Merge pull request #35258 from feiskyer/package-aliase
Automatic merge from submit-queue Fix package aliases to follow golang convention Some package aliases are not not align with golang convention https://blog.golang.org/package-names. This PR fixes them. Also adds a verify script and presubmit checks. Fixes #35070. cc/ @timstclair @Random-Liu
This commit is contained in:
@@ -33,7 +33,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/client/restclient"
|
||||
kclientcmd "k8s.io/kubernetes/pkg/client/unversioned/clientcmd"
|
||||
kdns "k8s.io/kubernetes/pkg/dns"
|
||||
dnsConfig "k8s.io/kubernetes/pkg/dns/config"
|
||||
dnsconfig "k8s.io/kubernetes/pkg/dns/config"
|
||||
"k8s.io/kubernetes/pkg/runtime/schema"
|
||||
)
|
||||
|
||||
@@ -58,15 +58,15 @@ func NewKubeDNSServerDefault(config *options.KubeDNSConfig) *KubeDNSServer {
|
||||
ks.dnsBindAddress = config.DNSBindAddress
|
||||
ks.dnsPort = config.DNSPort
|
||||
|
||||
var configSync dnsConfig.Sync
|
||||
var configSync dnsconfig.Sync
|
||||
if config.ConfigMap == "" {
|
||||
glog.V(0).Infof("ConfigMap not configured, using values from command line flags")
|
||||
configSync = dnsConfig.NewNopSync(
|
||||
&dnsConfig.Config{Federations: config.Federations})
|
||||
configSync = dnsconfig.NewNopSync(
|
||||
&dnsconfig.Config{Federations: config.Federations})
|
||||
} else {
|
||||
glog.V(0).Infof("Using configuration read from ConfigMap: %v:%v",
|
||||
config.ConfigMapNs, config.ConfigMap)
|
||||
configSync = dnsConfig.NewSync(
|
||||
configSync = dnsconfig.NewSync(
|
||||
kubeClient, config.ConfigMapNs, config.ConfigMap)
|
||||
}
|
||||
|
||||
|
6
federation/client/cache/cluster_cache.go
vendored
6
federation/client/cache/cluster_cache.go
vendored
@@ -19,13 +19,13 @@ package cache
|
||||
import (
|
||||
"github.com/golang/glog"
|
||||
"k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
kubeCache "k8s.io/kubernetes/pkg/client/cache"
|
||||
kubecache "k8s.io/kubernetes/pkg/client/cache"
|
||||
)
|
||||
|
||||
// StoreToClusterLister makes a Store have the List method of the unversioned.ClusterInterface
|
||||
// The Store must contain (only) clusters.
|
||||
type StoreToClusterLister struct {
|
||||
kubeCache.Store
|
||||
kubecache.Store
|
||||
}
|
||||
|
||||
func (s *StoreToClusterLister) List() (clusters v1beta1.ClusterList, err error) {
|
||||
@@ -41,7 +41,7 @@ type ClusterConditionPredicate func(cluster v1beta1.Cluster) bool
|
||||
|
||||
// storeToClusterConditionLister filters and returns nodes matching the given type and status from the store.
|
||||
type storeToClusterConditionLister struct {
|
||||
store kubeCache.Store
|
||||
store kubecache.Store
|
||||
predicate ClusterConditionPredicate
|
||||
}
|
||||
|
||||
|
@@ -21,8 +21,8 @@ import (
|
||||
"time"
|
||||
|
||||
"github.com/golang/glog"
|
||||
federation_v1beta1 "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
cluster_cache "k8s.io/kubernetes/federation/client/cache"
|
||||
federationv1beta1 "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
clustercache "k8s.io/kubernetes/federation/client/cache"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
@@ -43,14 +43,14 @@ type ClusterController struct {
|
||||
// clusterMonitorPeriod is the period for updating status of cluster
|
||||
clusterMonitorPeriod time.Duration
|
||||
// clusterClusterStatusMap is a mapping of clusterName and cluster status of last sampling
|
||||
clusterClusterStatusMap map[string]federation_v1beta1.ClusterStatus
|
||||
clusterClusterStatusMap map[string]federationv1beta1.ClusterStatus
|
||||
|
||||
// clusterKubeClientMap is a mapping of clusterName and restclient
|
||||
clusterKubeClientMap map[string]ClusterClient
|
||||
|
||||
// cluster framework and store
|
||||
clusterController *cache.Controller
|
||||
clusterStore cluster_cache.StoreToClusterLister
|
||||
clusterStore clustercache.StoreToClusterLister
|
||||
}
|
||||
|
||||
// NewclusterController returns a new cluster controller
|
||||
@@ -59,7 +59,7 @@ func NewclusterController(federationClient federationclientset.Interface, cluste
|
||||
knownClusterSet: make(sets.String),
|
||||
federationClient: federationClient,
|
||||
clusterMonitorPeriod: clusterMonitorPeriod,
|
||||
clusterClusterStatusMap: make(map[string]federation_v1beta1.ClusterStatus),
|
||||
clusterClusterStatusMap: make(map[string]federationv1beta1.ClusterStatus),
|
||||
clusterKubeClientMap: make(map[string]ClusterClient),
|
||||
}
|
||||
cc.clusterStore.Store, cc.clusterController = cache.NewInformer(
|
||||
@@ -71,7 +71,7 @@ func NewclusterController(federationClient federationclientset.Interface, cluste
|
||||
return cc.federationClient.Federation().Clusters().Watch(options)
|
||||
},
|
||||
},
|
||||
&federation_v1beta1.Cluster{},
|
||||
&federationv1beta1.Cluster{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
cache.ResourceEventHandlerFuncs{
|
||||
DeleteFunc: cc.delFromClusterSet,
|
||||
@@ -84,7 +84,7 @@ func NewclusterController(federationClient federationclientset.Interface, cluste
|
||||
// delFromClusterSet delete a cluster from clusterSet and
|
||||
// delete the corresponding restclient from the map clusterKubeClientMap
|
||||
func (cc *ClusterController) delFromClusterSet(obj interface{}) {
|
||||
cluster := obj.(*federation_v1beta1.Cluster)
|
||||
cluster := obj.(*federationv1beta1.Cluster)
|
||||
cc.knownClusterSet.Delete(cluster.Name)
|
||||
delete(cc.clusterKubeClientMap, cluster.Name)
|
||||
}
|
||||
@@ -92,7 +92,7 @@ func (cc *ClusterController) delFromClusterSet(obj interface{}) {
|
||||
// addToClusterSet insert the new cluster to clusterSet and create a corresponding
|
||||
// restclient to map clusterKubeClientMap
|
||||
func (cc *ClusterController) addToClusterSet(obj interface{}) {
|
||||
cluster := obj.(*federation_v1beta1.Cluster)
|
||||
cluster := obj.(*federationv1beta1.Cluster)
|
||||
cc.knownClusterSet.Insert(cluster.Name)
|
||||
// create the restclient of cluster
|
||||
restClient, err := NewClusterClientSet(cluster)
|
||||
@@ -115,7 +115,7 @@ func (cc *ClusterController) Run() {
|
||||
}, cc.clusterMonitorPeriod, wait.NeverStop)
|
||||
}
|
||||
|
||||
func (cc *ClusterController) GetClusterStatus(cluster *federation_v1beta1.Cluster) (*federation_v1beta1.ClusterStatus, error) {
|
||||
func (cc *ClusterController) GetClusterStatus(cluster *federationv1beta1.Cluster) (*federationv1beta1.ClusterStatus, error) {
|
||||
// just get the status of cluster, by requesting the restapi "/healthz"
|
||||
clusterClient, found := cc.clusterKubeClientMap[cluster.Name]
|
||||
if !found {
|
||||
|
@@ -23,9 +23,9 @@ import (
|
||||
"net/http/httptest"
|
||||
"testing"
|
||||
|
||||
federation_v1beta1 "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationv1beta1 "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
controller_util "k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
controllerutil "k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/pkg/api/testapi"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
@@ -35,15 +35,15 @@ import (
|
||||
"k8s.io/kubernetes/pkg/util/uuid"
|
||||
)
|
||||
|
||||
func newCluster(clusterName string, serverUrl string) *federation_v1beta1.Cluster {
|
||||
cluster := federation_v1beta1.Cluster{
|
||||
func newCluster(clusterName string, serverUrl string) *federationv1beta1.Cluster {
|
||||
cluster := federationv1beta1.Cluster{
|
||||
TypeMeta: unversioned.TypeMeta{APIVersion: testapi.Federation.GroupVersion().String()},
|
||||
ObjectMeta: v1.ObjectMeta{
|
||||
UID: uuid.NewUUID(),
|
||||
Name: clusterName,
|
||||
},
|
||||
Spec: federation_v1beta1.ClusterSpec{
|
||||
ServerAddressByClientCIDRs: []federation_v1beta1.ServerAddressByClientCIDR{
|
||||
Spec: federationv1beta1.ClusterSpec{
|
||||
ServerAddressByClientCIDRs: []federationv1beta1.ServerAddressByClientCIDR{
|
||||
{
|
||||
ClientCIDR: "0.0.0.0/0",
|
||||
ServerAddress: serverUrl,
|
||||
@@ -54,13 +54,13 @@ func newCluster(clusterName string, serverUrl string) *federation_v1beta1.Cluste
|
||||
return &cluster
|
||||
}
|
||||
|
||||
func newClusterList(cluster *federation_v1beta1.Cluster) *federation_v1beta1.ClusterList {
|
||||
clusterList := federation_v1beta1.ClusterList{
|
||||
func newClusterList(cluster *federationv1beta1.Cluster) *federationv1beta1.ClusterList {
|
||||
clusterList := federationv1beta1.ClusterList{
|
||||
TypeMeta: unversioned.TypeMeta{APIVersion: testapi.Federation.GroupVersion().String()},
|
||||
ListMeta: unversioned.ListMeta{
|
||||
SelfLink: "foobar",
|
||||
},
|
||||
Items: []federation_v1beta1.Cluster{},
|
||||
Items: []federationv1beta1.Cluster{},
|
||||
}
|
||||
clusterList.Items = append(clusterList.Items, *cluster)
|
||||
return &clusterList
|
||||
@@ -68,7 +68,7 @@ func newClusterList(cluster *federation_v1beta1.Cluster) *federation_v1beta1.Clu
|
||||
|
||||
// init a fake http handler, simulate a federation apiserver, response the "DELETE" "PUT" "GET" "UPDATE"
|
||||
// when "canBeGotten" is false, means that user can not get the cluster cluster from apiserver
|
||||
func createHttptestFakeHandlerForFederation(clusterList *federation_v1beta1.ClusterList, canBeGotten bool) *http.HandlerFunc {
|
||||
func createHttptestFakeHandlerForFederation(clusterList *federationv1beta1.ClusterList, canBeGotten bool) *http.HandlerFunc {
|
||||
fakeHandler := http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) {
|
||||
clusterListString, _ := json.Marshal(*clusterList)
|
||||
w.Header().Set("Content-Type", "application/json")
|
||||
@@ -125,8 +125,8 @@ func TestUpdateClusterStatusOK(t *testing.T) {
|
||||
federationClientSet := federationclientset.NewForConfigOrDie(restclient.AddUserAgent(restClientCfg, "cluster-controller"))
|
||||
|
||||
// Override KubeconfigGetterForCluster to avoid having to setup service accounts and mount files with secret tokens.
|
||||
originalGetter := controller_util.KubeconfigGetterForCluster
|
||||
controller_util.KubeconfigGetterForCluster = func(c *federation_v1beta1.Cluster) clientcmd.KubeconfigGetter {
|
||||
originalGetter := controllerutil.KubeconfigGetterForCluster
|
||||
controllerutil.KubeconfigGetterForCluster = func(c *federationv1beta1.Cluster) clientcmd.KubeconfigGetter {
|
||||
return func() (*clientcmdapi.Config, error) {
|
||||
return &clientcmdapi.Config{}, nil
|
||||
}
|
||||
@@ -141,11 +141,11 @@ func TestUpdateClusterStatusOK(t *testing.T) {
|
||||
if !found {
|
||||
t.Errorf("Failed to Update Cluster Status")
|
||||
} else {
|
||||
if (clusterStatus.Conditions[1].Status != v1.ConditionFalse) || (clusterStatus.Conditions[1].Type != federation_v1beta1.ClusterOffline) {
|
||||
if (clusterStatus.Conditions[1].Status != v1.ConditionFalse) || (clusterStatus.Conditions[1].Type != federationv1beta1.ClusterOffline) {
|
||||
t.Errorf("Failed to Update Cluster Status")
|
||||
}
|
||||
}
|
||||
|
||||
// Reset KubeconfigGetterForCluster
|
||||
controller_util.KubeconfigGetterForCluster = originalGetter
|
||||
controllerutil.KubeconfigGetterForCluster = originalGetter
|
||||
}
|
||||
|
@@ -19,17 +19,17 @@ package configmap
|
||||
import (
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/eventsink"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/controller"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/flowcontrol"
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
@@ -79,7 +79,7 @@ type ConfigMapController struct {
|
||||
func NewConfigMapController(client federationclientset.Interface) *ConfigMapController {
|
||||
broadcaster := record.NewBroadcaster()
|
||||
broadcaster.StartRecordingToSink(eventsink.NewFederatedEventSink(client))
|
||||
recorder := broadcaster.NewRecorder(api_v1.EventSource{Component: "federated-configmaps-controller"})
|
||||
recorder := broadcaster.NewRecorder(apiv1.EventSource{Component: "federated-configmaps-controller"})
|
||||
|
||||
configmapcontroller := &ConfigMapController{
|
||||
federatedApiClient: client,
|
||||
@@ -98,43 +98,43 @@ func NewConfigMapController(client federationclientset.Interface) *ConfigMapCont
|
||||
// Start informer on federated API servers on configmaps that should be federated.
|
||||
configmapcontroller.configmapInformerStore, configmapcontroller.configmapInformerController = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
return client.Core().ConfigMaps(api_v1.NamespaceAll).List(options)
|
||||
ListFunc: func(options apiv1.ListOptions) (pkgruntime.Object, error) {
|
||||
return client.Core().ConfigMaps(apiv1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
return client.Core().ConfigMaps(api_v1.NamespaceAll).Watch(options)
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return client.Core().ConfigMaps(apiv1.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&api_v1.ConfigMap{},
|
||||
&apiv1.ConfigMap{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
util.NewTriggerOnAllChanges(func(obj pkg_runtime.Object) { configmapcontroller.deliverConfigMapObj(obj, 0, false) }))
|
||||
util.NewTriggerOnAllChanges(func(obj pkgruntime.Object) { configmapcontroller.deliverConfigMapObj(obj, 0, false) }))
|
||||
|
||||
// Federated informer on configmaps in members of federation.
|
||||
configmapcontroller.configmapFederatedInformer = util.NewFederatedInformer(
|
||||
client,
|
||||
func(cluster *federation_api.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
func(cluster *federationapi.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
return cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
return targetClient.Core().ConfigMaps(api_v1.NamespaceAll).List(options)
|
||||
ListFunc: func(options apiv1.ListOptions) (pkgruntime.Object, error) {
|
||||
return targetClient.Core().ConfigMaps(apiv1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Core().ConfigMaps(api_v1.NamespaceAll).Watch(options)
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Core().ConfigMaps(apiv1.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&api_v1.ConfigMap{},
|
||||
&apiv1.ConfigMap{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
// Trigger reconciliation whenever something in federated cluster is changed. In most cases it
|
||||
// would be just confirmation that some configmap opration succeeded.
|
||||
util.NewTriggerOnAllChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
configmapcontroller.deliverConfigMapObj(obj, configmapcontroller.configmapReviewDelay, false)
|
||||
},
|
||||
))
|
||||
},
|
||||
|
||||
&util.ClusterLifecycleHandlerFuncs{
|
||||
ClusterAvailable: func(cluster *federation_api.Cluster) {
|
||||
ClusterAvailable: func(cluster *federationapi.Cluster) {
|
||||
// When new cluster becomes available process all the configmaps again.
|
||||
configmapcontroller.clusterDeliverer.DeliverAt(allClustersKey, nil, time.Now().Add(configmapcontroller.clusterAvailableDelay))
|
||||
},
|
||||
@@ -143,19 +143,19 @@ func NewConfigMapController(client federationclientset.Interface) *ConfigMapCont
|
||||
|
||||
// Federated updater along with Create/Update/Delete operations.
|
||||
configmapcontroller.federatedUpdater = util.NewFederatedUpdater(configmapcontroller.configmapFederatedInformer,
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
configmap := obj.(*api_v1.ConfigMap)
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
configmap := obj.(*apiv1.ConfigMap)
|
||||
_, err := client.Core().ConfigMaps(configmap.Namespace).Create(configmap)
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
configmap := obj.(*api_v1.ConfigMap)
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
configmap := obj.(*apiv1.ConfigMap)
|
||||
_, err := client.Core().ConfigMaps(configmap.Namespace).Update(configmap)
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
configmap := obj.(*api_v1.ConfigMap)
|
||||
err := client.Core().ConfigMaps(configmap.Namespace).Delete(configmap.Name, &api_v1.DeleteOptions{})
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
configmap := obj.(*apiv1.ConfigMap)
|
||||
err := client.Core().ConfigMaps(configmap.Namespace).Delete(configmap.Name, &apiv1.DeleteOptions{})
|
||||
return err
|
||||
})
|
||||
return configmapcontroller
|
||||
@@ -179,7 +179,7 @@ func (configmapcontroller *ConfigMapController) Run(stopChan <-chan struct{}) {
|
||||
}
|
||||
|
||||
func (configmapcontroller *ConfigMapController) deliverConfigMapObj(obj interface{}, delay time.Duration, failed bool) {
|
||||
configmap := obj.(*api_v1.ConfigMap)
|
||||
configmap := obj.(*apiv1.ConfigMap)
|
||||
configmapcontroller.deliverConfigMap(types.NamespacedName{Namespace: configmap.Namespace, Name: configmap.Name}, delay, failed)
|
||||
}
|
||||
|
||||
@@ -220,7 +220,7 @@ func (configmapcontroller *ConfigMapController) reconcileConfigMapsOnClusterChan
|
||||
configmapcontroller.clusterDeliverer.DeliverAt(allClustersKey, nil, time.Now().Add(configmapcontroller.clusterAvailableDelay))
|
||||
}
|
||||
for _, obj := range configmapcontroller.configmapInformerStore.List() {
|
||||
configmap := obj.(*api_v1.ConfigMap)
|
||||
configmap := obj.(*apiv1.ConfigMap)
|
||||
configmapcontroller.deliverConfigMap(types.NamespacedName{Namespace: configmap.Namespace, Name: configmap.Name},
|
||||
configmapcontroller.smallDelay, false)
|
||||
}
|
||||
@@ -247,7 +247,7 @@ func (configmapcontroller *ConfigMapController) reconcileConfigMap(configmap typ
|
||||
glog.V(8).Infof("Skipping not federated config map: %s", key)
|
||||
return
|
||||
}
|
||||
baseConfigMap := baseConfigMapObj.(*api_v1.ConfigMap)
|
||||
baseConfigMap := baseConfigMapObj.(*apiv1.ConfigMap)
|
||||
|
||||
clusters, err := configmapcontroller.configmapFederatedInformer.GetReadyClusters()
|
||||
if err != nil {
|
||||
@@ -266,7 +266,7 @@ func (configmapcontroller *ConfigMapController) reconcileConfigMap(configmap typ
|
||||
}
|
||||
|
||||
// Do not modify data.
|
||||
desiredConfigMap := &api_v1.ConfigMap{
|
||||
desiredConfigMap := &apiv1.ConfigMap{
|
||||
ObjectMeta: util.DeepCopyRelevantObjectMeta(baseConfigMap.ObjectMeta),
|
||||
Data: baseConfigMap.Data,
|
||||
}
|
||||
@@ -281,7 +281,7 @@ func (configmapcontroller *ConfigMapController) reconcileConfigMap(configmap typ
|
||||
ClusterName: cluster.Name,
|
||||
})
|
||||
} else {
|
||||
clusterConfigMap := clusterConfigMapObj.(*api_v1.ConfigMap)
|
||||
clusterConfigMap := clusterConfigMapObj.(*apiv1.ConfigMap)
|
||||
|
||||
// Update existing configmap, if needed.
|
||||
if !util.ConfigMapEquivalent(desiredConfigMap, clusterConfigMap) {
|
||||
|
@@ -21,13 +21,13 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fake_fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fakefedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
. "k8s.io/kubernetes/federation/pkg/federation-controller/util/test"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -36,29 +36,29 @@ import (
|
||||
)
|
||||
|
||||
func TestConfigMapController(t *testing.T) {
|
||||
cluster1 := NewCluster("cluster1", api_v1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", api_v1.ConditionTrue)
|
||||
cluster1 := NewCluster("cluster1", apiv1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", apiv1.ConditionTrue)
|
||||
|
||||
fakeClient := &fake_fedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federation_api.ClusterList{Items: []federation_api.Cluster{*cluster1}})
|
||||
RegisterFakeList("configmaps", &fakeClient.Fake, &api_v1.ConfigMapList{Items: []api_v1.ConfigMap{}})
|
||||
fakeClient := &fakefedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federationapi.ClusterList{Items: []federationapi.Cluster{*cluster1}})
|
||||
RegisterFakeList("configmaps", &fakeClient.Fake, &apiv1.ConfigMapList{Items: []apiv1.ConfigMap{}})
|
||||
configmapWatch := RegisterFakeWatch("configmaps", &fakeClient.Fake)
|
||||
clusterWatch := RegisterFakeWatch("clusters", &fakeClient.Fake)
|
||||
|
||||
cluster1Client := &fake_kubeclientset.Clientset{}
|
||||
cluster1Client := &fakekubeclientset.Clientset{}
|
||||
cluster1Watch := RegisterFakeWatch("configmaps", &cluster1Client.Fake)
|
||||
RegisterFakeList("configmaps", &cluster1Client.Fake, &api_v1.ConfigMapList{Items: []api_v1.ConfigMap{}})
|
||||
RegisterFakeList("configmaps", &cluster1Client.Fake, &apiv1.ConfigMapList{Items: []apiv1.ConfigMap{}})
|
||||
cluster1CreateChan := RegisterFakeCopyOnCreate("configmaps", &cluster1Client.Fake, cluster1Watch)
|
||||
cluster1UpdateChan := RegisterFakeCopyOnUpdate("configmaps", &cluster1Client.Fake, cluster1Watch)
|
||||
|
||||
cluster2Client := &fake_kubeclientset.Clientset{}
|
||||
cluster2Client := &fakekubeclientset.Clientset{}
|
||||
cluster2Watch := RegisterFakeWatch("configmaps", &cluster2Client.Fake)
|
||||
RegisterFakeList("configmaps", &cluster2Client.Fake, &api_v1.ConfigMapList{Items: []api_v1.ConfigMap{}})
|
||||
RegisterFakeList("configmaps", &cluster2Client.Fake, &apiv1.ConfigMapList{Items: []apiv1.ConfigMap{}})
|
||||
cluster2CreateChan := RegisterFakeCopyOnCreate("configmaps", &cluster2Client.Fake, cluster2Watch)
|
||||
|
||||
configmapController := NewConfigMapController(fakeClient)
|
||||
informer := ToFederatedInformerForTestOnly(configmapController.configmapFederatedInformer)
|
||||
informer.SetClientFactory(func(cluster *federation_api.Cluster) (kubeclientset.Interface, error) {
|
||||
informer.SetClientFactory(func(cluster *federationapi.Cluster) (kubeclientset.Interface, error) {
|
||||
switch cluster.Name {
|
||||
case cluster1.Name:
|
||||
return cluster1Client, nil
|
||||
@@ -77,8 +77,8 @@ func TestConfigMapController(t *testing.T) {
|
||||
stop := make(chan struct{})
|
||||
configmapController.Run(stop)
|
||||
|
||||
configmap1 := &api_v1.ConfigMap{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
configmap1 := &apiv1.ConfigMap{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-configmap",
|
||||
Namespace: "ns",
|
||||
SelfLink: "/api/v1/namespaces/ns/configmaps/test-configmap",
|
||||
@@ -136,7 +136,7 @@ func TestConfigMapController(t *testing.T) {
|
||||
close(stop)
|
||||
}
|
||||
|
||||
func GetConfigMapFromChan(c chan runtime.Object) *api_v1.ConfigMap {
|
||||
configmap := GetObjectFromChan(c).(*api_v1.ConfigMap)
|
||||
func GetConfigMapFromChan(c chan runtime.Object) *apiv1.ConfigMap {
|
||||
configmap := GetObjectFromChan(c).(*apiv1.ConfigMap)
|
||||
return configmap
|
||||
}
|
||||
|
@@ -21,21 +21,21 @@ import (
|
||||
"reflect"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/eventsink"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/errors"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
extensionsv1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/controller"
|
||||
"k8s.io/kubernetes/pkg/conversion"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/flowcontrol"
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
@@ -87,7 +87,7 @@ type DaemonSetController struct {
|
||||
func NewDaemonSetController(client federationclientset.Interface) *DaemonSetController {
|
||||
broadcaster := record.NewBroadcaster()
|
||||
broadcaster.StartRecordingToSink(eventsink.NewFederatedEventSink(client))
|
||||
recorder := broadcaster.NewRecorder(api_v1.EventSource{Component: "federated-daemonset-controller"})
|
||||
recorder := broadcaster.NewRecorder(apiv1.EventSource{Component: "federated-daemonset-controller"})
|
||||
|
||||
daemonsetcontroller := &DaemonSetController{
|
||||
federatedApiClient: client,
|
||||
@@ -106,28 +106,28 @@ func NewDaemonSetController(client federationclientset.Interface) *DaemonSetCont
|
||||
// Start informer in federated API servers on daemonsets that should be federated.
|
||||
daemonsetcontroller.daemonsetInformerStore, daemonsetcontroller.daemonsetInformerController = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
return client.Extensions().DaemonSets(api_v1.NamespaceAll).List(options)
|
||||
ListFunc: func(options apiv1.ListOptions) (pkgruntime.Object, error) {
|
||||
return client.Extensions().DaemonSets(apiv1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
return client.Extensions().DaemonSets(api_v1.NamespaceAll).Watch(options)
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return client.Extensions().DaemonSets(apiv1.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&extensionsv1.DaemonSet{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
util.NewTriggerOnAllChanges(func(obj pkg_runtime.Object) { daemonsetcontroller.deliverDaemonSetObj(obj, 0, false) }))
|
||||
util.NewTriggerOnAllChanges(func(obj pkgruntime.Object) { daemonsetcontroller.deliverDaemonSetObj(obj, 0, false) }))
|
||||
|
||||
// Federated informer on daemonsets in members of federation.
|
||||
daemonsetcontroller.daemonsetFederatedInformer = util.NewFederatedInformer(
|
||||
client,
|
||||
func(cluster *federation_api.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
func(cluster *federationapi.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
return cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
return targetClient.Extensions().DaemonSets(api_v1.NamespaceAll).List(options)
|
||||
ListFunc: func(options apiv1.ListOptions) (pkgruntime.Object, error) {
|
||||
return targetClient.Extensions().DaemonSets(apiv1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Extensions().DaemonSets(api_v1.NamespaceAll).Watch(options)
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Extensions().DaemonSets(apiv1.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&extensionsv1.DaemonSet{},
|
||||
@@ -135,14 +135,14 @@ func NewDaemonSetController(client federationclientset.Interface) *DaemonSetCont
|
||||
// Trigger reconciliation whenever something in federated cluster is changed. In most cases it
|
||||
// would be just confirmation that some daemonset opration succeeded.
|
||||
util.NewTriggerOnAllChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
daemonsetcontroller.deliverDaemonSetObj(obj, daemonsetcontroller.daemonsetReviewDelay, false)
|
||||
},
|
||||
))
|
||||
},
|
||||
|
||||
&util.ClusterLifecycleHandlerFuncs{
|
||||
ClusterAvailable: func(cluster *federation_api.Cluster) {
|
||||
ClusterAvailable: func(cluster *federationapi.Cluster) {
|
||||
// When new cluster becomes available process all the daemonsets again.
|
||||
daemonsetcontroller.clusterDeliverer.DeliverAt(allClustersKey, nil, time.Now().Add(daemonsetcontroller.clusterAvailableDelay))
|
||||
},
|
||||
@@ -151,7 +151,7 @@ func NewDaemonSetController(client federationclientset.Interface) *DaemonSetCont
|
||||
|
||||
// Federated updater along with Create/Update/Delete operations.
|
||||
daemonsetcontroller.federatedUpdater = util.NewFederatedUpdater(daemonsetcontroller.daemonsetFederatedInformer,
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
daemonset := obj.(*extensionsv1.DaemonSet)
|
||||
glog.V(4).Infof("Attempting to create daemonset: %s/%s", daemonset.Namespace, daemonset.Name)
|
||||
_, err := client.Extensions().DaemonSets(daemonset.Namespace).Create(daemonset)
|
||||
@@ -162,7 +162,7 @@ func NewDaemonSetController(client federationclientset.Interface) *DaemonSetCont
|
||||
}
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
daemonset := obj.(*extensionsv1.DaemonSet)
|
||||
glog.V(4).Infof("Attempting to update daemonset: %s/%s", daemonset.Namespace, daemonset.Name)
|
||||
_, err := client.Extensions().DaemonSets(daemonset.Namespace).Update(daemonset)
|
||||
@@ -173,10 +173,10 @@ func NewDaemonSetController(client federationclientset.Interface) *DaemonSetCont
|
||||
}
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
daemonset := obj.(*extensionsv1.DaemonSet)
|
||||
glog.V(4).Infof("Attempting to delete daemonset: %s/%s", daemonset.Namespace, daemonset.Name)
|
||||
err := client.Extensions().DaemonSets(daemonset.Namespace).Delete(daemonset.Name, &api_v1.DeleteOptions{})
|
||||
err := client.Extensions().DaemonSets(daemonset.Namespace).Delete(daemonset.Name, &apiv1.DeleteOptions{})
|
||||
if err != nil {
|
||||
glog.Errorf("Error deleting daemonset %s/%s/: %v", daemonset.Namespace, daemonset.Name, err)
|
||||
} else {
|
||||
@@ -190,7 +190,7 @@ func NewDaemonSetController(client federationclientset.Interface) *DaemonSetCont
|
||||
daemonsetcontroller.removeFinalizerFunc,
|
||||
daemonsetcontroller.addFinalizerFunc,
|
||||
// objNameFunc
|
||||
func(obj pkg_runtime.Object) string {
|
||||
func(obj pkgruntime.Object) string {
|
||||
daemonset := obj.(*extensionsv1.DaemonSet)
|
||||
return daemonset.Name
|
||||
},
|
||||
@@ -204,7 +204,7 @@ func NewDaemonSetController(client federationclientset.Interface) *DaemonSetCont
|
||||
}
|
||||
|
||||
// Returns true if the given object has the given finalizer in its ObjectMeta.
|
||||
func (daemonsetcontroller *DaemonSetController) hasFinalizerFunc(obj pkg_runtime.Object, finalizer string) bool {
|
||||
func (daemonsetcontroller *DaemonSetController) hasFinalizerFunc(obj pkgruntime.Object, finalizer string) bool {
|
||||
daemonset := obj.(*extensionsv1.DaemonSet)
|
||||
for i := range daemonset.ObjectMeta.Finalizers {
|
||||
if string(daemonset.ObjectMeta.Finalizers[i]) == finalizer {
|
||||
@@ -216,7 +216,7 @@ func (daemonsetcontroller *DaemonSetController) hasFinalizerFunc(obj pkg_runtime
|
||||
|
||||
// Removes the finalizer from the given objects ObjectMeta.
|
||||
// Assumes that the given object is a daemonset.
|
||||
func (daemonsetcontroller *DaemonSetController) removeFinalizerFunc(obj pkg_runtime.Object, finalizer string) (pkg_runtime.Object, error) {
|
||||
func (daemonsetcontroller *DaemonSetController) removeFinalizerFunc(obj pkgruntime.Object, finalizer string) (pkgruntime.Object, error) {
|
||||
daemonset := obj.(*extensionsv1.DaemonSet)
|
||||
newFinalizers := []string{}
|
||||
hasFinalizer := false
|
||||
@@ -241,7 +241,7 @@ func (daemonsetcontroller *DaemonSetController) removeFinalizerFunc(obj pkg_runt
|
||||
|
||||
// Adds the given finalizer to the given objects ObjectMeta.
|
||||
// Assumes that the given object is a daemonset.
