [Debugging Latency in Go](https://medium.com/observability/debugging-latency-in-go-1-11-9f97a7910d68) +for an example of their mutual use. + +## Profiles + +OpenCensus tags can be applied as profiler labels +for users who are on Go 1.9 and above. + +[embedmd]:# (internal/readme/tags.go profiler) +```go +ctx, err = tag.New(ctx, + tag.Insert(osKey, "macOS-10.12.5"), + tag.Insert(userIDKey, "fff0989878"), +) +if err != nil { + log.Fatal(err) +} +tag.Do(ctx, func(ctx context.Context) { + // Do work. + // When profiling is on, samples will be + // recorded with the key/values from the tag map. +}) +``` + +A screenshot of the CPU profile from the program above: + +![CPU profile](https://i.imgur.com/jBKjlkw.png) + +## Deprecation Policy + +Before version 1.0.0, the following deprecation policy will be observed: + +No backwards-incompatible changes will be made except for the removal of symbols that have +been marked as *Deprecated* for at least one minor release (e.g. 0.9.0 to 0.10.0). A release +removing the *Deprecated* functionality will be made no sooner than 28 days after the first +release in which the functionality was marked *Deprecated*. + +[travis-image]: https://travis-ci.org/census-instrumentation/opencensus-go.svg?branch=master +[travis-url]: https://travis-ci.org/census-instrumentation/opencensus-go +[appveyor-image]: https://ci.appveyor.com/api/projects/status/vgtt29ps1783ig38?svg=true +[appveyor-url]: https://ci.appveyor.com/project/opencensusgoteam/opencensus-go/branch/master +[godoc-image]: https://godoc.org/go.opencensus.io?status.svg +[godoc-url]: https://godoc.org/go.opencensus.io +[gitter-image]: https://badges.gitter.im/census-instrumentation/lobby.svg +[gitter-url]: https://gitter.im/census-instrumentation/lobby?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge + + +[new-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap +[new-replace-ex]: https://godoc.org/go.opencensus.io/tag#example-NewMap--Replace + +[exporter-prom]: https://godoc.org/contrib.go.opencensus.io/exporter/prometheus +[exporter-stackdriver]: https://godoc.org/contrib.go.opencensus.io/exporter/stackdriver +[exporter-zipkin]: https://godoc.org/contrib.go.opencensus.io/exporter/zipkin +[exporter-jaeger]: https://godoc.org/contrib.go.opencensus.io/exporter/jaeger +[exporter-xray]: https://github.com/census-ecosystem/opencensus-go-exporter-aws +[exporter-datadog]: https://github.com/DataDog/opencensus-go-exporter-datadog +[exporter-graphite]: https://github.com/census-ecosystem/opencensus-go-exporter-graphite +[exporter-honeycomb]: https://github.com/honeycombio/opencensus-exporter diff --git a/vendor/go.opencensus.io/go.mod b/vendor/go.opencensus.io/go.mod new file mode 100644 index 000000000..cb4de80f3 --- /dev/null +++ b/vendor/go.opencensus.io/go.mod @@ -0,0 +1,12 @@ +module go.opencensus.io + +require ( + github.com/golang/protobuf v1.3.1 + github.com/google/go-cmp v0.3.0 + github.com/hashicorp/golang-lru v0.5.1 + golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 + golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd // indirect + golang.org/x/text v0.3.2 // indirect + google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb // indirect + google.golang.org/grpc v1.20.1 +) diff --git a/vendor/go.opencensus.io/internal/internal.go b/vendor/go.opencensus.io/internal/internal.go new file mode 100644 index 000000000..9a638781c --- /dev/null +++ b/vendor/go.opencensus.io/internal/internal.go @@ -0,0 +1,37 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal // import "go.opencensus.io/internal" + +import ( + "fmt" + "time" + + opencensus "go.opencensus.io" +) + +// UserAgent is the user agent to be added to the outgoing +// requests from the exporters. +var UserAgent = fmt.Sprintf("opencensus-go/%s", opencensus.Version()) + +// MonotonicEndTime returns the end time at present +// but offset from start, monotonically. +// +// The monotonic clock is used in subtractions hence +// the duration since start added back to start gives +// end as a monotonic time. +// See https://golang.org/pkg/time/#hdr-Monotonic_Clocks +func MonotonicEndTime(start time.Time) time.Time { + return start.Add(time.Now().Sub(start)) +} diff --git a/vendor/go.opencensus.io/internal/sanitize.go b/vendor/go.opencensus.io/internal/sanitize.go new file mode 100644 index 000000000..de8ccf236 --- /dev/null +++ b/vendor/go.opencensus.io/internal/sanitize.go @@ -0,0 +1,50 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "strings" + "unicode" +) + +const labelKeySizeLimit = 100 + +// Sanitize returns a string that is trunacated to 100 characters if it's too +// long, and replaces non-alphanumeric characters to underscores. +func Sanitize(s string) string { + if len(s) == 0 { + return s + } + if len(s) > labelKeySizeLimit { + s = s[:labelKeySizeLimit] + } + s = strings.Map(sanitizeRune, s) + if unicode.IsDigit(rune(s[0])) { + s = "key_" + s + } + if s[0] == '_' { + s = "key" + s + } + return s +} + +// converts anything that is not a letter or digit to an underscore +func sanitizeRune(r rune) rune { + if unicode.IsLetter(r) || unicode.IsDigit(r) { + return r + } + // Everything else turns into an underscore + return '_' +} diff --git a/vendor/go.opencensus.io/internal/traceinternals.go b/vendor/go.opencensus.io/internal/traceinternals.go new file mode 100644 index 000000000..073af7b47 --- /dev/null +++ b/vendor/go.opencensus.io/internal/traceinternals.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package internal + +import ( + "time" +) + +// Trace allows internal access to some trace functionality. +// TODO(#412): remove this +var Trace interface{} + +// LocalSpanStoreEnabled true if the local span store is enabled. +var LocalSpanStoreEnabled bool + +// BucketConfiguration stores the number of samples to store for span buckets +// for successful and failed spans for a particular span name. +type BucketConfiguration struct { + Name string + MaxRequestsSucceeded int + MaxRequestsErrors int +} + +// PerMethodSummary is a summary of the spans stored for a single span name. +type PerMethodSummary struct { + Active int + LatencyBuckets []LatencyBucketSummary + ErrorBuckets []ErrorBucketSummary +} + +// LatencyBucketSummary is a summary of a latency bucket. +type LatencyBucketSummary struct { + MinLatency, MaxLatency time.Duration + Size int +} + +// ErrorBucketSummary is a summary of an error bucket. +type ErrorBucketSummary struct { + ErrorCode int32 + Size int +} diff --git a/vendor/go.opencensus.io/opencensus.go b/vendor/go.opencensus.io/opencensus.go new file mode 100644 index 000000000..626d73645 --- /dev/null +++ b/vendor/go.opencensus.io/opencensus.go @@ -0,0 +1,21 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package opencensus contains Go support for OpenCensus. +package opencensus // import "go.opencensus.io" + +// Version is the current release version of OpenCensus in use. +func Version() string { + return "0.22.0" +} diff --git a/vendor/go.opencensus.io/trace/basetypes.go b/vendor/go.opencensus.io/trace/basetypes.go new file mode 100644 index 000000000..0c54492a2 --- /dev/null +++ b/vendor/go.opencensus.io/trace/basetypes.go @@ -0,0 +1,119 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "fmt" + "time" +) + +type ( + // TraceID is a 16-byte identifier for a set of spans. + TraceID [16]byte + + // SpanID is an 8-byte identifier for a single span. + SpanID [8]byte +) + +func (t TraceID) String() string { + return fmt.Sprintf("%02x", t[:]) +} + +func (s SpanID) String() string { + return fmt.Sprintf("%02x", s[:]) +} + +// Annotation represents a text annotation with a set of attributes and a timestamp. +type Annotation struct { + Time time.Time + Message string + Attributes map[string]interface{} +} + +// Attribute represents a key-value pair on a span, link or annotation. +// Construct with one of: BoolAttribute, Int64Attribute, or StringAttribute. +type Attribute struct { + key string + value interface{} +} + +// BoolAttribute returns a bool-valued attribute. +func BoolAttribute(key string, value bool) Attribute { + return Attribute{key: key, value: value} +} + +// Int64Attribute returns an int64-valued attribute. +func Int64Attribute(key string, value int64) Attribute { + return Attribute{key: key, value: value} +} + +// Float64Attribute returns a float64-valued attribute. +func Float64Attribute(key string, value float64) Attribute { + return Attribute{key: key, value: value} +} + +// StringAttribute returns a string-valued attribute. +func StringAttribute(key string, value string) Attribute { + return Attribute{key: key, value: value} +} + +// LinkType specifies the relationship between the span that had the link +// added, and the linked span. +type LinkType int32 + +// LinkType values. +const ( + LinkTypeUnspecified LinkType = iota // The relationship of the two spans is unknown. + LinkTypeChild // The linked span is a child of the current span. + LinkTypeParent // The linked span is the parent of the current span. +) + +// Link represents a reference from one span to another span. +type Link struct { + TraceID TraceID + SpanID SpanID + Type LinkType + // Attributes is a set of attributes on the link. + Attributes map[string]interface{} +} + +// MessageEventType specifies the type of message event. +type MessageEventType int32 + +// MessageEventType values. +const ( + MessageEventTypeUnspecified MessageEventType = iota // Unknown event type. + MessageEventTypeSent // Indicates a sent RPC message. + MessageEventTypeRecv // Indicates a received RPC message. +) + +// MessageEvent represents an event describing a message sent or received on the network. +type MessageEvent struct { + Time time.Time + EventType MessageEventType + MessageID int64 + UncompressedByteSize int64 + CompressedByteSize int64 +} + +// Status is the status of a Span. +type Status struct { + // Code is a status code. Zero indicates success. + // + // If Code will be propagated to Google APIs, it ideally should be a value from + // https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto . + Code int32 + Message string +} diff --git a/vendor/go.opencensus.io/trace/config.go b/vendor/go.opencensus.io/trace/config.go new file mode 100644 index 000000000..775f8274f --- /dev/null +++ b/vendor/go.opencensus.io/trace/config.go @@ -0,0 +1,86 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + + "go.opencensus.io/trace/internal" +) + +// Config represents the global tracing configuration. +type Config struct { + // DefaultSampler is the default sampler used when creating new spans. + DefaultSampler Sampler + + // IDGenerator is for internal use only. + IDGenerator internal.IDGenerator + + // MaxAnnotationEventsPerSpan is max number of annotation events per span + MaxAnnotationEventsPerSpan int + + // MaxMessageEventsPerSpan is max number of message events per span + MaxMessageEventsPerSpan int + + // MaxAnnotationEventsPerSpan is max number of attributes per span + MaxAttributesPerSpan int + + // MaxLinksPerSpan is max number of links per span + MaxLinksPerSpan int +} + +var configWriteMu sync.Mutex + +const ( + // DefaultMaxAnnotationEventsPerSpan is default max number of annotation events per span + DefaultMaxAnnotationEventsPerSpan = 32 + + // DefaultMaxMessageEventsPerSpan is default max number of message events per span + DefaultMaxMessageEventsPerSpan = 128 + + // DefaultMaxAttributesPerSpan is default max number of attributes per span + DefaultMaxAttributesPerSpan = 32 + + // DefaultMaxLinksPerSpan is default max number of links per span + DefaultMaxLinksPerSpan = 32 +) + +// ApplyConfig applies changes to the global tracing configuration. +// +// Fields not provided in the given config are going to be preserved. +func ApplyConfig(cfg Config) { + configWriteMu.Lock() + defer configWriteMu.Unlock() + c := *config.Load().(*Config) + if cfg.DefaultSampler != nil { + c.DefaultSampler = cfg.DefaultSampler + } + if cfg.IDGenerator != nil { + c.IDGenerator = cfg.IDGenerator + } + if cfg.MaxAnnotationEventsPerSpan > 0 { + c.MaxAnnotationEventsPerSpan = cfg.MaxAnnotationEventsPerSpan + } + if cfg.MaxMessageEventsPerSpan > 0 { + c.MaxMessageEventsPerSpan = cfg.MaxMessageEventsPerSpan + } + if cfg.MaxAttributesPerSpan > 0 { + c.MaxAttributesPerSpan = cfg.MaxAttributesPerSpan + } + if cfg.MaxLinksPerSpan > 0 { + c.MaxLinksPerSpan = cfg.MaxLinksPerSpan + } + config.Store(&c) +} diff --git a/vendor/go.opencensus.io/trace/doc.go b/vendor/go.opencensus.io/trace/doc.go new file mode 100644 index 000000000..04b1ee4f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/doc.go @@ -0,0 +1,53 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/* +Package trace contains support for OpenCensus distributed tracing. + +The following assumes a basic familiarity with OpenCensus concepts. +See http://opencensus.io + + +Exporting Traces + +To export collected tracing data, register at least one exporter. You can use +one of the provided exporters or write your own. + + trace.RegisterExporter(exporter) + +By default, traces will be sampled relatively rarely. To change the sampling +frequency for your entire program, call ApplyConfig. Use a ProbabilitySampler +to sample a subset of traces, or use AlwaysSample to collect a trace on every run: + + trace.ApplyConfig(trace.Config{DefaultSampler: trace.AlwaysSample()}) + +Be careful about using trace.AlwaysSample in a production application with +significant traffic: a new trace will be started and exported for every request. + +Adding Spans to a Trace + +A trace consists of a tree of spans. In Go, the current span is carried in a +context.Context. + +It is common to want to capture all the activity of a function call in a span. For +this to work, the function must take a context.Context as a parameter. Add these two +lines to the top of the function: + + ctx, span := trace.StartSpan(ctx, "example.com/Run") + defer span.End() + +StartSpan will create a new top-level span if the context +doesn't contain another span, otherwise it will create a child span. +*/ +package trace // import "go.opencensus.io/trace" diff --git a/vendor/go.opencensus.io/trace/evictedqueue.go b/vendor/go.opencensus.io/trace/evictedqueue.go new file mode 100644 index 000000000..ffc264f23 --- /dev/null +++ b/vendor/go.opencensus.io/trace/evictedqueue.go @@ -0,0 +1,38 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +type evictedQueue struct { + queue []interface{} + capacity int + droppedCount int +} + +func newEvictedQueue(capacity int) *evictedQueue { + eq := &evictedQueue{ + capacity: capacity, + queue: make([]interface{}, 0), + } + + return eq +} + +func (eq *evictedQueue) add(value interface{}) { + if len(eq.queue) == eq.capacity { + eq.queue = eq.queue[1:] + eq.droppedCount++ + } + eq.queue = append(eq.queue, value) +} diff --git a/vendor/go.opencensus.io/trace/export.go b/vendor/go.opencensus.io/trace/export.go new file mode 100644 index 000000000..e0d9a4b99 --- /dev/null +++ b/vendor/go.opencensus.io/trace/export.go @@ -0,0 +1,97 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "sync/atomic" + "time" +) + +// Exporter is a type for functions that receive sampled trace spans. +// +// The ExportSpan method should be safe for concurrent use and should return +// quickly; if an Exporter takes a significant amount of time to process a +// SpanData, that work should be done on another goroutine. +// +// The SpanData should not be modified, but a pointer to it can be kept. +type Exporter interface { + ExportSpan(s *SpanData) +} + +type exportersMap map[Exporter]struct{} + +var ( + exporterMu sync.Mutex + exporters atomic.Value +) + +// RegisterExporter adds to the list of Exporters that will receive sampled +// trace spans. +// +// Binaries can register exporters, libraries shouldn't register exporters. +func RegisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + new[e] = struct{}{} + exporters.Store(new) + exporterMu.Unlock() +} + +// UnregisterExporter removes from the list of Exporters the Exporter that was +// registered with the given name. +func UnregisterExporter(e Exporter) { + exporterMu.Lock() + new := make(exportersMap) + if old, ok := exporters.Load().(exportersMap); ok { + for k, v := range old { + new[k] = v + } + } + delete(new, e) + exporters.Store(new) + exporterMu.Unlock() +} + +// SpanData contains all the information collected by a Span. +type SpanData struct { + SpanContext + ParentSpanID SpanID + SpanKind int + Name string + StartTime time.Time + // The wall clock time of EndTime will be adjusted to always be offset + // from StartTime by the duration of the span. + EndTime time.Time + // The values of Attributes each have type string, bool, or int64. + Attributes map[string]interface{} + Annotations []Annotation + MessageEvents []MessageEvent + Status + Links []Link + HasRemoteParent bool + DroppedAttributeCount int + DroppedAnnotationCount int + DroppedMessageEventCount int + DroppedLinkCount int + + // ChildSpanCount holds the number of child span created for this span. + ChildSpanCount int +} diff --git a/vendor/go.opencensus.io/trace/internal/internal.go b/vendor/go.opencensus.io/trace/internal/internal.go new file mode 100644 index 000000000..7e808d8f3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/internal/internal.go @@ -0,0 +1,22 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package internal provides trace internals. +package internal + +// IDGenerator allows custom generators for TraceId and SpanId. +type IDGenerator interface { + NewTraceID() [16]byte + NewSpanID() [8]byte +} diff --git a/vendor/go.opencensus.io/trace/lrumap.go b/vendor/go.opencensus.io/trace/lrumap.go new file mode 100644 index 000000000..3f80a3368 --- /dev/null +++ b/vendor/go.opencensus.io/trace/lrumap.go @@ -0,0 +1,37 @@ +// Copyright 2019, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "github.com/hashicorp/golang-lru/simplelru" +) + +type lruMap struct { + simpleLruMap *simplelru.LRU + droppedCount int +} + +func newLruMap(size int) *lruMap { + lm := &lruMap{} + lm.simpleLruMap, _ = simplelru.NewLRU(size, nil) + return lm +} + +func (lm *lruMap) add(key, value interface{}) { + evicted := lm.simpleLruMap.Add(key, value) + if evicted { + lm.droppedCount++ + } +} diff --git a/vendor/go.opencensus.io/trace/sampling.go b/vendor/go.opencensus.io/trace/sampling.go new file mode 100644 index 000000000..71c10f9e3 --- /dev/null +++ b/vendor/go.opencensus.io/trace/sampling.go @@ -0,0 +1,75 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "encoding/binary" +) + +const defaultSamplingProbability = 1e-4 + +// Sampler decides whether a trace should be sampled and exported. +type Sampler func(SamplingParameters) SamplingDecision + +// SamplingParameters contains the values passed to a Sampler. +type SamplingParameters struct { + ParentContext SpanContext + TraceID TraceID + SpanID SpanID + Name string + HasRemoteParent bool +} + +// SamplingDecision is the value returned by a Sampler. +type SamplingDecision struct { + Sample bool +} + +// ProbabilitySampler returns a Sampler that samples a given fraction of traces. +// +// It also samples spans whose parents are sampled. +func ProbabilitySampler(fraction float64) Sampler { + if !(fraction >= 0) { + fraction = 0 + } else if fraction >= 1 { + return AlwaysSample() + } + + traceIDUpperBound := uint64(fraction * (1 << 63)) + return Sampler(func(p SamplingParameters) SamplingDecision { + if p.ParentContext.IsSampled() { + return SamplingDecision{Sample: true} + } + x := binary.BigEndian.Uint64(p.TraceID[0:8]) >> 1 + return SamplingDecision{Sample: x < traceIDUpperBound} + }) +} + +// AlwaysSample returns a Sampler that samples every trace. +// Be careful about using this sampler in a production application with +// significant traffic: a new trace will be started and exported for every +// request. +func AlwaysSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: true} + } +} + +// NeverSample returns a Sampler that samples no traces. +func NeverSample() Sampler { + return func(p SamplingParameters) SamplingDecision { + return SamplingDecision{Sample: false} + } +} diff --git a/vendor/go.opencensus.io/trace/spanbucket.go b/vendor/go.opencensus.io/trace/spanbucket.go new file mode 100644 index 000000000..fbabad34c --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanbucket.go @@ -0,0 +1,130 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "time" +) + +// samplePeriod is the minimum time between accepting spans in a single bucket. +const samplePeriod = time.Second + +// defaultLatencies contains the default latency bucket bounds. +// TODO: consider defaults, make configurable +var defaultLatencies = [...]time.Duration{ + 10 * time.Microsecond, + 100 * time.Microsecond, + time.Millisecond, + 10 * time.Millisecond, + 100 * time.Millisecond, + time.Second, + 10 * time.Second, + time.Minute, +} + +// bucket is a container for a set of spans for a particular error code or latency range. +type bucket struct { + nextTime time.Time // next time we can accept a span + buffer []*SpanData // circular buffer of spans + nextIndex int // location next SpanData should be placed in buffer + overflow bool // whether the circular buffer has wrapped around +} + +func makeBucket(bufferSize int) bucket { + return bucket{ + buffer: make([]*SpanData, bufferSize), + } +} + +// add adds a span to the bucket, if nextTime has been reached. +func (b *bucket) add(s *SpanData) { + if s.EndTime.Before(b.nextTime) { + return + } + if len(b.buffer) == 0 { + return + } + b.nextTime = s.EndTime.Add(samplePeriod) + b.buffer[b.nextIndex] = s + b.nextIndex++ + if b.nextIndex == len(b.buffer) { + b.nextIndex = 0 + b.overflow = true + } +} + +// size returns the number of spans in the bucket. +func (b *bucket) size() int { + if b.overflow { + return len(b.buffer) + } + return b.nextIndex +} + +// span returns the ith span in the bucket. +func (b *bucket) span(i int) *SpanData { + if !b.overflow { + return b.buffer[i] + } + if i < len(b.buffer)-b.nextIndex { + return b.buffer[b.nextIndex+i] + } + return b.buffer[b.nextIndex+i-len(b.buffer)] +} + +// resize changes the size of the bucket to n, keeping up to n existing spans. +func (b *bucket) resize(n int) { + cur := b.size() + newBuffer := make([]*SpanData, n) + if cur < n { + for i := 0; i < cur; i++ { + newBuffer[i] = b.span(i) + } + b.buffer = newBuffer + b.nextIndex = cur + b.overflow = false + return + } + for i := 0; i < n; i++ { + newBuffer[i] = b.span(i + cur - n) + } + b.buffer = newBuffer + b.nextIndex = 0 + b.overflow = true +} + +// latencyBucket returns the appropriate bucket number for a given latency. +func latencyBucket(latency time.Duration) int { + i := 0 + for i < len(defaultLatencies) && latency >= defaultLatencies[i] { + i++ + } + return i +} + +// latencyBucketBounds returns the lower and upper bounds for a latency bucket +// number. +// +// The lower bound is inclusive, the upper bound is exclusive (except for the +// last bucket.) +func latencyBucketBounds(index int) (lower time.Duration, upper time.Duration) { + if index == 0 { + return 0, defaultLatencies[index] + } + if index == len(defaultLatencies) { + return defaultLatencies[index-1], 1<<63 - 1 + } + return defaultLatencies[index-1], defaultLatencies[index] +} diff --git a/vendor/go.opencensus.io/trace/spanstore.go b/vendor/go.opencensus.io/trace/spanstore.go new file mode 100644 index 000000000..c442d9902 --- /dev/null +++ b/vendor/go.opencensus.io/trace/spanstore.go @@ -0,0 +1,306 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "sync" + "time" + + "go.opencensus.io/internal" +) + +const ( + maxBucketSize = 100000 + defaultBucketSize = 10 +) + +var ( + ssmu sync.RWMutex // protects spanStores + spanStores = make(map[string]*spanStore) +) + +// This exists purely to avoid exposing internal methods used by z-Pages externally. +type internalOnly struct{} + +func init() { + //TODO(#412): remove + internal.Trace = &internalOnly{} +} + +// ReportActiveSpans returns the active spans for the given name. +func (i internalOnly) ReportActiveSpans(name string) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for span := range s.active { + out = append(out, span.makeSpanData()) + } + return out +} + +// ReportSpansByError returns a sample of error spans. +// +// If code is nonzero, only spans with that status code are returned. +func (i internalOnly) ReportSpansByError(name string, code int32) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + if code != 0 { + if b, ok := s.errors[code]; ok { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } else { + for _, b := range s.errors { + for _, sd := range b.buffer { + if sd == nil { + break + } + out = append(out, sd) + } + } + } + return out +} + +// ConfigureBucketSizes sets the number of spans to keep per latency and error +// bucket for different span names. +func (i internalOnly) ConfigureBucketSizes(bcs []internal.BucketConfiguration) { + for _, bc := range bcs { + latencyBucketSize := bc.MaxRequestsSucceeded + if latencyBucketSize < 0 { + latencyBucketSize = 0 + } + if latencyBucketSize > maxBucketSize { + latencyBucketSize = maxBucketSize + } + errorBucketSize := bc.MaxRequestsErrors + if errorBucketSize < 0 { + errorBucketSize = 0 + } + if errorBucketSize > maxBucketSize { + errorBucketSize = maxBucketSize + } + spanStoreSetSize(bc.Name, latencyBucketSize, errorBucketSize) + } +} + +// ReportSpansPerMethod returns a summary of what spans are being stored for each span name. +func (i internalOnly) ReportSpansPerMethod() map[string]internal.PerMethodSummary { + out := make(map[string]internal.PerMethodSummary) + ssmu.RLock() + defer ssmu.RUnlock() + for name, s := range spanStores { + s.mu.Lock() + p := internal.PerMethodSummary{ + Active: len(s.active), + } + for code, b := range s.errors { + p.ErrorBuckets = append(p.ErrorBuckets, internal.ErrorBucketSummary{ + ErrorCode: code, + Size: b.size(), + }) + } + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + p.LatencyBuckets = append(p.LatencyBuckets, internal.LatencyBucketSummary{ + MinLatency: min, + MaxLatency: max, + Size: b.size(), + }) + } + s.mu.Unlock() + out[name] = p + } + return out +} + +// ReportSpansByLatency returns a sample of successful spans. +// +// minLatency is the minimum latency of spans to be returned. +// maxLatency, if nonzero, is the maximum latency of spans to be returned. +func (i internalOnly) ReportSpansByLatency(name string, minLatency, maxLatency time.Duration) []*SpanData { + s := spanStoreForName(name) + if s == nil { + return nil + } + var out []*SpanData + s.mu.Lock() + defer s.mu.Unlock() + for i, b := range s.latency { + min, max := latencyBucketBounds(i) + if i+1 != len(s.latency) && max <= minLatency { + continue + } + if maxLatency != 0 && maxLatency < min { + continue + } + for _, sd := range b.buffer { + if sd == nil { + break + } + if minLatency != 0 || maxLatency != 0 { + d := sd.EndTime.Sub(sd.StartTime) + if d < minLatency { + continue + } + if maxLatency != 0 && d > maxLatency { + continue + } + } + out = append(out, sd) + } + } + return out +} + +// spanStore keeps track of spans stored for a particular span name. +// +// It contains all active spans; a sample of spans for failed requests, +// categorized by error code; and a sample of spans for successful requests, +// bucketed by latency. +type spanStore struct { + mu sync.Mutex // protects everything below. + active map[*Span]struct{} + errors map[int32]*bucket + latency []bucket + maxSpansPerErrorBucket int +} + +// newSpanStore creates a span store. +func newSpanStore(name string, latencyBucketSize int, errorBucketSize int) *spanStore { + s := &spanStore{ + active: make(map[*Span]struct{}), + latency: make([]bucket, len(defaultLatencies)+1), + maxSpansPerErrorBucket: errorBucketSize, + } + for i := range s.latency { + s.latency[i] = makeBucket(latencyBucketSize) + } + return s +} + +// spanStoreForName returns the spanStore for the given name. +// +// It returns nil if it doesn't exist. +func spanStoreForName(name string) *spanStore { + var s *spanStore + ssmu.RLock() + s, _ = spanStores[name] + ssmu.RUnlock() + return s +} + +// spanStoreForNameCreateIfNew returns the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreForNameCreateIfNew(name string) *spanStore { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + return s + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + return s + } + s = newSpanStore(name, defaultBucketSize, defaultBucketSize) + spanStores[name] = s + return s +} + +// spanStoreSetSize resizes the spanStore for the given name. +// +// It creates it if it didn't exist. +func spanStoreSetSize(name string, latencyBucketSize int, errorBucketSize int) { + ssmu.RLock() + s, ok := spanStores[name] + ssmu.RUnlock() + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + ssmu.Lock() + defer ssmu.Unlock() + s, ok = spanStores[name] + if ok { + s.resize(latencyBucketSize, errorBucketSize) + return + } + s = newSpanStore(name, latencyBucketSize, errorBucketSize) + spanStores[name] = s +} + +func (s *spanStore) resize(latencyBucketSize int, errorBucketSize int) { + s.mu.Lock() + for i := range s.latency { + s.latency[i].resize(latencyBucketSize) + } + for _, b := range s.errors { + b.resize(errorBucketSize) + } + s.maxSpansPerErrorBucket = errorBucketSize + s.mu.Unlock() +} + +// add adds a span to the active bucket of the spanStore. +func (s *spanStore) add(span *Span) { + s.mu.Lock() + s.active[span] = struct{}{} + s.mu.Unlock() +} + +// finished removes a span from the active set, and adds a corresponding +// SpanData to a latency or error bucket. +func (s *spanStore) finished(span *Span, sd *SpanData) { + latency := sd.EndTime.Sub(sd.StartTime) + if latency < 0 { + latency = 0 + } + code := sd.Status.Code + + s.mu.Lock() + delete(s.active, span) + if code == 0 { + s.latency[latencyBucket(latency)].add(sd) + } else { + if s.errors == nil { + s.errors = make(map[int32]*bucket) + } + if b := s.errors[code]; b != nil { + b.add(sd) + } else { + b := makeBucket(s.maxSpansPerErrorBucket) + s.errors[code] = &b + b.add(sd) + } + } + s.mu.Unlock() +} diff --git a/vendor/go.opencensus.io/trace/status_codes.go b/vendor/go.opencensus.io/trace/status_codes.go new file mode 100644 index 000000000..ec60effd1 --- /dev/null +++ b/vendor/go.opencensus.io/trace/status_codes.go @@ -0,0 +1,37 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +// Status codes for use with Span.SetStatus. These correspond to the status +// codes used by gRPC defined here: https://github.com/googleapis/googleapis/blob/master/google/rpc/code.proto +const ( + StatusCodeOK = 0 + StatusCodeCancelled = 1 + StatusCodeUnknown = 2 + StatusCodeInvalidArgument = 3 + StatusCodeDeadlineExceeded = 4 + StatusCodeNotFound = 5 + StatusCodeAlreadyExists = 6 + StatusCodePermissionDenied = 7 + StatusCodeResourceExhausted = 8 + StatusCodeFailedPrecondition = 9 + StatusCodeAborted = 10 + StatusCodeOutOfRange = 11 + StatusCodeUnimplemented = 12 + StatusCodeInternal = 13 + StatusCodeUnavailable = 14 + StatusCodeDataLoss = 15 + StatusCodeUnauthenticated = 16 +) diff --git a/vendor/go.opencensus.io/trace/trace.go b/vendor/go.opencensus.io/trace/trace.go new file mode 100644 index 000000000..38ead7bf0 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace.go @@ -0,0 +1,598 @@ +// Copyright 2017, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +package trace + +import ( + "context" + crand "crypto/rand" + "encoding/binary" + "fmt" + "math/rand" + "sync" + "sync/atomic" + "time" + + "go.opencensus.io/internal" + "go.opencensus.io/trace/tracestate" +) + +// Span represents a span of a trace. It has an associated SpanContext, and +// stores data accumulated while the span is active. +// +// Ideally users should interact with Spans by calling the functions in this +// package that take a Context parameter. +type Span struct { + // data contains information recorded about the span. + // + // It will be non-nil if we are exporting the span or recording events for it. + // Otherwise, data is nil, and the Span is simply a carrier for the + // SpanContext, so that the trace ID is propagated. + data *SpanData + mu sync.Mutex // protects the contents of *data (but not the pointer value.) + spanContext SpanContext + + // lruAttributes are capped at configured limit. When the capacity is reached an oldest entry + // is removed to create room for a new entry. + lruAttributes *lruMap + + // annotations are stored in FIFO queue capped by configured limit. + annotations *evictedQueue + + // messageEvents are stored in FIFO queue capped by configured limit. + messageEvents *evictedQueue + + // links are stored in FIFO queue capped by configured limit. + links *evictedQueue + + // spanStore is the spanStore this span belongs to, if any, otherwise it is nil. + *spanStore + endOnce sync.Once + + executionTracerTaskEnd func() // ends the execution tracer span +} + +// IsRecordingEvents returns true if events are being recorded for this span. +// Use this check to avoid computing expensive annotations when they will never +// be used. +func (s *Span) IsRecordingEvents() bool { + if s == nil { + return false + } + return s.data != nil +} + +// TraceOptions contains options associated with a trace span. +type TraceOptions uint32 + +// IsSampled returns true if the span will be exported. +func (sc SpanContext) IsSampled() bool { + return sc.TraceOptions.IsSampled() +} + +// setIsSampled sets the TraceOptions bit that determines whether the span will be exported. +func (sc *SpanContext) setIsSampled(sampled bool) { + if sampled { + sc.TraceOptions |= 1 + } else { + sc.TraceOptions &= ^TraceOptions(1) + } +} + +// IsSampled returns true if the span will be exported. +func (t TraceOptions) IsSampled() bool { + return t&1 == 1 +} + +// SpanContext contains the state that must propagate across process boundaries. +// +// SpanContext is not an implementation of context.Context. +// TODO: add reference to external Census docs for SpanContext. +type SpanContext struct { + TraceID TraceID + SpanID SpanID + TraceOptions TraceOptions + Tracestate *tracestate.Tracestate +} + +type contextKey struct{} + +// FromContext returns the Span stored in a context, or nil if there isn't one. +func FromContext(ctx context.Context) *Span { + s, _ := ctx.Value(contextKey{}).(*Span) + return s +} + +// NewContext returns a new context with the given Span attached. +func NewContext(parent context.Context, s *Span) context.Context { + return context.WithValue(parent, contextKey{}, s) +} + +// All available span kinds. Span kind must be either one of these values. +const ( + SpanKindUnspecified = iota + SpanKindServer + SpanKindClient +) + +// StartOptions contains options concerning how a span is started. +type StartOptions struct { + // Sampler to consult for this Span. If provided, it is always consulted. + // + // If not provided, then the behavior differs based on whether + // the parent of this Span is remote, local, or there is no parent. + // In the case of a remote parent or no parent, the + // default sampler (see Config) will be consulted. Otherwise, + // when there is a non-remote parent, no new sampling decision will be made: + // we will preserve the sampling of the parent. + Sampler Sampler + + // SpanKind represents the kind of a span. If none is set, + // SpanKindUnspecified is used. + SpanKind int +} + +// StartOption apply changes to StartOptions. +type StartOption func(*StartOptions) + +// WithSpanKind makes new spans to be created with the given kind. +func WithSpanKind(spanKind int) StartOption { + return func(o *StartOptions) { + o.SpanKind = spanKind + } +} + +// WithSampler makes new spans to be be created with a custom sampler. +// Otherwise, the global sampler is used. +func WithSampler(sampler Sampler) StartOption { + return func(o *StartOptions) { + o.Sampler = sampler + } +} + +// StartSpan starts a new child span of the current span in the context. If +// there is no span in the context, creates a new trace and span. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpan(ctx context.Context, name string, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + var parent SpanContext + if p := FromContext(ctx); p != nil { + p.addChild() + parent = p.spanContext + } + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, false, opts) + + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +// StartSpanWithRemoteParent starts a new child span of the span from the given parent. +// +// If the incoming context contains a parent, it ignores. StartSpanWithRemoteParent is +// preferred for cases where the parent is propagated via an incoming request. +// +// Returned context contains the newly created span. You can use it to +// propagate the returned span in process. +func StartSpanWithRemoteParent(ctx context.Context, name string, parent SpanContext, o ...StartOption) (context.Context, *Span) { + var opts StartOptions + for _, op := range o { + op(&opts) + } + span := startSpanInternal(name, parent != SpanContext{}, parent, true, opts) + ctx, end := startExecutionTracerTask(ctx, name) + span.executionTracerTaskEnd = end + return NewContext(ctx, span), span +} + +func startSpanInternal(name string, hasParent bool, parent SpanContext, remoteParent bool, o StartOptions) *Span { + span := &Span{} + span.spanContext = parent + + cfg := config.Load().(*Config) + + if !hasParent { + span.spanContext.TraceID = cfg.IDGenerator.NewTraceID() + } + span.spanContext.SpanID = cfg.IDGenerator.NewSpanID() + sampler := cfg.DefaultSampler + + if !hasParent || remoteParent || o.Sampler != nil { + // If this span is the child of a local span and no Sampler is set in the + // options, keep the parent's TraceOptions. + // + // Otherwise, consult the Sampler in the options if it is non-nil, otherwise + // the default sampler. + if o.Sampler != nil { + sampler = o.Sampler + } + span.spanContext.setIsSampled(sampler(SamplingParameters{ + ParentContext: parent, + TraceID: span.spanContext.TraceID, + SpanID: span.spanContext.SpanID, + Name: name, + HasRemoteParent: remoteParent}).Sample) + } + + if !internal.LocalSpanStoreEnabled && !span.spanContext.IsSampled() { + return span + } + + span.data = &SpanData{ + SpanContext: span.spanContext, + StartTime: time.Now(), + SpanKind: o.SpanKind, + Name: name, + HasRemoteParent: remoteParent, + } + span.lruAttributes = newLruMap(cfg.MaxAttributesPerSpan) + span.annotations = newEvictedQueue(cfg.MaxAnnotationEventsPerSpan) + span.messageEvents = newEvictedQueue(cfg.MaxMessageEventsPerSpan) + span.links = newEvictedQueue(cfg.MaxLinksPerSpan) + + if hasParent { + span.data.ParentSpanID = parent.SpanID + } + if internal.LocalSpanStoreEnabled { + var ss *spanStore + ss = spanStoreForNameCreateIfNew(name) + if ss != nil { + span.spanStore = ss + ss.add(span) + } + } + + return span +} + +// End ends the span. +func (s *Span) End() { + if s == nil { + return + } + if s.executionTracerTaskEnd != nil { + s.executionTracerTaskEnd() + } + if !s.IsRecordingEvents() { + return + } + s.endOnce.Do(func() { + exp, _ := exporters.Load().(exportersMap) + mustExport := s.spanContext.IsSampled() && len(exp) > 0 + if s.spanStore != nil || mustExport { + sd := s.makeSpanData() + sd.EndTime = internal.MonotonicEndTime(sd.StartTime) + if s.spanStore != nil { + s.spanStore.finished(s, sd) + } + if mustExport { + for e := range exp { + e.ExportSpan(sd) + } + } + } + }) +} + +// makeSpanData produces a SpanData representing the current state of the Span. +// It requires that s.data is non-nil. +func (s *Span) makeSpanData() *SpanData { + var sd SpanData + s.mu.Lock() + sd = *s.data + if s.lruAttributes.simpleLruMap.Len() > 0 { + sd.Attributes = s.lruAttributesToAttributeMap() + sd.DroppedAttributeCount = s.lruAttributes.droppedCount + } + if len(s.annotations.queue) > 0 { + sd.Annotations = s.interfaceArrayToAnnotationArray() + sd.DroppedAnnotationCount = s.annotations.droppedCount + } + if len(s.messageEvents.queue) > 0 { + sd.MessageEvents = s.interfaceArrayToMessageEventArray() + sd.DroppedMessageEventCount = s.messageEvents.droppedCount + } + if len(s.links.queue) > 0 { + sd.Links = s.interfaceArrayToLinksArray() + sd.DroppedLinkCount = s.links.droppedCount + } + s.mu.Unlock() + return &sd +} + +// SpanContext returns the SpanContext of the span. +func (s *Span) SpanContext() SpanContext { + if s == nil { + return SpanContext{} + } + return s.spanContext +} + +// SetName sets the name of the span, if it is recording events. +func (s *Span) SetName(name string) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Name = name + s.mu.Unlock() +} + +// SetStatus sets the status of the span, if it is recording events. +func (s *Span) SetStatus(status Status) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.Status = status + s.mu.Unlock() +} + +func (s *Span) interfaceArrayToLinksArray() []Link { + linksArr := make([]Link, 0) + for _, value := range s.links.queue { + linksArr = append(linksArr, value.(Link)) + } + return linksArr +} + +func (s *Span) interfaceArrayToMessageEventArray() []MessageEvent { + messageEventArr := make([]MessageEvent, 0) + for _, value := range s.messageEvents.queue { + messageEventArr = append(messageEventArr, value.(MessageEvent)) + } + return messageEventArr +} + +func (s *Span) interfaceArrayToAnnotationArray() []Annotation { + annotationArr := make([]Annotation, 0) + for _, value := range s.annotations.queue { + annotationArr = append(annotationArr, value.(Annotation)) + } + return annotationArr +} + +func (s *Span) lruAttributesToAttributeMap() map[string]interface{} { + attributes := make(map[string]interface{}) + for _, key := range s.lruAttributes.simpleLruMap.Keys() { + value, ok := s.lruAttributes.simpleLruMap.Get(key) + if ok { + keyStr := key.