|
||||
func (daemonsetcontroller *DaemonSetController) addFinalizerFunc(obj pkg_runtime.Object, finalizer string) (pkg_runtime.Object, error) {
|
||||
func (daemonsetcontroller *DaemonSetController) addFinalizerFunc(obj pkgruntime.Object, finalizer string) (pkgruntime.Object, error) {
|
||||
daemonset := obj.(*extensionsv1.DaemonSet)
|
||||
daemonset.ObjectMeta.Finalizers = append(daemonset.ObjectMeta.Finalizers, finalizer)
|
||||
daemonset, err := daemonsetcontroller.federatedApiClient.Extensions().DaemonSets(daemonset.Namespace).Update(daemonset)
|
||||
|
@@ -22,16 +22,16 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fake_fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fakefedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
//"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
. "k8s.io/kubernetes/federation/pkg/federation-controller/util/test"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
extensionsv1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
|
||||
@@ -39,30 +39,30 @@ import (
|
||||
)
|
||||
|
||||
func TestDaemonSetController(t *testing.T) {
|
||||
cluster1 := NewCluster("cluster1", api_v1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", api_v1.ConditionTrue)
|
||||
cluster1 := NewCluster("cluster1", apiv1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", apiv1.ConditionTrue)
|
||||
|
||||
fakeClient := &fake_fedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federation_api.ClusterList{Items: []federation_api.Cluster{*cluster1}})
|
||||
fakeClient := &fakefedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federationapi.ClusterList{Items: []federationapi.Cluster{*cluster1}})
|
||||
RegisterFakeList("daemonsets", &fakeClient.Fake, &extensionsv1.DaemonSetList{Items: []extensionsv1.DaemonSet{}})
|
||||
daemonsetWatch := RegisterFakeWatch("daemonsets", &fakeClient.Fake)
|
||||
// daemonsetUpdateChan := RegisterFakeCopyOnUpdate("daemonsets", &fakeClient.Fake, daemonsetWatch)
|
||||
clusterWatch := RegisterFakeWatch("clusters", &fakeClient.Fake)
|
||||
|
||||
cluster1Client := &fake_kubeclientset.Clientset{}
|
||||
cluster1Client := &fakekubeclientset.Clientset{}
|
||||
cluster1Watch := RegisterFakeWatch("daemonsets", &cluster1Client.Fake)
|
||||
RegisterFakeList("daemonsets", &cluster1Client.Fake, &extensionsv1.DaemonSetList{Items: []extensionsv1.DaemonSet{}})
|
||||
cluster1CreateChan := RegisterFakeCopyOnCreate("daemonsets", &cluster1Client.Fake, cluster1Watch)
|
||||
// cluster1UpdateChan := RegisterFakeCopyOnUpdate("daemonsets", &cluster1Client.Fake, cluster1Watch)
|
||||
|
||||
cluster2Client := &fake_kubeclientset.Clientset{}
|
||||
cluster2Client := &fakekubeclientset.Clientset{}
|
||||
cluster2Watch := RegisterFakeWatch("daemonsets", &cluster2Client.Fake)
|
||||
RegisterFakeList("daemonsets", &cluster2Client.Fake, &extensionsv1.DaemonSetList{Items: []extensionsv1.DaemonSet{}})
|
||||
cluster2CreateChan := RegisterFakeCopyOnCreate("daemonsets", &cluster2Client.Fake, cluster2Watch)
|
||||
|
||||
daemonsetController := NewDaemonSetController(fakeClient)
|
||||
informer := ToFederatedInformerForTestOnly(daemonsetController.daemonsetFederatedInformer)
|
||||
informer.SetClientFactory(func(cluster *federation_api.Cluster) (kubeclientset.Interface, error) {
|
||||
informer.SetClientFactory(func(cluster *federationapi.Cluster) (kubeclientset.Interface, error) {
|
||||
switch cluster.Name {
|
||||
case cluster1.Name:
|
||||
return cluster1Client, nil
|
||||
@@ -82,7 +82,7 @@ func TestDaemonSetController(t *testing.T) {
|
||||
daemonsetController.Run(stop)
|
||||
|
||||
daemonset1 := extensionsv1.DaemonSet{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-daemonset",
|
||||
Namespace: "ns",
|
||||
SelfLink: "/api/v1/namespaces/ns/daemonsets/test-daemonset",
|
||||
@@ -102,7 +102,7 @@ func TestDaemonSetController(t *testing.T) {
|
||||
updatedDaemonSet := GetDaemonSetFromChan(daemonsetUpdateChan)
|
||||
assert.True(t, daemonsetController.hasFinalizerFunc(updatedDaemonSet, deletionhelper.FinalizerDeleteFromUnderlyingClusters))
|
||||
updatedDaemonSet = GetDaemonSetFromChan(daemonsetUpdateChan)
|
||||
assert.True(t, daemonsetController.hasFinalizerFunc(updatedDaemonSet, api_v1.FinalizerOrphan))
|
||||
assert.True(t, daemonsetController.hasFinalizerFunc(updatedDaemonSet, apiv1.FinalizerOrphan))
|
||||
daemonset1 = *updatedDaemonSet
|
||||
*/
|
||||
createdDaemonSet := GetDaemonSetFromChan(cluster1CreateChan)
|
||||
|
@@ -23,13 +23,13 @@ import (
|
||||
"time"
|
||||
|
||||
fedv1 "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fake_fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
fakefedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
. "k8s.io/kubernetes/federation/pkg/federation-controller/util/test"
|
||||
"k8s.io/kubernetes/pkg/api/meta"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
extensionsv1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -83,19 +83,19 @@ func TestDeploymentController(t *testing.T) {
|
||||
cluster1 := NewCluster("cluster1", apiv1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", apiv1.ConditionTrue)
|
||||
|
||||
fakeClient := &fake_fedclientset.Clientset{}
|
||||
fakeClient := &fakefedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &fedv1.ClusterList{Items: []fedv1.Cluster{*cluster1}})
|
||||
deploymentsWatch := RegisterFakeWatch("deployments", &fakeClient.Fake)
|
||||
clusterWatch := RegisterFakeWatch("clusters", &fakeClient.Fake)
|
||||
|
||||
cluster1Client := &fake_kubeclientset.Clientset{}
|
||||
cluster1Client := &fakekubeclientset.Clientset{}
|
||||
cluster1Watch := RegisterFakeWatch("deployments", &cluster1Client.Fake)
|
||||
_ = RegisterFakeWatch("pods", &cluster1Client.Fake)
|
||||
RegisterFakeList("deployments", &cluster1Client.Fake, &extensionsv1.DeploymentList{Items: []extensionsv1.Deployment{}})
|
||||
cluster1CreateChan := RegisterFakeCopyOnCreate("deployments", &cluster1Client.Fake, cluster1Watch)
|
||||
cluster1UpdateChan := RegisterFakeCopyOnUpdate("deployments", &cluster1Client.Fake, cluster1Watch)
|
||||
|
||||
cluster2Client := &fake_kubeclientset.Clientset{}
|
||||
cluster2Client := &fakekubeclientset.Clientset{}
|
||||
cluster2Watch := RegisterFakeWatch("deployments", &cluster2Client.Fake)
|
||||
_ = RegisterFakeWatch("pods", &cluster2Client.Fake)
|
||||
RegisterFakeList("deployments", &cluster2Client.Fake, &extensionsv1.DeploymentList{Items: []extensionsv1.Deployment{}})
|
||||
|
@@ -21,7 +21,7 @@ import (
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
@@ -29,13 +29,13 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/errors"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
extensions_v1beta1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
extensionsv1beta1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/controller"
|
||||
"k8s.io/kubernetes/pkg/conversion"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/flowcontrol"
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
@@ -134,17 +134,17 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
// Start informer in federated API servers on ingresses that should be federated.
|
||||
ic.ingressInformerStore, ic.ingressInformerController = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
return client.Extensions().Ingresses(api.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options v1.ListOptions) (watch.Interface, error) {
|
||||
return client.Extensions().Ingresses(api.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&extensions_v1beta1.Ingress{},
|
||||
&extensionsv1beta1.Ingress{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
util.NewTriggerOnAllChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
ic.deliverIngressObj(obj, 0, false)
|
||||
},
|
||||
))
|
||||
@@ -152,29 +152,29 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
// Federated informer on ingresses in members of federation.
|
||||
ic.ingressFederatedInformer = util.NewFederatedInformer(
|
||||
client,
|
||||
func(cluster *federation_api.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
func(cluster *federationapi.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
return cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
return targetClient.Extensions().Ingresses(api.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options v1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Extensions().Ingresses(api.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&extensions_v1beta1.Ingress{},
|
||||
&extensionsv1beta1.Ingress{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
// Trigger reconciliation whenever something in federated cluster is changed. In most cases it
|
||||
// would be just confirmation that some ingress operation succeeded.
|
||||
util.NewTriggerOnAllChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
ic.deliverIngressObj(obj, ic.ingressReviewDelay, false)
|
||||
},
|
||||
))
|
||||
},
|
||||
|
||||
&util.ClusterLifecycleHandlerFuncs{
|
||||
ClusterAvailable: func(cluster *federation_api.Cluster) {
|
||||
ClusterAvailable: func(cluster *federationapi.Cluster) {
|
||||
// When new cluster becomes available process all the ingresses again, and configure it's ingress controller's configmap with the correct UID
|
||||
ic.clusterDeliverer.DeliverAfter(cluster.Name, cluster, ic.clusterAvailableDelay)
|
||||
},
|
||||
@@ -184,11 +184,11 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
// Federated informer on configmaps for ingress controllers in members of the federation.
|
||||
ic.configMapFederatedInformer = util.NewFederatedInformer(
|
||||
client,
|
||||
func(cluster *federation_api.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
func(cluster *federationapi.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
glog.V(4).Infof("Returning new informer for cluster %q", cluster.Name)
|
||||
return cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
if targetClient == nil {
|
||||
glog.Errorf("Internal error: targetClient is nil")
|
||||
}
|
||||
@@ -206,14 +206,14 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
// Trigger reconcilation whenever the ingress controller's configmap in a federated cluster is changed. In most cases it
|
||||
// would be just confirmation that the configmap for the ingress controller is correct.
|
||||
util.NewTriggerOnAllChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
ic.deliverConfigMapObj(cluster.Name, obj, ic.configMapReviewDelay, false)
|
||||
},
|
||||
))
|
||||
},
|
||||
|
||||
&util.ClusterLifecycleHandlerFuncs{
|
||||
ClusterAvailable: func(cluster *federation_api.Cluster) {
|
||||
ClusterAvailable: func(cluster *federationapi.Cluster) {
|
||||
ic.clusterDeliverer.DeliverAfter(cluster.Name, cluster, ic.clusterAvailableDelay)
|
||||
},
|
||||
},
|
||||
@@ -221,8 +221,8 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
|
||||
// Federated ingress updater along with Create/Update/Delete operations.
|
||||
ic.federatedIngressUpdater = util.NewFederatedUpdater(ic.ingressFederatedInformer,
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
glog.V(4).Infof("Attempting to create Ingress: %v", ingress)
|
||||
_, err := client.Extensions().Ingresses(ingress.Namespace).Create(ingress)
|
||||
if err != nil {
|
||||
@@ -232,8 +232,8 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
}
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
glog.V(4).Infof("Attempting to update Ingress: %v", ingress)
|
||||
_, err := client.Extensions().Ingresses(ingress.Namespace).Update(ingress)
|
||||
if err != nil {
|
||||
@@ -243,8 +243,8 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
}
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
glog.V(4).Infof("Attempting to delete Ingress: %v", ingress)
|
||||
err := client.Extensions().Ingresses(ingress.Namespace).Delete(ingress.Name, &v1.DeleteOptions{})
|
||||
return err
|
||||
@@ -252,14 +252,14 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
|
||||
// Federated configmap updater along with Create/Update/Delete operations. Only Update should ever be called.
|
||||
ic.federatedConfigMapUpdater = util.NewFederatedUpdater(ic.configMapFederatedInformer,
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
configMap := obj.(*v1.ConfigMap)
|
||||
configMapName := types.NamespacedName{Name: configMap.Name, Namespace: configMap.Namespace}
|
||||
glog.Errorf("Internal error: Incorrectly attempting to create ConfigMap: %q", configMapName)
|
||||
_, err := client.Core().ConfigMaps(configMap.Namespace).Create(configMap)
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
configMap := obj.(*v1.ConfigMap)
|
||||
configMapName := types.NamespacedName{Name: configMap.Name, Namespace: configMap.Namespace}
|
||||
glog.V(4).Infof("Attempting to update ConfigMap: %v", configMap)
|
||||
@@ -271,7 +271,7 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
}
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
configMap := obj.(*v1.ConfigMap)
|
||||
configMapName := types.NamespacedName{Name: configMap.Name, Namespace: configMap.Namespace}
|
||||
glog.Errorf("Internal error: Incorrectly attempting to delete ConfigMap: %q", configMapName)
|
||||
@@ -284,8 +284,8 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
ic.removeFinalizerFunc,
|
||||
ic.addFinalizerFunc,
|
||||
// objNameFunc
|
||||
func(obj pkg_runtime.Object) string {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
func(obj pkgruntime.Object) string {
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
return ingress.Name
|
||||
},
|
||||
ic.updateTimeout,
|
||||
@@ -297,8 +297,8 @@ func NewIngressController(client federationclientset.Interface) *IngressControll
|
||||
}
|
||||
|
||||
// Returns true if the given object has the given finalizer in its ObjectMeta.
|
||||
func (ic *IngressController) hasFinalizerFunc(obj pkg_runtime.Object, finalizer string) bool {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
func (ic *IngressController) hasFinalizerFunc(obj pkgruntime.Object, finalizer string) bool {
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
for i := range ingress.ObjectMeta.Finalizers {
|
||||
if string(ingress.ObjectMeta.Finalizers[i]) == finalizer {
|
||||
return true
|
||||
@@ -309,8 +309,8 @@ func (ic *IngressController) hasFinalizerFunc(obj pkg_runtime.Object, finalizer
|
||||
|
||||
// Removes the finalizer from the given objects ObjectMeta.
|
||||
// Assumes that the given object is a ingress.
|
||||
func (ic *IngressController) removeFinalizerFunc(obj pkg_runtime.Object, finalizer string) (pkg_runtime.Object, error) {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
func (ic *IngressController) removeFinalizerFunc(obj pkgruntime.Object, finalizer string) (pkgruntime.Object, error) {
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
newFinalizers := []string{}
|
||||
hasFinalizer := false
|
||||
for i := range ingress.ObjectMeta.Finalizers {
|
||||
@@ -334,8 +334,8 @@ func (ic *IngressController) removeFinalizerFunc(obj pkg_runtime.Object, finaliz
|
||||
|
||||
// Adds the given finalizer to the given objects ObjectMeta.
|
||||
// Assumes that the given object is a ingress.
|
||||
func (ic *IngressController) addFinalizerFunc(obj pkg_runtime.Object, finalizer string) (pkg_runtime.Object, error) {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
func (ic *IngressController) addFinalizerFunc(obj pkgruntime.Object, finalizer string) (pkgruntime.Object, error) {
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
ingress.ObjectMeta.Finalizers = append(ingress.ObjectMeta.Finalizers, finalizer)
|
||||
ingress, err := ic.federatedApiClient.Extensions().Ingresses(ingress.Namespace).Update(ingress)
|
||||
if err != nil {
|
||||
@@ -394,7 +394,7 @@ func (ic *IngressController) Run(stopChan <-chan struct{}) {
|
||||
}
|
||||
|
||||
func (ic *IngressController) deliverIngressObj(obj interface{}, delay time.Duration, failed bool) {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
ic.deliverIngress(types.NamespacedName{Namespace: ingress.Namespace, Name: ingress.Name}, delay, failed)
|
||||
}
|
||||
|
||||
@@ -474,7 +474,7 @@ func (ic *IngressController) reconcileIngressesOnClusterChange(clusterName strin
|
||||
}
|
||||
|
||||
for _, obj := range ingressList {
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
nsName := types.NamespacedName{Name: ingress.Name, Namespace: ingress.Namespace}
|
||||
glog.V(4).Infof("Delivering federated ingress %q for cluster %q", nsName, clusterName)
|
||||
ic.deliverIngress(nsName, ic.smallDelay, false)
|
||||
@@ -543,7 +543,7 @@ func (ic *IngressController) reconcileConfigMapForCluster(clusterName string) {
|
||||
In cases 2 and 3, the configmaps will be updated in the next cycle, triggered by the federation cluster update(s)
|
||||
|
||||
*/
|
||||
func (ic *IngressController) reconcileConfigMap(cluster *federation_api.Cluster, configMap *v1.ConfigMap) {
|
||||
func (ic *IngressController) reconcileConfigMap(cluster *federationapi.Cluster, configMap *v1.ConfigMap) {
|
||||
ic.Lock() // TODO: Reduce the scope of this master election lock.
|
||||
defer ic.Unlock()
|
||||
|
||||
@@ -586,7 +586,7 @@ func (ic *IngressController) reconcileConfigMap(cluster *federation_api.Cluster,
|
||||
If there is no elected master cluster, an error is returned.
|
||||
All other clusters must use the ingress UID of the elected master.
|
||||
*/
|
||||
func (ic *IngressController) getMasterCluster() (master *federation_api.Cluster, ingressUID string, err error) {
|
||||
func (ic *IngressController) getMasterCluster() (master *federationapi.Cluster, ingressUID string, err error) {
|
||||
clusters, err := ic.configMapFederatedInformer.GetReadyClusters()
|
||||
if err != nil {
|
||||
glog.Errorf("Failed to get cluster list: %v", err)
|
||||
@@ -607,10 +607,10 @@ func (ic *IngressController) getMasterCluster() (master *federation_api.Cluster,
|
||||
updateClusterIngressUIDToMasters takes the ingress UID annotation on the master cluster and applies it to cluster.
|
||||
If there is no master cluster, then fallbackUID is used (and hence this cluster becomes the master).
|
||||
*/
|
||||
func (ic *IngressController) updateClusterIngressUIDToMasters(cluster *federation_api.Cluster, fallbackUID string) {
|
||||
func (ic *IngressController) updateClusterIngressUIDToMasters(cluster *federationapi.Cluster, fallbackUID string) {
|
||||
masterCluster, masterUID, err := ic.getMasterCluster()
|
||||
clusterObj, clusterErr := conversion.NewCloner().DeepCopy(cluster) // Make a clone so that we don't clobber our input param
|
||||
cluster, ok := clusterObj.(*federation_api.Cluster)
|
||||
cluster, ok := clusterObj.(*federationapi.Cluster)
|
||||
if clusterErr != nil || !ok {
|
||||
glog.Errorf("Internal error: Failed clone cluster resource while attempting to add master ingress UID annotation (%q = %q) from master cluster %q to cluster %q, will try again later: %v", uidAnnotationKey, masterUID, masterCluster.Name, cluster.Name, err)
|
||||
return
|
||||
@@ -655,7 +655,7 @@ func (ic *IngressController) isClusterReady(clusterName string) bool {
|
||||
|
||||
// updateAnnotationOnIngress updates the annotation with the given key on the given federated ingress.
|
||||
// Queues the ingress for resync when done.
|
||||
func (ic *IngressController) updateAnnotationOnIngress(ingress *extensions_v1beta1.Ingress, key, value string) {
|
||||
func (ic *IngressController) updateAnnotationOnIngress(ingress *extensionsv1beta1.Ingress, key, value string) {
|
||||
if ingress.ObjectMeta.Annotations == nil {
|
||||
ingress.ObjectMeta.Annotations = make(map[string]string)
|
||||
}
|
||||
@@ -693,9 +693,9 @@ func (ic *IngressController) reconcileIngress(ingress types.NamespacedName) {
|
||||
return
|
||||
}
|
||||
baseIngressObj, err := conversion.NewCloner().DeepCopy(baseIngressObjFromStore)
|
||||
baseIngress, ok := baseIngressObj.(*extensions_v1beta1.Ingress)
|
||||
baseIngress, ok := baseIngressObj.(*extensionsv1beta1.Ingress)
|
||||
if err != nil || !ok {
|
||||
glog.Errorf("Internal Error %v : Object retrieved from ingressInformerStore with key %q is not of correct type *extensions_v1beta1.Ingress: %v", err, key, baseIngressObj)
|
||||
glog.Errorf("Internal Error %v : Object retrieved from ingressInformerStore with key %q is not of correct type *extensionsv1beta1.Ingress: %v", err, key, baseIngressObj)
|
||||
} else {
|
||||
glog.V(4).Infof("Base (federated) ingress: %v", baseIngress)
|
||||
}
|
||||
@@ -720,7 +720,7 @@ func (ic *IngressController) reconcileIngress(ingress types.NamespacedName) {
|
||||
ic.deliverIngress(ingress, 0, true)
|
||||
return
|
||||
}
|
||||
baseIngress = updatedIngressObj.(*extensions_v1beta1.Ingress)
|
||||
baseIngress = updatedIngressObj.(*extensionsv1beta1.Ingress)
|
||||
|
||||
glog.V(3).Infof("Syncing ingress %s in underlying clusters", baseIngress.Name)
|
||||
|
||||
@@ -744,7 +744,7 @@ func (ic *IngressController) reconcileIngress(ingress types.NamespacedName) {
|
||||
ic.deliverIngress(ingress, 0, true)
|
||||
return
|
||||
}
|
||||
desiredIngress := &extensions_v1beta1.Ingress{}
|
||||
desiredIngress := &extensionsv1beta1.Ingress{}
|
||||
objMeta, err := conversion.NewCloner().DeepCopy(baseIngress.ObjectMeta)
|
||||
if err != nil {
|
||||
glog.Errorf("Error deep copying ObjectMeta: %v", err)
|
||||
@@ -757,9 +757,9 @@ func (ic *IngressController) reconcileIngress(ingress types.NamespacedName) {
|
||||
if !ok {
|
||||
glog.Errorf("Internal error: Failed to cast to v1.ObjectMeta: %v", objMeta)
|
||||
}
|
||||
desiredIngress.Spec = objSpec.(extensions_v1beta1.IngressSpec)
|
||||
desiredIngress.Spec = objSpec.(extensionsv1beta1.IngressSpec)
|
||||
if !ok {
|
||||
glog.Errorf("Internal error: Failed to cast to extensions_v1beta1.Ingressespec: %v", objSpec)
|
||||
glog.Errorf("Internal error: Failed to cast to extensionsv1beta1.Ingressespec: %v", objSpec)
|
||||
}
|
||||
glog.V(4).Infof("Desired Ingress: %v", desiredIngress)
|
||||
|
||||
@@ -799,7 +799,7 @@ func (ic *IngressController) reconcileIngress(ingress types.NamespacedName) {
|
||||
glog.V(4).Infof("No annotation %q exists on ingress %q in federation and waiting for ingress in cluster %s. Not queueing create operation for ingress until annotation exists", staticIPNameKeyWritable, ingress, firstClusterName)
|
||||
}
|
||||
} else {
|
||||
clusterIngress := clusterIngressObj.(*extensions_v1beta1.Ingress)
|
||||
clusterIngress := clusterIngressObj.(*extensionsv1beta1.Ingress)
|
||||
glog.V(4).Infof("Found existing Ingress %s in cluster %s - checking if update is required (in either direction)", ingress, cluster.Name)
|
||||
clusterIPName, clusterIPNameExists := clusterIngress.ObjectMeta.Annotations[staticIPNameKeyReadonly]
|
||||
baseLBStatusExists := len(baseIngress.Status.LoadBalancer.Ingress) > 0
|
||||
@@ -898,7 +898,7 @@ func (ic *IngressController) reconcileIngress(ingress types.NamespacedName) {
|
||||
}
|
||||
|
||||
// delete deletes the given ingress or returns error if the deletion was not complete.
|
||||
func (ic *IngressController) delete(ingress *extensions_v1beta1.Ingress) error {
|
||||
func (ic *IngressController) delete(ingress *extensionsv1beta1.Ingress) error {
|
||||
glog.V(3).Infof("Handling deletion of ingress: %v", *ingress)
|
||||
_, err := ic.deletionHelper.HandleObjectInUnderlyingClusters(ingress)
|
||||
if err != nil {
|
||||
|
@@ -22,17 +22,17 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fake_fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fakefedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
. "k8s.io/kubernetes/federation/pkg/federation-controller/util/test"
|
||||
"k8s.io/kubernetes/pkg/api/errors"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
extensions_v1beta1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
extensionsv1beta1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -41,40 +41,40 @@ import (
|
||||
)
|
||||
|
||||
func TestIngressController(t *testing.T) {
|
||||
fakeClusterList := federation_api.ClusterList{Items: []federation_api.Cluster{}}
|
||||
fakeConfigMapList1 := api_v1.ConfigMapList{Items: []api_v1.ConfigMap{}}
|
||||
fakeConfigMapList2 := api_v1.ConfigMapList{Items: []api_v1.ConfigMap{}}
|
||||
cluster1 := NewCluster("cluster1", api_v1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", api_v1.ConditionTrue)
|
||||
fakeClusterList := federationapi.ClusterList{Items: []federationapi.Cluster{}}
|
||||
fakeConfigMapList1 := apiv1.ConfigMapList{Items: []apiv1.ConfigMap{}}
|
||||
fakeConfigMapList2 := apiv1.ConfigMapList{Items: []apiv1.ConfigMap{}}
|
||||
cluster1 := NewCluster("cluster1", apiv1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", apiv1.ConditionTrue)
|
||||
cfg1 := NewConfigMap("foo")
|
||||
cfg2 := NewConfigMap("bar") // Different UID from cfg1, so that we can check that they get reconciled.
|
||||
|
||||
t.Log("Creating fake infrastructure")
|
||||
fedClient := &fake_fedclientset.Clientset{}
|
||||
fedClient := &fakefedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fedClient.Fake, &fakeClusterList)
|
||||
RegisterFakeList("ingresses", &fedClient.Fake, &extensions_v1beta1.IngressList{Items: []extensions_v1beta1.Ingress{}})
|
||||
RegisterFakeList("ingresses", &fedClient.Fake, &extensionsv1beta1.IngressList{Items: []extensionsv1beta1.Ingress{}})
|
||||
fedIngressWatch := RegisterFakeWatch("ingresses", &fedClient.Fake)
|
||||
clusterWatch := RegisterFakeWatch("clusters", &fedClient.Fake)
|
||||
fedClusterUpdateChan := RegisterFakeCopyOnUpdate("clusters", &fedClient.Fake, clusterWatch)
|
||||
//fedIngressUpdateChan := RegisterFakeCopyOnUpdate("ingresses", &fedClient.Fake, fedIngressWatch)
|
||||
|
||||
cluster1Client := &fake_kubeclientset.Clientset{}
|
||||
RegisterFakeList("ingresses", &cluster1Client.Fake, &extensions_v1beta1.IngressList{Items: []extensions_v1beta1.Ingress{}})
|
||||
cluster1Client := &fakekubeclientset.Clientset{}
|
||||
RegisterFakeList("ingresses", &cluster1Client.Fake, &extensionsv1beta1.IngressList{Items: []extensionsv1beta1.Ingress{}})
|
||||
RegisterFakeList("configmaps", &cluster1Client.Fake, &fakeConfigMapList1)
|
||||
cluster1IngressWatch := RegisterFakeWatch("ingresses", &cluster1Client.Fake)
|
||||
cluster1ConfigMapWatch := RegisterFakeWatch("configmaps", &cluster1Client.Fake)
|
||||
cluster1IngressCreateChan := RegisterFakeCopyOnCreate("ingresses", &cluster1Client.Fake, cluster1IngressWatch)
|
||||
// cluster1IngressUpdateChan := RegisterFakeCopyOnUpdate("ingresses", &cluster1Client.Fake, cluster1IngressWatch)
|
||||
|
||||
cluster2Client := &fake_kubeclientset.Clientset{}
|
||||
RegisterFakeList("ingresses", &cluster2Client.Fake, &extensions_v1beta1.IngressList{Items: []extensions_v1beta1.Ingress{}})
|
||||
cluster2Client := &fakekubeclientset.Clientset{}
|
||||
RegisterFakeList("ingresses", &cluster2Client.Fake, &extensionsv1beta1.IngressList{Items: []extensionsv1beta1.Ingress{}})
|
||||
RegisterFakeList("configmaps", &cluster2Client.Fake, &fakeConfigMapList2)
|
||||
cluster2IngressWatch := RegisterFakeWatch("ingresses", &cluster2Client.Fake)
|
||||
cluster2ConfigMapWatch := RegisterFakeWatch("configmaps", &cluster2Client.Fake)
|
||||
cluster2IngressCreateChan := RegisterFakeCopyOnCreate("ingresses", &cluster2Client.Fake, cluster2IngressWatch)
|
||||
cluster2ConfigMapUpdateChan := RegisterFakeCopyOnUpdate("configmaps", &cluster2Client.Fake, cluster2ConfigMapWatch)
|
||||
|
||||
clientFactoryFunc := func(cluster *federation_api.Cluster) (kubeclientset.Interface, error) {
|
||||
clientFactoryFunc := func(cluster *federationapi.Cluster) (kubeclientset.Interface, error) {
|
||||
switch cluster.Name {
|
||||
case cluster1.Name:
|
||||
return cluster1Client, nil
|
||||
@@ -102,8 +102,8 @@ func TestIngressController(t *testing.T) {
|
||||
// TODO: Here we are creating the ingress with first cluster annotation.
|
||||
// Add another test without that annotation when
|
||||
// https://github.com/kubernetes/kubernetes/issues/36540 is fixed.
|
||||
ing1 := extensions_v1beta1.Ingress{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
ing1 := extensionsv1beta1.Ingress{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-ingress",
|
||||
Namespace: "mynamespace",
|
||||
SelfLink: "/api/v1/namespaces/mynamespace/ingress/test-ingress",
|
||||
@@ -111,9 +111,9 @@ func TestIngressController(t *testing.T) {
|
||||
firstClusterAnnotation: cluster1.Name,
|
||||
},
|
||||
},
|
||||
Status: extensions_v1beta1.IngressStatus{
|
||||
LoadBalancer: api_v1.LoadBalancerStatus{
|
||||
Ingress: make([]api_v1.LoadBalancerIngress, 0, 0),
|
||||
Status: extensionsv1beta1.IngressStatus{
|
||||
LoadBalancer: apiv1.LoadBalancerStatus{
|
||||
Ingress: make([]apiv1.LoadBalancerIngress, 0, 0),
|
||||
},
|
||||
},
|
||||
}
|
||||
@@ -139,7 +139,7 @@ func TestIngressController(t *testing.T) {
|
||||
updatedIngress := GetIngressFromChan(t, fedIngressUpdateChan)
|
||||
assert.True(t, ingressController.hasFinalizerFunc(updatedIngress, deletionhelper.FinalizerDeleteFromUnderlyingClusters))
|
||||
updatedIngress = GetIngressFromChan(t, fedIngressUpdateChan)
|
||||
assert.True(t, ingressController.hasFinalizerFunc(updatedIngress, api_v1.FinalizerOrphan), fmt.Sprintf("ingress does not have the orphan finalizer: %v", updatedIngress))
|
||||
assert.True(t, ingressController.hasFinalizerFunc(updatedIngress, apiv1.FinalizerOrphan), fmt.Sprintf("ingress does not have the orphan finalizer: %v", updatedIngress))
|
||||
ing1 = *updatedIngress
|
||||
*/
|
||||
t.Log("Checking that Ingress was correctly created in cluster 1")
|
||||
@@ -159,7 +159,7 @@ func TestIngressController(t *testing.T) {
|
||||
// TODO: Re-enable this when we have fixed these flaky tests: https://github.com/kubernetes/kubernetes/issues/36540.
|
||||
// Test that IP address gets transferred from cluster ingress to federated ingress.
|
||||
t.Log("Checking that IP address gets transferred from cluster ingress to federated ingress")
|
||||
createdIngress.Status.LoadBalancer.Ingress = append(createdIngress.Status.LoadBalancer.Ingress, api_v1.LoadBalancerIngress{IP: "1.2.3.4"})
|
||||
createdIngress.Status.LoadBalancer.Ingress = append(createdIngress.Status.LoadBalancer.Ingress, apiv1.LoadBalancerIngress{IP: "1.2.3.4"})
|
||||
cluster1IngressWatch.Modify(createdIngress)
|
||||
// Wait for store to see the updated cluster ingress.
|
||||
assert.NoError(t, WaitForStatusUpdate(t, ingressController.ingressFederatedInformer.GetTargetStore(),
|
||||
@@ -210,28 +210,28 @@ func TestIngressController(t *testing.T) {
|
||||
close(stop)
|
||||
}
|
||||
|
||||
func GetIngressFromChan(t *testing.T, c chan runtime.Object) *extensions_v1beta1.Ingress {
|
||||
func GetIngressFromChan(t *testing.T, c chan runtime.Object) *extensionsv1beta1.Ingress {
|
||||
obj := GetObjectFromChan(c)
|
||||
ingress, ok := obj.(*extensions_v1beta1.Ingress)
|
||||
ingress, ok := obj.(*extensionsv1beta1.Ingress)
|
||||
if !ok {
|
||||
t.Logf("Object on channel was not of type *extensions_v1beta1.Ingress: %v", obj)
|
||||
t.Logf("Object on channel was not of type *extensionsv1beta1.Ingress: %v", obj)
|
||||
}
|
||||
return ingress
|
||||
}
|
||||
|
||||
func GetConfigMapFromChan(c chan runtime.Object) *api_v1.ConfigMap {
|
||||
configMap, _ := GetObjectFromChan(c).(*api_v1.ConfigMap)
|
||||
func GetConfigMapFromChan(c chan runtime.Object) *apiv1.ConfigMap {
|
||||
configMap, _ := GetObjectFromChan(c).(*apiv1.ConfigMap)
|
||||
return configMap
|
||||
}
|
||||
|
||||
func GetClusterFromChan(c chan runtime.Object) *federation_api.Cluster {
|
||||
cluster, _ := GetObjectFromChan(c).(*federation_api.Cluster)
|
||||
func GetClusterFromChan(c chan runtime.Object) *federationapi.Cluster {
|
||||
cluster, _ := GetObjectFromChan(c).(*federationapi.Cluster)
|
||||
return cluster
|
||||
}
|
||||
|
||||
func NewConfigMap(uid string) *api_v1.ConfigMap {
|
||||
return &api_v1.ConfigMap{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
func NewConfigMap(uid string) *apiv1.ConfigMap {
|
||||
return &apiv1.ConfigMap{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: uidConfigMapName,
|
||||
Namespace: uidConfigMapNamespace,
|
||||
SelfLink: "/api/v1/namespaces/" + uidConfigMapNamespace + "/configmap/" + uidConfigMapName,
|
||||
@@ -252,8 +252,8 @@ func WaitForFinalizersInFederationStore(ingressController *IngressController, st
|
||||
if !found || err != nil {
|
||||
return false, err
|
||||
}
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
if ingressController.hasFinalizerFunc(ingress, api_v1.FinalizerOrphan) &&
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
if ingressController.hasFinalizerFunc(ingress, apiv1.FinalizerOrphan) &&
|
||||
ingressController.hasFinalizerFunc(ingress, deletionhelper.FinalizerDeleteFromUnderlyingClusters) {
|
||||
return true, nil
|
||||
}
|
||||
@@ -280,14 +280,14 @@ func WaitForIngressInClusterStore(store util.FederatedReadOnlyStore, clusterName
|
||||
}
|
||||
|
||||
// Wait for ingress status to be updated to match the desiredStatus.
|
||||
func WaitForStatusUpdate(t *testing.T, store util.FederatedReadOnlyStore, clusterName, key string, desiredStatus api_v1.LoadBalancerStatus, timeout time.Duration) error {
|
||||
func WaitForStatusUpdate(t *testing.T, store util.FederatedReadOnlyStore, clusterName, key string, desiredStatus apiv1.LoadBalancerStatus, timeout time.Duration) error {
|
||||
retryInterval := 100 * time.Millisecond
|
||||
err := wait.PollImmediate(retryInterval, timeout, func() (bool, error) {
|
||||
obj, found, err := store.GetByKey(clusterName, key)
|
||||
if !found || err != nil {
|
||||
return false, err
|
||||
}
|
||||
ingress := obj.(*extensions_v1beta1.Ingress)
|
||||
ingress := obj.(*extensionsv1beta1.Ingress)
|
||||
return reflect.DeepEqual(ingress.Status.LoadBalancer, desiredStatus), nil
|
||||
})
|
||||
return err
|
||||
|
@@ -20,14 +20,14 @@ import (
|
||||
"fmt"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/eventsink"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/errors"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
@@ -84,7 +84,7 @@ type NamespaceController struct {
|
||||
func NewNamespaceController(client federationclientset.Interface) *NamespaceController {
|
||||
broadcaster := record.NewBroadcaster()
|
||||
broadcaster.StartRecordingToSink(eventsink.NewFederatedEventSink(client))
|
||||
recorder := broadcaster.NewRecorder(api_v1.EventSource{Component: "federated-namespace-controller"})
|
||||
recorder := broadcaster.NewRecorder(apiv1.EventSource{Component: "federated-namespace-controller"})
|
||||
|
||||
nc := &NamespaceController{
|
||||
federatedApiClient: client,
|
||||
@@ -103,31 +103,31 @@ func NewNamespaceController(client federationclientset.Interface) *NamespaceCont
|
||||
// Start informer in federated API servers on namespaces that should be federated.
|
||||
nc.namespaceInformerStore, nc.namespaceInformerController = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (runtime.Object, error) {
|
||||
ListFunc: func(options apiv1.ListOptions) (runtime.Object, error) {
|
||||
return client.Core().Namespaces().List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return client.Core().Namespaces().Watch(options)
|
||||
},
|
||||
},
|
||||
&api_v1.Namespace{},
|
||||
&apiv1.Namespace{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
util.NewTriggerOnAllChanges(func(obj runtime.Object) { nc.deliverNamespaceObj(obj, 0, false) }))
|
||||
|
||||
// Federated informer on namespaces in members of federation.
|
||||
nc.namespaceFederatedInformer = util.NewFederatedInformer(
|
||||
client,
|
||||
func(cluster *federation_api.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
func(cluster *federationapi.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
return cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (runtime.Object, error) {
|
||||
ListFunc: func(options apiv1.ListOptions) (runtime.Object, error) {
|
||||
return targetClient.Core().Namespaces().List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Core().Namespaces().Watch(options)
|
||||
},
|
||||
},
|
||||
&api_v1.Namespace{},
|
||||
&apiv1.Namespace{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
// Trigger reconciliation whenever something in federated cluster is changed. In most cases it
|
||||
// would be just confirmation that some namespace opration succeeded.
|
||||
@@ -136,7 +136,7 @@ func NewNamespaceController(client federationclientset.Interface) *NamespaceCont
|
||||
))
|
||||
},
|
||||
&util.ClusterLifecycleHandlerFuncs{
|
||||
ClusterAvailable: func(cluster *federation_api.Cluster) {
|
||||
ClusterAvailable: func(cluster *federationapi.Cluster) {
|
||||
// When new cluster becomes available process all the namespaces again.
|
||||
nc.clusterDeliverer.DeliverAfter(allClustersKey, nil, nc.clusterAvailableDelay)
|
||||
},
|
||||
@@ -146,18 +146,18 @@ func NewNamespaceController(client federationclientset.Interface) *NamespaceCont
|
||||
// Federated updeater along with Create/Update/Delete operations.
|
||||
nc.federatedUpdater = util.NewFederatedUpdater(nc.namespaceFederatedInformer,
|
||||
func(client kubeclientset.Interface, obj runtime.Object) error {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
_, err := client.Core().Namespaces().Create(namespace)
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj runtime.Object) error {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
_, err := client.Core().Namespaces().Update(namespace)
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj runtime.Object) error {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
err := client.Core().Namespaces().Delete(namespace.Name, &api_v1.DeleteOptions{})
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
err := client.Core().Namespaces().Delete(namespace.Name, &apiv1.DeleteOptions{})
|
||||
// IsNotFound error is fine since that means the object is deleted already.
|
||||
if errors.IsNotFound(err) {
|
||||
return nil
|
||||
@@ -171,7 +171,7 @@ func NewNamespaceController(client federationclientset.Interface) *NamespaceCont
|
||||
nc.addFinalizerFunc,
|
||||
// objNameFunc
|
||||
func(obj runtime.Object) string {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
return namespace.Name
|
||||
},
|
||||
nc.updateTimeout,
|
||||
@@ -184,7 +184,7 @@ func NewNamespaceController(client federationclientset.Interface) *NamespaceCont
|
||||
|
||||
// Returns true if the given object has the given finalizer in its ObjectMeta.
|
||||
func (nc *NamespaceController) hasFinalizerFunc(obj runtime.Object, finalizer string) bool {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
for i := range namespace.ObjectMeta.Finalizers {
|
||||
if string(namespace.ObjectMeta.Finalizers[i]) == finalizer {
|
||||
return true
|
||||
@@ -196,7 +196,7 @@ func (nc *NamespaceController) hasFinalizerFunc(obj runtime.Object, finalizer st
|
||||
// Removes the finalizer from the given objects ObjectMeta.
|
||||
// Assumes that the given object is a namespace.
|
||||
func (nc *NamespaceController) removeFinalizerFunc(obj runtime.Object, finalizer string) (runtime.Object, error) {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
newFinalizers := []string{}
|
||||
hasFinalizer := false
|
||||
for i := range namespace.ObjectMeta.Finalizers {
|
||||
@@ -221,7 +221,7 @@ func (nc *NamespaceController) removeFinalizerFunc(obj runtime.Object, finalizer
|
||||
// Adds the given finalizer to the given objects ObjectMeta.
|
||||
// Assumes that the given object is a namespace.
|
||||
func (nc *NamespaceController) addFinalizerFunc(obj runtime.Object, finalizer string) (runtime.Object, error) {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
namespace.ObjectMeta.Finalizers = append(namespace.ObjectMeta.Finalizers, finalizer)
|
||||
namespace, err := nc.federatedApiClient.Core().Namespaces().Finalize(namespace)
|
||||
if err != nil {
|
||||
@@ -231,8 +231,8 @@ func (nc *NamespaceController) addFinalizerFunc(obj runtime.Object, finalizer st
|
||||
}
|
||||
|
||||
// Returns true if the given object has the given finalizer in its NamespaceSpec.
|
||||
func (nc *NamespaceController) hasFinalizerFuncInSpec(obj runtime.Object, finalizer api_v1.FinalizerName) bool {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
func (nc *NamespaceController) hasFinalizerFuncInSpec(obj runtime.Object, finalizer apiv1.FinalizerName) bool {
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
for i := range namespace.Spec.Finalizers {
|
||||
if namespace.Spec.Finalizers[i] == finalizer {
|
||||
return true
|
||||
@@ -242,8 +242,8 @@ func (nc *NamespaceController) hasFinalizerFuncInSpec(obj runtime.Object, finali
|
||||
}
|
||||
|
||||
// Removes the finalizer from the given objects NamespaceSpec.
|
||||
func (nc *NamespaceController) removeFinalizerFromSpec(namespace *api_v1.Namespace, finalizer api_v1.FinalizerName) (*api_v1.Namespace, error) {
|
||||
updatedFinalizers := []api_v1.FinalizerName{}
|
||||
func (nc *NamespaceController) removeFinalizerFromSpec(namespace *apiv1.Namespace, finalizer apiv1.FinalizerName) (*apiv1.Namespace, error) {
|
||||
updatedFinalizers := []apiv1.FinalizerName{}
|
||||
for i := range namespace.Spec.Finalizers {
|
||||
if namespace.Spec.Finalizers[i] != finalizer {
|
||||
updatedFinalizers = append(updatedFinalizers, namespace.Spec.Finalizers[i])
|
||||
@@ -275,7 +275,7 @@ func (nc *NamespaceController) Run(stopChan <-chan struct{}) {
|
||||
}
|
||||
|
||||
func (nc *NamespaceController) deliverNamespaceObj(obj interface{}, delay time.Duration, failed bool) {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
nc.deliverNamespace(namespace.Name, delay, failed)
|
||||
}
|
||||
|
||||
@@ -314,7 +314,7 @@ func (nc *NamespaceController) reconcileNamespacesOnClusterChange() {
|
||||
nc.clusterDeliverer.DeliverAfter(allClustersKey, nil, nc.clusterAvailableDelay)
|
||||
}
|
||||
for _, obj := range nc.namespaceInformerStore.List() {
|
||||
namespace := obj.(*api_v1.Namespace)
|
||||
namespace := obj.(*apiv1.Namespace)
|
||||
nc.deliverNamespace(namespace.Name, nc.smallDelay, false)
|
||||
}
|
||||
}
|
||||
@@ -339,7 +339,7 @@ func (nc *NamespaceController) reconcileNamespace(namespace string) {
|
||||
// Create a copy before modifying the namespace to prevent race condition with
|
||||
// other readers of namespace from store.
|
||||
namespaceObj, err := conversion.NewCloner().DeepCopy(namespaceObjFromStore)
|
||||
baseNamespace, ok := namespaceObj.(*api_v1.Namespace)
|
||||
baseNamespace, ok := namespaceObj.(*apiv1.Namespace)
|
||||
if err != nil || !ok {
|
||||
glog.Errorf("Error in retrieving obj from store: %v, %v", ok, err)
|
||||
nc.deliverNamespace(namespace, 0, true)
|
||||
@@ -368,7 +368,7 @@ func (nc *NamespaceController) reconcileNamespace(namespace string) {
|
||||
nc.deliverNamespace(namespace, 0, false)
|
||||
return
|
||||
}
|
||||
baseNamespace = updatedNamespaceObj.(*api_v1.Namespace)
|
||||
baseNamespace = updatedNamespaceObj.(*apiv1.Namespace)
|
||||
|
||||
glog.V(3).Infof("Syncing namespace %s in underlying clusters", baseNamespace.Name)
|
||||
// Sync the namespace in all underlying clusters.
|
||||
@@ -388,9 +388,9 @@ func (nc *NamespaceController) reconcileNamespace(namespace string) {
|
||||
return
|
||||
}
|
||||
// The object should not be modified.
|
||||
desiredNamespace := &api_v1.Namespace{
|
||||
desiredNamespace := &apiv1.Namespace{
|
||||
ObjectMeta: util.DeepCopyRelevantObjectMeta(baseNamespace.ObjectMeta),
|
||||
Spec: util.DeepCopyApiTypeOrPanic(baseNamespace.Spec).(api_v1.NamespaceSpec),
|
||||
Spec: util.DeepCopyApiTypeOrPanic(baseNamespace.Spec).(apiv1.NamespaceSpec),
|
||||
}
|
||||
glog.V(5).Infof("Desired namespace in underlying clusters: %+v", desiredNamespace)
|
||||
|
||||
@@ -404,7 +404,7 @@ func (nc *NamespaceController) reconcileNamespace(namespace string) {
|
||||
ClusterName: cluster.Name,
|
||||
})
|
||||
} else {
|
||||
clusterNamespace := clusterNamespaceObj.(*api_v1.Namespace)
|
||||
clusterNamespace := clusterNamespaceObj.(*apiv1.Namespace)
|
||||
|
||||
// Update existing namespace, if needed.
|
||||
if !util.ObjectMetaAndSpecEquivalent(desiredNamespace, clusterNamespace) {
|
||||
@@ -441,17 +441,17 @@ func (nc *NamespaceController) reconcileNamespace(namespace string) {
|
||||
}
|
||||
|
||||
// delete deletes the given namespace or returns error if the deletion was not complete.
|
||||
func (nc *NamespaceController) delete(namespace *api_v1.Namespace) error {
|
||||
func (nc *NamespaceController) delete(namespace *apiv1.Namespace) error {
|
||||
// Set Terminating status.
|
||||
updatedNamespace := &api_v1.Namespace{
|
||||
updatedNamespace := &apiv1.Namespace{
|
||||
ObjectMeta: namespace.ObjectMeta,
|
||||
Spec: namespace.Spec,
|
||||
Status: api_v1.NamespaceStatus{
|
||||
Phase: api_v1.NamespaceTerminating,
|
||||
Status: apiv1.NamespaceStatus{
|
||||
Phase: apiv1.NamespaceTerminating,
|
||||
},
|
||||
}
|
||||
var err error
|
||||
if namespace.Status.Phase != api_v1.NamespaceTerminating {
|
||||
if namespace.Status.Phase != apiv1.NamespaceTerminating {
|
||||
glog.V(2).Infof("Marking ns %s as terminating", namespace.Name)
|
||||
nc.eventRecorder.Event(namespace, api.EventTypeNormal, "DeleteNamespace", fmt.Sprintf("Marking for deletion"))
|
||||
_, err = nc.federatedApiClient.Core().Namespaces().Update(updatedNamespace)
|
||||
@@ -460,7 +460,7 @@ func (nc *NamespaceController) delete(namespace *api_v1.Namespace) error {
|
||||
}
|
||||
}
|
||||
|
||||
if nc.hasFinalizerFuncInSpec(updatedNamespace, api_v1.FinalizerKubernetes) {
|
||||
if nc.hasFinalizerFuncInSpec(updatedNamespace, apiv1.FinalizerKubernetes) {
|
||||
// Delete resources in this namespace.
|
||||
updatedNamespace, err = nc.removeKubernetesFinalizer(updatedNamespace)
|
||||
if err != nil {
|
||||
@@ -488,42 +488,42 @@ func (nc *NamespaceController) delete(namespace *api_v1.Namespace) error {
|
||||
}
|
||||
|
||||
// Ensures that all resources in this namespace are deleted and then removes the kubernetes finalizer.
|
||||
func (nc *NamespaceController) removeKubernetesFinalizer(namespace *api_v1.Namespace) (*api_v1.Namespace, error) {
|
||||
func (nc *NamespaceController) removeKubernetesFinalizer(namespace *apiv1.Namespace) (*apiv1.Namespace, error) {
|
||||
// Right now there are just 7 types of objects: Deployments, DaemonSets, ReplicaSet, Secret, Ingress, Events and Service.
|
||||
// Temporarly these items are simply deleted one by one to squeeze this code into 1.4.
|
||||
// TODO: Make it generic (like in the regular namespace controller) and parallel.
|
||||
err := nc.federatedApiClient.Core().Services(namespace.Name).DeleteCollection(&api_v1.DeleteOptions{}, api_v1.ListOptions{})
|
||||
err := nc.federatedApiClient.Core().Services(namespace.Name).DeleteCollection(&apiv1.DeleteOptions{}, apiv1.ListOptions{})
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to delete service list: %v", err)
|
||||
}
|
||||
err = nc.federatedApiClient.Extensions().ReplicaSets(namespace.Name).DeleteCollection(&api_v1.DeleteOptions{}, api_v1.ListOptions{})
|
||||
err = nc.federatedApiClient.Extensions().ReplicaSets(namespace.Name).DeleteCollection(&apiv1.DeleteOptions{}, apiv1.ListOptions{})
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to delete replicaset list from namespace: %v", err)
|
||||
}
|
||||
err = nc.federatedApiClient.Core().Secrets(namespace.Name).DeleteCollection(&api_v1.DeleteOptions{}, api_v1.ListOptions{})
|
||||
err = nc.federatedApiClient.Core().Secrets(namespace.Name).DeleteCollection(&apiv1.DeleteOptions{}, apiv1.ListOptions{})
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to delete secret list from namespace: %v", err)
|
||||
}
|
||||
err = nc.federatedApiClient.Extensions().Ingresses(namespace.Name).DeleteCollection(&api_v1.DeleteOptions{}, api_v1.ListOptions{})
|
||||
err = nc.federatedApiClient.Extensions().Ingresses(namespace.Name).DeleteCollection(&apiv1.DeleteOptions{}, apiv1.ListOptions{})
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to delete ingresses list from namespace: %v", err)
|
||||
}
|
||||
err = nc.federatedApiClient.Extensions().DaemonSets(namespace.Name).DeleteCollection(&api_v1.DeleteOptions{}, api_v1.ListOptions{})
|
||||
err = nc.federatedApiClient.Extensions().DaemonSets(namespace.Name).DeleteCollection(&apiv1.DeleteOptions{}, apiv1.ListOptions{})
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to delete daemonsets list from namespace: %v", err)
|
||||
}
|
||||
err = nc.federatedApiClient.Extensions().Deployments(namespace.Name).DeleteCollection(&api_v1.DeleteOptions{}, api_v1.ListOptions{})
|
||||
err = nc.federatedApiClient.Extensions().Deployments(namespace.Name).DeleteCollection(&apiv1.DeleteOptions{}, apiv1.ListOptions{})
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to delete deployments list from namespace: %v", err)
|
||||
}
|
||||
err = nc.federatedApiClient.Core().Events(namespace.Name).DeleteCollection(&api_v1.DeleteOptions{}, api_v1.ListOptions{})
|
||||
err = nc.federatedApiClient.Core().Events(namespace.Name).DeleteCollection(&apiv1.DeleteOptions{}, apiv1.ListOptions{})
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("failed to delete events list from namespace: %v", err)
|
||||
}
|
||||
|
||||
// Remove kube_api.FinalizerKubernetes
|
||||
if len(namespace.Spec.Finalizers) != 0 {
|
||||
return nc.removeFinalizerFromSpec(namespace, api_v1.FinalizerKubernetes)
|
||||
return nc.removeFinalizerFromSpec(namespace, apiv1.FinalizerKubernetes)
|
||||
}
|
||||
return namespace, nil
|
||||
}
|
||||
|
@@ -21,16 +21,16 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fake_fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fakefedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
. "k8s.io/kubernetes/federation/pkg/federation-controller/util/test"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
extensionsv1 "k8s.io/kubernetes/pkg/apis/extensions/v1beta1"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/client/testing/core"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -39,51 +39,51 @@ import (
|
||||
)
|
||||
|
||||
func TestNamespaceController(t *testing.T) {
|
||||
cluster1 := NewCluster("cluster1", api_v1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", api_v1.ConditionTrue)
|
||||
ns1 := api_v1.Namespace{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
cluster1 := NewCluster("cluster1", apiv1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", apiv1.ConditionTrue)
|
||||
ns1 := apiv1.Namespace{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-namespace",
|
||||
SelfLink: "/api/v1/namespaces/test-namespace",
|
||||
},
|
||||
Spec: api_v1.NamespaceSpec{
|
||||
Finalizers: []api_v1.FinalizerName{api_v1.FinalizerKubernetes},
|
||||
Spec: apiv1.NamespaceSpec{
|
||||
Finalizers: []apiv1.FinalizerName{apiv1.FinalizerKubernetes},
|
||||
},
|
||||
}
|
||||
|
||||
fakeClient := &fake_fedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federation_api.ClusterList{Items: []federation_api.Cluster{*cluster1}})
|
||||
RegisterFakeList("namespaces", &fakeClient.Fake, &api_v1.NamespaceList{Items: []api_v1.Namespace{}})
|
||||
fakeClient := &fakefedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federationapi.ClusterList{Items: []federationapi.Cluster{*cluster1}})
|
||||
RegisterFakeList("namespaces", &fakeClient.Fake, &apiv1.NamespaceList{Items: []apiv1.Namespace{}})
|
||||
namespaceWatch := RegisterFakeWatch("namespaces", &fakeClient.Fake)
|
||||
namespaceCreateChan := RegisterFakeCopyOnCreate("namespaces", &fakeClient.Fake, namespaceWatch)
|
||||
clusterWatch := RegisterFakeWatch("clusters", &fakeClient.Fake)
|
||||
|
||||
cluster1Client := &fake_kubeclientset.Clientset{}
|
||||
cluster1Client := &fakekubeclientset.Clientset{}
|
||||
cluster1Watch := RegisterFakeWatch("namespaces", &cluster1Client.Fake)
|
||||
RegisterFakeList("namespaces", &cluster1Client.Fake, &api_v1.NamespaceList{Items: []api_v1.Namespace{}})
|
||||
RegisterFakeList("namespaces", &cluster1Client.Fake, &apiv1.NamespaceList{Items: []apiv1.Namespace{}})
|
||||
cluster1CreateChan := RegisterFakeCopyOnCreate("namespaces", &cluster1Client.Fake, cluster1Watch)
|
||||
// cluster1UpdateChan := RegisterFakeCopyOnUpdate("namespaces", &cluster1Client.Fake, cluster1Watch)
|
||||
|
||||
cluster2Client := &fake_kubeclientset.Clientset{}
|
||||
cluster2Client := &fakekubeclientset.Clientset{}
|
||||
cluster2Watch := RegisterFakeWatch("namespaces", &cluster2Client.Fake)
|
||||
RegisterFakeList("namespaces", &cluster2Client.Fake, &api_v1.NamespaceList{Items: []api_v1.Namespace{}})
|
||||
RegisterFakeList("namespaces", &cluster2Client.Fake, &apiv1.NamespaceList{Items: []apiv1.Namespace{}})
|
||||
cluster2CreateChan := RegisterFakeCopyOnCreate("namespaces", &cluster2Client.Fake, cluster2Watch)
|
||||
|
||||
RegisterFakeList("replicasets", &fakeClient.Fake, &extensionsv1.ReplicaSetList{Items: []extensionsv1.ReplicaSet{
|
||||
{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-rs",
|
||||
Namespace: ns1.Namespace,
|
||||
}}}})
|
||||
RegisterFakeList("secrets", &fakeClient.Fake, &api_v1.SecretList{Items: []api_v1.Secret{
|
||||
RegisterFakeList("secrets", &fakeClient.Fake, &apiv1.SecretList{Items: []apiv1.Secret{
|
||||
{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-secret",
|
||||
Namespace: ns1.Namespace,
|
||||
}}}})
|
||||
RegisterFakeList("services", &fakeClient.Fake, &api_v1.ServiceList{Items: []api_v1.Service{
|
||||
RegisterFakeList("services", &fakeClient.Fake, &apiv1.ServiceList{Items: []apiv1.Service{
|
||||
{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-service",
|
||||
Namespace: ns1.Namespace,
|
||||
}}}})
|
||||
@@ -93,7 +93,7 @@ func TestNamespaceController(t *testing.T) {
|
||||
secretDeleteChan := RegisterDeleteCollection(&fakeClient.Fake, "secrets")
|
||||
|
||||
namespaceController := NewNamespaceController(fakeClient)
|
||||
informerClientFactory := func(cluster *federation_api.Cluster) (kubeclientset.Interface, error) {
|
||||
informerClientFactory := func(cluster *federationapi.Cluster) (kubeclientset.Interface, error) {
|
||||
switch cluster.Name {
|
||||
case cluster1.Name:
|
||||
return cluster1Client, nil
|
||||
@@ -155,7 +155,7 @@ func TestNamespaceController(t *testing.T) {
|
||||
// Delete the namespace with orphan finalizer (let namespaces
|
||||
// in underlying clusters be as is).
|
||||
// TODO: Add a test without orphan finalizer.
|
||||
ns1.ObjectMeta.Finalizers = append(ns1.ObjectMeta.Finalizers, api_v1.FinalizerOrphan)
|
||||
ns1.ObjectMeta.Finalizers = append(ns1.ObjectMeta.Finalizers, apiv1.FinalizerOrphan)
|
||||
ns1.DeletionTimestamp = &unversioned.Time{Time: time.Now()}
|
||||
namespaceWatch.Modify(&ns1)
|
||||
assert.Equal(t, ns1.Name, GetStringFromChan(nsDeleteChan))
|
||||
@@ -166,7 +166,7 @@ func TestNamespaceController(t *testing.T) {
|
||||
close(stop)
|
||||
}
|
||||
|
||||
func setClientFactory(informer util.FederatedInformer, informerClientFactory func(*federation_api.Cluster) (kubeclientset.Interface, error)) {
|
||||
func setClientFactory(informer util.FederatedInformer, informerClientFactory func(*federationapi.Cluster) (kubeclientset.Interface, error)) {
|
||||
testInformer := ToFederatedInformerForTestOnly(informer)
|
||||
testInformer.SetClientFactory(informerClientFactory)
|
||||
}
|
||||
@@ -199,8 +199,8 @@ func GetStringFromChan(c chan string) string {
|
||||
}
|
||||
}
|
||||
|
||||
func GetNamespaceFromChan(c chan runtime.Object) *api_v1.Namespace {
|
||||
namespace := GetObjectFromChan(c).(*api_v1.Namespace)
|
||||
func GetNamespaceFromChan(c chan runtime.Object) *apiv1.Namespace {
|
||||
namespace := GetObjectFromChan(c).(*apiv1.Namespace)
|
||||
return namespace
|
||||
|
||||
}
|
||||
|
@@ -20,20 +20,20 @@ import (
|
||||
"fmt"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/eventsink"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/errors"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/controller"
|
||||
"k8s.io/kubernetes/pkg/conversion"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/flowcontrol"
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
@@ -85,7 +85,7 @@ type SecretController struct {
|
||||
func NewSecretController(client federationclientset.Interface) *SecretController {
|
||||
broadcaster := record.NewBroadcaster()
|
||||
broadcaster.StartRecordingToSink(eventsink.NewFederatedEventSink(client))
|
||||
recorder := broadcaster.NewRecorder(api_v1.EventSource{Component: "federated-secrets-controller"})
|
||||
recorder := broadcaster.NewRecorder(apiv1.EventSource{Component: "federated-secrets-controller"})
|
||||
|
||||
secretcontroller := &SecretController{
|
||||
federatedApiClient: client,
|
||||
@@ -104,43 +104,43 @@ func NewSecretController(client federationclientset.Interface) *SecretController
|
||||
// Start informer in federated API servers on secrets that should be federated.
|
||||
secretcontroller.secretInformerStore, secretcontroller.secretInformerController = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
return client.Core().Secrets(api_v1.NamespaceAll).List(options)
|
||||
ListFunc: func(options apiv1.ListOptions) (pkgruntime.Object, error) {
|
||||
return client.Core().Secrets(apiv1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
return client.Core().Secrets(api_v1.NamespaceAll).Watch(options)
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return client.Core().Secrets(apiv1.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&api_v1.Secret{},
|
||||
&apiv1.Secret{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
util.NewTriggerOnAllChanges(func(obj pkg_runtime.Object) { secretcontroller.deliverSecretObj(obj, 0, false) }))
|
||||
util.NewTriggerOnAllChanges(func(obj pkgruntime.Object) { secretcontroller.deliverSecretObj(obj, 0, false) }))
|
||||
|
||||
// Federated informer on secrets in members of federation.
|
||||
secretcontroller.secretFederatedInformer = util.NewFederatedInformer(
|
||||
client,
|
||||
func(cluster *federation_api.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
func(cluster *federationapi.Cluster, targetClient kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
return cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
return targetClient.Core().Secrets(api_v1.NamespaceAll).List(options)
|
||||
ListFunc: func(options apiv1.ListOptions) (pkgruntime.Object, error) {
|
||||
return targetClient.Core().Secrets(apiv1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Core().Secrets(api_v1.NamespaceAll).Watch(options)
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return targetClient.Core().Secrets(apiv1.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&api_v1.Secret{},
|
||||
&apiv1.Secret{},
|
||||
controller.NoResyncPeriodFunc(),
|
||||
// Trigger reconciliation whenever something in federated cluster is changed. In most cases it
|
||||
// would be just confirmation that some secret opration succeeded.
|
||||
util.NewTriggerOnAllChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
secretcontroller.deliverSecretObj(obj, secretcontroller.secretReviewDelay, false)
|
||||
},
|
||||
))
|
||||
},
|
||||
|
||||
&util.ClusterLifecycleHandlerFuncs{
|
||||
ClusterAvailable: func(cluster *federation_api.Cluster) {
|
||||
ClusterAvailable: func(cluster *federationapi.Cluster) {
|
||||
// When new cluster becomes available process all the secrets again.
|
||||
secretcontroller.clusterDeliverer.DeliverAt(allClustersKey, nil, time.Now().Add(secretcontroller.clusterAvailableDelay))
|
||||
},
|
||||
@@ -149,19 +149,19 @@ func NewSecretController(client federationclientset.Interface) *SecretController
|
||||
|
||||
// Federated updeater along with Create/Update/Delete operations.
|
||||
secretcontroller.federatedUpdater = util.NewFederatedUpdater(secretcontroller.secretFederatedInformer,
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
secret := obj.(*apiv1.Secret)
|
||||
_, err := client.Core().Secrets(secret.Namespace).Create(secret)
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
secret := obj.(*apiv1.Secret)
|
||||
_, err := client.Core().Secrets(secret.Namespace).Update(secret)
|
||||
return err
|
||||
},
|
||||
func(client kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
err := client.Core().Secrets(secret.Namespace).Delete(secret.Name, &api_v1.DeleteOptions{})
|
||||
func(client kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
secret := obj.(*apiv1.Secret)
|
||||
err := client.Core().Secrets(secret.Namespace).Delete(secret.Name, &apiv1.DeleteOptions{})
|
||||
return err
|
||||
})
|
||||
|
||||
@@ -170,8 +170,8 @@ func NewSecretController(client federationclientset.Interface) *SecretController
|
||||
secretcontroller.removeFinalizerFunc,
|
||||
secretcontroller.addFinalizerFunc,
|
||||
// objNameFunc
|
||||
func(obj pkg_runtime.Object) string {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
func(obj pkgruntime.Object) string {
|
||||
secret := obj.(*apiv1.Secret)
|
||||
return secret.Name
|
||||
},
|
||||
secretcontroller.updateTimeout,
|
||||
@@ -184,8 +184,8 @@ func NewSecretController(client federationclientset.Interface) *SecretController
|
||||
}
|
||||
|
||||
// Returns true if the given object has the given finalizer in its ObjectMeta.
|
||||
func (secretcontroller *SecretController) hasFinalizerFunc(obj pkg_runtime.Object, finalizer string) bool {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
func (secretcontroller *SecretController) hasFinalizerFunc(obj pkgruntime.Object, finalizer string) bool {
|
||||
secret := obj.(*apiv1.Secret)
|
||||
for i := range secret.ObjectMeta.Finalizers {
|
||||
if string(secret.ObjectMeta.Finalizers[i]) == finalizer {
|
||||
return true
|
||||
@@ -196,8 +196,8 @@ func (secretcontroller *SecretController) hasFinalizerFunc(obj pkg_runtime.Objec
|
||||
|
||||
// Removes the finalizer from the given objects ObjectMeta.
|
||||
// Assumes that the given object is a secret.
|
||||
func (secretcontroller *SecretController) removeFinalizerFunc(obj pkg_runtime.Object, finalizer string) (pkg_runtime.Object, error) {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
func (secretcontroller *SecretController) removeFinalizerFunc(obj pkgruntime.Object, finalizer string) (pkgruntime.Object, error) {
|
||||
secret := obj.(*apiv1.Secret)
|
||||
newFinalizers := []string{}
|
||||
hasFinalizer := false
|
||||
for i := range secret.ObjectMeta.Finalizers {
|
||||
@@ -221,8 +221,8 @@ func (secretcontroller *SecretController) removeFinalizerFunc(obj pkg_runtime.Ob
|
||||
|
||||
// Adds the given finalizer to the given objects ObjectMeta.
|
||||
// Assumes that the given object is a secret.
|
||||
func (secretcontroller *SecretController) addFinalizerFunc(obj pkg_runtime.Object, finalizer string) (pkg_runtime.Object, error) {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
func (secretcontroller *SecretController) addFinalizerFunc(obj pkgruntime.Object, finalizer string) (pkgruntime.Object, error) {
|
||||
secret := obj.(*apiv1.Secret)
|
||||
secret.ObjectMeta.Finalizers = append(secret.ObjectMeta.Finalizers, finalizer)
|
||||
secret, err := secretcontroller.federatedApiClient.Core().Secrets(secret.Namespace).Update(secret)
|
||||
if err != nil {
|
||||
@@ -249,7 +249,7 @@ func (secretcontroller *SecretController) Run(stopChan <-chan struct{}) {
|
||||
}
|
||||
|
||||
func (secretcontroller *SecretController) deliverSecretObj(obj interface{}, delay time.Duration, failed bool) {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
secret := obj.(*apiv1.Secret)
|
||||
secretcontroller.deliverSecret(types.NamespacedName{Namespace: secret.Namespace, Name: secret.Name}, delay, failed)
|
||||
}
|
||||
|
||||
@@ -289,7 +289,7 @@ func (secretcontroller *SecretController) reconcileSecretsOnClusterChange() {
|
||||
secretcontroller.clusterDeliverer.DeliverAt(allClustersKey, nil, time.Now().Add(secretcontroller.clusterAvailableDelay))
|
||||
}
|
||||
for _, obj := range secretcontroller.secretInformerStore.List() {
|
||||
secret := obj.(*api_v1.Secret)
|
||||
secret := obj.(*apiv1.Secret)
|
||||
secretcontroller.deliverSecret(types.NamespacedName{Namespace: secret.Namespace, Name: secret.Name}, secretcontroller.smallDelay, false)
|
||||
}
|
||||
}
|
||||
@@ -316,7 +316,7 @@ func (secretcontroller *SecretController) reconcileSecret(secret types.Namespace
|
||||
// Create a copy before modifying the obj to prevent race condition with
|
||||
// other readers of obj from store.
|
||||
baseSecretObj, err := conversion.NewCloner().DeepCopy(baseSecretObjFromStore)
|
||||
baseSecret, ok := baseSecretObj.(*api_v1.Secret)
|
||||
baseSecret, ok := baseSecretObj.(*apiv1.Secret)
|
||||
if err != nil || !ok {
|
||||
glog.Errorf("Error in retrieving obj from store: %v, %v", ok, err)
|
||||
secretcontroller.deliverSecret(secret, 0, true)
|
||||
@@ -342,7 +342,7 @@ func (secretcontroller *SecretController) reconcileSecret(secret types.Namespace
|
||||
secretcontroller.deliverSecret(secret, 0, false)
|
||||
return
|
||||
}
|
||||
baseSecret = updatedSecretObj.(*api_v1.Secret)
|
||||
baseSecret = updatedSecretObj.(*apiv1.Secret)
|
||||
|
||||
glog.V(3).Infof("Syncing secret %s in underlying clusters", baseSecret.Name)
|
||||
|
||||
@@ -363,7 +363,7 @@ func (secretcontroller *SecretController) reconcileSecret(secret types.Namespace
|
||||
}
|
||||
|
||||
// The data should not be modified.