(string) + attributes[keyStr] = value + } + } + return attributes +} + +func (s *Span) copyToCappedAttributes(attributes []Attribute) { + for _, a := range attributes { + s.lruAttributes.add(a.key, a.value) + } +} + +func (s *Span) addChild() { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.data.ChildSpanCount++ + s.mu.Unlock() +} + +// AddAttributes sets attributes in the span. +// +// Existing attributes whose keys appear in the attributes parameter are overwritten. +func (s *Span) AddAttributes(attributes ...Attribute) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.copyToCappedAttributes(attributes) + s.mu.Unlock() +} + +// copyAttributes copies a slice of Attributes into a map. +func copyAttributes(m map[string]interface{}, attributes []Attribute) { + for _, a := range attributes { + m[a.key] = a.value + } +} + +func (s *Span) lazyPrintfInternal(attributes []Attribute, format string, a ...interface{}) { + now := time.Now() + msg := fmt.Sprintf(format, a...) + var m map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + m = make(map[string]interface{}) + copyAttributes(m, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: msg, + Attributes: m, + }) + s.mu.Unlock() +} + +func (s *Span) printStringInternal(attributes []Attribute, str string) { + now := time.Now() + var a map[string]interface{} + s.mu.Lock() + if len(attributes) != 0 { + a = make(map[string]interface{}) + copyAttributes(a, attributes) + } + s.annotations.add(Annotation{ + Time: now, + Message: str, + Attributes: a, + }) + s.mu.Unlock() +} + +// Annotate adds an annotation with attributes. +// Attributes can be nil. +func (s *Span) Annotate(attributes []Attribute, str string) { + if !s.IsRecordingEvents() { + return + } + s.printStringInternal(attributes, str) +} + +// Annotatef adds an annotation with attributes. +func (s *Span) Annotatef(attributes []Attribute, format string, a ...interface{}) { + if !s.IsRecordingEvents() { + return + } + s.lazyPrintfInternal(attributes, format, a...) +} + +// AddMessageSendEvent adds a message send event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageSendEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeSent, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddMessageReceiveEvent adds a message receive event to the span. +// +// messageID is an identifier for the message, which is recommended to be +// unique in this span and the same between the send event and the receive +// event (this allows to identify a message between the sender and receiver). +// For example, this could be a sequence id. +func (s *Span) AddMessageReceiveEvent(messageID, uncompressedByteSize, compressedByteSize int64) { + if !s.IsRecordingEvents() { + return + } + now := time.Now() + s.mu.Lock() + s.messageEvents.add(MessageEvent{ + Time: now, + EventType: MessageEventTypeRecv, + MessageID: messageID, + UncompressedByteSize: uncompressedByteSize, + CompressedByteSize: compressedByteSize, + }) + s.mu.Unlock() +} + +// AddLink adds a link to the span. +func (s *Span) AddLink(l Link) { + if !s.IsRecordingEvents() { + return + } + s.mu.Lock() + s.links.add(l) + s.mu.Unlock() +} + +func (s *Span) String() string { + if s == nil { + return "" + } + if s.data == nil { + return fmt.Sprintf("span %s", s.spanContext.SpanID) + } + s.mu.Lock() + str := fmt.Sprintf("span %s %q", s.spanContext.SpanID, s.data.Name) + s.mu.Unlock() + return str +} + +var config atomic.Value // access atomically + +func init() { + gen := &defaultIDGenerator{} + // initialize traceID and spanID generators. + var rngSeed int64 + for _, p := range []interface{}{ + &rngSeed, &gen.traceIDAdd, &gen.nextSpanID, &gen.spanIDInc, + } { + binary.Read(crand.Reader, binary.LittleEndian, p) + } + gen.traceIDRand = rand.New(rand.NewSource(rngSeed)) + gen.spanIDInc |= 1 + + config.Store(&Config{ + DefaultSampler: ProbabilitySampler(defaultSamplingProbability), + IDGenerator: gen, + MaxAttributesPerSpan: DefaultMaxAttributesPerSpan, + MaxAnnotationEventsPerSpan: DefaultMaxAnnotationEventsPerSpan, + MaxMessageEventsPerSpan: DefaultMaxMessageEventsPerSpan, + MaxLinksPerSpan: DefaultMaxLinksPerSpan, + }) +} + +type defaultIDGenerator struct { + sync.Mutex + + // Please keep these as the first fields + // so that these 8 byte fields will be aligned on addresses + // divisible by 8, on both 32-bit and 64-bit machines when + // performing atomic increments and accesses. + // See: + // * https://github.com/census-instrumentation/opencensus-go/issues/587 + // * https://github.com/census-instrumentation/opencensus-go/issues/865 + // * https://golang.org/pkg/sync/atomic/#pkg-note-BUG + nextSpanID uint64 + spanIDInc uint64 + + traceIDAdd [2]uint64 + traceIDRand *rand.Rand +} + +// NewSpanID returns a non-zero span ID from a randomly-chosen sequence. +func (gen *defaultIDGenerator) NewSpanID() [8]byte { + var id uint64 + for id == 0 { + id = atomic.AddUint64(&gen.nextSpanID, gen.spanIDInc) + } + var sid [8]byte + binary.LittleEndian.PutUint64(sid[:], id) + return sid +} + +// NewTraceID returns a non-zero trace ID from a randomly-chosen sequence. +// mu should be held while this function is called. +func (gen *defaultIDGenerator) NewTraceID() [16]byte { + var tid [16]byte + // Construct the trace ID from two outputs of traceIDRand, with a constant + // added to each half for additional entropy. + gen.Lock() + binary.LittleEndian.PutUint64(tid[0:8], gen.traceIDRand.Uint64()+gen.traceIDAdd[0]) + binary.LittleEndian.PutUint64(tid[8:16], gen.traceIDRand.Uint64()+gen.traceIDAdd[1]) + gen.Unlock() + return tid +} diff --git a/vendor/go.opencensus.io/trace/trace_go11.go b/vendor/go.opencensus.io/trace/trace_go11.go new file mode 100644 index 000000000..b7d8aaf28 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_go11.go @@ -0,0 +1,32 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build go1.11 + +package trace + +import ( + "context" + t "runtime/trace" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + if !t.IsEnabled() { + // Avoid additional overhead if + // runtime/trace is not enabled. + return ctx, func() {} + } + nctx, task := t.NewTask(ctx, name) + return nctx, task.End +} diff --git a/vendor/go.opencensus.io/trace/trace_nongo11.go b/vendor/go.opencensus.io/trace/trace_nongo11.go new file mode 100644 index 000000000..e25419859 --- /dev/null +++ b/vendor/go.opencensus.io/trace/trace_nongo11.go @@ -0,0 +1,25 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// +build !go1.11 + +package trace + +import ( + "context" +) + +func startExecutionTracerTask(ctx context.Context, name string) (context.Context, func()) { + return ctx, func() {} +} diff --git a/vendor/go.opencensus.io/trace/tracestate/tracestate.go b/vendor/go.opencensus.io/trace/tracestate/tracestate.go new file mode 100644 index 000000000..2d6c713eb --- /dev/null +++ b/vendor/go.opencensus.io/trace/tracestate/tracestate.go @@ -0,0 +1,147 @@ +// Copyright 2018, OpenCensus Authors +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +// Package tracestate implements support for the Tracestate header of the +// W3C TraceContext propagation format. +package tracestate + +import ( + "fmt" + "regexp" +) + +const ( + keyMaxSize = 256 + valueMaxSize = 256 + maxKeyValuePairs = 32 +) + +const ( + keyWithoutVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,255}` + keyWithVendorFormat = `[a-z][_0-9a-z\-\*\/]{0,240}@[a-z][_0-9a-z\-\*\/]{0,13}` + keyFormat = `(` + keyWithoutVendorFormat + `)|(` + keyWithVendorFormat + `)` + valueFormat = `[\x20-\x2b\x2d-\x3c\x3e-\x7e]{0,255}[\x21-\x2b\x2d-\x3c\x3e-\x7e]` +) + +var keyValidationRegExp = regexp.MustCompile(`^(` + keyFormat + `)$`) +var valueValidationRegExp = regexp.MustCompile(`^(` + valueFormat + `)$`) + +// Tracestate represents tracing-system specific context in a list of key-value pairs. Tracestate allows different +// vendors propagate additional information and inter-operate with their legacy Id formats. +type Tracestate struct { + entries []Entry +} + +// Entry represents one key-value pair in a list of key-value pair of Tracestate. +type Entry struct { + // Key is an opaque string up to 256 characters printable. It MUST begin with a lowercase letter, + // and can only contain lowercase letters a-z, digits 0-9, underscores _, dashes -, asterisks *, and + // forward slashes /. + Key string + + // Value is an opaque string up to 256 characters printable ASCII RFC0020 characters (i.e., the + // range 0x20 to 0x7E) except comma , and =. + Value string +} + +// Entries returns a slice of Entry. +func (ts *Tracestate) Entries() []Entry { + if ts == nil { + return nil + } + return ts.entries +} + +func (ts *Tracestate) remove(key string) *Entry { + for index, entry := range ts.entries { + if entry.Key == key { + ts.entries = append(ts.entries[:index], ts.entries[index+1:]...) + return &entry + } + } + return nil +} + +func (ts *Tracestate) add(entries []Entry) error { + for _, entry := range entries { + ts.remove(entry.Key) + } + if len(ts.entries)+len(entries) > maxKeyValuePairs { + return fmt.Errorf("adding %d key-value pairs to current %d pairs exceeds the limit of %d", + len(entries), len(ts.entries), maxKeyValuePairs) + } + ts.entries = append(entries, ts.entries...) + return nil +} + +func isValid(entry Entry) bool { + return keyValidationRegExp.MatchString(entry.Key) && + valueValidationRegExp.MatchString(entry.Value) +} + +func containsDuplicateKey(entries ...Entry) (string, bool) { + keyMap := make(map[string]int) + for _, entry := range entries { + if _, ok := keyMap[entry.Key]; ok { + return entry.Key, true + } + keyMap[entry.Key] = 1 + } + return "", false +} + +func areEntriesValid(entries ...Entry) (*Entry, bool) { + for _, entry := range entries { + if !isValid(entry) { + return &entry, false + } + } + return nil, true +} + +// New creates a Tracestate object from a parent and/or entries (key-value pair). +// Entries from the parent are copied if present. The entries passed to this function +// are inserted in front of those copied from the parent. If an entry copied from the +// parent contains the same key as one of the entry in entries then the entry copied +// from the parent is removed. See add func. +// +// An error is returned with nil Tracestate if +// 1. one or more entry in entries is invalid. +// 2. two or more entries in the input entries have the same key. +// 3. the number of entries combined from the parent and the input entries exceeds maxKeyValuePairs. +// (duplicate entry is counted only once). +func New(parent *Tracestate, entries ...Entry) (*Tracestate, error) { + if parent == nil && len(entries) == 0 { + return nil, nil + } + if entry, ok := areEntriesValid(entries...); !ok { + return nil, fmt.Errorf("key-value pair {%s, %s} is invalid", entry.Key, entry.Value) + } + + if key, duplicate := containsDuplicateKey(entries...); duplicate { + return nil, fmt.Errorf("contains duplicate keys (%s)", key) + } + + tracestate := Tracestate{} + + if parent != nil && len(parent.entries) > 0 { + tracestate.entries = append([]Entry{}, parent.entries...) + } + + err := tracestate.add(entries) + if err != nil { + return nil, err + } + return &tracestate, nil +} diff --git a/vendor/golang.org/x/sys/unix/affinity_linux.go b/vendor/golang.org/x/sys/unix/affinity_linux.go index 72afe3338..14e4d5caa 100644 --- a/vendor/golang.org/x/sys/unix/affinity_linux.go +++ b/vendor/golang.org/x/sys/unix/affinity_linux.go @@ -91,9 +91,13 @@ func onesCount64(x uint64) int { const m0 = 0x5555555555555555 // 01010101 ... const m1 = 0x3333333333333333 // 00110011 ... const m2 = 0x0f0f0f0f0f0f0f0f // 00001111 ... - const m3 = 0x00ff00ff00ff00ff // etc. - const m4 = 0x0000ffff0000ffff + // Unused in this function, but definitions preserved for + // documentation purposes: + // + // const m3 = 0x00ff00ff00ff00ff // etc. + // const m4 = 0x0000ffff0000ffff + // // Implementation: Parallel summing of adjacent bits. // See "Hacker's Delight", Chap. 5: Counting Bits. // The following pattern shows the general approach: diff --git a/vendor/golang.org/x/sys/unix/dirent.go b/vendor/golang.org/x/sys/unix/dirent.go index 4407c505a..304016b68 100644 --- a/vendor/golang.org/x/sys/unix/dirent.go +++ b/vendor/golang.org/x/sys/unix/dirent.go @@ -2,16 +2,101 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// +build aix darwin dragonfly freebsd linux nacl netbsd openbsd solaris +// +build aix darwin dragonfly freebsd linux netbsd openbsd solaris package unix -import "syscall" +import "unsafe" + +// readInt returns the size-bytes unsigned integer in native byte order at offset off. +func readInt(b []byte, off, size uintptr) (u uint64, ok bool) { + if len(b) < int(off+size) { + return 0, false + } + if isBigEndian { + return readIntBE(b[off:], size), true + } + return readIntLE(b[off:], size), true +} + +func readIntBE(b []byte, size uintptr) uint64 { + switch size { + case 1: + return uint64(b[0]) + case 2: + _ = b[1] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[1]) | uint64(b[0])<<8 + case 4: + _ = b[3] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[3]) | uint64(b[2])<<8 | uint64(b[1])<<16 | uint64(b[0])<<24 + case 8: + _ = b[7] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[7]) | uint64(b[6])<<8 | uint64(b[5])<<16 | uint64(b[4])<<24 | + uint64(b[3])<<32 | uint64(b[2])<<40 | uint64(b[1])<<48 | uint64(b[0])<<56 + default: + panic("syscall: readInt with unsupported size") + } +} + +func readIntLE(b []byte, size uintptr) uint64 { + switch size { + case 1: + return uint64(b[0]) + case 2: + _ = b[1] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[0]) | uint64(b[1])<<8 + case 4: + _ = b[3] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 + case 8: + _ = b[7] // bounds check hint to compiler; see golang.org/issue/14808 + return uint64(b[0]) | uint64(b[1])<<8 | uint64(b[2])<<16 | uint64(b[3])<<24 | + uint64(b[4])<<32 | uint64(b[5])<<40 | uint64(b[6])<<48 | uint64(b[7])<<56 + default: + panic("syscall: readInt with unsupported size") + } +} // ParseDirent parses up to max directory entries in buf, // appending the names to names. It returns the number of // bytes consumed from buf, the number of entries added // to names, and the new names slice. func ParseDirent(buf []byte, max int, names []string) (consumed int, count int, newnames []string) { - return syscall.ParseDirent(buf, max, names) + origlen := len(buf) + count = 0 + for max != 0 && len(buf) > 0 { + reclen, ok := direntReclen(buf) + if !ok || reclen > uint64(len(buf)) { + return origlen, count, names + } + rec := buf[:reclen] + buf = buf[reclen:] + ino, ok := direntIno(rec) + if !ok { + break + } + if ino == 0 { // File absent in directory. + continue + } + const namoff = uint64(unsafe.Offsetof(Dirent{}.Name)) + namlen, ok := direntNamlen(rec) + if !ok || namoff+namlen > uint64(len(rec)) { + break + } + name := rec[namoff : namoff+namlen] + for i, c := range name { + if c == 0 { + name = name[:i] + break + } + } + // Check for useless names before allocating a string. + if string(name) == "." || string(name) == ".." { + continue + } + max-- + count++ + names = append(names, string(name)) + } + return origlen - len(buf), count, names } diff --git a/vendor/golang.org/x/sys/unix/endian_little.go b/vendor/golang.org/x/sys/unix/endian_little.go index 085df2d8d..bcdb5d30e 100644 --- a/vendor/golang.org/x/sys/unix/endian_little.go +++ b/vendor/golang.org/x/sys/unix/endian_little.go @@ -2,7 +2,7 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. // -// +build 386 amd64 amd64p32 arm arm64 ppc64le mipsle mips64le +// +build 386 amd64 amd64p32 arm arm64 ppc64le mipsle mips64le riscv64 package unix diff --git a/vendor/golang.org/x/sys/unix/readdirent_getdents.go b/vendor/golang.org/x/sys/unix/readdirent_getdents.go new file mode 100644 index 000000000..3a90aa6df --- /dev/null +++ b/vendor/golang.org/x/sys/unix/readdirent_getdents.go @@ -0,0 +1,12 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build aix dragonfly freebsd linux netbsd openbsd + +package unix + +// ReadDirent reads directory entries from fd and writes them into buf. +func ReadDirent(fd int, buf []byte) (n int, err error) { + return Getdents(fd, buf) +} diff --git a/vendor/golang.org/x/sys/unix/readdirent_getdirentries.go b/vendor/golang.org/x/sys/unix/readdirent_getdirentries.go new file mode 100644 index 000000000..5fdae40b3 --- /dev/null +++ b/vendor/golang.org/x/sys/unix/readdirent_getdirentries.go @@ -0,0 +1,19 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build darwin + +package unix + +import "unsafe" + +// ReadDirent reads directory entries from fd and writes them into buf. +func ReadDirent(fd int, buf []byte) (n int, err error) { + // Final argument is (basep *uintptr) and the syscall doesn't take nil. + // 64 bits should be enough. (32 bits isn't even on 386). Since the + // actual system call is getdirentries64, 64 is a good guess. + // TODO(rsc): Can we use a single global basep for all calls? + var base = (*uintptr)(unsafe.Pointer(new(uint64))) + return Getdirentries(fd, buf, base) +} diff --git a/vendor/golang.org/x/sys/unix/syscall_aix.go b/vendor/golang.org/x/sys/unix/syscall_aix.go index 45e12fb8a..1aa065f9c 100644 --- a/vendor/golang.org/x/sys/unix/syscall_aix.go +++ b/vendor/golang.org/x/sys/unix/syscall_aix.go @@ -280,8 +280,24 @@ func sendfile(outfd int, infd int, offset *int64, count int) (written int, err e return -1, ENOSYS } +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Ino), unsafe.Sizeof(Dirent{}.Ino)) +} + +func direntReclen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Reclen), unsafe.Sizeof(Dirent{}.Reclen)) +} + +func direntNamlen(buf []byte) (uint64, bool) { + reclen, ok := direntReclen(buf) + if !ok { + return 0, false + } + return reclen - uint64(unsafe.Offsetof(Dirent{}.Name)), true +} + //sys getdirent(fd int, buf []byte) (n int, err error) -func ReadDirent(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { return getdirent(fd, buf) } diff --git a/vendor/golang.org/x/sys/unix/syscall_bsd.go b/vendor/golang.org/x/sys/unix/syscall_bsd.go index 33c8b5f0d..97a8eef6f 100644 --- a/vendor/golang.org/x/sys/unix/syscall_bsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_bsd.go @@ -63,15 +63,6 @@ func Setgroups(gids []int) (err error) { return setgroups(len(a), &a[0]) } -func ReadDirent(fd int, buf []byte) (n int, err error) { - // Final argument is (basep *uintptr) and the syscall doesn't take nil. - // 64 bits should be enough. (32 bits isn't even on 386). Since the - // actual system call is getdirentries64, 64 is a good guess. - // TODO(rsc): Can we use a single global basep for all calls? - var base = (*uintptr)(unsafe.Pointer(new(uint64))) - return Getdirentries(fd, buf, base) -} - // Wait status is 7 bits at bottom, either 0 (exited), // 0x7F (stopped), or a signal number that caused an exit. // The 0x80 bit is whether there was a core dump. @@ -86,6 +77,7 @@ const ( shift = 8 exited = 0 + killed = 9 stopped = 0x7F ) @@ -112,6 +104,8 @@ func (w WaitStatus) CoreDump() bool { return w.Signaled() && w&core != 0 } func (w WaitStatus) Stopped() bool { return w&mask == stopped && syscall.Signal(w>>shift) != SIGSTOP } +func (w WaitStatus) Killed() bool { return w&mask == killed && syscall.Signal(w>>shift) != SIGKILL } + func (w WaitStatus) Continued() bool { return w&mask == stopped && syscall.Signal(w>>shift) == SIGSTOP } func (w WaitStatus) StopSignal() syscall.Signal { diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin.go b/vendor/golang.org/x/sys/unix/syscall_darwin.go index 212009189..3e1cdfb50 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin.go @@ -77,7 +77,18 @@ func nametomib(name string) (mib []_C_int, err error) { return buf[0 : n/siz], nil } -//sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Ino), unsafe.Sizeof(Dirent{}.Ino)) +} + +func direntReclen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Reclen), unsafe.Sizeof(Dirent{}.Reclen)) +} + +func direntNamlen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) +} + func PtraceAttach(pid int) (err error) { return ptrace(PT_ATTACH, pid, 0, 0) } func PtraceDetach(pid int) (err error) { return ptrace(PT_DETACH, pid, 0, 0) } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go index 489726fa9..cd8be182a 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_386.go @@ -10,6 +10,8 @@ import ( "syscall" ) +//sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: int32(sec), Nsec: int32(nsec)} } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go index 914b89bde..d0d07243c 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_amd64.go @@ -10,6 +10,8 @@ import ( "syscall" ) +//sys ptrace(request int, pid int, addr uintptr, data uintptr) (err error) + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go index 4a284cf50..01e8a38a9 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm.go @@ -8,6 +8,10 @@ import ( "syscall" ) +func ptrace(request int, pid int, addr uintptr, data uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: int32(sec), Nsec: int32(nsec)} } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go index 52dcd88f6..e674f81da 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin_arm64.go @@ -10,6 +10,10 @@ import ( "syscall" ) +func ptrace(request int, pid int, addr uintptr, data uintptr) error { + return ENOTSUP +} + func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} } diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go index 962eee304..260a400f9 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go @@ -57,6 +57,22 @@ func nametomib(name string) (mib []_C_int, err error) { return buf[0 : n/siz], nil } +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Fileno), unsafe.Sizeof(Dirent{}.Fileno)) +} + +func direntReclen(buf []byte) (uint64, bool) { + namlen, ok := direntNamlen(buf) + if !ok { + return 0, false + } + return (16 + namlen + 1 + 7) &^ 7, true +} + +func direntNamlen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) +} + //sysnb pipe() (r int, w int, err error) func Pipe(p []int) (err error) { @@ -269,6 +285,7 @@ func Sendfile(outfd int, infd int, offset *int64, count int) (written int, err e //sys Fstatfs(fd int, stat *Statfs_t) (err error) //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) +//sys Getdents(fd int, buf []byte) (n int, err error) //sys Getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) //sys Getdtablesize() (size int) //sysnb Getegid() (egid int) diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd.go b/vendor/golang.org/x/sys/unix/syscall_freebsd.go index f135812a3..329d240b9 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd.go @@ -82,6 +82,18 @@ func nametomib(name string) (mib []_C_int, err error) { return buf[0 : n/siz], nil } +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Fileno), unsafe.Sizeof(Dirent{}.Fileno)) +} + +func direntReclen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Reclen), unsafe.Sizeof(Dirent{}.Reclen)) +} + +func direntNamlen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) +} + func Pipe(p []int) (err error) { return Pipe2(p, 0) } @@ -362,7 +374,21 @@ func Getdents(fd int, buf []byte) (n int, err error) { func Getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { if supportsABI(_ino64First) { - return getdirentries_freebsd12(fd, buf, basep) + if basep == nil || unsafe.Sizeof(*basep) == 8 { + return getdirentries_freebsd12(fd, buf, (*uint64)(unsafe.Pointer(basep))) + } + // The freebsd12 syscall needs a 64-bit base. On 32-bit machines + // we can't just use the basep passed in. See #32498. + var base uint64 = uint64(*basep) + n, err = getdirentries_freebsd12(fd, buf, &base) + *basep = uintptr(base) + if base>>32 != 0 { + // We can't stuff the base back into a uintptr, so any + // future calls would be suspect. Generate an error. + // EIO is allowed by getdirentries. + err = EIO + } + return } // The old syscall entries are smaller than the new. Use 1/4 of the original @@ -507,6 +533,70 @@ func Sendfile(outfd int, infd int, offset *int64, count int) (written int, err e return sendfile(outfd, infd, offset, count) } +//sys ptrace(request int, pid int, addr uintptr, data int) (err error) + +func PtraceAttach(pid int) (err error) { + return ptrace(PTRACE_ATTACH, pid, 0, 0) +} + +func PtraceCont(pid int, signal int) (err error) { + return ptrace(PTRACE_CONT, pid, 1, signal) +} + +func PtraceDetach(pid int) (err error) { + return ptrace(PTRACE_DETACH, pid, 1, 0) +} + +func PtraceGetFpRegs(pid int, fpregsout *FpReg) (err error) { + return ptrace(PTRACE_GETFPREGS, pid, uintptr(unsafe.Pointer(fpregsout)), 0) +} + +func PtraceGetFsBase(pid int, fsbase *int64) (err error) { + return ptrace(PTRACE_GETFSBASE, pid, uintptr(unsafe.Pointer(fsbase)), 0) +} + +func PtraceGetRegs(pid int, regsout *Reg) (err error) { + return ptrace(PTRACE_GETREGS, pid, uintptr(unsafe.Pointer(regsout)), 0) +} + +func PtraceIO(req int, pid int, addr uintptr, out []byte, countin int) (count int, err error) { + ioDesc := PtraceIoDesc{Op: int32(req), Offs: (*byte)(unsafe.Pointer(addr)), Addr: (*byte)(unsafe.Pointer(&out[0])), Len: uint(countin)} + err = ptrace(PTRACE_IO, pid, uintptr(unsafe.Pointer(&ioDesc)), 0) + return int(ioDesc.Len), err +} + +func PtraceLwpEvents(pid int, enable int) (err error) { + return ptrace(PTRACE_LWPEVENTS, pid, 0, enable) +} + +func PtraceLwpInfo(pid int, info uintptr) (err error) { + return ptrace(PTRACE_LWPINFO, pid, info, int(unsafe.Sizeof(PtraceLwpInfoStruct{}))) +} + +func PtracePeekData(pid int, addr uintptr, out []byte) (count int, err error) { + return PtraceIO(PIOD_READ_D, pid, addr, out, SizeofLong) +} + +func PtracePeekText(pid int, addr uintptr, out []byte) (count int, err error) { + return PtraceIO(PIOD_READ_I, pid, addr, out, SizeofLong) +} + +func PtracePokeData(pid int, addr uintptr, data []byte) (count int, err error) { + return PtraceIO(PIOD_WRITE_D, pid, addr, data, SizeofLong) +} + +func PtracePokeText(pid int, addr uintptr, data []byte) (count int, err error) { + return PtraceIO(PIOD_WRITE_I, pid, addr, data, SizeofLong) +} + +func PtraceSetRegs(pid int, regs *Reg) (err error) { + return ptrace(PTRACE_SETREGS, pid, uintptr(unsafe.Pointer(regs)), 0) +} + +func PtraceSingleStep(pid int) (err error) { + return ptrace(PTRACE_SINGLESTEP, pid, 1, 0) +} + /* * Exposed directly */ @@ -555,7 +645,7 @@ func Sendfile(outfd int, infd int, offset *int64, count int) (written int, err e //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) //sys getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) -//sys getdirentries_freebsd12(fd int, buf []byte, basep *uintptr) (n int, err error) +//sys getdirentries_freebsd12(fd int, buf []byte, basep *uint64) (n int, err error) //sys Getdtablesize() (size int) //sysnb Getegid() (egid int) //sysnb Geteuid() (uid int) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux.go b/vendor/golang.org/x/sys/unix/syscall_linux.go index c92545ea5..637b5017b 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux.go @@ -13,7 +13,6 @@ package unix import ( "encoding/binary" - "net" "runtime" "syscall" "unsafe" @@ -765,7 +764,7 @@ const px_proto_oe = 0 type SockaddrPPPoE struct { SID uint16 - Remote net.HardwareAddr + Remote []byte Dev string raw RawSockaddrPPPoX } @@ -916,7 +915,7 @@ func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { } sa := &SockaddrPPPoE{ SID: binary.BigEndian.Uint16(pp[6:8]), - Remote: net.HardwareAddr(pp[8:14]), + Remote: pp[8:14], } for i := 14; i < 14+IFNAMSIZ; i++ { if pp[i] == 0 { @@ -1414,8 +1413,20 @@ func Reboot(cmd int) (err error) { return reboot(LINUX_REBOOT_MAGIC1, LINUX_REBOOT_MAGIC2, cmd, "") } -func ReadDirent(fd int, buf []byte) (n int, err error) { - return Getdents(fd, buf) +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Ino), unsafe.Sizeof(Dirent{}.Ino)) +} + +func direntReclen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Reclen), unsafe.Sizeof(Dirent{}.Reclen)) +} + +func direntNamlen(buf []byte) (uint64, bool) { + reclen, ok := direntReclen(buf) + if !ok { + return 0, false + } + return reclen - uint64(unsafe.Offsetof(Dirent{}.Name)), true } //sys mount(source string, target string, fstype string, flags uintptr, data *byte) (err error) @@ -1450,6 +1461,8 @@ func Sendfile(outfd int, infd int, offset *int64, count int) (written int, err e //sys Acct(path string) (err error) //sys AddKey(keyType string, description string, payload []byte, ringid int) (id int, err error) //sys Adjtimex(buf *Timex) (state int, err error) +//sys Capget(hdr *CapUserHeader, data *CapUserData) (err error) +//sys Capset(hdr *CapUserHeader, data *CapUserData) (err error) //sys Chdir(path string) (err error) //sys Chroot(path string) (err error) //sys ClockGetres(clockid int32, res *Timespec) (err error) @@ -1755,8 +1768,6 @@ func OpenByHandleAt(mountFD int, handle FileHandle, flags int) (fd int, err erro // Alarm // ArchPrctl // Brk -// Capget -// Capset // ClockNanosleep // ClockSettime // Clone diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd.go b/vendor/golang.org/x/sys/unix/syscall_netbsd.go index 5240e16e4..5ef309040 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd.go @@ -94,6 +94,18 @@ func nametomib(name string) (mib []_C_int, err error) { return mib, nil } +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Fileno), unsafe.Sizeof(Dirent{}.Fileno)) +} + +func direntReclen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Reclen), unsafe.Sizeof(Dirent{}.Reclen)) +} + +func direntNamlen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) +} + func SysctlClockinfo(name string) (*Clockinfo, error) { mib, err := sysctlmib(name) if err != nil { @@ -120,9 +132,30 @@ func Pipe(p []int) (err error) { return } -//sys getdents(fd int, buf []byte) (n int, err error) +//sys Getdents(fd int, buf []byte) (n int, err error) func Getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { - return getdents(fd, buf) + n, err = Getdents(fd, buf) + if err != nil || basep == nil { + return + } + + var off int64 + off, err = Seek(fd, 0, 1 /* SEEK_CUR */) + if err != nil { + *basep = ^uintptr(0) + return + } + *basep = uintptr(off) + if unsafe.Sizeof(*basep) == 8 { + return + } + if off>>32 != 0 { + // We can't stuff the offset back into a uintptr, so any + // future calls would be suspect. Generate an error. + // EIO is allowed by getdirentries. + err = EIO + } + return } const ImplementsGetwd = true diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd.go b/vendor/golang.org/x/sys/unix/syscall_openbsd.go index c8648ec02..1a074b2fe 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd.go @@ -43,6 +43,18 @@ func nametomib(name string) (mib []_C_int, err error) { return nil, EINVAL } +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Fileno), unsafe.Sizeof(Dirent{}.Fileno)) +} + +func direntReclen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Reclen), unsafe.Sizeof(Dirent{}.Reclen)) +} + +func direntNamlen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Namlen), unsafe.Sizeof(Dirent{}.Namlen)) +} + func SysctlClockinfo(name string) (*Clockinfo, error) { mib, err := sysctlmib(name) if err != nil { @@ -89,9 +101,30 @@ func Pipe(p []int) (err error) { return } -//sys getdents(fd int, buf []byte) (n int, err error) +//sys Getdents(fd int, buf []byte) (n int, err error) func Getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { - return getdents(fd, buf) + n, err = Getdents(fd, buf) + if err != nil || basep == nil { + return + } + + var off int64 + off, err = Seek(fd, 0, 1 /* SEEK_CUR */) + if err != nil { + *basep = ^uintptr(0) + return + } + *basep = uintptr(off) + if unsafe.Sizeof(*basep) == 8 { + return + } + if off>>32 != 0 { + // We can't stuff the offset back into a uintptr, so any + // future calls would be suspect. Generate an error. + // EIO was allowed by getdirentries. + err = EIO + } + return } const ImplementsGetwd = true diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris.go b/vendor/golang.org/x/sys/unix/syscall_solaris.go index e47801275..0153a316d 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris.go @@ -35,6 +35,22 @@ type SockaddrDatalink struct { raw RawSockaddrDatalink } +func direntIno(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Ino), unsafe.Sizeof(Dirent{}.Ino)) +} + +func direntReclen(buf []byte) (uint64, bool) { + return readInt(buf, unsafe.Offsetof(Dirent{}.Reclen), unsafe.Sizeof(Dirent{}.Reclen)) +} + +func direntNamlen(buf []byte) (uint64, bool) { + reclen, ok := direntReclen(buf) + if !ok { + return 0, false + } + return reclen - uint64(unsafe.Offsetof(Dirent{}.Name)), true +} + //sysnb pipe(p *[2]_C_int) (n int, err error) func Pipe(p []int) (err error) { @@ -189,6 +205,7 @@ func Setgroups(gids []int) (err error) { return setgroups(len(a), &a[0]) } +// ReadDirent reads directory entries from fd and writes them into buf. func ReadDirent(fd int, buf []byte) (n int, err error) { // Final argument is (basep *uintptr) and the syscall doesn't take nil. // TODO(rsc): Can we use a single global basep for all calls? diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go index 881e69f12..3fb475bcc 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -669,6 +722,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -934,6 +988,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1096,6 +1151,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1958,6 +2027,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x80108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x80108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x541b SIOCOUTQ = 0x5411 SIOCOUTQNSD = 0x894b @@ -2165,6 +2238,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2384,6 +2458,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x400854d5 TUNDETACHFILTER = 0x400854d6 + TUNGETDEVNETNS = 0x54e3 TUNGETFEATURES = 0x800454cf TUNGETFILTER = 0x800854db TUNGETIFF = 0x800454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go index 039b007d7..9c4e19f9a 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -669,6 +722,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -934,6 +988,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1096,6 +1151,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1959,6 +2028,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x80108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x80108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x541b SIOCOUTQ = 0x5411 SIOCOUTQNSD = 0x894b @@ -2166,6 +2239,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2385,6 +2459,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x401054d5 TUNDETACHFILTER = 0x401054d6 + TUNGETDEVNETNS = 0x54e3 TUNGETFEATURES = 0x800454cf TUNGETFILTER = 0x801054db TUNGETIFF = 0x800454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go index 97ed569a2..a1f038c06 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1965,6 +2034,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x80108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x80108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x541b SIOCOUTQ = 0x5411 SIOCOUTQNSD = 0x894b @@ -2172,6 +2245,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2391,6 +2465,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x400854d5 TUNDETACHFILTER = 0x400854d6 + TUNGETDEVNETNS = 0x54e3 TUNGETFEATURES = 0x800454cf TUNGETFILTER = 0x800854db TUNGETIFF = 0x800454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go index d47f3ba6a..504ce1389 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -489,6 +541,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -671,6 +724,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -936,6 +990,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1098,6 +1153,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1949,6 +2018,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x80108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x80108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x541b SIOCOUTQ = 0x5411 SIOCOUTQNSD = 0x894b @@ -2157,6 +2230,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2376,6 +2450,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x401054d5 TUNDETACHFILTER = 0x401054d6 + TUNGETDEVNETNS = 0x54e3 TUNGETFEATURES = 0x800454cf TUNGETFILTER = 0x801054db TUNGETIFF = 0x800454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go index 0ae030ee4..58b642904 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1958,6 +2027,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x40108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x40108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x467f SIOCOUTQ = 0x7472 SIOCOUTQNSD = 0x894b @@ -2166,6 +2239,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2386,6 +2460,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x800854d5 TUNDETACHFILTER = 0x800854d6 + TUNGETDEVNETNS = 0x200054e3 TUNGETFEATURES = 0x400454cf TUNGETFILTER = 0x400854db TUNGETIFF = 0x400454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go index 91b49dddb..35e33de60 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1958,6 +2027,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x40108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x40108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x467f SIOCOUTQ = 0x7472 SIOCOUTQNSD = 0x894b @@ -2166,6 +2239,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2386,6 +2460,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 + TUNGETDEVNETNS = 0x200054e3 TUNGETFEATURES = 0x400454cf TUNGETFILTER = 0x401054db TUNGETIFF = 0x400454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go index 7f1ef04eb..574fcd8c5 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1958,6 +2027,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x40108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x40108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x467f SIOCOUTQ = 0x7472 SIOCOUTQNSD = 0x894b @@ -2166,6 +2239,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2386,6 +2460,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 + TUNGETDEVNETNS = 0x200054e3 TUNGETFEATURES = 0x400454cf TUNGETFILTER = 0x401054db TUNGETIFF = 0x400454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go index 724a244fd..cdf0cf5f4 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1958,6 +2027,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x40108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x40108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x467f SIOCOUTQ = 0x7472 SIOCOUTQNSD = 0x894b @@ -2166,6 +2239,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2386,6 +2460,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x800854d5 TUNDETACHFILTER = 0x800854d6 + TUNGETDEVNETNS = 0x200054e3 TUNGETFEATURES = 0x400454cf TUNGETFILTER = 0x400854db TUNGETIFF = 0x400454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go index 250446292..eefdb3286 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0xff CBAUDEX = 0x0 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -2016,6 +2085,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x40108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x40108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x4004667f SIOCOUTQ = 0x40047473 SIOCOUTQNSD = 0x894b @@ -2223,6 +2296,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2446,6 +2520,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 + TUNGETDEVNETNS = 0x200054e3 TUNGETFEATURES = 0x400454cf TUNGETFILTER = 0x401054db TUNGETIFF = 0x400454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go index e7c49911b..78db21041 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0xff CBAUDEX = 0x0 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -2016,6 +2085,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x40108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x40108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x4004667f SIOCOUTQ = 0x40047473 SIOCOUTQNSD = 0x894b @@ -2223,6 +2296,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2446,6 +2520,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 + TUNGETDEVNETNS = 0x200054e3 TUNGETFEATURES = 0x400454cf TUNGETFILTER = 0x401054db TUNGETIFF = 0x400454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go index 0373d65ae..0cd07f933 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_riscv64.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -1946,6 +2015,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x80108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x80108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x541b SIOCOUTQ = 0x5411 SIOCOUTQNSD = 0x894b @@ -2153,6 +2226,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2372,6 +2446,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x401054d5 TUNDETACHFILTER = 0x401054d6 + TUNGETDEVNETNS = 0x54e3 TUNGETFEATURES = 0x800454cf TUNGETFILTER = 0x801054db TUNGETIFF = 0x800454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go index b2ed7ee6a..ac4f1d9f7 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go @@ -196,6 +196,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -217,6 +219,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -238,16 +245,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -290,8 +300,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -334,6 +346,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -372,6 +423,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -488,6 +540,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -668,6 +721,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -933,6 +987,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1095,6 +1150,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -2019,6 +2088,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x80108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x80108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x541b SIOCOUTQ = 0x5411 SIOCOUTQNSD = 0x894b @@ -2226,6 +2299,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2445,6 +2519,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x401054d5 TUNDETACHFILTER = 0x401054d6 + TUNGETDEVNETNS = 0x54e3 TUNGETFEATURES = 0x800454cf TUNGETFILTER = 0x801054db TUNGETIFF = 0x800454d2 diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go index 58067c529..8a12f1412 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go @@ -199,6 +199,8 @@ const ( BPF_A = 0x10 BPF_ABS = 0x20 BPF_ADD = 0x0 + BPF_ADJ_ROOM_ENCAP_L2_MASK = 0xff + BPF_ADJ_ROOM_ENCAP_L2_SHIFT = 0x38 BPF_ALU = 0x4 BPF_ALU64 = 0x7 BPF_AND = 0x50 @@ -220,6 +222,11 @@ const ( BPF_FROM_BE = 0x8 BPF_FROM_LE = 0x0 BPF_FS_MAGIC = 0xcafe4a11 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV4 = 0x2 + BPF_F_ADJ_ROOM_ENCAP_L3_IPV6 = 0x4 + BPF_F_ADJ_ROOM_ENCAP_L4_GRE = 0x8 + BPF_F_ADJ_ROOM_ENCAP_L4_UDP = 0x10 + BPF_F_ADJ_ROOM_FIXED_GSO = 0x1 BPF_F_ALLOW_MULTI = 0x2 BPF_F_ALLOW_OVERRIDE = 0x1 BPF_F_ANY_ALIGNMENT = 0x2 @@ -241,16 +248,19 @@ const ( BPF_F_PSEUDO_HDR = 0x10 BPF_F_QUERY_EFFECTIVE = 0x1 BPF_F_RDONLY = 0x8 + BPF_F_RDONLY_PROG = 0x80 BPF_F_RECOMPUTE_CSUM = 0x1 BPF_F_REUSE_STACKID = 0x400 BPF_F_SEQ_NUMBER = 0x8 BPF_F_SKIP_FIELD_MASK = 0xff BPF_F_STACK_BUILD_ID = 0x20 BPF_F_STRICT_ALIGNMENT = 0x1 + BPF_F_SYSCTL_BASE_NAME = 0x1 BPF_F_TUNINFO_IPV6 = 0x1 BPF_F_USER_BUILD_ID = 0x800 BPF_F_USER_STACK = 0x100 BPF_F_WRONLY = 0x10 + BPF_F_WRONLY_PROG = 0x100 BPF_F_ZERO_CSUM_TX = 0x2 BPF_F_ZERO_SEED = 0x40 BPF_H = 0x8 @@ -293,8 +303,10 @@ const ( BPF_OR = 0x40 BPF_PSEUDO_CALL = 0x1 BPF_PSEUDO_MAP_FD = 0x1 + BPF_PSEUDO_MAP_VALUE = 0x2 BPF_RET = 0x6 BPF_RSH = 0x70 + BPF_SK_STORAGE_GET_F_CREATE = 0x1 BPF_SOCK_OPS_ALL_CB_FLAGS = 0x7 BPF_SOCK_OPS_RETRANS_CB_FLAG = 0x2 BPF_SOCK_OPS_RTO_CB_FLAG = 0x1 @@ -337,6 +349,45 @@ const ( CAN_SFF_MASK = 0x7ff CAN_TP16 = 0x3 CAN_TP20 = 0x4 + CAP_AUDIT_CONTROL = 0x1e + CAP_AUDIT_READ = 0x25 + CAP_AUDIT_WRITE = 0x1d + CAP_BLOCK_SUSPEND = 0x24 + CAP_CHOWN = 0x0 + CAP_DAC_OVERRIDE = 0x1 + CAP_DAC_READ_SEARCH = 0x2 + CAP_FOWNER = 0x3 + CAP_FSETID = 0x4 + CAP_IPC_LOCK = 0xe + CAP_IPC_OWNER = 0xf + CAP_KILL = 0x5 + CAP_LAST_CAP = 0x25 + CAP_LEASE = 0x1c + CAP_LINUX_IMMUTABLE = 0x9 + CAP_MAC_ADMIN = 0x21 + CAP_MAC_OVERRIDE = 0x20 + CAP_MKNOD = 0x1b + CAP_NET_ADMIN = 0xc + CAP_NET_BIND_SERVICE = 0xa + CAP_NET_BROADCAST = 0xb + CAP_NET_RAW = 0xd + CAP_SETFCAP = 0x1f + CAP_SETGID = 0x6 + CAP_SETPCAP = 0x8 + CAP_SETUID = 0x7 + CAP_SYSLOG = 0x22 + CAP_SYS_ADMIN = 0x15 + CAP_SYS_BOOT = 0x16 + CAP_SYS_CHROOT = 0x12 + CAP_SYS_MODULE = 0x10 + CAP_SYS_NICE = 0x17 + CAP_SYS_PACCT = 0x14 + CAP_SYS_PTRACE = 0x13 + CAP_SYS_RAWIO = 0x11 + CAP_SYS_RESOURCE = 0x18 + CAP_SYS_TIME = 0x19 + CAP_SYS_TTY_CONFIG = 0x1a + CAP_WAKE_ALARM = 0x23 CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf @@ -375,6 +426,7 @@ const ( CLONE_NEWUTS = 0x4000000 CLONE_PARENT = 0x8000 CLONE_PARENT_SETTID = 0x100000 + CLONE_PIDFD = 0x1000 CLONE_PTRACE = 0x2000 CLONE_SETTLS = 0x80000 CLONE_SIGHAND = 0x800 @@ -492,6 +544,7 @@ const ( ETH_P_DNA_RC = 0x6002 ETH_P_DNA_RT = 0x6003 ETH_P_DSA = 0x1b + ETH_P_DSA_8021Q = 0xdadb ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada ETH_P_ERSPAN = 0x88be @@ -672,6 +725,7 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x1 + F_SEAL_FUTURE_WRITE = 0x10 F_SEAL_GROW = 0x4 F_SEAL_SEAL = 0x1 F_SEAL_SHRINK = 0x2 @@ -937,6 +991,7 @@ const ( IPV6_RECVRTHDR = 0x38 IPV6_RECVTCLASS = 0x42 IPV6_ROUTER_ALERT = 0x16 + IPV6_ROUTER_ALERT_ISOLATE = 0x1e IPV6_RTHDR = 0x39 IPV6_RTHDRDSTOPTS = 0x37 IPV6_RTHDR_LOOSE = 0x0 @@ -1099,6 +1154,20 @@ const ( LOCK_NB = 0x4 LOCK_SH = 0x1 LOCK_UN = 0x8 + LOOP_CLR_FD = 0x4c01 + LOOP_CTL_ADD = 0x4c80 + LOOP_CTL_GET_FREE = 0x4c82 + LOOP_CTL_REMOVE = 0x4c81 + LOOP_GET_STATUS = 0x4c03 + LOOP_GET_STATUS64 = 0x4c05 + LOOP_SET_BLOCK_SIZE = 0x4c09 + LOOP_SET_CAPACITY = 0x4c07 + LOOP_SET_DIRECT_IO = 0x4c08 + LOOP_SET_FD = 0x4c00 + LOOP_SET_STATUS = 0x4c02 + LOOP_SET_STATUS64 = 0x4c04 + LO_KEY_SIZE = 0x20 + LO_NAME_SIZE = 0x40 MADV_DODUMP = 0x11 MADV_DOFORK = 0xb MADV_DONTDUMP = 0x10 @@ -2011,6 +2080,10 @@ const ( SIOCGSKNS = 0x894c SIOCGSTAMP = 0x8906 SIOCGSTAMPNS = 0x8907 + SIOCGSTAMPNS_NEW = 0x40108907 + SIOCGSTAMPNS_OLD = 0x8907 + SIOCGSTAMP_NEW = 0x40108906 + SIOCGSTAMP_OLD = 0x8906 SIOCINQ = 0x4004667f SIOCOUTQ = 0x40047473 SIOCOUTQNSD = 0x894b @@ -2218,6 +2291,7 @@ const ( SYNC_FILE_RANGE_WAIT_AFTER = 0x4 SYNC_FILE_RANGE_WAIT_BEFORE = 0x1 SYNC_FILE_RANGE_WRITE = 0x2 + SYNC_FILE_RANGE_WRITE_AND_WAIT = 0x7 SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 @@ -2434,6 +2508,7 @@ const ( TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 + TUNGETDEVNETNS = 0x200054e3 TUNGETFEATURES = 0x400454cf TUNGETFILTER = 0x401054db TUNGETIFF = 0x400454d2 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go index c4ec7ff87..dd5ea36ee 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.1_11.go @@ -377,16 +377,6 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := Syscall6(SYS_GETATTRLIST, uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -1691,6 +1681,16 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int32, usec int32, err error) { r0, r1, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tp)), 0, 0) sec = int32(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go index 23346dc68..78ca92339 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go @@ -527,21 +527,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -2341,6 +2326,21 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_ptrace_trampoline() + +//go:linkname libc_ptrace libc_ptrace +//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int32, usec int32, err error) { r0, r1, e1 := syscall_rawSyscall(funcPC(libc_gettimeofday_trampoline), uintptr(unsafe.Pointer(tp)), 0, 0) sec = int32(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s index 37b85b4f6..f40465ca8 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.s @@ -64,8 +64,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 @@ -264,6 +262,8 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 + JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 JMP libc_gettimeofday(SB) TEXT ·libc_fstat64_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go index c142e33e9..64df03c45 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go @@ -527,21 +527,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { @@ -2356,6 +2341,21 @@ func writelen(fd int, buf *byte, nbuf int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { + _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +func libc_ptrace_trampoline() + +//go:linkname libc_ptrace libc_ptrace +//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func gettimeofday(tp *Timeval) (sec int64, usec int32, err error) { r0, r1, e1 := syscall_rawSyscall(funcPC(libc_gettimeofday_trampoline), uintptr(unsafe.Pointer(tp)), 0, 0) sec = int64(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s index 1a3915197..debcb8ed3 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.s @@ -64,8 +64,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 @@ -266,6 +264,8 @@ TEXT ·libc_mmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_mmap(SB) TEXT ·libc_munmap_trampoline(SB),NOSPLIT,$0-0 JMP libc_munmap(SB) +TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 + JMP libc_ptrace(SB) TEXT ·libc_gettimeofday_trampoline(SB),NOSPLIT,$0-0 JMP libc_gettimeofday(SB) TEXT ·libc_fstat64_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go index 01cffbf46..ed3306239 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go @@ -527,21 +527,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s index 994056f35..66af9f480 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.s @@ -64,8 +64,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go index 8f2691dee..5258a7328 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go @@ -527,21 +527,6 @@ func libc_munlockall_trampoline() // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func ptrace(request int, pid int, addr uintptr, data uintptr) (err error) { - _, _, e1 := syscall_syscall6(funcPC(libc_ptrace_trampoline), uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -func libc_ptrace_trampoline() - -//go:linkname libc_ptrace libc_ptrace -//go:cgo_import_dynamic libc_ptrace ptrace "/usr/lib/libSystem.B.dylib" - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func getattrlist(path *byte, list unsafe.Pointer, buf unsafe.Pointer, size uintptr, options int) (err error) { _, _, e1 := syscall_syscall6(funcPC(libc_getattrlist_trampoline), uintptr(unsafe.Pointer(path)), uintptr(list), uintptr(buf), uintptr(size), uintptr(options), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s index 61dc0d4c1..f57f48f82 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.s @@ -64,8 +64,6 @@ TEXT ·libc_munlock_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlock(SB) TEXT ·libc_munlockall_trampoline(SB),NOSPLIT,$0-0 JMP libc_munlockall(SB) -TEXT ·libc_ptrace_trampoline(SB),NOSPLIT,$0-0 - JMP libc_ptrace(SB) TEXT ·libc_getattrlist_trampoline(SB),NOSPLIT,$0-0 JMP libc_getattrlist(SB) TEXT ·libc_pipe_trampoline(SB),NOSPLIT,$0-0 diff --git a/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go index ae9f1a21e..cdfe9318b 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go @@ -749,6 +749,23 @@ func Ftruncate(fd int, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Getdents(fd int, buf []byte) (n int, err error) { + var _p0 unsafe.Pointer + if len(buf) > 0 { + _p0 = unsafe.Pointer(&buf[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall(SYS_GETDENTS, uintptr(fd), uintptr(_p0), uintptr(len(buf))) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go index 80903e47b..a783306b2 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go @@ -387,6 +387,16 @@ func pipe2(p *[2]_C_int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data int) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -1019,7 +1029,7 @@ func getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdirentries_freebsd12(fd int, buf []byte, basep *uintptr) (n int, err error) { +func getdirentries_freebsd12(fd int, buf []byte, basep *uint64) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go index cd250ff0e..f995520d3 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go @@ -387,6 +387,16 @@ func pipe2(p *[2]_C_int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data int) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -1019,7 +1029,7 @@ func getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdirentries_freebsd12(fd int, buf []byte, basep *uintptr) (n int, err error) { +func getdirentries_freebsd12(fd int, buf []byte, basep *uint64) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go index 290a9c2cb..d681acd43 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go @@ -387,6 +387,16 @@ func pipe2(p *[2]_C_int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data int) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -1019,7 +1029,7 @@ func getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdirentries_freebsd12(fd int, buf []byte, basep *uintptr) (n int, err error) { +func getdirentries_freebsd12(fd int, buf []byte, basep *uint64) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm64.go index c6df9d2e8..5049b2ede 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm64.go @@ -404,6 +404,16 @@ func Getcwd(buf []byte) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func ptrace(request int, pid int, addr uintptr, data int) (err error) { + _, _, e1 := Syscall6(SYS_PTRACE, uintptr(request), uintptr(pid), uintptr(addr), uintptr(data), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func ioctl(fd int, req uint, arg uintptr) (err error) { _, _, e1 := Syscall(SYS_IOCTL, uintptr(fd), uintptr(req), uintptr(arg)) if e1 != 0 { @@ -1019,7 +1029,7 @@ func getdirentries(fd int, buf []byte, basep *uintptr) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdirentries_freebsd12(fd int, buf []byte, basep *uintptr) (n int, err error) { +func getdirentries_freebsd12(fd int, buf []byte, basep *uint64) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go index 81d90a27e..c5e46e4cf 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go index 0c184586b..da8819e48 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go index 18ef8a626..6ad9be6dd 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go index 2fba25d05..f88331782 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go index c330f4ffa..8eebc6c77 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go index 8e9e0098a..ecf62a677 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go index c22d62607..1ba0f7b6f 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go index 700a99e97..20012b2f0 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go index cec4c106c..2b520deaa 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go index 677ef5a69..d9f044c95 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go index 565034c54..9feed65eb 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_riscv64.