|
||||
desiredSecret := &api_v1.Secret{
|
||||
desiredSecret := &apiv1.Secret{
|
||||
ObjectMeta: util.DeepCopyRelevantObjectMeta(baseSecret.ObjectMeta),
|
||||
Data: baseSecret.Data,
|
||||
Type: baseSecret.Type,
|
||||
@@ -379,7 +379,7 @@ func (secretcontroller *SecretController) reconcileSecret(secret types.Namespace
|
||||
ClusterName: cluster.Name,
|
||||
})
|
||||
} else {
|
||||
clusterSecret := clusterSecretObj.(*api_v1.Secret)
|
||||
clusterSecret := clusterSecretObj.(*apiv1.Secret)
|
||||
|
||||
// Update existing secret, if needed.
|
||||
if !util.SecretEquivalent(*desiredSecret, *clusterSecret) {
|
||||
@@ -416,7 +416,7 @@ func (secretcontroller *SecretController) reconcileSecret(secret types.Namespace
|
||||
}
|
||||
|
||||
// delete deletes the given secret or returns error if the deletion was not complete.
|
||||
func (secretcontroller *SecretController) delete(secret *api_v1.Secret) error {
|
||||
func (secretcontroller *SecretController) delete(secret *apiv1.Secret) error {
|
||||
glog.V(3).Infof("Handling deletion of secret: %v", *secret)
|
||||
_, err := secretcontroller.deletionHelper.HandleObjectInUnderlyingClusters(secret)
|
||||
if err != nil {
|
||||
|
@@ -22,14 +22,14 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fake_fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fakefedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util/deletionhelper"
|
||||
. "k8s.io/kubernetes/federation/pkg/federation-controller/util/test"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -38,29 +38,29 @@ import (
|
||||
)
|
||||
|
||||
func TestSecretController(t *testing.T) {
|
||||
cluster1 := NewCluster("cluster1", api_v1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", api_v1.ConditionTrue)
|
||||
cluster1 := NewCluster("cluster1", apiv1.ConditionTrue)
|
||||
cluster2 := NewCluster("cluster2", apiv1.ConditionTrue)
|
||||
|
||||
fakeClient := &fake_fedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federation_api.ClusterList{Items: []federation_api.Cluster{*cluster1}})
|
||||
RegisterFakeList("secrets", &fakeClient.Fake, &api_v1.SecretList{Items: []api_v1.Secret{}})
|
||||
fakeClient := &fakefedclientset.Clientset{}
|
||||
RegisterFakeList("clusters", &fakeClient.Fake, &federationapi.ClusterList{Items: []federationapi.Cluster{*cluster1}})
|
||||
RegisterFakeList("secrets", &fakeClient.Fake, &apiv1.SecretList{Items: []apiv1.Secret{}})
|
||||
secretWatch := RegisterFakeWatch("secrets", &fakeClient.Fake)
|
||||
secretUpdateChan := RegisterFakeCopyOnUpdate("secrets", &fakeClient.Fake, secretWatch)
|
||||
clusterWatch := RegisterFakeWatch("clusters", &fakeClient.Fake)
|
||||
|
||||
cluster1Client := &fake_kubeclientset.Clientset{}
|
||||
cluster1Client := &fakekubeclientset.Clientset{}
|
||||
cluster1Watch := RegisterFakeWatch("secrets", &cluster1Client.Fake)
|
||||
RegisterFakeList("secrets", &cluster1Client.Fake, &api_v1.SecretList{Items: []api_v1.Secret{}})
|
||||
RegisterFakeList("secrets", &cluster1Client.Fake, &apiv1.SecretList{Items: []apiv1.Secret{}})
|
||||
cluster1CreateChan := RegisterFakeCopyOnCreate("secrets", &cluster1Client.Fake, cluster1Watch)
|
||||
// cluster1UpdateChan := RegisterFakeCopyOnUpdate("secrets", &cluster1Client.Fake, cluster1Watch)
|
||||
|
||||
cluster2Client := &fake_kubeclientset.Clientset{}
|
||||
cluster2Client := &fakekubeclientset.Clientset{}
|
||||
cluster2Watch := RegisterFakeWatch("secrets", &cluster2Client.Fake)
|
||||
RegisterFakeList("secrets", &cluster2Client.Fake, &api_v1.SecretList{Items: []api_v1.Secret{}})
|
||||
RegisterFakeList("secrets", &cluster2Client.Fake, &apiv1.SecretList{Items: []apiv1.Secret{}})
|
||||
cluster2CreateChan := RegisterFakeCopyOnCreate("secrets", &cluster2Client.Fake, cluster2Watch)
|
||||
|
||||
secretController := NewSecretController(fakeClient)
|
||||
informerClientFactory := func(cluster *federation_api.Cluster) (kubeclientset.Interface, error) {
|
||||
informerClientFactory := func(cluster *federationapi.Cluster) (kubeclientset.Interface, error) {
|
||||
switch cluster.Name {
|
||||
case cluster1.Name:
|
||||
return cluster1Client, nil
|
||||
@@ -80,8 +80,8 @@ func TestSecretController(t *testing.T) {
|
||||
stop := make(chan struct{})
|
||||
secretController.Run(stop)
|
||||
|
||||
secret1 := api_v1.Secret{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
secret1 := apiv1.Secret{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "test-secret",
|
||||
Namespace: "ns",
|
||||
SelfLink: "/api/v1/namespaces/ns/secrets/test-secret",
|
||||
@@ -90,7 +90,7 @@ func TestSecretController(t *testing.T) {
|
||||
"A": []byte("ala ma kota"),
|
||||
"B": []byte("quick brown fox"),
|
||||
},
|
||||
Type: api_v1.SecretTypeOpaque,
|
||||
Type: apiv1.SecretTypeOpaque,
|
||||
}
|
||||
|
||||
// Test add federated secret.
|
||||
@@ -99,7 +99,7 @@ func TestSecretController(t *testing.T) {
|
||||
updatedSecret := GetSecretFromChan(secretUpdateChan)
|
||||
assert.True(t, secretController.hasFinalizerFunc(updatedSecret, deletionhelper.FinalizerDeleteFromUnderlyingClusters))
|
||||
updatedSecret = GetSecretFromChan(secretUpdateChan)
|
||||
assert.True(t, secretController.hasFinalizerFunc(updatedSecret, api_v1.FinalizerOrphan))
|
||||
assert.True(t, secretController.hasFinalizerFunc(updatedSecret, apiv1.FinalizerOrphan))
|
||||
secret1 = *updatedSecret
|
||||
|
||||
// Verify that the secret is created in underlying cluster1.
|
||||
@@ -161,12 +161,12 @@ func TestSecretController(t *testing.T) {
|
||||
close(stop)
|
||||
}
|
||||
|
||||
func setClientFactory(informer util.FederatedInformer, informerClientFactory func(*federation_api.Cluster) (kubeclientset.Interface, error)) {
|
||||
func setClientFactory(informer util.FederatedInformer, informerClientFactory func(*federationapi.Cluster) (kubeclientset.Interface, error)) {
|
||||
testInformer := ToFederatedInformerForTestOnly(informer)
|
||||
testInformer.SetClientFactory(informerClientFactory)
|
||||
}
|
||||
|
||||
func secretsEqual(a, b api_v1.Secret) bool {
|
||||
func secretsEqual(a, b apiv1.Secret) bool {
|
||||
// Clear the SelfLink and ObjectMeta.Finalizers since they will be different
|
||||
// in resoure in federation control plane and resource in underlying cluster.
|
||||
a.SelfLink = ""
|
||||
@@ -176,20 +176,20 @@ func secretsEqual(a, b api_v1.Secret) bool {
|
||||
return reflect.DeepEqual(a, b)
|
||||
}
|
||||
|
||||
func GetSecretFromChan(c chan runtime.Object) *api_v1.Secret {
|
||||
secret := GetObjectFromChan(c).(*api_v1.Secret)
|
||||
func GetSecretFromChan(c chan runtime.Object) *apiv1.Secret {
|
||||
secret := GetObjectFromChan(c).(*apiv1.Secret)
|
||||
return secret
|
||||
}
|
||||
|
||||
// Wait till the store is updated with latest secret.
|
||||
func WaitForSecretStoreUpdate(store util.FederatedReadOnlyStore, clusterName, key string, desiredSecret *api_v1.Secret, timeout time.Duration) error {
|
||||
func WaitForSecretStoreUpdate(store util.FederatedReadOnlyStore, clusterName, key string, desiredSecret *apiv1.Secret, timeout time.Duration) error {
|
||||
retryInterval := 100 * time.Millisecond
|
||||
err := wait.PollImmediate(retryInterval, timeout, func() (bool, error) {
|
||||
obj, found, err := store.GetByKey(clusterName, key)
|
||||
if !found || err != nil {
|
||||
return false, err
|
||||
}
|
||||
equal := secretsEqual(*obj.(*api_v1.Secret), *desiredSecret)
|
||||
equal := secretsEqual(*obj.(*apiv1.Secret), *desiredSecret)
|
||||
return equal, err
|
||||
})
|
||||
return err
|
||||
|
@@ -24,7 +24,7 @@ import (
|
||||
cache "k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/restclient"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
"k8s.io/kubernetes/pkg/util/workqueue"
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
@@ -91,7 +91,7 @@ func (cc *clusterClientCache) startClusterLW(cluster *v1beta1.Cluster, clusterNa
|
||||
}
|
||||
cachedClusterClient.endpointStore.Store, cachedClusterClient.endpointController = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
return clientset.Core().Endpoints(v1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options v1.ListOptions) (watch.Interface, error) {
|
||||
@@ -115,7 +115,7 @@ func (cc *clusterClientCache) startClusterLW(cluster *v1beta1.Cluster, clusterNa
|
||||
|
||||
cachedClusterClient.serviceStore.Indexer, cachedClusterClient.serviceController = cache.NewIndexerInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
return clientset.Core().Services(v1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options v1.ListOptions) (watch.Interface, error) {
|
||||
|
@@ -34,7 +34,7 @@ import (
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/controller"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/sets"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -164,7 +164,7 @@ func New(federationClient fedclientset.Interface, dns dnsprovider.Interface,
|
||||
}
|
||||
s.serviceStore.Indexer, s.serviceController = cache.NewIndexerInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
return s.federationClient.Core().Services(v1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options v1.ListOptions) (watch.Interface, error) {
|
||||
@@ -187,7 +187,7 @@ func New(federationClient fedclientset.Interface, dns dnsprovider.Interface,
|
||||
)
|
||||
s.clusterStore.Store, s.clusterController = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
return s.federationClient.Federation().Clusters().List(options)
|
||||
},
|
||||
WatchFunc: func(options v1.ListOptions) (watch.Interface, error) {
|
||||
|
@@ -19,9 +19,9 @@ package eventsink
|
||||
import (
|
||||
"testing"
|
||||
|
||||
fake_fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
fakefedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
. "k8s.io/kubernetes/federation/pkg/federation-controller/util/test"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/testing/core"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
|
||||
@@ -29,7 +29,7 @@ import (
|
||||
)
|
||||
|
||||
func TestEventSink(t *testing.T) {
|
||||
fakeFederationClient := &fake_fedclientset.Clientset{}
|
||||
fakeFederationClient := &fakefedclientset.Clientset{}
|
||||
createdChan := make(chan runtime.Object, 100)
|
||||
fakeFederationClient.AddReactor("create", "events", func(action core.Action) (bool, runtime.Object, error) {
|
||||
createAction := action.(core.CreateAction)
|
||||
@@ -45,8 +45,8 @@ func TestEventSink(t *testing.T) {
|
||||
return true, obj, nil
|
||||
})
|
||||
|
||||
event := api_v1.Event{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
event := apiv1.Event{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "bzium",
|
||||
Namespace: "ns",
|
||||
},
|
||||
@@ -54,7 +54,7 @@ func TestEventSink(t *testing.T) {
|
||||
sink := NewFederatedEventSink(fakeFederationClient)
|
||||
eventUpdated, err := sink.Create(&event)
|
||||
assert.NoError(t, err)
|
||||
eventV1 := GetObjectFromChan(createdChan).(*api_v1.Event)
|
||||
eventV1 := GetObjectFromChan(createdChan).(*apiv1.Event)
|
||||
assert.NotNil(t, eventV1)
|
||||
// Just some simple sanity checks.
|
||||
assert.Equal(t, event.Name, eventV1.Name)
|
||||
@@ -62,7 +62,7 @@ func TestEventSink(t *testing.T) {
|
||||
|
||||
eventUpdated, err = sink.Update(&event)
|
||||
assert.NoError(t, err)
|
||||
eventV1 = GetObjectFromChan(updateChan).(*api_v1.Event)
|
||||
eventV1 = GetObjectFromChan(updateChan).(*apiv1.Event)
|
||||
assert.NotNil(t, eventV1)
|
||||
// Just some simple sanity checks.
|
||||
assert.Equal(t, event.Name, eventV1.Name)
|
||||
|
@@ -22,13 +22,13 @@ import (
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
"k8s.io/kubernetes/pkg/client/restclient"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
|
||||
"github.com/golang/glog"
|
||||
@@ -68,7 +68,7 @@ type FederatedReadOnlyStore interface {
|
||||
// issues occur less often. All users of the interface should assume
|
||||
// that there may be significant delays in content updates of all kinds and write their
|
||||
// code that it doesn't break if something is slightly out-of-sync.
|
||||
ClustersSynced(clusters []*federation_api.Cluster) bool
|
||||
ClustersSynced(clusters []*federationapi.Cluster) bool
|
||||
}
|
||||
|
||||
// An interface to access federation members and clients.
|
||||
@@ -77,13 +77,13 @@ type FederationView interface {
|
||||
GetClientsetForCluster(clusterName string) (kubeclientset.Interface, error)
|
||||
|
||||
// GetUnreadyClusters returns a list of all clusters that are not ready yet.
|
||||
GetUnreadyClusters() ([]*federation_api.Cluster, error)
|
||||
GetUnreadyClusters() ([]*federationapi.Cluster, error)
|
||||
|
||||
// GetReadyClusers returns all clusters for which the sub-informers are run.
|
||||
GetReadyClusters() ([]*federation_api.Cluster, error)
|
||||
GetReadyClusters() ([]*federationapi.Cluster, error)
|
||||
|
||||
// GetReadyCluster returns the cluster with the given name, if found.
|
||||
GetReadyCluster(name string) (*federation_api.Cluster, bool, error)
|
||||
GetReadyCluster(name string) (*federationapi.Cluster, bool, error)
|
||||
|
||||
// ClustersSynced returns true if the view is synced (for the first time).
|
||||
ClustersSynced() bool
|
||||
@@ -111,12 +111,12 @@ type FederatedInformer interface {
|
||||
type FederatedInformerForTestOnly interface {
|
||||
FederatedInformer
|
||||
|
||||
SetClientFactory(func(*federation_api.Cluster) (kubeclientset.Interface, error))
|
||||
SetClientFactory(func(*federationapi.Cluster) (kubeclientset.Interface, error))
|
||||
}
|
||||
|
||||
// A function that should be used to create an informer on the target object. Store should use
|
||||
// cache.DeletionHandlingMetaNamespaceKeyFunc as a keying function.
|
||||
type TargetInformerFactory func(*federation_api.Cluster, kubeclientset.Interface) (cache.Store, cache.ControllerInterface)
|
||||
type TargetInformerFactory func(*federationapi.Cluster, kubeclientset.Interface) (cache.Store, cache.ControllerInterface)
|
||||
|
||||
// A structure with cluster lifecycle handler functions. Cluster is available (and ClusterAvailable is fired)
|
||||
// when it is created in federated etcd and ready. Cluster becomes unavailable (and ClusterUnavailable is fired)
|
||||
@@ -124,10 +124,10 @@ type TargetInformerFactory func(*federation_api.Cluster, kubeclientset.Interface
|
||||
// and ClusterUnavailable are fired.
|
||||
type ClusterLifecycleHandlerFuncs struct {
|
||||
// Fired when the cluster becomes available.
|
||||
ClusterAvailable func(*federation_api.Cluster)
|
||||
ClusterAvailable func(*federationapi.Cluster)
|
||||
// Fired when the cluster becomes unavailable. The second arg contains data that was present
|
||||
// in the cluster before deletion.
|
||||
ClusterUnavailable func(*federation_api.Cluster, []interface{})
|
||||
ClusterUnavailable func(*federationapi.Cluster, []interface{})
|
||||
}
|
||||
|
||||
// Builds a FederatedInformer for the given federation client and factory.
|
||||
@@ -138,7 +138,7 @@ func NewFederatedInformer(
|
||||
|
||||
federatedInformer := &federatedInformerImpl{
|
||||
targetInformerFactory: targetInformerFactory,
|
||||
clientFactory: func(cluster *federation_api.Cluster) (kubeclientset.Interface, error) {
|
||||
clientFactory: func(cluster *federationapi.Cluster) (kubeclientset.Interface, error) {
|
||||
clusterConfig, err := BuildClusterConfig(cluster)
|
||||
if err == nil && clusterConfig != nil {
|
||||
clientset := kubeclientset.NewForConfigOrDie(restclient.AddUserAgent(clusterConfig, userAgentName))
|
||||
@@ -160,18 +160,18 @@ func NewFederatedInformer(
|
||||
|
||||
federatedInformer.clusterInformer.store, federatedInformer.clusterInformer.controller = cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options apiv1.ListOptions) (pkgruntime.Object, error) {
|
||||
return federationClient.Federation().Clusters().List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return federationClient.Federation().Clusters().Watch(options)
|
||||
},
|
||||
},
|
||||
&federation_api.Cluster{},
|
||||
&federationapi.Cluster{},
|
||||
clusterSyncPeriod,
|
||||
cache.ResourceEventHandlerFuncs{
|
||||
DeleteFunc: func(old interface{}) {
|
||||
oldCluster, ok := old.(*federation_api.Cluster)
|
||||
oldCluster, ok := old.(*federationapi.Cluster)
|
||||
if ok {
|
||||
var data []interface{}
|
||||
if clusterLifecycle.ClusterUnavailable != nil {
|
||||
@@ -184,7 +184,7 @@ func NewFederatedInformer(
|
||||
}
|
||||
},
|
||||
AddFunc: func(cur interface{}) {
|
||||
curCluster, ok := cur.(*federation_api.Cluster)
|
||||
curCluster, ok := cur.(*federationapi.Cluster)
|
||||
if ok && isClusterReady(curCluster) {
|
||||
federatedInformer.addCluster(curCluster)
|
||||
if clusterLifecycle.ClusterAvailable != nil {
|
||||
@@ -195,12 +195,12 @@ func NewFederatedInformer(
|
||||
}
|
||||
},
|
||||
UpdateFunc: func(old, cur interface{}) {
|
||||
oldCluster, ok := old.(*federation_api.Cluster)
|
||||
oldCluster, ok := old.(*federationapi.Cluster)
|
||||
if !ok {
|
||||
glog.Errorf("Internal error: Cluster %v not updated. Old cluster not of correct type.", old)
|
||||
return
|
||||
}
|
||||
curCluster, ok := cur.(*federation_api.Cluster)
|
||||
curCluster, ok := cur.(*federationapi.Cluster)
|
||||
if !ok {
|
||||
glog.Errorf("Internal error: Cluster %v not updated. New cluster not of correct type.", cur)
|
||||
return
|
||||
@@ -230,10 +230,10 @@ func NewFederatedInformer(
|
||||
return federatedInformer
|
||||
}
|
||||
|
||||
func isClusterReady(cluster *federation_api.Cluster) bool {
|
||||
func isClusterReady(cluster *federationapi.Cluster) bool {
|
||||
for _, condition := range cluster.Status.Conditions {
|
||||
if condition.Type == federation_api.ClusterReady {
|
||||
if condition.Status == api_v1.ConditionTrue {
|
||||
if condition.Type == federationapi.ClusterReady {
|
||||
if condition.Status == apiv1.ConditionTrue {
|
||||
return true
|
||||
}
|
||||
}
|
||||
@@ -260,7 +260,7 @@ type federatedInformerImpl struct {
|
||||
targetInformers map[string]informer
|
||||
|
||||
// A function to build clients.
|
||||
clientFactory func(*federation_api.Cluster) (kubeclientset.Interface, error)
|
||||
clientFactory func(*federationapi.Cluster) (kubeclientset.Interface, error)
|
||||
}
|
||||
|
||||
// *federatedInformerImpl implements FederatedInformer interface.
|
||||
@@ -291,7 +291,7 @@ func (f *federatedInformerImpl) Start() {
|
||||
go f.clusterInformer.controller.Run(f.clusterInformer.stopChan)
|
||||
}
|
||||
|
||||
func (f *federatedInformerImpl) SetClientFactory(clientFactory func(*federation_api.Cluster) (kubeclientset.Interface, error)) {
|
||||
func (f *federatedInformerImpl) SetClientFactory(clientFactory func(*federationapi.Cluster) (kubeclientset.Interface, error)) {
|
||||
f.Lock()
|
||||
defer f.Unlock()
|
||||
|
||||
@@ -319,14 +319,14 @@ func (f *federatedInformerImpl) getClientsetForClusterUnlocked(clusterName strin
|
||||
return nil, fmt.Errorf("cluster %q not found", clusterName)
|
||||
}
|
||||
|
||||
func (f *federatedInformerImpl) GetUnreadyClusters() ([]*federation_api.Cluster, error) {
|
||||
func (f *federatedInformerImpl) GetUnreadyClusters() ([]*federationapi.Cluster, error) {
|
||||
f.Lock()
|
||||
defer f.Unlock()
|
||||
|
||||
items := f.clusterInformer.store.List()
|
||||
result := make([]*federation_api.Cluster, 0, len(items))
|
||||
result := make([]*federationapi.Cluster, 0, len(items))
|
||||
for _, item := range items {
|
||||
if cluster, ok := item.(*federation_api.Cluster); ok {
|
||||
if cluster, ok := item.(*federationapi.Cluster); ok {
|
||||
if !isClusterReady(cluster) {
|
||||
result = append(result, cluster)
|
||||
}
|
||||
@@ -338,14 +338,14 @@ func (f *federatedInformerImpl) GetUnreadyClusters() ([]*federation_api.Cluster,
|
||||
}
|
||||
|
||||
// GetReadyClusers returns all clusters for which the sub-informers are run.
|
||||
func (f *federatedInformerImpl) GetReadyClusters() ([]*federation_api.Cluster, error) {
|
||||
func (f *federatedInformerImpl) GetReadyClusters() ([]*federationapi.Cluster, error) {
|
||||
f.Lock()
|
||||
defer f.Unlock()
|
||||
|
||||
items := f.clusterInformer.store.List()
|
||||
result := make([]*federation_api.Cluster, 0, len(items))
|
||||
result := make([]*federationapi.Cluster, 0, len(items))
|
||||
for _, item := range items {
|
||||
if cluster, ok := item.(*federation_api.Cluster); ok {
|
||||
if cluster, ok := item.(*federationapi.Cluster); ok {
|
||||
if isClusterReady(cluster) {
|
||||
result = append(result, cluster)
|
||||
}
|
||||
@@ -357,15 +357,15 @@ func (f *federatedInformerImpl) GetReadyClusters() ([]*federation_api.Cluster, e
|
||||
}
|
||||
|
||||
// GetCluster returns the cluster with the given name, if found.
|
||||
func (f *federatedInformerImpl) GetReadyCluster(name string) (*federation_api.Cluster, bool, error) {
|
||||
func (f *federatedInformerImpl) GetReadyCluster(name string) (*federationapi.Cluster, bool, error) {
|
||||
f.Lock()
|
||||
defer f.Unlock()
|
||||
return f.getReadyClusterUnlocked(name)
|
||||
}
|
||||
|
||||
func (f *federatedInformerImpl) getReadyClusterUnlocked(name string) (*federation_api.Cluster, bool, error) {
|
||||
func (f *federatedInformerImpl) getReadyClusterUnlocked(name string) (*federationapi.Cluster, bool, error) {
|
||||
if obj, exist, err := f.clusterInformer.store.GetByKey(name); exist && err == nil {
|
||||
if cluster, ok := obj.(*federation_api.Cluster); ok {
|
||||
if cluster, ok := obj.(*federationapi.Cluster); ok {
|
||||
if isClusterReady(cluster) {
|
||||
return cluster, true, nil
|
||||
}
|
||||
@@ -385,7 +385,7 @@ func (f *federatedInformerImpl) ClustersSynced() bool {
|
||||
}
|
||||
|
||||
// Adds the given cluster to federated informer.
|
||||
func (f *federatedInformerImpl) addCluster(cluster *federation_api.Cluster) {
|
||||
func (f *federatedInformerImpl) addCluster(cluster *federationapi.Cluster) {
|
||||
f.Lock()
|
||||
defer f.Unlock()
|
||||
name := cluster.Name
|
||||
@@ -405,7 +405,7 @@ func (f *federatedInformerImpl) addCluster(cluster *federation_api.Cluster) {
|
||||
}
|
||||
|
||||
// Removes the cluster from federated informer.
|
||||
func (f *federatedInformerImpl) deleteCluster(cluster *federation_api.Cluster) {
|
||||
func (f *federatedInformerImpl) deleteCluster(cluster *federationapi.Cluster) {
|
||||
f.Lock()
|
||||
defer f.Unlock()
|
||||
name := cluster.Name
|
||||
@@ -486,7 +486,7 @@ func (fs *federatedStoreImpl) GetKeyFor(item interface{}) string {
|
||||
|
||||
// Checks whether stores for all clusters form the lists (and only these) are there and
|
||||
// are synced.
|
||||
func (fs *federatedStoreImpl) ClustersSynced(clusters []*federation_api.Cluster) bool {
|
||||
func (fs *federatedStoreImpl) ClustersSynced(clusters []*federationapi.Cluster) bool {
|
||||
|
||||
// Get the list of informers to check under a lock and check it outside.
|
||||
okSoFar, informersToCheck := func() (bool, []informer) {
|
||||
|
@@ -20,12 +20,12 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
fakefederationclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_release_1_5/fake"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/client/testing/core"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
@@ -39,18 +39,18 @@ func TestFederatedInformer(t *testing.T) {
|
||||
fakeFederationClient := &fakefederationclientset.Clientset{}
|
||||
|
||||
// Add a single cluster to federation and remove it when needed.
|
||||
cluster := federation_api.Cluster{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
cluster := federationapi.Cluster{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: "mycluster",
|
||||
},
|
||||
Status: federation_api.ClusterStatus{
|
||||
Conditions: []federation_api.ClusterCondition{
|
||||
{Type: federation_api.ClusterReady, Status: api_v1.ConditionTrue},
|
||||
Status: federationapi.ClusterStatus{
|
||||
Conditions: []federationapi.ClusterCondition{
|
||||
{Type: federationapi.ClusterReady, Status: apiv1.ConditionTrue},
|
||||
},
|
||||
},
|
||||
}
|
||||
fakeFederationClient.AddReactor("list", "clusters", func(action core.Action) (bool, runtime.Object, error) {
|
||||
return true, &federation_api.ClusterList{Items: []federation_api.Cluster{cluster}}, nil
|
||||
return true, &federationapi.ClusterList{Items: []federationapi.Cluster{cluster}}, nil
|
||||
})
|
||||
deleteChan := make(chan struct{})
|
||||
fakeFederationClient.AddWatchReactor("clusters", func(action core.Action) (bool, watch.Interface, error) {
|
||||
@@ -62,32 +62,32 @@ func TestFederatedInformer(t *testing.T) {
|
||||
return true, fakeWatch, nil
|
||||
})
|
||||
|
||||
fakeKubeClient := &fake_kubeclientset.Clientset{}
|
||||
fakeKubeClient := &fakekubeclientset.Clientset{}
|
||||
// There is a single service ns1/s1 in cluster mycluster.
|
||||
service := api_v1.Service{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
service := apiv1.Service{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Namespace: "ns1",
|
||||
Name: "s1",
|
||||
},
|
||||
}
|
||||
fakeKubeClient.AddReactor("list", "services", func(action core.Action) (bool, runtime.Object, error) {
|
||||
return true, &api_v1.ServiceList{Items: []api_v1.Service{service}}, nil
|
||||
return true, &apiv1.ServiceList{Items: []apiv1.Service{service}}, nil
|
||||
})
|
||||
fakeKubeClient.AddWatchReactor("services", func(action core.Action) (bool, watch.Interface, error) {
|
||||
return true, watch.NewFake(), nil
|
||||
})
|
||||
|
||||
targetInformerFactory := func(cluster *federation_api.Cluster, clientset kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
targetInformerFactory := func(cluster *federationapi.Cluster, clientset kubeclientset.Interface) (cache.Store, cache.ControllerInterface) {
|
||||
return cache.NewInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options api_v1.ListOptions) (runtime.Object, error) {
|
||||
return clientset.Core().Services(api_v1.NamespaceAll).List(options)
|
||||
ListFunc: func(options apiv1.ListOptions) (runtime.Object, error) {
|
||||
return clientset.Core().Services(apiv1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options api_v1.ListOptions) (watch.Interface, error) {
|
||||
return clientset.Core().Services(api_v1.NamespaceAll).Watch(options)
|
||||
WatchFunc: func(options apiv1.ListOptions) (watch.Interface, error) {
|
||||
return clientset.Core().Services(apiv1.NamespaceAll).Watch(options)
|
||||
},
|
||||
},
|
||||
&api_v1.Service{},
|
||||
&apiv1.Service{},
|
||||
10*time.Second,
|
||||
cache.ResourceEventHandlerFuncs{})
|
||||
}
|
||||
@@ -95,25 +95,25 @@ func TestFederatedInformer(t *testing.T) {
|
||||
addedClusters := make(chan string, 1)
|
||||
deletedClusters := make(chan string, 1)
|
||||
lifecycle := ClusterLifecycleHandlerFuncs{
|
||||
ClusterAvailable: func(cluster *federation_api.Cluster) {
|
||||
ClusterAvailable: func(cluster *federationapi.Cluster) {
|
||||
addedClusters <- cluster.Name
|
||||
close(addedClusters)
|
||||
},
|
||||
ClusterUnavailable: func(cluster *federation_api.Cluster, _ []interface{}) {
|
||||
ClusterUnavailable: func(cluster *federationapi.Cluster, _ []interface{}) {
|
||||
deletedClusters <- cluster.Name
|
||||
close(deletedClusters)
|
||||
},
|
||||
}
|
||||
|
||||
informer := NewFederatedInformer(fakeFederationClient, targetInformerFactory, &lifecycle).(*federatedInformerImpl)
|
||||
informer.clientFactory = func(cluster *federation_api.Cluster) (kubeclientset.Interface, error) {
|
||||
informer.clientFactory = func(cluster *federationapi.Cluster) (kubeclientset.Interface, error) {
|
||||
return fakeKubeClient, nil
|
||||
}
|
||||
assert.NotNil(t, informer)
|
||||
informer.Start()
|
||||
|
||||
// Wait until mycluster is synced.
|
||||
for !informer.GetTargetStore().ClustersSynced([]*federation_api.Cluster{&cluster}) {
|
||||
for !informer.GetTargetStore().ClustersSynced([]*federationapi.Cluster{&cluster}) {
|
||||
time.Sleep(time.Millisecond * 100)
|
||||
}
|
||||
readyClusters, err := informer.GetReadyClusters()
|
||||
@@ -131,7 +131,7 @@ func TestFederatedInformer(t *testing.T) {
|
||||
|
||||
// All checked, lets delete the cluster.
|
||||
deleteChan <- struct{}{}
|
||||
for !informer.GetTargetStore().ClustersSynced([]*federation_api.Cluster{}) {
|
||||
for !informer.GetTargetStore().ClustersSynced([]*federationapi.Cluster{}) {
|
||||
time.Sleep(time.Millisecond * 100)
|
||||
}
|
||||
readyClusters, err = informer.GetReadyClusters()
|
||||
|
@@ -21,7 +21,7 @@ import (
|
||||
"time"
|
||||
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
)
|
||||
|
||||
// Type of the operation that can be executed in Federated.
|
||||
@@ -37,7 +37,7 @@ const (
|
||||
type FederatedOperation struct {
|
||||
Type FederatedOperationType
|
||||
ClusterName string
|
||||
Obj pkg_runtime.Object
|
||||
Obj pkgruntime.Object
|
||||
}
|
||||
|
||||
// A helper that executes the given set of updates on federation, in parallel.
|
||||
@@ -52,7 +52,7 @@ type FederatedUpdater interface {
|
||||
}
|
||||
|
||||
// A function that executes some operation using the passed client and object.
|
||||
type FederatedOperationHandler func(kubeclientset.Interface, pkg_runtime.Object) error
|
||||
type FederatedOperationHandler func(kubeclientset.Interface, pkgruntime.Object) error
|
||||
|
||||
type federatedUpdaterImpl struct {
|
||||
federation FederationView
|
||||
|
@@ -21,11 +21,11 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
fake_kubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
fakekubeclientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
@@ -38,18 +38,18 @@ type fakeFederationView struct {
|
||||
var _ FederationView = &fakeFederationView{}
|
||||
|
||||
func (f *fakeFederationView) GetClientsetForCluster(clusterName string) (kubeclientset.Interface, error) {
|
||||
return &fake_kubeclientset.Clientset{}, nil
|
||||
return &fakekubeclientset.Clientset{}, nil
|
||||
}
|
||||
|
||||
func (f *fakeFederationView) GetReadyClusters() ([]*federation_api.Cluster, error) {
|
||||
return []*federation_api.Cluster{}, nil
|
||||
func (f *fakeFederationView) GetReadyClusters() ([]*federationapi.Cluster, error) {
|
||||
return []*federationapi.Cluster{}, nil
|
||||
}
|
||||
|
||||
func (f *fakeFederationView) GetUnreadyClusters() ([]*federation_api.Cluster, error) {
|
||||
return []*federation_api.Cluster{}, nil
|
||||
func (f *fakeFederationView) GetUnreadyClusters() ([]*federationapi.Cluster, error) {
|
||||
return []*federationapi.Cluster{}, nil
|
||||
}
|
||||
|
||||
func (f *fakeFederationView) GetReadyCluster(name string) (*federation_api.Cluster, bool, error) {
|
||||
func (f *fakeFederationView) GetReadyCluster(name string) (*federationapi.Cluster, bool, error) {
|
||||
return nil, false, nil
|
||||
}
|
||||
|
||||
@@ -62,13 +62,13 @@ func TestFederatedUpdaterOK(t *testing.T) {
|
||||
updateChan := make(chan string, 5)
|
||||
|
||||
updater := NewFederatedUpdater(&fakeFederationView{},
|
||||
func(_ kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
service := obj.(*api_v1.Service)
|
||||
func(_ kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
service := obj.(*apiv1.Service)
|
||||
addChan <- service.Name
|
||||
return nil
|
||||
},
|
||||
func(_ kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
service := obj.(*api_v1.Service)
|
||||
func(_ kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
service := obj.(*apiv1.Service)
|
||||
updateChan <- service.Name
|
||||
return nil
|
||||
},
|
||||
@@ -93,7 +93,7 @@ func TestFederatedUpdaterOK(t *testing.T) {
|
||||
|
||||
func TestFederatedUpdaterError(t *testing.T) {
|
||||
updater := NewFederatedUpdater(&fakeFederationView{},
|
||||
func(_ kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(_ kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
return fmt.Errorf("boom")
|
||||
}, noop, noop)
|
||||
|
||||
@@ -113,7 +113,7 @@ func TestFederatedUpdaterError(t *testing.T) {
|
||||
func TestFederatedUpdaterTimeout(t *testing.T) {
|
||||
start := time.Now()
|
||||
updater := NewFederatedUpdater(&fakeFederationView{},
|
||||
func(_ kubeclientset.Interface, obj pkg_runtime.Object) error {
|
||||
func(_ kubeclientset.Interface, obj pkgruntime.Object) error {
|
||||
time.Sleep(time.Minute)
|
||||
return nil
|
||||
},
|
||||
@@ -134,15 +134,15 @@ func TestFederatedUpdaterTimeout(t *testing.T) {
|
||||
assert.True(t, start.Add(10*time.Second).After(end))
|
||||
}
|
||||
|
||||
func makeService(cluster, name string) *api_v1.Service {
|
||||
return &api_v1.Service{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
func makeService(cluster, name string) *apiv1.Service {
|
||||
return &apiv1.Service{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Namespace: "ns1",
|
||||
Name: name,
|
||||
},
|
||||
}
|
||||
}
|
||||
|
||||
func noop(_ kubeclientset.Interface, _ pkg_runtime.Object) error {
|
||||
func noop(_ kubeclientset.Interface, _ pkgruntime.Object) error {
|
||||
return nil
|
||||
}
|
||||
|
@@ -20,25 +20,25 @@ import (
|
||||
"fmt"
|
||||
"reflect"
|
||||
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
)
|
||||
|
||||
// Returns cache.ResourceEventHandlerFuncs that trigger the given function
|
||||
// on all object changes.
|
||||
func NewTriggerOnAllChanges(triggerFunc func(pkg_runtime.Object)) *cache.ResourceEventHandlerFuncs {
|
||||
func NewTriggerOnAllChanges(triggerFunc func(pkgruntime.Object)) *cache.ResourceEventHandlerFuncs {
|
||||
return &cache.ResourceEventHandlerFuncs{
|
||||
DeleteFunc: func(old interface{}) {
|
||||
oldObj := old.(pkg_runtime.Object)
|
||||
oldObj := old.(pkgruntime.Object)
|
||||
triggerFunc(oldObj)
|
||||
},
|
||||
AddFunc: func(cur interface{}) {
|
||||
curObj := cur.(pkg_runtime.Object)
|
||||
curObj := cur.(pkgruntime.Object)
|
||||
triggerFunc(curObj)
|
||||
},
|
||||
UpdateFunc: func(old, cur interface{}) {
|
||||
curObj := cur.(pkg_runtime.Object)
|
||||
curObj := cur.(pkgruntime.Object)
|
||||
if !reflect.DeepEqual(old, cur) {
|
||||
triggerFunc(curObj)
|
||||
}
|
||||
@@ -48,7 +48,7 @@ func NewTriggerOnAllChanges(triggerFunc func(pkg_runtime.Object)) *cache.Resourc
|
||||
|
||||
// Returns cache.ResourceEventHandlerFuncs that trigger the given function
|
||||
// on object add and delete as well as spec/object meta on update.
|
||||
func NewTriggerOnMetaAndSpecChanges(triggerFunc func(pkg_runtime.Object)) *cache.ResourceEventHandlerFuncs {
|
||||
func NewTriggerOnMetaAndSpecChanges(triggerFunc func(pkgruntime.Object)) *cache.ResourceEventHandlerFuncs {
|
||||
getFieldOrPanic := func(obj interface{}, fieldName string) interface{} {
|
||||
val := reflect.ValueOf(obj).Elem().FieldByName(fieldName)
|
||||
if val.IsValid() {
|
||||
@@ -59,17 +59,17 @@ func NewTriggerOnMetaAndSpecChanges(triggerFunc func(pkg_runtime.Object)) *cache
|
||||
}
|
||||
return &cache.ResourceEventHandlerFuncs{
|
||||
DeleteFunc: func(old interface{}) {
|
||||
oldObj := old.(pkg_runtime.Object)
|
||||
oldObj := old.(pkgruntime.Object)
|
||||
triggerFunc(oldObj)
|
||||
},
|
||||
AddFunc: func(cur interface{}) {
|
||||
curObj := cur.(pkg_runtime.Object)
|
||||
curObj := cur.(pkgruntime.Object)
|
||||
triggerFunc(curObj)
|
||||
},
|
||||
UpdateFunc: func(old, cur interface{}) {
|
||||
curObj := cur.(pkg_runtime.Object)
|
||||
oldMeta := getFieldOrPanic(old, "ObjectMeta").(api_v1.ObjectMeta)
|
||||
curMeta := getFieldOrPanic(cur, "ObjectMeta").(api_v1.ObjectMeta)
|
||||
curObj := cur.(pkgruntime.Object)
|
||||
oldMeta := getFieldOrPanic(old, "ObjectMeta").(apiv1.ObjectMeta)
|
||||
curMeta := getFieldOrPanic(cur, "ObjectMeta").(apiv1.ObjectMeta)
|
||||
if !ObjectMetaEquivalent(oldMeta, curMeta) ||
|
||||
!reflect.DeepEqual(getFieldOrPanic(old, "Spec"), getFieldOrPanic(cur, "Spec")) {
|
||||
triggerFunc(curObj)
|
||||
|
@@ -19,22 +19,22 @@ package util
|
||||
import (
|
||||
"testing"
|
||||
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func TestHandlers(t *testing.T) {
|
||||
// There is a single service ns1/s1 in cluster mycluster.
|
||||
service := api_v1.Service{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
service := apiv1.Service{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Namespace: "ns1",
|
||||
Name: "s1",
|
||||
},
|
||||
}
|
||||
service2 := api_v1.Service{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
service2 := apiv1.Service{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Namespace: "ns1",
|
||||
Name: "s1",
|
||||
Annotations: map[string]string{
|
||||
@@ -53,7 +53,7 @@ func TestHandlers(t *testing.T) {
|
||||
}
|
||||
|
||||
trigger := NewTriggerOnAllChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
triggerChan <- struct{}{}
|
||||
})
|
||||
|
||||
@@ -67,7 +67,7 @@ func TestHandlers(t *testing.T) {
|
||||
assert.True(t, triggered())
|
||||
|
||||
trigger2 := NewTriggerOnMetaAndSpecChanges(
|
||||
func(obj pkg_runtime.Object) {
|
||||
func(obj pkgruntime.Object) {
|
||||
triggerChan <- struct{}{}
|
||||
},
|
||||
)
|
||||
@@ -81,14 +81,14 @@ func TestHandlers(t *testing.T) {
|
||||
trigger2.OnUpdate(&service, &service2)
|
||||
assert.True(t, triggered())
|
||||
|
||||
service3 := api_v1.Service{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
service3 := apiv1.Service{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Namespace: "ns1",
|
||||
Name: "s1",
|
||||
},
|
||||
Status: api_v1.ServiceStatus{
|
||||
LoadBalancer: api_v1.LoadBalancerStatus{
|
||||
Ingress: []api_v1.LoadBalancerIngress{{
|
||||
Status: apiv1.ServiceStatus{
|
||||
LoadBalancer: apiv1.LoadBalancerStatus{
|
||||
Ingress: []apiv1.LoadBalancerIngress{{
|
||||
Hostname: "A",
|
||||
}},
|
||||
},
|
||||
|
@@ -20,19 +20,19 @@ import (
|
||||
"hash/fnv"
|
||||
"sort"
|
||||
|
||||
fed_api "k8s.io/kubernetes/federation/apis/federation"
|
||||
fedapi "k8s.io/kubernetes/federation/apis/federation"
|
||||
)
|
||||
|
||||
// Planner decides how many out of the given replicas should be placed in each of the
|
||||
// federated clusters.
|
||||
type Planner struct {
|
||||
preferences *fed_api.FederatedReplicaSetPreferences
|
||||
preferences *fedapi.FederatedReplicaSetPreferences
|
||||
}
|
||||
|
||||
type namedClusterReplicaSetPreferences struct {
|
||||
clusterName string
|
||||
hash uint32
|
||||
fed_api.ClusterReplicaSetPreferences
|
||||
fedapi.ClusterReplicaSetPreferences
|
||||
}
|
||||
|
||||
type byWeight []*namedClusterReplicaSetPreferences
|
||||
@@ -46,7 +46,7 @@ func (a byWeight) Less(i, j int) bool {
|
||||
return (a[i].Weight > a[j].Weight) || (a[i].Weight == a[j].Weight && a[i].hash < a[j].hash)
|
||||
}
|
||||
|
||||
func NewPlanner(preferences *fed_api.FederatedReplicaSetPreferences) *Planner {
|
||||
func NewPlanner(preferences *fedapi.FederatedReplicaSetPreferences) *Planner {
|
||||
return &Planner{
|
||||
preferences: preferences,
|
||||
}
|
||||
@@ -71,7 +71,7 @@ func (p *Planner) Plan(replicasToDistribute int64, availableClusters []string, c
|
||||
plan := make(map[string]int64, len(preferences))
|
||||
overflow := make(map[string]int64, len(preferences))
|
||||
|
||||
named := func(name string, pref fed_api.ClusterReplicaSetPreferences) *namedClusterReplicaSetPreferences {
|
||||
named := func(name string, pref fedapi.ClusterReplicaSetPreferences) *namedClusterReplicaSetPreferences {
|
||||
// Seems to work better than addler for our case.
|
||||
hasher := fnv.New32()
|
||||
hasher.Write([]byte(name))
|
||||
|
@@ -19,13 +19,13 @@ package planner
|
||||
import (
|
||||
"testing"
|
||||
|
||||
fed_api "k8s.io/kubernetes/federation/apis/federation"
|
||||
fedapi "k8s.io/kubernetes/federation/apis/federation"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
func doCheck(t *testing.T, pref map[string]fed_api.ClusterReplicaSetPreferences, replicas int64, clusters []string, expected map[string]int64) {
|
||||
planer := NewPlanner(&fed_api.FederatedReplicaSetPreferences{
|
||||
func doCheck(t *testing.T, pref map[string]fedapi.ClusterReplicaSetPreferences, replicas int64, clusters []string, expected map[string]int64) {
|
||||
planer := NewPlanner(&fedapi.FederatedReplicaSetPreferences{
|
||||
Clusters: pref,
|
||||
})
|
||||
plan, overflow := planer.Plan(replicas, clusters, map[string]int64{}, map[string]int64{}, "")
|
||||
@@ -33,9 +33,9 @@ func doCheck(t *testing.T, pref map[string]fed_api.ClusterReplicaSetPreferences,
|
||||
assert.Equal(t, 0, len(overflow))
|
||||
}
|
||||
|
||||
func doCheckWithExisting(t *testing.T, pref map[string]fed_api.ClusterReplicaSetPreferences, replicas int64, clusters []string,
|
||||
func doCheckWithExisting(t *testing.T, pref map[string]fedapi.ClusterReplicaSetPreferences, replicas int64, clusters []string,
|
||||
existing map[string]int64, expected map[string]int64) {
|
||||
planer := NewPlanner(&fed_api.FederatedReplicaSetPreferences{
|
||||
planer := NewPlanner(&fedapi.FederatedReplicaSetPreferences{
|
||||
Clusters: pref,
|
||||
})
|
||||
plan, overflow := planer.Plan(replicas, clusters, existing, map[string]int64{}, "")
|
||||
@@ -43,12 +43,12 @@ func doCheckWithExisting(t *testing.T, pref map[string]fed_api.ClusterReplicaSet
|
||||
assert.EqualValues(t, expected, plan)
|
||||
}
|
||||
|
||||
func doCheckWithExistingAndCapacity(t *testing.T, rebalance bool, pref map[string]fed_api.ClusterReplicaSetPreferences, replicas int64, clusters []string,
|
||||
func doCheckWithExistingAndCapacity(t *testing.T, rebalance bool, pref map[string]fedapi.ClusterReplicaSetPreferences, replicas int64, clusters []string,
|
||||
existing map[string]int64,
|
||||
capacity map[string]int64,
|
||||
expected map[string]int64,
|
||||
expectedOverflow map[string]int64) {
|
||||
planer := NewPlanner(&fed_api.FederatedReplicaSetPreferences{
|
||||
planer := NewPlanner(&fedapi.FederatedReplicaSetPreferences{
|
||||
Rebalance: rebalance,
|
||||
Clusters: pref,
|
||||
})
|
||||
@@ -62,102 +62,102 @@ func pint(val int64) *int64 {
|
||||
}
|
||||
|
||||
func TestEqual(t *testing.T) {
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B", "C"},
|
||||
// hash dependent
|
||||
map[string]int64{"A": 16, "B": 17, "C": 17})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B"},
|
||||
map[string]int64{"A": 25, "B": 25})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
1, []string{"A", "B"},
|
||||
// hash dependent
|
||||
map[string]int64{"A": 0, "B": 1})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
1, []string{"A", "B", "C", "D"},
|
||||
// hash dependent
|
||||
map[string]int64{"A": 0, "B": 0, "C": 0, "D": 1})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
1, []string{"A"},
|
||||
map[string]int64{"A": 1})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
1, []string{},
|
||||
map[string]int64{})
|
||||
}
|
||||
|
||||
func TestEqualWithExisting(t *testing.T) {
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"C": 30},
|
||||
map[string]int64{"A": 10, "B": 10, "C": 30})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B"},
|
||||
map[string]int64{"A": 30},
|
||||
map[string]int64{"A": 30, "B": 20})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
15, []string{"A", "B"},
|
||||
map[string]int64{"A": 0, "B": 8},
|
||||
map[string]int64{"A": 7, "B": 8})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
15, []string{"A", "B"},
|
||||
map[string]int64{"A": 1, "B": 8},
|
||||
map[string]int64{"A": 7, "B": 8})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
15, []string{"A", "B"},
|
||||
map[string]int64{"A": 4, "B": 8},
|
||||
map[string]int64{"A": 7, "B": 8})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
15, []string{"A", "B"},
|
||||
map[string]int64{"A": 5, "B": 8},
|
||||
map[string]int64{"A": 7, "B": 8})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
15, []string{"A", "B"},
|
||||
map[string]int64{"A": 6, "B": 8},
|
||||
map[string]int64{"A": 7, "B": 8})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
15, []string{"A", "B"},
|
||||
map[string]int64{"A": 7, "B": 8},
|
||||
map[string]int64{"A": 7, "B": 8})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
500000, []string{"A", "B"},
|
||||
map[string]int64{"A": 300000},
|
||||
map[string]int64{"A": 300000, "B": 200000})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B"},
|
||||
map[string]int64{"A": 10},
|
||||
map[string]int64{"A": 25, "B": 25})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B"},
|
||||
map[string]int64{"A": 10, "B": 70},
|
||||
@@ -165,13 +165,13 @@ func TestEqualWithExisting(t *testing.T) {
|
||||
// TODO: Should be 10:40, update algorithm. Issue: #31816
|
||||
map[string]int64{"A": 0, "B": 50})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
1, []string{"A", "B"},
|
||||
map[string]int64{"A": 30},
|
||||
map[string]int64{"A": 1, "B": 0})
|
||||
|
||||
doCheckWithExisting(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExisting(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B"},
|
||||
map[string]int64{"A": 10, "B": 20},
|
||||
@@ -180,7 +180,7 @@ func TestEqualWithExisting(t *testing.T) {
|
||||
|
||||
func TestWithExistingAndCapacity(t *testing.T) {
|
||||
// desired without capacity: map[string]int64{"A": 17, "B": 17, "C": 16})
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{},
|
||||
@@ -189,7 +189,7 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
map[string]int64{"C": 7})
|
||||
|
||||
// desired B:50 C:0
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000},
|
||||
"B": {Weight: 1}},
|
||||
50, []string{"B", "C"},
|
||||
@@ -200,7 +200,7 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
)
|
||||
|
||||
// desired A:20 B:40
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 1},
|
||||
"B": {Weight: 2}},
|
||||
60, []string{"A", "B", "C"},
|
||||
@@ -210,7 +210,7 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
map[string]int64{"B": 30})
|
||||
|
||||
// map[string]int64{"A": 10, "B": 30, "C": 21, "D": 10})
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000, MaxReplicas: pint(10)},
|
||||
"B": {Weight: 1},
|
||||
"C": {Weight: 1, MaxReplicas: pint(21)},
|
||||
@@ -223,7 +223,7 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
)
|
||||
|
||||
// desired A:20 B:20
|
||||
doCheckWithExistingAndCapacity(t, false, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, false, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 1},
|
||||
"B": {Weight: 1}},
|
||||
60, []string{"A", "B", "C"},
|
||||
@@ -233,7 +233,7 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
map[string]int64{"A": 20, "B": 20})
|
||||
|
||||
// desired A:10 B:50 although A:50 B:10 is fuly acceptable because rebalance = false
|
||||
doCheckWithExistingAndCapacity(t, false, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, false, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 1},
|
||||
"B": {Weight: 5}},
|
||||
60, []string{"A", "B", "C"},
|
||||
@@ -242,7 +242,7 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
map[string]int64{"A": 50, "B": 10, "C": 0},
|
||||
map[string]int64{})
|
||||
|
||||
doCheckWithExistingAndCapacity(t, false, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, false, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {MinReplicas: 20, Weight: 0}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{},
|
||||
@@ -251,7 +251,7 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
map[string]int64{})
|
||||
|
||||
// Actually we would like to have extra 20 in B but 15 is also good.
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheckWithExistingAndCapacity(t, true, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {MinReplicas: 20, Weight: 1}},
|
||||
60, []string{"A", "B"},
|
||||
map[string]int64{},
|
||||
@@ -261,75 +261,75 @@ func TestWithExistingAndCapacity(t *testing.T) {
|
||||
}
|
||||
|
||||
func TestMin(t *testing.T) {
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {MinReplicas: 2, Weight: 0}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 2, "B": 2, "C": 2})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {MinReplicas: 20, Weight: 0}},
|
||||
50, []string{"A", "B", "C"},
|
||||
// hash dependant.
|
||||
map[string]int64{"A": 10, "B": 20, "C": 20})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {MinReplicas: 20, Weight: 0},
|
||||
"A": {MinReplicas: 100, Weight: 1}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 50, "B": 0, "C": 0})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {MinReplicas: 10, Weight: 1, MaxReplicas: pint(12)}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 12, "B": 12, "C": 12})
|
||||
}
|
||||
|
||||
func TestMax(t *testing.T) {
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 1, MaxReplicas: pint(2)}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 2, "B": 2, "C": 2})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"*": {Weight: 0, MaxReplicas: pint(2)}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 0, "B": 0, "C": 0})
|
||||
}
|
||||
|
||||
func TestWeight(t *testing.T) {
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 1},
|
||||
"B": {Weight: 2}},
|
||||
60, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 20, "B": 40, "C": 0})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000},
|
||||
"B": {Weight: 1}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 50, "B": 0, "C": 0})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000},
|
||||
"B": {Weight: 1}},
|
||||
50, []string{"B", "C"},
|
||||
map[string]int64{"B": 50, "C": 0})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000, MaxReplicas: pint(10)},
|
||||
"B": {Weight: 1},
|
||||
"C": {Weight: 1}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 10, "B": 20, "C": 20})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000, MaxReplicas: pint(10)},
|
||||
"B": {Weight: 1},
|
||||
"C": {Weight: 1, MaxReplicas: pint(10)}},
|
||||
50, []string{"A", "B", "C"},
|
||||
map[string]int64{"A": 10, "B": 30, "C": 10})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000, MaxReplicas: pint(10)},
|
||||
"B": {Weight: 1},
|
||||
"C": {Weight: 1, MaxReplicas: pint(21)},
|
||||
@@ -337,7 +337,7 @@ func TestWeight(t *testing.T) {
|
||||
71, []string{"A", "B", "C", "D"},
|
||||
map[string]int64{"A": 10, "B": 30, "C": 21, "D": 10})
|
||||
|
||||
doCheck(t, map[string]fed_api.ClusterReplicaSetPreferences{
|
||||
doCheck(t, map[string]fedapi.ClusterReplicaSetPreferences{
|
||||
"A": {Weight: 10000, MaxReplicas: pint(10)},
|
||||
"B": {Weight: 1},
|
||||
"C": {Weight: 1, MaxReplicas: pint(21)},
|
||||
|
@@ -24,10 +24,10 @@ import (
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
federation_api "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
federationapi "k8s.io/kubernetes/federation/apis/federation/v1beta1"
|
||||
"k8s.io/kubernetes/federation/pkg/federation-controller/util"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
api_v1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
apiv1 "k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/testing/core"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -250,7 +250,7 @@ func CheckObjectFromChan(c chan runtime.Object, checkFunction CheckingFunction)
|
||||
}
|
||||
|
||||
// CompareObjectMeta returns an error when the given objects are not equivalent.
|
||||
func CompareObjectMeta(a, b api_v1.ObjectMeta) error {
|
||||
func CompareObjectMeta(a, b apiv1.ObjectMeta) error {
|
||||
if a.Namespace != b.Namespace {
|
||||
return fmt.Errorf("Different namespace expected:%s observed:%s", a.Namespace, b.Namespace)
|
||||
}
|
||||
@@ -272,15 +272,15 @@ func ToFederatedInformerForTestOnly(informer util.FederatedInformer) util.Federa
|
||||
}
|
||||
|
||||
// NewCluster builds a new cluster object.
|
||||
func NewCluster(name string, readyStatus api_v1.ConditionStatus) *federation_api.Cluster {
|
||||
return &federation_api.Cluster{
|
||||
ObjectMeta: api_v1.ObjectMeta{
|
||||
func NewCluster(name string, readyStatus apiv1.ConditionStatus) *federationapi.Cluster {
|
||||
return &federationapi.Cluster{
|
||||
ObjectMeta: apiv1.ObjectMeta{
|
||||
Name: name,
|
||||
Annotations: map[string]string{},
|
||||
},
|
||||
Status: federation_api.ClusterStatus{
|
||||
Conditions: []federation_api.ClusterCondition{
|
||||
{Type: federation_api.ClusterReady, Status: readyStatus},
|
||||
Status: federationapi.ClusterStatus{
|
||||
Conditions: []federationapi.ClusterCondition{
|
||||
{Type: federationapi.ClusterReady, Status: readyStatus},
|
||||
},
|
||||
},
|
||||
}
|
||||
|
34
hack/verify-pkg-names.sh
Executable file
34
hack/verify-pkg-names.sh
Executable file
@@ -0,0 +1,34 @@
|
||||
#!/bin/bash
|
||||
|
||||
# Copyright 2016 The Kubernetes Authors.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# http://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
|
||||
# Verify whether codes follow golang convention.
|
||||
|
||||
set -o errexit
|
||||
set -o nounset
|
||||
set -o pipefail
|
||||
|
||||
KUBE_ROOT=$(dirname "${BASH_SOURCE}")/..
|
||||
source "${KUBE_ROOT}/hack/lib/init.sh"
|
||||
|
||||
kube::golang::verify_go_version
|
||||
|
||||
cd "${KUBE_ROOT}"
|
||||
if git --no-pager grep -E $'^(import |\t)[a-z]+[A-Z_][a-zA-Z]* "[^"]+"$' -- '**/*.go' ':(exclude)vendor/*' ':(exclude)staging/*'; then
|
||||
echo "!!! Some package aliase break go conventions."
|
||||
echo "To fix these errors, do not use capitalizaed or underlined characters"
|
||||
echo "in pkg aliases. Refer to https://blog.golang.org/package-names for more info."
|
||||
exit 1
|
||||
fi
|
@@ -62,6 +62,18 @@ else
|
||||
fi
|
||||
echo "${reset}"
|
||||
|
||||
echo -ne "Checking for package aliases... "
|
||||
if ! hack/verify-pkg-names.sh > /dev/null; then
|
||||
echo "${red}ERROR!"
|
||||
echo "Some package aliase break go conventions. To fix these errors, "
|
||||
echo "do not use capitalizaed or underlined characters in pkg aliases. "
|
||||
echo "Refer to https://blog.golang.org/package-names for more info."
|
||||
exit_code=1
|
||||
else
|
||||
echo "${green}OK"
|
||||
fi
|
||||
echo "${reset}"
|
||||
|
||||
echo -ne "Checking for files that need boilerplate... "
|
||||
files=($(git diff --cached --name-only --diff-filter ACM))
|
||||
# We always make sure there is one file in the files list. Some tools check
|
||||
|
@@ -45,7 +45,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/api/v1/service"
|
||||
"k8s.io/kubernetes/pkg/cloudprovider"
|
||||
aws_credentials "k8s.io/kubernetes/pkg/credentialprovider/aws"
|
||||
awscredentials "k8s.io/kubernetes/pkg/credentialprovider/aws"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/sets"
|
||||
"k8s.io/kubernetes/pkg/volume"
|
||||
@@ -172,7 +172,7 @@ const DefaultVolumeType = "gp2"
|
||||
// See http://docs.aws.amazon.com/AWSEC2/latest/UserGuide/volume_limits.html#linux-specific-volume-limits
|
||||
const DefaultMaxEBSVolumes = 39
|
||||
|
||||
// Used to call aws_credentials.Init() just once
|
||||
// Used to call awscredentials.Init() just once
|
||||
var once sync.Once
|
||||
|
||||
// Services is an abstraction over AWS, to allow mocking/other implementations
|
||||
@@ -720,7 +720,7 @@ func getAvailabilityZone(metadata EC2Metadata) (string, error) {
|
||||
}
|
||||
|
||||
func isRegionValid(region string) bool {
|
||||
for _, r := range aws_credentials.AWSRegions {
|
||||
for _, r := range awscredentials.AWSRegions {
|
||||
if r == region {
|
||||
return true
|
||||
}
|
||||
@@ -836,7 +836,7 @@ func newAWSCloud(config io.Reader, awsServices Services) (*Cloud, error) {
|
||||
|
||||
// Register handler for ECR credentials
|
||||
once.Do(func() {
|
||||
aws_credentials.Init()
|
||||
awscredentials.Init()
|
||||
})
|
||||
|
||||
return awsCloud, nil
|
||||
|
@@ -32,11 +32,11 @@ import (
|
||||
"github.com/rackspace/gophercloud/openstack/networking/v2/extensions/lbaas/vips"
|
||||
"github.com/rackspace/gophercloud/openstack/networking/v2/extensions/lbaas_v2/listeners"
|
||||
"github.com/rackspace/gophercloud/openstack/networking/v2/extensions/lbaas_v2/loadbalancers"
|
||||
v2_monitors "github.com/rackspace/gophercloud/openstack/networking/v2/extensions/lbaas_v2/monitors"
|
||||
v2_pools "github.com/rackspace/gophercloud/openstack/networking/v2/extensions/lbaas_v2/pools"
|
||||
v2monitors "github.com/rackspace/gophercloud/openstack/networking/v2/extensions/lbaas_v2/monitors"
|
||||
v2pools "github.com/rackspace/gophercloud/openstack/networking/v2/extensions/lbaas_v2/pools"
|
||||
"github.com/rackspace/gophercloud/openstack/networking/v2/extensions/security/groups"
|
||||
"github.com/rackspace/gophercloud/openstack/networking/v2/extensions/security/rules"
|
||||
neutron_ports "github.com/rackspace/gophercloud/openstack/networking/v2/ports"
|
||||
neutronports "github.com/rackspace/gophercloud/openstack/networking/v2/ports"
|
||||
"github.com/rackspace/gophercloud/pagination"
|
||||
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
@@ -80,12 +80,12 @@ func networkExtensions(client *gophercloud.ServiceClient) (map[string]bool, erro
|
||||
return seen, err
|
||||
}
|
||||
|
||||
func getPortByIP(client *gophercloud.ServiceClient, ipAddress string) (neutron_ports.Port, error) {
|
||||
var targetPort neutron_ports.Port
|
||||
func getPortByIP(client *gophercloud.ServiceClient, ipAddress string) (neutronports.Port, error) {
|
||||
var targetPort neutronports.Port
|
||||
var portFound = false
|
||||
|
||||
err := neutron_ports.List(client, neutron_ports.ListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
portList, err := neutron_ports.ExtractPorts(page)
|
||||
err := neutronports.List(client, neutronports.ListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
portList, err := neutronports.ExtractPorts(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -293,10 +293,10 @@ func getListenerForPort(existingListeners []listeners.Listener, port v1.ServiceP
|
||||
}
|
||||
|
||||
// Get pool for a listener. A listener always has exactly one pool.
|
||||
func getPoolByListenerID(client *gophercloud.ServiceClient, loadbalancerID string, listenerID string) (*v2_pools.Pool, error) {
|
||||
listenerPools := make([]v2_pools.Pool, 0, 1)
|
||||
err := v2_pools.List(client, v2_pools.ListOpts{LoadbalancerID: loadbalancerID}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
poolsList, err := v2_pools.ExtractPools(page)
|
||||
func getPoolByListenerID(client *gophercloud.ServiceClient, loadbalancerID string, listenerID string) (*v2pools.Pool, error) {
|
||||
listenerPools := make([]v2pools.Pool, 0, 1)
|
||||
err := v2pools.List(client, v2pools.ListOpts{LoadbalancerID: loadbalancerID}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
poolsList, err := v2pools.ExtractPools(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -328,10 +328,10 @@ func getPoolByListenerID(client *gophercloud.ServiceClient, loadbalancerID strin
|
||||
return &listenerPools[0], nil
|
||||
}
|
||||
|
||||
func getMembersByPoolID(client *gophercloud.ServiceClient, id string) ([]v2_pools.Member, error) {
|
||||
var members []v2_pools.Member
|
||||
err := v2_pools.ListAssociateMembers(client, id, v2_pools.MemberListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
membersList, err := v2_pools.ExtractMembers(page)
|
||||
func getMembersByPoolID(client *gophercloud.ServiceClient, id string) ([]v2pools.Member, error) {
|
||||
var members []v2pools.Member
|
||||
err := v2pools.ListAssociateMembers(client, id, v2pools.MemberListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
membersList, err := v2pools.ExtractMembers(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -347,10 +347,10 @@ func getMembersByPoolID(client *gophercloud.ServiceClient, id string) ([]v2_pool
|
||||
}
|
||||
|
||||
// Each pool has exactly one or zero monitors. ListOpts does not seem to filter anything.
|
||||
func getMonitorByPoolID(client *gophercloud.ServiceClient, id string) (*v2_monitors.Monitor, error) {
|
||||
var monitorList []v2_monitors.Monitor
|
||||
err := v2_monitors.List(client, v2_monitors.ListOpts{PoolID: id}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
monitorsList, err := v2_monitors.ExtractMonitors(page)
|
||||
func getMonitorByPoolID(client *gophercloud.ServiceClient, id string) (*v2monitors.Monitor, error) {
|
||||
var monitorList []v2monitors.Monitor
|
||||
err := v2monitors.List(client, v2monitors.ListOpts{PoolID: id}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
monitorsList, err := v2monitors.ExtractMonitors(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -385,7 +385,7 @@ func getMonitorByPoolID(client *gophercloud.ServiceClient, id string) (*v2_monit
|
||||
}
|
||||
|
||||
// Check if a member exists for node
|
||||
func memberExists(members []v2_pools.Member, addr string, port int) bool {
|
||||
func memberExists(members []v2pools.Member, addr string, port int) bool {
|
||||
for _, member := range members {
|
||||
if member.Address == addr && member.ProtocolPort == port {
|
||||
return true
|
||||
@@ -407,7 +407,7 @@ func popListener(existingListeners []listeners.Listener, id string) []listeners.