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go index 7feb2c6b6..0a6515088 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go index 07655c455..e27f66930 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go @@ -408,6 +408,26 @@ func Adjtimex(buf *Timex) (state int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Capget(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPGET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Capset(hdr *CapUserHeader, data *CapUserData) (err error) { + _, _, e1 := Syscall(SYS_CAPSET, uintptr(unsafe.Pointer(hdr)), uintptr(unsafe.Pointer(data)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Chdir(path string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go index 642db7670..7e0582664 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go @@ -389,7 +389,7 @@ func pipe() (fd1 int, fd2 int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go index 59585fee3..d94d076aa 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go @@ -389,7 +389,7 @@ func pipe() (fd1 int, fd2 int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go index 6ec31434b..cf5bf3d05 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go @@ -389,7 +389,7 @@ func pipe() (fd1 int, fd2 int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go index 603d14433..243a9317c 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm64.go @@ -389,7 +389,7 @@ func pipe() (fd1 int, fd2 int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go index 6a489fac0..a9532d078 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go @@ -387,7 +387,7 @@ func pipe(p *[2]_C_int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go index 30cba4347..0cb9f0177 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go @@ -387,7 +387,7 @@ func pipe(p *[2]_C_int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go index fa1beda33..6fc99b549 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go @@ -387,7 +387,7 @@ func pipe(p *[2]_C_int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go index eb5899046..27878a72b 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm64.go @@ -387,7 +387,7 @@ func pipe(p *[2]_C_int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getdents(fd int, buf []byte) (n int, err error) { +func Getdents(fd int, buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { _p0 = unsafe.Pointer(&buf[0]) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_386.go b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_386.go index 55c3a3294..9474974b6 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_386.go @@ -1,4 +1,4 @@ -// go run mksysnum.go https://svn.freebsd.org/base/stable/10/sys/kern/syscalls.master +// go run mksysnum.go https://svn.freebsd.org/base/stable/11/sys/kern/syscalls.master // Code generated by the command above; see README.md. DO NOT EDIT. // +build 386,freebsd @@ -118,8 +118,6 @@ const ( SYS_SEMSYS = 169 // { int semsys(int which, int a2, int a3, int a4, int a5); } SYS_MSGSYS = 170 // { int msgsys(int which, int a2, int a3, int a4, int a5, int a6); } SYS_SHMSYS = 171 // { int shmsys(int which, int a2, int a3, int a4); } - SYS_FREEBSD6_PREAD = 173 // { ssize_t freebsd6_pread(int fd, void *buf, size_t nbyte, int pad, off_t offset); } - SYS_FREEBSD6_PWRITE = 174 // { ssize_t freebsd6_pwrite(int fd, const void *buf, size_t nbyte, int pad, off_t offset); } SYS_SETFIB = 175 // { int setfib(int fibnum); } SYS_NTP_ADJTIME = 176 // { int ntp_adjtime(struct timex *tp); } SYS_SETGID = 181 // { int setgid(gid_t gid); } @@ -133,10 +131,6 @@ const ( SYS_GETRLIMIT = 194 // { int getrlimit(u_int which, struct rlimit *rlp); } getrlimit __getrlimit_args int SYS_SETRLIMIT = 195 // { int setrlimit(u_int which, struct rlimit *rlp); } setrlimit __setrlimit_args int SYS_GETDIRENTRIES = 196 // { int getdirentries(int fd, char *buf, u_int count, long *basep); } - SYS_FREEBSD6_MMAP = 197 // { caddr_t freebsd6_mmap(caddr_t addr, size_t len, int prot, int flags, int fd, int pad, off_t pos); } - SYS_FREEBSD6_LSEEK = 199 // { off_t freebsd6_lseek(int fd, int pad, off_t offset, int whence); } - SYS_FREEBSD6_TRUNCATE = 200 // { int freebsd6_truncate(char *path, int pad, off_t length); } - SYS_FREEBSD6_FTRUNCATE = 201 // { int freebsd6_ftruncate(int fd, int pad, off_t length); } SYS___SYSCTL = 202 // { int __sysctl(int *name, u_int namelen, void *old, size_t *oldlenp, void *new, size_t newlen); } __sysctl sysctl_args int SYS_MLOCK = 203 // { int mlock(const void *addr, size_t len); } SYS_MUNLOCK = 204 // { int munlock(const void *addr, size_t len); } @@ -164,6 +158,7 @@ const ( SYS_FFCLOCK_GETCOUNTER = 241 // { int ffclock_getcounter(ffcounter *ffcount); } SYS_FFCLOCK_SETESTIMATE = 242 // { int ffclock_setestimate( struct ffclock_estimate *cest); } SYS_FFCLOCK_GETESTIMATE = 243 // { int ffclock_getestimate( struct ffclock_estimate *cest); } + SYS_CLOCK_NANOSLEEP = 244 // { int clock_nanosleep(clockid_t clock_id, int flags, const struct timespec *rqtp, struct timespec *rmtp); } SYS_CLOCK_GETCPUCLOCKID2 = 247 // { int clock_getcpuclockid2(id_t id,int which, clockid_t *clock_id); } SYS_NTP_GETTIME = 248 // { int ntp_gettime(struct ntptimeval *ntvp); } SYS_MINHERIT = 250 // { int minherit(void *addr, size_t len, int inherit); } @@ -197,13 +192,10 @@ const ( SYS_GETSID = 310 // { int getsid(pid_t pid); } SYS_SETRESUID = 311 // { int setresuid(uid_t ruid, uid_t euid, uid_t suid); } SYS_SETRESGID = 312 // { int setresgid(gid_t rgid, gid_t egid, gid_t sgid); } - SYS_AIO_RETURN = 314 // { int aio_return(struct aiocb *aiocbp); } + SYS_AIO_RETURN = 314 // { ssize_t aio_return(struct aiocb *aiocbp); } SYS_AIO_SUSPEND = 315 // { int aio_suspend( struct aiocb * const * aiocbp, int nent, const struct timespec *timeout); } SYS_AIO_CANCEL = 316 // { int aio_cancel(int fd, struct aiocb *aiocbp); } SYS_AIO_ERROR = 317 // { int aio_error(struct aiocb *aiocbp); } - SYS_OAIO_READ = 318 // { int oaio_read(struct oaiocb *aiocbp); } - SYS_OAIO_WRITE = 319 // { int oaio_write(struct oaiocb *aiocbp); } - SYS_OLIO_LISTIO = 320 // { int olio_listio(int mode, struct oaiocb * const *acb_list, int nent, struct osigevent *sig); } SYS_YIELD = 321 // { int yield(void); } SYS_MLOCKALL = 324 // { int mlockall(int how); } SYS_MUNLOCKALL = 325 // { int munlockall(void); } @@ -236,7 +228,7 @@ const ( SYS_EXTATTR_SET_FILE = 356 // { ssize_t extattr_set_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } SYS_EXTATTR_GET_FILE = 357 // { ssize_t extattr_get_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } SYS_EXTATTR_DELETE_FILE = 358 // { int extattr_delete_file(const char *path, int attrnamespace, const char *attrname); } - SYS_AIO_WAITCOMPLETE = 359 // { int aio_waitcomplete( struct aiocb **aiocbp, struct timespec *timeout); } + SYS_AIO_WAITCOMPLETE = 359 // { ssize_t aio_waitcomplete( struct aiocb **aiocbp, struct timespec *timeout); } SYS_GETRESUID = 360 // { int getresuid(uid_t *ruid, uid_t *euid, uid_t *suid); } SYS_GETRESGID = 361 // { int getresgid(gid_t *rgid, gid_t *egid, gid_t *sgid); } SYS_KQUEUE = 362 // { int kqueue(void); } @@ -258,7 +250,7 @@ const ( SYS_UUIDGEN = 392 // { int uuidgen(struct uuid *store, int count); } SYS_SENDFILE = 393 // { int sendfile(int fd, int s, off_t offset, size_t nbytes, struct sf_hdtr *hdtr, off_t *sbytes, int flags); } SYS_MAC_SYSCALL = 394 // { int mac_syscall(const char *policy, int call, void *arg); } - SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, long bufsize, int flags); } + SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, long bufsize, int mode); } SYS_STATFS = 396 // { int statfs(char *path, struct statfs *buf); } SYS_FSTATFS = 397 // { int fstatfs(int fd, struct statfs *buf); } SYS_FHSTATFS = 398 // { int fhstatfs(const struct fhandle *u_fhp, struct statfs *buf); } @@ -293,8 +285,6 @@ const ( SYS_THR_EXIT = 431 // { void thr_exit(long *state); } SYS_THR_SELF = 432 // { int thr_self(long *id); } SYS_THR_KILL = 433 // { int thr_kill(long id, int sig); } - SYS__UMTX_LOCK = 434 // { int _umtx_lock(struct umtx *umtx); } - SYS__UMTX_UNLOCK = 435 // { int _umtx_unlock(struct umtx *umtx); } SYS_JAIL_ATTACH = 436 // { int jail_attach(int jid); } SYS_EXTATTR_LIST_FD = 437 // { ssize_t extattr_list_fd(int fd, int attrnamespace, void *data, size_t nbytes); } SYS_EXTATTR_LIST_FILE = 438 // { ssize_t extattr_list_file( const char *path, int attrnamespace, void *data, size_t nbytes); } @@ -400,4 +390,7 @@ const ( SYS_PPOLL = 545 // { int ppoll(struct pollfd *fds, u_int nfds, const struct timespec *ts, const sigset_t *set); } SYS_FUTIMENS = 546 // { int futimens(int fd, struct timespec *times); } SYS_UTIMENSAT = 547 // { int utimensat(int fd, char *path, struct timespec *times, int flag); } + SYS_NUMA_GETAFFINITY = 548 // { int numa_getaffinity(cpuwhich_t which, id_t id, struct vm_domain_policy_entry *policy); } + SYS_NUMA_SETAFFINITY = 549 // { int numa_setaffinity(cpuwhich_t which, id_t id, const struct vm_domain_policy_entry *policy); } + SYS_FDATASYNC = 550 // { int fdatasync(int fd); } ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_amd64.go index b39be6cb8..48a7beae7 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_amd64.go @@ -1,4 +1,4 @@ -// go run mksysnum.go https://svn.freebsd.org/base/stable/10/sys/kern/syscalls.master +// go run mksysnum.go https://svn.freebsd.org/base/stable/11/sys/kern/syscalls.master // Code generated by the command above; see README.md. DO NOT EDIT. // +build amd64,freebsd @@ -118,8 +118,6 @@ const ( SYS_SEMSYS = 169 // { int semsys(int which, int a2, int a3, int a4, int a5); } SYS_MSGSYS = 170 // { int msgsys(int which, int a2, int a3, int a4, int a5, int a6); } SYS_SHMSYS = 171 // { int shmsys(int which, int a2, int a3, int a4); } - SYS_FREEBSD6_PREAD = 173 // { ssize_t freebsd6_pread(int fd, void *buf, size_t nbyte, int pad, off_t offset); } - SYS_FREEBSD6_PWRITE = 174 // { ssize_t freebsd6_pwrite(int fd, const void *buf, size_t nbyte, int pad, off_t offset); } SYS_SETFIB = 175 // { int setfib(int fibnum); } SYS_NTP_ADJTIME = 176 // { int ntp_adjtime(struct timex *tp); } SYS_SETGID = 181 // { int setgid(gid_t gid); } @@ -133,10 +131,6 @@ const ( SYS_GETRLIMIT = 194 // { int getrlimit(u_int which, struct rlimit *rlp); } getrlimit __getrlimit_args int SYS_SETRLIMIT = 195 // { int setrlimit(u_int which, struct rlimit *rlp); } setrlimit __setrlimit_args int SYS_GETDIRENTRIES = 196 // { int getdirentries(int fd, char *buf, u_int count, long *basep); } - SYS_FREEBSD6_MMAP = 197 // { caddr_t freebsd6_mmap(caddr_t addr, size_t len, int prot, int flags, int fd, int pad, off_t pos); } - SYS_FREEBSD6_LSEEK = 199 // { off_t freebsd6_lseek(int fd, int pad, off_t offset, int whence); } - SYS_FREEBSD6_TRUNCATE = 200 // { int freebsd6_truncate(char *path, int pad, off_t length); } - SYS_FREEBSD6_FTRUNCATE = 201 // { int freebsd6_ftruncate(int fd, int pad, off_t length); } SYS___SYSCTL = 202 // { int __sysctl(int *name, u_int namelen, void *old, size_t *oldlenp, void *new, size_t newlen); } __sysctl sysctl_args int SYS_MLOCK = 203 // { int mlock(const void *addr, size_t len); } SYS_MUNLOCK = 204 // { int munlock(const void *addr, size_t len); } @@ -164,6 +158,7 @@ const ( SYS_FFCLOCK_GETCOUNTER = 241 // { int ffclock_getcounter(ffcounter *ffcount); } SYS_FFCLOCK_SETESTIMATE = 242 // { int ffclock_setestimate( struct ffclock_estimate *cest); } SYS_FFCLOCK_GETESTIMATE = 243 // { int ffclock_getestimate( struct ffclock_estimate *cest); } + SYS_CLOCK_NANOSLEEP = 244 // { int clock_nanosleep(clockid_t clock_id, int flags, const struct timespec *rqtp, struct timespec *rmtp); } SYS_CLOCK_GETCPUCLOCKID2 = 247 // { int clock_getcpuclockid2(id_t id,int which, clockid_t *clock_id); } SYS_NTP_GETTIME = 248 // { int ntp_gettime(struct ntptimeval *ntvp); } SYS_MINHERIT = 250 // { int minherit(void *addr, size_t len, int inherit); } @@ -197,13 +192,10 @@ const ( SYS_GETSID = 310 // { int getsid(pid_t pid); } SYS_SETRESUID = 311 // { int setresuid(uid_t ruid, uid_t euid, uid_t suid); } SYS_SETRESGID = 312 // { int setresgid(gid_t rgid, gid_t egid, gid_t sgid); } - SYS_AIO_RETURN = 314 // { int aio_return(struct aiocb *aiocbp); } + SYS_AIO_RETURN = 314 // { ssize_t aio_return(struct aiocb *aiocbp); } SYS_AIO_SUSPEND = 315 // { int aio_suspend( struct aiocb * const * aiocbp, int nent, const struct timespec *timeout); } SYS_AIO_CANCEL = 316 // { int aio_cancel(int fd, struct aiocb *aiocbp); } SYS_AIO_ERROR = 317 // { int aio_error(struct aiocb *aiocbp); } - SYS_OAIO_READ = 318 // { int oaio_read(struct oaiocb *aiocbp); } - SYS_OAIO_WRITE = 319 // { int oaio_write(struct oaiocb *aiocbp); } - SYS_OLIO_LISTIO = 320 // { int olio_listio(int mode, struct oaiocb * const *acb_list, int nent, struct osigevent *sig); } SYS_YIELD = 321 // { int yield(void); } SYS_MLOCKALL = 324 // { int mlockall(int how); } SYS_MUNLOCKALL = 325 // { int munlockall(void); } @@ -236,7 +228,7 @@ const ( SYS_EXTATTR_SET_FILE = 356 // { ssize_t extattr_set_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } SYS_EXTATTR_GET_FILE = 357 // { ssize_t extattr_get_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } SYS_EXTATTR_DELETE_FILE = 358 // { int extattr_delete_file(const char *path, int attrnamespace, const char *attrname); } - SYS_AIO_WAITCOMPLETE = 359 // { int aio_waitcomplete( struct aiocb **aiocbp, struct timespec *timeout); } + SYS_AIO_WAITCOMPLETE = 359 // { ssize_t aio_waitcomplete( struct aiocb **aiocbp, struct timespec *timeout); } SYS_GETRESUID = 360 // { int getresuid(uid_t *ruid, uid_t *euid, uid_t *suid); } SYS_GETRESGID = 361 // { int getresgid(gid_t *rgid, gid_t *egid, gid_t *sgid); } SYS_KQUEUE = 362 // { int kqueue(void); } @@ -258,7 +250,7 @@ const ( SYS_UUIDGEN = 392 // { int uuidgen(struct uuid *store, int count); } SYS_SENDFILE = 393 // { int sendfile(int fd, int s, off_t offset, size_t nbytes, struct sf_hdtr *hdtr, off_t *sbytes, int flags); } SYS_MAC_SYSCALL = 394 // { int mac_syscall(const char *policy, int call, void *arg); } - SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, long bufsize, int flags); } + SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, long bufsize, int mode); } SYS_STATFS = 396 // { int statfs(char *path, struct statfs *buf); } SYS_FSTATFS = 397 // { int fstatfs(int fd, struct statfs *buf); } SYS_FHSTATFS = 398 // { int fhstatfs(const struct fhandle *u_fhp, struct statfs *buf); } @@ -293,8 +285,6 @@ const ( SYS_THR_EXIT = 431 // { void thr_exit(long *state); } SYS_THR_SELF = 432 // { int thr_self(long *id); } SYS_THR_KILL = 433 // { int thr_kill(long id, int sig); } - SYS__UMTX_LOCK = 434 // { int _umtx_lock(struct umtx *umtx); } - SYS__UMTX_UNLOCK = 435 // { int _umtx_unlock(struct umtx *umtx); } SYS_JAIL_ATTACH = 436 // { int jail_attach(int jid); } SYS_EXTATTR_LIST_FD = 437 // { ssize_t extattr_list_fd(int fd, int attrnamespace, void *data, size_t nbytes); } SYS_EXTATTR_LIST_FILE = 438 // { ssize_t extattr_list_file( const char *path, int attrnamespace, void *data, size_t nbytes); } @@ -400,4 +390,7 @@ const ( SYS_PPOLL = 545 // { int ppoll(struct pollfd *fds, u_int nfds, const struct timespec *ts, const sigset_t *set); } SYS_FUTIMENS = 546 // { int futimens(int fd, struct timespec *times); } SYS_UTIMENSAT = 547 // { int utimensat(int fd, char *path, struct timespec *times, int flag); } + SYS_NUMA_GETAFFINITY = 548 // { int numa_getaffinity(cpuwhich_t which, id_t id, struct vm_domain_policy_entry *policy); } + SYS_NUMA_SETAFFINITY = 549 // { int numa_setaffinity(cpuwhich_t which, id_t id, const struct vm_domain_policy_entry *policy); } + SYS_FDATASYNC = 550 // { int fdatasync(int fd); } ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm.go b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm.go index 44ffd4ce5..4a6dfd4a7 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm.go @@ -1,4 +1,4 @@ -// go run mksysnum.go https://svn.freebsd.org/base/stable/10/sys/kern/syscalls.master +// go run mksysnum.go https://svn.freebsd.org/base/stable/11/sys/kern/syscalls.master // Code generated by the command above; see README.md. DO NOT EDIT. // +build arm,freebsd @@ -118,8 +118,6 @@ const ( SYS_SEMSYS = 169 // { int semsys(int which, int a2, int a3, int a4, int a5); } SYS_MSGSYS = 170 // { int msgsys(int which, int a2, int a3, int a4, int a5, int a6); } SYS_SHMSYS = 171 // { int shmsys(int which, int a2, int a3, int a4); } - SYS_FREEBSD6_PREAD = 173 // { ssize_t freebsd6_pread(int fd, void *buf, size_t nbyte, int pad, off_t offset); } - SYS_FREEBSD6_PWRITE = 174 // { ssize_t freebsd6_pwrite(int fd, const void *buf, size_t nbyte, int pad, off_t offset); } SYS_SETFIB = 175 // { int setfib(int fibnum); } SYS_NTP_ADJTIME = 176 // { int ntp_adjtime(struct timex *tp); } SYS_SETGID = 181 // { int setgid(gid_t gid); } @@ -133,10 +131,6 @@ const ( SYS_GETRLIMIT = 194 // { int getrlimit(u_int which, struct rlimit *rlp); } getrlimit __getrlimit_args int SYS_SETRLIMIT = 195 // { int setrlimit(u_int which, struct rlimit *rlp); } setrlimit __setrlimit_args int SYS_GETDIRENTRIES = 196 // { int getdirentries(int fd, char *buf, u_int count, long *basep); } - SYS_FREEBSD6_MMAP = 197 // { caddr_t freebsd6_mmap(caddr_t addr, size_t len, int prot, int flags, int fd, int pad, off_t pos); } - SYS_FREEBSD6_LSEEK = 199 // { off_t freebsd6_lseek(int fd, int pad, off_t offset, int whence); } - SYS_FREEBSD6_TRUNCATE = 200 // { int freebsd6_truncate(char *path, int pad, off_t length); } - SYS_FREEBSD6_FTRUNCATE = 201 // { int freebsd6_ftruncate(int fd, int pad, off_t length); } SYS___SYSCTL = 202 // { int __sysctl(int *name, u_int namelen, void *old, size_t *oldlenp, void *new, size_t newlen); } __sysctl sysctl_args int SYS_MLOCK = 203 // { int mlock(const void *addr, size_t len); } SYS_MUNLOCK = 204 // { int munlock(const void *addr, size_t len); } @@ -164,6 +158,7 @@ const ( SYS_FFCLOCK_GETCOUNTER = 241 // { int ffclock_getcounter(ffcounter *ffcount); } SYS_FFCLOCK_SETESTIMATE = 242 // { int ffclock_setestimate( struct ffclock_estimate *cest); } SYS_FFCLOCK_GETESTIMATE = 243 // { int ffclock_getestimate( struct ffclock_estimate *cest); } + SYS_CLOCK_NANOSLEEP = 244 // { int clock_nanosleep(clockid_t clock_id, int flags, const struct timespec *rqtp, struct timespec *rmtp); } SYS_CLOCK_GETCPUCLOCKID2 = 247 // { int clock_getcpuclockid2(id_t id,int which, clockid_t *clock_id); } SYS_NTP_GETTIME = 248 // { int ntp_gettime(struct ntptimeval *ntvp); } SYS_MINHERIT = 250 // { int minherit(void *addr, size_t len, int inherit); } @@ -197,13 +192,10 @@ const ( SYS_GETSID = 310 // { int getsid(pid_t pid); } SYS_SETRESUID = 311 // { int setresuid(uid_t ruid, uid_t euid, uid_t suid); } SYS_SETRESGID = 312 // { int setresgid(gid_t rgid, gid_t egid, gid_t sgid); } - SYS_AIO_RETURN = 314 // { int aio_return(struct aiocb *aiocbp); } + SYS_AIO_RETURN = 314 // { ssize_t aio_return(struct aiocb *aiocbp); } SYS_AIO_SUSPEND = 315 // { int aio_suspend( struct aiocb * const * aiocbp, int nent, const struct timespec *timeout); } SYS_AIO_CANCEL = 316 // { int aio_cancel(int fd, struct aiocb *aiocbp); } SYS_AIO_ERROR = 317 // { int aio_error(struct aiocb *aiocbp); } - SYS_OAIO_READ = 318 // { int oaio_read(struct oaiocb *aiocbp); } - SYS_OAIO_WRITE = 319 // { int oaio_write(struct oaiocb *aiocbp); } - SYS_OLIO_LISTIO = 320 // { int olio_listio(int mode, struct oaiocb * const *acb_list, int nent, struct osigevent *sig); } SYS_YIELD = 321 // { int yield(void); } SYS_MLOCKALL = 324 // { int mlockall(int how); } SYS_MUNLOCKALL = 325 // { int munlockall(void); } @@ -236,7 +228,7 @@ const ( SYS_EXTATTR_SET_FILE = 356 // { ssize_t extattr_set_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } SYS_EXTATTR_GET_FILE = 357 // { ssize_t extattr_get_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } SYS_EXTATTR_DELETE_FILE = 358 // { int extattr_delete_file(const char *path, int attrnamespace, const char *attrname); } - SYS_AIO_WAITCOMPLETE = 359 // { int aio_waitcomplete( struct aiocb **aiocbp, struct timespec *timeout); } + SYS_AIO_WAITCOMPLETE = 359 // { ssize_t aio_waitcomplete( struct aiocb **aiocbp, struct timespec *timeout); } SYS_GETRESUID = 360 // { int getresuid(uid_t *ruid, uid_t *euid, uid_t *suid); } SYS_GETRESGID = 361 // { int getresgid(gid_t *rgid, gid_t *egid, gid_t *sgid); } SYS_KQUEUE = 362 // { int kqueue(void); } @@ -258,7 +250,7 @@ const ( SYS_UUIDGEN = 392 // { int uuidgen(struct uuid *store, int count); } SYS_SENDFILE = 393 // { int sendfile(int fd, int s, off_t offset, size_t nbytes, struct sf_hdtr *hdtr, off_t *sbytes, int flags); } SYS_MAC_SYSCALL = 394 // { int mac_syscall(const char *policy, int call, void *arg); } - SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, long bufsize, int flags); } + SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, long bufsize, int mode); } SYS_STATFS = 396 // { int statfs(char *path, struct statfs *buf); } SYS_FSTATFS = 397 // { int fstatfs(int fd, struct statfs *buf); } SYS_FHSTATFS = 398 // { int fhstatfs(const struct fhandle *u_fhp, struct statfs *buf); } @@ -293,8 +285,6 @@ const ( SYS_THR_EXIT = 431 // { void thr_exit(long *state); } SYS_THR_SELF = 432 // { int thr_self(long *id); } SYS_THR_KILL = 433 // { int thr_kill(long id, int sig); } - SYS__UMTX_LOCK = 434 // { int _umtx_lock(struct umtx *umtx); } - SYS__UMTX_UNLOCK = 435 // { int _umtx_unlock(struct umtx *umtx); } SYS_JAIL_ATTACH = 436 // { int jail_attach(int jid); } SYS_EXTATTR_LIST_FD = 437 // { ssize_t extattr_list_fd(int fd, int attrnamespace, void *data, size_t nbytes); } SYS_EXTATTR_LIST_FILE = 438 // { ssize_t extattr_list_file( const char *path, int attrnamespace, void *data, size_t nbytes); } @@ -400,4 +390,7 @@ const ( SYS_PPOLL = 545 // { int ppoll(struct pollfd *fds, u_int nfds, const struct timespec *ts, const sigset_t *set); } SYS_FUTIMENS = 546 // { int futimens(int fd, struct timespec *times); } SYS_UTIMENSAT = 547 // { int utimensat(int fd, char *path, struct timespec *times, int flag); } + SYS_NUMA_GETAFFINITY = 548 // { int numa_getaffinity(cpuwhich_t which, id_t id, struct vm_domain_policy_entry *policy); } + SYS_NUMA_SETAFFINITY = 549 // { int numa_setaffinity(cpuwhich_t which, id_t id, const struct vm_domain_policy_entry *policy); } + SYS_FDATASYNC = 550 // { int fdatasync(int fd); } ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm64.go index 9f21e9550..3e51af8ed 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_freebsd_arm64.go @@ -1,4 +1,4 @@ -// go run mksysnum.go https://svn.freebsd.org/base/stable/10/sys/kern/syscalls.master +// go run mksysnum.go https://svn.freebsd.org/base/stable/11/sys/kern/syscalls.master // Code generated by the command above; see README.md. DO NOT EDIT. // +build arm64,freebsd @@ -7,13 +7,13 @@ package unix const ( // SYS_NOSYS = 0; // { int nosys(void); } syscall nosys_args int - SYS_EXIT = 1 // { void sys_exit(int rval); } exit \ + SYS_EXIT = 1 // { void sys_exit(int rval); } exit sys_exit_args void SYS_FORK = 2 // { int fork(void); } - SYS_READ = 3 // { ssize_t read(int fd, void *buf, \ - SYS_WRITE = 4 // { ssize_t write(int fd, const void *buf, \ + SYS_READ = 3 // { ssize_t read(int fd, void *buf, size_t nbyte); } + SYS_WRITE = 4 // { ssize_t write(int fd, const void *buf, size_t nbyte); } SYS_OPEN = 5 // { int open(char *path, int flags, int mode); } SYS_CLOSE = 6 // { int close(int fd); } - SYS_WAIT4 = 7 // { int wait4(int pid, int *status, \ + SYS_WAIT4 = 7 // { int wait4(int pid, int *status, int options, struct rusage *rusage); } SYS_LINK = 9 // { int link(char *path, char *link); } SYS_UNLINK = 10 // { int unlink(char *path); } SYS_CHDIR = 12 // { int chdir(char *path); } @@ -21,20 +21,20 @@ const ( SYS_MKNOD = 14 // { int mknod(char *path, int mode, int dev); } SYS_CHMOD = 15 // { int chmod(char *path, int mode); } SYS_CHOWN = 16 // { int chown(char *path, int uid, int gid); } - SYS_OBREAK = 17 // { int obreak(char *nsize); } break \ + SYS_OBREAK = 17 // { int obreak(char *nsize); } break obreak_args int SYS_GETPID = 20 // { pid_t getpid(void); } - SYS_MOUNT = 21 // { int mount(char *type, char *path, \ + SYS_MOUNT = 21 // { int mount(char *type, char *path, int flags, caddr_t data); } SYS_UNMOUNT = 22 // { int unmount(char *path, int flags); } SYS_SETUID = 23 // { int setuid(uid_t uid); } SYS_GETUID = 24 // { uid_t getuid(void); } SYS_GETEUID = 25 // { uid_t geteuid(void); } - SYS_PTRACE = 26 // { int ptrace(int req, pid_t pid, \ - SYS_RECVMSG = 27 // { int recvmsg(int s, struct msghdr *msg, \ - SYS_SENDMSG = 28 // { int sendmsg(int s, struct msghdr *msg, \ - SYS_RECVFROM = 29 // { int recvfrom(int s, caddr_t buf, \ - SYS_ACCEPT = 30 // { int accept(int s, \ - SYS_GETPEERNAME = 31 // { int getpeername(int fdes, \ - SYS_GETSOCKNAME = 32 // { int getsockname(int fdes, \ + SYS_PTRACE = 26 // { int ptrace(int req, pid_t pid, caddr_t addr, int data); } + SYS_RECVMSG = 27 // { int recvmsg(int s, struct msghdr *msg, int flags); } + SYS_SENDMSG = 28 // { int sendmsg(int s, struct msghdr *msg, int flags); } + SYS_RECVFROM = 29 // { int recvfrom(int s, caddr_t buf, size_t len, int flags, struct sockaddr * __restrict from, __socklen_t * __restrict fromlenaddr); } + SYS_ACCEPT = 30 // { int accept(int s, struct sockaddr * __restrict name, __socklen_t * __restrict anamelen); } + SYS_GETPEERNAME = 31 // { int getpeername(int fdes, struct sockaddr * __restrict asa, __socklen_t * __restrict alen); } + SYS_GETSOCKNAME = 32 // { int getsockname(int fdes, struct sockaddr * __restrict asa, __socklen_t * __restrict alen); } SYS_ACCESS = 33 // { int access(char *path, int amode); } SYS_CHFLAGS = 34 // { int chflags(const char *path, u_long flags); } SYS_FCHFLAGS = 35 // { int fchflags(int fd, u_long flags); } @@ -42,56 +42,57 @@ const ( SYS_KILL = 37 // { int kill(int pid, int signum); } SYS_GETPPID = 39 // { pid_t getppid(void); } SYS_DUP = 41 // { int dup(u_int fd); } + SYS_PIPE = 42 // { int pipe(void); } SYS_GETEGID = 43 // { gid_t getegid(void); } - SYS_PROFIL = 44 // { int profil(caddr_t samples, size_t size, \ - SYS_KTRACE = 45 // { int ktrace(const char *fname, int ops, \ + SYS_PROFIL = 44 // { int profil(caddr_t samples, size_t size, size_t offset, u_int scale); } + SYS_KTRACE = 45 // { int ktrace(const char *fname, int ops, int facs, int pid); } SYS_GETGID = 47 // { gid_t getgid(void); } - SYS_GETLOGIN = 49 // { int getlogin(char *namebuf, u_int \ + SYS_GETLOGIN = 49 // { int getlogin(char *namebuf, u_int namelen); } SYS_SETLOGIN = 50 // { int setlogin(char *namebuf); } SYS_ACCT = 51 // { int acct(char *path); } - SYS_SIGALTSTACK = 53 // { int sigaltstack(stack_t *ss, \ - SYS_IOCTL = 54 // { int ioctl(int fd, u_long com, \ + SYS_SIGALTSTACK = 53 // { int sigaltstack(stack_t *ss, stack_t *oss); } + SYS_IOCTL = 54 // { int ioctl(int fd, u_long com, caddr_t data); } SYS_REBOOT = 55 // { int reboot(int opt); } SYS_REVOKE = 56 // { int revoke(char *path); } SYS_SYMLINK = 57 // { int symlink(char *path, char *link); } - SYS_READLINK = 58 // { ssize_t readlink(char *path, char *buf, \ - SYS_EXECVE = 59 // { int execve(char *fname, char **argv, \ - SYS_UMASK = 60 // { int umask(int newmask); } umask umask_args \ + SYS_READLINK = 58 // { ssize_t readlink(char *path, char *buf, size_t count); } + SYS_EXECVE = 59 // { int execve(char *fname, char **argv, char **envv); } + SYS_UMASK = 60 // { int umask(int newmask); } umask umask_args int SYS_CHROOT = 61 // { int chroot(char *path); } - SYS_MSYNC = 65 // { int msync(void *addr, size_t len, \ + SYS_MSYNC = 65 // { int msync(void *addr, size_t len, int flags); } SYS_VFORK = 66 // { int vfork(void); } SYS_SBRK = 69 // { int sbrk(int incr); } SYS_SSTK = 70 // { int sstk(int incr); } - SYS_OVADVISE = 72 // { int ovadvise(int anom); } vadvise \ + SYS_OVADVISE = 72 // { int ovadvise(int anom); } vadvise ovadvise_args int SYS_MUNMAP = 73 // { int munmap(void *addr, size_t len); } - SYS_MPROTECT = 74 // { int mprotect(const void *addr, size_t len, \ - SYS_MADVISE = 75 // { int madvise(void *addr, size_t len, \ - SYS_MINCORE = 78 // { int mincore(const void *addr, size_t len, \ - SYS_GETGROUPS = 79 // { int getgroups(u_int gidsetsize, \ - SYS_SETGROUPS = 80 // { int setgroups(u_int gidsetsize, \ + SYS_MPROTECT = 74 // { int mprotect(const void *addr, size_t len, int prot); } + SYS_MADVISE = 75 // { int madvise(void *addr, size_t len, int behav); } + SYS_MINCORE = 78 // { int mincore(const void *addr, size_t len, char *vec); } + SYS_GETGROUPS = 79 // { int getgroups(u_int gidsetsize, gid_t *gidset); } + SYS_SETGROUPS = 80 // { int setgroups(u_int gidsetsize, gid_t *gidset); } SYS_GETPGRP = 81 // { int getpgrp(void); } SYS_SETPGID = 82 // { int setpgid(int pid, int pgid); } - SYS_SETITIMER = 83 // { int setitimer(u_int which, struct \ + SYS_SETITIMER = 83 // { int setitimer(u_int which, struct itimerval *itv, struct itimerval *oitv); } SYS_SWAPON = 85 // { int swapon(char *name); } - SYS_GETITIMER = 86 // { int getitimer(u_int which, \ + SYS_GETITIMER = 86 // { int getitimer(u_int which, struct itimerval *itv); } SYS_GETDTABLESIZE = 89 // { int getdtablesize(void); } SYS_DUP2 = 90 // { int dup2(u_int from, u_int to); } SYS_FCNTL = 92 // { int fcntl(int fd, int cmd, long arg); } - SYS_SELECT = 93 // { int select(int nd, fd_set *in, fd_set *ou, \ + SYS_SELECT = 93 // { int select(int nd, fd_set *in, fd_set *ou, fd_set *ex, struct timeval *tv); } SYS_FSYNC = 95 // { int fsync(int fd); } - SYS_SETPRIORITY = 96 // { int setpriority(int which, int who, \ - SYS_SOCKET = 97 // { int socket(int domain, int type, \ - SYS_CONNECT = 98 // { int connect(int s, caddr_t name, \ + SYS_SETPRIORITY = 96 // { int setpriority(int which, int who, int prio); } + SYS_SOCKET = 97 // { int socket(int domain, int type, int protocol); } + SYS_CONNECT = 98 // { int connect(int s, caddr_t name, int namelen); } SYS_GETPRIORITY = 100 // { int getpriority(int which, int who); } - SYS_BIND = 104 // { int bind(int s, caddr_t name, \ - SYS_SETSOCKOPT = 105 // { int setsockopt(int s, int level, int name, \ + SYS_BIND = 104 // { int bind(int s, caddr_t name, int namelen); } + SYS_SETSOCKOPT = 105 // { int setsockopt(int s, int level, int name, caddr_t val, int valsize); } SYS_LISTEN = 106 // { int listen(int s, int backlog); } - SYS_GETTIMEOFDAY = 116 // { int gettimeofday(struct timeval *tp, \ - SYS_GETRUSAGE = 117 // { int getrusage(int who, \ - SYS_GETSOCKOPT = 118 // { int getsockopt(int s, int level, int name, \ - SYS_READV = 120 // { int readv(int fd, struct iovec *iovp, \ - SYS_WRITEV = 121 // { int writev(int fd, struct iovec *iovp, \ - SYS_SETTIMEOFDAY = 122 // { int settimeofday(struct timeval *tv, \ + SYS_GETTIMEOFDAY = 116 // { int gettimeofday(struct timeval *tp, struct timezone *tzp); } + SYS_GETRUSAGE = 117 // { int getrusage(int who, struct rusage *rusage); } + SYS_GETSOCKOPT = 118 // { int getsockopt(int s, int level, int name, caddr_t val, int *avalsize); } + SYS_READV = 120 // { int readv(int fd, struct iovec *iovp, u_int iovcnt); } + SYS_WRITEV = 121 // { int writev(int fd, struct iovec *iovp, u_int iovcnt); } + SYS_SETTIMEOFDAY = 122 // { int settimeofday(struct timeval *tv, struct timezone *tzp); } SYS_FCHOWN = 123 // { int fchown(int fd, int uid, int gid); } SYS_FCHMOD = 124 // { int fchmod(int fd, int mode); } SYS_SETREUID = 126 // { int setreuid(int ruid, int euid); } @@ -99,24 +100,24 @@ const ( SYS_RENAME = 128 // { int rename(char *from, char *to); } SYS_FLOCK = 131 // { int flock(int fd, int how); } SYS_MKFIFO = 132 // { int mkfifo(char *path, int mode); } - SYS_SENDTO = 133 // { int sendto(int s, caddr_t buf, size_t len, \ + SYS_SENDTO = 133 // { int sendto(int s, caddr_t buf, size_t len, int flags, caddr_t to, int tolen); } SYS_SHUTDOWN = 134 // { int shutdown(int s, int how); } - SYS_SOCKETPAIR = 135 // { int socketpair(int domain, int type, \ + SYS_SOCKETPAIR = 135 // { int socketpair(int domain, int type, int protocol, int *rsv); } SYS_MKDIR = 136 // { int mkdir(char *path, int mode); } SYS_RMDIR = 137 // { int rmdir(char *path); } - SYS_UTIMES = 138 // { int utimes(char *path, \ - SYS_ADJTIME = 140 // { int adjtime(struct timeval *delta, \ + SYS_UTIMES = 138 // { int utimes(char *path, struct timeval *tptr); } + SYS_ADJTIME = 140 // { int adjtime(struct timeval *delta, struct timeval *olddelta); } SYS_SETSID = 147 // { int setsid(void); } - SYS_QUOTACTL = 148 // { int quotactl(char *path, int cmd, int uid, \ + SYS_QUOTACTL = 148 // { int quotactl(char *path, int cmd, int uid, caddr_t arg); } SYS_NLM_SYSCALL = 154 // { int nlm_syscall(int debug_level, int grace_period, int addr_count, char **addrs); } SYS_NFSSVC = 155 // { int nfssvc(int flag, caddr_t argp); } - SYS_LGETFH = 160 // { int lgetfh(char *fname, \ - SYS_GETFH = 161 // { int getfh(char *fname, \ + SYS_LGETFH = 160 // { int lgetfh(char *fname, struct fhandle *fhp); } + SYS_GETFH = 161 // { int getfh(char *fname, struct fhandle *fhp); } SYS_SYSARCH = 165 // { int sysarch(int op, char *parms); } - SYS_RTPRIO = 166 // { int rtprio(int function, pid_t pid, \ - SYS_SEMSYS = 169 // { int semsys(int which, int a2, int a3, \ - SYS_MSGSYS = 170 // { int msgsys(int which, int a2, int a3, \ - SYS_SHMSYS = 171 // { int shmsys(int which, int a2, int a3, \ + SYS_RTPRIO = 166 // { int rtprio(int function, pid_t pid, struct rtprio *rtp); } + SYS_SEMSYS = 169 // { int semsys(int which, int a2, int a3, int a4, int a5); } + SYS_MSGSYS = 170 // { int msgsys(int which, int a2, int a3, int a4, int a5, int a6); } + SYS_SHMSYS = 171 // { int shmsys(int which, int a2, int a3, int a4); } SYS_SETFIB = 175 // { int setfib(int fibnum); } SYS_NTP_ADJTIME = 176 // { int ntp_adjtime(struct timex *tp); } SYS_SETGID = 181 // { int setgid(gid_t gid); } @@ -127,269 +128,269 @@ const ( SYS_LSTAT = 190 // { int lstat(char *path, struct stat *ub); } SYS_PATHCONF = 191 // { int pathconf(char *path, int name); } SYS_FPATHCONF = 192 // { int fpathconf(int fd, int name); } - SYS_GETRLIMIT = 194 // { int getrlimit(u_int which, \ - SYS_SETRLIMIT = 195 // { int setrlimit(u_int which, \ - SYS_GETDIRENTRIES = 196 // { int getdirentries(int fd, char *buf, \ - SYS___SYSCTL = 202 // { int __sysctl(int *name, u_int namelen, \ + SYS_GETRLIMIT = 194 // { int getrlimit(u_int which, struct rlimit *rlp); } getrlimit __getrlimit_args int + SYS_SETRLIMIT = 195 // { int setrlimit(u_int which, struct rlimit *rlp); } setrlimit __setrlimit_args int + SYS_GETDIRENTRIES = 196 // { int getdirentries(int fd, char *buf, u_int count, long *basep); } + SYS___SYSCTL = 202 // { int __sysctl(int *name, u_int namelen, void *old, size_t *oldlenp, void *new, size_t newlen); } __sysctl sysctl_args int SYS_MLOCK = 203 // { int mlock(const void *addr, size_t len); } SYS_MUNLOCK = 204 // { int munlock(const void *addr, size_t len); } SYS_UNDELETE = 205 // { int undelete(char *path); } SYS_FUTIMES = 206 // { int futimes(int fd, struct timeval *tptr); } SYS_GETPGID = 207 // { int getpgid(pid_t pid); } - SYS_POLL = 209 // { int poll(struct pollfd *fds, u_int nfds, \ - SYS_SEMGET = 221 // { int semget(key_t key, int nsems, \ - SYS_SEMOP = 222 // { int semop(int semid, struct sembuf *sops, \ + SYS_POLL = 209 // { int poll(struct pollfd *fds, u_int nfds, int timeout); } + SYS_SEMGET = 221 // { int semget(key_t key, int nsems, int semflg); } + SYS_SEMOP = 222 // { int semop(int semid, struct sembuf *sops, size_t nsops); } SYS_MSGGET = 225 // { int msgget(key_t key, int msgflg); } - SYS_MSGSND = 226 // { int msgsnd(int msqid, const void *msgp, \ - SYS_MSGRCV = 227 // { int msgrcv(int msqid, void *msgp, \ - SYS_SHMAT = 228 // { int shmat(int shmid, const void *shmaddr, \ + SYS_MSGSND = 226 // { int msgsnd(int msqid, const void *msgp, size_t msgsz, int msgflg); } + SYS_MSGRCV = 227 // { int msgrcv(int msqid, void *msgp, size_t msgsz, long msgtyp, int msgflg); } + SYS_SHMAT = 228 // { int shmat(int shmid, const void *shmaddr, int shmflg); } SYS_SHMDT = 230 // { int shmdt(const void *shmaddr); } - SYS_SHMGET = 231 // { int shmget(key_t key, size_t size, \ - SYS_CLOCK_GETTIME = 232 // { int clock_gettime(clockid_t clock_id, \ - SYS_CLOCK_SETTIME = 233 // { int clock_settime( \ - SYS_CLOCK_GETRES = 234 // { int clock_getres(clockid_t clock_id, \ - SYS_KTIMER_CREATE = 235 // { int ktimer_create(clockid_t clock_id, \ + SYS_SHMGET = 231 // { int shmget(key_t key, size_t size, int shmflg); } + SYS_CLOCK_GETTIME = 232 // { int clock_gettime(clockid_t clock_id, struct timespec *tp); } + SYS_CLOCK_SETTIME = 233 // { int clock_settime( clockid_t clock_id, const struct timespec *tp); } + SYS_CLOCK_GETRES = 234 // { int clock_getres(clockid_t clock_id, struct timespec *tp); } + SYS_KTIMER_CREATE = 235 // { int ktimer_create(clockid_t clock_id, struct sigevent *evp, int *timerid); } SYS_KTIMER_DELETE = 236 // { int ktimer_delete(int timerid); } - SYS_KTIMER_SETTIME = 237 // { int ktimer_settime(int timerid, int flags, \ - SYS_KTIMER_GETTIME = 238 // { int ktimer_gettime(int timerid, struct \ + SYS_KTIMER_SETTIME = 237 // { int ktimer_settime(int timerid, int flags, const struct itimerspec *value, struct itimerspec *ovalue); } + SYS_KTIMER_GETTIME = 238 // { int ktimer_gettime(int timerid, struct itimerspec *value); } SYS_KTIMER_GETOVERRUN = 239 // { int ktimer_getoverrun(int timerid); } - SYS_NANOSLEEP = 240 // { int nanosleep(const struct timespec *rqtp, \ + SYS_NANOSLEEP = 240 // { int nanosleep(const struct timespec *rqtp, struct timespec *rmtp); } SYS_FFCLOCK_GETCOUNTER = 241 // { int ffclock_getcounter(ffcounter *ffcount); } - SYS_FFCLOCK_SETESTIMATE = 242 // { int ffclock_setestimate( \ - SYS_FFCLOCK_GETESTIMATE = 243 // { int ffclock_getestimate( \ - SYS_CLOCK_NANOSLEEP = 244 // { int clock_nanosleep(clockid_t clock_id, \ - SYS_CLOCK_GETCPUCLOCKID2 = 247 // { int clock_getcpuclockid2(id_t id,\ + SYS_FFCLOCK_SETESTIMATE = 242 // { int ffclock_setestimate( struct ffclock_estimate *cest); } + SYS_FFCLOCK_GETESTIMATE = 243 // { int ffclock_getestimate( struct ffclock_estimate *cest); } + SYS_CLOCK_NANOSLEEP = 244 // { int clock_nanosleep(clockid_t clock_id, int flags, const struct timespec *rqtp, struct timespec *rmtp); } + SYS_CLOCK_GETCPUCLOCKID2 = 247 // { int clock_getcpuclockid2(id_t id,int which, clockid_t *clock_id); } SYS_NTP_GETTIME = 248 // { int ntp_gettime(struct ntptimeval *ntvp); } - SYS_MINHERIT = 250 // { int minherit(void *addr, size_t len, \ + SYS_MINHERIT = 250 // { int minherit(void *addr, size_t len, int inherit); } SYS_RFORK = 251 // { int rfork(int flags); } - SYS_OPENBSD_POLL = 252 // { int openbsd_poll(struct pollfd *fds, \ + SYS_OPENBSD_POLL = 252 // { int openbsd_poll(struct pollfd *fds, u_int nfds, int timeout); } SYS_ISSETUGID = 253 // { int issetugid(void); } SYS_LCHOWN = 254 // { int lchown(char *path, int uid, int gid); } SYS_AIO_READ = 255 // { int aio_read(struct aiocb *aiocbp); } SYS_AIO_WRITE = 256 // { int aio_write(struct aiocb *aiocbp); } - SYS_LIO_LISTIO = 257 // { int lio_listio(int mode, \ - SYS_GETDENTS = 272 // { int getdents(int fd, char *buf, \ + SYS_LIO_LISTIO = 257 // { int lio_listio(int mode, struct aiocb * const *acb_list, int nent, struct sigevent *sig); } + SYS_GETDENTS = 272 // { int getdents(int fd, char *buf, size_t count); } SYS_LCHMOD = 274 // { int lchmod(char *path, mode_t mode); } - SYS_LUTIMES = 276 // { int lutimes(char *path, \ + SYS_LUTIMES = 276 // { int lutimes(char *path, struct timeval *tptr); } SYS_NSTAT = 278 // { int nstat(char *path, struct nstat *ub); } SYS_NFSTAT = 279 // { int nfstat(int fd, struct nstat *sb); } SYS_NLSTAT = 280 // { int nlstat(char *path, struct nstat *ub); } - SYS_PREADV = 289 // { ssize_t preadv(int fd, struct iovec *iovp, \ - SYS_PWRITEV = 290 // { ssize_t pwritev(int fd, struct iovec *iovp, \ - SYS_FHOPEN = 298 // { int fhopen(const struct fhandle *u_fhp, \ - SYS_FHSTAT = 299 // { int fhstat(const struct fhandle *u_fhp, \ + SYS_PREADV = 289 // { ssize_t preadv(int fd, struct iovec *iovp, u_int iovcnt, off_t offset); } + SYS_PWRITEV = 290 // { ssize_t pwritev(int fd, struct iovec *iovp, u_int iovcnt, off_t offset); } + SYS_FHOPEN = 298 // { int fhopen(const struct fhandle *u_fhp, int flags); } + SYS_FHSTAT = 299 // { int fhstat(const struct fhandle *u_fhp, struct stat *sb); } SYS_MODNEXT = 300 // { int modnext(int modid); } - SYS_MODSTAT = 301 // { int modstat(int modid, \ + SYS_MODSTAT = 301 // { int modstat(int modid, struct module_stat *stat); } SYS_MODFNEXT = 302 // { int modfnext(int modid); } SYS_MODFIND = 303 // { int modfind(const char *name); } SYS_KLDLOAD = 304 // { int kldload(const char *file); } SYS_KLDUNLOAD = 305 // { int kldunload(int fileid); } SYS_KLDFIND = 306 // { int kldfind(const char *file); } SYS_KLDNEXT = 307 // { int kldnext(int fileid); } - SYS_KLDSTAT = 308 // { int kldstat(int fileid, struct \ + SYS_KLDSTAT = 308 // { int kldstat(int fileid, struct kld_file_stat* stat); } SYS_KLDFIRSTMOD = 309 // { int kldfirstmod(int fileid); } SYS_GETSID = 310 // { int getsid(pid_t pid); } - SYS_SETRESUID = 311 // { int setresuid(uid_t ruid, uid_t euid, \ - SYS_SETRESGID = 312 // { int setresgid(gid_t rgid, gid_t egid, \ + SYS_SETRESUID = 311 // { int setresuid(uid_t ruid, uid_t euid, uid_t suid); } + SYS_SETRESGID = 312 // { int setresgid(gid_t rgid, gid_t egid, gid_t sgid); } SYS_AIO_RETURN = 314 // { ssize_t aio_return(struct aiocb *aiocbp); } - SYS_AIO_SUSPEND = 315 // { int aio_suspend( \ - SYS_AIO_CANCEL = 316 // { int aio_cancel(int fd, \ + SYS_AIO_SUSPEND = 315 // { int aio_suspend( struct aiocb * const * aiocbp, int nent, const struct timespec *timeout); } + SYS_AIO_CANCEL = 316 // { int aio_cancel(int fd, struct aiocb *aiocbp); } SYS_AIO_ERROR = 317 // { int aio_error(struct aiocb *aiocbp); } SYS_YIELD = 321 // { int yield(void); } SYS_MLOCKALL = 324 // { int mlockall(int how); } SYS_MUNLOCKALL = 325 // { int munlockall(void); } SYS___GETCWD = 326 // { int __getcwd(char *buf, u_int buflen); } - SYS_SCHED_SETPARAM = 327 // { int sched_setparam (pid_t pid, \ - SYS_SCHED_GETPARAM = 328 // { int sched_getparam (pid_t pid, struct \ - SYS_SCHED_SETSCHEDULER = 329 // { int sched_setscheduler (pid_t pid, int \ + SYS_SCHED_SETPARAM = 327 // { int sched_setparam (pid_t pid, const struct sched_param *param); } + SYS_SCHED_GETPARAM = 328 // { int sched_getparam (pid_t pid, struct sched_param *param); } + SYS_SCHED_SETSCHEDULER = 329 // { int sched_setscheduler (pid_t pid, int policy, const struct sched_param *param); } SYS_SCHED_GETSCHEDULER = 330 // { int sched_getscheduler (pid_t pid); } SYS_SCHED_YIELD = 331 // { int sched_yield (void); } SYS_SCHED_GET_PRIORITY_MAX = 332 // { int sched_get_priority_max (int policy); } SYS_SCHED_GET_PRIORITY_MIN = 333 // { int sched_get_priority_min (int policy); } - SYS_SCHED_RR_GET_INTERVAL = 334 // { int sched_rr_get_interval (pid_t pid, \ + SYS_SCHED_RR_GET_INTERVAL = 334 // { int sched_rr_get_interval (pid_t pid, struct timespec *interval); } SYS_UTRACE = 335 // { int utrace(const void *addr, size_t len); } - SYS_KLDSYM = 337 // { int kldsym(int fileid, int cmd, \ + SYS_KLDSYM = 337 // { int kldsym(int fileid, int cmd, void *data); } SYS_JAIL = 338 // { int jail(struct jail *jail); } - SYS_SIGPROCMASK = 340 // { int sigprocmask(int how, \ + SYS_SIGPROCMASK = 340 // { int sigprocmask(int how, const sigset_t *set, sigset_t *oset); } SYS_SIGSUSPEND = 341 // { int sigsuspend(const sigset_t *sigmask); } SYS_SIGPENDING = 343 // { int sigpending(sigset_t *set); } - SYS_SIGTIMEDWAIT = 345 // { int sigtimedwait(const sigset_t *set, \ - SYS_SIGWAITINFO = 346 // { int sigwaitinfo(const sigset_t *set, \ - SYS___ACL_GET_FILE = 347 // { int __acl_get_file(const char *path, \ - SYS___ACL_SET_FILE = 348 // { int __acl_set_file(const char *path, \ - SYS___ACL_GET_FD = 349 // { int __acl_get_fd(int filedes, \ - SYS___ACL_SET_FD = 350 // { int __acl_set_fd(int filedes, \ - SYS___ACL_DELETE_FILE = 351 // { int __acl_delete_file(const char *path, \ - SYS___ACL_DELETE_FD = 352 // { int __acl_delete_fd(int filedes, \ - SYS___ACL_ACLCHECK_FILE = 353 // { int __acl_aclcheck_file(const char *path, \ - SYS___ACL_ACLCHECK_FD = 354 // { int __acl_aclcheck_fd(int filedes, \ - SYS_EXTATTRCTL = 355 // { int extattrctl(const char *path, int cmd, \ - SYS_EXTATTR_SET_FILE = 356 // { ssize_t extattr_set_file( \ - SYS_EXTATTR_GET_FILE = 357 // { ssize_t extattr_get_file( \ - SYS_EXTATTR_DELETE_FILE = 358 // { int extattr_delete_file(const char *path, \ - SYS_AIO_WAITCOMPLETE = 359 // { ssize_t aio_waitcomplete( \ - SYS_GETRESUID = 360 // { int getresuid(uid_t *ruid, uid_t *euid, \ - SYS_GETRESGID = 361 // { int getresgid(gid_t *rgid, gid_t *egid, \ + SYS_SIGTIMEDWAIT = 345 // { int sigtimedwait(const sigset_t *set, siginfo_t *info, const struct timespec *timeout); } + SYS_SIGWAITINFO = 346 // { int sigwaitinfo(const sigset_t *set, siginfo_t *info); } + SYS___ACL_GET_FILE = 347 // { int __acl_get_file(const char *path, acl_type_t type, struct acl *aclp); } + SYS___ACL_SET_FILE = 348 // { int __acl_set_file(const char *path, acl_type_t type, struct acl *aclp); } + SYS___ACL_GET_FD = 349 // { int __acl_get_fd(int filedes, acl_type_t type, struct acl *aclp); } + SYS___ACL_SET_FD = 350 // { int __acl_set_fd(int filedes, acl_type_t type, struct acl *aclp); } + SYS___ACL_DELETE_FILE = 351 // { int __acl_delete_file(const char *path, acl_type_t type); } + SYS___ACL_DELETE_FD = 352 // { int __acl_delete_fd(int filedes, acl_type_t type); } + SYS___ACL_ACLCHECK_FILE = 353 // { int __acl_aclcheck_file(const char *path, acl_type_t type, struct acl *aclp); } + SYS___ACL_ACLCHECK_FD = 354 // { int __acl_aclcheck_fd(int filedes, acl_type_t type, struct acl *aclp); } + SYS_EXTATTRCTL = 355 // { int extattrctl(const char *path, int cmd, const char *filename, int attrnamespace, const char *attrname); } + SYS_EXTATTR_SET_FILE = 356 // { ssize_t extattr_set_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } + SYS_EXTATTR_GET_FILE = 357 // { ssize_t extattr_get_file( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } + SYS_EXTATTR_DELETE_FILE = 358 // { int extattr_delete_file(const char *path, int attrnamespace, const char *attrname); } + SYS_AIO_WAITCOMPLETE = 359 // { ssize_t aio_waitcomplete( struct aiocb **aiocbp, struct timespec *timeout); } + SYS_GETRESUID = 360 // { int getresuid(uid_t *ruid, uid_t *euid, uid_t *suid); } + SYS_GETRESGID = 361 // { int getresgid(gid_t *rgid, gid_t *egid, gid_t *sgid); } SYS_KQUEUE = 362 // { int kqueue(void); } - SYS_KEVENT = 363 // { int kevent(int fd, \ - SYS_EXTATTR_SET_FD = 371 // { ssize_t extattr_set_fd(int fd, \ - SYS_EXTATTR_GET_FD = 372 // { ssize_t extattr_get_fd(int fd, \ - SYS_EXTATTR_DELETE_FD = 373 // { int extattr_delete_fd(int fd, \ + SYS_KEVENT = 363 // { int kevent(int fd, struct kevent *changelist, int nchanges, struct kevent *eventlist, int nevents, const struct timespec *timeout); } + SYS_EXTATTR_SET_FD = 371 // { ssize_t extattr_set_fd(int fd, int attrnamespace, const char *attrname, void *data, size_t nbytes); } + SYS_EXTATTR_GET_FD = 372 // { ssize_t extattr_get_fd(int fd, int attrnamespace, const char *attrname, void *data, size_t nbytes); } + SYS_EXTATTR_DELETE_FD = 373 // { int extattr_delete_fd(int fd, int attrnamespace, const char *attrname); } SYS___SETUGID = 374 // { int __setugid(int flag); } SYS_EACCESS = 376 // { int eaccess(char *path, int amode); } - SYS_NMOUNT = 378 // { int nmount(struct iovec *iovp, \ + SYS_NMOUNT = 378 // { int nmount(struct iovec *iovp, unsigned int iovcnt, int flags); } SYS___MAC_GET_PROC = 384 // { int __mac_get_proc(struct mac *mac_p); } SYS___MAC_SET_PROC = 385 // { int __mac_set_proc(struct mac *mac_p); } - SYS___MAC_GET_FD = 386 // { int __mac_get_fd(int fd, \ - SYS___MAC_GET_FILE = 387 // { int __mac_get_file(const char *path_p, \ - SYS___MAC_SET_FD = 388 // { int __mac_set_fd(int fd, \ - SYS___MAC_SET_FILE = 389 // { int __mac_set_file(const char *path_p, \ - SYS_KENV = 390 // { int kenv(int what, const char *name, \ - SYS_LCHFLAGS = 391 // { int lchflags(const char *path, \ - SYS_UUIDGEN = 392 // { int uuidgen(struct uuid *store, \ - SYS_SENDFILE = 393 // { int sendfile(int fd, int s, off_t offset, \ - SYS_MAC_SYSCALL = 394 // { int mac_syscall(const char *policy, \ - SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, \ - SYS_STATFS = 396 // { int statfs(char *path, \ + SYS___MAC_GET_FD = 386 // { int __mac_get_fd(int fd, struct mac *mac_p); } + SYS___MAC_GET_FILE = 387 // { int __mac_get_file(const char *path_p, struct mac *mac_p); } + SYS___MAC_SET_FD = 388 // { int __mac_set_fd(int fd, struct mac *mac_p); } + SYS___MAC_SET_FILE = 389 // { int __mac_set_file(const char *path_p, struct mac *mac_p); } + SYS_KENV = 390 // { int kenv(int what, const char *name, char *value, int len); } + SYS_LCHFLAGS = 391 // { int lchflags(const char *path, u_long flags); } + SYS_UUIDGEN = 392 // { int uuidgen(struct uuid *store, int count); } + SYS_SENDFILE = 393 // { int sendfile(int fd, int s, off_t offset, size_t nbytes, struct sf_hdtr *hdtr, off_t *sbytes, int flags); } + SYS_MAC_SYSCALL = 394 // { int mac_syscall(const char *policy, int call, void *arg); } + SYS_GETFSSTAT = 395 // { int getfsstat(struct statfs *buf, long bufsize, int mode); } + SYS_STATFS = 396 // { int statfs(char *path, struct statfs *buf); } SYS_FSTATFS = 397 // { int fstatfs(int fd, struct statfs *buf); } - SYS_FHSTATFS = 398 // { int fhstatfs(const struct fhandle *u_fhp, \ + SYS_FHSTATFS = 398 // { int fhstatfs(const struct fhandle *u_fhp, struct statfs *buf); } SYS_KSEM_CLOSE = 400 // { int ksem_close(semid_t id); } SYS_KSEM_POST = 401 // { int ksem_post(semid_t id); } SYS_KSEM_WAIT = 402 // { int ksem_wait(semid_t id); } SYS_KSEM_TRYWAIT = 403 // { int ksem_trywait(semid_t id); } - SYS_KSEM_INIT = 404 // { int ksem_init(semid_t *idp, \ - SYS_KSEM_OPEN = 405 // { int ksem_open(semid_t *idp, \ + SYS_KSEM_INIT = 404 // { int ksem_init(semid_t *idp, unsigned int value); } + SYS_KSEM_OPEN = 405 // { int ksem_open(semid_t *idp, const char *name, int oflag, mode_t mode, unsigned int value); } SYS_KSEM_UNLINK = 406 // { int ksem_unlink(const char *name); } SYS_KSEM_GETVALUE = 407 // { int ksem_getvalue(semid_t id, int *val); } SYS_KSEM_DESTROY = 408 // { int ksem_destroy(semid_t id); } - SYS___MAC_GET_PID = 409 // { int __mac_get_pid(pid_t pid, \ - SYS___MAC_GET_LINK = 410 // { int __mac_get_link(const char *path_p, \ - SYS___MAC_SET_LINK = 411 // { int __mac_set_link(const char *path_p, \ - SYS_EXTATTR_SET_LINK = 412 // { ssize_t extattr_set_link( \ - SYS_EXTATTR_GET_LINK = 413 // { ssize_t extattr_get_link( \ - SYS_EXTATTR_DELETE_LINK = 414 // { int extattr_delete_link( \ - SYS___MAC_EXECVE = 415 // { int __mac_execve(char *fname, char **argv, \ - SYS_SIGACTION = 416 // { int sigaction(int sig, \ - SYS_SIGRETURN = 417 // { int sigreturn( \ + SYS___MAC_GET_PID = 409 // { int __mac_get_pid(pid_t pid, struct mac *mac_p); } + SYS___MAC_GET_LINK = 410 // { int __mac_get_link(const char *path_p, struct mac *mac_p); } + SYS___MAC_SET_LINK = 411 // { int __mac_set_link(const char *path_p, struct mac *mac_p); } + SYS_EXTATTR_SET_LINK = 412 // { ssize_t extattr_set_link( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } + SYS_EXTATTR_GET_LINK = 413 // { ssize_t extattr_get_link( const char *path, int attrnamespace, const char *attrname, void *data, size_t nbytes); } + SYS_EXTATTR_DELETE_LINK = 414 // { int extattr_delete_link( const char *path, int attrnamespace, const char *attrname); } + SYS___MAC_EXECVE = 415 // { int __mac_execve(char *fname, char **argv, char **envv, struct mac *mac_p); } + SYS_SIGACTION = 416 // { int sigaction(int sig, const struct sigaction *act, struct sigaction *oact); } + SYS_SIGRETURN = 417 // { int sigreturn( const struct __ucontext *sigcntxp); } SYS_GETCONTEXT = 421 // { int getcontext(struct __ucontext *ucp); } - SYS_SETCONTEXT = 422 // { int setcontext( \ - SYS_SWAPCONTEXT = 423 // { int swapcontext(struct __ucontext *oucp, \ + SYS_SETCONTEXT = 422 // { int setcontext( const struct __ucontext *ucp); } + SYS_SWAPCONTEXT = 423 // { int swapcontext(struct __ucontext *oucp, const struct __ucontext *ucp); } SYS_SWAPOFF = 424 // { int swapoff(const char *name); } - SYS___ACL_GET_LINK = 425 // { int __acl_get_link(const char *path, \ - SYS___ACL_SET_LINK = 426 // { int __acl_set_link(const char *path, \ - SYS___ACL_DELETE_LINK = 427 // { int __acl_delete_link(const char *path, \ - SYS___ACL_ACLCHECK_LINK = 428 // { int __acl_aclcheck_link(const char *path, \ - SYS_SIGWAIT = 429 // { int sigwait(const sigset_t *set, \ - SYS_THR_CREATE = 430 // { int thr_create(ucontext_t *ctx, long *id, \ + SYS___ACL_GET_LINK = 425 // { int __acl_get_link(const char *path, acl_type_t type, struct acl *aclp); } + SYS___ACL_SET_LINK = 426 // { int __acl_set_link(const char *path, acl_type_t type, struct acl *aclp); } + SYS___ACL_DELETE_LINK = 427 // { int __acl_delete_link(const char *path, acl_type_t type); } + SYS___ACL_ACLCHECK_LINK = 428 // { int __acl_aclcheck_link(const char *path, acl_type_t type, struct acl *aclp); } + SYS_SIGWAIT = 429 // { int sigwait(const sigset_t *set, int *sig); } + SYS_THR_CREATE = 430 // { int thr_create(ucontext_t *ctx, long *id, int flags); } SYS_THR_EXIT = 431 // { void thr_exit(long *state); } SYS_THR_SELF = 432 // { int thr_self(long *id); } SYS_THR_KILL = 433 // { int thr_kill(long id, int sig); } SYS_JAIL_ATTACH = 436 // { int jail_attach(int jid); } - SYS_EXTATTR_LIST_FD = 437 // { ssize_t extattr_list_fd(int fd, \ - SYS_EXTATTR_LIST_FILE = 438 // { ssize_t extattr_list_file( \ - SYS_EXTATTR_LIST_LINK = 439 // { ssize_t extattr_list_link( \ - SYS_KSEM_TIMEDWAIT = 441 // { int ksem_timedwait(semid_t id, \ - SYS_THR_SUSPEND = 442 // { int thr_suspend( \ + SYS_EXTATTR_LIST_FD = 437 // { ssize_t extattr_list_fd(int fd, int attrnamespace, void *data, size_t nbytes); } + SYS_EXTATTR_LIST_FILE = 438 // { ssize_t extattr_list_file( const char *path, int attrnamespace, void *data, size_t nbytes); } + SYS_EXTATTR_LIST_LINK = 439 // { ssize_t extattr_list_link( const char *path, int attrnamespace, void *data, size_t nbytes); } + SYS_KSEM_TIMEDWAIT = 441 // { int ksem_timedwait(semid_t id, const struct timespec *abstime); } + SYS_THR_SUSPEND = 442 // { int thr_suspend( const struct timespec *timeout); } SYS_THR_WAKE = 443 // { int thr_wake(long id); } SYS_KLDUNLOADF = 444 // { int kldunloadf(int fileid, int flags); } - SYS_AUDIT = 445 // { int audit(const void *record, \ - SYS_AUDITON = 446 // { int auditon(int cmd, void *data, \ + SYS_AUDIT = 445 // { int audit(const void *record, u_int length); } + SYS_AUDITON = 446 // { int auditon(int cmd, void *data, u_int length); } SYS_GETAUID = 447 // { int getauid(uid_t *auid); } SYS_SETAUID = 448 // { int setauid(uid_t *auid); } SYS_GETAUDIT = 449 // { int getaudit(struct auditinfo *auditinfo); } SYS_SETAUDIT = 450 // { int setaudit(struct auditinfo *auditinfo); } - SYS_GETAUDIT_ADDR = 451 // { int getaudit_addr( \ - SYS_SETAUDIT_ADDR = 452 // { int setaudit_addr( \ + SYS_GETAUDIT_ADDR = 451 // { int getaudit_addr( struct auditinfo_addr *auditinfo_addr, u_int length); } + SYS_SETAUDIT_ADDR = 452 // { int setaudit_addr( struct auditinfo_addr *auditinfo_addr, u_int length); } SYS_AUDITCTL = 453 // { int auditctl(char *path); } - SYS__UMTX_OP = 454 // { int _umtx_op(void *obj, int op, \ - SYS_THR_NEW = 455 // { int thr_new(struct thr_param *param, \ + SYS__UMTX_OP = 454 // { int _umtx_op(void *obj, int op, u_long val, void *uaddr1, void *uaddr2); } + SYS_THR_NEW = 455 // { int thr_new(struct thr_param *param, int param_size); } SYS_SIGQUEUE = 456 // { int sigqueue(pid_t pid, int signum, void *value); } - SYS_KMQ_OPEN = 457 // { int kmq_open(const char *path, int flags, \ - SYS_KMQ_SETATTR = 458 // { int kmq_setattr(int mqd, \ - SYS_KMQ_TIMEDRECEIVE = 459 // { int kmq_timedreceive(int mqd, \ - SYS_KMQ_TIMEDSEND = 460 // { int kmq_timedsend(int mqd, \ - SYS_KMQ_NOTIFY = 461 // { int kmq_notify(int mqd, \ + SYS_KMQ_OPEN = 457 // { int kmq_open(const char *path, int flags, mode_t mode, const struct mq_attr *attr); } + SYS_KMQ_SETATTR = 458 // { int kmq_setattr(int mqd, const struct mq_attr *attr, struct mq_attr *oattr); } + SYS_KMQ_TIMEDRECEIVE = 459 // { int kmq_timedreceive(int mqd, char *msg_ptr, size_t msg_len, unsigned *msg_prio, const struct timespec *abs_timeout); } + SYS_KMQ_TIMEDSEND = 460 // { int kmq_timedsend(int mqd, const char *msg_ptr, size_t msg_len,unsigned msg_prio, const struct timespec *abs_timeout);} + SYS_KMQ_NOTIFY = 461 // { int kmq_notify(int mqd, const struct sigevent *sigev); } SYS_KMQ_UNLINK = 462 // { int kmq_unlink(const char *path); } SYS_ABORT2 = 463 // { int abort2(const char *why, int nargs, void **args); } SYS_THR_SET_NAME = 464 // { int thr_set_name(long id, const char *name); } SYS_AIO_FSYNC = 465 // { int aio_fsync(int op, struct aiocb *aiocbp); } - SYS_RTPRIO_THREAD = 466 // { int rtprio_thread(int function, \ + SYS_RTPRIO_THREAD = 466 // { int rtprio_thread(int function, lwpid_t lwpid, struct rtprio *rtp); } SYS_SCTP_PEELOFF = 471 // { int sctp_peeloff(int sd, uint32_t name); } - SYS_SCTP_GENERIC_SENDMSG = 472 // { int sctp_generic_sendmsg(int sd, caddr_t msg, int mlen, \ - SYS_SCTP_GENERIC_SENDMSG_IOV = 473 // { int sctp_generic_sendmsg_iov(int sd, struct iovec *iov, int iovlen, \ - SYS_SCTP_GENERIC_RECVMSG = 474 // { int sctp_generic_recvmsg(int sd, struct iovec *iov, int iovlen, \ - SYS_PREAD = 475 // { ssize_t pread(int fd, void *buf, \ - SYS_PWRITE = 476 // { ssize_t pwrite(int fd, const void *buf, \ - SYS_MMAP = 477 // { caddr_t mmap(caddr_t addr, size_t len, \ - SYS_LSEEK = 478 // { off_t lseek(int fd, off_t offset, \ + SYS_SCTP_GENERIC_SENDMSG = 472 // { int sctp_generic_sendmsg(int sd, caddr_t msg, int mlen, caddr_t to, __socklen_t tolen, struct sctp_sndrcvinfo *sinfo, int flags); } + SYS_SCTP_GENERIC_SENDMSG_IOV = 473 // { int sctp_generic_sendmsg_iov(int sd, struct iovec *iov, int iovlen, caddr_t to, __socklen_t tolen, struct sctp_sndrcvinfo *sinfo, int flags); } + SYS_SCTP_GENERIC_RECVMSG = 474 // { int sctp_generic_recvmsg(int sd, struct iovec *iov, int iovlen, struct sockaddr * from, __socklen_t *fromlenaddr, struct sctp_sndrcvinfo *sinfo, int *msg_flags); } + SYS_PREAD = 475 // { ssize_t pread(int fd, void *buf, size_t nbyte, off_t offset); } + SYS_PWRITE = 476 // { ssize_t pwrite(int fd, const void *buf, size_t nbyte, off_t offset); } + SYS_MMAP = 477 // { caddr_t mmap(caddr_t addr, size_t len, int prot, int flags, int fd, off_t pos); } + SYS_LSEEK = 478 // { off_t lseek(int fd, off_t offset, int whence); } SYS_TRUNCATE = 479 // { int truncate(char *path, off_t length); } SYS_FTRUNCATE = 480 // { int ftruncate(int fd, off_t length); } SYS_THR_KILL2 = 481 // { int thr_kill2(pid_t pid, long id, int sig); } - SYS_SHM_OPEN = 482 // { int shm_open(const char *path, int flags, \ + SYS_SHM_OPEN = 482 // { int shm_open(const char *path, int flags, mode_t mode); } SYS_SHM_UNLINK = 483 // { int shm_unlink(const char *path); } SYS_CPUSET = 484 // { int cpuset(cpusetid_t *setid); } - SYS_CPUSET_SETID = 485 // { int cpuset_setid(cpuwhich_t which, id_t id, \ - SYS_CPUSET_GETID = 486 // { int cpuset_getid(cpulevel_t level, \ - SYS_CPUSET_GETAFFINITY = 487 // { int cpuset_getaffinity(cpulevel_t level, \ - SYS_CPUSET_SETAFFINITY = 488 // { int cpuset_setaffinity(cpulevel_t level, \ - SYS_FACCESSAT = 489 // { int faccessat(int fd, char *path, int amode, \ - SYS_FCHMODAT = 490 // { int fchmodat(int fd, char *path, mode_t mode, \ - SYS_FCHOWNAT = 491 // { int fchownat(int fd, char *path, uid_t uid, \ - SYS_FEXECVE = 492 // { int fexecve(int fd, char **argv, \ - SYS_FSTATAT = 493 // { int fstatat(int fd, char *path, \ - SYS_FUTIMESAT = 494 // { int futimesat(int fd, char *path, \ - SYS_LINKAT = 495 // { int linkat(int fd1, char *path1, int fd2, \ + SYS_CPUSET_SETID = 485 // { int cpuset_setid(cpuwhich_t which, id_t id, cpusetid_t setid); } + SYS_CPUSET_GETID = 486 // { int cpuset_getid(cpulevel_t level, cpuwhich_t which, id_t id, cpusetid_t *setid); } + SYS_CPUSET_GETAFFINITY = 487 // { int cpuset_getaffinity(cpulevel_t level, cpuwhich_t which, id_t id, size_t cpusetsize, cpuset_t *mask); } + SYS_CPUSET_SETAFFINITY = 488 // { int cpuset_setaffinity(cpulevel_t level, cpuwhich_t which, id_t id, size_t cpusetsize, const cpuset_t *mask); } + SYS_FACCESSAT = 489 // { int faccessat(int fd, char *path, int amode, int flag); } + SYS_FCHMODAT = 490 // { int fchmodat(int fd, char *path, mode_t mode, int flag); } + SYS_FCHOWNAT = 491 // { int fchownat(int fd, char *path, uid_t uid, gid_t gid, int flag); } + SYS_FEXECVE = 492 // { int fexecve(int fd, char **argv, char **envv); } + SYS_FSTATAT = 493 // { int fstatat(int fd, char *path, struct stat *buf, int flag); } + SYS_FUTIMESAT = 494 // { int futimesat(int fd, char *path, struct timeval *times); } + SYS_LINKAT = 495 // { int linkat(int fd1, char *path1, int fd2, char *path2, int flag); } SYS_MKDIRAT = 496 // { int mkdirat(int fd, char *path, mode_t mode); } SYS_MKFIFOAT = 497 // { int mkfifoat(int fd, char *path, mode_t mode); } - SYS_MKNODAT = 498 // { int mknodat(int fd, char *path, mode_t mode, \ - SYS_OPENAT = 499 // { int openat(int fd, char *path, int flag, \ - SYS_READLINKAT = 500 // { int readlinkat(int fd, char *path, char *buf, \ - SYS_RENAMEAT = 501 // { int renameat(int oldfd, char *old, int newfd, \ - SYS_SYMLINKAT = 502 // { int symlinkat(char *path1, int fd, \ + SYS_MKNODAT = 498 // { int mknodat(int fd, char *path, mode_t mode, dev_t dev); } + SYS_OPENAT = 499 // { int openat(int fd, char *path, int flag, mode_t mode); } + SYS_READLINKAT = 500 // { int readlinkat(int fd, char *path, char *buf, size_t bufsize); } + SYS_RENAMEAT = 501 // { int renameat(int oldfd, char *old, int newfd, char *new); } + SYS_SYMLINKAT = 502 // { int symlinkat(char *path1, int fd, char *path2); } SYS_UNLINKAT = 503 // { int unlinkat(int fd, char *path, int flag); } SYS_POSIX_OPENPT = 504 // { int posix_openpt(int flags); } SYS_GSSD_SYSCALL = 505 // { int gssd_syscall(char *path); } - SYS_JAIL_GET = 506 // { int jail_get(struct iovec *iovp, \ - SYS_JAIL_SET = 507 // { int jail_set(struct iovec *iovp, \ + SYS_JAIL_GET = 506 // { int jail_get(struct iovec *iovp, unsigned int iovcnt, int flags); } + SYS_JAIL_SET = 507 // { int jail_set(struct iovec *iovp, unsigned int iovcnt, int flags); } SYS_JAIL_REMOVE = 508 // { int jail_remove(int jid); } SYS_CLOSEFROM = 509 // { int closefrom(int lowfd); } - SYS___SEMCTL = 510 // { int __semctl(int semid, int semnum, \ - SYS_MSGCTL = 511 // { int msgctl(int msqid, int cmd, \ - SYS_SHMCTL = 512 // { int shmctl(int shmid, int cmd, \ + SYS___SEMCTL = 510 // { int __semctl(int semid, int semnum, int cmd, union semun *arg); } + SYS_MSGCTL = 511 // { int msgctl(int msqid, int cmd, struct msqid_ds *buf); } + SYS_SHMCTL = 512 // { int shmctl(int shmid, int cmd, struct shmid_ds *buf); } SYS_LPATHCONF = 513 // { int lpathconf(char *path, int name); } - SYS___CAP_RIGHTS_GET = 515 // { int __cap_rights_get(int version, \ + SYS___CAP_RIGHTS_GET = 515 // { int __cap_rights_get(int version, int fd, cap_rights_t *rightsp); } SYS_CAP_ENTER = 516 // { int cap_enter(void); } SYS_CAP_GETMODE = 517 // { int cap_getmode(u_int *modep); } SYS_PDFORK = 518 // { int pdfork(int *fdp, int flags); } SYS_PDKILL = 519 // { int pdkill(int fd, int signum); } SYS_PDGETPID = 520 // { int pdgetpid(int fd, pid_t *pidp); } - SYS_PSELECT = 522 // { int pselect(int nd, fd_set *in, \ - SYS_GETLOGINCLASS = 523 // { int getloginclass(char *namebuf, \ + SYS_PSELECT = 522 // { int pselect(int nd, fd_set *in, fd_set *ou, fd_set *ex, const struct timespec *ts, const sigset_t *sm); } + SYS_GETLOGINCLASS = 523 // { int getloginclass(char *namebuf, size_t namelen); } SYS_SETLOGINCLASS = 524 // { int setloginclass(const char *namebuf); } - SYS_RCTL_GET_RACCT = 525 // { int rctl_get_racct(const void *inbufp, \ - SYS_RCTL_GET_RULES = 526 // { int rctl_get_rules(const void *inbufp, \ - SYS_RCTL_GET_LIMITS = 527 // { int rctl_get_limits(const void *inbufp, \ - SYS_RCTL_ADD_RULE = 528 // { int rctl_add_rule(const void *inbufp, \ - SYS_RCTL_REMOVE_RULE = 529 // { int rctl_remove_rule(const void *inbufp, \ - SYS_POSIX_FALLOCATE = 530 // { int posix_fallocate(int fd, \ - SYS_POSIX_FADVISE = 531 // { int posix_fadvise(int fd, off_t offset, \ - SYS_WAIT6 = 532 // { int wait6(idtype_t idtype, id_t id, \ - SYS_CAP_RIGHTS_LIMIT = 533 // { int cap_rights_limit(int fd, \ - SYS_CAP_IOCTLS_LIMIT = 534 // { int cap_ioctls_limit(int fd, \ - SYS_CAP_IOCTLS_GET = 535 // { ssize_t cap_ioctls_get(int fd, \ - SYS_CAP_FCNTLS_LIMIT = 536 // { int cap_fcntls_limit(int fd, \ - SYS_CAP_FCNTLS_GET = 537 // { int cap_fcntls_get(int fd, \ - SYS_BINDAT = 538 // { int bindat(int fd, int s, caddr_t name, \ - SYS_CONNECTAT = 539 // { int connectat(int fd, int s, caddr_t name, \ - SYS_CHFLAGSAT = 540 // { int chflagsat(int fd, const char *path, \ - SYS_ACCEPT4 = 541 // { int accept4(int s, \ + SYS_RCTL_GET_RACCT = 525 // { int rctl_get_racct(const void *inbufp, size_t inbuflen, void *outbufp, size_t outbuflen); } + SYS_RCTL_GET_RULES = 526 // { int rctl_get_rules(const void *inbufp, size_t inbuflen, void *outbufp, size_t outbuflen); } + SYS_RCTL_GET_LIMITS = 527 // { int rctl_get_limits(const void *inbufp, size_t inbuflen, void *outbufp, size_t outbuflen); } + SYS_RCTL_ADD_RULE = 528 // { int rctl_add_rule(const void *inbufp, size_t inbuflen, void *outbufp, size_t outbuflen); } + SYS_RCTL_REMOVE_RULE = 529 // { int rctl_remove_rule(const void *inbufp, size_t inbuflen, void *outbufp, size_t outbuflen); } + SYS_POSIX_FALLOCATE = 530 // { int posix_fallocate(int fd, off_t offset, off_t len); } + SYS_POSIX_FADVISE = 531 // { int posix_fadvise(int fd, off_t offset, off_t len, int advice); } + SYS_WAIT6 = 532 // { int wait6(idtype_t idtype, id_t id, int *status, int options, struct __wrusage *wrusage, siginfo_t *info); } + SYS_CAP_RIGHTS_LIMIT = 533 // { int cap_rights_limit(int fd, cap_rights_t *rightsp); } + SYS_CAP_IOCTLS_LIMIT = 534 // { int cap_ioctls_limit(int fd, const u_long *cmds, size_t ncmds); } + SYS_CAP_IOCTLS_GET = 535 // { ssize_t cap_ioctls_get(int fd, u_long *cmds, size_t maxcmds); } + SYS_CAP_FCNTLS_LIMIT = 536 // { int cap_fcntls_limit(int fd, uint32_t fcntlrights); } + SYS_CAP_FCNTLS_GET = 537 // { int cap_fcntls_get(int fd, uint32_t *fcntlrightsp); } + SYS_BINDAT = 538 // { int bindat(int fd, int s, caddr_t name, int namelen); } + SYS_CONNECTAT = 539 // { int connectat(int fd, int s, caddr_t name, int namelen); } + SYS_CHFLAGSAT = 540 // { int chflagsat(int fd, const char *path, u_long flags, int atflag); } + SYS_ACCEPT4 = 541 // { int accept4(int s, struct sockaddr * __restrict name, __socklen_t * __restrict anamelen, int flags); } SYS_PIPE2 = 542 // { int pipe2(int *fildes, int flags); } SYS_AIO_MLOCK = 543 // { int aio_mlock(struct aiocb *aiocbp); } - SYS_PROCCTL = 544 // { int procctl(idtype_t idtype, id_t id, \ - SYS_PPOLL = 545 // { int ppoll(struct pollfd *fds, u_int nfds, \ - SYS_FUTIMENS = 546 // { int futimens(int fd, \ - SYS_UTIMENSAT = 547 // { int utimensat(int fd, \ - SYS_NUMA_GETAFFINITY = 548 // { int numa_getaffinity(cpuwhich_t which, \ - SYS_NUMA_SETAFFINITY = 549 // { int numa_setaffinity(cpuwhich_t which, \ + SYS_PROCCTL = 544 // { int procctl(idtype_t idtype, id_t id, int com, void *data); } + SYS_PPOLL = 545 // { int ppoll(struct pollfd *fds, u_int nfds, const struct timespec *ts, const sigset_t *set); } + SYS_FUTIMENS = 546 // { int futimens(int fd, struct timespec *times); } + SYS_UTIMENSAT = 547 // { int utimensat(int fd, char *path, struct timespec *times, int flag); } + SYS_NUMA_GETAFFINITY = 548 // { int numa_getaffinity(cpuwhich_t which, id_t id, struct vm_domain_policy_entry *policy); } + SYS_NUMA_SETAFFINITY = 549 // { int numa_setaffinity(cpuwhich_t which, id_t id, const struct vm_domain_policy_entry *policy); } SYS_FDATASYNC = 550 // { int fdatasync(int fd); } ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go index 33b6e4d1a..e869c0603 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_386.go @@ -423,4 +423,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go index 9ba207847..4917b8ab6 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_amd64.go @@ -345,4 +345,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go index 94f68f101..f85fcb4f8 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm.go @@ -387,4 +387,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go index 15c413516..678a119bc 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_arm64.go @@ -290,4 +290,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go index 638465b14..222c9f9a2 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips.go @@ -408,4 +408,10 @@ const ( SYS_IO_URING_SETUP = 4425 SYS_IO_URING_ENTER = 4426 SYS_IO_URING_REGISTER = 4427 + SYS_OPEN_TREE = 4428 + SYS_MOVE_MOUNT = 4429 + SYS_FSOPEN = 4430 + SYS_FSCONFIG = 4431 + SYS_FSMOUNT = 4432 + SYS_FSPICK = 4433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go index 57ec82aac..28e6d0e9d 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64.go @@ -338,4 +338,10 @@ const ( SYS_IO_URING_SETUP = 5425 SYS_IO_URING_ENTER = 5426 SYS_IO_URING_REGISTER = 5427 + SYS_OPEN_TREE = 5428 + SYS_MOVE_MOUNT = 5429 + SYS_FSOPEN = 5430 + SYS_FSCONFIG = 5431 + SYS_FSMOUNT = 5432 + SYS_FSPICK = 5433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go index 825a3e3b0..e643c6f63 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mips64le.go @@ -338,4 +338,10 @@ const ( SYS_IO_URING_SETUP = 5425 SYS_IO_URING_ENTER = 5426 SYS_IO_URING_REGISTER = 5427 + SYS_OPEN_TREE = 5428 + SYS_MOVE_MOUNT = 5429 + SYS_FSOPEN = 5430 + SYS_FSCONFIG = 5431 + SYS_FSMOUNT = 5432 + SYS_FSPICK = 5433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go index f152dfdd0..01d93c420 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_mipsle.go @@ -408,4 +408,10 @@ const ( SYS_IO_URING_SETUP = 4425 SYS_IO_URING_ENTER = 4426 SYS_IO_URING_REGISTER = 4427 + SYS_OPEN_TREE = 4428 + SYS_MOVE_MOUNT = 4429 + SYS_FSOPEN = 4430 + SYS_FSCONFIG = 4431 + SYS_FSMOUNT = 4432 + SYS_FSPICK = 4433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go index 7cbe78b19..5744149eb 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go @@ -387,4 +387,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go index 51a2f1236..21c832042 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go @@ -387,4 +387,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go index 323432ae3..c1bb6d8f2 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_riscv64.go @@ -289,4 +289,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go index 9dca97484..bc3cc6b5b 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go @@ -352,4 +352,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go index d3da46f0d..0a2841ba8 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go @@ -367,4 +367,10 @@ const ( SYS_IO_URING_SETUP = 425 SYS_IO_URING_ENTER = 426 SYS_IO_URING_REGISTER = 427 + SYS_OPEN_TREE = 428 + SYS_MOVE_MOUNT = 429 + SYS_FSOPEN = 430 + SYS_FSCONFIG = 431 + SYS_FSMOUNT = 432 + SYS_FSPICK = 433 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go index 0edc5409a..7312e95ff 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_386.go @@ -324,11 +324,108 @@ const ( ) const ( - PTRACE_TRACEME = 0x0 - PTRACE_CONT = 0x7 - PTRACE_KILL = 0x8 + PTRACE_ATTACH = 0xa + PTRACE_CONT = 0x7 + PTRACE_DETACH = 0xb + PTRACE_GETFPREGS = 0x23 + PTRACE_GETFSBASE = 0x47 + PTRACE_GETLWPLIST = 0xf + PTRACE_GETNUMLWPS = 0xe + PTRACE_GETREGS = 0x21 + PTRACE_GETXSTATE = 0x45 + PTRACE_IO = 0xc + PTRACE_KILL = 0x8 + PTRACE_LWPEVENTS = 0x18 + PTRACE_LWPINFO = 0xd + PTRACE_SETFPREGS = 0x24 + PTRACE_SETREGS = 0x22 + PTRACE_SINGLESTEP = 0x9 + PTRACE_TRACEME = 0x0 ) +const ( + PIOD_READ_D = 0x1 + PIOD_WRITE_D = 0x2 + PIOD_READ_I = 0x3 + PIOD_WRITE_I = 0x4 +) + +const ( + PL_FLAG_BORN = 0x100 + PL_FLAG_EXITED = 0x200 + PL_FLAG_SI = 0x20 +) + +const ( + TRAP_BRKPT = 0x1 + TRAP_TRACE = 0x2 +) + +type PtraceLwpInfoStruct struct { + Lwpid int32 + Event int32 + Flags int32 + Sigmask Sigset_t + Siglist Sigset_t + Siginfo __Siginfo + Tdname [20]int8 + Child_pid int32 + Syscall_code uint32 + Syscall_narg uint32 +} + +type __Siginfo struct { + Signo int32 + Errno int32 + Code int32 + Pid int32 + Uid uint32 + Status int32 + Addr *byte + Value [4]byte + X_reason [32]byte +} + +type Sigset_t struct { + Val [4]uint32 +} + +type Reg struct { + Fs uint32 + Es uint32 + Ds uint32 + Edi uint32 + Esi uint32 + Ebp uint32 + Isp uint32 + Ebx uint32 + Edx uint32 + Ecx uint32 + Eax uint32 + Trapno uint32 + Err uint32 + Eip uint32 + Cs uint32 + Eflags uint32 + Esp uint32 + Ss uint32 + Gs uint32 +} + +type FpReg struct { + Env [7]uint32 + Acc [8][10]uint8 + Ex_sw uint32 + Pad [64]uint8 +} + +type PtraceIoDesc struct { + Op int32 + Offs *byte + Addr *byte + Len uint +} + type Kevent_t struct { Ident uint32 Filter int16 diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go index 8881ce842..29ba2f5bf 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_amd64.go @@ -322,11 +322,115 @@ const ( ) const ( - PTRACE_TRACEME = 0x0 - PTRACE_CONT = 0x7 - PTRACE_KILL = 0x8 + PTRACE_ATTACH = 0xa + PTRACE_CONT = 0x7 + PTRACE_DETACH = 0xb + PTRACE_GETFPREGS = 0x23 + PTRACE_GETFSBASE = 0x47 + PTRACE_GETLWPLIST = 0xf + PTRACE_GETNUMLWPS = 0xe + PTRACE_GETREGS = 0x21 + PTRACE_GETXSTATE = 0x45 + PTRACE_IO = 0xc + PTRACE_KILL = 0x8 + PTRACE_LWPEVENTS = 0x18 + PTRACE_LWPINFO = 0xd + PTRACE_SETFPREGS = 0x24 + PTRACE_SETREGS = 0x22 + PTRACE_SINGLESTEP = 0x9 + PTRACE_TRACEME = 0x0 ) +const ( + PIOD_READ_D = 0x1 + PIOD_WRITE_D = 0x2 + PIOD_READ_I = 0x3 + PIOD_WRITE_I = 0x4 +) + +const ( + PL_FLAG_BORN = 0x100 + PL_FLAG_EXITED = 0x200 + PL_FLAG_SI = 0x20 +) + +const ( + TRAP_BRKPT = 0x1 + TRAP_TRACE = 0x2 +) + +type PtraceLwpInfoStruct struct { + Lwpid int32 + Event int32 + Flags int32 + Sigmask Sigset_t + Siglist Sigset_t + Siginfo __Siginfo + Tdname [20]int8 + Child_pid int32 + Syscall_code uint32 + Syscall_narg uint32 +} + +type __Siginfo struct { + Signo int32 + Errno int32 + Code int32 + Pid int32 + Uid uint32 + Status int32 + Addr *byte + Value [8]byte + _ [40]byte +} + +type Sigset_t struct { + Val [4]uint32 +} + +type Reg struct { + R15 int64 + R14 int64 + R13 int64 + R12 int64 + R11 int64 + R10 int64 + R9 int64 + R8 int64 + Rdi int64 + Rsi int64 + Rbp int64 + Rbx int64 + Rdx int64 + Rcx int64 + Rax int64 + Trapno uint32 + Fs uint16 + Gs uint16 + Err uint32 + Es uint16 + Ds uint16 + Rip int64 + Cs int64 + Rflags int64 + Rsp int64 + Ss int64 +} + +type FpReg struct { + Env [4]uint64 + Acc [8][16]uint8 + Xacc [16][16]uint8 + Spare [12]uint64 +} + +type PtraceIoDesc struct { + Op int32 + Offs *byte + Addr *byte + Len uint +} + type Kevent_t struct { Ident uint64 Filter int16 diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go index fc713999c..b4090ef31 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm.go @@ -322,11 +322,92 @@ const ( ) const ( - PTRACE_TRACEME = 0x0 - PTRACE_CONT = 0x7 - PTRACE_KILL = 0x8 + PTRACE_ATTACH = 0xa + PTRACE_CONT = 0x7 + PTRACE_DETACH = 0xb + PTRACE_GETFPREGS = 0x23 + PTRACE_GETFSBASE = 0x47 + PTRACE_GETLWPLIST = 0xf + PTRACE_GETNUMLWPS = 0xe + PTRACE_GETREGS = 0x21 + PTRACE_GETXSTATE = 0x45 + PTRACE_IO = 0xc + PTRACE_KILL = 0x8 + PTRACE_LWPEVENTS = 0x18 + PTRACE_LWPINFO = 0xd + PTRACE_SETFPREGS = 0x24 + PTRACE_SETREGS = 0x22 + PTRACE_SINGLESTEP = 0x9 + PTRACE_TRACEME = 0x0 ) +const ( + PIOD_READ_D = 0x1 + PIOD_WRITE_D = 0x2 + PIOD_READ_I = 0x3 + PIOD_WRITE_I = 0x4 +) + +const ( + PL_FLAG_BORN = 0x100 + PL_FLAG_EXITED = 0x200 + PL_FLAG_SI = 0x20 +) + +const ( + TRAP_BRKPT = 0x1 + TRAP_TRACE = 0x2 +) + +type PtraceLwpInfoStruct struct { + Lwpid int32 + Event int32 + Flags int32 + Sigmask Sigset_t + Siglist Sigset_t + Siginfo __Siginfo + Tdname [20]int8 + Child_pid int32 + Syscall_code uint32 + Syscall_narg uint32 +} + +type __Siginfo struct { + Signo int32 + Errno int32 + Code int32 + Pid int32 + Uid uint32 + Status int32 + Addr *byte + Value [4]byte + X_reason [32]byte +} + +type Sigset_t struct { + Val [4]uint32 +} + +type Reg struct { + R [13]uint32 + R_sp uint32 + R_lr uint32 + R_pc uint32 + R_cpsr uint32 +} + +type FpReg struct { + Fpr_fpsr uint32 + Fpr [8][3]uint32 +} + +type PtraceIoDesc struct { + Op int32 + Offs *byte + Addr *byte + Len uint +} + type Kevent_t struct { Ident uint32 Filter int16 diff --git a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go index 5a0753ee4..1542a8773 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_freebsd_arm64.go @@ -322,11 +322,93 @@ const ( ) const ( - PTRACE_TRACEME = 0x0 - PTRACE_CONT = 0x7 - PTRACE_KILL = 0x8 + PTRACE_ATTACH = 0xa + PTRACE_CONT = 0x7 + PTRACE_DETACH = 0xb + PTRACE_GETFPREGS = 0x23 + PTRACE_GETFSBASE = 0x47 + PTRACE_GETLWPLIST = 0xf + PTRACE_GETNUMLWPS = 0xe + PTRACE_GETREGS = 0x21 + PTRACE_GETXSTATE = 0x45 + PTRACE_IO = 0xc + PTRACE_KILL = 0x8 + PTRACE_LWPEVENTS = 0x18 + PTRACE_LWPINFO = 0xd + PTRACE_SETFPREGS = 0x24 + PTRACE_SETREGS = 0x22 + PTRACE_SINGLESTEP = 0x9 + PTRACE_TRACEME = 0x0 ) +const ( + PIOD_READ_D = 0x1 + PIOD_WRITE_D = 0x2 + PIOD_READ_I = 0x3 + PIOD_WRITE_I = 0x4 +) + +const ( + PL_FLAG_BORN = 0x100 + PL_FLAG_EXITED = 0x200 + PL_FLAG_SI = 0x20 +) + +const ( + TRAP_BRKPT = 0x1 + TRAP_TRACE = 0x2 +) + +type PtraceLwpInfoStruct struct { + Lwpid int32 + Event int32 + Flags int32 + Sigmask Sigset_t + Siglist Sigset_t + Siginfo __Siginfo + Tdname [20]int8 + Child_pid int32 + Syscall_code uint32 + Syscall_narg uint32 +} + +type __Siginfo struct { + Signo int32 + Errno int32 + Code int32 + Pid int32 + Uid uint32 + Status int32 + Addr *byte + Value [8]byte + X_reason [40]byte +} + +type Sigset_t struct { + Val [4]uint32 +} + +type Reg struct { + X [30]uint64 + Lr uint64 + Sp uint64 + Elr uint64 + Spsr uint32 +} + +type FpReg struct { + Fp_q [32]uint128 + Fp_sr uint32 + Fp_cr uint32 +} + +type PtraceIoDesc struct { + Op int32 + Offs *byte + Addr *byte + Len uint +} + type Kevent_t struct { Ident uint64 Filter int16 diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go index 06e3a3f4d..50bc4128f 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go @@ -2467,3 +2467,57 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint16 + Inode uint32 + Rdevice uint16 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint32 + Reserved [4]int8 +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go index cef25e732..055eaa76a 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go @@ -2480,3 +2480,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint64 + Inode uint64 + Rdevice uint64 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]int8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go index c4369361e..66019c9cf 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go @@ -2458,3 +2458,57 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint16 + Inode uint32 + Rdevice uint16 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint32 + Reserved [4]uint8 +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go index 76c55e053..3104798c4 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go @@ -2459,3 +2459,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint32 + Inode uint64 + Rdevice uint32 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]int8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go index 4302d574f..46c86021b 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go @@ -2464,3 +2464,57 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint32 + Inode uint32 + Rdevice uint32 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint32 + Reserved [4]int8 +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go index 7ea742be6..c2fe1a62a 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go @@ -2461,3 +2461,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint32 + Inode uint64 + Rdevice uint32 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]int8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go index 8f2b8ad4e..f1eb0d397 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go @@ -2461,3 +2461,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint32 + Inode uint64 + Rdevice uint32 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]int8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go index 865bf57da..8759bc36b 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go @@ -2464,3 +2464,57 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint32 + Inode uint32 + Rdevice uint32 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint32 + Reserved [4]int8 +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go index 2b68027d5..a81200541 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go @@ -2469,3 +2469,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint64 + Inode uint64 + Rdevice uint64 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]uint8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go index 76cd7e643..74b7a9199 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go @@ -2469,3 +2469,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint64 + Inode uint64 + Rdevice uint64 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]uint8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go index f99f06155..ccea3e638 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_riscv64.go @@ -808,6 +808,7 @@ type Ustat_t struct { type EpollEvent struct { Events uint32 + _ int32 Fd int32 Pad int32 } @@ -2486,3 +2487,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint32 + Inode uint64 + Rdevice uint32 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]uint8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go index d9d03ae49..d8fc0bc1c 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go @@ -2483,3 +2483,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint16 + Inode uint64 + Rdevice uint16 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]int8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go index b247fe94b..5e0ab9329 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go @@ -2464,3 +2464,58 @@ const ( BPF_FD_TYPE_UPROBE = 0x4 BPF_FD_TYPE_URETPROBE = 0x5 ) + +type CapUserHeader struct { + Version uint32 + Pid int32 +} + +type CapUserData struct { + Effective uint32 + Permitted uint32 + Inheritable uint32 +} + +const ( + LINUX_CAPABILITY_VERSION_1 = 0x19980330 + LINUX_CAPABILITY_VERSION_2 = 0x20071026 + LINUX_CAPABILITY_VERSION_3 = 0x20080522 +) + +const ( + LO_FLAGS_READ_ONLY = 0x1 + LO_FLAGS_AUTOCLEAR = 0x4 + LO_FLAGS_PARTSCAN = 0x8 + LO_FLAGS_DIRECT_IO = 0x10 +) + +type LoopInfo struct { + Number int32 + Device uint32 + Inode uint64 + Rdevice uint32 + Offset int32 + Encrypt_type int32 + Encrypt_key_size int32 + Flags int32 + Name [64]int8 + Encrypt_key [32]uint8 + Init [2]uint64 + Reserved [4]int8 + _ [4]byte +} +type LoopInfo64 struct { + Device uint64 + Inode uint64 + Rdevice uint64 + Offset uint64 + Sizelimit uint64 + Number uint32 + Encrypt_type uint32 + Encrypt_key_size uint32 + Flags uint32 + File_name [64]uint8 + Crypt_name [64]uint8 + Encrypt_key [32]uint8 + Init [2]uint64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go b/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go index a2268b4f6..86736ab6e 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go @@ -411,6 +411,7 @@ type Ptmget struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x200 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go index 59e1da0a6..3427811f9 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go @@ -418,6 +418,7 @@ type Ptmget struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x200 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go b/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go index 1f1f0f381..399f37a43 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go @@ -416,6 +416,7 @@ type Ptmget struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x200 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm64.go index 8dca204a9..32f0c15d9 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm64.go @@ -418,6 +418,7 @@ type Ptmget struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x200 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_openbsd_386.go b/vendor/golang.org/x/sys/unix/ztypes_openbsd_386.go index 900fb4462..61ea0019a 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_openbsd_386.go @@ -436,6 +436,7 @@ type Winsize struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x4 AT_SYMLINK_NOFOLLOW = 0x2 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go index 028fa78d7..87a493f68 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go @@ -436,6 +436,7 @@ type Winsize struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x4 AT_SYMLINK_NOFOLLOW = 0x2 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm.go b/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm.go index b45d5eedf..d80836efa 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm.go @@ -437,6 +437,7 @@ type Winsize struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x4 AT_SYMLINK_NOFOLLOW = 0x2 ) diff --git a/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm64.go index fa369a32a..4e158746f 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_openbsd_arm64.go @@ -430,6 +430,7 @@ type Winsize struct { const ( AT_FDCWD = -0x64 + AT_SYMLINK_FOLLOW = 0x4 AT_SYMLINK_NOFOLLOW = 0x2 ) diff --git a/vendor/golang.org/x/sys/windows/service.go b/vendor/golang.org/x/sys/windows/service.go index 9a59b42f6..847e00bc9 100644 --- a/vendor/golang.org/x/sys/windows/service.go +++ b/vendor/golang.org/x/sys/windows/service.go @@ -159,6 +159,10 @@ type SERVICE_DESCRIPTION struct { Description *uint16 } +type SERVICE_DELAYED_AUTO_START_INFO struct { + IsDelayedAutoStartUp uint32 +} + type SERVICE_STATUS_PROCESS struct { ServiceType uint32 CurrentState uint32 @@ -200,12 +204,19 @@ type SC_ACTION struct { Delay uint32 } +type QUERY_SERVICE_LOCK_STATUS struct { + IsLocked uint32 + LockOwner *uint16 + LockDuration uint32 +} + //sys CloseServiceHandle(handle Handle) (err error) = advapi32.CloseServiceHandle //sys CreateService(mgr Handle, serviceName *uint16, displayName *uint16, access uint32, srvType uint32, startType uint32, errCtl uint32, pathName *uint16, loadOrderGroup *uint16, tagId *uint32, dependencies *uint16, serviceStartName *uint16, password *uint16) (handle Handle, err error) [failretval==0] = advapi32.CreateServiceW //sys OpenService(mgr Handle, serviceName *uint16, access uint32) (handle Handle, err error) [failretval==0] = advapi32.OpenServiceW //sys DeleteService(service Handle) (err error) = advapi32.DeleteService //sys StartService(service Handle, numArgs uint32, argVectors **uint16) (err error) = advapi32.StartServiceW //sys QueryServiceStatus(service Handle, status *SERVICE_STATUS) (err error) = advapi32.QueryServiceStatus +//sys QueryServiceLockStatus(mgr Handle, lockStatus *QUERY_SERVICE_LOCK_STATUS, bufSize uint32, bytesNeeded *uint32) (err error) = advapi32.QueryServiceLockStatusW //sys ControlService(service Handle, control uint32, status *SERVICE_STATUS) (err error) = advapi32.ControlService //sys StartServiceCtrlDispatcher(serviceTable *SERVICE_TABLE_ENTRY) (err error) = advapi32.StartServiceCtrlDispatcherW //sys SetServiceStatus(service Handle, serviceStatus *SERVICE_STATUS) (err error) = advapi32.SetServiceStatus diff --git a/vendor/golang.org/x/sys/windows/svc/eventlog/install.go b/vendor/golang.org/x/sys/windows/svc/eventlog/install.go deleted file mode 100644 index c76a3760a..000000000 --- a/vendor/golang.org/x/sys/windows/svc/eventlog/install.go +++ /dev/null @@ -1,80 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows - -package eventlog - -import ( - "errors" - - "golang.org/x/sys/windows" - "golang.org/x/sys/windows/registry" -) - -const ( - // Log levels. - Info = windows.EVENTLOG_INFORMATION_TYPE - Warning = windows.EVENTLOG_WARNING_TYPE - Error = windows.EVENTLOG_ERROR_TYPE -) - -const addKeyName = `SYSTEM\CurrentControlSet\Services\EventLog\Application` - -// Install modifies PC registry to allow logging with an event source src. -// It adds all required keys and values to the event log registry key. -// Install uses msgFile as the event message file. If useExpandKey is true, -// the event message file is installed as REG_EXPAND_SZ value, -// otherwise as REG_SZ. Use bitwise of log.Error, log.Warning and -// log.Info to specify events supported by the new event source. -func Install(src, msgFile string, useExpandKey bool, eventsSupported uint32) error { - appkey, err := registry.OpenKey(registry.LOCAL_MACHINE, addKeyName, registry.CREATE_SUB_KEY) - if err != nil { - return err - } - defer appkey.Close() - - sk, alreadyExist, err := registry.CreateKey(appkey, src, registry.SET_VALUE) - if err != nil { - return err - } - defer sk.Close() - if alreadyExist { - return errors.New(addKeyName + `\` + src + " registry key already exists") - } - - err = sk.SetDWordValue("CustomSource", 1) - if err != nil { - return err - } - if useExpandKey { - err = sk.SetExpandStringValue("EventMessageFile", msgFile) - } else { - err = sk.SetStringValue("EventMessageFile", msgFile) - } - if err != nil { - return err - } - err = sk.SetDWordValue("TypesSupported", eventsSupported) - if err != nil { - return err - } - return nil -} - -// InstallAsEventCreate is the same as Install, but uses -// %SystemRoot%\System32\EventCreate.exe as the event message file. -func InstallAsEventCreate(src string, eventsSupported uint32) error { - return Install(src, "%SystemRoot%\\System32\\EventCreate.exe", true, eventsSupported) -} - -// Remove deletes all registry elements installed by the correspondent Install. -func Remove(src string) error { - appkey, err := registry.OpenKey(registry.LOCAL_MACHINE, addKeyName, registry.SET_VALUE) - if err != nil { - return err - } - defer appkey.Close() - return registry.DeleteKey(appkey, src) -} diff --git a/vendor/golang.org/x/sys/windows/svc/eventlog/log.go b/vendor/golang.org/x/sys/windows/svc/eventlog/log.go deleted file mode 100644 index 46e5153d0..000000000 --- a/vendor/golang.org/x/sys/windows/svc/eventlog/log.go +++ /dev/null @@ -1,70 +0,0 @@ -// Copyright 2012 The Go Authors. All rights reserved. -// Use of this source code is governed by a BSD-style -// license that can be found in the LICENSE file. - -// +build windows - -// Package eventlog implements access to Windows event log. -// -package eventlog - -import ( - "errors" - "syscall" - - "golang.org/x/sys/windows" -) - -// Log provides access to the system log. -type Log struct { - Handle windows.Handle -} - -// Open retrieves a handle to the specified event log. -func Open(source string) (*Log, error) { - return OpenRemote("", source) -} - -// OpenRemote does the same as Open, but on different computer host. -func OpenRemote(host, source string) (*Log, error) { - if source == "" { - return nil, errors.New("Specify event log source") - } - var s *uint16 - if host != "" { - s = syscall.StringToUTF16Ptr(host) - } - h, err := windows.RegisterEventSource(s, syscall.StringToUTF16Ptr(source)) - if err != nil { - return nil, err - } - return &Log{Handle: h}, nil -} - -// Close closes event log l. -func (l *Log) Close() error { - return windows.DeregisterEventSource(l.Handle) -} - -func (l *Log) report(etype uint16, eid uint32, msg string) error { - ss := []*uint16{syscall.StringToUTF16Ptr(msg)} - return windows.ReportEvent(l.Handle, etype, 0, eid, 0, 1, 0, &ss[0], nil) -} - -// Info writes an information event msg with event id eid to the end of event log l. -// When EventCreate.exe is used, eid must be between 1 and 1000. -func (l *Log) Info(eid uint32, msg string) error { - return l.report(windows.EVENTLOG_INFORMATION_TYPE, eid, msg) -} - -// Warning writes an warning event msg with event id eid to the end of event log l. -// When EventCreate.exe is used, eid must be between 1 and 1000. -func (l *Log) Warning(eid uint32, msg string) error { - return l.report(windows.EVENTLOG_WARNING_TYPE, eid, msg) -} - -// Error writes an error event msg with event id eid to the end of event log l. -// When EventCreate.exe is used, eid must be between 1 and 1000. -func (l *Log) Error(eid uint32, msg string) error { - return l.report(windows.EVENTLOG_ERROR_TYPE, eid, msg) -} diff --git a/vendor/golang.org/x/sys/windows/svc/mgr/config.go b/vendor/golang.org/x/sys/windows/svc/mgr/config.go index d804e31f1..8431edbe7 100644 --- a/vendor/golang.org/x/sys/windows/svc/mgr/config.go +++ b/vendor/golang.org/x/sys/windows/svc/mgr/config.go @@ -42,6 +42,8 @@ type Config struct { DisplayName string Password string Description string + SidType uint32 // one of SERVICE_SID_TYPE, the type of sid to use for the service + DelayedAutoStart bool // the service is started after other auto-start services are started plus a short delay } func toString(p *uint16) string { @@ -94,6 +96,16 @@ func (s *Service) Config() (Config, error) { } p2 := (*windows.SERVICE_DESCRIPTION)(unsafe.Pointer(&b[0])) + b, err = s.queryServiceConfig2(windows.SERVICE_CONFIG_DELAYED_AUTO_START_INFO) + if err != nil { + return Config{}, err + } + p3 := (*windows.SERVICE_DELAYED_AUTO_START_INFO)(unsafe.Pointer(&b[0])) + delayedStart := false + if p3.IsDelayedAutoStartUp != 0 { + delayedStart = true + } + return Config{ ServiceType: p.ServiceType, StartType: p.StartType, @@ -105,6 +117,7 @@ func (s *Service) Config() (Config, error) { ServiceStartName: toString(p.ServiceStartName), DisplayName: toString(p.DisplayName), Description: toString(p2.Description), + DelayedAutoStart: delayedStart, }, nil } @@ -114,6 +127,19 @@ func updateDescription(handle windows.Handle, desc string) error { windows.SERVICE_CONFIG_DESCRIPTION, (*byte)(unsafe.Pointer(&d))) } +func updateSidType(handle windows.Handle, sidType uint32) error { + return windows.ChangeServiceConfig2(handle, windows.SERVICE_CONFIG_SERVICE_SID_INFO, (*byte)(unsafe.Pointer(&sidType))) +} + +func updateStartUp(handle windows.Handle, isDelayed bool) error { + var d windows.SERVICE_DELAYED_AUTO_START_INFO + if isDelayed { + d.IsDelayedAutoStartUp = 1 + } + return windows.ChangeServiceConfig2(handle, + windows.SERVICE_CONFIG_DELAYED_AUTO_START_INFO, (*byte)(unsafe.Pointer(&d))) +} + // UpdateConfig updates service s configuration parameters. func (s *Service) UpdateConfig(c Config) error { err := windows.ChangeServiceConfig(s.Handle, c.ServiceType, c.StartType, @@ -123,6 +149,16 @@ func (s *Service) UpdateConfig(c Config) error { if err != nil { return err } + err = updateSidType(s.Handle, c.SidType) + if err != nil { + return err + } + + err = updateStartUp(s.Handle, c.DelayedAutoStart) + if err != nil { + return err + } + return updateDescription(s.Handle, c.Description) } diff --git a/vendor/golang.org/x/sys/windows/svc/mgr/mgr.go b/vendor/golang.org/x/sys/windows/svc/mgr/mgr.go index 76965b560..8d1cfd8bf 100644 --- a/vendor/golang.org/x/sys/windows/svc/mgr/mgr.go +++ b/vendor/golang.org/x/sys/windows/svc/mgr/mgr.go @@ -13,6 +13,7 @@ package mgr import ( "syscall" + "time" "unicode/utf16" "unsafe" @@ -48,6 +49,36 @@ func (m *Mgr) Disconnect() error { return windows.CloseServiceHandle(m.Handle) } +type LockStatus struct { + IsLocked bool // Whether the SCM has been locked. + Age time.Duration // For how long the SCM has been locked. + Owner string // The name of the user who has locked the SCM. +} + +// LockStatus returns whether the service control manager is locked by +// the system, for how long, and by whom. A locked SCM indicates that +// most service actions will block until the system unlocks the SCM. +func (m *Mgr) LockStatus() (*LockStatus, error) { + bytesNeeded := uint32(unsafe.Sizeof(windows.QUERY_SERVICE_LOCK_STATUS{}) + 1024) + for { + bytes := make([]byte, bytesNeeded) + lockStatus := (*windows.QUERY_SERVICE_LOCK_STATUS)(unsafe.Pointer(&bytes[0])) + err := windows.QueryServiceLockStatus(m.Handle, lockStatus, uint32(len(bytes)), &bytesNeeded) + if err == windows.ERROR_INSUFFICIENT_BUFFER && bytesNeeded >= uint32(unsafe.Sizeof(windows.QUERY_SERVICE_LOCK_STATUS{})) { + continue + } + if err != nil { + return nil, err + } + status := &LockStatus{ + IsLocked: lockStatus.IsLocked != 0, + Age: time.Duration(lockStatus.LockDuration) * time.Second, + Owner: windows.UTF16ToString((*[(1 << 30) - 1]uint16)(unsafe.Pointer(lockStatus.LockOwner))[:]), + } + return status, nil + } +} + func toPtr(s string) *uint16 { if len(s) == 0 { return nil @@ -102,9 +133,27 @@ func (m *Mgr) CreateService(name, exepath string, c Config, args ...string) (*Se if err != nil { return nil, err } + if c.SidType != windows.SERVICE_SID_TYPE_NONE { + err = updateSidType(h, c.SidType) + if err != nil { + windows.DeleteService(h) + windows.CloseHandle(h) + return nil, err + } + } if c.Description != "" { err = updateDescription(h, c.Description) if err != nil { + windows.DeleteService(h) + windows.CloseHandle(h) + return nil, err + } + } + if c.DelayedAutoStart { + err = updateStartUp(h, c.DelayedAutoStart) + if err != nil { + windows.DeleteService(h) + windows.CloseHandle(h) return nil, err } } diff --git a/vendor/golang.org/x/sys/windows/syscall_windows.go b/vendor/golang.org/x/sys/windows/syscall_windows.go index c698da330..452d44126 100644 --- a/vendor/golang.org/x/sys/windows/syscall_windows.go +++ b/vendor/golang.org/x/sys/windows/syscall_windows.go @@ -10,6 +10,7 @@ import ( errorspkg "errors" "sync" "syscall" + "time" "unicode/utf16" "unsafe" ) @@ -171,8 +172,9 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys CancelIo(s Handle) (err error) //sys CancelIoEx(s Handle, o *Overlapped) (err error) //sys CreateProcess(appName *uint16, commandLine *uint16, procSecurity *SecurityAttributes, threadSecurity *SecurityAttributes, inheritHandles bool, creationFlags uint32, env *uint16, currentDir *uint16, startupInfo *StartupInfo, outProcInfo *ProcessInformation) (err error) = CreateProcessW -//sys OpenProcess(da uint32, inheritHandle bool, pid uint32) (handle Handle, err error) +//sys OpenProcess(desiredAccess uint32, inheritHandle bool, processId uint32) (handle Handle, err error) //sys ShellExecute(hwnd Handle, verb *uint16, file *uint16, args *uint16, cwd *uint16, showCmd int32) (err error) = shell32.ShellExecuteW +//sys shGetKnownFolderPath(id *KNOWNFOLDERID, flags uint32, token Token, path **uint16) (ret error) = shell32.SHGetKnownFolderPath //sys TerminateProcess(handle Handle, exitcode uint32) (err error) //sys GetExitCodeProcess(handle Handle, exitcode *uint32) (err error) //sys GetStartupInfo(startupInfo *StartupInfo) (err error) = GetStartupInfoW @@ -194,6 +196,7 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys SetEnvironmentVariable(name *uint16, value *uint16) (err error) = kernel32.SetEnvironmentVariableW //sys CreateEnvironmentBlock(block **uint16, token Token, inheritExisting bool) (err error) = userenv.CreateEnvironmentBlock //sys DestroyEnvironmentBlock(block *uint16) (err error) = userenv.DestroyEnvironmentBlock +//sys getTickCount64() (ms uint64) = kernel32.GetTickCount64 //sys SetFileTime(handle Handle, ctime *Filetime, atime *Filetime, wtime *Filetime) (err error) //sys GetFileAttributes(name *uint16) (attrs uint32, err error) [failretval==INVALID_FILE_ATTRIBUTES] = kernel32.GetFileAttributesW //sys SetFileAttributes(name *uint16, attrs uint32) (err error) = kernel32.SetFileAttributesW @@ -232,7 +235,7 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys RegQueryInfoKey(key Handle, class *uint16, classLen *uint32, reserved *uint32, subkeysLen *uint32, maxSubkeyLen *uint32, maxClassLen *uint32, valuesLen *uint32, maxValueNameLen *uint32, maxValueLen *uint32, saLen *uint32, lastWriteTime *Filetime) (regerrno error) = advapi32.RegQueryInfoKeyW //sys RegEnumKeyEx(key Handle, index uint32, name *uint16, nameLen *uint32, reserved *uint32, class *uint16, classLen *uint32, lastWriteTime *Filetime) (regerrno error) = advapi32.RegEnumKeyExW //sys RegQueryValueEx(key Handle, name *uint16, reserved *uint32, valtype *uint32, buf *byte, buflen *uint32) (regerrno error) = advapi32.RegQueryValueExW -//sys getCurrentProcessId() (pid uint32) = kernel32.GetCurrentProcessId +//sys GetCurrentProcessId() (pid uint32) = kernel32.GetCurrentProcessId //sys GetConsoleMode(console Handle, mode *uint32) (err error) = kernel32.GetConsoleMode //sys SetConsoleMode(console Handle, mode uint32) (err error) = kernel32.SetConsoleMode //sys GetConsoleScreenBufferInfo(console Handle, info *ConsoleScreenBufferInfo) (err error) = kernel32.GetConsoleScreenBufferInfo @@ -241,6 +244,8 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys CreateToolhelp32Snapshot(flags uint32, processId uint32) (handle Handle, err error) [failretval==InvalidHandle] = kernel32.CreateToolhelp32Snapshot //sys Process32First(snapshot Handle, procEntry *ProcessEntry32) (err error) = kernel32.Process32FirstW //sys Process32Next(snapshot Handle, procEntry *ProcessEntry32) (err error) = kernel32.Process32NextW +//sys Thread32First(snapshot Handle, threadEntry *ThreadEntry32) (err error) +//sys Thread32Next(snapshot Handle, threadEntry *ThreadEntry32) (err error) //sys DeviceIoControl(handle Handle, ioControlCode uint32, inBuffer *byte, inBufferSize uint32, outBuffer *byte, outBufferSize uint32, bytesReturned *uint32, overlapped *Overlapped) (err error) // This function returns 1 byte BOOLEAN rather than the 4 byte BOOL. //sys CreateSymbolicLink(symlinkfilename *uint16, targetfilename *uint16, flags uint32) (err error) [failretval&0xff==0] = CreateSymbolicLinkW @@ -262,6 +267,8 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys GetPriorityClass(process Handle) (ret uint32, err error) = kernel32.GetPriorityClass //sys SetInformationJobObject(job Handle, JobObjectInformationClass uint32, JobObjectInformation uintptr, JobObjectInformationLength uint32) (ret int, err error) //sys GenerateConsoleCtrlEvent(ctrlEvent uint32, processGroupID uint32) (err error) +//sys GetProcessId(process Handle) (id uint32, err error) +//sys OpenThread(desiredAccess uint32, inheritHandle bool, threadId uint32) (handle Handle, err error) // Volume Management Functions //sys DefineDosDevice(flags uint32, deviceName *uint16, targetPath *uint16) (err error) = DefineDosDeviceW @@ -284,6 +291,12 @@ func NewCallbackCDecl(fn interface{}) uintptr { //sys SetVolumeLabel(rootPathName *uint16, volumeName *uint16) (err error) = SetVolumeLabelW //sys SetVolumeMountPoint(volumeMountPoint *uint16, volumeName *uint16) (err error) = SetVolumeMountPointW //sys MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret int32, err error) [failretval==0] = user32.MessageBoxW +//sys clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) = ole32.CLSIDFromString +//sys stringFromGUID2(rguid *GUID, lpsz *uint16, cchMax int32) (chars int32) = ole32.StringFromGUID2 +//sys coCreateGuid(pguid *GUID) (ret error) = ole32.CoCreateGuid +//sys CoTaskMemFree(address unsafe.Pointer) = ole32.CoTaskMemFree +//sys rtlGetVersion(info *OsVersionInfoEx) (ret error) = ntdll.RtlGetVersion +//sys rtlGetNtVersionNumbers(majorVersion *uint32, minorVersion *uint32, buildNumber *uint32) = ntdll.RtlGetNtVersionNumbers // syscall interface implementation for other packages @@ -498,6 +511,10 @@ func ComputerName() (name string, err error) { return string(utf16.Decode(b[0:n])), nil } +func DurationSinceBoot() time.Duration { + return time.Duration(getTickCount64()) * time.Millisecond +} + func Ftruncate(fd Handle, length int64) (err error) { curoffset, e := Seek(fd, 0, 1) if e != nil { @@ -1107,7 +1124,7 @@ func SetsockoptIPv6Mreq(fd Handle, level, opt int, mreq *IPv6Mreq) (err error) { return syscall.EWINDOWS } -func Getpid() (pid int) { return int(getCurrentProcessId()) } +func Getpid() (pid int) { return int(GetCurrentProcessId()) } func FindFirstFile(name *uint16, data *Win32finddata) (handle Handle, err error) { // NOTE(rsc): The Win32finddata struct is wrong for the system call: @@ -1235,3 +1252,78 @@ func Readlink(path string, buf []byte) (n int, err error) { return n, nil } + +// GUIDFromString parses a string in the form of +// "{XXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX}" into a GUID. +func GUIDFromString(str string) (GUID, error) { + guid := GUID{} + str16, err := syscall.UTF16PtrFromString(str) + if err != nil { + return guid, err + } + err = clsidFromString(str16, &guid) + if err != nil { + return guid, err + } + return guid, nil +} + +// GenerateGUID creates a new random GUID. +func GenerateGUID() (GUID, error) { + guid := GUID{} + err := coCreateGuid(&guid) + if err != nil { + return guid, err + } + return guid, nil +} + +// String returns the canonical string form of the GUID, +// in the form of "{XXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX}". +func (guid GUID) String() string { + var str [100]uint16 + chars := stringFromGUID2(&guid, &str[0], int32(len(str))) + if chars <= 1 { + return "" + } + return string(utf16.Decode(str[:chars-1])) +} + +// KnownFolderPath returns a well-known folder path for the current user, specified by one of +// the FOLDERID_ constants, and chosen and optionally created based on a KF_ flag. +func KnownFolderPath(folderID *KNOWNFOLDERID, flags uint32) (string, error) { + return Token(0).KnownFolderPath(folderID, flags) +} + +// KnownFolderPath returns a well-known folder path for the user token, specified by one of +// the FOLDERID_ constants, and chosen and optionally created based on a KF_ flag. +func (t Token) KnownFolderPath(folderID *KNOWNFOLDERID, flags uint32) (string, error) { + var p *uint16 + err := shGetKnownFolderPath(folderID, flags, t, &p) + if err != nil { + return "", err + } + defer CoTaskMemFree(unsafe.Pointer(p)) + return UTF16ToString((*[(1 << 30) - 1]uint16)(unsafe.Pointer(p))[:]), nil +} + +// RtlGetVersion returns the version of the underlying operating system, ignoring +// manifest semantics but is affected by the application compatibility layer. +func RtlGetVersion() *OsVersionInfoEx { + info := &OsVersionInfoEx{} + info.osVersionInfoSize = uint32(unsafe.Sizeof(*info)) + // According to documentation, this function always succeeds. + // The function doesn't even check the validity of the + // osVersionInfoSize member. Disassembling ntdll.dll indicates + // that the documentation is indeed correct about that. + _ = rtlGetVersion(info) + return info +} + +// RtlGetNtVersionNumbers returns the version of the underlying operating system, +// ignoring manifest semantics and the application compatibility layer. +func RtlGetNtVersionNumbers() (majorVersion, minorVersion, buildNumber uint32) { + rtlGetNtVersionNumbers(&majorVersion, &minorVersion, &buildNumber) + buildNumber &= 0xffff + return +} diff --git a/vendor/golang.org/x/sys/windows/types_windows.go b/vendor/golang.org/x/sys/windows/types_windows.go index 99b85f6dd..1e3947f0f 100644 --- a/vendor/golang.org/x/sys/windows/types_windows.go +++ b/vendor/golang.org/x/sys/windows/types_windows.go @@ -158,17 +158,50 @@ const ( WAIT_OBJECT_0 = 0x00000000 WAIT_FAILED = 0xFFFFFFFF - PROCESS_TERMINATE = 1 - PROCESS_QUERY_INFORMATION = 0x00000400 - SYNCHRONIZE = 0x00100000 + // Standard access rights. + DELETE = 0x00010000 + READ_CONTROL = 0x00020000 + SYNCHRONIZE = 0x00100000 + WRITE_DAC = 0x00040000 + WRITE_OWNER = 0x00080000 + + // Access rights for process. + PROCESS_CREATE_PROCESS = 0x0080 + PROCESS_CREATE_THREAD = 0x0002 + PROCESS_DUP_HANDLE = 0x0040 + PROCESS_QUERY_INFORMATION = 0x0400 + PROCESS_QUERY_LIMITED_INFORMATION = 0x1000 + PROCESS_SET_INFORMATION = 0x0200 + PROCESS_SET_QUOTA = 0x0100 + PROCESS_SUSPEND_RESUME = 0x0800 + PROCESS_TERMINATE = 0x0001 + PROCESS_VM_OPERATION = 0x0008 + PROCESS_VM_READ = 0x0010 + PROCESS_VM_WRITE = 0x0020 + + // Access rights for thread. + THREAD_DIRECT_IMPERSONATION = 0x0200 + THREAD_GET_CONTEXT = 0x0008 + THREAD_IMPERSONATE = 0x0100 + THREAD_QUERY_INFORMATION = 0x0040 + THREAD_QUERY_LIMITED_INFORMATION = 0x0800 + THREAD_SET_CONTEXT = 0x0010 + THREAD_SET_INFORMATION = 0x0020 + THREAD_SET_LIMITED_INFORMATION = 0x0400 + THREAD_SET_THREAD_TOKEN = 0x0080 + THREAD_SUSPEND_RESUME = 0x0002 + THREAD_TERMINATE = 0x0001 FILE_MAP_COPY = 0x01 FILE_MAP_WRITE = 0x02 FILE_MAP_READ = 0x04 FILE_MAP_EXECUTE = 0x20 - CTRL_C_EVENT = 0 - CTRL_BREAK_EVENT = 1 + CTRL_C_EVENT = 0 + CTRL_BREAK_EVENT = 1 + CTRL_CLOSE_EVENT = 2 + CTRL_LOGOFF_EVENT = 5 + CTRL_SHUTDOWN_EVENT = 6 // Windows reserves errors >= 1<<29 for application use. APPLICATION_ERROR = 1 << 29 @@ -629,6 +662,16 @@ type ProcessEntry32 struct { ExeFile [MAX_PATH]uint16 } +type ThreadEntry32 struct { + Size uint32 + Usage uint32 + ThreadID uint32 + OwnerProcessID uint32 + BasePri int32 + DeltaPri int32 + Flags uint32 +} + type Systemtime struct { Year uint16 Month uint16 @@ -1590,3 +1633,36 @@ const ( JobObjectNotificationLimitInformation2 = 34 JobObjectSecurityLimitInformation = 5 ) + +const ( + KF_FLAG_DEFAULT = 0x00000000 + KF_FLAG_FORCE_APP_DATA_REDIRECTION = 0x00080000 + KF_FLAG_RETURN_FILTER_REDIRECTION_TARGET = 0x00040000 + KF_FLAG_FORCE_PACKAGE_REDIRECTION = 0x00020000 + KF_FLAG_NO_PACKAGE_REDIRECTION = 0x00010000 + KF_FLAG_FORCE_APPCONTAINER_REDIRECTION = 0x00020000 + KF_FLAG_NO_APPCONTAINER_REDIRECTION = 0x00010000 + KF_FLAG_CREATE = 0x00008000 + KF_FLAG_DONT_VERIFY = 0x00004000 + KF_FLAG_DONT_UNEXPAND = 0x00002000 + KF_FLAG_NO_ALIAS = 0x00001000 + KF_FLAG_INIT = 0x00000800 + KF_FLAG_DEFAULT_PATH = 0x00000400 + KF_FLAG_NOT_PARENT_RELATIVE = 0x00000200 + KF_FLAG_SIMPLE_IDLIST = 0x00000100 + KF_FLAG_ALIAS_ONLY = 0x80000000 +) + +type OsVersionInfoEx struct { + osVersionInfoSize uint32 + MajorVersion uint32 + MinorVersion uint32 + BuildNumber uint32 + PlatformId uint32 + CsdVersion [128]uint16 + ServicePackMajor uint16 + ServicePackMinor uint16 + SuiteMask uint16 + ProductType byte + _ byte +} diff --git a/vendor/golang.org/x/sys/windows/zerrors_windows.go b/vendor/golang.org/x/sys/windows/zerrors_windows.go index 2b4cea5b9..f02120035 100644 --- a/vendor/golang.org/x/sys/windows/zerrors_windows.go +++ b/vendor/golang.org/x/sys/windows/zerrors_windows.go @@ -1,4 +1,4 @@ -// Code generated by 'go generate'; DO NOT EDIT. +// Code generated by 'mkerrors.bash'; DO NOT EDIT. package windows diff --git a/vendor/golang.org/x/sys/windows/zknownfolderids_windows.go b/vendor/golang.org/x/sys/windows/zknownfolderids_windows.go new file mode 100644 index 000000000..6048ac679 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/zknownfolderids_windows.go @@ -0,0 +1,149 @@ +// Code generated by 'mkknownfolderids.bash'; DO NOT EDIT. + +package windows + +type KNOWNFOLDERID GUID + +var ( + FOLDERID_NetworkFolder = &KNOWNFOLDERID{0xd20beec4, 0x5ca8, 0x4905, [8]byte{0xae, 0x3b, 0xbf, 0x25, 0x1e, 0xa0, 0x9b, 0x53}} + FOLDERID_ComputerFolder = &KNOWNFOLDERID{0x0ac0837c, 0xbbf8, 0x452a, [8]byte{0x85, 0x0d, 0x79, 0xd0, 0x8e, 0x66, 0x7c, 0xa7}} + FOLDERID_InternetFolder = &KNOWNFOLDERID{0x4d9f7874, 0x4e0c, 0x4904, [8]byte{0x96, 0x7b, 0x40, 0xb0, 0xd2, 0x0c, 0x3e, 0x4b}} + FOLDERID_ControlPanelFolder = &KNOWNFOLDERID{0x82a74aeb, 0xaeb4, 0x465c, [8]byte{0xa0, 0x14, 0xd0, 0x97, 0xee, 0x34, 0x6d, 0x63}} + FOLDERID_PrintersFolder = &KNOWNFOLDERID{0x76fc4e2d, 0xd6ad, 0x4519, [8]byte{0xa6, 0x63, 0x37, 0xbd, 0x56, 0x06, 0x81, 0x85}} + FOLDERID_SyncManagerFolder = &KNOWNFOLDERID{0x43668bf8, 0xc14e, 0x49b2, [8]byte{0x97, 0xc9, 0x74, 0x77, 0x84, 0xd7, 0x84, 0xb7}} + FOLDERID_SyncSetupFolder = &KNOWNFOLDERID{0x0f214138, 0xb1d3, 0x4a90, [8]byte{0xbb, 0xa9, 0x27, 0xcb, 0xc0, 0xc5, 0x38, 0x9a}} + FOLDERID_ConflictFolder = &KNOWNFOLDERID{0x4bfefb45, 0x347d, 0x4006, [8]byte{0xa5, 0xbe, 0xac, 0x0c, 0xb0, 0x56, 0x71, 0x92}} + FOLDERID_SyncResultsFolder = &KNOWNFOLDERID{0x289a9a43, 0xbe44, 0x4057, [8]byte{0xa4, 0x1b, 0x58, 0x7a, 0x76, 0xd7, 0xe7, 0xf9}} + FOLDERID_RecycleBinFolder = &KNOWNFOLDERID{0xb7534046, 0x3ecb, 0x4c18, [8]byte{0xbe, 0x4e, 0x64, 0xcd, 0x4c, 0xb7, 0xd6, 0xac}} + FOLDERID_ConnectionsFolder = &KNOWNFOLDERID{0x6f0cd92b, 0x2e97, 0x45d1, [8]byte{0x88, 0xff, 0xb0, 0xd1, 0x86, 0xb8, 0xde, 0xdd}} + FOLDERID_Fonts = &KNOWNFOLDERID{0xfd228cb7, 0xae11, 0x4ae3, [8]byte{0x86, 0x4c, 0x16, 0xf3, 0x91, 0x0a, 0xb8, 0xfe}} + FOLDERID_Desktop = &KNOWNFOLDERID{0xb4bfcc3a, 0xdb2c, 0x424c, [8]byte{0xb0, 0x29, 0x7f, 0xe9, 0x9a, 0x87, 0xc6, 0x41}} + FOLDERID_Startup = &KNOWNFOLDERID{0xb97d20bb, 0xf46a, 0x4c97, [8]byte{0xba, 0x10, 0x5e, 0x36, 0x08, 0x43, 0x08, 0x54}} + FOLDERID_Programs = &KNOWNFOLDERID{0xa77f5d77, 0x2e2b, 0x44c3, [8]byte{0xa6, 0xa2, 0xab, 0xa6, 0x01, 0x05, 0x4a, 0x51}} + FOLDERID_StartMenu = &KNOWNFOLDERID{0x625b53c3, 0xab48, 0x4ec1, [8]byte{0xba, 0x1f, 0xa1, 0xef, 0x41, 0x46, 0xfc, 0x19}} + FOLDERID_Recent = &KNOWNFOLDERID{0xae50c081, 0xebd2, 0x438a, [8]byte{0x86, 0x55, 0x8a, 0x09, 0x2e, 0x34, 0x98, 0x7a}} + FOLDERID_SendTo = &KNOWNFOLDERID{0x8983036c, 0x27c0, 0x404b, [8]byte{0x8f, 0x08, 0x10, 0x2d, 0x10, 0xdc, 0xfd, 0x74}} + FOLDERID_Documents = &KNOWNFOLDERID{0xfdd39ad0, 0x238f, 0x46af, [8]byte{0xad, 0xb4, 0x6c, 0x85, 0x48, 0x03, 0x69, 0xc7}} + FOLDERID_Favorites = &KNOWNFOLDERID{0x1777f761, 0x68ad, 0x4d8a, [8]byte{0x87, 0xbd, 0x30, 0xb7, 0x59, 0xfa, 0x33, 0xdd}} + FOLDERID_NetHood = &KNOWNFOLDERID{0xc5abbf53, 0xe17f, 0x4121, [8]byte{0x89, 0x00, 0x86, 0x62, 0x6f, 0xc2, 0xc9, 0x73}} + FOLDERID_PrintHood = &KNOWNFOLDERID{0x9274bd8d, 0xcfd1, 0x41c3, [8]byte{0xb3, 0x5e, 0xb1, 0x3f, 0x55, 0xa7, 0x58, 0xf4}} + FOLDERID_Templates = &KNOWNFOLDERID{0xa63293e8, 0x664e, 0x48db, [8]byte{0xa0, 0x79, 0xdf, 0x75, 0x9e, 0x05, 0x09, 0xf7}} + FOLDERID_CommonStartup = &KNOWNFOLDERID{0x82a5ea35, 0xd9cd, 0x47c5, [8]byte{0x96, 0x29, 0xe1, 0x5d, 0x2f, 0x71, 0x4e, 0x6e}} + FOLDERID_CommonPrograms = &KNOWNFOLDERID{0x0139d44e, 0x6afe, 0x49f2, [8]byte{0x86, 0x90, 0x3d, 0xaf, 0xca, 0xe6, 0xff, 0xb8}} + FOLDERID_CommonStartMenu = &KNOWNFOLDERID{0xa4115719, 0xd62e, 0x491d, [8]byte{0xaa, 0x7c, 0xe7, 0x4b, 0x8b, 0xe3, 0xb0, 0x67}} + FOLDERID_PublicDesktop = &KNOWNFOLDERID{0xc4aa340d, 0xf20f, 0x4863, [8]byte{0xaf, 0xef, 0xf8, 0x7e, 0xf2, 0xe6, 0xba, 0x25}} + FOLDERID_ProgramData = &KNOWNFOLDERID{0x62ab5d82, 0xfdc1, 0x4dc3, [8]byte{0xa9, 0xdd, 0x07, 0x0d, 0x1d, 0x49, 0x5d, 0x97}} + FOLDERID_CommonTemplates = &KNOWNFOLDERID{0xb94237e7, 0x57ac, 0x4347, [8]byte{0x91, 0x51, 0xb0, 0x8c, 0x6c, 0x32, 0xd1, 0xf7}} + FOLDERID_PublicDocuments = &KNOWNFOLDERID{0xed4824af, 0xdce4, 0x45a8, [8]byte{0x81, 0xe2, 0xfc, 0x79, 0x65, 0x08, 0x36, 0x34}} + FOLDERID_RoamingAppData = &KNOWNFOLDERID{0x3eb685db, 0x65f9, 0x4cf6, [8]byte{0xa0, 0x3a, 0xe3, 0xef, 0x65, 0x72, 0x9f, 0x3d}} + FOLDERID_LocalAppData = &KNOWNFOLDERID{0xf1b32785, 0x6fba, 0x4fcf, [8]byte{0x9d, 0x55, 0x7b, 0x8e, 0x7f, 0x15, 0x70, 0x91}} + FOLDERID_LocalAppDataLow = &KNOWNFOLDERID{0xa520a1a4, 0x1780, 0x4ff6, [8]byte{0xbd, 0x18, 0x16, 0x73, 0x43, 0xc5, 0xaf, 0x16}} + FOLDERID_InternetCache = &KNOWNFOLDERID{0x352481e8, 0x33be, 0x4251, [8]byte{0xba, 0x85, 0x60, 0x07, 0xca, 0xed, 0xcf, 0x9d}} + FOLDERID_Cookies = &KNOWNFOLDERID{0x2b0f765d, 0xc0e9, 0x4171, [8]byte{0x90, 0x8e, 0x08, 0xa6, 0x11, 0xb8, 0x4f, 0xf6}} + FOLDERID_History = &KNOWNFOLDERID{0xd9dc8a3b, 0xb784, 0x432e, [8]byte{0xa7, 0x81, 0x5a, 0x11, 0x30, 0xa7, 0x59, 0x63}} + FOLDERID_System = &KNOWNFOLDERID{0x1ac14e77, 0x02e7, 0x4e5d, [8]byte{0xb7, 0x44, 0x2e, 0xb1, 0xae, 0x51, 0x98, 0xb7}} + FOLDERID_SystemX86 = &KNOWNFOLDERID{0xd65231b0, 0xb2f1, 0x4857, [8]byte{0xa4, 0xce, 0xa8, 0xe7, 0xc6, 0xea, 0x7d, 0x27}} + FOLDERID_Windows = &KNOWNFOLDERID{0xf38bf404, 0x1d43, 0x42f2, [8]byte{0x93, 0x05, 0x67, 0xde, 0x0b, 0x28, 0xfc, 0x23}} + FOLDERID_Profile = &KNOWNFOLDERID{0x5e6c858f, 0x0e22, 0x4760, [8]byte{0x9a, 0xfe, 0xea, 0x33, 0x17, 0xb6, 0x71, 0x73}} + FOLDERID_Pictures = &KNOWNFOLDERID{0x33e28130, 0x4e1e, 0x4676, [8]byte{0x83, 0x5a, 0x98, 0x39, 0x5c, 0x3b, 0xc3, 0xbb}} + FOLDERID_ProgramFilesX86 = &KNOWNFOLDERID{0x7c5a40ef, 0xa0fb, 0x4bfc, [8]byte{0x87, 0x4a, 0xc0, 0xf2, 0xe0, 0xb9, 0xfa, 0x8e}} + FOLDERID_ProgramFilesCommonX86 = &KNOWNFOLDERID{0xde974d24, 0xd9c6, 0x4d3e, [8]byte{0xbf, 0x91, 0xf4, 0x45, 0x51, 0x20, 0xb9, 0x17}} + FOLDERID_ProgramFilesX64 = &KNOWNFOLDERID{0x6d809377, 0x6af0, 0x444b, [8]byte{0x89, 0x57, 0xa3, 0x77, 0x3f, 0x02, 0x20, 0x0e}} + FOLDERID_ProgramFilesCommonX64 = &KNOWNFOLDERID{0x6365d5a7, 0x0f0d, 0x45e5, [8]byte{0x87, 0xf6, 0x0d, 0xa5, 0x6b, 0x6a, 0x4f, 0x7d}} + FOLDERID_ProgramFiles = &KNOWNFOLDERID{0x905e63b6, 0xc1bf, 0x494e, [8]byte{0xb2, 0x9c, 0x65, 0xb7, 0x32, 0xd3, 0xd2, 0x1a}} + FOLDERID_ProgramFilesCommon = &KNOWNFOLDERID{0xf7f1ed05, 0x9f6d, 0x47a2, [8]byte{0xaa, 0xae, 0x29, 0xd3, 0x17, 0xc6, 0xf0, 0x66}} + FOLDERID_UserProgramFiles = &KNOWNFOLDERID{0x5cd7aee2, 0x2219, 0x4a67, [8]byte{0xb8, 0x5d, 0x6c, 0x9c, 0xe1, 0x56, 0x60, 0xcb}} + FOLDERID_UserProgramFilesCommon = &KNOWNFOLDERID{0xbcbd3057, 0xca5c, 0x4622, [8]byte{0xb4, 0x2d, 0xbc, 0x56, 0xdb, 0x0a, 0xe5, 0x16}} + FOLDERID_AdminTools = &KNOWNFOLDERID{0x724ef170, 0xa42d, 0x4fef, [8]byte{0x9f, 0x26, 0xb6, 0x0e, 0x84, 0x6f, 0xba, 0x4f}} + FOLDERID_CommonAdminTools = &KNOWNFOLDERID{0xd0384e7d, 0xbac3, 0x4797, [8]byte{0x8f, 0x14, 0xcb, 0xa2, 0x29, 0xb3, 0x92, 0xb5}} + FOLDERID_Music = &KNOWNFOLDERID{0x4bd8d571, 0x6d19, 0x48d3, [8]byte{0xbe, 0x97, 0x42, 0x22, 0x20, 0x08, 0x0e, 0x43}} + FOLDERID_Videos = &KNOWNFOLDERID{0x18989b1d, 0x99b5, 0x455b, [8]byte{0x84, 0x1c, 0xab, 0x7c, 0x74, 0xe4, 0xdd, 0xfc}} + FOLDERID_Ringtones = &KNOWNFOLDERID{0xc870044b, 0xf49e, 0x4126, [8]byte{0xa9, 0xc3, 0xb5, 0x2a, 0x1f, 0xf4, 0x11, 0xe8}} + FOLDERID_PublicPictures = &KNOWNFOLDERID{0xb6ebfb86, 0x6907, 0x413c, [8]byte{0x9a, 0xf7, 0x4f, 0xc2, 0xab, 0xf0, 0x7c, 0xc5}} + FOLDERID_PublicMusic = &KNOWNFOLDERID{0x3214fab5, 0x9757, 0x4298, [8]byte{0xbb, 0x61, 0x92, 0xa9, 0xde, 0xaa, 0x44, 0xff}} + FOLDERID_PublicVideos = &KNOWNFOLDERID{0x2400183a, 0x6185, 0x49fb, [8]byte{0xa2, 0xd8, 0x4a, 0x39, 0x2a, 0x60, 0x2b, 0xa3}} + FOLDERID_PublicRingtones = &KNOWNFOLDERID{0xe555ab60, 0x153b, 0x4d17, [8]byte{0x9f, 0x04, 0xa5, 0xfe, 0x99, 0xfc, 0x15, 0xec}} + FOLDERID_ResourceDir = &KNOWNFOLDERID{0x8ad10c31, 0x2adb, 0x4296, [8]byte{0xa8, 0xf7, 0xe4, 0x70, 0x12, 0x32, 0xc9, 0x72}} + FOLDERID_LocalizedResourcesDir = &KNOWNFOLDERID{0x2a00375e, 0x224c, 0x49de, [8]byte{0xb8, 0xd1, 0x44, 0x0d, 0xf7, 0xef, 0x3d, 0xdc}} + FOLDERID_CommonOEMLinks = &KNOWNFOLDERID{0xc1bae2d0, 0x10df, 0x4334, [8]byte{0xbe, 0xdd, 0x7a, 0xa2, 0x0b, 0x22, 0x7a, 0x9d}} + FOLDERID_CDBurning = &KNOWNFOLDERID{0x9e52ab10, 0xf80d, 0x49df, [8]byte{0xac, 0xb8, 0x43, 0x30, 0xf5, 0x68, 0x78, 0x55}} + FOLDERID_UserProfiles = &KNOWNFOLDERID{0x0762d272, 0xc50a, 0x4bb0, [8]byte{0xa3, 0x82, 0x69, 0x7d, 0xcd, 0x72, 0x9b, 0x80}} + FOLDERID_Playlists = &KNOWNFOLDERID{0xde92c1c7, 0x837f, 0x4f69, [8]byte{0xa3, 0xbb, 0x86, 0xe6, 0x31, 0x20, 0x4a, 0x23}} + FOLDERID_SamplePlaylists = &KNOWNFOLDERID{0x15ca69b3, 0x30ee, 0x49c1, [8]byte{0xac, 0xe1, 0x6b, 0x5e, 0xc3, 0x72, 0xaf, 0xb5}} + FOLDERID_SampleMusic = &KNOWNFOLDERID{0xb250c668, 0xf57d, 0x4ee1, [8]byte{0xa6, 0x3c, 0x29, 0x0e, 0xe7, 0xd1, 0xaa, 0x1f}} + FOLDERID_SamplePictures = &KNOWNFOLDERID{0xc4900540, 0x2379, 0x4c75, [8]byte{0x84, 0x4b, 0x64, 0xe6, 0xfa, 0xf8, 0x71, 0x6b}} + FOLDERID_SampleVideos = &KNOWNFOLDERID{0x859ead94, 0x2e85, 0x48ad, [8]byte{0xa7, 0x1a, 0x09, 0x69, 0xcb, 0x56, 0xa6, 0xcd}} + FOLDERID_PhotoAlbums = &KNOWNFOLDERID{0x69d2cf90, 0xfc33, 0x4fb7, [8]byte{0x9a, 0x0c, 0xeb, 0xb0, 0xf0, 0xfc, 0xb4, 0x3c}} + FOLDERID_Public = &KNOWNFOLDERID{0xdfdf76a2, 0xc82a, 0x4d63, [8]byte{0x90, 0x6a, 0x56, 0x44, 0xac, 0x45, 0x73, 0x85}} + FOLDERID_ChangeRemovePrograms = &KNOWNFOLDERID{0xdf7266ac, 0x9274, 0x4867, [8]byte{0x8d, 0x55, 0x3b, 0xd6, 0x61, 0xde, 0x87, 0x2d}} + FOLDERID_AppUpdates = &KNOWNFOLDERID{0xa305ce99, 0xf527, 0x492b, [8]byte{0x8b, 0x1a, 0x7e, 0x76, 0xfa, 0x98, 0xd6, 0xe4}} + FOLDERID_AddNewPrograms = &KNOWNFOLDERID{0xde61d971, 0x5ebc, 0x4f02, [8]byte{0xa3, 0xa9, 0x6c, 0x82, 0x89, 0x5e, 0x5c, 0x04}} + FOLDERID_Downloads = &KNOWNFOLDERID{0x374de290, 0x123f, 0x4565, [8]byte{0x91, 0x64, 0x39, 0xc4, 0x92, 0x5e, 0x46, 0x7b}} + FOLDERID_PublicDownloads = &KNOWNFOLDERID{0x3d644c9b, 0x1fb8, 0x4f30, [8]byte{0x9b, 0x45, 0xf6, 0x70, 0x23, 0x5f, 0x79, 0xc0}} + FOLDERID_SavedSearches = &KNOWNFOLDERID{0x7d1d3a04, 0xdebb, 0x4115, [8]byte{0x95, 0xcf, 0x2f, 0x29, 0xda, 0x29, 0x20, 0xda}} + FOLDERID_QuickLaunch = &KNOWNFOLDERID{0x52a4f021, 0x7b75, 0x48a9, [8]byte{0x9f, 0x6b, 0x4b, 0x87, 0xa2, 0x10, 0xbc, 0x8f}} + FOLDERID_Contacts = &KNOWNFOLDERID{0x56784854, 0xc6cb, 0x462b, [8]byte{0x81, 0x69, 0x88, 0xe3, 0x50, 0xac, 0xb8, 0x82}} + FOLDERID_SidebarParts = &KNOWNFOLDERID{0xa75d362e, 0x50fc, 0x4fb7, [8]byte{0xac, 0x2c, 0xa8, 0xbe, 0xaa, 0x31, 0x44, 0x93}} + FOLDERID_SidebarDefaultParts = &KNOWNFOLDERID{0x7b396e54, 0x9ec5, 0x4300, [8]byte{0xbe, 0x0a, 0x24, 0x82, 0xeb, 0xae, 0x1a, 0x26}} + FOLDERID_PublicGameTasks = &KNOWNFOLDERID{0xdebf2536, 0xe1a8, 0x4c59, [8]byte{0xb6, 0xa2, 0x41, 0x45, 0x86, 0x47, 0x6a, 0xea}} + FOLDERID_GameTasks = &KNOWNFOLDERID{0x054fae61, 0x4dd8, 0x4787, [8]byte{0x80, 0xb6, 0x09, 0x02, 0x20, 0xc4, 0xb7, 0x00}} + FOLDERID_SavedGames = &KNOWNFOLDERID{0x4c5c32ff, 0xbb9d, 0x43b0, [8]byte{0xb5, 0xb4, 0x2d, 0x72, 0xe5, 0x4e, 0xaa, 0xa4}} + FOLDERID_Games = &KNOWNFOLDERID{0xcac52c1a, 0xb53d, 0x4edc, [8]byte{0x92, 0xd7, 0x6b, 0x2e, 0x8a, 0xc1, 0x94, 0x34}} + FOLDERID_SEARCH_MAPI = &KNOWNFOLDERID{0x98ec0e18, 0x2098, 0x4d44, [8]byte{0x86, 0x44, 0x66, 0x97, 0x93, 0x15, 0xa2, 0x81}} + FOLDERID_SEARCH_CSC = &KNOWNFOLDERID{0xee32e446, 0x31ca, 0x4aba, [8]byte{0x81, 0x4f, 0xa5, 0xeb, 0xd2, 0xfd, 0x6d, 0x5e}} + FOLDERID_Links = &KNOWNFOLDERID{0xbfb9d5e0, 0xc6a9, 0x404c, [8]byte{0xb2, 0xb2, 0xae, 0x6d, 0xb6, 0xaf, 0x49, 0x68}} + FOLDERID_UsersFiles = &KNOWNFOLDERID{0xf3ce0f7c, 0x4901, 0x4acc, [8]byte{0x86, 0x48, 0xd5, 0xd4, 0x4b, 0x04, 0xef, 0x8f}} + FOLDERID_UsersLibraries = &KNOWNFOLDERID{0xa302545d, 0xdeff, 0x464b, [8]byte{0xab, 0xe8, 0x61, 0xc8, 0x64, 0x8d, 0x93, 0x9b}} + FOLDERID_SearchHome = &KNOWNFOLDERID{0x190337d1, 0xb8ca, 0x4121, [8]byte{0xa6, 0x39, 0x6d, 0x47, 0x2d, 0x16, 0x97, 0x2a}} + FOLDERID_OriginalImages = &KNOWNFOLDERID{0x2c36c0aa, 0x5812, 0x4b87, [8]byte{0xbf, 0xd0, 0x4c, 0xd0, 0xdf, 0xb1, 0x9b, 0x39}} + FOLDERID_DocumentsLibrary = &KNOWNFOLDERID{0x7b0db17d, 0x9cd2, 0x4a93, [8]byte{0x97, 0x33, 0x46, 0xcc, 0x89, 0x02, 0x2e, 0x7c}} + FOLDERID_MusicLibrary = &KNOWNFOLDERID{0x2112ab0a, 0xc86a, 0x4ffe, [8]byte{0xa3, 0x68, 0x0d, 0xe9, 0x6e, 0x47, 0x01, 0x2e}} + FOLDERID_PicturesLibrary = &KNOWNFOLDERID{0xa990ae9f, 0xa03b, 0x4e80, [8]byte{0x94, 0xbc, 0x99, 0x12, 0xd7, 0x50, 0x41, 0x04}} + FOLDERID_VideosLibrary = &KNOWNFOLDERID{0x491e922f, 0x5643, 0x4af4, [8]byte{0xa7, 0xeb, 0x4e, 0x7a, 0x13, 0x8d, 0x81, 0x74}} + FOLDERID_RecordedTVLibrary = &KNOWNFOLDERID{0x1a6fdba2, 0xf42d, 0x4358, [8]byte{0xa7, 0x98, 0xb7, 0x4d, 0x74, 0x59, 0x26, 0xc5}} + FOLDERID_HomeGroup = &KNOWNFOLDERID{0x52528a6b, 0xb9e3, 0x4add, [8]byte{0xb6, 0x0d, 0x58, 0x8c, 0x2d, 0xba, 0x84, 0x2d}} + FOLDERID_HomeGroupCurrentUser = &KNOWNFOLDERID{0x9b74b6a3, 0x0dfd, 0x4f11, [8]byte{0x9e, 0x78, 0x5f, 0x78, 0x00, 0xf2, 0xe7, 0x72}} + FOLDERID_DeviceMetadataStore = &KNOWNFOLDERID{0x5ce4a5e9, 0xe4eb, 0x479d, [8]byte{0xb8, 0x9f, 0x13, 0x0c, 0x02, 0x88, 0x61, 0x55}} + FOLDERID_Libraries = &KNOWNFOLDERID{0x1b3ea5dc, 0xb587, 0x4786, [8]byte{0xb4, 0xef, 0xbd, 0x1d, 0xc3, 0x32, 0xae, 0xae}} + FOLDERID_PublicLibraries = &KNOWNFOLDERID{0x48daf80b, 0xe6cf, 0x4f4e, [8]byte{0xb8, 0x00, 0x0e, 0x69, 0xd8, 0x4e, 0xe3, 0x84}} + FOLDERID_UserPinned = &KNOWNFOLDERID{0x9e3995ab, 0x1f9c, 0x4f13, [8]byte{0xb8, 0x27, 0x48, 0xb2, 0x4b, 0x6c, 0x71, 0x74}} + FOLDERID_ImplicitAppShortcuts = &KNOWNFOLDERID{0xbcb5256f, 0x79f6, 0x4cee, [8]byte{0xb7, 0x25, 0xdc, 0x34, 0xe4, 0x02, 0xfd, 0x46}} + FOLDERID_AccountPictures = &KNOWNFOLDERID{0x008ca0b1, 0x55b4, 0x4c56, [8]byte{0xb8, 0xa8, 0x4d, 0xe4, 0xb2, 0x99, 0xd3, 0xbe}} + FOLDERID_PublicUserTiles = &KNOWNFOLDERID{0x0482af6c, 0x08f1, 0x4c34, [8]byte{0x8c, 0x90, 0xe1, 0x7e, 0xc9, 0x8b, 0x1e, 0x17}} + FOLDERID_AppsFolder = &KNOWNFOLDERID{0x1e87508d, 0x89c2, 0x42f0, [8]byte{0x8a, 0x7e, 0x64, 0x5a, 0x0f, 0x50, 0xca, 0x58}} + FOLDERID_StartMenuAllPrograms = &KNOWNFOLDERID{0xf26305ef, 0x6948, 0x40b9, [8]byte{0xb2, 0x55, 0x81, 0x45, 0x3d, 0x09, 0xc7, 0x85}} + FOLDERID_CommonStartMenuPlaces = &KNOWNFOLDERID{0xa440879f, 0x87a0, 0x4f7d, [8]byte{0xb7, 0x00, 0x02, 0x07, 0xb9, 0x66, 0x19, 0x4a}} + FOLDERID_ApplicationShortcuts = &KNOWNFOLDERID{0xa3918781, 0xe5f2, 0x4890, [8]byte{0xb3, 0xd9, 0xa7, 0xe5, 0x43, 0x32, 0x32, 0x8c}} + FOLDERID_RoamingTiles = &KNOWNFOLDERID{0x00bcfc5a, 0xed94, 0x4e48, [8]byte{0x96, 0xa1, 0x3f, 0x62, 0x17, 0xf2, 0x19, 0x90}} + FOLDERID_RoamedTileImages = &KNOWNFOLDERID{0xaaa8d5a5, 0xf1d6, 0x4259, [8]byte{0xba, 0xa8, 0x78, 0xe7, 0xef, 0x60, 0x83, 0x5e}} + FOLDERID_Screenshots = &KNOWNFOLDERID{0xb7bede81, 0xdf94, 0x4682, [8]byte{0xa7, 0xd8, 0x57, 0xa5, 0x26, 0x20, 0xb8, 0x6f}} + FOLDERID_CameraRoll = &KNOWNFOLDERID{0xab5fb87b, 0x7ce2, 0x4f83, [8]byte{0x91, 0x5d, 0x55, 0x08, 0x46, 0xc9, 0x53, 0x7b}} + FOLDERID_SkyDrive = &KNOWNFOLDERID{0xa52bba46, 0xe9e1, 0x435f, [8]byte{0xb3, 0xd9, 0x28, 0xda, 0xa6, 0x48, 0xc0, 0xf6}} + FOLDERID_OneDrive = &KNOWNFOLDERID{0xa52bba46, 0xe9e1, 0x435f, [8]byte{0xb3, 0xd9, 0x28, 0xda, 0xa6, 0x48, 0xc0, 0xf6}} + FOLDERID_SkyDriveDocuments = &KNOWNFOLDERID{0x24d89e24, 0x2f19, 0x4534, [8]byte{0x9d, 0xde, 0x6a, 0x66, 0x71, 0xfb, 0xb8, 0xfe}} + FOLDERID_SkyDrivePictures = &KNOWNFOLDERID{0x339719b5, 0x8c47, 0x4894, [8]byte{0x94, 0xc2, 0xd8, 0xf7, 0x7a, 0xdd, 0x44, 0xa6}} + FOLDERID_SkyDriveMusic = &KNOWNFOLDERID{0xc3f2459e, 0x80d6, 0x45dc, [8]byte{0xbf, 0xef, 0x1f, 0x76, 0x9f, 0x2b, 0xe7, 0x30}} + FOLDERID_SkyDriveCameraRoll = &KNOWNFOLDERID{0x767e6811, 0x49cb, 0x4273, [8]byte{0x87, 0xc2, 0x20, 0xf3, 0x55, 0xe1, 0x08, 0x5b}} + FOLDERID_SearchHistory = &KNOWNFOLDERID{0x0d4c3db6, 0x03a3, 0x462f, [8]byte{0xa0, 0xe6, 0x08, 0x92, 0x4c, 0x41, 0xb5, 0xd4}} + FOLDERID_SearchTemplates = &KNOWNFOLDERID{0x7e636bfe, 0xdfa9, 0x4d5e, [8]byte{0xb4, 0x56, 0xd7, 0xb3, 0x98, 0x51, 0xd8, 0xa9}} + FOLDERID_CameraRollLibrary = &KNOWNFOLDERID{0x2b20df75, 0x1eda, 0x4039, [8]byte{0x80, 0x97, 0x38, 0x79, 0x82, 0x27, 0xd5, 0xb7}} + FOLDERID_SavedPictures = &KNOWNFOLDERID{0x3b193882, 0xd3ad, 0x4eab, [8]byte{0x96, 0x5a, 0x69, 0x82, 0x9d, 0x1f, 0xb5, 0x9f}} + FOLDERID_SavedPicturesLibrary = &KNOWNFOLDERID{0xe25b5812, 0xbe88, 0x4bd9, [8]byte{0x94, 0xb0, 0x29, 0x23, 0x34, 0x77, 0xb6, 0xc3}} + FOLDERID_RetailDemo = &KNOWNFOLDERID{0x12d4c69e, 0x24ad, 0x4923, [8]byte{0xbe, 0x19, 0x31, 0x32, 0x1c, 0x43, 0xa7, 0x67}} + FOLDERID_Device = &KNOWNFOLDERID{0x1c2ac1dc, 0x4358, 0x4b6c, [8]byte{0x97, 0x33, 0xaf, 0x21, 0x15, 0x65, 0x76, 0xf0}} + FOLDERID_DevelopmentFiles = &KNOWNFOLDERID{0xdbe8e08e, 0x3053, 0x4bbc, [8]byte{0xb1, 0x83, 0x2a, 0x7b, 0x2b, 0x19, 0x1e, 0x59}} + FOLDERID_Objects3D = &KNOWNFOLDERID{0x31c0dd25, 0x9439, 0x4f12, [8]byte{0xbf, 0x41, 0x7f, 0xf4, 0xed, 0xa3, 0x87, 0x22}} + FOLDERID_AppCaptures = &KNOWNFOLDERID{0xedc0fe71, 0x98d8, 0x4f4a, [8]byte{0xb9, 0x20, 0xc8, 0xdc, 0x13, 0x3c, 0xb1, 0x65}} + FOLDERID_LocalDocuments = &KNOWNFOLDERID{0xf42ee2d3, 0x909f, 0x4907, [8]byte{0x88, 0x71, 0x4c, 0x22, 0xfc, 0x0b, 0xf7, 0x56}} + FOLDERID_LocalPictures = &KNOWNFOLDERID{0x0ddd015d, 0xb06c, 0x45d5, [8]byte{0x8c, 0x4c, 0xf5, 0x97, 0x13, 0x85, 0x46, 0x39}} + FOLDERID_LocalVideos = &KNOWNFOLDERID{0x35286a68, 0x3c57, 0x41a1, [8]byte{0xbb, 0xb1, 0x0e, 0xae, 0x73, 0xd7, 0x6c, 0x95}} + FOLDERID_LocalMusic = &KNOWNFOLDERID{0xa0c69a99, 0x21c8, 0x4671, [8]byte{0x87, 0x03, 0x79, 0x34, 0x16, 0x2f, 0xcf, 0x1d}} + FOLDERID_LocalDownloads = &KNOWNFOLDERID{0x7d83ee9b, 0x2244, 0x4e70, [8]byte{0xb1, 0xf5, 0x53, 0x93, 0x04, 0x2a, 0xf1, 0xe4}} + FOLDERID_RecordedCalls = &KNOWNFOLDERID{0x2f8b40c2, 0x83ed, 0x48ee, [8]byte{0xb3, 0x83, 0xa1, 0xf1, 0x57, 0xec, 0x6f, 0x9a}} + FOLDERID_AllAppMods = &KNOWNFOLDERID{0x7ad67899, 0x66af, 0x43ba, [8]byte{0x91, 0x56, 0x6a, 0xad, 0x42, 0xe6, 0xc5, 0x96}} + FOLDERID_CurrentAppMods = &KNOWNFOLDERID{0x3db40b20, 0x2a30, 0x4dbe, [8]byte{0x91, 0x7e, 0x77, 0x1d, 0xd2, 0x1d, 0xd0, 0x99}} + FOLDERID_AppDataDesktop = &KNOWNFOLDERID{0xb2c5e279, 0x7add, 0x439f, [8]byte{0xb2, 0x8c, 0xc4, 0x1f, 0xe1, 0xbb, 0xf6, 0x72}} + FOLDERID_AppDataDocuments = &KNOWNFOLDERID{0x7be16610, 0x1f7f, 0x44ac, [8]byte{0xbf, 0xf0, 0x83, 0xe1, 0x5f, 0x2f, 0xfc, 0xa1}} + FOLDERID_AppDataFavorites = &KNOWNFOLDERID{0x7cfbefbc, 0xde1f, 0x45aa, [8]byte{0xb8, 0x43, 0xa5, 0x42, 0xac, 0x53, 0x6c, 0xc9}} + FOLDERID_AppDataProgramData = &KNOWNFOLDERID{0x559d40a3, 0xa036, 0x40fa, [8]byte{0xaf, 0x61, 0x84, 0xcb, 0x43, 0x0a, 0x4d, 0x34}} +) diff --git a/vendor/golang.org/x/sys/windows/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/zsyscall_windows.go index dcd10e069..e5d62f3bf 100644 --- a/vendor/golang.org/x/sys/windows/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/zsyscall_windows.go @@ -42,6 +42,8 @@ var ( modmswsock = NewLazySystemDLL("mswsock.dll") modcrypt32 = NewLazySystemDLL("crypt32.dll") moduser32 = NewLazySystemDLL("user32.dll") + modole32 = NewLazySystemDLL("ole32.dll") + modntdll = NewLazySystemDLL("ntdll.dll") modws2_32 = NewLazySystemDLL("ws2_32.dll") moddnsapi = NewLazySystemDLL("dnsapi.dll") modiphlpapi = NewLazySystemDLL("iphlpapi.dll") @@ -59,6 +61,7 @@ var ( procDeleteService = modadvapi32.NewProc("DeleteService") procStartServiceW = modadvapi32.NewProc("StartServiceW") procQueryServiceStatus = modadvapi32.NewProc("QueryServiceStatus") + procQueryServiceLockStatusW = modadvapi32.NewProc("QueryServiceLockStatusW") procControlService = modadvapi32.NewProc("ControlService") procStartServiceCtrlDispatcherW = modadvapi32.NewProc("StartServiceCtrlDispatcherW") procSetServiceStatus = modadvapi32.NewProc("SetServiceStatus") @@ -112,6 +115,7 @@ var ( procCreateProcessW = modkernel32.NewProc("CreateProcessW") procOpenProcess = modkernel32.NewProc("OpenProcess") procShellExecuteW = modshell32.NewProc("ShellExecuteW") + procSHGetKnownFolderPath = modshell32.NewProc("SHGetKnownFolderPath") procTerminateProcess = modkernel32.NewProc("TerminateProcess") procGetExitCodeProcess = modkernel32.NewProc("GetExitCodeProcess") procGetStartupInfoW = modkernel32.NewProc("GetStartupInfoW") @@ -133,6 +137,7 @@ var ( procSetEnvironmentVariableW = modkernel32.NewProc("SetEnvironmentVariableW") procCreateEnvironmentBlock = moduserenv.NewProc("CreateEnvironmentBlock") procDestroyEnvironmentBlock = moduserenv.NewProc("DestroyEnvironmentBlock") + procGetTickCount64 = modkernel32.NewProc("GetTickCount64") procSetFileTime = modkernel32.NewProc("SetFileTime") procGetFileAttributesW = modkernel32.NewProc("GetFileAttributesW") procSetFileAttributesW = modkernel32.NewProc("SetFileAttributesW") @@ -180,6 +185,8 @@ var ( procCreateToolhelp32Snapshot = modkernel32.NewProc("CreateToolhelp32Snapshot") procProcess32FirstW = modkernel32.NewProc("Process32FirstW") procProcess32NextW = modkernel32.NewProc("Process32NextW") + procThread32First = modkernel32.NewProc("Thread32First") + procThread32Next = modkernel32.NewProc("Thread32Next") procDeviceIoControl = modkernel32.NewProc("DeviceIoControl") procCreateSymbolicLinkW = modkernel32.NewProc("CreateSymbolicLinkW") procCreateHardLinkW = modkernel32.NewProc("CreateHardLinkW") @@ -200,6 +207,8 @@ var ( procGetPriorityClass = modkernel32.NewProc("GetPriorityClass") procSetInformationJobObject = modkernel32.NewProc("SetInformationJobObject") procGenerateConsoleCtrlEvent = modkernel32.NewProc("GenerateConsoleCtrlEvent") + procGetProcessId = modkernel32.NewProc("GetProcessId") + procOpenThread = modkernel32.NewProc("OpenThread") procDefineDosDeviceW = modkernel32.NewProc("DefineDosDeviceW") procDeleteVolumeMountPointW = modkernel32.NewProc("DeleteVolumeMountPointW") procFindFirstVolumeW = modkernel32.NewProc("FindFirstVolumeW") @@ -220,6 +229,12 @@ var ( procSetVolumeLabelW = modkernel32.NewProc("SetVolumeLabelW") procSetVolumeMountPointW = modkernel32.NewProc("SetVolumeMountPointW") procMessageBoxW = moduser32.NewProc("MessageBoxW") + procCLSIDFromString = modole32.NewProc("CLSIDFromString") + procStringFromGUID2 = modole32.NewProc("StringFromGUID2") + procCoCreateGuid = modole32.NewProc("CoCreateGuid") + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") + procRtlGetVersion = modntdll.NewProc("RtlGetVersion") + procRtlGetNtVersionNumbers = modntdll.NewProc("RtlGetNtVersionNumbers") procWSAStartup = modws2_32.NewProc("WSAStartup") procWSACleanup = modws2_32.NewProc("WSACleanup") procWSAIoctl = modws2_32.NewProc("WSAIoctl") @@ -418,6 +433,18 @@ func QueryServiceStatus(service Handle, status *SERVICE_STATUS) (err error) { return } +func QueryServiceLockStatus(mgr Handle, lockStatus *QUERY_SERVICE_LOCK_STATUS, bufSize uint32, bytesNeeded *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryServiceLockStatusW.Addr(), 4, uintptr(mgr), uintptr(unsafe.Pointer(lockStatus)), uintptr(bufSize), uintptr(unsafe.Pointer(bytesNeeded)), 0, 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func ControlService(service Handle, control uint32, status *SERVICE_STATUS) (err error) { r1, _, e1 := syscall.Syscall(procControlService.Addr(), 3, uintptr(service), uintptr(control), uintptr(unsafe.Pointer(status))) if r1 == 0 { @@ -1064,14 +1091,14 @@ func CreateProcess(appName *uint16, commandLine *uint16, procSecurity *SecurityA return } -func OpenProcess(da uint32, inheritHandle bool, pid uint32) (handle Handle, err error) { +func OpenProcess(desiredAccess uint32, inheritHandle bool, processId uint32) (handle Handle, err error) { var _p0 uint32 if inheritHandle { _p0 = 1 } else { _p0 = 0 } - r0, _, e1 := syscall.Syscall(procOpenProcess.Addr(), 3, uintptr(da), uintptr(_p0), uintptr(pid)) + r0, _, e1 := syscall.Syscall(procOpenProcess.