|
||||
return existingListeners
|
||||
}
|
||||
|
||||
func popMember(members []v2_pools.Member, addr string, port int) []v2_pools.Member {
|
||||
func popMember(members []v2pools.Member, addr string, port int) []v2pools.Member {
|
||||
for i, member := range members {
|
||||
if member.Address == addr && member.ProtocolPort == port {
|
||||
members[i] = members[len(members)-1]
|
||||
@@ -596,12 +596,12 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
}
|
||||
|
||||
affinity := v1.ServiceAffinityNone
|
||||
var persistence *v2_pools.SessionPersistence
|
||||
var persistence *v2pools.SessionPersistence
|
||||
switch affinity {
|
||||
case v1.ServiceAffinityNone:
|
||||
persistence = nil
|
||||
case v1.ServiceAffinityClientIP:
|
||||
persistence = &v2_pools.SessionPersistence{Type: "SOURCE_IP"}
|
||||
persistence = &v2pools.SessionPersistence{Type: "SOURCE_IP"}
|
||||
default:
|
||||
return nil, fmt.Errorf("unsupported load balancer affinity: %v", affinity)
|
||||
}
|
||||
@@ -624,9 +624,9 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
|
||||
waitLoadbalancerActiveProvisioningStatus(lbaas.network, loadbalancer.ID)
|
||||
|
||||
lbmethod := v2_pools.LBMethod(lbaas.opts.LBMethod)
|
||||
lbmethod := v2pools.LBMethod(lbaas.opts.LBMethod)
|
||||
if lbmethod == "" {
|
||||
lbmethod = v2_pools.LBMethodRoundRobin
|
||||
lbmethod = v2pools.LBMethodRoundRobin
|
||||
}
|
||||
|
||||
oldListeners, err := getListenersByLoadBalancerID(lbaas.network, loadbalancer.ID)
|
||||
@@ -662,9 +662,9 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
}
|
||||
if pool == nil {
|
||||
glog.V(4).Infof("Creating pool for listener %s", listener.ID)
|
||||
pool, err = v2_pools.Create(lbaas.network, v2_pools.CreateOpts{
|
||||
pool, err = v2pools.Create(lbaas.network, v2pools.CreateOpts{
|
||||
Name: fmt.Sprintf("pool_%s_%d", name, portIndex),
|
||||
Protocol: v2_pools.Protocol(port.Protocol),
|
||||
Protocol: v2pools.Protocol(port.Protocol),
|
||||
LBMethod: lbmethod,
|
||||
ListenerID: listener.ID,
|
||||
Persistence: persistence,
|
||||
@@ -695,7 +695,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
|
||||
if !memberExists(members, addr, int(port.NodePort)) {
|
||||
glog.V(4).Infof("Creating member for pool %s", pool.ID)
|
||||
_, err := v2_pools.CreateAssociateMember(lbaas.network, pool.ID, v2_pools.MemberCreateOpts{
|
||||
_, err := v2pools.CreateAssociateMember(lbaas.network, pool.ID, v2pools.MemberCreateOpts{
|
||||
ProtocolPort: int(port.NodePort),
|
||||
Address: addr,
|
||||
SubnetID: lbaas.opts.SubnetId,
|
||||
@@ -716,7 +716,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
// Delete obsolete members for this pool
|
||||
for _, member := range members {
|
||||
glog.V(4).Infof("Deleting obsolete member %s for pool %s address %s", member.ID, pool.ID, member.Address)
|
||||
err := v2_pools.DeleteMember(lbaas.network, pool.ID, member.ID).ExtractErr()
|
||||
err := v2pools.DeleteMember(lbaas.network, pool.ID, member.ID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return nil, fmt.Errorf("Error deleting obsolete member %s for pool %s address %s: %v", member.ID, pool.ID, member.Address, err)
|
||||
}
|
||||
@@ -726,7 +726,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
monitorID := pool.MonitorID
|
||||
if monitorID == "" && lbaas.opts.CreateMonitor {
|
||||
glog.V(4).Infof("Creating monitor for pool %s", pool.ID)
|
||||
monitor, err := v2_monitors.Create(lbaas.network, v2_monitors.CreateOpts{
|
||||
monitor, err := v2monitors.Create(lbaas.network, v2monitors.CreateOpts{
|
||||
PoolID: pool.ID,
|
||||
Type: string(port.Protocol),
|
||||
Delay: int(lbaas.opts.MonitorDelay.Duration.Seconds()),
|
||||
@@ -756,7 +756,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
monitorID := pool.MonitorID
|
||||
if monitorID != "" {
|
||||
glog.V(4).Infof("Deleting obsolete monitor %s for pool %s", monitorID, pool.ID)
|
||||
err = v2_monitors.Delete(lbaas.network, monitorID).ExtractErr()
|
||||
err = v2monitors.Delete(lbaas.network, monitorID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return nil, fmt.Errorf("Error deleting obsolete monitor %s for pool %s: %v", monitorID, pool.ID, err)
|
||||
}
|
||||
@@ -770,7 +770,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
if members != nil {
|
||||
for _, member := range members {
|
||||
glog.V(4).Infof("Deleting obsolete member %s for pool %s address %s", member.ID, pool.ID, member.Address)
|
||||
err := v2_pools.DeleteMember(lbaas.network, pool.ID, member.ID).ExtractErr()
|
||||
err := v2pools.DeleteMember(lbaas.network, pool.ID, member.ID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return nil, fmt.Errorf("Error deleting obsolete member %s for pool %s address %s: %v", member.ID, pool.ID, member.Address, err)
|
||||
}
|
||||
@@ -779,7 +779,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
}
|
||||
glog.V(4).Infof("Deleting obsolete pool %s for listener %s", pool.ID, listener.ID)
|
||||
// delete pool
|
||||
err = v2_pools.Delete(lbaas.network, pool.ID).ExtractErr()
|
||||
err = v2pools.Delete(lbaas.network, pool.ID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return nil, fmt.Errorf("Error deleting obsolete pool %s for listener %s: %v", pool.ID, listener.ID, err)
|
||||
}
|
||||
@@ -923,9 +923,9 @@ func (lbaas *LbaasV2) EnsureLoadBalancer(clusterName string, apiService *v1.Serv
|
||||
return nil, err
|
||||
}
|
||||
|
||||
update_opts := neutron_ports.UpdateOpts{SecurityGroups: []string{lbSecGroup.ID}}
|
||||
update_opts := neutronports.UpdateOpts{SecurityGroups: []string{lbSecGroup.ID}}
|
||||
|
||||
res := neutron_ports.Update(lbaas.network, port.ID, update_opts)
|
||||
res := neutronports.Update(lbaas.network, port.ID, update_opts)
|
||||
|
||||
if res.Err != nil {
|
||||
glog.Errorf("Error occured updating port: %s", port.ID)
|
||||
@@ -986,9 +986,9 @@ func (lbaas *LbaasV2) UpdateLoadBalancer(clusterName string, service *v1.Service
|
||||
}
|
||||
|
||||
// Get all pools for this loadbalancer, by listener ID.
|
||||
lbPools := make(map[string]v2_pools.Pool)
|
||||
err = v2_pools.List(lbaas.network, v2_pools.ListOpts{LoadbalancerID: loadbalancer.ID}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
poolsList, err := v2_pools.ExtractPools(page)
|
||||
lbPools := make(map[string]v2pools.Pool)
|
||||
err = v2pools.List(lbaas.network, v2pools.ListOpts{LoadbalancerID: loadbalancer.ID}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
poolsList, err := v2pools.ExtractPools(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -1038,9 +1038,9 @@ func (lbaas *LbaasV2) UpdateLoadBalancer(clusterName string, service *v1.Service
|
||||
}
|
||||
|
||||
// Find existing pool members (by address) for this port
|
||||
members := make(map[string]v2_pools.Member)
|
||||
err := v2_pools.ListAssociateMembers(lbaas.network, pool.ID, v2_pools.MemberListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
membersList, err := v2_pools.ExtractMembers(page)
|
||||
members := make(map[string]v2pools.Member)
|
||||
err := v2pools.ListAssociateMembers(lbaas.network, pool.ID, v2pools.MemberListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
membersList, err := v2pools.ExtractMembers(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -1059,7 +1059,7 @@ func (lbaas *LbaasV2) UpdateLoadBalancer(clusterName string, service *v1.Service
|
||||
// Already exists, do not create member
|
||||
continue
|
||||
}
|
||||
_, err := v2_pools.CreateAssociateMember(lbaas.network, pool.ID, v2_pools.MemberCreateOpts{
|
||||
_, err := v2pools.CreateAssociateMember(lbaas.network, pool.ID, v2pools.MemberCreateOpts{
|
||||
Address: addr,
|
||||
ProtocolPort: int(port.NodePort),
|
||||
SubnetID: lbaas.opts.SubnetId,
|
||||
@@ -1076,7 +1076,7 @@ func (lbaas *LbaasV2) UpdateLoadBalancer(clusterName string, service *v1.Service
|
||||
// Still present, do not delete member
|
||||
continue
|
||||
}
|
||||
err = v2_pools.DeleteMember(lbaas.network, pool.ID, member.ID).ExtractErr()
|
||||
err = v2pools.DeleteMember(lbaas.network, pool.ID, member.ID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return err
|
||||
}
|
||||
@@ -1137,8 +1137,8 @@ func (lbaas *LbaasV2) EnsureLoadBalancerDeleted(clusterName string, service *v1.
|
||||
// get all pools (and health monitors) associated with this loadbalancer
|
||||
var poolIDs []string
|
||||
var monitorIDs []string
|
||||
err = v2_pools.List(lbaas.network, v2_pools.ListOpts{LoadbalancerID: loadbalancer.ID}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
poolsList, err := v2_pools.ExtractPools(page)
|
||||
err = v2pools.List(lbaas.network, v2pools.ListOpts{LoadbalancerID: loadbalancer.ID}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
poolsList, err := v2pools.ExtractPools(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -1157,8 +1157,8 @@ func (lbaas *LbaasV2) EnsureLoadBalancerDeleted(clusterName string, service *v1.
|
||||
// get all members associated with each poolIDs
|
||||
var memberIDs []string
|
||||
for _, poolID := range poolIDs {
|
||||
err := v2_pools.ListAssociateMembers(lbaas.network, poolID, v2_pools.MemberListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
membersList, err := v2_pools.ExtractMembers(page)
|
||||
err := v2pools.ListAssociateMembers(lbaas.network, poolID, v2pools.MemberListOpts{}).EachPage(func(page pagination.Page) (bool, error) {
|
||||
membersList, err := v2pools.ExtractMembers(page)
|
||||
if err != nil {
|
||||
return false, err
|
||||
}
|
||||
@@ -1176,7 +1176,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancerDeleted(clusterName string, service *v1.
|
||||
|
||||
// delete all monitors
|
||||
for _, monitorID := range monitorIDs {
|
||||
err := v2_monitors.Delete(lbaas.network, monitorID).ExtractErr()
|
||||
err := v2monitors.Delete(lbaas.network, monitorID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return err
|
||||
}
|
||||
@@ -1187,7 +1187,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancerDeleted(clusterName string, service *v1.
|
||||
for _, poolID := range poolIDs {
|
||||
// delete all members for this pool
|
||||
for _, memberID := range memberIDs {
|
||||
err := v2_pools.DeleteMember(lbaas.network, poolID, memberID).ExtractErr()
|
||||
err := v2pools.DeleteMember(lbaas.network, poolID, memberID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return err
|
||||
}
|
||||
@@ -1195,7 +1195,7 @@ func (lbaas *LbaasV2) EnsureLoadBalancerDeleted(clusterName string, service *v1.
|
||||
}
|
||||
|
||||
// delete pool
|
||||
err := v2_pools.Delete(lbaas.network, poolID).ExtractErr()
|
||||
err := v2pools.Delete(lbaas.network, poolID).ExtractErr()
|
||||
if err != nil && !isNotFound(err) {
|
||||
return err
|
||||
}
|
||||
|
@@ -25,7 +25,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/resource"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
api_pod "k8s.io/kubernetes/pkg/api/v1/pod"
|
||||
apipod "k8s.io/kubernetes/pkg/api/v1/pod"
|
||||
apps "k8s.io/kubernetes/pkg/apis/apps/v1beta1"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
@@ -211,8 +211,8 @@ func (f *fakePetClient) Update(expected, wanted *pcb) error {
|
||||
pets := []*pcb{}
|
||||
for i, pet := range f.pets {
|
||||
if wanted.pod.Name == pet.pod.Name {
|
||||
f.pets[i].pod.Annotations[api_pod.PodHostnameAnnotation] = wanted.pod.Annotations[api_pod.PodHostnameAnnotation]
|
||||
f.pets[i].pod.Annotations[api_pod.PodSubdomainAnnotation] = wanted.pod.Annotations[api_pod.PodSubdomainAnnotation]
|
||||
f.pets[i].pod.Annotations[apipod.PodHostnameAnnotation] = wanted.pod.Annotations[apipod.PodHostnameAnnotation]
|
||||
f.pets[i].pod.Annotations[apipod.PodSubdomainAnnotation] = wanted.pod.Annotations[apipod.PodSubdomainAnnotation]
|
||||
f.pets[i].pod.Spec = wanted.pod.Spec
|
||||
found = true
|
||||
}
|
||||
|
@@ -24,7 +24,7 @@ import (
|
||||
"testing"
|
||||
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
api_pod "k8s.io/kubernetes/pkg/api/v1/pod"
|
||||
apipod "k8s.io/kubernetes/pkg/api/v1/pod"
|
||||
)
|
||||
|
||||
func TestPetIDName(t *testing.T) {
|
||||
@@ -54,11 +54,11 @@ func TestPetIDDNS(t *testing.T) {
|
||||
if err != nil {
|
||||
t.Fatalf("Failed to generate pet %v", err)
|
||||
}
|
||||
if hostname, ok := pod.Annotations[api_pod.PodHostnameAnnotation]; !ok || hostname != petName {
|
||||
if hostname, ok := pod.Annotations[apipod.PodHostnameAnnotation]; !ok || hostname != petName {
|
||||
t.Errorf("Wrong hostname: %v", hostname)
|
||||
}
|
||||
// TODO: Check this against the governing service.
|
||||
if subdomain, ok := pod.Annotations[api_pod.PodSubdomainAnnotation]; !ok || subdomain != petSubdomain {
|
||||
if subdomain, ok := pod.Annotations[apipod.PodSubdomainAnnotation]; !ok || subdomain != petSubdomain {
|
||||
t.Errorf("Wrong subdomain: %v", subdomain)
|
||||
}
|
||||
}
|
||||
|
@@ -25,7 +25,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
apps "k8s.io/kubernetes/pkg/apis/apps/v1beta1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
fake_internal "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
fakeinternal "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/fake"
|
||||
"k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/typed/apps/v1beta1"
|
||||
"k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/typed/apps/v1beta1/fake"
|
||||
"k8s.io/kubernetes/pkg/controller"
|
||||
@@ -281,7 +281,7 @@ func TestSyncStatefulSetBlockedPet(t *testing.T) {
|
||||
}
|
||||
|
||||
type fakeClient struct {
|
||||
fake_internal.Clientset
|
||||
fakeinternal.Clientset
|
||||
statefulsetClient *fakeStatefulSetClient
|
||||
}
|
||||
|
||||
|
@@ -43,7 +43,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/watch"
|
||||
|
||||
heapster "k8s.io/heapster/metrics/api/v1/types"
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
@@ -298,15 +298,15 @@ func (tc *testCase) prepareTestClient(t *testing.T) *fake.Clientset {
|
||||
var heapsterRawMemResponse []byte
|
||||
|
||||
if tc.useMetricsApi {
|
||||
metrics := metrics_api.PodMetricsList{}
|
||||
metrics := metricsapi.PodMetricsList{}
|
||||
for i, cpu := range tc.reportedLevels {
|
||||
podMetric := metrics_api.PodMetrics{
|
||||
podMetric := metricsapi.PodMetrics{
|
||||
ObjectMeta: v1.ObjectMeta{
|
||||
Name: fmt.Sprintf("%s-%d", podNamePrefix, i),
|
||||
Namespace: namespace,
|
||||
},
|
||||
Timestamp: unversioned.Time{Time: time.Now()},
|
||||
Containers: []metrics_api.ContainerMetrics{
|
||||
Containers: []metricsapi.ContainerMetrics{
|
||||
{
|
||||
Name: "container",
|
||||
Usage: v1.ResourceList{
|
||||
|
@@ -29,7 +29,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/labels"
|
||||
|
||||
heapster "k8s.io/heapster/metrics/api/v1/types"
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
)
|
||||
|
||||
// PodResourceInfo contains pod resourcemetric values as a map from pod names to
|
||||
@@ -92,7 +92,7 @@ func (h *HeapsterMetricsClient) GetResourceMetric(resource v1.ResourceName, name
|
||||
|
||||
glog.V(4).Infof("Heapster metrics result: %s", string(resultRaw))
|
||||
|
||||
metrics := metrics_api.PodMetricsList{}
|
||||
metrics := metricsapi.PodMetricsList{}
|
||||
err = json.Unmarshal(resultRaw, &metrics)
|
||||
if err != nil {
|
||||
return nil, time.Time{}, fmt.Errorf("failed to unmarshal heapster response: %v", err)
|
||||
|
@@ -34,7 +34,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
|
||||
heapster "k8s.io/heapster/metrics/api/v1/types"
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
@@ -103,18 +103,18 @@ func (tc *testCase) prepareTestClient(t *testing.T) *fake.Clientset {
|
||||
|
||||
if isResource {
|
||||
fakeClient.AddProxyReactor("services", func(action core.Action) (handled bool, ret restclient.ResponseWrapper, err error) {
|
||||
metrics := metrics_api.PodMetricsList{}
|
||||
metrics := metricsapi.PodMetricsList{}
|
||||
for i, containers := range tc.reportedPodMetrics {
|
||||
metric := metrics_api.PodMetrics{
|
||||
metric := metricsapi.PodMetrics{
|
||||
ObjectMeta: v1.ObjectMeta{
|
||||
Name: fmt.Sprintf("%s-%d", podNamePrefix, i),
|
||||
Namespace: namespace,
|
||||
},
|
||||
Timestamp: unversioned.Time{Time: fixedTimestamp.Add(time.Duration(tc.targetTimestamp) * time.Minute)},
|
||||
Containers: []metrics_api.ContainerMetrics{},
|
||||
Containers: []metricsapi.ContainerMetrics{},
|
||||
}
|
||||
for j, cpu := range containers {
|
||||
cm := metrics_api.ContainerMetrics{
|
||||
cm := metricsapi.ContainerMetrics{
|
||||
Name: fmt.Sprintf("%s-%d-container-%d", podNamePrefix, i, j),
|
||||
Usage: v1.ResourceList{
|
||||
v1.ResourceCPU: *resource.NewMilliQuantity(
|
||||
|
@@ -36,7 +36,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
|
||||
heapster "k8s.io/heapster/metrics/api/v1/types"
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
@@ -131,15 +131,15 @@ func (tc *replicaCalcTestCase) prepareTestClient(t *testing.T) *fake.Clientset {
|
||||
var heapsterRawMemResponse []byte
|
||||
|
||||
if tc.resource != nil {
|
||||
metrics := metrics_api.PodMetricsList{}
|
||||
metrics := metricsapi.PodMetricsList{}
|
||||
for i, resValue := range tc.resource.levels {
|
||||
podMetric := metrics_api.PodMetrics{
|
||||
podMetric := metricsapi.PodMetrics{
|
||||
ObjectMeta: v1.ObjectMeta{
|
||||
Name: fmt.Sprintf("%s-%d", podNamePrefix, i),
|
||||
Namespace: testNamespace,
|
||||
},
|
||||
Timestamp: unversioned.Time{Time: tc.timestamp},
|
||||
Containers: []metrics_api.ContainerMetrics{
|
||||
Containers: []metricsapi.ContainerMetrics{
|
||||
{
|
||||
Name: "container1",
|
||||
Usage: v1.ResourceList{
|
||||
|
@@ -29,12 +29,12 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
clientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
unversioned_core "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/typed/core/v1"
|
||||
unversionedcore "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/typed/core/v1"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/cloudprovider"
|
||||
"k8s.io/kubernetes/pkg/controller"
|
||||
"k8s.io/kubernetes/pkg/fields"
|
||||
pkg_runtime "k8s.io/kubernetes/pkg/runtime"
|
||||
pkgruntime "k8s.io/kubernetes/pkg/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/metrics"
|
||||
"k8s.io/kubernetes/pkg/util/runtime"
|
||||
"k8s.io/kubernetes/pkg/util/wait"
|
||||
@@ -99,7 +99,7 @@ type ServiceController struct {
|
||||
// (like load balancers) in sync with the registry.
|
||||
func New(cloud cloudprovider.Interface, kubeClient clientset.Interface, clusterName string) (*ServiceController, error) {
|
||||
broadcaster := record.NewBroadcaster()
|
||||
broadcaster.StartRecordingToSink(&unversioned_core.EventSinkImpl{Interface: kubeClient.Core().Events("")})
|
||||
broadcaster.StartRecordingToSink(&unversionedcore.EventSinkImpl{Interface: kubeClient.Core().Events("")})
|
||||
recorder := broadcaster.NewRecorder(v1.EventSource{Component: "service-controller"})
|
||||
|
||||
if kubeClient != nil && kubeClient.Core().RESTClient().GetRateLimiter() != nil {
|
||||
@@ -121,7 +121,7 @@ func New(cloud cloudprovider.Interface, kubeClient clientset.Interface, clusterN
|
||||
}
|
||||
s.serviceStore.Indexer, s.serviceController = cache.NewIndexerInformer(
|
||||
&cache.ListWatch{
|
||||
ListFunc: func(options v1.ListOptions) (pkg_runtime.Object, error) {
|
||||
ListFunc: func(options v1.ListOptions) (pkgruntime.Object, error) {
|
||||
return s.kubeClient.Core().Services(v1.NamespaceAll).List(options)
|
||||
},
|
||||
WatchFunc: func(options v1.ListOptions) (watch.Interface, error) {
|
||||
|
@@ -27,7 +27,7 @@ import (
|
||||
storage "k8s.io/kubernetes/pkg/apis/storage/v1beta1"
|
||||
"k8s.io/kubernetes/pkg/client/cache"
|
||||
clientset "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5"
|
||||
unversioned_core "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/typed/core/v1"
|
||||
unversionedcore "k8s.io/kubernetes/pkg/client/clientset_generated/release_1_5/typed/core/v1"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/cloudprovider"
|
||||
"k8s.io/kubernetes/pkg/conversion"
|
||||
@@ -62,7 +62,7 @@ func NewController(p ControllerParameters) *PersistentVolumeController {
|
||||
eventRecorder := p.EventRecorder
|
||||
if eventRecorder == nil {
|
||||
broadcaster := record.NewBroadcaster()
|
||||
broadcaster.StartRecordingToSink(&unversioned_core.EventSinkImpl{Interface: p.KubeClient.Core().Events("")})
|
||||
broadcaster.StartRecordingToSink(&unversionedcore.EventSinkImpl{Interface: p.KubeClient.Core().Events("")})
|
||||
eventRecorder = broadcaster.NewRecorder(v1.EventSource{Component: "persistentvolume-controller"})
|
||||
}
|
||||
|
||||
|
@@ -29,7 +29,7 @@ import (
|
||||
etcd "github.com/coreos/etcd/client"
|
||||
"github.com/miekg/dns"
|
||||
skymsg "github.com/skynetservices/skydns/msg"
|
||||
skyServer "github.com/skynetservices/skydns/server"
|
||||
skyserver "github.com/skynetservices/skydns/server"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"github.com/stretchr/testify/require"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
@@ -171,9 +171,9 @@ func assertSRVRecordsMatchPort(t *testing.T, records []dns.RR, port ...int) {
|
||||
|
||||
func TestSkySimpleSRVLookup(t *testing.T) {
|
||||
kd := newKubeDNS()
|
||||
skydnsConfig := &skyServer.Config{Domain: testDomain, DnsAddr: "0.0.0.0:53"}
|
||||
skyServer.SetDefaults(skydnsConfig)
|
||||
s := skyServer.New(kd, skydnsConfig)
|
||||
skydnsConfig := &skyserver.Config{Domain: testDomain, DnsAddr: "0.0.0.0:53"}
|
||||
skyserver.SetDefaults(skydnsConfig)
|
||||
s := skyserver.New(kd, skydnsConfig)
|
||||
|
||||
service := newHeadlessService()
|
||||
endpointIPs := []string{"10.0.0.1", "10.0.0.2"}
|
||||
@@ -201,9 +201,9 @@ func TestSkySimpleSRVLookup(t *testing.T) {
|
||||
|
||||
func TestSkyPodHostnameSRVLookup(t *testing.T) {
|
||||
kd := newKubeDNS()
|
||||
skydnsConfig := &skyServer.Config{Domain: testDomain, DnsAddr: "0.0.0.0:53"}
|
||||
skyServer.SetDefaults(skydnsConfig)
|
||||
s := skyServer.New(kd, skydnsConfig)
|
||||
skydnsConfig := &skyserver.Config{Domain: testDomain, DnsAddr: "0.0.0.0:53"}
|
||||
skyserver.SetDefaults(skydnsConfig)
|
||||
s := skyserver.New(kd, skydnsConfig)
|
||||
|
||||
service := newHeadlessService()
|
||||
endpointIPs := []string{"10.0.0.1", "10.0.0.2"}
|
||||
@@ -240,9 +240,9 @@ func TestSkyPodHostnameSRVLookup(t *testing.T) {
|
||||
|
||||
func TestSkyNamedPortSRVLookup(t *testing.T) {
|
||||
kd := newKubeDNS()
|
||||
skydnsConfig := &skyServer.Config{Domain: testDomain, DnsAddr: "0.0.0.0:53"}
|
||||
skyServer.SetDefaults(skydnsConfig)
|
||||
s := skyServer.New(kd, skydnsConfig)
|
||||
skydnsConfig := &skyserver.Config{Domain: testDomain, DnsAddr: "0.0.0.0:53"}
|
||||
skyserver.SetDefaults(skydnsConfig)
|
||||
s := skyserver.New(kd, skydnsConfig)
|
||||
|
||||
service := newHeadlessService()
|
||||
eip := "10.0.0.1"
|
||||
|
@@ -25,7 +25,7 @@ import (
|
||||
|
||||
"net/url"
|
||||
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
"k8s.io/kubernetes/pkg/client/restclient/fake"
|
||||
cmdtesting "k8s.io/kubernetes/pkg/kubectl/cmd/testing"
|
||||
)
|
||||
@@ -85,14 +85,14 @@ func TestTopPodAllInNamespaceMetrics(t *testing.T) {
|
||||
metrics := testPodMetricsData()
|
||||
testNamespace := "testnamespace"
|
||||
nonTestNamespace := "anothernamespace"
|
||||
expectedMetrics := metrics_api.PodMetricsList{
|
||||
expectedMetrics := metricsapi.PodMetricsList{
|
||||
ListMeta: metrics.ListMeta,
|
||||
Items: metrics.Items[0:2],
|
||||
}
|
||||
for _, m := range expectedMetrics.Items {
|
||||
m.Namespace = testNamespace
|
||||
}
|
||||
nonExpectedMetrics := metrics_api.PodMetricsList{
|
||||
nonExpectedMetrics := metricsapi.PodMetricsList{
|
||||
ListMeta: metrics.ListMeta,
|
||||
Items: metrics.Items[2:],
|
||||
}
|
||||
@@ -144,7 +144,7 @@ func TestTopPodWithNameMetrics(t *testing.T) {
|
||||
initTestErrorHandler(t)
|
||||
metrics := testPodMetricsData()
|
||||
expectedMetrics := metrics.Items[0]
|
||||
nonExpectedMetrics := metrics_api.PodMetricsList{
|
||||
nonExpectedMetrics := metricsapi.PodMetricsList{
|
||||
ListMeta: metrics.ListMeta,
|
||||
Items: metrics.Items[1:],
|
||||
}
|
||||
@@ -192,11 +192,11 @@ func TestTopPodWithNameMetrics(t *testing.T) {
|
||||
func TestTopPodWithLabelSelectorMetrics(t *testing.T) {
|
||||
initTestErrorHandler(t)
|
||||
metrics := testPodMetricsData()
|
||||
expectedMetrics := metrics_api.PodMetricsList{
|
||||
expectedMetrics := metricsapi.PodMetricsList{
|
||||
ListMeta: metrics.ListMeta,
|
||||
Items: metrics.Items[0:2],
|
||||
}
|
||||
nonExpectedMetrics := metrics_api.PodMetricsList{
|
||||
nonExpectedMetrics := metricsapi.PodMetricsList{
|
||||
ListMeta: metrics.ListMeta,
|
||||
Items: metrics.Items[2:],
|
||||
}
|
||||
@@ -249,7 +249,7 @@ func TestTopPodWithContainersMetrics(t *testing.T) {
|
||||
initTestErrorHandler(t)
|
||||
metrics := testPodMetricsData()
|
||||
expectedMetrics := metrics.Items[0]
|
||||
nonExpectedMetrics := metrics_api.PodMetricsList{
|
||||
nonExpectedMetrics := metricsapi.PodMetricsList{
|
||||
ListMeta: metrics.ListMeta,
|
||||
Items: metrics.Items[1:],
|
||||
}
|
||||
|
@@ -25,7 +25,7 @@ import (
|
||||
|
||||
"testing"
|
||||
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/resource"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
@@ -59,12 +59,12 @@ func marshallBody(metrics interface{}) (io.ReadCloser, error) {
|
||||
return ioutil.NopCloser(bytes.NewReader(result)), nil
|
||||
}
|
||||
|
||||
func testNodeMetricsData() (*metrics_api.NodeMetricsList, *api.NodeList) {
|
||||
metrics := &metrics_api.NodeMetricsList{
|
||||
func testNodeMetricsData() (*metricsapi.NodeMetricsList, *api.NodeList) {
|
||||
metrics := &metricsapi.NodeMetricsList{
|
||||
ListMeta: unversioned.ListMeta{
|
||||
ResourceVersion: "1",
|
||||
},
|
||||
Items: []metrics_api.NodeMetrics{
|
||||
Items: []metricsapi.NodeMetrics{
|
||||
{
|
||||
ObjectMeta: v1.ObjectMeta{Name: "node1", ResourceVersion: "10"},
|
||||
Window: unversioned.Duration{Duration: time.Minute},
|
||||
@@ -115,16 +115,16 @@ func testNodeMetricsData() (*metrics_api.NodeMetricsList, *api.NodeList) {
|
||||
return metrics, nodes
|
||||
}
|
||||
|
||||
func testPodMetricsData() *metrics_api.PodMetricsList {
|
||||
return &metrics_api.PodMetricsList{
|
||||
func testPodMetricsData() *metricsapi.PodMetricsList {
|
||||
return &metricsapi.PodMetricsList{
|
||||
ListMeta: unversioned.ListMeta{
|
||||
ResourceVersion: "2",
|
||||
},
|
||||
Items: []metrics_api.PodMetrics{
|
||||
Items: []metricsapi.PodMetrics{
|
||||
{
|
||||
ObjectMeta: v1.ObjectMeta{Name: "pod1", Namespace: "test", ResourceVersion: "10"},
|
||||
Window: unversioned.Duration{Duration: time.Minute},
|
||||
Containers: []metrics_api.ContainerMetrics{
|
||||
Containers: []metricsapi.ContainerMetrics{
|
||||
{
|
||||
Name: "container1-1",
|
||||
Usage: v1.ResourceList{
|
||||
@@ -146,7 +146,7 @@ func testPodMetricsData() *metrics_api.PodMetricsList {
|
||||
{
|
||||
ObjectMeta: v1.ObjectMeta{Name: "pod2", Namespace: "test", ResourceVersion: "11"},
|
||||
Window: unversioned.Duration{Duration: time.Minute},
|
||||
Containers: []metrics_api.ContainerMetrics{
|
||||
Containers: []metricsapi.ContainerMetrics{
|
||||
{
|
||||
Name: "container2-1",
|
||||
Usage: v1.ResourceList{
|
||||
@@ -176,7 +176,7 @@ func testPodMetricsData() *metrics_api.PodMetricsList {
|
||||
{
|
||||
ObjectMeta: v1.ObjectMeta{Name: "pod3", Namespace: "test", ResourceVersion: "12"},
|
||||
Window: unversioned.Duration{Duration: time.Minute},
|
||||
Containers: []metrics_api.ContainerMetrics{
|
||||
Containers: []metricsapi.ContainerMetrics{
|
||||
{
|
||||
Name: "container3-1",
|
||||
Usage: v1.ResourceList{
|
||||
|
@@ -19,7 +19,7 @@ package util
|
||||
import (
|
||||
"sync"
|
||||
|
||||
fed_clientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_internalclientset"
|
||||
fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_internalclientset"
|
||||
"k8s.io/kubernetes/pkg/apimachinery/registered"
|
||||
"k8s.io/kubernetes/pkg/client/clientset_generated/internalclientset"
|
||||
"k8s.io/kubernetes/pkg/client/restclient"
|
||||
@@ -33,7 +33,7 @@ func NewClientCache(loader clientcmd.ClientConfig) *ClientCache {
|
||||
return &ClientCache{
|
||||
clientsets: make(map[schema.GroupVersion]*internalclientset.Clientset),
|
||||
configs: make(map[schema.GroupVersion]*restclient.Config),
|
||||
fedClientSets: make(map[schema.GroupVersion]fed_clientset.Interface),
|
||||
fedClientSets: make(map[schema.GroupVersion]fedclientset.Interface),
|
||||
loader: loader,
|
||||
}
|
||||
}
|
||||
@@ -43,7 +43,7 @@ func NewClientCache(loader clientcmd.ClientConfig) *ClientCache {
|
||||
type ClientCache struct {
|
||||
loader clientcmd.ClientConfig
|
||||
clientsets map[schema.GroupVersion]*internalclientset.Clientset
|
||||
fedClientSets map[schema.GroupVersion]fed_clientset.Interface
|
||||
fedClientSets map[schema.GroupVersion]fedclientset.Interface
|
||||
configs map[schema.GroupVersion]*restclient.Config
|
||||
|
||||
matchVersion bool
|
||||
@@ -158,7 +158,7 @@ func (c *ClientCache) ClientSetForVersion(requiredVersion *schema.GroupVersion)
|
||||
return clientset, nil
|
||||
}
|
||||
|
||||
func (c *ClientCache) FederationClientSetForVersion(version *schema.GroupVersion) (fed_clientset.Interface, error) {
|
||||
func (c *ClientCache) FederationClientSetForVersion(version *schema.GroupVersion) (fedclientset.Interface, error) {
|
||||
if version != nil {
|
||||
if clientSet, found := c.fedClientSets[*version]; found {
|
||||
return clientSet, nil
|
||||
@@ -170,7 +170,7 @@ func (c *ClientCache) FederationClientSetForVersion(version *schema.GroupVersion
|
||||
}
|
||||
|
||||
// TODO: support multi versions of client with clientset
|
||||
clientSet, err := fed_clientset.NewForConfig(config)
|
||||
clientSet, err := fedclientset.NewForConfig(config)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
@@ -178,7 +178,7 @@ func (c *ClientCache) FederationClientSetForVersion(version *schema.GroupVersion
|
||||
|
||||
if version != nil {
|
||||
configCopy := *config
|
||||
clientSet, err := fed_clientset.NewForConfig(&configCopy)
|
||||
clientSet, err := fedclientset.NewForConfig(&configCopy)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
@@ -29,7 +29,7 @@ import (
|
||||
"time"
|
||||
|
||||
"k8s.io/kubernetes/federation/apis/federation"
|
||||
fed_clientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_internalclientset"
|
||||
fedclientset "k8s.io/kubernetes/federation/client/clientset_generated/federation_internalclientset"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/errors"
|
||||
"k8s.io/kubernetes/pkg/api/events"
|
||||
@@ -2320,7 +2320,7 @@ func describeConfigMap(configMap *api.ConfigMap) (string, error) {
|
||||
}
|
||||
|
||||
type ClusterDescriber struct {
|
||||
fed_clientset.Interface
|
||||
fedclientset.Interface
|
||||
}
|
||||
|
||||
func (d *ClusterDescriber) Describe(namespace, name string, describerSettings DescriberSettings) (string, error) {
|
||||
|
@@ -26,7 +26,7 @@ import (
|
||||
"time"
|
||||
|
||||
"k8s.io/kubernetes/federation/apis/federation"
|
||||
fed_fake "k8s.io/kubernetes/federation/client/clientset_generated/federation_internalclientset/fake"
|
||||
fedfake "k8s.io/kubernetes/federation/client/clientset_generated/federation_internalclientset/fake"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/resource"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
@@ -665,7 +665,7 @@ func TestDescribeCluster(t *testing.T) {
|
||||
},
|
||||
},
|
||||
}
|
||||
fake := fed_fake.NewSimpleClientset(&cluster)
|
||||
fake := fedfake.NewSimpleClientset(&cluster)
|
||||
d := ClusterDescriber{Interface: fake}
|
||||
out, err := d.Describe("any", "foo", DescriberSettings{ShowEvents: true})
|
||||
if err != nil {
|
||||
|
@@ -21,7 +21,7 @@ import (
|
||||
"errors"
|
||||
"fmt"
|
||||
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/validation"
|
||||
coreclient "k8s.io/kubernetes/pkg/client/clientset_generated/internalclientset/typed/core/internalversion"
|
||||
@@ -97,63 +97,63 @@ func nodeMetricsUrl(name string) (string, error) {
|
||||
return fmt.Sprintf("%s/nodes/%s", metricsRoot, name), nil
|
||||
}
|
||||
|
||||
func (cli *HeapsterMetricsClient) GetNodeMetrics(nodeName string, selector labels.Selector) ([]metrics_api.NodeMetrics, error) {
|
||||
func (cli *HeapsterMetricsClient) GetNodeMetrics(nodeName string, selector labels.Selector) ([]metricsapi.NodeMetrics, error) {
|
||||
params := map[string]string{"labelSelector": selector.String()}
|
||||
path, err := nodeMetricsUrl(nodeName)
|
||||
if err != nil {
|
||||
return []metrics_api.NodeMetrics{}, err
|
||||
return []metricsapi.NodeMetrics{}, err
|
||||
}
|
||||
resultRaw, err := GetHeapsterMetrics(cli, path, params)
|
||||
if err != nil {
|
||||
return []metrics_api.NodeMetrics{}, err
|
||||
return []metricsapi.NodeMetrics{}, err
|
||||
}
|
||||
metrics := make([]metrics_api.NodeMetrics, 0)
|
||||
metrics := make([]metricsapi.NodeMetrics, 0)
|
||||
if len(nodeName) == 0 {
|
||||
metricsList := metrics_api.NodeMetricsList{}
|
||||
metricsList := metricsapi.NodeMetricsList{}
|
||||
err = json.Unmarshal(resultRaw, &metricsList)
|
||||
if err != nil {
|
||||
return []metrics_api.NodeMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
return []metricsapi.NodeMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
}
|
||||
metrics = append(metrics, metricsList.Items...)