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(processId)) handle = Handle(r0) if handle == 0 { if e1 != 0 { @@ -1095,6 +1122,14 @@ func ShellExecute(hwnd Handle, verb *uint16, file *uint16, args *uint16, cwd *ui return } +func shGetKnownFolderPath(id *KNOWNFOLDERID, flags uint32, token Token, path **uint16) (ret error) { + r0, _, _ := syscall.Syscall6(procSHGetKnownFolderPath.Addr(), 4, uintptr(unsafe.Pointer(id)), uintptr(flags), uintptr(token), uintptr(unsafe.Pointer(path)), 0, 0) + if r0 != 0 { + ret = syscall.Errno(r0) + } + return +} + func TerminateProcess(handle Handle, exitcode uint32) (err error) { r1, _, e1 := syscall.Syscall(procTerminateProcess.Addr(), 2, uintptr(handle), uintptr(exitcode), 0) if r1 == 0 { @@ -1373,6 +1408,12 @@ func DestroyEnvironmentBlock(block *uint16) (err error) { return } +func getTickCount64() (ms uint64) { + r0, _, _ := syscall.Syscall(procGetTickCount64.Addr(), 0, 0, 0, 0) + ms = uint64(r0) + return +} + func SetFileTime(handle Handle, ctime *Filetime, atime *Filetime, wtime *Filetime) (err error) { r1, _, e1 := syscall.Syscall6(procSetFileTime.Addr(), 4, uintptr(handle), uintptr(unsafe.Pointer(ctime)), uintptr(unsafe.Pointer(atime)), uintptr(unsafe.Pointer(wtime)), 0, 0) if r1 == 0 { @@ -1815,7 +1856,7 @@ func RegQueryValueEx(key Handle, name *uint16, reserved *uint32, valtype *uint32 return } -func getCurrentProcessId() (pid uint32) { +func GetCurrentProcessId() (pid uint32) { r0, _, _ := syscall.Syscall(procGetCurrentProcessId.Addr(), 0, 0, 0, 0) pid = uint32(r0) return @@ -1918,6 +1959,30 @@ func Process32Next(snapshot Handle, procEntry *ProcessEntry32) (err error) { return } +func Thread32First(snapshot Handle, threadEntry *ThreadEntry32) (err error) { + r1, _, e1 := syscall.Syscall(procThread32First.Addr(), 2, uintptr(snapshot), uintptr(unsafe.Pointer(threadEntry)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func Thread32Next(snapshot Handle, threadEntry *ThreadEntry32) (err error) { + r1, _, e1 := syscall.Syscall(procThread32Next.Addr(), 2, uintptr(snapshot), uintptr(unsafe.Pointer(threadEntry)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func DeviceIoControl(handle Handle, ioControlCode uint32, inBuffer *byte, inBufferSize uint32, outBuffer *byte, outBufferSize uint32, bytesReturned *uint32, overlapped *Overlapped) (err error) { r1, _, e1 := syscall.Syscall9(procDeviceIoControl.Addr(), 8, uintptr(handle), uintptr(ioControlCode), uintptr(unsafe.Pointer(inBuffer)), uintptr(inBufferSize), uintptr(unsafe.Pointer(outBuffer)), uintptr(outBufferSize), uintptr(unsafe.Pointer(bytesReturned)), uintptr(unsafe.Pointer(overlapped)), 0) if r1 == 0 { @@ -2159,6 +2224,38 @@ func GenerateConsoleCtrlEvent(ctrlEvent uint32, processGroupID uint32) (err erro return } +func GetProcessId(process Handle) (id uint32, err error) { + r0, _, e1 := syscall.Syscall(procGetProcessId.Addr(), 1, uintptr(process), 0, 0) + id = uint32(r0) + if id == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + +func OpenThread(desiredAccess uint32, inheritHandle bool, threadId uint32) (handle Handle, err error) { + var _p0 uint32 + if inheritHandle { + _p0 = 1 + } else { + _p0 = 0 + } + r0, _, e1 := syscall.Syscall(procOpenThread.Addr(), 3, uintptr(desiredAccess), uintptr(_p0), uintptr(threadId)) + handle = Handle(r0) + if handle == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func DefineDosDevice(flags uint32, deviceName *uint16, targetPath *uint16) (err error) { r1, _, e1 := syscall.Syscall(procDefineDosDeviceW.Addr(), 3, uintptr(flags), uintptr(unsafe.Pointer(deviceName)), uintptr(unsafe.Pointer(targetPath))) if r1 == 0 { @@ -2399,6 +2496,46 @@ func MessageBox(hwnd Handle, text *uint16, caption *uint16, boxtype uint32) (ret return } +func clsidFromString(lpsz *uint16, pclsid *GUID) (ret error) { + r0, _, _ := syscall.Syscall(procCLSIDFromString.Addr(), 2, uintptr(unsafe.Pointer(lpsz)), uintptr(unsafe.Pointer(pclsid)), 0) + if r0 != 0 { + ret = syscall.Errno(r0) + } + return +} + +func stringFromGUID2(rguid *GUID, lpsz *uint16, cchMax int32) (chars int32) { + r0, _, _ := syscall.Syscall(procStringFromGUID2.Addr(), 3, uintptr(unsafe.Pointer(rguid)), uintptr(unsafe.Pointer(lpsz)), uintptr(cchMax)) + chars = int32(r0) + return +} + +func coCreateGuid(pguid *GUID) (ret error) { + r0, _, _ := syscall.Syscall(procCoCreateGuid.Addr(), 1, uintptr(unsafe.Pointer(pguid)), 0, 0) + if r0 != 0 { + ret = syscall.Errno(r0) + } + return +} + +func CoTaskMemFree(address unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(address), 0, 0) + return +} + +func rtlGetVersion(info *OsVersionInfoEx) (ret error) { + r0, _, _ := syscall.Syscall(procRtlGetVersion.Addr(), 1, uintptr(unsafe.Pointer(info)), 0, 0) + if r0 != 0 { + ret = syscall.Errno(r0) + } + return +} + +func rtlGetNtVersionNumbers(majorVersion *uint32, minorVersion *uint32, buildNumber *uint32) { + syscall.Syscall(procRtlGetNtVersionNumbers.Addr(), 3, uintptr(unsafe.Pointer(majorVersion)), uintptr(unsafe.Pointer(minorVersion)), uintptr(unsafe.Pointer(buildNumber))) + return +} + func WSAStartup(verreq uint32, data *WSAData) (sockerr error) { r0, _, _ := syscall.Syscall(procWSAStartup.Addr(), 2, uintptr(verreq), uintptr(unsafe.Pointer(data)), 0) if r0 != 0 { diff --git a/vendor/google.golang.org/grpc/README.md b/vendor/google.golang.org/grpc/README.md index f5eec6717..afbc43db5 100644 --- a/vendor/google.golang.org/grpc/README.md +++ b/vendor/google.golang.org/grpc/README.md @@ -1,42 +1,96 @@ # gRPC-Go -[![Build Status](https://travis-ci.org/grpc/grpc-go.svg)](https://travis-ci.org/grpc/grpc-go) [![GoDoc](https://godoc.org/google.golang.org/grpc?status.svg)](https://godoc.org/google.golang.org/grpc) [![GoReportCard](https://goreportcard.com/badge/grpc/grpc-go)](https://goreportcard.com/report/github.com/grpc/grpc-go) +[![Build Status](https://travis-ci.org/grpc/grpc-go.svg)](https://travis-ci.org/grpc/grpc-go) +[![GoDoc](https://godoc.org/google.golang.org/grpc?status.svg)](https://godoc.org/google.golang.org/grpc) +[![GoReportCard](https://goreportcard.com/badge/grpc/grpc-go)](https://goreportcard.com/report/github.com/grpc/grpc-go) -The Go implementation of [gRPC](https://grpc.io/): A high performance, open source, general RPC framework that puts mobile and HTTP/2 first. For more information see the [gRPC Quick Start: Go](https://grpc.io/docs/quickstart/go.html) guide. +The Go implementation of [gRPC](https://grpc.io/): A high performance, open +source, general RPC framework that puts mobile and HTTP/2 first. For more +information see the [gRPC Quick Start: +Go](https://grpc.io/docs/quickstart/go.html) guide. Installation ------------ -To install this package, you need to install Go and setup your Go workspace on your computer. The simplest way to install the library is to run: +To install this package, you need to install Go and setup your Go workspace on +your computer. The simplest way to install the library is to run: ``` $ go get -u google.golang.org/grpc ``` +With Go module support (Go 1.11+), simply `import "google.golang.org/grpc"` in +your source code and `go [build|run|test]` will automatically download the +necessary dependencies ([Go modules +ref](https://github.com/golang/go/wiki/Modules)). + +If you are trying to access grpc-go from within China, please see the +[FAQ](#FAQ) below. + Prerequisites ------------- - gRPC-Go requires Go 1.9 or later. -Constraints ------------ -The grpc package should only depend on standard Go packages and a small number of exceptions. If your contribution introduces new dependencies which are NOT in the [list](https://godoc.org/google.golang.org/grpc?imports), you need a discussion with gRPC-Go authors and consultants. - Documentation ------------- -See [API documentation](https://godoc.org/google.golang.org/grpc) for package and API descriptions and find examples in the [examples directory](examples/). +- See [godoc](https://godoc.org/google.golang.org/grpc) for package and API + descriptions. +- Documentation on specific topics can be found in the [Documentation + directory](Documentation/). +- Examples can be found in the [examples directory](examples/). Performance ----------- -See the current benchmarks for some of the languages supported in [this dashboard](https://performance-dot-grpc-testing.appspot.com/explore?dashboard=5652536396611584&widget=490377658&container=1286539696). +Performance benchmark data for grpc-go and other languages is maintained in +[this +dashboard](https://performance-dot-grpc-testing.appspot.com/explore?dashboard=5652536396611584&widget=490377658&container=1286539696). Status ------ -General Availability [Google Cloud Platform Launch Stages](https://cloud.google.com/terms/launch-stages). +General Availability [Google Cloud Platform Launch +Stages](https://cloud.google.com/terms/launch-stages). FAQ --- +#### I/O Timeout Errors + +The `golang.org` domain may be blocked from some countries. `go get` usually +produces an error like the following when this happens: + +``` +$ go get -u google.golang.org/grpc +package google.golang.org/grpc: unrecognized import path "google.golang.org/grpc" (https fetch: Get https://google.golang.org/grpc?go-get=1: dial tcp 216.239.37.1:443: i/o timeout) +``` + +To build Go code, there are several options: + +- Set up a VPN and access google.golang.org through that. + +- Without Go module support: `git clone` the repo manually: + + ``` + git clone https://github.com/grpc/grpc-go.git $GOPATH/src/google.golang.org/grpc + ``` + + You will need to do the same for all of grpc's dependencies in `golang.org`, + e.g. `golang.org/x/net`. + +- With Go module support: it is possible to use the `replace` feature of `go + mod` to create aliases for golang.org packages. In your project's directory: + + ``` + go mod edit -replace=google.golang.org/grpc=github.com/grpc/grpc-go@latest + go mod tidy + go mod vendor + go build -mod=vendor + ``` + + Again, this will need to be done for all transitive dependencies hosted on + golang.org as well. Please refer to [this + issue](https://github.com/golang/go/issues/28652) in the golang repo regarding + this concern. + #### Compiling error, undefined: grpc.SupportPackageIsVersion Please update proto package, gRPC package and rebuild the proto files: diff --git a/vendor/google.golang.org/grpc/balancer.go b/vendor/google.golang.org/grpc/balancer.go index a78e702ba..a8eb0f476 100644 --- a/vendor/google.golang.org/grpc/balancer.go +++ b/vendor/google.golang.org/grpc/balancer.go @@ -43,7 +43,7 @@ type Address struct { // BalancerConfig specifies the configurations for Balancer. // -// Deprecated: please use package balancer. +// Deprecated: please use package balancer. May be removed in a future 1.x release. type BalancerConfig struct { // DialCreds is the transport credential the Balancer implementation can // use to dial to a remote load balancer server. The Balancer implementations @@ -57,7 +57,7 @@ type BalancerConfig struct { // BalancerGetOptions configures a Get call. // -// Deprecated: please use package balancer. +// Deprecated: please use package balancer. May be removed in a future 1.x release. type BalancerGetOptions struct { // BlockingWait specifies whether Get should block when there is no // connected address. @@ -66,7 +66,7 @@ type BalancerGetOptions struct { // Balancer chooses network addresses for RPCs. // -// Deprecated: please use package balancer. +// Deprecated: please use package balancer. May be removed in a future 1.x release. type Balancer interface { // Start does the initialization work to bootstrap a Balancer. For example, // this function may start the name resolution and watch the updates. It will @@ -120,7 +120,7 @@ type Balancer interface { // RoundRobin returns a Balancer that selects addresses round-robin. It uses r to watch // the name resolution updates and updates the addresses available correspondingly. // -// Deprecated: please use package balancer/roundrobin. +// Deprecated: please use package balancer/roundrobin. May be removed in a future 1.x release. func RoundRobin(r naming.Resolver) Balancer { return &roundRobin{r: r} } diff --git a/vendor/google.golang.org/grpc/balancer/balancer.go b/vendor/google.golang.org/grpc/balancer/balancer.go index fafede238..c266f4ec1 100644 --- a/vendor/google.golang.org/grpc/balancer/balancer.go +++ b/vendor/google.golang.org/grpc/balancer/balancer.go @@ -22,6 +22,7 @@ package balancer import ( "context" + "encoding/json" "errors" "net" "strings" @@ -31,6 +32,7 @@ import ( "google.golang.org/grpc/internal" "google.golang.org/grpc/metadata" "google.golang.org/grpc/resolver" + "google.golang.org/grpc/serviceconfig" ) var ( @@ -39,7 +41,10 @@ var ( ) // Register registers the balancer builder to the balancer map. b.Name -// (lowercased) will be used as the name registered with this builder. +// (lowercased) will be used as the name registered with this builder. If the +// Builder implements ConfigParser, ParseConfig will be called when new service +// configs are received by the resolver, and the result will be provided to the +// Balancer in UpdateClientConnState. // // NOTE: this function must only be called during initialization time (i.e. in // an init() function), and is not thread-safe. If multiple Balancers are @@ -138,6 +143,8 @@ type ClientConn interface { ResolveNow(resolver.ResolveNowOption) // Target returns the dial target for this ClientConn. + // + // Deprecated: Use the Target field in the BuildOptions instead. Target() string } @@ -155,6 +162,10 @@ type BuildOptions struct { Dialer func(context.Context, string) (net.Conn, error) // ChannelzParentID is the entity parent's channelz unique identification number. ChannelzParentID int64 + // Target contains the parsed address info of the dial target. It is the same resolver.Target as + // passed to the resolver. + // See the documentation for the resolver.Target type for details about what it contains. + Target resolver.Target } // Builder creates a balancer. @@ -166,6 +177,14 @@ type Builder interface { Name() string } +// ConfigParser parses load balancer configs. +type ConfigParser interface { + // ParseConfig parses the JSON load balancer config provided into an + // internal form or returns an error if the config is invalid. For future + // compatibility reasons, unknown fields in the config should be ignored. + ParseConfig(LoadBalancingConfigJSON json.RawMessage) (serviceconfig.LoadBalancingConfig, error) +} + // PickOptions contains addition information for the Pick operation. type PickOptions struct { // FullMethodName is the method name that NewClientStream() is called @@ -264,7 +283,7 @@ type Balancer interface { // non-nil error to gRPC. // // Deprecated: if V2Balancer is implemented by the Balancer, - // UpdateResolverState will be called instead. + // UpdateClientConnState will be called instead. HandleResolvedAddrs([]resolver.Address, error) // Close closes the balancer. The balancer is not required to call // ClientConn.RemoveSubConn for its existing SubConns. @@ -277,14 +296,23 @@ type SubConnState struct { // TODO: add last connection error } +// ClientConnState describes the state of a ClientConn relevant to the +// balancer. +type ClientConnState struct { + ResolverState resolver.State + // The parsed load balancing configuration returned by the builder's + // ParseConfig method, if implemented. + BalancerConfig serviceconfig.LoadBalancingConfig +} + // V2Balancer is defined for documentation purposes. If a Balancer also -// implements V2Balancer, its UpdateResolverState method will be called instead -// of HandleResolvedAddrs and its UpdateSubConnState will be called instead of -// HandleSubConnStateChange. +// implements V2Balancer, its UpdateClientConnState method will be called +// instead of HandleResolvedAddrs and its UpdateSubConnState will be called +// instead of HandleSubConnStateChange. type V2Balancer interface { - // UpdateResolverState is called by gRPC when the state of the resolver + // UpdateClientConnState is called by gRPC when the state of the ClientConn // changes. - UpdateResolverState(resolver.State) + UpdateClientConnState(ClientConnState) // UpdateSubConnState is called by gRPC when the state of a SubConn // changes. UpdateSubConnState(SubConn, SubConnState) diff --git a/vendor/google.golang.org/grpc/balancer/base/balancer.go b/vendor/google.golang.org/grpc/balancer/base/balancer.go index c5a51bd1d..1af88f0a3 100644 --- a/vendor/google.golang.org/grpc/balancer/base/balancer.go +++ b/vendor/google.golang.org/grpc/balancer/base/balancer.go @@ -70,13 +70,15 @@ func (b *baseBalancer) HandleResolvedAddrs(addrs []resolver.Address, err error) panic("not implemented") } -func (b *baseBalancer) UpdateResolverState(s resolver.State) { - // TODO: handle s.Err (log if not nil) once implemented. - // TODO: handle s.ServiceConfig? - grpclog.Infoln("base.baseBalancer: got new resolver state: ", s) +func (b *baseBalancer) UpdateClientConnState(s balancer.ClientConnState) { + // TODO: handle s.ResolverState.Err (log if not nil) once implemented. + // TODO: handle s.ResolverState.ServiceConfig? + if grpclog.V(2) { + grpclog.Infoln("base.baseBalancer: got new ClientConn state: ", s) + } // addrsSet is the set converted from addrs, it's used for quick lookup of an address. addrsSet := make(map[resolver.Address]struct{}) - for _, a := range s.Addresses { + for _, a := range s.ResolverState.Addresses { addrsSet[a] = struct{}{} if _, ok := b.subConns[a]; !ok { // a is a new address (not existing in b.subConns). @@ -127,10 +129,14 @@ func (b *baseBalancer) HandleSubConnStateChange(sc balancer.SubConn, s connectiv func (b *baseBalancer) UpdateSubConnState(sc balancer.SubConn, state balancer.SubConnState) { s := state.ConnectivityState - grpclog.Infof("base.baseBalancer: handle SubConn state change: %p, %v", sc, s) + if grpclog.V(2) { + grpclog.Infof("base.baseBalancer: handle SubConn state change: %p, %v", sc, s) + } oldS, ok := b.scStates[sc] if !ok { - grpclog.Infof("base.baseBalancer: got state changes for an unknown SubConn: %p, %v", sc, s) + if grpclog.V(2) { + grpclog.Infof("base.baseBalancer: got state changes for an unknown SubConn: %p, %v", sc, s) + } return } b.scStates[sc] = s diff --git a/vendor/google.golang.org/grpc/balancer_conn_wrappers.go b/vendor/google.golang.org/grpc/balancer_conn_wrappers.go index bc965f0ac..8df4095ca 100644 --- a/vendor/google.golang.org/grpc/balancer_conn_wrappers.go +++ b/vendor/google.golang.org/grpc/balancer_conn_wrappers.go @@ -88,7 +88,7 @@ type ccBalancerWrapper struct { cc *ClientConn balancer balancer.Balancer stateChangeQueue *scStateUpdateBuffer - resolverUpdateCh chan *resolver.State + ccUpdateCh chan *balancer.ClientConnState done chan struct{} mu sync.Mutex @@ -99,7 +99,7 @@ func newCCBalancerWrapper(cc *ClientConn, b balancer.Builder, bopts balancer.Bui ccb := &ccBalancerWrapper{ cc: cc, stateChangeQueue: newSCStateUpdateBuffer(), - resolverUpdateCh: make(chan *resolver.State, 1), + ccUpdateCh: make(chan *balancer.ClientConnState, 1), done: make(chan struct{}), subConns: make(map[*acBalancerWrapper]struct{}), } @@ -126,7 +126,7 @@ func (ccb *ccBalancerWrapper) watcher() { } else { ccb.balancer.HandleSubConnStateChange(t.sc, t.state) } - case s := <-ccb.resolverUpdateCh: + case s := <-ccb.ccUpdateCh: select { case <-ccb.done: ccb.balancer.Close() @@ -134,9 +134,9 @@ func (ccb *ccBalancerWrapper) watcher() { default: } if ub, ok := ccb.balancer.(balancer.V2Balancer); ok { - ub.UpdateResolverState(*s) + ub.UpdateClientConnState(*s) } else { - ccb.balancer.HandleResolvedAddrs(s.Addresses, nil) + ccb.balancer.HandleResolvedAddrs(s.ResolverState.Addresses, nil) } case <-ccb.done: } @@ -151,9 +151,11 @@ func (ccb *ccBalancerWrapper) watcher() { for acbw := range scs { ccb.cc.removeAddrConn(acbw.getAddrConn(), errConnDrain) } + ccb.UpdateBalancerState(connectivity.Connecting, nil) return default: } + ccb.cc.firstResolveEvent.Fire() } } @@ -178,9 +180,10 @@ func (ccb *ccBalancerWrapper) handleSubConnStateChange(sc balancer.SubConn, s co }) } -func (ccb *ccBalancerWrapper) updateResolverState(s resolver.State) { +func (ccb *ccBalancerWrapper) updateClientConnState(ccs *balancer.ClientConnState) { if ccb.cc.curBalancerName != grpclbName { // Filter any grpclb addresses since we don't have the grpclb balancer. + s := &ccs.ResolverState for i := 0; i < len(s.Addresses); { if s.Addresses[i].Type == resolver.GRPCLB { copy(s.Addresses[i:], s.Addresses[i+1:]) @@ -191,10 +194,10 @@ func (ccb *ccBalancerWrapper) updateResolverState(s resolver.State) { } } select { - case <-ccb.resolverUpdateCh: + case <-ccb.ccUpdateCh: default: } - ccb.resolverUpdateCh <- &s + ccb.ccUpdateCh <- ccs } func (ccb *ccBalancerWrapper) NewSubConn(addrs []resolver.Address, opts balancer.NewSubConnOptions) (balancer.SubConn, error) { diff --git a/vendor/google.golang.org/grpc/balancer_v1_wrapper.go b/vendor/google.golang.org/grpc/balancer_v1_wrapper.go index 29bda6353..66e9a44ac 100644 --- a/vendor/google.golang.org/grpc/balancer_v1_wrapper.go +++ b/vendor/google.golang.org/grpc/balancer_v1_wrapper.go @@ -20,7 +20,6 @@ package grpc import ( "context" - "strings" "sync" "google.golang.org/grpc/balancer" @@ -34,13 +33,7 @@ type balancerWrapperBuilder struct { } func (bwb *balancerWrapperBuilder) Build(cc balancer.ClientConn, opts balancer.BuildOptions) balancer.Balancer { - targetAddr := cc.Target() - targetSplitted := strings.Split(targetAddr, ":///") - if len(targetSplitted) >= 2 { - targetAddr = targetSplitted[1] - } - - bwb.b.Start(targetAddr, BalancerConfig{ + bwb.b.Start(opts.Target.Endpoint, BalancerConfig{ DialCreds: opts.DialCreds, Dialer: opts.Dialer, }) @@ -49,7 +42,7 @@ func (bwb *balancerWrapperBuilder) Build(cc balancer.ClientConn, opts balancer.B balancer: bwb.b, pickfirst: pickfirst, cc: cc, - targetAddr: targetAddr, + targetAddr: opts.Target.Endpoint, startCh: make(chan struct{}), conns: make(map[resolver.Address]balancer.SubConn), connSt: make(map[balancer.SubConn]*scState), @@ -120,7 +113,7 @@ func (bw *balancerWrapper) lbWatcher() { } for addrs := range notifyCh { - grpclog.Infof("balancerWrapper: got update addr from Notify: %v\n", addrs) + grpclog.Infof("balancerWrapper: got update addr from Notify: %v", addrs) if bw.pickfirst { var ( oldA resolver.Address diff --git a/vendor/google.golang.org/grpc/clientconn.go b/vendor/google.golang.org/grpc/clientconn.go index bd2d2b317..a7643df7d 100644 --- a/vendor/google.golang.org/grpc/clientconn.go +++ b/vendor/google.golang.org/grpc/clientconn.go @@ -38,13 +38,13 @@ import ( "google.golang.org/grpc/grpclog" "google.golang.org/grpc/internal/backoff" "google.golang.org/grpc/internal/channelz" - "google.golang.org/grpc/internal/envconfig" "google.golang.org/grpc/internal/grpcsync" "google.golang.org/grpc/internal/transport" "google.golang.org/grpc/keepalive" "google.golang.org/grpc/resolver" _ "google.golang.org/grpc/resolver/dns" // To register dns resolver. _ "google.golang.org/grpc/resolver/passthrough" // To register passthrough resolver. + "google.golang.org/grpc/serviceconfig" "google.golang.org/grpc/status" ) @@ -137,6 +137,9 @@ func DialContext(ctx context.Context, target string, opts ...DialOption) (conn * opt.apply(&cc.dopts) } + chainUnaryClientInterceptors(cc) + chainStreamClientInterceptors(cc) + defer func() { if err != nil { cc.Close() @@ -290,6 +293,7 @@ func DialContext(ctx context.Context, target string, opts ...DialOption) (conn * CredsBundle: cc.dopts.copts.CredsBundle, Dialer: cc.dopts.copts.Dialer, ChannelzParentID: cc.channelzID, + Target: cc.parsedTarget, } // Build the resolver. @@ -327,6 +331,68 @@ func DialContext(ctx context.Context, target string, opts ...DialOption) (conn * return cc, nil } +// chainUnaryClientInterceptors chains all unary client interceptors into one. +func chainUnaryClientInterceptors(cc *ClientConn) { + interceptors := cc.dopts.chainUnaryInts + // Prepend dopts.unaryInt to the chaining interceptors if it exists, since unaryInt will + // be executed before any other chained interceptors. + if cc.dopts.unaryInt != nil { + interceptors = append([]UnaryClientInterceptor{cc.dopts.unaryInt}, interceptors...) + } + var chainedInt UnaryClientInterceptor + if len(interceptors) == 0 { + chainedInt = nil + } else if len(interceptors) == 1 { + chainedInt = interceptors[0] + } else { + chainedInt = func(ctx context.Context, method string, req, reply interface{}, cc *ClientConn, invoker UnaryInvoker, opts ...CallOption) error { + return interceptors[0](ctx, method, req, reply, cc, getChainUnaryInvoker(interceptors, 0, invoker), opts...) + } + } + cc.dopts.unaryInt = chainedInt +} + +// getChainUnaryInvoker recursively generate the chained unary invoker. +func getChainUnaryInvoker(interceptors []UnaryClientInterceptor, curr int, finalInvoker UnaryInvoker) UnaryInvoker { + if curr == len(interceptors)-1 { + return finalInvoker + } + return func(ctx context.Context, method string, req, reply interface{}, cc *ClientConn, opts ...CallOption) error { + return interceptors[curr+1](ctx, method, req, reply, cc, getChainUnaryInvoker(interceptors, curr+1, finalInvoker), opts...) + } +} + +// chainStreamClientInterceptors chains all stream client interceptors into one. +func chainStreamClientInterceptors(cc *ClientConn) { + interceptors := cc.dopts.chainStreamInts + // Prepend dopts.streamInt to the chaining interceptors if it exists, since streamInt will + // be executed before any other chained interceptors. + if cc.dopts.streamInt != nil { + interceptors = append([]StreamClientInterceptor{cc.dopts.streamInt}, interceptors...) + } + var chainedInt StreamClientInterceptor + if len(interceptors) == 0 { + chainedInt = nil + } else if len(interceptors) == 1 { + chainedInt = interceptors[0] + } else { + chainedInt = func(ctx context.Context, desc *StreamDesc, cc *ClientConn, method string, streamer Streamer, opts ...CallOption) (ClientStream, error) { + return interceptors[0](ctx, desc, cc, method, getChainStreamer(interceptors, 0, streamer), opts...) + } + } + cc.dopts.streamInt = chainedInt +} + +// getChainStreamer recursively generate the chained client stream constructor. +func getChainStreamer(interceptors []StreamClientInterceptor, curr int, finalStreamer Streamer) Streamer { + if curr == len(interceptors)-1 { + return finalStreamer + } + return func(ctx context.Context, desc *StreamDesc, cc *ClientConn, method string, opts ...CallOption) (ClientStream, error) { + return interceptors[curr+1](ctx, desc, cc, method, getChainStreamer(interceptors, curr+1, finalStreamer), opts...) + } +} + // connectivityStateManager keeps the connectivity.State of ClientConn. // This struct will eventually be exported so the balancers can access it. type connectivityStateManager struct { @@ -466,24 +532,6 @@ func (cc *ClientConn) waitForResolvedAddrs(ctx context.Context) error { } } -// gRPC should resort to default service config when: -// * resolver service config is disabled -// * or, resolver does not return a service config or returns an invalid one. -func (cc *ClientConn) fallbackToDefaultServiceConfig(sc string) bool { - if cc.dopts.disableServiceConfig { - return true - } - // The logic below is temporary, will be removed once we change the resolver.State ServiceConfig field type. - // Right now, we assume that empty service config string means resolver does not return a config. - if sc == "" { - return true - } - // TODO: the logic below is temporary. Once we finish the logic to validate service config - // in resolver, we will replace the logic below. - _, err := parseServiceConfig(sc) - return err != nil -} - func (cc *ClientConn) updateResolverState(s resolver.State) error { cc.mu.Lock() defer cc.mu.Unlock() @@ -494,54 +542,47 @@ func (cc *ClientConn) updateResolverState(s resolver.State) error { return nil } - if cc.fallbackToDefaultServiceConfig(s.ServiceConfig) { + if cc.dopts.disableServiceConfig || s.ServiceConfig == nil { if cc.dopts.defaultServiceConfig != nil && cc.sc == nil { cc.applyServiceConfig(cc.dopts.defaultServiceConfig) } - } else { - // TODO: the parsing logic below will be moved inside resolver. - sc, err := parseServiceConfig(s.ServiceConfig) - if err != nil { - return err - } - if cc.sc == nil || cc.sc.rawJSONString != s.ServiceConfig { - cc.applyServiceConfig(sc) - } - } - - // update the service config that will be sent to balancer. - if cc.sc != nil { - s.ServiceConfig = cc.sc.rawJSONString + } else if sc, ok := s.ServiceConfig.(*ServiceConfig); ok { + cc.applyServiceConfig(sc) } + var balCfg serviceconfig.LoadBalancingConfig if cc.dopts.balancerBuilder == nil { // Only look at balancer types and switch balancer if balancer dial // option is not set. - var isGRPCLB bool - for _, a := range s.Addresses { - if a.Type == resolver.GRPCLB { - isGRPCLB = true - break - } - } var newBalancerName string - // TODO: use new loadBalancerConfig field with appropriate priority. - if isGRPCLB { - newBalancerName = grpclbName - } else if cc.sc != nil && cc.sc.LB != nil { - newBalancerName = *cc.sc.LB + if cc.sc != nil && cc.sc.lbConfig != nil { + newBalancerName = cc.sc.lbConfig.name + balCfg = cc.sc.lbConfig.cfg } else { - newBalancerName = PickFirstBalancerName + var isGRPCLB bool + for _, a := range s.Addresses { + if a.Type == resolver.GRPCLB { + isGRPCLB = true + break + } + } + if isGRPCLB { + newBalancerName = grpclbName + } else if cc.sc != nil && cc.sc.LB != nil { + newBalancerName = *cc.sc.LB + } else { + newBalancerName = PickFirstBalancerName + } } cc.switchBalancer(newBalancerName) } else if cc.balancerWrapper == nil { // Balancer dial option was set, and this is the first time handling // resolved addresses. Build a balancer with dopts.balancerBuilder. + cc.curBalancerName = cc.dopts.balancerBuilder.Name() cc.balancerWrapper = newCCBalancerWrapper(cc, cc.dopts.balancerBuilder, cc.balancerBuildOpts) } - cc.balancerWrapper.updateResolverState(s) - cc.firstResolveEvent.Fire() + cc.balancerWrapper.updateClientConnState(&balancer.ClientConnState{ResolverState: s, BalancerConfig: balCfg}) return nil } @@ -554,7 +595,7 @@ func (cc *ClientConn) updateResolverState(s resolver.State) error { // // Caller must hold cc.mu. func (cc *ClientConn) switchBalancer(name string) { - if strings.ToLower(cc.curBalancerName) == strings.ToLower(name) { + if strings.EqualFold(cc.curBalancerName, name) { return } @@ -693,6 +734,8 @@ func (ac *addrConn) connect() error { ac.mu.Unlock() return nil } + // Update connectivity state within the lock to prevent subsequent or + // concurrent calls from resetting the transport more than once. ac.updateConnectivityState(connectivity.Connecting) ac.mu.Unlock() @@ -703,7 +746,16 @@ func (ac *addrConn) connect() error { // tryUpdateAddrs tries to update ac.addrs with the new addresses list. // -// It checks whether current connected address of ac is in the new addrs list. +// If ac is Connecting, it returns false. The caller should tear down the ac and +// create a new one. Note that the backoff will be reset when this happens. +// +// If ac is TransientFailure, it updates ac.addrs and returns true. The updated +// addresses will be picked up by retry in the next iteration after backoff. +// +// If ac is Shutdown or Idle, it updates ac.addrs and returns true. +// +// If ac is Ready, it checks whether current connected address of ac is in the +// new addrs list. // - If true, it updates ac.addrs and returns true. The ac will keep using // the existing connection. // - If false, it does nothing and returns false. @@ -711,17 +763,18 @@ func (ac *addrConn) tryUpdateAddrs(addrs []resolver.Address) bool { ac.mu.Lock() defer ac.mu.Unlock() grpclog.Infof("addrConn: tryUpdateAddrs curAddr: %v, addrs: %v", ac.curAddr, addrs) - if ac.state == connectivity.Shutdown { + if ac.state == connectivity.Shutdown || + ac.state == connectivity.TransientFailure || + ac.state == connectivity.Idle { ac.addrs = addrs return true } - // Unless we're busy reconnecting already, let's reconnect from the top of - // the list. - if ac.state != connectivity.Ready { + if ac.state == connectivity.Connecting { return false } + // ac.state is Ready, try to find the connected address. var curAddrFound bool for _, a := range addrs { if reflect.DeepEqual(ac.curAddr, a) { @@ -970,6 +1023,9 @@ func (ac *addrConn) resetTransport() { // The spec doesn't mention what should be done for multiple addresses. // https://github.com/grpc/grpc/blob/master/doc/connection-backoff.md#proposed-backoff-algorithm connectDeadline := time.Now().Add(dialDuration) + + ac.updateConnectivityState(connectivity.Connecting) + ac.transport = nil ac.mu.Unlock() newTr, addr, reconnect, err := ac.tryAllAddrs(addrs, connectDeadline) @@ -1004,55 +1060,32 @@ func (ac *addrConn) resetTransport() { ac.mu.Lock() if ac.state == connectivity.Shutdown { - newTr.Close() ac.mu.Unlock() + newTr.Close() return } ac.curAddr = addr ac.transport = newTr ac.backoffIdx = 0 - healthCheckConfig := ac.cc.healthCheckConfig() - // LB channel health checking is only enabled when all the four requirements below are met: - // 1. it is not disabled by the user with the WithDisableHealthCheck DialOption, - // 2. the internal.HealthCheckFunc is set by importing the grpc/healthcheck package, - // 3. a service config with non-empty healthCheckConfig field is provided, - // 4. the current load balancer allows it. hctx, hcancel := context.WithCancel(ac.ctx) - healthcheckManagingState := false - if !ac.cc.dopts.disableHealthCheck && healthCheckConfig != nil && ac.scopts.HealthCheckEnabled { - if ac.cc.dopts.healthCheckFunc == nil { - // TODO: add a link to the health check doc in the error message. - grpclog.Error("the client side LB channel health check function has not been set.") - } else { - // TODO(deklerk) refactor to just return transport - go ac.startHealthCheck(hctx, newTr, addr, healthCheckConfig.ServiceName) - healthcheckManagingState = true - } - } - if !healthcheckManagingState { - ac.updateConnectivityState(connectivity.Ready) - } + ac.startHealthCheck(hctx) ac.mu.Unlock() // Block until the created transport is down. And when this happens, // we restart from the top of the addr list. <-reconnect.Done() hcancel() - - // Need to reconnect after a READY, the addrConn enters - // TRANSIENT_FAILURE. + // restart connecting - the top of the loop will set state to + // CONNECTING. This is against the current connectivity semantics doc, + // however it allows for graceful behavior for RPCs not yet dispatched + // - unfortunate timing would otherwise lead to the RPC failing even + // though the TRANSIENT_FAILURE state (called for by the doc) would be + // instantaneous. // - // This will set addrConn to TRANSIENT_FAILURE for a very short period - // of time, and turns CONNECTING. It seems reasonable to skip this, but - // READY-CONNECTING is not a valid transition. - ac.mu.Lock() - if ac.state == connectivity.Shutdown { - ac.mu.Unlock() - return - } - ac.updateConnectivityState(connectivity.TransientFailure) - ac.mu.Unlock() + // Ideally we should transition to Idle here and block until there is + // RPC activity that leads to the balancer requesting a reconnect of + // the associated SubConn. } } @@ -1066,8 +1099,6 @@ func (ac *addrConn) tryAllAddrs(addrs []resolver.Address, connectDeadline time.T ac.mu.Unlock() return nil, resolver.Address{}, nil, errConnClosing } - ac.updateConnectivityState(connectivity.Connecting) - ac.transport = nil ac.cc.mu.RLock() ac.dopts.copts.KeepaliveParams = ac.cc.mkp @@ -1111,14 +1142,35 @@ func (ac *addrConn) createTransport(addr resolver.Address, copts transport.Conne Authority: ac.cc.authority, } + once := sync.Once{} onGoAway := func(r transport.GoAwayReason) { ac.mu.Lock() ac.adjustParams(r) + once.Do(func() { + if ac.state == connectivity.Ready { + // Prevent this SubConn from being used for new RPCs by setting its + // state to Connecting. + // + // TODO: this should be Idle when grpc-go properly supports it. + ac.updateConnectivityState(connectivity.Connecting) + } + }) ac.mu.Unlock() reconnect.Fire() } onClose := func() { + ac.mu.Lock() + once.Do(func() { + if ac.state == connectivity.Ready { + // Prevent this SubConn from being used for new RPCs by setting its + // state to Connecting. + // + // TODO: this should be Idle when grpc-go properly supports it. + ac.updateConnectivityState(connectivity.Connecting) + } + }) + ac.mu.Unlock() close(onCloseCalled) reconnect.Fire() } @@ -1140,60 +1192,99 @@ func (ac *addrConn) createTransport(addr resolver.Address, copts transport.Conne return nil, nil, err } - if ac.dopts.reqHandshake == envconfig.RequireHandshakeOn { - select { - case <-time.After(connectDeadline.Sub(time.Now())): - // We didn't get the preface in time. - newTr.Close() - grpclog.Warningf("grpc: addrConn.createTransport failed to connect to %v: didn't receive server preface in time. Reconnecting...", addr) - return nil, nil, errors.New("timed out waiting for server handshake") - case <-prefaceReceived: - // We got the preface - huzzah! things are good. - case <-onCloseCalled: - // The transport has already closed - noop. - return nil, nil, errors.New("connection closed") - // TODO(deklerk) this should bail on ac.ctx.Done(). Add a test and fix. - } + select { + case <-time.After(connectDeadline.Sub(time.Now())): + // We didn't get the preface in time. + newTr.Close() + grpclog.Warningf("grpc: addrConn.createTransport failed to connect to %v: didn't receive server preface in time. Reconnecting...", addr) + return nil, nil, errors.New("timed out waiting for server handshake") + case <-prefaceReceived: + // We got the preface - huzzah! things are good. + case <-onCloseCalled: + // The transport has already closed - noop. + return nil, nil, errors.New("connection closed") + // TODO(deklerk) this should bail on ac.ctx.Done(). Add a test and fix. } return newTr, reconnect, nil } -func (ac *addrConn) startHealthCheck(ctx context.Context, newTr transport.ClientTransport, addr resolver.Address, serviceName string) { - // Set up the health check helper functions - newStream := func() (interface{}, error) { - return ac.newClientStream(ctx, &StreamDesc{ServerStreams: true}, "/grpc.health.v1.Health/Watch", newTr) +// startHealthCheck starts the health checking stream (RPC) to watch the health +// stats of this connection if health checking is requested and configured. +// +// LB channel health checking is enabled when all requirements below are met: +// 1. it is not disabled by the user with the WithDisableHealthCheck DialOption +// 2. internal.HealthCheckFunc is set by importing the grpc/healthcheck package +// 3. a service config with non-empty healthCheckConfig field is provided +// 4. the load balancer requests it +// +// It sets addrConn to READY if the health checking stream is not started. +// +// Caller must hold ac.mu. +func (ac *addrConn) startHealthCheck(ctx context.Context) { + var healthcheckManagingState bool + defer func() { + if !healthcheckManagingState { + ac.updateConnectivityState(connectivity.Ready) + } + }() + + if ac.cc.dopts.disableHealthCheck { + return } - firstReady := true - reportHealth := func(ok bool) { + healthCheckConfig := ac.cc.healthCheckConfig() + if healthCheckConfig == nil { + return + } + if !ac.scopts.HealthCheckEnabled { + return + } + healthCheckFunc := ac.cc.dopts.healthCheckFunc + if healthCheckFunc == nil { + // The health package is not imported to set health check function. + // + // TODO: add a link to the health check doc in the error message. + grpclog.Error("Health check is requested but health check function is not set.") + return + } + + healthcheckManagingState = true + + // Set up the health check helper functions. + currentTr := ac.transport + newStream := func(method string) (interface{}, error) { + ac.mu.Lock() + if ac.transport != currentTr { + ac.mu.Unlock() + return nil, status.Error(codes.Canceled, "the provided transport is no longer valid to use") + } + ac.mu.Unlock() + return newNonRetryClientStream(ctx, &StreamDesc{ServerStreams: true}, method, currentTr, ac) + } + setConnectivityState := func(s connectivity.State) { ac.mu.Lock() defer ac.mu.Unlock() - if ac.transport != newTr { + if ac.transport != currentTr { return } - if ok { - if firstReady { - firstReady = false - ac.curAddr = addr - } - ac.updateConnectivityState(connectivity.Ready) - } else { - ac.updateConnectivityState(connectivity.TransientFailure) - } + ac.updateConnectivityState(s) } - err := ac.cc.dopts.healthCheckFunc(ctx, newStream, reportHealth, serviceName) - if err != nil { - if status.Code(err) == codes.Unimplemented { - if channelz.IsOn() { - channelz.AddTraceEvent(ac.channelzID, &channelz.TraceEventDesc{ - Desc: "Subchannel health check is unimplemented at server side, thus health check is disabled", - Severity: channelz.CtError, - }) + // Start the health checking stream. + go func() { + err := ac.cc.dopts.healthCheckFunc(ctx, newStream, setConnectivityState, healthCheckConfig.ServiceName) + if err != nil { + if status.Code(err) == codes.Unimplemented { + if channelz.IsOn() { + channelz.AddTraceEvent(ac.channelzID, &channelz.TraceEventDesc{ + Desc: "Subchannel health check is unimplemented at server side, thus health check is disabled", + Severity: channelz.CtError, + }) + } + grpclog.Error("Subchannel health check is unimplemented at server side, thus health check is disabled") + } else { + grpclog.Errorf("HealthCheckFunc exits with unexpected error %v", err) } - grpclog.Error("Subchannel health check is unimplemented at server side, thus health check is disabled") - } else { - grpclog.Errorf("HealthCheckFunc exits with unexpected error %v", err) } - } + }() } func (ac *addrConn) resetConnectBackoff() { diff --git a/vendor/google.golang.org/grpc/codes/codes.go b/vendor/google.golang.org/grpc/codes/codes.go index d9b9d5782..02738839d 100644 --- a/vendor/google.golang.org/grpc/codes/codes.go +++ b/vendor/google.golang.org/grpc/codes/codes.go @@ -132,7 +132,8 @@ const ( // Unavailable indicates the service is currently unavailable. // This is a most likely a transient condition and may be corrected - // by retrying with a backoff. + // by retrying with a backoff. Note that it is not always safe to retry + // non-idempotent operations. // // See litmus test above for deciding between FailedPrecondition, // Aborted, and Unavailable. diff --git a/vendor/google.golang.org/grpc/credentials/credentials.go b/vendor/google.golang.org/grpc/credentials/credentials.go index 88aff9459..8ea3d4a1d 100644 --- a/vendor/google.golang.org/grpc/credentials/credentials.go +++ b/vendor/google.golang.org/grpc/credentials/credentials.go @@ -278,24 +278,22 @@ type ChannelzSecurityValue interface { // TLSChannelzSecurityValue defines the struct that TLS protocol should return // from GetSecurityValue(), containing security info like cipher and certificate used. type TLSChannelzSecurityValue struct { + ChannelzSecurityValue StandardName string LocalCertificate []byte RemoteCertificate []byte } -func (*TLSChannelzSecurityValue) isChannelzSecurityValue() {} - // OtherChannelzSecurityValue defines the struct that non-TLS protocol should return // from GetSecurityValue(), which contains protocol specific security info. Note // the Value field will be sent to users of channelz requesting channel info, and // thus sensitive info should better be avoided. type OtherChannelzSecurityValue struct { + ChannelzSecurityValue Name string Value proto.Message } -func (*OtherChannelzSecurityValue) isChannelzSecurityValue() {} - var cipherSuiteLookup = map[uint16]string{ tls.TLS_RSA_WITH_RC4_128_SHA: "TLS_RSA_WITH_RC4_128_SHA", tls.TLS_RSA_WITH_3DES_EDE_CBC_SHA: "TLS_RSA_WITH_3DES_EDE_CBC_SHA", diff --git a/vendor/google.golang.org/grpc/dialoptions.go b/vendor/google.golang.org/grpc/dialoptions.go index e114fecbb..e8f34d0d6 100644 --- a/vendor/google.golang.org/grpc/dialoptions.go +++ b/vendor/google.golang.org/grpc/dialoptions.go @@ -39,8 +39,12 @@ import ( // dialOptions configure a Dial call. dialOptions are set by the DialOption // values passed to Dial. type dialOptions struct { - unaryInt UnaryClientInterceptor - streamInt StreamClientInterceptor + unaryInt UnaryClientInterceptor + streamInt StreamClientInterceptor + + chainUnaryInts []UnaryClientInterceptor + chainStreamInts []StreamClientInterceptor + cp Compressor dc Decompressor bs backoff.Strategy @@ -56,7 +60,6 @@ type dialOptions struct { balancerBuilder balancer.Builder // This is to support grpclb. resolverBuilder resolver.Builder - reqHandshake envconfig.RequireHandshakeSetting channelzParentID int64 disableServiceConfig bool disableRetry bool @@ -96,17 +99,6 @@ func newFuncDialOption(f func(*dialOptions)) *funcDialOption { } } -// WithWaitForHandshake blocks