|
||||
} else {
|
||||
var singleMetric metrics_api.NodeMetrics
|
||||
var singleMetric metricsapi.NodeMetrics
|
||||
err = json.Unmarshal(resultRaw, &singleMetric)
|
||||
if err != nil {
|
||||
return []metrics_api.NodeMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
return []metricsapi.NodeMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
}
|
||||
metrics = append(metrics, singleMetric)
|
||||
}
|
||||
return metrics, nil
|
||||
}
|
||||
|
||||
func (cli *HeapsterMetricsClient) GetPodMetrics(namespace string, podName string, allNamespaces bool, selector labels.Selector) ([]metrics_api.PodMetrics, error) {
|
||||
func (cli *HeapsterMetricsClient) GetPodMetrics(namespace string, podName string, allNamespaces bool, selector labels.Selector) ([]metricsapi.PodMetrics, error) {
|
||||
if allNamespaces {
|
||||
namespace = api.NamespaceAll
|
||||
}
|
||||
path, err := podMetricsUrl(namespace, podName)
|
||||
if err != nil {
|
||||
return []metrics_api.PodMetrics{}, err
|
||||
return []metricsapi.PodMetrics{}, err
|
||||
}
|
||||
|
||||
params := map[string]string{"labelSelector": selector.String()}
|
||||
allMetrics := make([]metrics_api.PodMetrics, 0)
|
||||
allMetrics := make([]metricsapi.PodMetrics, 0)
|
||||
|
||||
resultRaw, err := GetHeapsterMetrics(cli, path, params)
|
||||
if err != nil {
|
||||
return []metrics_api.PodMetrics{}, err
|
||||
return []metricsapi.PodMetrics{}, err
|
||||
}
|
||||
if len(podName) == 0 {
|
||||
metrics := metrics_api.PodMetricsList{}
|
||||
metrics := metricsapi.PodMetricsList{}
|
||||
err = json.Unmarshal(resultRaw, &metrics)
|
||||
if err != nil {
|
||||
return []metrics_api.PodMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
return []metricsapi.PodMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
}
|
||||
allMetrics = append(allMetrics, metrics.Items...)
|
||||
} else {
|
||||
var singleMetric metrics_api.PodMetrics
|
||||
var singleMetric metricsapi.PodMetrics
|
||||
err = json.Unmarshal(resultRaw, &singleMetric)
|
||||
if err != nil {
|
||||
return []metrics_api.PodMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
return []metricsapi.PodMetrics{}, fmt.Errorf("failed to unmarshall heapster response: %v", err)
|
||||
}
|
||||
allMetrics = append(allMetrics, singleMetric)
|
||||
}
|
||||
|
@@ -20,7 +20,7 @@ import (
|
||||
"fmt"
|
||||
"io"
|
||||
|
||||
metrics_api "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
metricsapi "k8s.io/heapster/metrics/apis/metrics/v1alpha1"
|
||||
"k8s.io/kubernetes/pkg/api"
|
||||
"k8s.io/kubernetes/pkg/api/resource"
|
||||
"k8s.io/kubernetes/pkg/kubectl"
|
||||
@@ -51,7 +51,7 @@ func NewTopCmdPrinter(out io.Writer) *TopCmdPrinter {
|
||||
return &TopCmdPrinter{out: out}
|
||||
}
|
||||
|
||||
func (printer *TopCmdPrinter) PrintNodeMetrics(metrics []metrics_api.NodeMetrics, availableResources map[string]api.ResourceList) error {
|
||||
func (printer *TopCmdPrinter) PrintNodeMetrics(metrics []metricsapi.NodeMetrics, availableResources map[string]api.ResourceList) error {
|
||||
if len(metrics) == 0 {
|
||||
return nil
|
||||
}
|
||||
@@ -74,7 +74,7 @@ func (printer *TopCmdPrinter) PrintNodeMetrics(metrics []metrics_api.NodeMetrics
|
||||
return nil
|
||||
}
|
||||
|
||||
func (printer *TopCmdPrinter) PrintPodMetrics(metrics []metrics_api.PodMetrics, printContainers bool, withNamespace bool) error {
|
||||
func (printer *TopCmdPrinter) PrintPodMetrics(metrics []metricsapi.PodMetrics, printContainers bool, withNamespace bool) error {
|
||||
if len(metrics) == 0 {
|
||||
return nil
|
||||
}
|
||||
@@ -104,7 +104,7 @@ func printColumnNames(out io.Writer, names []string) {
|
||||
fmt.Fprint(out, "\n")
|
||||
}
|
||||
|
||||
func printSinglePodMetrics(out io.Writer, m *metrics_api.PodMetrics, printContainersOnly bool, withNamespace bool) error {
|
||||
func printSinglePodMetrics(out io.Writer, m *metricsapi.PodMetrics, printContainersOnly bool, withNamespace bool) error {
|
||||
containers := make(map[string]api.ResourceList)
|
||||
podMetrics := make(api.ResourceList)
|
||||
for _, res := range MeasuredResources {
|
||||
|
@@ -19,20 +19,20 @@ package api
|
||||
import (
|
||||
"time"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
// RuntimeVersioner contains methods for runtime name, version and API version.
|
||||
type RuntimeVersioner interface {
|
||||
// Version returns the runtime name, runtime version and runtime API version
|
||||
Version(apiVersion string) (*runtimeApi.VersionResponse, error)
|
||||
Version(apiVersion string) (*runtimeapi.VersionResponse, error)
|
||||
}
|
||||
|
||||
// ContainerManager contains methods to manipulate containers managed by a
|
||||
// container runtime. The methods are thread-safe.
|
||||
type ContainerManager interface {
|
||||
// CreateContainer creates a new container in specified PodSandbox.
|
||||
CreateContainer(podSandboxID string, config *runtimeApi.ContainerConfig, sandboxConfig *runtimeApi.PodSandboxConfig) (string, error)
|
||||
CreateContainer(podSandboxID string, config *runtimeapi.ContainerConfig, sandboxConfig *runtimeapi.PodSandboxConfig) (string, error)
|
||||
// StartContainer starts the container.
|
||||
StartContainer(containerID string) error
|
||||
// StopContainer stops a running container with a grace period (i.e., timeout).
|
||||
@@ -40,16 +40,16 @@ type ContainerManager interface {
|
||||
// RemoveContainer removes the container.
|
||||
RemoveContainer(containerID string) error
|
||||
// ListContainers lists all containers by filters.
|
||||
ListContainers(filter *runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error)
|
||||
ListContainers(filter *runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error)
|
||||
// ContainerStatus returns the status of the container.
|
||||
ContainerStatus(containerID string) (*runtimeApi.ContainerStatus, error)
|
||||
ContainerStatus(containerID string) (*runtimeapi.ContainerStatus, error)
|
||||
// ExecSync executes a command in the container, and returns the stdout output.
|
||||
// If command exits with a non-zero exit code, an error is returned.
|
||||
ExecSync(containerID string, cmd []string, timeout time.Duration) (stdout []byte, stderr []byte, err error)
|
||||
// Exec prepares a streaming endpoint to execute a command in the container, and returns the address.
|
||||
Exec(*runtimeApi.ExecRequest) (*runtimeApi.ExecResponse, error)
|
||||
Exec(*runtimeapi.ExecRequest) (*runtimeapi.ExecResponse, error)
|
||||
// Attach prepares a streaming endpoint to attach to a running container, and returns the address.
|
||||
Attach(req *runtimeApi.AttachRequest) (*runtimeApi.AttachResponse, error)
|
||||
Attach(req *runtimeapi.AttachRequest) (*runtimeapi.AttachResponse, error)
|
||||
}
|
||||
|
||||
// PodSandboxManager contains methods for operating on PodSandboxes. The methods
|
||||
@@ -57,7 +57,7 @@ type ContainerManager interface {
|
||||
type PodSandboxManager interface {
|
||||
// RunPodSandbox creates and starts a pod-level sandbox. Runtimes should ensure
|
||||
// the sandbox is in ready state.
|
||||
RunPodSandbox(config *runtimeApi.PodSandboxConfig) (string, error)
|
||||
RunPodSandbox(config *runtimeapi.PodSandboxConfig) (string, error)
|
||||
// StopPodSandbox stops the sandbox. If there are any running containers in the
|
||||
// sandbox, they should be force terminated.
|
||||
StopPodSandbox(podSandboxID string) error
|
||||
@@ -65,11 +65,11 @@ type PodSandboxManager interface {
|
||||
// sandbox, they should be forcibly removed.
|
||||
RemovePodSandbox(podSandboxID string) error
|
||||
// PodSandboxStatus returns the Status of the PodSandbox.
|
||||
PodSandboxStatus(podSandboxID string) (*runtimeApi.PodSandboxStatus, error)
|
||||
PodSandboxStatus(podSandboxID string) (*runtimeapi.PodSandboxStatus, error)
|
||||
// ListPodSandbox returns a list of Sandbox.
|
||||
ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]*runtimeApi.PodSandbox, error)
|
||||
ListPodSandbox(filter *runtimeapi.PodSandboxFilter) ([]*runtimeapi.PodSandbox, error)
|
||||
// PortForward prepares a streaming endpoint to forward ports from a PodSandbox, and returns the address.
|
||||
PortForward(*runtimeApi.PortForwardRequest) (*runtimeApi.PortForwardResponse, error)
|
||||
PortForward(*runtimeapi.PortForwardRequest) (*runtimeapi.PortForwardResponse, error)
|
||||
}
|
||||
|
||||
// RuntimeService interface should be implemented by a container runtime.
|
||||
@@ -80,9 +80,9 @@ type RuntimeService interface {
|
||||
PodSandboxManager
|
||||
|
||||
// UpdateRuntimeConfig updates runtime configuration if specified
|
||||
UpdateRuntimeConfig(runtimeConfig *runtimeApi.RuntimeConfig) error
|
||||
UpdateRuntimeConfig(runtimeConfig *runtimeapi.RuntimeConfig) error
|
||||
// Status returns the status of the runtime.
|
||||
Status() (*runtimeApi.RuntimeStatus, error)
|
||||
Status() (*runtimeapi.RuntimeStatus, error)
|
||||
}
|
||||
|
||||
// ImageManagerService interface should be implemented by a container image
|
||||
@@ -90,11 +90,11 @@ type RuntimeService interface {
|
||||
// The methods should be thread-safe.
|
||||
type ImageManagerService interface {
|
||||
// ListImages lists the existing images.
|
||||
ListImages(filter *runtimeApi.ImageFilter) ([]*runtimeApi.Image, error)
|
||||
ListImages(filter *runtimeapi.ImageFilter) ([]*runtimeapi.Image, error)
|
||||
// ImageStatus returns the status of the image.
|
||||
ImageStatus(image *runtimeApi.ImageSpec) (*runtimeApi.Image, error)
|
||||
ImageStatus(image *runtimeapi.ImageSpec) (*runtimeapi.Image, error)
|
||||
// PullImage pulls an image with the authentication config.
|
||||
PullImage(image *runtimeApi.ImageSpec, auth *runtimeApi.AuthConfig) error
|
||||
PullImage(image *runtimeapi.ImageSpec, auth *runtimeapi.AuthConfig) error
|
||||
// RemoveImage removes the image.
|
||||
RemoveImage(image *runtimeApi.ImageSpec) error
|
||||
RemoveImage(image *runtimeapi.ImageSpec) error
|
||||
}
|
||||
|
@@ -19,7 +19,7 @@ package testing
|
||||
import (
|
||||
"sync"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/util/sliceutils"
|
||||
)
|
||||
|
||||
@@ -28,14 +28,14 @@ type FakeImageService struct {
|
||||
|
||||
FakeImageSize uint64
|
||||
Called []string
|
||||
Images map[string]*runtimeApi.Image
|
||||
Images map[string]*runtimeapi.Image
|
||||
}
|
||||
|
||||
func (r *FakeImageService) SetFakeImages(images []string) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Images = make(map[string]*runtimeApi.Image)
|
||||
r.Images = make(map[string]*runtimeapi.Image)
|
||||
for _, image := range images {
|
||||
r.Images[image] = r.makeFakeImage(image)
|
||||
}
|
||||
@@ -51,25 +51,25 @@ func (r *FakeImageService) SetFakeImageSize(size uint64) {
|
||||
func NewFakeImageService() *FakeImageService {
|
||||
return &FakeImageService{
|
||||
Called: make([]string, 0),
|
||||
Images: make(map[string]*runtimeApi.Image),
|
||||
Images: make(map[string]*runtimeapi.Image),
|
||||
}
|
||||
}
|
||||
|
||||
func (r *FakeImageService) makeFakeImage(image string) *runtimeApi.Image {
|
||||
return &runtimeApi.Image{
|
||||
func (r *FakeImageService) makeFakeImage(image string) *runtimeapi.Image {
|
||||
return &runtimeapi.Image{
|
||||
Id: &image,
|
||||
Size_: &r.FakeImageSize,
|
||||
RepoTags: []string{image},
|
||||
}
|
||||
}
|
||||
|
||||
func (r *FakeImageService) ListImages(filter *runtimeApi.ImageFilter) ([]*runtimeApi.Image, error) {
|
||||
func (r *FakeImageService) ListImages(filter *runtimeapi.ImageFilter) ([]*runtimeapi.Image, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Called = append(r.Called, "ListImages")
|
||||
|
||||
images := make([]*runtimeApi.Image, 0)
|
||||
images := make([]*runtimeapi.Image, 0)
|
||||
for _, img := range r.Images {
|
||||
if filter != nil && filter.Image != nil {
|
||||
if !sliceutils.StringInSlice(filter.Image.GetImage(), img.RepoTags) {
|
||||
@@ -82,7 +82,7 @@ func (r *FakeImageService) ListImages(filter *runtimeApi.ImageFilter) ([]*runtim
|
||||
return images, nil
|
||||
}
|
||||
|
||||
func (r *FakeImageService) ImageStatus(image *runtimeApi.ImageSpec) (*runtimeApi.Image, error) {
|
||||
func (r *FakeImageService) ImageStatus(image *runtimeapi.ImageSpec) (*runtimeapi.Image, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
@@ -91,7 +91,7 @@ func (r *FakeImageService) ImageStatus(image *runtimeApi.ImageSpec) (*runtimeApi
|
||||
return r.Images[image.GetImage()], nil
|
||||
}
|
||||
|
||||
func (r *FakeImageService) PullImage(image *runtimeApi.ImageSpec, auth *runtimeApi.AuthConfig) error {
|
||||
func (r *FakeImageService) PullImage(image *runtimeapi.ImageSpec, auth *runtimeapi.AuthConfig) error {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
@@ -107,7 +107,7 @@ func (r *FakeImageService) PullImage(image *runtimeApi.ImageSpec, auth *runtimeA
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *FakeImageService) RemoveImage(image *runtimeApi.ImageSpec) error {
|
||||
func (r *FakeImageService) RemoveImage(image *runtimeapi.ImageSpec) error {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
|
@@ -22,7 +22,7 @@ import (
|
||||
"sync"
|
||||
"time"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
var (
|
||||
@@ -34,12 +34,12 @@ var (
|
||||
|
||||
type FakePodSandbox struct {
|
||||
// PodSandboxStatus contains the runtime information for a sandbox.
|
||||
runtimeApi.PodSandboxStatus
|
||||
runtimeapi.PodSandboxStatus
|
||||
}
|
||||
|
||||
type FakeContainer struct {
|
||||
// ContainerStatus contains the runtime information for a container.
|
||||
runtimeApi.ContainerStatus
|
||||
runtimeapi.ContainerStatus
|
||||
|
||||
// the sandbox id of this container
|
||||
SandboxID string
|
||||
@@ -50,7 +50,7 @@ type FakeRuntimeService struct {
|
||||
|
||||
Called []string
|
||||
|
||||
FakeStatus *runtimeApi.RuntimeStatus
|
||||
FakeStatus *runtimeapi.RuntimeStatus
|
||||
Containers map[string]*FakeContainer
|
||||
Sandboxes map[string]*FakePodSandbox
|
||||
}
|
||||
@@ -96,13 +96,13 @@ func NewFakeRuntimeService() *FakeRuntimeService {
|
||||
}
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) Version(apiVersion string) (*runtimeApi.VersionResponse, error) {
|
||||
func (r *FakeRuntimeService) Version(apiVersion string) (*runtimeapi.VersionResponse, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Called = append(r.Called, "Version")
|
||||
|
||||
return &runtimeApi.VersionResponse{
|
||||
return &runtimeapi.VersionResponse{
|
||||
Version: &version,
|
||||
RuntimeName: &FakeRuntimeName,
|
||||
RuntimeVersion: &version,
|
||||
@@ -110,7 +110,7 @@ func (r *FakeRuntimeService) Version(apiVersion string) (*runtimeApi.VersionResp
|
||||
}, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) Status() (*runtimeApi.RuntimeStatus, error) {
|
||||
func (r *FakeRuntimeService) Status() (*runtimeapi.RuntimeStatus, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
@@ -119,7 +119,7 @@ func (r *FakeRuntimeService) Status() (*runtimeApi.RuntimeStatus, error) {
|
||||
return r.FakeStatus, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) RunPodSandbox(config *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (r *FakeRuntimeService) RunPodSandbox(config *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
@@ -129,14 +129,14 @@ func (r *FakeRuntimeService) RunPodSandbox(config *runtimeApi.PodSandboxConfig)
|
||||
// fixed name from BuildSandboxName() for easily making fake sandboxes.
|
||||
podSandboxID := BuildSandboxName(config.Metadata)
|
||||
createdAt := time.Now().Unix()
|
||||
readyState := runtimeApi.PodSandboxState_SANDBOX_READY
|
||||
readyState := runtimeapi.PodSandboxState_SANDBOX_READY
|
||||
r.Sandboxes[podSandboxID] = &FakePodSandbox{
|
||||
PodSandboxStatus: runtimeApi.PodSandboxStatus{
|
||||
PodSandboxStatus: runtimeapi.PodSandboxStatus{
|
||||
Id: &podSandboxID,
|
||||
Metadata: config.Metadata,
|
||||
State: &readyState,
|
||||
CreatedAt: &createdAt,
|
||||
Network: &runtimeApi.PodSandboxNetworkStatus{
|
||||
Network: &runtimeapi.PodSandboxNetworkStatus{
|
||||
Ip: &FakePodSandboxIP,
|
||||
},
|
||||
Labels: config.Labels,
|
||||
@@ -153,7 +153,7 @@ func (r *FakeRuntimeService) StopPodSandbox(podSandboxID string) error {
|
||||
|
||||
r.Called = append(r.Called, "StopPodSandbox")
|
||||
|
||||
notReadyState := runtimeApi.PodSandboxState_SANDBOX_NOTREADY
|
||||
notReadyState := runtimeapi.PodSandboxState_SANDBOX_NOTREADY
|
||||
if s, ok := r.Sandboxes[podSandboxID]; ok {
|
||||
s.State = ¬ReadyState
|
||||
} else {
|
||||
@@ -175,7 +175,7 @@ func (r *FakeRuntimeService) RemovePodSandbox(podSandboxID string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) PodSandboxStatus(podSandboxID string) (*runtimeApi.PodSandboxStatus, error) {
|
||||
func (r *FakeRuntimeService) PodSandboxStatus(podSandboxID string) (*runtimeapi.PodSandboxStatus, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
@@ -190,13 +190,13 @@ func (r *FakeRuntimeService) PodSandboxStatus(podSandboxID string) (*runtimeApi.
|
||||
return &status, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]*runtimeApi.PodSandbox, error) {
|
||||
func (r *FakeRuntimeService) ListPodSandbox(filter *runtimeapi.PodSandboxFilter) ([]*runtimeapi.PodSandbox, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Called = append(r.Called, "ListPodSandbox")
|
||||
|
||||
result := make([]*runtimeApi.PodSandbox, 0)
|
||||
result := make([]*runtimeapi.PodSandbox, 0)
|
||||
for id, s := range r.Sandboxes {
|
||||
if filter != nil {
|
||||
if filter.Id != nil && filter.GetId() != id {
|
||||
@@ -210,7 +210,7 @@ func (r *FakeRuntimeService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter)
|
||||
}
|
||||
}
|
||||
|
||||
result = append(result, &runtimeApi.PodSandbox{
|
||||
result = append(result, &runtimeapi.PodSandbox{
|
||||
Id: s.Id,
|
||||
Metadata: s.Metadata,
|
||||
State: s.State,
|
||||
@@ -223,15 +223,15 @@ func (r *FakeRuntimeService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter)
|
||||
return result, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) PortForward(*runtimeApi.PortForwardRequest) (*runtimeApi.PortForwardResponse, error) {
|
||||
func (r *FakeRuntimeService) PortForward(*runtimeapi.PortForwardRequest) (*runtimeapi.PortForwardResponse, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Called = append(r.Called, "PortForward")
|
||||
return &runtimeApi.PortForwardResponse{}, nil
|
||||
return &runtimeapi.PortForwardResponse{}, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) CreateContainer(podSandboxID string, config *runtimeApi.ContainerConfig, sandboxConfig *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (r *FakeRuntimeService) CreateContainer(podSandboxID string, config *runtimeapi.ContainerConfig, sandboxConfig *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
@@ -241,10 +241,10 @@ func (r *FakeRuntimeService) CreateContainer(podSandboxID string, config *runtim
|
||||
// fixed BuildContainerName() for easily making fake containers.
|
||||
containerID := BuildContainerName(config.Metadata, podSandboxID)
|
||||
createdAt := time.Now().Unix()
|
||||
createdState := runtimeApi.ContainerState_CONTAINER_CREATED
|
||||
createdState := runtimeapi.ContainerState_CONTAINER_CREATED
|
||||
imageRef := config.Image.GetImage()
|
||||
r.Containers[containerID] = &FakeContainer{
|
||||
ContainerStatus: runtimeApi.ContainerStatus{
|
||||
ContainerStatus: runtimeapi.ContainerStatus{
|
||||
Id: &containerID,
|
||||
Metadata: config.Metadata,
|
||||
Image: config.Image,
|
||||
@@ -273,7 +273,7 @@ func (r *FakeRuntimeService) StartContainer(containerID string) error {
|
||||
|
||||
// Set container to running.
|
||||
startedAt := time.Now().Unix()
|
||||
runningState := runtimeApi.ContainerState_CONTAINER_RUNNING
|
||||
runningState := runtimeapi.ContainerState_CONTAINER_RUNNING
|
||||
c.State = &runningState
|
||||
c.StartedAt = &startedAt
|
||||
|
||||
@@ -293,7 +293,7 @@ func (r *FakeRuntimeService) StopContainer(containerID string, timeout int64) er
|
||||
|
||||
// Set container to exited state.
|
||||
finishedAt := time.Now().Unix()
|
||||
exitedState := runtimeApi.ContainerState_CONTAINER_EXITED
|
||||
exitedState := runtimeapi.ContainerState_CONTAINER_EXITED
|
||||
c.State = &exitedState
|
||||
c.FinishedAt = &finishedAt
|
||||
|
||||
@@ -312,13 +312,13 @@ func (r *FakeRuntimeService) RemoveContainer(containerID string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) ListContainers(filter *runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error) {
|
||||
func (r *FakeRuntimeService) ListContainers(filter *runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Called = append(r.Called, "ListContainers")
|
||||
|
||||
result := make([]*runtimeApi.Container, 0)
|
||||
result := make([]*runtimeapi.Container, 0)
|
||||
for _, s := range r.Containers {
|
||||
if filter != nil {
|
||||
if filter.Id != nil && filter.GetId() != s.GetId() {
|
||||
@@ -335,7 +335,7 @@ func (r *FakeRuntimeService) ListContainers(filter *runtimeApi.ContainerFilter)
|
||||
}
|
||||
}
|
||||
|
||||
result = append(result, &runtimeApi.Container{
|
||||
result = append(result, &runtimeapi.Container{
|
||||
Id: s.Id,
|
||||
CreatedAt: s.CreatedAt,
|
||||
PodSandboxId: &s.SandboxID,
|
||||
@@ -351,7 +351,7 @@ func (r *FakeRuntimeService) ListContainers(filter *runtimeApi.ContainerFilter)
|
||||
return result, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) ContainerStatus(containerID string) (*runtimeApi.ContainerStatus, error) {
|
||||
func (r *FakeRuntimeService) ContainerStatus(containerID string) (*runtimeapi.ContainerStatus, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
@@ -374,22 +374,22 @@ func (r *FakeRuntimeService) ExecSync(containerID string, cmd []string, timeout
|
||||
return nil, nil, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) Exec(*runtimeApi.ExecRequest) (*runtimeApi.ExecResponse, error) {
|
||||
func (r *FakeRuntimeService) Exec(*runtimeapi.ExecRequest) (*runtimeapi.ExecResponse, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Called = append(r.Called, "Exec")
|
||||
return &runtimeApi.ExecResponse{}, nil
|
||||
return &runtimeapi.ExecResponse{}, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) Attach(req *runtimeApi.AttachRequest) (*runtimeApi.AttachResponse, error) {
|
||||
func (r *FakeRuntimeService) Attach(req *runtimeapi.AttachRequest) (*runtimeapi.AttachResponse, error) {
|
||||
r.Lock()
|
||||
defer r.Unlock()
|
||||
|
||||
r.Called = append(r.Called, "Attach")
|
||||
return &runtimeApi.AttachResponse{}, nil
|
||||
return &runtimeapi.AttachResponse{}, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntimeService) UpdateRuntimeConfig(runtimeCOnfig *runtimeApi.RuntimeConfig) error {
|
||||
func (r *FakeRuntimeService) UpdateRuntimeConfig(runtimeCOnfig *runtimeapi.RuntimeConfig) error {
|
||||
return nil
|
||||
}
|
||||
|
@@ -19,15 +19,15 @@ package testing
|
||||
import (
|
||||
"fmt"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
func BuildContainerName(metadata *runtimeApi.ContainerMetadata, sandboxID string) string {
|
||||
func BuildContainerName(metadata *runtimeapi.ContainerMetadata, sandboxID string) string {
|
||||
// include the sandbox ID to make the container ID unique.
|
||||
return fmt.Sprintf("%s_%s_%d", sandboxID, metadata.GetName(), metadata.GetAttempt())
|
||||
}
|
||||
|
||||
func BuildSandboxName(metadata *runtimeApi.PodSandboxMetadata) string {
|
||||
func BuildSandboxName(metadata *runtimeapi.PodSandboxMetadata) string {
|
||||
return fmt.Sprintf("%s_%s_%s_%d", metadata.GetName(), metadata.GetNamespace(), metadata.GetUid(), metadata.GetAttempt())
|
||||
}
|
||||
|
||||
|
@@ -26,7 +26,7 @@ import (
|
||||
|
||||
"github.com/golang/glog"
|
||||
"github.com/google/cadvisor/cache/memory"
|
||||
cadvisorMetrics "github.com/google/cadvisor/container"
|
||||
cadvisormetrics "github.com/google/cadvisor/container"
|
||||
"github.com/google/cadvisor/events"
|
||||
cadvisorfs "github.com/google/cadvisor/fs"
|
||||
cadvisorhttp "github.com/google/cadvisor/http"
|
||||
@@ -101,7 +101,7 @@ func New(port uint, runtime string, rootPath string) (Interface, error) {
|
||||
}
|
||||
|
||||
// Create and start the cAdvisor container manager.
|
||||
m, err := manager.New(memory.New(statsCacheDuration, nil), sysFs, maxHousekeepingInterval, allowDynamicHousekeeping, cadvisorMetrics.MetricSet{cadvisorMetrics.NetworkTcpUsageMetrics: struct{}{}}, http.DefaultClient)
|
||||
m, err := manager.New(memory.New(statsCacheDuration, nil), sysFs, maxHousekeepingInterval, allowDynamicHousekeeping, cadvisormetrics.MetricSet{cadvisormetrics.NetworkTcpUsageMetrics: struct{}{}}, http.DefaultClient)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
|
@@ -17,12 +17,12 @@ limitations under the License.
|
||||
package cadvisor
|
||||
|
||||
import (
|
||||
cadvisorApi "github.com/google/cadvisor/info/v1"
|
||||
cadvisorapi "github.com/google/cadvisor/info/v1"
|
||||
"k8s.io/kubernetes/pkg/api/resource"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
)
|
||||
|
||||
func CapacityFromMachineInfo(info *cadvisorApi.MachineInfo) v1.ResourceList {
|
||||
func CapacityFromMachineInfo(info *cadvisorapi.MachineInfo) v1.ResourceList {
|
||||
c := v1.ResourceList{
|
||||
v1.ResourceCPU: *resource.NewMilliQuantity(
|
||||
int64(info.NumCores*1000),
|
||||
|
@@ -28,7 +28,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/util/format"
|
||||
"k8s.io/kubernetes/pkg/kubelet/util/ioutils"
|
||||
"k8s.io/kubernetes/pkg/runtime"
|
||||
@@ -209,11 +209,11 @@ func ConvertPodStatusToRunningPod(runtimeName string, podStatus *PodStatus) Pod
|
||||
// This is only needed because we need to return sandboxes as if they were
|
||||
// kubecontainer.Containers to avoid substantial changes to PLEG.
|
||||
// TODO: Remove this once it becomes obsolete.
|
||||
func SandboxToContainerState(state runtimeApi.PodSandboxState) ContainerState {
|
||||
func SandboxToContainerState(state runtimeapi.PodSandboxState) ContainerState {
|
||||
switch state {
|
||||
case runtimeApi.PodSandboxState_SANDBOX_READY:
|
||||
case runtimeapi.PodSandboxState_SANDBOX_READY:
|
||||
return ContainerStateRunning
|
||||
case runtimeApi.PodSandboxState_SANDBOX_NOTREADY:
|
||||
case runtimeapi.PodSandboxState_SANDBOX_NOTREADY:
|
||||
return ContainerStateExited
|
||||
}
|
||||
return ContainerStateUnknown
|
||||
|
@@ -26,7 +26,7 @@ import (
|
||||
|
||||
"github.com/golang/glog"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
"k8s.io/kubernetes/pkg/util/flowcontrol"
|
||||
"k8s.io/kubernetes/pkg/util/term"
|
||||
@@ -299,7 +299,7 @@ type PodStatus struct {
|
||||
ContainerStatuses []*ContainerStatus
|
||||
// Status of the pod sandbox.
|
||||
// Only for kuberuntime now, other runtime may keep it nil.
|
||||
SandboxStatuses []*runtimeApi.PodSandboxStatus
|
||||
SandboxStatuses []*runtimeapi.PodSandboxStatus
|
||||
}
|
||||
|
||||
// ContainerStatus represents the status of a container.