until the initial settings frame is received from -// the server before assigning RPCs to the connection. -// -// Deprecated: this is the default behavior, and this option will be removed -// after the 1.18 release. -func WithWaitForHandshake() DialOption { - return newFuncDialOption(func(o *dialOptions) { - o.reqHandshake = envconfig.RequireHandshakeOn - }) -} - // WithWriteBufferSize determines how much data can be batched before doing a // write on the wire. The corresponding memory allocation for this buffer will // be twice the size to keep syscalls low. The default value for this buffer is @@ -152,7 +144,8 @@ func WithInitialConnWindowSize(s int32) DialOption { // WithMaxMsgSize returns a DialOption which sets the maximum message size the // client can receive. // -// Deprecated: use WithDefaultCallOptions(MaxCallRecvMsgSize(s)) instead. +// Deprecated: use WithDefaultCallOptions(MaxCallRecvMsgSize(s)) instead. Will +// be supported throughout 1.x. func WithMaxMsgSize(s int) DialOption { return WithDefaultCallOptions(MaxCallRecvMsgSize(s)) } @@ -168,7 +161,8 @@ func WithDefaultCallOptions(cos ...CallOption) DialOption { // WithCodec returns a DialOption which sets a codec for message marshaling and // unmarshaling. // -// Deprecated: use WithDefaultCallOptions(ForceCodec(_)) instead. +// Deprecated: use WithDefaultCallOptions(ForceCodec(_)) instead. Will be +// supported throughout 1.x. func WithCodec(c Codec) DialOption { return WithDefaultCallOptions(CallCustomCodec(c)) } @@ -177,7 +171,7 @@ func WithCodec(c Codec) DialOption { // message compression. It has lower priority than the compressor set by the // UseCompressor CallOption. // -// Deprecated: use UseCompressor instead. +// Deprecated: use UseCompressor instead. Will be supported throughout 1.x. func WithCompressor(cp Compressor) DialOption { return newFuncDialOption(func(o *dialOptions) { o.cp = cp @@ -192,7 +186,8 @@ func WithCompressor(cp Compressor) DialOption { // message. If no compressor is registered for the encoding, an Unimplemented // status error will be returned. // -// Deprecated: use encoding.RegisterCompressor instead. +// Deprecated: use encoding.RegisterCompressor instead. Will be supported +// throughout 1.x. func WithDecompressor(dc Decompressor) DialOption { return newFuncDialOption(func(o *dialOptions) { o.dc = dc @@ -203,7 +198,7 @@ func WithDecompressor(dc Decompressor) DialOption { // Name resolver will be ignored if this DialOption is specified. // // Deprecated: use the new balancer APIs in balancer package and -// WithBalancerName. +// WithBalancerName. Will be removed in a future 1.x release. func WithBalancer(b Balancer) DialOption { return newFuncDialOption(func(o *dialOptions) { o.balancerBuilder = &balancerWrapperBuilder{ @@ -219,7 +214,8 @@ func WithBalancer(b Balancer) DialOption { // The balancer cannot be overridden by balancer option specified by service // config. // -// This is an EXPERIMENTAL API. +// Deprecated: use WithDefaultServiceConfig and WithDisableServiceConfig +// instead. Will be removed in a future 1.x release. func WithBalancerName(balancerName string) DialOption { builder := balancer.Get(balancerName) if builder == nil { @@ -240,9 +236,10 @@ func withResolverBuilder(b resolver.Builder) DialOption { // WithServiceConfig returns a DialOption which has a channel to read the // service configuration. // -// Deprecated: service config should be received through name resolver, as -// specified here. -// https://github.com/grpc/grpc/blob/master/doc/service_config.md +// Deprecated: service config should be received through name resolver or via +// WithDefaultServiceConfig, as specified at +// https://github.com/grpc/grpc/blob/master/doc/service_config.md. Will be +// removed in a future 1.x release. func WithServiceConfig(c <-chan ServiceConfig) DialOption { return newFuncDialOption(func(o *dialOptions) { o.scChan = c @@ -325,7 +322,8 @@ func WithCredentialsBundle(b credentials.Bundle) DialOption { // WithTimeout returns a DialOption that configures a timeout for dialing a // ClientConn initially. This is valid if and only if WithBlock() is present. // -// Deprecated: use DialContext and context.WithTimeout instead. +// Deprecated: use DialContext and context.WithTimeout instead. Will be +// supported throughout 1.x. func WithTimeout(d time.Duration) DialOption { return newFuncDialOption(func(o *dialOptions) { o.timeout = d @@ -352,7 +350,8 @@ func init() { // is returned by f, gRPC checks the error's Temporary() method to decide if it // should try to reconnect to the network address. // -// Deprecated: use WithContextDialer instead +// Deprecated: use WithContextDialer instead. Will be supported throughout +// 1.x. func WithDialer(f func(string, time.Duration) (net.Conn, error)) DialOption { return WithContextDialer( func(ctx context.Context, addr string) (net.Conn, error) { @@ -414,6 +413,17 @@ func WithUnaryInterceptor(f UnaryClientInterceptor) DialOption { }) } +// WithChainUnaryInterceptor returns a DialOption that specifies the chained +// interceptor for unary RPCs. The first interceptor will be the outer most, +// while the last interceptor will be the inner most wrapper around the real call. +// All interceptors added by this method will be chained, and the interceptor +// defined by WithUnaryInterceptor will always be prepended to the chain. +func WithChainUnaryInterceptor(interceptors ...UnaryClientInterceptor) DialOption { + return newFuncDialOption(func(o *dialOptions) { + o.chainUnaryInts = append(o.chainUnaryInts, interceptors...) + }) +} + // WithStreamInterceptor returns a DialOption that specifies the interceptor for // streaming RPCs. func WithStreamInterceptor(f StreamClientInterceptor) DialOption { @@ -422,6 +432,17 @@ func WithStreamInterceptor(f StreamClientInterceptor) DialOption { }) } +// WithChainStreamInterceptor returns a DialOption that specifies the chained +// interceptor for unary RPCs. The first interceptor will be the outer most, +// while the last interceptor will be the inner most wrapper around the real call. +// All interceptors added by this method will be chained, and the interceptor +// defined by WithStreamInterceptor will always be prepended to the chain. +func WithChainStreamInterceptor(interceptors ...StreamClientInterceptor) DialOption { + return newFuncDialOption(func(o *dialOptions) { + o.chainStreamInts = append(o.chainStreamInts, interceptors...) + }) +} + // WithAuthority returns a DialOption that specifies the value to be used as the // :authority pseudo-header. This value only works with WithInsecure and has no // effect if TransportCredentials are present. @@ -440,12 +461,12 @@ func WithChannelzParentID(id int64) DialOption { }) } -// WithDisableServiceConfig returns a DialOption that causes grpc to ignore any +// WithDisableServiceConfig returns a DialOption that causes gRPC to ignore any // service config provided by the resolver and provides a hint to the resolver // to not fetch service configs. // -// Note that, this dial option only disables service config from resolver. If -// default service config is provided, grpc will use the default service config. +// Note that this dial option only disables service config from resolver. If +// default service config is provided, gRPC will use the default service config. func WithDisableServiceConfig() DialOption { return newFuncDialOption(func(o *dialOptions) { o.disableServiceConfig = true @@ -454,8 +475,10 @@ func WithDisableServiceConfig() DialOption { // WithDefaultServiceConfig returns a DialOption that configures the default // service config, which will be used in cases where: -// 1. WithDisableServiceConfig is called. -// 2. Resolver does not return service config or if the resolver gets and invalid config. +// +// 1. WithDisableServiceConfig is also used. +// 2. Resolver does not return a service config or if the resolver returns an +// invalid service config. // // This API is EXPERIMENTAL. func WithDefaultServiceConfig(s string) DialOption { @@ -511,7 +534,6 @@ func withHealthCheckFunc(f internal.HealthChecker) DialOption { func defaultDialOptions() dialOptions { return dialOptions{ disableRetry: !envconfig.Retry, - reqHandshake: envconfig.RequireHandshake, healthCheckFunc: internal.HealthCheckFunc, copts: transport.ConnectOptions{ WriteBufferSize: defaultWriteBufSize, diff --git a/vendor/google.golang.org/grpc/go.mod b/vendor/google.golang.org/grpc/go.mod index 9f3ef3a53..c1a8340c5 100644 --- a/vendor/google.golang.org/grpc/go.mod +++ b/vendor/google.golang.org/grpc/go.mod @@ -7,13 +7,13 @@ require ( github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b github.com/golang/mock v1.1.1 github.com/golang/protobuf v1.2.0 + github.com/google/go-cmp v0.2.0 golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3 golang.org/x/net v0.0.0-20190311183353-d8887717615a golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be - golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f // indirect golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a - golang.org/x/tools v0.0.0-20190311212946-11955173bddd + golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135 google.golang.org/appengine v1.1.0 // indirect google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 - honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099 + honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc ) diff --git a/vendor/google.golang.org/grpc/health/client.go b/vendor/google.golang.org/grpc/health/client.go index e15f04c22..b43746e61 100644 --- a/vendor/google.golang.org/grpc/health/client.go +++ b/vendor/google.golang.org/grpc/health/client.go @@ -26,6 +26,7 @@ import ( "google.golang.org/grpc" "google.golang.org/grpc/codes" + "google.golang.org/grpc/connectivity" healthpb "google.golang.org/grpc/health/grpc_health_v1" "google.golang.org/grpc/internal" "google.golang.org/grpc/internal/backoff" @@ -51,7 +52,11 @@ func init() { internal.HealthCheckFunc = clientHealthCheck } -func clientHealthCheck(ctx context.Context, newStream func() (interface{}, error), reportHealth func(bool), service string) error { +const healthCheckMethod = "/grpc.health.v1.Health/Watch" + +// This function implements the protocol defined at: +// https://github.com/grpc/grpc/blob/master/doc/health-checking.md +func clientHealthCheck(ctx context.Context, newStream func(string) (interface{}, error), setConnectivityState func(connectivity.State), service string) error { tryCnt := 0 retryConnection: @@ -65,7 +70,8 @@ retryConnection: if ctx.Err() != nil { return nil } - rawS, err := newStream() + setConnectivityState(connectivity.Connecting) + rawS, err := newStream(healthCheckMethod) if err != nil { continue retryConnection } @@ -73,7 +79,7 @@ retryConnection: s, ok := rawS.(grpc.ClientStream) // Ideally, this should never happen. But if it happens, the server is marked as healthy for LBing purposes. if !ok { - reportHealth(true) + setConnectivityState(connectivity.Ready) return fmt.Errorf("newStream returned %v (type %T); want grpc.ClientStream", rawS, rawS) } @@ -89,19 +95,23 @@ retryConnection: // Reports healthy for the LBing purposes if health check is not implemented in the server. if status.Code(err) == codes.Unimplemented { - reportHealth(true) + setConnectivityState(connectivity.Ready) return err } // Reports unhealthy if server's Watch method gives an error other than UNIMPLEMENTED. if err != nil { - reportHealth(false) + setConnectivityState(connectivity.TransientFailure) continue retryConnection } // As a message has been received, removes the need for backoff for the next retry by reseting the try count. tryCnt = 0 - reportHealth(resp.Status == healthpb.HealthCheckResponse_SERVING) + if resp.Status == healthpb.HealthCheckResponse_SERVING { + setConnectivityState(connectivity.Ready) + } else { + setConnectivityState(connectivity.TransientFailure) + } } } } diff --git a/vendor/google.golang.org/grpc/internal/channelz/funcs.go b/vendor/google.golang.org/grpc/internal/channelz/funcs.go index 041520d35..f0744f993 100644 --- a/vendor/google.golang.org/grpc/internal/channelz/funcs.go +++ b/vendor/google.golang.org/grpc/internal/channelz/funcs.go @@ -24,6 +24,7 @@ package channelz import ( + "fmt" "sort" "sync" "sync/atomic" @@ -95,9 +96,14 @@ func (d *dbWrapper) get() *channelMap { // NewChannelzStorage initializes channelz data storage and id generator. // +// This function returns a cleanup function to wait for all channelz state to be reset by the +// grpc goroutines when those entities get closed. By using this cleanup function, we make sure tests +// don't mess up each other, i.e. lingering goroutine from previous test doing entity removal happen +// to remove some entity just register by the new test, since the id space is the same. +// // Note: This function is exported for testing purpose only. User should not call // it in most cases. -func NewChannelzStorage() { +func NewChannelzStorage() (cleanup func() error) { db.set(&channelMap{ topLevelChannels: make(map[int64]struct{}), channels: make(map[int64]*channel), @@ -107,6 +113,28 @@ func NewChannelzStorage() { subChannels: make(map[int64]*subChannel), }) idGen.reset() + return func() error { + var err error + cm := db.get() + if cm == nil { + return nil + } + for i := 0; i < 1000; i++ { + cm.mu.Lock() + if len(cm.topLevelChannels) == 0 && len(cm.servers) == 0 && len(cm.channels) == 0 && len(cm.subChannels) == 0 && len(cm.listenSockets) == 0 && len(cm.normalSockets) == 0 { + cm.mu.Unlock() + // all things stored in the channelz map have been cleared. + return nil + } + cm.mu.Unlock() + time.Sleep(10 * time.Millisecond) + } + + cm.mu.Lock() + err = fmt.Errorf("after 10s the channelz map has not been cleaned up yet, topchannels: %d, servers: %d, channels: %d, subchannels: %d, listen sockets: %d, normal sockets: %d", len(cm.topLevelChannels), len(cm.servers), len(cm.channels), len(cm.subChannels), len(cm.listenSockets), len(cm.normalSockets)) + cm.mu.Unlock() + return err + } } // GetTopChannels returns a slice of top channel's ChannelMetric, along with a diff --git a/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go b/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go index 11be7cd08..3ee8740f1 100644 --- a/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go +++ b/vendor/google.golang.org/grpc/internal/envconfig/envconfig.go @@ -25,40 +25,11 @@ import ( ) const ( - prefix = "GRPC_GO_" - retryStr = prefix + "RETRY" - requireHandshakeStr = prefix + "REQUIRE_HANDSHAKE" -) - -// RequireHandshakeSetting describes the settings for handshaking. -type RequireHandshakeSetting int - -const ( - // RequireHandshakeOn indicates to wait for handshake before considering a - // connection ready/successful. - RequireHandshakeOn RequireHandshakeSetting = iota - // RequireHandshakeOff indicates to not wait for handshake before - // considering a connection ready/successful. - RequireHandshakeOff + prefix = "GRPC_GO_" + retryStr = prefix + "RETRY" ) var ( // Retry is set if retry is explicitly enabled via "GRPC_GO_RETRY=on". Retry = strings.EqualFold(os.Getenv(retryStr), "on") - // RequireHandshake is set based upon the GRPC_GO_REQUIRE_HANDSHAKE - // environment variable. - // - // Will be removed after the 1.18 release. - RequireHandshake = RequireHandshakeOn ) - -func init() { - switch strings.ToLower(os.Getenv(requireHandshakeStr)) { - case "on": - fallthrough - default: - RequireHandshake = RequireHandshakeOn - case "off": - RequireHandshake = RequireHandshakeOff - } -} diff --git a/vendor/google.golang.org/grpc/internal/internal.go b/vendor/google.golang.org/grpc/internal/internal.go index c1d2c690c..bc1f99ac8 100644 --- a/vendor/google.golang.org/grpc/internal/internal.go +++ b/vendor/google.golang.org/grpc/internal/internal.go @@ -23,6 +23,8 @@ package internal import ( "context" "time" + + "google.golang.org/grpc/connectivity" ) var ( @@ -37,10 +39,25 @@ var ( // KeepaliveMinPingTime is the minimum ping interval. This must be 10s by // default, but tests may wish to set it lower for convenience. KeepaliveMinPingTime = 10 * time.Second + // ParseServiceConfig is a function to parse JSON service configs into + // opaque data structures. + ParseServiceConfig func(sc string) (interface{}, error) + // StatusRawProto is exported by status/status.go. This func returns a + // pointer to the wrapped Status proto for a given status.Status without a + // call to proto.Clone(). The returned Status proto should not be mutated by + // the caller. + StatusRawProto interface{} // func (*status.Status) *spb.Status ) // HealthChecker defines the signature of the client-side LB channel health checking function. -type HealthChecker func(ctx context.Context, newStream func() (interface{}, error), reportHealth func(bool), serviceName string) error +// +// The implementation is expected to create a health checking RPC stream by +// calling newStream(), watch for the health status of serviceName, and report +// it's health back by calling setConnectivityState(). +// +// The health checking protocol is defined at: +// https://github.com/grpc/grpc/blob/master/doc/health-checking.md +type HealthChecker func(ctx context.Context, newStream func(string) (interface{}, error), setConnectivityState func(connectivity.State), serviceName string) error const ( // CredsBundleModeFallback switches GoogleDefaultCreds to fallback mode. diff --git a/vendor/google.golang.org/grpc/internal/transport/controlbuf.go b/vendor/google.golang.org/grpc/internal/transport/controlbuf.go index 204ba1588..b8e0aa4db 100644 --- a/vendor/google.golang.org/grpc/internal/transport/controlbuf.go +++ b/vendor/google.golang.org/grpc/internal/transport/controlbuf.go @@ -23,6 +23,7 @@ import ( "fmt" "runtime" "sync" + "sync/atomic" "golang.org/x/net/http2" "golang.org/x/net/http2/hpack" @@ -84,12 +85,24 @@ func (il *itemList) isEmpty() bool { // the control buffer of transport. They represent different aspects of // control tasks, e.g., flow control, settings, streaming resetting, etc. +// maxQueuedTransportResponseFrames is the most queued "transport response" +// frames we will buffer before preventing new reads from occurring on the +// transport. These are control frames sent in response to client requests, +// such as RST_STREAM due to bad headers or settings acks. +const maxQueuedTransportResponseFrames = 50 + +type cbItem interface { + isTransportResponseFrame() bool +} + // registerStream is used to register an incoming stream with loopy writer. type registerStream struct { streamID uint32 wq *writeQuota } +func (*registerStream) isTransportResponseFrame() bool { return false } + // headerFrame is also used to register stream on the client-side. type headerFrame struct { streamID uint32 @@ -102,6 +115,10 @@ type headerFrame struct { onOrphaned func(error) // Valid on client-side } +func (h *headerFrame) isTransportResponseFrame() bool { + return h.cleanup != nil && h.cleanup.rst // Results in a RST_STREAM +} + type cleanupStream struct { streamID uint32 rst bool @@ -109,6 +126,8 @@ type cleanupStream struct { onWrite func() } +func (c *cleanupStream) isTransportResponseFrame() bool { return c.rst } // Results in a RST_STREAM + type dataFrame struct { streamID uint32 endStream bool @@ -119,27 +138,41 @@ type dataFrame struct { onEachWrite func() } +func (*dataFrame) isTransportResponseFrame() bool { return false } + type incomingWindowUpdate struct { streamID uint32 increment uint32 } +func (*incomingWindowUpdate) isTransportResponseFrame() bool { return false } + type outgoingWindowUpdate struct { streamID uint32 increment uint32 } +func (*outgoingWindowUpdate) isTransportResponseFrame() bool { + return false // window updates are throttled by thresholds +} + type incomingSettings struct { ss []http2.Setting } +func (*incomingSettings) isTransportResponseFrame() bool { return true } // Results in a settings ACK + type outgoingSettings struct { ss []http2.Setting } +func (*outgoingSettings) isTransportResponseFrame() bool { return false } + type incomingGoAway struct { } +func (*incomingGoAway) isTransportResponseFrame() bool { return false } + type goAway struct { code http2.ErrCode debugData []byte @@ -147,15 +180,21 @@ type goAway struct { closeConn bool } +func (*goAway) isTransportResponseFrame() bool { return false } + type ping struct { ack bool data [8]byte } +func (*ping) isTransportResponseFrame() bool { return true } + type outFlowControlSizeRequest struct { resp chan uint32 } +func (*outFlowControlSizeRequest) isTransportResponseFrame() bool { return false } + type outStreamState int const ( @@ -238,6 +277,14 @@ type controlBuffer struct { consumerWaiting bool list *itemList err error + + // transportResponseFrames counts the number of queued items that represent + // the response of an action initiated by the peer. trfChan is created + // when transportResponseFrames >= maxQueuedTransportResponseFrames and is + // closed and nilled when transportResponseFrames drops below the + // threshold. Both fields are protected by mu. + transportResponseFrames int + trfChan atomic.Value // *chan struct{} } func newControlBuffer(done <-chan struct{}) *controlBuffer { @@ -248,12 +295,24 @@ func newControlBuffer(done <-chan struct{}) *controlBuffer { } } -func (c *controlBuffer) put(it interface{}) error { +// throttle blocks if there are too many incomingSettings/cleanupStreams in the +// controlbuf. +func (c *controlBuffer) throttle() { + ch, _ := c.trfChan.Load().(*chan struct{}) + if ch != nil { + select { + case <-*ch: + case <-c.done: + } + } +} + +func (c *controlBuffer) put(it cbItem) error { _, err := c.executeAndPut(nil, it) return err } -func (c *controlBuffer) executeAndPut(f func(it interface{}) bool, it interface{}) (bool, error) { +func (c *controlBuffer) executeAndPut(f func(it interface{}) bool, it cbItem) (bool, error) { var wakeUp bool c.mu.Lock() if c.err != nil { @@ -271,6 +330,15 @@ func (c *controlBuffer) executeAndPut(f func(it interface{}) bool, it interface{ c.consumerWaiting = false } c.list.enqueue(it) + if it.isTransportResponseFrame() { + c.transportResponseFrames++ + if c.transportResponseFrames == maxQueuedTransportResponseFrames { + // We are adding the frame that puts us over the threshold; create + // a throttling channel. + ch := make(chan struct{}) + c.trfChan.Store(&ch) + } + } c.mu.Unlock() if wakeUp { select { @@ -304,7 +372,17 @@ func (c *controlBuffer) get(block bool) (interface{}, error) { return nil, c.err } if !c.list.isEmpty() { - h := c.list.dequeue() + h := c.list.dequeue().(cbItem) + if h.isTransportResponseFrame() { + if c.transportResponseFrames == maxQueuedTransportResponseFrames { + // We are removing the frame that put us over the + // threshold; close and clear the throttling channel. + ch := c.trfChan.Load().(*chan struct{}) + close(*ch) + c.trfChan.Store((*chan struct{})(nil)) + } + c.transportResponseFrames-- + } c.mu.Unlock() return h, nil } diff --git a/vendor/google.golang.org/grpc/internal/transport/flowcontrol.go b/vendor/google.golang.org/grpc/internal/transport/flowcontrol.go index 5ea997a7e..f262edd8e 100644 --- a/vendor/google.golang.org/grpc/internal/transport/flowcontrol.go +++ b/vendor/google.golang.org/grpc/internal/transport/flowcontrol.go @@ -149,6 +149,7 @@ func (f *inFlow) maybeAdjust(n uint32) uint32 { n = uint32(math.MaxInt32) } f.mu.Lock() + defer f.mu.Unlock() // estSenderQuota is the receiver's view of the maximum number of bytes the sender // can send without a window update. estSenderQuota := int32(f.limit - (f.pendingData + f.pendingUpdate)) @@ -169,10 +170,8 @@ func (f *inFlow) maybeAdjust(n uint32) uint32 { // is padded; We will fallback on the current available window(at least a 1/4th of the limit). f.delta = n } - f.mu.Unlock() return f.delta } - f.mu.Unlock() return 0 } diff --git a/vendor/google.golang.org/grpc/internal/transport/handler_server.go b/vendor/google.golang.org/grpc/internal/transport/handler_server.go index f2de84d43..78f9ddc3d 100644 --- a/vendor/google.golang.org/grpc/internal/transport/handler_server.go +++ b/vendor/google.golang.org/grpc/internal/transport/handler_server.go @@ -24,6 +24,7 @@ package transport import ( + "bytes" "context" "errors" "fmt" @@ -347,7 +348,7 @@ func (ht *serverHandlerTransport) HandleStreams(startStream func(*Stream), trace ht.stats.HandleRPC(s.ctx, inHeader) } s.trReader = &transportReader{ - reader: &recvBufferReader{ctx: s.ctx, ctxDone: s.ctx.Done(), recv: s.buf}, + reader: &recvBufferReader{ctx: s.ctx, ctxDone: s.ctx.Done(), recv: s.buf, freeBuffer: func(*bytes.Buffer) {}}, windowHandler: func(int) {}, } @@ -361,7 +362,7 @@ func (ht *serverHandlerTransport) HandleStreams(startStream func(*Stream), trace for buf := make([]byte, readSize); ; { n, err := req.Body.Read(buf) if n > 0 { - s.buf.put(recvMsg{data: buf[:n:n]}) + s.buf.put(recvMsg{buffer: bytes.NewBuffer(buf[:n:n])}) buf = buf[n:] } if err != nil { diff --git a/vendor/google.golang.org/grpc/internal/transport/http2_client.go b/vendor/google.golang.org/grpc/internal/transport/http2_client.go index 9dee6db61..41a79c567 100644 --- a/vendor/google.golang.org/grpc/internal/transport/http2_client.go +++ b/vendor/google.golang.org/grpc/internal/transport/http2_client.go @@ -117,6 +117,8 @@ type http2Client struct { onGoAway func(GoAwayReason) onClose func() + + bufferPool *bufferPool } func dial(ctx context.Context, fn func(context.Context, string) (net.Conn, error), addr string) (net.Conn, error) { @@ -249,6 +251,7 @@ func newHTTP2Client(connectCtx, ctx context.Context, addr TargetInfo, opts Conne onGoAway: onGoAway, onClose: onClose, keepaliveEnabled: keepaliveEnabled, + bufferPool: newBufferPool(), } t.controlBuf = newControlBuffer(t.ctxDone) if opts.InitialWindowSize >= defaultWindowSize { @@ -367,6 +370,7 @@ func (t *http2Client) newStream(ctx context.Context, callHdr *CallHdr) *Stream { closeStream: func(err error) { t.CloseStream(s, err) }, + freeBuffer: t.bufferPool.put, }, windowHandler: func(n int) { t.updateWindow(s, uint32(n)) @@ -437,6 +441,15 @@ func (t *http2Client) createHeaderFields(ctx context.Context, callHdr *CallHdr) if md, added, ok := metadata.FromOutgoingContextRaw(ctx); ok { var k string + for k, vv := range md { + // HTTP doesn't allow you to set pseudoheaders after non pseudoheaders were set. + if isReservedHeader(k) { + continue + } + for _, v := range vv { + headerFields = append(headerFields, hpack.HeaderField{Name: k, Value: encodeMetadataHeader(k, v)}) + } + } for _, vv := range added { for i, v := range vv { if i%2 == 0 { @@ -450,15 +463,6 @@ func (t *http2Client) createHeaderFields(ctx context.Context, callHdr *CallHdr) headerFields = append(headerFields, hpack.HeaderField{Name: strings.ToLower(k), Value: encodeMetadataHeader(k, v)}) } } - for k, vv := range md { - // HTTP doesn't allow you to set pseudoheaders after non pseudoheaders were set. - if isReservedHeader(k) { - continue - } - for _, v := range vv { - headerFields = append(headerFields, hpack.HeaderField{Name: k, Value: encodeMetadataHeader(k, v)}) - } - } } if md, ok := t.md.(*metadata.MD); ok { for k, vv := range *md { @@ -489,6 +493,9 @@ func (t *http2Client) createAudience(callHdr *CallHdr) string { } func (t *http2Client) getTrAuthData(ctx context.Context, audience string) (map[string]string, error) { + if len(t.perRPCCreds) == 0 { + return nil, nil + } authData := map[string]string{} for _, c := range t.perRPCCreds { data, err := c.GetRequestMetadata(ctx, audience) @@ -509,7 +516,7 @@ func (t *http2Client) getTrAuthData(ctx context.Context, audience string) (map[s } func (t *http2Client) getCallAuthData(ctx context.Context, audience string, callHdr *CallHdr) (map[string]string, error) { - callAuthData := map[string]string{} + var callAuthData map[string]string // Check if credentials.PerRPCCredentials were provided via call options. // Note: if these credentials are provided both via dial options and call // options, then both sets of credentials will be applied. @@ -521,6 +528,7 @@ func (t *http2Client) getCallAuthData(ctx context.Context, audience string, call if err != nil { return nil, status.Errorf(codes.Internal, "transport: %v", err) } + callAuthData = make(map[string]string, len(data)) for k, v := range data { // Capital header names are illegal in HTTP/2 k = strings.ToLower(k) @@ -549,10 +557,9 @@ func (t *http2Client) NewStream(ctx context.Context, callHdr *CallHdr) (_ *Strea s.write(recvMsg{err: err}) close(s.done) // If headerChan isn't closed, then close it. - if atomic.SwapUint32(&s.headerDone, 1) == 0 { + if atomic.CompareAndSwapUint32(&s.headerChanClosed, 0, 1) { close(s.headerChan) } - } hdr := &headerFrame{ hf: headerFields, @@ -713,7 +720,7 @@ func (t *http2Client) closeStream(s *Stream, err error, rst bool, rstCode http2. s.write(recvMsg{err: err}) } // If headerChan isn't closed, then close it. - if atomic.SwapUint32(&s.headerDone, 1) == 0 { + if atomic.CompareAndSwapUint32(&s.headerChanClosed, 0, 1) { s.noHeaders = true close(s.headerChan) } @@ -765,6 +772,9 @@ func (t *http2Client) Close() error { t.mu.Unlock() return nil } + // Call t.onClose before setting the state to closing to prevent the client + // from attempting to create new streams ASAP. + t.onClose() t.state = closing streams := t.activeStreams t.activeStreams = nil @@ -785,7 +795,6 @@ func (t *http2Client) Close() error { } t.statsHandler.HandleConn(t.ctx, connEnd) } - t.onClose() return err } @@ -794,21 +803,21 @@ func (t *http2Client) Close() error { // stream is closed. If there are no active streams, the transport is closed // immediately. This does nothing if the transport is already draining or // closing. -func (t *http2Client) GracefulClose() error { +func (t *http2Client) GracefulClose() { t.mu.Lock() // Make sure we move to draining only from active. if t.state == draining || t.state == closing { t.mu.Unlock() - return nil + return } t.state = draining active := len(t.activeStreams) t.mu.Unlock() if active == 0 { - return t.Close() + t.Close() + return } t.controlBuf.put(&incomingGoAway{}) - return nil } // Write formats the data into HTTP2 data frame(s) and sends it out. The caller @@ -946,9 +955,10 @@ func (t *http2Client) handleData(f *http2.DataFrame) { // guarantee f.Data() is consumed before the arrival of next frame. // Can this copy be eliminated? if len(f.Data()) > 0 { - data := make([]byte, len(f.Data())) - copy(data, f.Data()) - s.write(recvMsg{data: data}) + buffer := t.bufferPool.get() + buffer.Reset() + buffer.Write(f.Data()) + s.write(recvMsg{buffer: buffer}) } } // The server has closed the stream without sending trailers. Record that @@ -973,9 +983,9 @@ func (t *http2Client) handleRSTStream(f *http2.RSTStreamFrame) { statusCode = codes.Unknown } if statusCode == codes.Canceled { - // Our deadline was already exceeded, and that was likely the cause of - // this cancelation. Alter the status code accordingly. - if d, ok := s.ctx.Deadline(); ok && d.After(time.Now()) { + if d, ok := s.ctx.Deadline(); ok && !d.After(time.Now()) { + // Our deadline was already exceeded, and that was likely the cause + // of this cancelation. Alter the status code accordingly. statusCode = codes.DeadlineExceeded } } @@ -1080,11 +1090,12 @@ func (t *http2Client) handleGoAway(f *http2.GoAwayFrame) { default: t.setGoAwayReason(f) close(t.goAway) - t.state = draining t.controlBuf.put(&incomingGoAway{}) - - // This has to be a new goroutine because we're still using the current goroutine to read in the transport. + // Notify the clientconn about the GOAWAY before we set the state to + // draining, to allow the client to stop attempting to create streams + // before disallowing new streams on this connection. t.onGoAway(t.goAwayReason) + t.state = draining } // All streams with IDs greater than the GoAwayId // and smaller than the previous GoAway ID should be killed. @@ -1142,26 +1153,24 @@ func (t *http2Client) operateHeaders(frame *http2.MetaHeadersFrame) { } endStream := frame.StreamEnded() atomic.StoreUint32(&s.bytesReceived, 1) - initialHeader := atomic.SwapUint32(&s.headerDone, 1) == 0 + initialHeader := atomic.LoadUint32(&s.headerChanClosed) == 0 if !initialHeader && !endStream { - // As specified by RFC 7540, a HEADERS frame (and associated CONTINUATION frames) can only appear - // at the start or end of a stream. Therefore, second HEADERS frame must have EOS bit set. + // As specified by gRPC over HTTP2, a HEADERS frame (and associated CONTINUATION frames) can only appear at the start or end of a stream. Therefore, second HEADERS frame must have EOS bit set. st := status.New(codes.Internal, "a HEADERS frame cannot appear in the middle of a stream") t.closeStream(s, st.Err(), true, http2.ErrCodeProtocol, st, nil, false) return } state := &decodeState{} - // Initialize isGRPC value to be !initialHeader, since if a gRPC ResponseHeader has been received - // which indicates peer speaking gRPC, we are in gRPC mode. + // Initialize isGRPC value to be !initialHeader, since if a gRPC Response-Headers has already been received, then it means that the peer is speaking gRPC and we are in gRPC mode. state.data.isGRPC = !initialHeader if err := state.decodeHeader(frame); err != nil { t.closeStream(s, err, true, http2.ErrCodeProtocol, status.Convert(err), nil, endStream) return } - var isHeader bool + isHeader := false defer func() { if t.statsHandler != nil { if isHeader { @@ -1180,10 +1189,10 @@ func (t *http2Client) operateHeaders(frame *http2.MetaHeadersFrame) { } }() - // If headers haven't been received yet. - if initialHeader { + // If headerChan hasn't been closed yet + if atomic.CompareAndSwapUint32(&s.headerChanClosed, 0, 1) { if !endStream { - // Headers frame is ResponseHeader. + // HEADERS frame block carries a Response-Headers. isHeader = true // These values can be set without any synchronization because // stream goroutine will read it only after seeing a closed @@ -1192,14 +1201,17 @@ func (t *http2Client) operateHeaders(frame *http2.MetaHeadersFrame) { if len(state.data.mdata) > 0 { s.header = state.data.mdata } - close(s.headerChan) - return + } else { + // HEADERS frame block carries a Trailers-Only. + s.noHeaders = true } - // Headers frame is Trailers-only. - s.noHeaders = true close(s.headerChan) } + if !endStream { + return + } + // if client received END_STREAM from server while stream was still active, send RST_STREAM rst := s.getState() == streamActive t.closeStream(s, io.EOF, rst, http2.ErrCodeNo, state.status(), state.data.mdata, true) @@ -1233,6 +1245,7 @@ func (t *http2Client) reader() { // loop to keep reading incoming messages on this transport. for { + t.controlBuf.throttle() frame, err := t.framer.fr.ReadFrame() if t.keepaliveEnabled { atomic.CompareAndSwapUint32(&t.activity, 0, 1) @@ -1320,6 +1333,7 @@ func (t *http2Client) keepalive() { timer.Reset(t.kp.Time) continue } + infof("transport: closing client transport due to idleness.") t.Close() return case <-t.ctx.Done(): diff --git a/vendor/google.golang.org/grpc/internal/transport/http2_server.go b/vendor/google.golang.org/grpc/internal/transport/http2_server.go index 435092e5c..83439b562 100644 --- a/vendor/google.golang.org/grpc/internal/transport/http2_server.go +++ b/vendor/google.golang.org/grpc/internal/transport/http2_server.go @@ -35,9 +35,11 @@ import ( "golang.org/x/net/http2" "golang.org/x/net/http2/hpack" + spb "google.golang.org/genproto/googleapis/rpc/status" "google.golang.org/grpc/codes" "google.golang.org/grpc/credentials" "google.golang.org/grpc/grpclog" + "google.golang.org/grpc/internal" "google.golang.org/grpc/internal/channelz" "google.golang.org/grpc/internal/grpcrand" "google.golang.org/grpc/keepalive" @@ -55,6 +57,9 @@ var ( // ErrHeaderListSizeLimitViolation indicates that the header list size is larger // than the limit set by peer. ErrHeaderListSizeLimitViolation = errors.New("transport: trying to send header list size larger than the limit set by peer") + // statusRawProto is a function to get to the raw status proto wrapped in a + // status.Status without a proto.Clone(). + statusRawProto = internal.StatusRawProto.(func(*status.Status) *spb.Status) ) // http2Server implements the ServerTransport interface with HTTP2. @@ -119,6 +124,7 @@ type http2Server struct { // Fields below are for channelz metric collection. channelzID int64 // channelz unique identification number czData *channelzData + bufferPool *bufferPool } // newHTTP2Server constructs a ServerTransport based on HTTP2. ConnectionError is @@ -220,6 +226,7 @@ func newHTTP2Server(conn net.Conn, config *ServerConfig) (_ ServerTransport, err kep: kep, initialWindowSize: iwz, czData: new(channelzData), + bufferPool: newBufferPool(), } t.controlBuf = newControlBuffer(t.ctxDone) if dynamicWindow { @@ -405,9 +412,10 @@ func (t *http2Server) operateHeaders(frame *http2.MetaHeadersFrame, handle func( s.wq = newWriteQuota(defaultWriteQuota, s.ctxDone) s.trReader = &transportReader{ reader: &recvBufferReader{ - ctx: s.ctx, - ctxDone: s.ctxDone, - recv: s.buf, + ctx: s.ctx, + ctxDone: s.ctxDone, + recv: s.buf, + freeBuffer: t.bufferPool.put, }, windowHandler: func(n int) { t.updateWindow(s, uint32(n)) @@ -428,6 +436,7 @@ func (t *http2Server) operateHeaders(frame *http2.MetaHeadersFrame, handle func( func (t *http2Server) HandleStreams(handle func(*Stream), traceCtx func(context.Context, string) context.Context) { defer close(t.readerDone) for { + t.controlBuf.throttle() frame, err := t.framer.fr.ReadFrame() atomic.StoreUint32(&t.activity, 1) if err != nil { @@ -591,9 +600,10 @@ func (t *http2Server) handleData(f *http2.DataFrame) { // guarantee f.Data() is consumed before the arrival of next frame. // Can this copy be eliminated? if len(f.Data()) > 0 { - data := make([]byte, len(f.Data())) - copy(data, f.Data()) - s.write(recvMsg{data: data}) + buffer := t.bufferPool.get() + buffer.Reset() + buffer.Write(f.Data()) + s.write(recvMsg{buffer: buffer}) } } if f.Header().Flags.Has(http2.FlagDataEndStream) { @@ -757,6 +767,10 @@ func (t *http2Server) WriteHeader(s *Stream, md metadata.MD) error { return nil } +func (t *http2Server) setResetPingStrikes() { + atomic.StoreUint32(&t.resetPingStrikes, 1) +} + func (t *http2Server) writeHeaderLocked(s *Stream) error { // TODO(mmukhi): Benchmark if the performance gets better if count the metadata and other header fields // first and create a slice of that exact size. @@ -771,9 +785,7 @@ func (t *http2Server) writeHeaderLocked(s *Stream) error { streamID: s.id, hf: headerFields, endStream: false, - onWrite: func() { - atomic.StoreUint32(&t.resetPingStrikes, 1) - }, + onWrite: t.setResetPingStrikes, }) if !success { if err != nil { @@ -817,7 +829,7 @@ func (t *http2Server) WriteStatus(s *Stream, st *status.Status) error { headerFields = append(headerFields, hpack.HeaderField{Name: "grpc-status", Value: strconv.Itoa(int(st.Code()))}) headerFields = append(headerFields, hpack.HeaderField{Name: "grpc-message", Value: encodeGrpcMessage(st.Message())}) - if p := st.Proto(); p != nil && len(p.Details) > 0 { + if p := statusRawProto(st); p != nil && len(p.Details) > 0 { stBytes, err := proto.Marshal(p) if err != nil { // TODO: return error instead, when callers are able to handle it. @@ -833,9 +845,7 @@ func (t *http2Server) WriteStatus(s *Stream, st *status.Status) error { streamID: s.id, hf: headerFields, endStream: true, - onWrite: func() { - atomic.StoreUint32(&t.resetPingStrikes, 1) - }, + onWrite: t.setResetPingStrikes, } s.hdrMu.Unlock() success, err := t.controlBuf.execute(t.checkForHeaderListSize, trailingHeader) @@ -887,12 +897,10 @@ func (t *http2Server) Write(s *Stream, hdr []byte, data []byte, opts *Options) e hdr = append(hdr, data[:emptyLen]...) data = data[emptyLen:] df := &dataFrame{ - streamID: s.id, - h: hdr, - d: data, - onEachWrite: func() { - atomic.StoreUint32(&t.resetPingStrikes, 1) - }, + streamID: s.id, + h: hdr, + d: data, + onEachWrite: t.setResetPingStrikes, } if err := s.wq.get(int32(len(hdr) + len(data))); err != nil { select { @@ -958,6 +966,7 @@ func (t *http2Server) keepalive() { select { case <-maxAge.C: // Close the connection after grace period. + infof("transport: closing server transport due to maximum connection age.") t.Close() // Resetting the timer so that the clean-up doesn't deadlock. maxAge.Reset(infinity) @@ -971,6 +980,7 @@ func (t *http2Server) keepalive() { continue } if pingSent { + infof("transport: closing server transport due to idleness.") t.Close() // Resetting the timer so that the clean-up doesn't deadlock. keepalive.Reset(infinity) @@ -1019,13 +1029,7 @@ func (t *http2Server) Close() error { } // deleteStream deletes the stream s from transport's active streams. -func (t *http2Server) deleteStream(s *Stream, eosReceived bool) (oldState streamState) { - oldState = s.swapState(streamDone) - if oldState == streamDone { - // If the stream was already done, return. - return oldState - } - +func (t *http2Server) deleteStream(s *Stream, eosReceived bool) { // In case stream sending and receiving are invoked in separate // goroutines (e.g., bi-directional streaming), cancel needs to be // called to interrupt the potential blocking on other goroutines. @@ -1047,15 +1051,13 @@ func (t *http2Server) deleteStream(s *Stream, eosReceived bool) (oldState stream atomic.AddInt64(&t.czData.streamsFailed, 1) } } - - return oldState } // finishStream closes the stream and puts the trailing headerFrame into controlbuf. func (t *http2Server) finishStream(s *Stream, rst bool, rstCode http2.ErrCode, hdr *headerFrame, eosReceived bool) { - oldState := t.deleteStream(s, eosReceived) - // If the stream is already closed, then don't put trailing header to controlbuf. + oldState := s.swapState(streamDone) if oldState == streamDone { + // If the stream was already done, return. return } @@ -1063,14 +1065,18 @@ func (t *http2Server) finishStream(s *Stream, rst bool, rstCode http2.ErrCode, h streamID: s.id, rst: rst, rstCode: rstCode, - onWrite: func() {}, + onWrite: func() { + t.deleteStream(s, eosReceived) + }, } t.controlBuf.put(hdr) } // closeStream clears the footprint of a stream when the stream is not needed any more. func (t *http2Server) closeStream(s *Stream, rst bool, rstCode http2.ErrCode, eosReceived bool) { + s.swapState(streamDone) t.deleteStream(s, eosReceived) + t.controlBuf.put(&cleanupStream{ streamID: s.id, rst: rst, diff --git a/vendor/google.golang.org/grpc/internal/transport/transport.go b/vendor/google.golang.org/grpc/internal/transport/transport.go index 7f82cbb08..1c1d10670 100644 --- a/vendor/google.golang.org/grpc/internal/transport/transport.go +++ b/vendor/google.golang.org/grpc/internal/transport/transport.go @@ -22,6 +22,7 @@ package transport import ( + "bytes" "context" "errors" "fmt" @@ -39,10 +40,32 @@ import ( "google.golang.org/grpc/tap" ) +type bufferPool struct { + pool sync.Pool +} + +func newBufferPool() *bufferPool { + return &bufferPool{ + pool: sync.Pool{ + New: func() interface{} { + return new(bytes.Buffer) + }, + }, + } +} + +func (p *bufferPool) get() *bytes.Buffer { + return p.pool.Get().(*bytes.Buffer) +} + +func (p *bufferPool) put(b *bytes.Buffer) { + p.pool.Put(b) +} + // recvMsg represents the received msg from the transport. All transport // protocol specific info has been removed. type recvMsg struct { - data []byte + buffer *bytes.Buffer // nil: received some data // io.EOF: stream is completed. data is nil. // other non-nil error: transport failure. data is nil. @@ -117,8 +140,9 @@ type recvBufferReader struct { ctx context.Context ctxDone <-chan struct{} // cache of ctx.Done() (for performance). recv *recvBuffer - last []byte // Stores the remaining data in the previous calls. + last *bytes.Buffer // Stores the remaining data in the previous calls. err error + freeBuffer func(*bytes.Buffer) } // Read reads the next len(p) bytes from last. If last is drained, it tries to @@ -128,10 +152,13 @@ func (r *recvBufferReader) Read(p []byte) (n int, err error) { if r.err != nil { return 0, r.err } - if r.last != nil && len(r.last) > 0 { + if r.last != nil { // Read remaining data left in last call. - copied := copy(p, r.last) - r.last = r.last[copied:] + copied, _ := r.last.Read(p) + if r.last.Len() == 0 { + r.freeBuffer(r.last) + r.last = nil + } return copied, nil } if r.closeStream != nil { @@ -157,6 +184,19 @@ func (r *recvBufferReader) readClient(p []byte) (n int, err error) { // r.readAdditional acts on that message and returns the necessary error. select { case <-r.ctxDone: + // Note that this adds the ctx error to the end of recv buffer, and + // reads from the head. This will delay the error until recv buffer is + // empty, thus will delay ctx cancellation in Recv(). + // + // It's done this way to fix a race between ctx cancel and trailer. The + // race was, stream.Recv() may return ctx error if ctxDone wins the + // race, but stream.Trailer() may return a non-nil md because the stream + // was not marked as done when trailer is received. This closeStream + // call will mark stream as done, thus fix the race. + // + // TODO: delaying ctx error seems like a unnecessary side effect. What + // we really want is to mark the stream as done, and return ctx error + // faster. r.closeStream(ContextErr(r.ctx.Err())) m := <-r.recv.get() return r.readAdditional(m, p) @@ -170,8 +210,13 @@ func (r *recvBufferReader) readAdditional(m recvMsg, p []byte) (n int, err error if m.err != nil { return 0, m.err } - copied := copy(p, m.data) - r.last = m.data[copied:] + copied, _ := m.buffer.Read(p) + if m.buffer.Len() == 0 { + r.freeBuffer(m.buffer) + r.last = nil + } else { + r.last = m.buffer + } return copied, nil } @@ -204,8 +249,8 @@ type Stream struct { // is used to adjust flow control, if needed. requestRead func(int) - headerChan chan struct{} // closed to indicate the end of header metadata. - headerDone uint32 // set when headerChan is closed. Used to avoid closing headerChan multiple times. + headerChan chan struct{} // closed to indicate the end of header metadata. + headerChanClosed uint32 // set when headerChan is closed. Used to avoid closing headerChan multiple times. // hdrMu protects header and trailer metadata on the server-side. hdrMu sync.Mutex @@ -266,6 +311,14 @@ func (s *Stream) waitOnHeader() error { } select { case <-s.ctx.Done(): + // We prefer success over failure when reading messages because we delay + // context error in stream.Read(). To keep behavior consistent, we also + // prefer success here. + select { + case <-s.headerChan: + return nil + default: + } return ContextErr(s.ctx.Err()) case <-s.headerChan: return nil @@ -578,9 +631,12 @@ type ClientTransport interface { // is called only once. Close() error - // GracefulClose starts to tear down the transport. It stops accepting - // new RPCs and wait the completion of the pending RPCs. - GracefulClose() error + // GracefulClose starts to tear down the transport: the transport will stop + // accepting new RPCs and NewStream will return error. Once all streams are + // finished, the transport will close. + // + // It does not block. + GracefulClose() // Write sends the data for the given stream. A nil stream indicates // the write is to be performed on the transport as a whole. diff --git a/vendor/google.golang.org/grpc/naming/naming.go b/vendor/google.golang.org/grpc/naming/naming.go index c99fdbef4..f4c1c8b68 100644 --- a/vendor/google.golang.org/grpc/naming/naming.go +++ b/vendor/google.golang.org/grpc/naming/naming.go @@ -17,9 +17,8 @@ */ // Package naming defines the naming API and related data structures for gRPC. -// The interface is EXPERIMENTAL and may be subject to change. // -// Deprecated: please use package resolver. +// This package is deprecated: please use package resolver instead. package naming // Operation defines the corresponding operations for a name resolution change. diff --git a/vendor/google.golang.org/grpc/picker_wrapper.go b/vendor/google.golang.org/grpc/picker_wrapper.go index f9625496c..45baa2ae1 100644 --- a/vendor/google.golang.org/grpc/picker_wrapper.go +++ b/vendor/google.golang.org/grpc/picker_wrapper.go @@ -120,6 +120,14 @@ func (bp *pickerWrapper) pick(ctx context.Context, failfast bool, opts balancer. bp.mu.Unlock() select { case <-ctx.Done(): + if connectionErr := bp.connectionError(); connectionErr != nil { + switch ctx.Err() { + case context.DeadlineExceeded: + return nil, nil, status.Errorf(codes.DeadlineExceeded, "latest connection error: %v", connectionErr) + case context.Canceled: + return nil, nil, status.Errorf(codes.Canceled, "latest connection error: %v", connectionErr) + } + } return nil, nil, ctx.Err() case <-ch: } diff --git a/vendor/google.golang.org/grpc/pickfirst.go b/vendor/google.golang.org/grpc/pickfirst.go index d1e38aad7..ed05b02ed 100644 --- a/vendor/google.golang.org/grpc/pickfirst.go +++ b/vendor/google.golang.org/grpc/pickfirst.go @@ -51,14 +51,18 @@ type pickfirstBalancer struct { func (b *pickfirstBalancer) HandleResolvedAddrs(addrs []resolver.Address, err error) { if err != nil { - grpclog.Infof("pickfirstBalancer: HandleResolvedAddrs called with error %v", err) + if grpclog.V(2) { + grpclog.Infof("pickfirstBalancer: HandleResolvedAddrs called with error %v", err) + } return } if b.sc == nil { b.sc, err = b.cc.NewSubConn(addrs, balancer.NewSubConnOptions{}) if err != nil { //TODO(yuxuanli): why not change the cc state to Idle? - grpclog.Errorf("pickfirstBalancer: failed to NewSubConn: %v", err) + if grpclog.V(2) { + grpclog.Errorf("pickfirstBalancer: failed to NewSubConn: %v", err) + } return } b.cc.UpdateBalancerState(connectivity.Idle, &picker{sc: b.sc}) @@ -70,9 +74,13 @@ func (b *pickfirstBalancer) HandleResolvedAddrs(addrs []resolver.Address, err er } func (b *pickfirstBalancer) HandleSubConnStateChange(sc balancer.SubConn, s connectivity.State) { - grpclog.Infof("pickfirstBalancer: HandleSubConnStateChange: %p, %v", sc, s) + if grpclog.V(2) { + grpclog.Infof("pickfirstBalancer: HandleSubConnStateChange: %p, %v", sc, s) + } if b.sc != sc { - grpclog.Infof("pickfirstBalancer: ignored state change because sc is not recognized") + if grpclog.V(2) { + grpclog.Infof("pickfirstBalancer: ignored state change because sc is not recognized") + } return } if s == connectivity.Shutdown { diff --git a/vendor/google.golang.org/grpc/preloader.go b/vendor/google.golang.org/grpc/preloader.go new file mode 100644 index 000000000..76acbbcc9 --- /dev/null +++ b/vendor/google.golang.org/grpc/preloader.go @@ -0,0 +1,64 @@ +/* + * + * Copyright 2019 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +package grpc + +import ( + "google.golang.org/grpc/codes" + "google.golang.org/grpc/status" +) + +// PreparedMsg is responsible for creating a Marshalled and Compressed object. +// +// This API is EXPERIMENTAL. +type PreparedMsg struct { + // Struct for preparing msg before sending them + encodedData []byte + hdr []byte + payload []byte +} + +// Encode marshalls and compresses the message using the codec and compressor for the stream. +func (p *PreparedMsg) Encode(s Stream, msg interface{}) error { + ctx := s.Context() + rpcInfo, ok := rpcInfoFromContext(ctx) + if !ok { + return status.Errorf(codes.Internal, "grpc: unable to get rpcInfo") + } + + // check if the context has the relevant information to prepareMsg + if rpcInfo.preloaderInfo == nil { + return status.Errorf(codes.Internal, "grpc: rpcInfo.preloaderInfo is nil") + } + if rpcInfo.preloaderInfo.codec == nil { + return status.Errorf(codes.Internal, "grpc: rpcInfo.preloaderInfo.codec is nil") + } + + // prepare the msg + data, err := encode(rpcInfo.preloaderInfo.codec, msg) + if err != nil { + return err + } + p.encodedData = data + compData, err := compress(data, rpcInfo.preloaderInfo.cp, rpcInfo.preloaderInfo.comp) + if err != nil { + return err + } + p.hdr, p.payload = msgHeader(data, compData) + return nil +} diff --git a/vendor/google.golang.org/grpc/resolver/dns/dns_resolver.go b/vendor/google.golang.org/grpc/resolver/dns/dns_resolver.go index 583559907..297492e87 100644 --- a/vendor/google.golang.org/grpc/resolver/dns/dns_resolver.go +++ b/vendor/google.golang.org/grpc/resolver/dns/dns_resolver.go @@ -66,6 +66,9 @@ var ( var ( defaultResolver netResolver = net.DefaultResolver + // To prevent excessive re-resolution, we enforce a rate limit on DNS + // resolution requests. + minDNSResRate = 30 * time.Second ) var customAuthorityDialler = func(authority string) func(ctx context.Context, network, address string) (net.Conn, error) { @@ -241,7 +244,13 @@ func (d *dnsResolver) watcher() { return case <-d.t.C: case <-d.rn: + if !d.t.Stop() { + // Before resetting a timer, it should be stopped to prevent racing with + // reads on it's channel. + <-d.t.C + } } + result, sc := d.lookup() // Next lookup should happen within an interval defined by d.freq. It may be // more often due to exponential retry on empty address list. @@ -254,6 +263,16 @@ func (d *dnsResolver) watcher() { } d.cc.NewServiceConfig(sc) d.cc.NewAddress(result) + + // Sleep to prevent excessive re-resolutions. Incoming resolution requests + // will be queued in d.rn. + t := time.NewTimer(minDNSResRate) + select { + case <-t.C: + case <-d.ctx.Done(): + t.Stop() + return + } } } diff --git a/vendor/google.golang.org/grpc/resolver/resolver.go b/vendor/google.golang.org/grpc/resolver/resolver.go index 52ec603da..e83da346a 100644 --- a/vendor/google.golang.org/grpc/resolver/resolver.go +++ b/vendor/google.golang.org/grpc/resolver/resolver.go @@ -20,6 +20,10 @@ // All APIs in this package are experimental. package resolver +import ( + "google.golang.org/grpc/serviceconfig" +) + var ( // m is a map from scheme to resolver builder. m = make(map[string]Builder) @@ -100,11 +104,12 @@ type BuildOption struct { // State contains the current Resolver state relevant to the ClientConn. type State struct { - Addresses []Address // Resolved addresses for the target - ServiceConfig string // JSON representation of the service config + Addresses []Address // Resolved addresses for the target + // ServiceConfig is the parsed service config; obtained from + // serviceconfig.Parse. + ServiceConfig serviceconfig.Config // TODO: add Err error - // TODO: add ParsedServiceConfig interface{} } // ClientConn contains the callbacks for resolver to notify any updates @@ -132,6 +137,21 @@ type ClientConn interface { // Target represents a target for gRPC, as specified in: // https://github.com/grpc/grpc/blob/master/doc/naming.md. +// It is parsed from the target string that gets passed into Dial or DialContext by the user. And +// grpc passes it to the resolver and the balancer. +// +// If the target follows the naming spec, and the parsed scheme is registered with grpc, we will +// parse the target string according to the spec. e.g. "dns://some_authority/foo.bar" will be parsed +// into &Target{Scheme: "dns", Authority: "some_authority", Endpoint: "foo.bar"} +// +// If the target does not contain a scheme, we will apply the default scheme, and set the Target to +// be the full target string. e.g. "foo.bar" will be parsed into +// &Target{Scheme: resolver.GetDefaultScheme(), Endpoint: "foo.bar"}. +// +// If the parsed scheme is not registered (i.e. no corresponding resolver available to resolve the +// endpoint), we set the Scheme to be the default scheme, and set the Endpoint to be the full target +// string. e.g. target string "unknown_scheme://authority/endpoint" will be parsed into +// &Target{Scheme: resolver.GetDefaultScheme(), Endpoint: "unknown_scheme://authority/endpoint"}. type Target struct { Scheme string Authority string diff --git a/vendor/google.golang.org/grpc/resolver_conn_wrapper.go b/vendor/google.golang.org/grpc/resolver_conn_wrapper.go index e9cef3a92..6934905b0 100644 --- a/vendor/google.golang.org/grpc/resolver_conn_wrapper.go +++ b/vendor/google.golang.org/grpc/resolver_conn_wrapper.go @@ -138,19 +138,22 @@ func (ccr *ccResolverWrapper) NewServiceConfig(sc string) { return } grpclog.Infof("ccResolverWrapper: got new service config: %v", sc) - if channelz.IsOn() { - ccr.addChannelzTraceEvent(resolver.State{Addresses: ccr.curState.Addresses, ServiceConfig: sc}) + c, err := parseServiceConfig(sc) + if err != nil { + return } - ccr.curState.ServiceConfig = sc + if channelz.IsOn() { + ccr.addChannelzTraceEvent(resolver.State{Addresses: ccr.curState.Addresses, ServiceConfig: c}) + } + ccr.curState.ServiceConfig = c ccr.cc.updateResolverState(ccr.curState) } func (ccr *ccResolverWrapper) addChannelzTraceEvent(s resolver.State) { - if s.ServiceConfig == ccr.curState.ServiceConfig && (len(ccr.curState.Addresses) == 0) == (len(s.Addresses) == 0) { - return - } var updates []string - if s.ServiceConfig != ccr.curState.ServiceConfig { + oldSC, oldOK := ccr.curState.ServiceConfig.(*ServiceConfig) + newSC, newOK := s.ServiceConfig.(*ServiceConfig) + if oldOK != newOK || (oldOK && newOK && oldSC.rawJSONString != newSC.rawJSONString) { updates = append(updates, "service config updated") } if len(ccr.curState.Addresses) > 0 && len(s.Addresses) == 0 { diff --git a/vendor/google.golang.org/grpc/rpc_util.go b/vendor/google.golang.org/grpc/rpc_util.go index 2a595622d..088c3f1b2 100644 --- a/vendor/google.golang.org/grpc/rpc_util.go +++ b/vendor/google.golang.org/grpc/rpc_util.go @@ -694,14 +694,34 @@ func recv(p *parser, c baseCodec, s *transport.Stream, dc Decompressor, m interf return nil } +// Information about RPC type rpcInfo struct { - failfast bool + failfast bool + preloaderInfo *compressorInfo +} + +// Information about Preloader +// Responsible for storing codec, and compressors +// If stream (s) has context s.Context which stores rpcInfo that has non nil +// pointers to codec, and compressors, then we can use preparedMsg for Async message prep +// and reuse marshalled bytes +type compressorInfo struct { + codec baseCodec + cp Compressor + comp encoding.Compressor } type rpcInfoContextKey struct{} -func newContextWithRPCInfo(ctx context.Context, failfast bool) context.Context { - return context.WithValue(ctx, rpcInfoContextKey{}, &rpcInfo{failfast: failfast}) +func newContextWithRPCInfo(ctx context.Context, failfast bool, codec baseCodec, cp Compressor, comp encoding.Compressor) context.Context { + return context.WithValue(ctx, rpcInfoContextKey{}, &rpcInfo{ + failfast: failfast, + preloaderInfo: &compressorInfo{ + codec: codec, + cp: cp, + comp: comp, + }, + }) } func rpcInfoFromContext(ctx context.Context) (s *rpcInfo, ok bool) { diff --git a/vendor/google.golang.org/grpc/server.go b/vendor/google.golang.org/grpc/server.go index 8115828fd..f064b73e5 100644 --- a/vendor/google.golang.org/grpc/server.go +++ b/vendor/google.golang.org/grpc/server.go @@ -42,6 +42,7 @@ import ( "google.golang.org/grpc/grpclog" "google.golang.org/grpc/internal/binarylog" "google.golang.org/grpc/internal/channelz" + "google.golang.org/grpc/internal/grpcsync" "google.golang.org/grpc/internal/transport" "google.golang.org/grpc/keepalive" "google.golang.org/grpc/metadata" @@ -56,6 +57,8 @@ const ( defaultServerMaxSendMessageSize = math.MaxInt32 ) +var statusOK = status.New(codes.OK, "") + type methodHandler func(srv interface{}, ctx context.Context, dec func(interface{}) error, interceptor UnaryServerInterceptor) (interface{}, error) // MethodDesc represents an RPC service's method specification. @@ -86,21 +89,19 @@ type service struct { // Server is a gRPC server to serve RPC requests. type Server struct { - opts options + opts serverOptions mu sync.Mutex // guards following lis map[net.Listener]bool - conns map[io.Closer]bool + conns map[transport.ServerTransport]bool serve bool drain bool cv *sync.Cond // signaled when connections close for GracefulStop m map[string]*service // service name -> service info events trace.EventLog - quit chan struct{} - done chan struct{} - quitOnce sync.Once - doneOnce sync.Once + quit *grpcsync.Event + done *grpcsync.Event channelzRemoveOnce sync.Once serveWG sync.WaitGroup // counts active Serve goroutines for GracefulStop @@ -108,7 +109,7 @@ type Server struct { czData *channelzData } -type options struct { +type serverOptions struct { creds credentials.TransportCredentials codec baseCodec cp Compressor @@ -131,7 +132,7 @@ type options struct { maxHeaderListSize *uint32 } -var defaultServerOptions = options{ +var defaultServerOptions = serverOptions{ maxReceiveMessageSize: defaultServerMaxReceiveMessageSize, maxSendMessageSize: defaultServerMaxSendMessageSize, connectionTimeout: 120 * time.Second, @@ -140,7 +141,33 @@ var defaultServerOptions = options{ } // A ServerOption sets options such as credentials, codec and keepalive parameters, etc. -type ServerOption func(*options) +type ServerOption interface { + apply(*serverOptions) +} + +// EmptyServerOption does not alter the server configuration. It can be embedded +// in another structure to build custom server options. +// +// This API is EXPERIMENTAL. +type EmptyServerOption struct{} + +func (EmptyServerOption) apply(*serverOptions) {} + +// funcServerOption wraps a function that modifies serverOptions into an +// implementation of the ServerOption interface. +type funcServerOption struct { + f func(*serverOptions) +} + +func (fdo *funcServerOption) apply(do *serverOptions) { + fdo.f(do) +} + +func newFuncServerOption(f func(*serverOptions)) *funcServerOption { + return &funcServerOption{ + f: f, + } +} // WriteBufferSize determines how much data can be batched before doing a write on the wire. // The corresponding memory allocation for this buffer will be twice the size to keep syscalls low. @@ -148,9 +175,9 @@ type ServerOption func(*options) // Zero will disable the write buffer such that each write will be on underlying connection. // Note: A Send call may not directly translate to a write. func WriteBufferSize(s int) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.writeBufferSize = s - } + }) } // ReadBufferSize lets you set the size of read buffer, this determines how much data can be read at most @@ -159,25 +186,25 @@ func WriteBufferSize(s int) ServerOption { // Zero will disable read buffer for a connection so data framer can access the underlying // conn directly. func ReadBufferSize(s int) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.readBufferSize = s - } + }) } // InitialWindowSize returns a ServerOption that sets window size for stream. // The lower bound for window size is 64K and any value smaller than that will be ignored. func InitialWindowSize(s int32) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.initialWindowSize = s - } + }) } // InitialConnWindowSize returns a ServerOption that sets window size for a connection. // The lower bound for window size is 64K and any value smaller than that will be ignored. func InitialConnWindowSize(s int32) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.initialConnWindowSize = s - } + }) } // KeepaliveParams returns a ServerOption that sets keepalive and max-age parameters for the server. @@ -187,25 +214,25 @@ func KeepaliveParams(kp keepalive.ServerParameters) ServerOption { kp.Time = time.Second } - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.keepaliveParams = kp - } + }) } // KeepaliveEnforcementPolicy returns a ServerOption that sets keepalive enforcement policy for the server. func KeepaliveEnforcementPolicy(kep keepalive.EnforcementPolicy) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.keepalivePolicy = kep - } + }) } // CustomCodec returns a ServerOption that sets a codec for message marshaling and unmarshaling. // // This will override any lookups by content-subtype for Codecs registered with RegisterCodec. func CustomCodec(codec Codec) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.codec = codec - } + }) } // RPCCompressor returns a ServerOption that sets a compressor for outbound @@ -216,9 +243,9 @@ func CustomCodec(codec Codec) ServerOption { // // Deprecated: use encoding.RegisterCompressor instead. func RPCCompressor(cp Compressor) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.cp = cp - } + }) } // RPCDecompressor returns a ServerOption that sets a decompressor for inbound @@ -227,9 +254,9 @@ func RPCCompressor(cp Compressor) ServerOption { // // Deprecated: use encoding.RegisterCompressor instead. func RPCDecompressor(dc Decompressor) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.dc = dc - } + }) } // MaxMsgSize returns a ServerOption to set the max message size in bytes the server can receive. @@ -243,73 +270,73 @@ func MaxMsgSize(m int) ServerOption { // MaxRecvMsgSize returns a ServerOption to set the max message size in bytes the server can receive. // If this is not set, gRPC uses the default 4MB. func MaxRecvMsgSize(m int) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.maxReceiveMessageSize = m - } + }) } // MaxSendMsgSize returns a ServerOption to set the max message size in bytes the server can send. // If this is not set, gRPC uses the default `math.MaxInt32`. func MaxSendMsgSize(m int) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.maxSendMessageSize = m - } + }) } // MaxConcurrentStreams returns a ServerOption that will apply a limit on the number // of concurrent streams to each ServerTransport. func MaxConcurrentStreams(n uint32) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.maxConcurrentStreams = n - } + }) } // Creds returns a ServerOption that sets credentials for server connections. func Creds(c credentials.TransportCredentials) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.creds = c - } + }) } // UnaryInterceptor returns a ServerOption that sets the UnaryServerInterceptor for the // server. Only one unary interceptor can be installed. The construction of multiple // interceptors (e.g., chaining) can be implemented at the caller. func UnaryInterceptor(i UnaryServerInterceptor) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { if o.unaryInt != nil { panic("The unary server interceptor was already set and may not be reset.") } o.unaryInt = i - } + }) } // StreamInterceptor returns a ServerOption that sets the StreamServerInterceptor for the // server. Only one stream interceptor can be installed. func StreamInterceptor(i StreamServerInterceptor) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { if o.streamInt != nil { panic("The stream server interceptor was already set and may not be reset.") } o.streamInt = i - } + }) } // InTapHandle returns a ServerOption that sets the tap handle for all the server // transport to be created. Only one can be installed. func InTapHandle(h tap.ServerInHandle) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { if o.inTapHandle != nil { panic("The tap handle was already set and may not be reset.") } o.inTapHandle = h - } + }) } // StatsHandler returns a ServerOption that sets the stats handler for the server. func StatsHandler(h stats.Handler) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.statsHandler = h - } + }) } // UnknownServiceHandler returns a ServerOption that allows for adding a custom @@ -319,7 +346,7 @@ func StatsHandler(h stats.Handler) ServerOption { // The handling function has full access to the Context of the request and the // stream, and the invocation bypasses interceptors. func UnknownServiceHandler(streamHandler StreamHandler) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.unknownStreamDesc = &StreamDesc{ StreamName: "unknown_service_handler", Handler: streamHandler, @@ -327,7 +354,7 @@ func UnknownServiceHandler(streamHandler StreamHandler) ServerOption { ClientStreams: true, ServerStreams: true, } - } + }) } // ConnectionTimeout returns a ServerOption that sets the timeout for @@ -337,17 +364,17 @@ func UnknownServiceHandler(streamHandler StreamHandler) ServerOption { // // This API is EXPERIMENTAL. func ConnectionTimeout(d time.Duration) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.connectionTimeout = d - } + }) } // MaxHeaderListSize returns a ServerOption that sets the max (uncompressed) size // of header list that the server is prepared to accept. func MaxHeaderListSize(s uint32) ServerOption { - return func(o *options) { + return newFuncServerOption(func(o *serverOptions) { o.maxHeaderListSize = &s - } + }) } // NewServer creates a gRPC server which has no service registered and has not @@ -355,15 +382,15 @@ func MaxHeaderListSize(s uint32) ServerOption { func NewServer(opt ...ServerOption) *Server { opts := defaultServerOptions for _, o := range opt { - o(&opts) + o.apply(&opts) } s := &Server{ lis: make(map[net.Listener]bool), opts: opts, - conns: make(map[io.Closer]bool), + conns: make(map[transport.ServerTransport]bool), m: make(map[string]*service), - quit: make(chan struct{}), - done: make(chan struct{}), + quit: grpcsync.NewEvent(), + done: grpcsync.NewEvent(), czData: new(channelzData), } s.cv = sync.NewCond(&s.mu) @@ -530,11 +557,9 @@ func (s *Server) Serve(lis net.Listener) error { s.serveWG.Add(1) defer func() { s.serveWG.Done() - select { - // Stop or GracefulStop called; block until done and return nil. - case <-s.quit: - <-s.done - default: + if s.quit.HasFired() { + // Stop or GracefulStop called; block until done and return nil. + <-s.done.Done() } }() @@ -577,7 +602,7 @@ func (s *Server) Serve(lis net.Listener) error { timer := time.NewTimer(tempDelay) select { case <-timer.C: - case <-s.quit: + case <-s.quit.Done(): timer.Stop() return nil } @@ -587,10 +612,8 @@ func (s *Server) Serve(lis net.Listener) error { s.printf("done serving; Accept = %v", err) s.mu.Unlock() - select { - case <-s.quit: + if s.quit.HasFired() { return nil - default: } return err } @@ -611,6 +634,10 @@ func (s *Server) Serve(lis net.Listener) error { // handleRawConn forks a goroutine to handle a just-accepted connection that // has not had any I/O performed on it yet. func (s *Server) handleRawConn(rawConn net.Conn) { + if s.quit.HasFired() { + rawConn.Close() + return + } rawConn.SetDeadline(time.Now().Add(s.opts.connectionTimeout)) conn, authInfo, err := s.useTransportAuthenticator(rawConn) if err != nil { @@ -627,14 +654,6 @@ func (s *Server) handleRawConn(rawConn net.Conn) { return } - s.mu.Lock() - if s.conns == nil { - s.mu.Unlock() - conn.Close() - return - } - s.mu.Unlock() - // Finish handshaking (HTTP2) st := s.newHTTP2Transport(conn, authInfo) if st == nil { @@ -742,6 +761,9 @@ func (s *Server) ServeHTTP(w http.ResponseWriter, r *http.Request) { // traceInfo returns a traceInfo and associates it with stream, if tracing is enabled. // If tracing is not enabled, it returns nil. func (s *Server) traceInfo(st transport.ServerTransport, stream *transport.Stream) (trInfo *traceInfo) { + if !EnableTracing { + return nil + } tr, ok := trace.FromContext(stream.Context()) if !ok { return nil @@ -760,27 +782,27 @@ func (s *Server) traceInfo(st transport.ServerTransport, stream *transport.Strea return trInfo } -func (s *Server) addConn(c io.Closer) bool { +func (s *Server) addConn(st transport.ServerTransport) bool { s.mu.Lock() defer s.mu.Unlock() if s.conns == nil { - c.Close() + st.Close() return false } if s.drain { // Transport added after we drained our existing conns: drain it // immediately. - c.(transport.ServerTransport).Drain() + st.Drain() } - s.conns[c] = true + s.conns[st] = true return true } -func (s *Server) removeConn(c io.Closer) { +func (s *Server) removeConn(st transport.ServerTransport) { s.mu.Lock() defer s.mu.Unlock() if s.conns != nil { - delete(s.conns, c) + delete(s.conns, st) s.cv.Broadcast() } } @@ -952,10 +974,11 @@ func (s *Server) processUnaryRPC(t transport.ServerTransport, stream *transport. } if sh != nil { sh.HandleRPC(stream.Context(), &stats.InPayload{ - RecvTime: time.Now(), - Payload: v, - Data: d, - Length: len(d), + RecvTime: time.Now(), + Payload: v, + WireLength: payInfo.wireLength, + Data: d, + Length: len(d), }) } if binlog != nil { @@ -1051,7 +1074,7 @@ func (s *Server) processUnaryRPC(t transport.ServerTransport, stream *transport. // TODO: Should we be logging if writing status failed here, like above? // Should the logging be in WriteStatus? Should we ignore the WriteStatus // error or allow the stats handler to see it? - err = t.WriteStatus(stream, status.New(codes.OK, "")) + err = t.WriteStatus(stream, statusOK) if binlog != nil { binlog.Log(&binarylog.ServerTrailer{ Trailer: stream.Trailer(), @@ -1209,7 +1232,7 @@ func (s *Server) processStreamingRPC(t transport.ServerTransport, stream *transp ss.trInfo.tr.LazyLog(stringer("OK"), false) ss.mu.Unlock() } - err = t.WriteStatus(ss.s, status.New(codes.OK, "")) + err = t.WriteStatus(ss.s, statusOK) if ss.binlog != nil { ss.binlog.Log(&binarylog.ServerTrailer{ Trailer: ss.s.Trailer(), @@ -1326,15 +1349,11 @@ func ServerTransportStreamFromContext(ctx context.Context) ServerTransportStream // pending RPCs on the client side will get notified by connection // errors. func (s *Server) Stop() { - s.quitOnce.Do(func() { - close(s.quit) - }) + s.quit.Fire() defer func() { s.serveWG.Wait() - s.doneOnce.Do(func() { - close(s.done) - }) + s.done.Fire() }() s.channelzRemoveOnce.Do(func() { @@ -1371,15 +1390,8 @@ func (s *Server) Stop() { // accepting new connections and RPCs and blocks until all the pending RPCs are // finished. func (s *Server) GracefulStop() { - s.quitOnce.Do(func() { - close(s.quit) - }) - - defer func() { - s.doneOnce.Do(func() { - close(s.done) - }) - }() + s.quit.Fire() + defer s.done.Fire() s.channelzRemoveOnce.Do(func() { if channelz.IsOn() { @@ -1397,8 +1409,8 @@ func (s *Server) GracefulStop() { } s.lis = nil if !s.drain { - for c := range s.conns { - c.(transport.ServerTransport).Drain() + for st := range s.conns { + st.Drain() } s.drain = true } diff --git a/vendor/google.golang.org/grpc/service_config.go b/vendor/google.golang.org/grpc/service_config.go index 1c5227426..d0787f1e2 100644 --- a/vendor/google.golang.org/grpc/service_config.go +++ b/vendor/google.golang.org/grpc/service_config.go @@ -25,8 +25,11 @@ import ( "strings" "time" + "google.golang.org/grpc/balancer" "google.golang.org/grpc/codes" "google.golang.org/grpc/grpclog" + "google.golang.org/grpc/internal" + "google.golang.org/grpc/serviceconfig" ) const maxInt = int(^uint(0) >> 1) @@ -61,6 +64,11 @@ type MethodConfig struct { retryPolicy *retryPolicy } +type lbConfig struct { + name string + cfg serviceconfig.LoadBalancingConfig +} + // ServiceConfig is provided by the service provider and contains parameters for how // clients that connect to the service should behave. // @@ -68,10 +76,18 @@ type MethodConfig struct { // through name resolver, as specified here // https://github.com/grpc/grpc/blob/master/doc/service_config.md type ServiceConfig struct { - // LB is the load balancer the service providers recommends. The balancer specified - // via grpc.WithBalancer will override this. + serviceconfig.Config + + // LB is the load balancer the service providers recommends. The balancer + // specified via grpc.WithBalancer will override this. This is deprecated; + // lbConfigs is preferred. If lbConfig and LB are both present, lbConfig + // will be used. LB *string + // lbConfig is the service config's load balancing configuration. If + // lbConfig and LB are both present, lbConfig will be used. + lbConfig *lbConfig + // Methods contains a map for the methods in this service. If there is an // exact match for a method (i.e. /service/method) in the map, use the // corresponding MethodConfig. If there's no exact match, look for the @@ -233,15 +249,27 @@ type jsonMC struct { RetryPolicy *jsonRetryPolicy } +type loadBalancingConfig map[string]json.RawMessage + // TODO(lyuxuan): delete this struct after cleaning up old service config implementation. type jsonSC struct { LoadBalancingPolicy *string + LoadBalancingConfig *[]loadBalancingConfig MethodConfig *[]jsonMC RetryThrottling *retryThrottlingPolicy HealthCheckConfig *healthCheckConfig } +func init() { + internal.ParseServiceConfig = func(sc string) (interface{}, error) { + return parseServiceConfig(sc) + } +} + func parseServiceConfig(js string) (*ServiceConfig, error) { + if len(js) == 0 { + return nil, fmt.Errorf("no JSON service config provided") + } var rsc jsonSC err := json.Unmarshal([]byte(js), &rsc) if err != nil { @@ -255,10 +283,38 @@ func parseServiceConfig(js string) (*ServiceConfig, error) { healthCheckConfig: rsc.HealthCheckConfig, rawJSONString: js, } + if rsc.LoadBalancingConfig != nil { + for i, lbcfg := range *rsc.LoadBalancingConfig { + if len(lbcfg) != 1 { + err := fmt.Errorf("invalid loadBalancingConfig: entry %v does not contain exactly 1 policy/config pair: %q", i, lbcfg) + grpclog.Warningf(err.Error()) + return nil, err + } + var name string + var jsonCfg json.RawMessage + for name, jsonCfg = range lbcfg { + } + builder := balancer.Get(name) + if builder == nil { + continue + } + sc.lbConfig = &lbConfig{name: name} + if parser, ok := builder.(balancer.ConfigParser); ok { + var err error + sc.lbConfig.cfg, err = parser.ParseConfig(jsonCfg) + if err != nil { + return nil, fmt.Errorf("error parsing loadBalancingConfig for policy %q: %v", name, err) + } + } else if string(jsonCfg) != "{}" { + grpclog.Warningf("non-empty balancer configuration %q, but balancer does not implement ParseConfig", string(jsonCfg)) + } + break + } + } + if rsc.MethodConfig == nil { return &sc, nil } - for _, m := range *rsc.MethodConfig { if m.Name == nil { continue @@ -299,11 +355,11 @@ func parseServiceConfig(js string) (*ServiceConfig, error) { } if sc.retryThrottling != nil { - if sc.retryThrottling.MaxTokens <= 0 || - sc.retryThrottling.MaxTokens > 1000 || - sc.retryThrottling.TokenRatio <= 0 { - // Illegal throttling config; disable throttling. - sc.retryThrottling = nil + if mt := sc.retryThrottling.MaxTokens; mt <= 0 || mt > 1000 { + return nil, fmt.Errorf("invalid retry throttling config: maxTokens (%v) out of range (0, 1000]", mt) + } + if tr := sc.retryThrottling.TokenRatio; tr <= 0 { + return nil, fmt.Errorf("invalid retry throttling config: tokenRatio (%v) may not be negative", tr) } } return &sc, nil diff --git a/vendor/google.golang.org/grpc/serviceconfig/serviceconfig.go b/vendor/google.golang.org/grpc/serviceconfig/serviceconfig.go new file mode 100644 index 000000000..53b27875a --- /dev/null +++ b/vendor/google.golang.org/grpc/serviceconfig/serviceconfig.go @@ -0,0 +1,48 @@ +/* + * + * Copyright 2019 gRPC authors. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * + */ + +// Package serviceconfig defines types and methods for operating on gRPC +// service configs. +// +// This package is EXPERIMENTAL. +package serviceconfig + +import ( + "google.golang.org/grpc/internal" +) + +// Config represents an opaque data structure holding a service config. +type Config interface { + isConfig() +} + +// LoadBalancingConfig represents an opaque data structure holding a load +// balancer config. +type LoadBalancingConfig interface { + isLoadBalancingConfig() +} + +// Parse parses the JSON service config provided into an internal form or +// returns an error if the config is invalid. +func Parse(ServiceConfigJSON string) (Config, error) { + c, err := internal.ParseServiceConfig(ServiceConfigJSON) + if err != nil { + return nil, err + } + return c.(Config), err +} diff --git a/vendor/google.golang.org/grpc/status/status.go b/vendor/google.golang.org/grpc/status/status.go index ed36681bb..a1348e9b1 100644 --- a/vendor/google.golang.org/grpc/status/status.go +++ b/vendor/google.golang.org/grpc/status/status.go @@ -36,8 +36,15 @@ import ( "github.com/golang/protobuf/ptypes" spb "google.golang.org/genproto/googleapis/rpc/status" "google.golang.org/grpc/codes" + "google.golang.org/grpc/internal" ) +func init() { + internal.StatusRawProto = statusRawProto +} + +func statusRawProto(s *Status) *spb.Status { return s.s } + // statusError is an alias of a status proto. It implements error and Status, // and a nil statusError should never be returned by this package. type statusError spb.Status @@ -51,6 +58,17 @@ func (se *statusError) GRPCStatus() *Status { return &Status{s: (*spb.Status)(se)} } +// Is implements future error.Is functionality. +// A statusError is equivalent if the code and message are identical. +func (se *statusError) Is(target error) bool { + tse, ok := target.(*statusError) + if !ok { + return false + } + + return proto.Equal((*spb.Status)(se), (*spb.Status)(tse)) +} + // Status represents an RPC status code, message, and details. It is immutable // and should be created with New, Newf, or FromProto. type Status struct { @@ -125,7 +143,7 @@ func FromProto(s *spb.Status) *Status { // Status is returned with codes.Unknown and the original error message. func FromError(err error) (s *Status, ok bool) { if err == nil { - return &Status{s: &spb.Status{Code: int32(codes.OK)}}, true + return nil, true } if se, ok := err.(interface { GRPCStatus() *Status @@ -199,7 +217,7 @@ func Code(err error) codes.Code { func FromContextError(err error) *Status { switch err { case nil: - return New(codes.OK, "") + return nil case context.DeadlineExceeded: return New(codes.DeadlineExceeded, err.Error()) case context.Canceled: diff --git a/vendor/google.golang.org/grpc/stream.go b/vendor/google.golang.org/grpc/stream.go index 6e2bf51e0..134a624a1 100644 --- a/vendor/google.golang.org/grpc/stream.go +++ b/vendor/google.golang.org/grpc/stream.go @@ -30,7 +30,6 @@ import ( "golang.org/x/net/trace" "google.golang.org/grpc/balancer" "google.golang.org/grpc/codes" - "google.golang.org/grpc/connectivity" "google.golang.org/grpc/encoding" "google.golang.org/grpc/grpclog" "google.golang.org/grpc/internal/balancerload" @@ -245,7 +244,7 @@ func newClientStream(ctx context.Context, desc *StreamDesc, cc *ClientConn, meth trInfo.tr.LazyLog(&trInfo.firstLine, false) ctx = trace.NewContext(ctx, trInfo.tr) } - ctx = newContextWithRPCInfo(ctx, c.failFast) + ctx = newContextWithRPCInfo(ctx, c.failFast, c.codec, cp, comp) sh := cc.dopts.copts.StatsHandler var beginTime time.Time if sh != nil { @@ -328,13 +327,23 @@ func newClientStream(ctx context.Context, desc *StreamDesc, cc *ClientConn, meth return cs, nil } -func (cs *clientStream) newAttemptLocked(sh stats.Handler, trInfo *traceInfo) error { - cs.attempt = &csAttempt{ +// newAttemptLocked creates a new attempt with a transport. +// If it succeeds, then it replaces clientStream's attempt with this new attempt. +func (cs *clientStream) newAttemptLocked(sh stats.Handler, trInfo *traceInfo) (retErr error) { + newAttempt := &csAttempt{ cs: cs, dc: cs.cc.dopts.dc, statsHandler: sh, trInfo: trInfo, } + defer func() { + if retErr != nil { + // This attempt is not set in the clientStream, so it's finish won't + // be called. Call it here for stats and trace in case they are not + // nil. + newAttempt.finish(retErr) + } + }() if err := cs.ctx.Err(); err != nil { return toRPCErr(err) @@ -346,8 +355,9 @@ func (cs *clientStream) newAttemptLocked(sh stats.Handler, trInfo *traceInfo) er if trInfo != nil { trInfo.firstLine.SetRemoteAddr(t.RemoteAddr()) } - cs.attempt.t = t - cs.attempt.done = done + newAttempt.t = t + newAttempt.done = done + cs.attempt = newAttempt return nil } @@ -396,11 +406,18 @@ type clientStream struct { serverHeaderBinlogged bool mu sync.Mutex - firstAttempt bool // if true, transparent retry is valid - numRetries int // exclusive of transparent retry attempt(s) - numRetriesSincePushback int // retries since pushback; to reset backoff - finished bool // TODO: replace with atomic cmpxchg or sync.Once? - attempt *csAttempt // the active client stream attempt + firstAttempt bool // if true, transparent retry is valid + numRetries int // exclusive of transparent retry attempt(s) + numRetriesSincePushback int // retries since pushback; to reset backoff + finished bool // TODO: replace with atomic cmpxchg or sync.Once? + // attempt is the active client stream attempt. + // The only place where it is written is the newAttemptLocked method and this method never writes nil. + // So, attempt can be nil only inside newClientStream function when clientStream is first created. + // One of the first things done after clientStream's creation, is to call newAttemptLocked which either + // assigns a non nil value to the attempt or returns an error. If an error is returned from newAttemptLocked, + // then newClientStream calls finish on the clientStream and returns. So, finish method is the only + // place where we need to check if the attempt is nil. + attempt *csAttempt // TODO(hedging): hedging will have multiple attempts simultaneously. committed bool // active attempt committed for retry? buffer []func(a *csAttempt) error // operations to replay on retry @@ -458,8 +475,8 @@ func (cs *clientStream) shouldRetry(err error) error { if cs.attempt.s != nil { <-cs.attempt.s.Done() } - if cs.firstAttempt && !cs.callInfo.failFast && (cs.attempt.s == nil || cs.attempt.s.Unprocessed()) { - // First attempt, wait-for-ready, stream unprocessed: transparently retry. + if cs.firstAttempt && (cs.attempt.s == nil || cs.attempt.s.Unprocessed()) { + // First attempt, stream unprocessed: transparently retry. cs.firstAttempt = false return nil } @@ -677,15 +694,13 @@ func (cs *clientStream) SendMsg(m interface{}) (err error) { if !cs.desc.ClientStreams { cs.sentLast = true } - data, err := encode(cs.codec, m) + + // load hdr, payload, data + hdr, payload, data, err := prepareMsg(m, cs.codec, cs.cp, cs.comp) if err != nil { return err } - compData, err := compress(data, cs.cp, cs.comp) - if err != nil { - return err - } - hdr, payload := msgHeader(data, compData) + // TODO(dfawley): should we be checking len(data) instead? if len(payload) > *cs.callInfo.maxSendMessageSize { return status.Errorf(codes.ResourceExhausted, "trying to send message larger than max (%d vs. %d)", len(payload), *cs.callInfo.maxSendMessageSize) @@ -808,11 +823,11 @@ func (cs *clientStream) finish(err error) { } if cs.attempt != nil { cs.attempt.finish(err) - } - // after functions all rely upon having a stream. - if cs.attempt.s != nil { - for _, o := range cs.opts { - o.after(cs.callInfo) + // after functions all rely upon having a stream. + if cs.attempt.s != nil { + for _, o := range cs.opts { + o.after(cs.callInfo) + } } } cs.cancel() @@ -967,19 +982,18 @@ func (a *csAttempt) finish(err error) { a.mu.Unlock() } -func (ac *addrConn) newClientStream(ctx context.Context, desc *StreamDesc, method string, t transport.ClientTransport, opts ...CallOption) (_ ClientStream, err error) { - ac.mu.Lock() - if ac.transport != t { - ac.mu.Unlock() - return nil, status.Error(codes.Canceled, "the provided transport is no longer valid to use") - } - // transition to CONNECTING state when an attempt starts - if ac.state != connectivity.Connecting { - ac.updateConnectivityState(connectivity.Connecting) - ac.cc.handleSubConnStateChange(ac.acbw, ac.state) - } - ac.mu.Unlock() - +// newClientStream creates a ClientStream with the specified transport, on the +// given addrConn. +// +// It's expected that the given transport is either the same one in addrConn, or +// is already closed. To avoid race, transport is specified separately, instead +// of using ac.transpot. +// +// Main difference between this and ClientConn.NewStream: +// - no retry +// - no service config (or wait for service config) +// - no tracing or stats +func newNonRetryClientStream(ctx context.Context, desc *StreamDesc, method string, t transport.ClientTransport, ac *addrConn, opts ...CallOption) (_ ClientStream, err error) { if t == nil { // TODO: return RPC error here? return nil, errors.New("transport provided is nil") @@ -987,14 +1001,6 @@ func (ac *addrConn) newClientStream(ctx context.Context, desc *StreamDesc, metho // defaultCallInfo contains unnecessary info(i.e. failfast, maxRetryRPCBufferSize), so we just initialize an empty struct. c := &callInfo{} - for _, o := range opts { - if err := o.before(c); err != nil { - return nil, toRPCErr(err) - } - } - c.maxReceiveMessageSize = getMaxSize(nil, c.maxReceiveMessageSize, defaultClientMaxReceiveMessageSize) - c.maxSendMessageSize = getMaxSize(nil, c.maxSendMessageSize, defaultServerMaxSendMessageSize) - // Possible context leak: // The cancel function for the child context we create will only be called // when RecvMsg returns a non-nil error, if the ClientConn is closed, or if @@ -1007,6 +1013,13 @@ func (ac *addrConn) newClientStream(ctx context.Context, desc *StreamDesc, metho } }() + for _, o := range opts { + if err := o.before(c); err != nil { + return nil, toRPCErr(err) + } + } + c.maxReceiveMessageSize = getMaxSize(nil, c.maxReceiveMessageSize, defaultClientMaxReceiveMessageSize) + c.maxSendMessageSize = getMaxSize(nil, c.maxSendMessageSize, defaultServerMaxSendMessageSize) if err := setCallInfoCodec(c); err != nil { return nil, err } @@ -1039,6 +1052,7 @@ func (ac *addrConn) newClientStream(ctx context.Context, desc *StreamDesc, metho callHdr.Creds = c.creds } + // Use a special addrConnStream to avoid retry. as := &addrConnStream{ callHdr: callHdr, ac: ac, @@ -1150,15 +1164,13 @@ func (as *addrConnStream) SendMsg(m interface{}) (err error) { if !as.desc.ClientStreams { as.sentLast = true } - data, err := encode(as.codec, m) + + // load hdr, payload, data + hdr, payld, _, err := prepareMsg(m, as.codec, as.cp, as.comp) if err != nil { return err } - compData, err := compress(data, as.cp, as.comp) - if err != nil { - return err - } - hdr, payld := msgHeader(data, compData) + // TODO(dfawley): should we be checking len(data) instead? if len(payld) > *as.callInfo.maxSendMessageSize { return status.Errorf(codes.ResourceExhausted, "trying to send message larger than max (%d vs. %d)", len(payld), *as.callInfo.maxSendMessageSize) @@ -1395,15 +1407,13 @@ func (ss *serverStream) SendMsg(m interface{}) (err error) { ss.t.IncrMsgSent() } }() - data, err := encode(ss.codec, m) + + // load hdr, payload, data + hdr, payload, data, err := prepareMsg(m, ss.codec, ss.cp, ss.comp) if err != nil { return err } - compData, err := compress(data, ss.cp, ss.comp) - if err != nil { - return err - } - hdr, payload := msgHeader(data, compData) + // TODO(dfawley): should we be checking len(data) instead? if len(payload) > ss.maxSendMessageSize { return status.Errorf(codes.ResourceExhausted, "trying to send message larger than max (%d vs. %d)", len(payload), ss.maxSendMessageSize) @@ -1496,3 +1506,24 @@ func (ss *serverStream) RecvMsg(m interface{}) (err error) { func MethodFromServerStream(stream ServerStream) (string, bool) { return Method(stream.Context()) } + +// prepareMsg returns the hdr, payload and data +// using the compressors passed or using the +// passed preparedmsg +func prepareMsg(m interface{}, codec baseCodec, cp Compressor, comp encoding.Compressor) (hdr, payload, data []byte, err error) { + if preparedMsg, ok := m.(*PreparedMsg); ok { + return preparedMsg.hdr, preparedMsg.payload, preparedMsg.encodedData, nil + } + // The input interface is not a prepared msg. + // Marshal and Compress the data at this point + data, err = encode(codec, m) + if err != nil { + return nil, nil, nil, err + } + compData, err := compress(data, cp, comp) + if err != nil { + return nil, nil, nil, err + } + hdr, payload = msgHeader(data, compData) + return hdr, payload, data, nil +} diff --git a/vendor/google.golang.org/grpc/version.go b/vendor/google.golang.org/grpc/version.go index 092e08825..5411a73a2 100644 --- a/vendor/google.golang.org/grpc/version.go +++ b/vendor/google.golang.org/grpc/version.go @@ -19,4 +19,4 @@ package grpc // Version is the current grpc version. -const Version = "1.20.1" +const Version = "1.23.0"