|
||||
|
@@ -23,7 +23,7 @@ import (
|
||||
|
||||
dockertypes "github.com/docker/engine-api/types"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
// This file contains helper functions to convert docker API types to runtime
|
||||
@@ -36,13 +36,13 @@ const (
|
||||
statusExitedPrefix = "Exited"
|
||||
)
|
||||
|
||||
func imageToRuntimeAPIImage(image *dockertypes.Image) (*runtimeApi.Image, error) {
|
||||
func imageToRuntimeAPIImage(image *dockertypes.Image) (*runtimeapi.Image, error) {
|
||||
if image == nil {
|
||||
return nil, fmt.Errorf("unable to convert a nil pointer to a runtime API image")
|
||||
}
|
||||
|
||||
size := uint64(image.VirtualSize)
|
||||
return &runtimeApi.Image{
|
||||
return &runtimeapi.Image{
|
||||
Id: &image.ID,
|
||||
RepoTags: image.RepoTags,
|
||||
RepoDigests: image.RepoDigests,
|
||||
@@ -50,13 +50,13 @@ func imageToRuntimeAPIImage(image *dockertypes.Image) (*runtimeApi.Image, error)
|
||||
}, nil
|
||||
}
|
||||
|
||||
func imageInspectToRuntimeAPIImage(image *dockertypes.ImageInspect) (*runtimeApi.Image, error) {
|
||||
func imageInspectToRuntimeAPIImage(image *dockertypes.ImageInspect) (*runtimeapi.Image, error) {
|
||||
if image == nil {
|
||||
return nil, fmt.Errorf("unable to convert a nil pointer to a runtime API image")
|
||||
}
|
||||
|
||||
size := uint64(image.VirtualSize)
|
||||
runtimeImage := &runtimeApi.Image{
|
||||
runtimeImage := &runtimeapi.Image{
|
||||
Id: &image.ID,
|
||||
RepoTags: image.RepoTags,
|
||||
RepoDigests: image.RepoDigests,
|
||||
@@ -77,7 +77,7 @@ func toPullableImageID(id string, image *dockertypes.ImageInspect) string {
|
||||
return imageID
|
||||
}
|
||||
|
||||
func toRuntimeAPIContainer(c *dockertypes.Container) (*runtimeApi.Container, error) {
|
||||
func toRuntimeAPIContainer(c *dockertypes.Container) (*runtimeapi.Container, error) {
|
||||
state := toRuntimeAPIContainerState(c.Status)
|
||||
if len(c.Names) == 0 {
|
||||
return nil, fmt.Errorf("unexpected empty container name: %+v", c)
|
||||
@@ -90,11 +90,11 @@ func toRuntimeAPIContainer(c *dockertypes.Container) (*runtimeApi.Container, err
|
||||
sandboxID := c.Labels[sandboxIDLabelKey]
|
||||
// The timestamp in dockertypes.Container is in seconds.
|
||||
createdAt := c.Created * int64(time.Second)
|
||||
return &runtimeApi.Container{
|
||||
return &runtimeapi.Container{
|
||||
Id: &c.ID,
|
||||
PodSandboxId: &sandboxID,
|
||||
Metadata: metadata,
|
||||
Image: &runtimeApi.ImageSpec{Image: &c.Image},
|
||||
Image: &runtimeapi.ImageSpec{Image: &c.Image},
|
||||
ImageRef: &c.ImageID,
|
||||
State: &state,
|
||||
CreatedAt: &createdAt,
|
||||
@@ -103,48 +103,48 @@ func toRuntimeAPIContainer(c *dockertypes.Container) (*runtimeApi.Container, err
|
||||
}, nil
|
||||
}
|
||||
|
||||
func toDockerContainerStatus(state runtimeApi.ContainerState) string {
|
||||
func toDockerContainerStatus(state runtimeapi.ContainerState) string {
|
||||
switch state {
|
||||
case runtimeApi.ContainerState_CONTAINER_CREATED:
|
||||
case runtimeapi.ContainerState_CONTAINER_CREATED:
|
||||
return "created"
|
||||
case runtimeApi.ContainerState_CONTAINER_RUNNING:
|
||||
case runtimeapi.ContainerState_CONTAINER_RUNNING:
|
||||
return "running"
|
||||
case runtimeApi.ContainerState_CONTAINER_EXITED:
|
||||
case runtimeapi.ContainerState_CONTAINER_EXITED:
|
||||
return "exited"
|
||||
case runtimeApi.ContainerState_CONTAINER_UNKNOWN:
|
||||
case runtimeapi.ContainerState_CONTAINER_UNKNOWN:
|
||||
fallthrough
|
||||
default:
|
||||
return "unknown"
|
||||
}
|
||||
}
|
||||
|
||||
func toRuntimeAPIContainerState(state string) runtimeApi.ContainerState {
|
||||
func toRuntimeAPIContainerState(state string) runtimeapi.ContainerState {
|
||||
// Parse the state string in dockertypes.Container. This could break when
|
||||
// we upgrade docker.
|
||||
switch {
|
||||
case strings.HasPrefix(state, statusRunningPrefix):
|
||||
return runtimeApi.ContainerState_CONTAINER_RUNNING
|
||||
return runtimeapi.ContainerState_CONTAINER_RUNNING
|
||||
case strings.HasPrefix(state, statusExitedPrefix):
|
||||
return runtimeApi.ContainerState_CONTAINER_EXITED
|
||||
return runtimeapi.ContainerState_CONTAINER_EXITED
|
||||
case strings.HasPrefix(state, statusCreatedPrefix):
|
||||
return runtimeApi.ContainerState_CONTAINER_CREATED
|
||||
return runtimeapi.ContainerState_CONTAINER_CREATED
|
||||
default:
|
||||
return runtimeApi.ContainerState_CONTAINER_UNKNOWN
|
||||
return runtimeapi.ContainerState_CONTAINER_UNKNOWN
|
||||
}
|
||||
}
|
||||
|
||||
func toRuntimeAPISandboxState(state string) runtimeApi.PodSandboxState {
|
||||
func toRuntimeAPISandboxState(state string) runtimeapi.PodSandboxState {
|
||||
// Parse the state string in dockertypes.Container. This could break when
|
||||
// we upgrade docker.
|
||||
switch {
|
||||
case strings.HasPrefix(state, statusRunningPrefix):
|
||||
return runtimeApi.PodSandboxState_SANDBOX_READY
|
||||
return runtimeapi.PodSandboxState_SANDBOX_READY
|
||||
default:
|
||||
return runtimeApi.PodSandboxState_SANDBOX_NOTREADY
|
||||
return runtimeapi.PodSandboxState_SANDBOX_NOTREADY
|
||||
}
|
||||
}
|
||||
|
||||
func toRuntimeAPISandbox(c *dockertypes.Container) (*runtimeApi.PodSandbox, error) {
|
||||
func toRuntimeAPISandbox(c *dockertypes.Container) (*runtimeapi.PodSandbox, error) {
|
||||
state := toRuntimeAPISandboxState(c.Status)
|
||||
if len(c.Names) == 0 {
|
||||
return nil, fmt.Errorf("unexpected empty sandbox name: %+v", c)
|
||||
@@ -156,7 +156,7 @@ func toRuntimeAPISandbox(c *dockertypes.Container) (*runtimeApi.PodSandbox, erro
|
||||
labels, annotations := extractLabels(c.Labels)
|
||||
// The timestamp in dockertypes.Container is in seconds.
|
||||
createdAt := c.Created * int64(time.Second)
|
||||
return &runtimeApi.PodSandbox{
|
||||
return &runtimeapi.PodSandbox{
|
||||
Id: &c.ID,
|
||||
Metadata: metadata,
|
||||
State: &state,
|
||||
|
@@ -22,18 +22,18 @@ import (
|
||||
dockertypes "github.com/docker/engine-api/types"
|
||||
"github.com/stretchr/testify/assert"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
func TestConvertDockerStatusToRuntimeAPIState(t *testing.T) {
|
||||
testCases := []struct {
|
||||
input string
|
||||
expected runtimeApi.ContainerState
|
||||
expected runtimeapi.ContainerState
|
||||
}{
|
||||
{input: "Up 5 hours", expected: runtimeApi.ContainerState_CONTAINER_RUNNING},
|
||||
{input: "Exited (0) 2 hours ago", expected: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{input: "Created", expected: runtimeApi.ContainerState_CONTAINER_CREATED},
|
||||
{input: "Random string", expected: runtimeApi.ContainerState_CONTAINER_UNKNOWN},
|
||||
{input: "Up 5 hours", expected: runtimeapi.ContainerState_CONTAINER_RUNNING},
|
||||
{input: "Exited (0) 2 hours ago", expected: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
{input: "Created", expected: runtimeapi.ContainerState_CONTAINER_CREATED},
|
||||
{input: "Random string", expected: runtimeapi.ContainerState_CONTAINER_UNKNOWN},
|
||||
}
|
||||
|
||||
for _, test := range testCases {
|
||||
|
@@ -28,12 +28,12 @@ import (
|
||||
dockerstrslice "github.com/docker/engine-api/types/strslice"
|
||||
"github.com/golang/glog"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockertools"
|
||||
)
|
||||
|
||||
// ListContainers lists all containers matching the filter.
|
||||
func (ds *dockerService) ListContainers(filter *runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error) {
|
||||
func (ds *dockerService) ListContainers(filter *runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error) {
|
||||
opts := dockertypes.ContainerListOptions{All: true}
|
||||
|
||||
opts.Filter = dockerfilters.NewArgs()
|
||||
@@ -63,7 +63,7 @@ func (ds *dockerService) ListContainers(filter *runtimeApi.ContainerFilter) ([]*
|
||||
return nil, err
|
||||
}
|
||||
// Convert docker to runtime api containers.
|
||||
result := []*runtimeApi.Container{}
|
||||
result := []*runtimeapi.Container{}
|
||||
for i := range containers {
|
||||
c := containers[i]
|
||||
|
||||
@@ -82,7 +82,7 @@ func (ds *dockerService) ListContainers(filter *runtimeApi.ContainerFilter) ([]*
|
||||
// Docker cannot store the log to an arbitrary location (yet), so we create an
|
||||
// symlink at LogPath, linking to the actual path of the log.
|
||||
// TODO: check if the default values returned by the runtime API are ok.
|
||||
func (ds *dockerService) CreateContainer(podSandboxID string, config *runtimeApi.ContainerConfig, sandboxConfig *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (ds *dockerService) CreateContainer(podSandboxID string, config *runtimeapi.ContainerConfig, sandboxConfig *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
if config == nil {
|
||||
return "", fmt.Errorf("container config is nil")
|
||||
}
|
||||
@@ -283,7 +283,7 @@ func getContainerTimestamps(r *dockertypes.ContainerJSON) (time.Time, time.Time,
|
||||
}
|
||||
|
||||
// ContainerStatus inspects the docker container and returns the status.
|
||||
func (ds *dockerService) ContainerStatus(containerID string) (*runtimeApi.ContainerStatus, error) {
|
||||
func (ds *dockerService) ContainerStatus(containerID string) (*runtimeapi.ContainerStatus, error) {
|
||||
r, err := ds.client.InspectContainer(containerID)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
@@ -303,11 +303,11 @@ func (ds *dockerService) ContainerStatus(containerID string) (*runtimeApi.Contai
|
||||
imageID := toPullableImageID(r.Image, ir)
|
||||
|
||||
// Convert the mounts.
|
||||
mounts := []*runtimeApi.Mount{}
|
||||
mounts := []*runtimeapi.Mount{}
|
||||
for i := range r.Mounts {
|
||||
m := r.Mounts[i]
|
||||
readonly := !m.RW
|
||||
mounts = append(mounts, &runtimeApi.Mount{
|
||||
mounts = append(mounts, &runtimeapi.Mount{
|
||||
HostPath: &m.Source,
|
||||
ContainerPath: &m.Destination,
|
||||
Readonly: &readonly,
|
||||
@@ -315,11 +315,11 @@ func (ds *dockerService) ContainerStatus(containerID string) (*runtimeApi.Contai
|
||||
})
|
||||
}
|
||||
// Interpret container states.
|
||||
var state runtimeApi.ContainerState
|
||||
var state runtimeapi.ContainerState
|
||||
var reason, message string
|
||||
if r.State.Running {
|
||||
// Container is running.
|
||||
state = runtimeApi.ContainerState_CONTAINER_RUNNING
|
||||
state = runtimeapi.ContainerState_CONTAINER_RUNNING
|
||||
} else {
|
||||
// Container is *not* running. We need to get more details.
|
||||
// * Case 1: container has run and exited with non-zero finishedAt
|
||||
@@ -328,7 +328,7 @@ func (ds *dockerService) ContainerStatus(containerID string) (*runtimeApi.Contai
|
||||
// time, but a non-zero exit code.
|
||||
// * Case 3: container has been created, but not started (yet).
|
||||
if !finishedAt.IsZero() { // Case 1
|
||||
state = runtimeApi.ContainerState_CONTAINER_EXITED
|
||||
state = runtimeapi.ContainerState_CONTAINER_EXITED
|
||||
switch {
|
||||
case r.State.OOMKilled:
|
||||
// TODO: consider exposing OOMKilled via the runtimeAPI.
|
||||
@@ -341,13 +341,13 @@ func (ds *dockerService) ContainerStatus(containerID string) (*runtimeApi.Contai
|
||||
reason = "Error"
|
||||
}
|
||||
} else if r.State.ExitCode != 0 { // Case 2
|
||||
state = runtimeApi.ContainerState_CONTAINER_EXITED
|
||||
state = runtimeapi.ContainerState_CONTAINER_EXITED
|
||||
// Adjust finshedAt and startedAt time to createdAt time to avoid
|
||||
// the confusion.
|
||||
finishedAt, startedAt = createdAt, createdAt
|
||||
reason = "ContainerCannotRun"
|
||||
} else { // Case 3
|
||||
state = runtimeApi.ContainerState_CONTAINER_CREATED
|
||||
state = runtimeapi.ContainerState_CONTAINER_CREATED
|
||||
}
|
||||
message = r.State.Error
|
||||
}
|
||||
@@ -362,10 +362,10 @@ func (ds *dockerService) ContainerStatus(containerID string) (*runtimeApi.Contai
|
||||
}
|
||||
|
||||
labels, annotations := extractLabels(r.Config.Labels)
|
||||
return &runtimeApi.ContainerStatus{
|
||||
return &runtimeapi.ContainerStatus{
|
||||
Id: &r.ID,
|
||||
Metadata: metadata,
|
||||
Image: &runtimeApi.ImageSpec{Image: &r.Config.Image},
|
||||
Image: &runtimeapi.ImageSpec{Image: &r.Config.Image},
|
||||
ImageRef: &imageID,
|
||||
Mounts: mounts,
|
||||
ExitCode: &exitCode,
|
||||
|
@@ -24,18 +24,18 @@ import (
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
containertest "k8s.io/kubernetes/pkg/kubelet/container/testing"
|
||||
)
|
||||
|
||||
// A helper to create a basic config.
|
||||
func makeContainerConfig(sConfig *runtimeApi.PodSandboxConfig, name, image string, attempt uint32, labels, annotations map[string]string) *runtimeApi.ContainerConfig {
|
||||
return &runtimeApi.ContainerConfig{
|
||||
Metadata: &runtimeApi.ContainerMetadata{
|
||||
func makeContainerConfig(sConfig *runtimeapi.PodSandboxConfig, name, image string, attempt uint32, labels, annotations map[string]string) *runtimeapi.ContainerConfig {
|
||||
return &runtimeapi.ContainerConfig{
|
||||
Metadata: &runtimeapi.ContainerMetadata{
|
||||
Name: &name,
|
||||
Attempt: &attempt,
|
||||
},
|
||||
Image: &runtimeApi.ImageSpec{Image: &image},
|
||||
Image: &runtimeapi.ImageSpec{Image: &image},
|
||||
Labels: labels,
|
||||
Annotations: annotations,
|
||||
}
|
||||
@@ -48,8 +48,8 @@ func TestListContainers(t *testing.T) {
|
||||
podName, namespace := "foo", "bar"
|
||||
containerName, image := "sidecar", "logger"
|
||||
|
||||
configs := []*runtimeApi.ContainerConfig{}
|
||||
sConfigs := []*runtimeApi.PodSandboxConfig{}
|
||||
configs := []*runtimeapi.ContainerConfig{}
|
||||
sConfigs := []*runtimeapi.PodSandboxConfig{}
|
||||
for i := 0; i < 3; i++ {
|
||||
s := makeSandboxConfig(fmt.Sprintf("%s%d", podName, i),
|
||||
fmt.Sprintf("%s%d", namespace, i), fmt.Sprintf("%d", i), 0)
|
||||
@@ -61,8 +61,8 @@ func TestListContainers(t *testing.T) {
|
||||
configs = append(configs, c)
|
||||
}
|
||||
|
||||
expected := []*runtimeApi.Container{}
|
||||
state := runtimeApi.ContainerState_CONTAINER_RUNNING
|
||||
expected := []*runtimeapi.Container{}
|
||||
state := runtimeapi.ContainerState_CONTAINER_RUNNING
|
||||
var createdAt int64 = 0
|
||||
for i := range configs {
|
||||
// We don't care about the sandbox id; pass a bogus one.
|
||||
@@ -75,7 +75,7 @@ func TestListContainers(t *testing.T) {
|
||||
imageRef := "" // FakeDockerClient doesn't populate ImageRef yet.
|
||||
// Prepend to the expected list because ListContainers returns
|
||||
// the most recent containers first.
|
||||
expected = append([]*runtimeApi.Container{{
|
||||
expected = append([]*runtimeapi.Container{{
|
||||
Metadata: configs[i].Metadata,
|
||||
Id: &id,
|
||||
PodSandboxId: &sandboxID,
|
||||
@@ -105,13 +105,13 @@ func TestContainerStatus(t *testing.T) {
|
||||
var defaultTime time.Time
|
||||
dt := defaultTime.UnixNano()
|
||||
ct, st, ft := dt, dt, dt
|
||||
state := runtimeApi.ContainerState_CONTAINER_CREATED
|
||||
state := runtimeapi.ContainerState_CONTAINER_CREATED
|
||||
// The following variables are not set in FakeDockerClient.
|
||||
imageRef := DockerImageIDPrefix + ""
|
||||
exitCode := int32(0)
|
||||
var reason, message string
|
||||
|
||||
expected := &runtimeApi.ContainerStatus{
|
||||
expected := &runtimeapi.ContainerStatus{
|
||||
State: &state,
|
||||
CreatedAt: &ct,
|
||||
StartedAt: &st,
|
||||
@@ -122,7 +122,7 @@ func TestContainerStatus(t *testing.T) {
|
||||
ExitCode: &exitCode,
|
||||
Reason: &reason,
|
||||
Message: &message,
|
||||
Mounts: []*runtimeApi.Mount{},
|
||||
Mounts: []*runtimeapi.Mount{},
|
||||
Labels: config.Labels,
|
||||
Annotations: config.Annotations,
|
||||
}
|
||||
@@ -149,7 +149,7 @@ func TestContainerStatus(t *testing.T) {
|
||||
// Advance the clock and start the container.
|
||||
fClock.SetTime(time.Now())
|
||||
*expected.StartedAt = fClock.Now().UnixNano()
|
||||
*expected.State = runtimeApi.ContainerState_CONTAINER_RUNNING
|
||||
*expected.State = runtimeapi.ContainerState_CONTAINER_RUNNING
|
||||
|
||||
err = ds.StartContainer(id)
|
||||
assert.NoError(t, err)
|
||||
@@ -159,7 +159,7 @@ func TestContainerStatus(t *testing.T) {
|
||||
// Advance the clock and stop the container.
|
||||
fClock.SetTime(time.Now().Add(1 * time.Hour))
|
||||
*expected.FinishedAt = fClock.Now().UnixNano()
|
||||
*expected.State = runtimeApi.ContainerState_CONTAINER_EXITED
|
||||
*expected.State = runtimeapi.ContainerState_CONTAINER_EXITED
|
||||
*expected.Reason = "Completed"
|
||||
|
||||
err = ds.StopContainer(id, 0)
|
||||
|
@@ -18,14 +18,14 @@ package dockershim
|
||||
|
||||
import (
|
||||
dockertypes "github.com/docker/engine-api/types"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockertools"
|
||||
)
|
||||
|
||||
// This file implements methods in ImageManagerService.
|
||||
|
||||
// ListImages lists existing images.
|
||||
func (ds *dockerService) ListImages(filter *runtimeApi.ImageFilter) ([]*runtimeApi.Image, error) {
|
||||
func (ds *dockerService) ListImages(filter *runtimeapi.ImageFilter) ([]*runtimeapi.Image, error) {
|
||||
opts := dockertypes.ImageListOptions{}
|
||||
if filter != nil {
|
||||
if imgSpec := filter.GetImage(); imgSpec != nil {
|
||||
@@ -38,7 +38,7 @@ func (ds *dockerService) ListImages(filter *runtimeApi.ImageFilter) ([]*runtimeA
|
||||
return nil, err
|
||||
}
|
||||
|
||||
result := []*runtimeApi.Image{}
|
||||
result := []*runtimeapi.Image{}
|
||||
for _, i := range images {
|
||||
apiImage, err := imageToRuntimeAPIImage(&i)
|
||||
if err != nil {
|
||||
@@ -51,7 +51,7 @@ func (ds *dockerService) ListImages(filter *runtimeApi.ImageFilter) ([]*runtimeA
|
||||
}
|
||||
|
||||
// ImageStatus returns the status of the image, returns nil if the image doesn't present.
|
||||
func (ds *dockerService) ImageStatus(image *runtimeApi.ImageSpec) (*runtimeApi.Image, error) {
|
||||
func (ds *dockerService) ImageStatus(image *runtimeapi.ImageSpec) (*runtimeapi.Image, error) {
|
||||
imageInspect, err := ds.client.InspectImageByRef(image.GetImage())
|
||||
if err != nil {
|
||||
if dockertools.IsImageNotFoundError(err) {
|
||||
@@ -63,7 +63,7 @@ func (ds *dockerService) ImageStatus(image *runtimeApi.ImageSpec) (*runtimeApi.I
|
||||
}
|
||||
|
||||
// PullImage pulls an image with authentication config.
|
||||
func (ds *dockerService) PullImage(image *runtimeApi.ImageSpec, auth *runtimeApi.AuthConfig) error {
|
||||
func (ds *dockerService) PullImage(image *runtimeapi.ImageSpec, auth *runtimeapi.AuthConfig) error {
|
||||
return ds.client.PullImage(image.GetImage(),
|
||||
dockertypes.AuthConfig{
|
||||
Username: auth.GetUsername(),
|
||||
@@ -77,7 +77,7 @@ func (ds *dockerService) PullImage(image *runtimeApi.ImageSpec, auth *runtimeApi
|
||||
}
|
||||
|
||||
// RemoveImage removes the image.
|
||||
func (ds *dockerService) RemoveImage(image *runtimeApi.ImageSpec) error {
|
||||
func (ds *dockerService) RemoveImage(image *runtimeapi.ImageSpec) error {
|
||||
// If the image has multiple tags, we need to remove all the tags
|
||||
// TODO: We assume image.Image is image ID here, which is true in the current implementation
|
||||
// of kubelet, but we should still clarify this in CRI.
|
||||
|
@@ -21,7 +21,7 @@ import (
|
||||
|
||||
dockertypes "github.com/docker/engine-api/types"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockertools"
|
||||
)
|
||||
|
||||
@@ -29,7 +29,7 @@ func TestRemoveImage(t *testing.T) {
|
||||
ds, fakeDocker, _ := newTestDockerService()
|
||||
id := "1111"
|
||||
fakeDocker.Image = &dockertypes.ImageInspect{ID: id, RepoTags: []string{"foo"}}
|
||||
ds.RemoveImage(&runtimeApi.ImageSpec{Image: &id})
|
||||
ds.RemoveImage(&runtimeapi.ImageSpec{Image: &id})
|
||||
fakeDocker.AssertCallDetails(dockertools.NewCalledDetail("inspect_image", nil),
|
||||
dockertools.NewCalledDetail("remove_image", []interface{}{id, dockertypes.ImageRemoveOptions{PruneChildren: true}}))
|
||||
}
|
||||
@@ -38,7 +38,7 @@ func TestRemoveImageWithMultipleTags(t *testing.T) {
|
||||
ds, fakeDocker, _ := newTestDockerService()
|
||||
id := "1111"
|
||||
fakeDocker.Image = &dockertypes.ImageInspect{ID: id, RepoTags: []string{"foo", "bar"}}
|
||||
ds.RemoveImage(&runtimeApi.ImageSpec{Image: &id})
|
||||
ds.RemoveImage(&runtimeapi.ImageSpec{Image: &id})
|
||||
fakeDocker.AssertCallDetails(dockertools.NewCalledDetail("inspect_image", nil),
|
||||
dockertools.NewCalledDetail("remove_image", []interface{}{"foo", dockertypes.ImageRemoveOptions{PruneChildren: true}}),
|
||||
dockertools.NewCalledDetail("remove_image", []interface{}{"bar", dockertypes.ImageRemoveOptions{PruneChildren: true}}))
|
||||
|
@@ -24,7 +24,7 @@ import (
|
||||
dockerfilters "github.com/docker/engine-api/types/filters"
|
||||
"github.com/golang/glog"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/kubelet/qos"
|
||||
"k8s.io/kubernetes/pkg/kubelet/types"
|
||||
@@ -48,7 +48,7 @@ const (
|
||||
// For docker, PodSandbox is implemented by a container holding the network
|
||||
// namespace for the pod.
|
||||
// Note: docker doesn't use LogDirectory (yet).
|
||||
func (ds *dockerService) RunPodSandbox(config *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (ds *dockerService) RunPodSandbox(config *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
// Step 1: Pull the image for the sandbox.
|
||||
image := defaultSandboxImage
|
||||
podSandboxImage := ds.podSandboxImage
|
||||
@@ -179,7 +179,7 @@ func (ds *dockerService) getIP(sandbox *dockertypes.ContainerJSON) (string, erro
|
||||
}
|
||||
|
||||
// PodSandboxStatus returns the status of the PodSandbox.
|
||||
func (ds *dockerService) PodSandboxStatus(podSandboxID string) (*runtimeApi.PodSandboxStatus, error) {
|
||||
func (ds *dockerService) PodSandboxStatus(podSandboxID string) (*runtimeapi.PodSandboxStatus, error) {
|
||||
// Inspect the container.
|
||||
r, err := ds.client.InspectContainer(podSandboxID)
|
||||
if err != nil {
|
||||
@@ -194,15 +194,15 @@ func (ds *dockerService) PodSandboxStatus(podSandboxID string) (*runtimeApi.PodS
|
||||
ct := createdAt.UnixNano()
|
||||
|
||||
// Translate container to sandbox state.
|
||||
state := runtimeApi.PodSandboxState_SANDBOX_NOTREADY
|
||||
state := runtimeapi.PodSandboxState_SANDBOX_NOTREADY
|
||||
if r.State.Running {
|
||||
state = runtimeApi.PodSandboxState_SANDBOX_READY
|
||||
state = runtimeapi.PodSandboxState_SANDBOX_READY
|
||||
}
|
||||
IP, err := ds.getIP(r)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
network := &runtimeApi.PodSandboxNetworkStatus{Ip: &IP}
|
||||
network := &runtimeapi.PodSandboxNetworkStatus{Ip: &IP}
|
||||
netNS := getNetworkNamespace(r)
|
||||
|
||||
metadata, err := parseSandboxName(r.Name)
|
||||
@@ -211,7 +211,7 @@ func (ds *dockerService) PodSandboxStatus(podSandboxID string) (*runtimeApi.PodS
|
||||
}
|
||||
hostNetwork := sharesHostNetwork(r)
|
||||
labels, annotations := extractLabels(r.Config.Labels)
|
||||
return &runtimeApi.PodSandboxStatus{
|
||||
return &runtimeapi.PodSandboxStatus{
|
||||
Id: &r.ID,
|
||||
State: &state,
|
||||
CreatedAt: &ct,
|
||||
@@ -219,10 +219,10 @@ func (ds *dockerService) PodSandboxStatus(podSandboxID string) (*runtimeApi.PodS
|
||||
Labels: labels,
|
||||
Annotations: annotations,
|
||||
Network: network,
|
||||
Linux: &runtimeApi.LinuxPodSandboxStatus{
|
||||
Namespaces: &runtimeApi.Namespace{
|
||||
Linux: &runtimeapi.LinuxPodSandboxStatus{
|
||||
Namespaces: &runtimeapi.Namespace{
|
||||
Network: &netNS,
|
||||
Options: &runtimeApi.NamespaceOption{
|
||||
Options: &runtimeapi.NamespaceOption{
|
||||
HostNetwork: &hostNetwork,
|
||||
},
|
||||
},
|
||||
@@ -231,7 +231,7 @@ func (ds *dockerService) PodSandboxStatus(podSandboxID string) (*runtimeApi.PodS
|
||||
}
|
||||
|
||||
// ListPodSandbox returns a list of Sandbox.
|
||||
func (ds *dockerService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]*runtimeApi.PodSandbox, error) {
|
||||
func (ds *dockerService) ListPodSandbox(filter *runtimeapi.PodSandboxFilter) ([]*runtimeapi.PodSandbox, error) {
|
||||
// By default, list all containers whether they are running or not.
|
||||
opts := dockertypes.ContainerListOptions{All: true}
|
||||
filterOutReadySandboxes := false
|
||||
@@ -246,11 +246,11 @@ func (ds *dockerService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]
|
||||
f.Add("id", filter.GetId())
|
||||
}
|
||||
if filter.State != nil {
|
||||
if filter.GetState() == runtimeApi.PodSandboxState_SANDBOX_READY {
|
||||
if filter.GetState() == runtimeapi.PodSandboxState_SANDBOX_READY {
|
||||
// Only list running containers.
|
||||
opts.All = false
|
||||
} else {
|
||||
// runtimeApi.PodSandboxState_SANDBOX_NOTREADY can mean the
|
||||
// runtimeapi.PodSandboxState_SANDBOX_NOTREADY can mean the
|
||||
// container is in any of the non-running state (e.g., created,
|
||||
// exited). We can't tell docker to filter out running
|
||||
// containers directly, so we'll need to filter them out
|
||||
@@ -271,7 +271,7 @@ func (ds *dockerService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]
|
||||
}
|
||||
|
||||
// Convert docker containers to runtime api sandboxes.
|
||||
result := []*runtimeApi.PodSandbox{}
|
||||
result := []*runtimeapi.PodSandbox{}
|
||||
for i := range containers {
|
||||
c := containers[i]
|
||||
converted, err := toRuntimeAPISandbox(&c)
|
||||
@@ -279,7 +279,7 @@ func (ds *dockerService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]
|
||||
glog.V(4).Infof("Unable to convert docker to runtime API sandbox: %v", err)
|
||||
continue
|
||||
}
|
||||
if filterOutReadySandboxes && converted.GetState() == runtimeApi.PodSandboxState_SANDBOX_READY {
|
||||
if filterOutReadySandboxes && converted.GetState() == runtimeapi.PodSandboxState_SANDBOX_READY {
|
||||
continue
|
||||
}
|
||||
|
||||
@@ -289,7 +289,7 @@ func (ds *dockerService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]
|
||||
}
|
||||
|
||||
// applySandboxLinuxOptions applies LinuxPodSandboxConfig to dockercontainer.HostConfig and dockercontainer.ContainerCreateConfig.
|
||||
func (ds *dockerService) applySandboxLinuxOptions(hc *dockercontainer.HostConfig, lc *runtimeApi.LinuxPodSandboxConfig, createConfig *dockertypes.ContainerCreateConfig, image string) error {
|
||||
func (ds *dockerService) applySandboxLinuxOptions(hc *dockercontainer.HostConfig, lc *runtimeapi.LinuxPodSandboxConfig, createConfig *dockertypes.ContainerCreateConfig, image string) error {
|
||||
// Apply Cgroup options.
|
||||
// TODO: Check if this works with per-pod cgroups.
|
||||
hc.CgroupParent = lc.GetCgroupParent()
|
||||
@@ -299,8 +299,8 @@ func (ds *dockerService) applySandboxLinuxOptions(hc *dockercontainer.HostConfig
|
||||
return nil
|
||||
}
|
||||
|
||||
// makeSandboxDockerConfig returns dockertypes.ContainerCreateConfig based on runtimeApi.PodSandboxConfig.
|
||||
func (ds *dockerService) makeSandboxDockerConfig(c *runtimeApi.PodSandboxConfig, image string) (*dockertypes.ContainerCreateConfig, error) {
|
||||
// makeSandboxDockerConfig returns dockertypes.ContainerCreateConfig based on runtimeapi.PodSandboxConfig.
|
||||
func (ds *dockerService) makeSandboxDockerConfig(c *runtimeapi.PodSandboxConfig, image string) (*dockertypes.ContainerCreateConfig, error) {
|
||||
// Merge annotations and labels because docker supports only labels.
|
||||
labels := makeLabels(c.GetLabels(), c.GetAnnotations())
|
||||
// Apply a label to distinguish sandboxes from regular containers.
|
||||
|
@@ -24,19 +24,19 @@ import (
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/kubelet/types"
|
||||
)
|
||||
|
||||
// A helper to create a basic config.
|
||||
func makeSandboxConfig(name, namespace, uid string, attempt uint32) *runtimeApi.PodSandboxConfig {
|
||||
func makeSandboxConfig(name, namespace, uid string, attempt uint32) *runtimeapi.PodSandboxConfig {
|
||||
return makeSandboxConfigWithLabelsAndAnnotations(name, namespace, uid, attempt, map[string]string{}, map[string]string{})
|
||||
}
|
||||
|
||||
func makeSandboxConfigWithLabelsAndAnnotations(name, namespace, uid string, attempt uint32, labels, annotations map[string]string) *runtimeApi.PodSandboxConfig {
|
||||
return &runtimeApi.PodSandboxConfig{
|
||||
Metadata: &runtimeApi.PodSandboxMetadata{
|
||||
func makeSandboxConfigWithLabelsAndAnnotations(name, namespace, uid string, attempt uint32, labels, annotations map[string]string) *runtimeapi.PodSandboxConfig {
|
||||
return &runtimeapi.PodSandboxConfig{
|
||||
Metadata: &runtimeapi.PodSandboxMetadata{
|
||||
Name: &name,
|
||||
Namespace: &namespace,
|
||||
Uid: &uid,
|
||||
@@ -52,7 +52,7 @@ func makeSandboxConfigWithLabelsAndAnnotations(name, namespace, uid string, atte
|
||||
func TestListSandboxes(t *testing.T) {
|
||||
ds, _, _ := newTestDockerService()
|
||||
name, namespace := "foo", "bar"
|
||||
configs := []*runtimeApi.PodSandboxConfig{}
|
||||
configs := []*runtimeapi.PodSandboxConfig{}
|
||||
for i := 0; i < 3; i++ {
|
||||
c := makeSandboxConfigWithLabelsAndAnnotations(fmt.Sprintf("%s%d", name, i),
|
||||
fmt.Sprintf("%s%d", namespace, i), fmt.Sprintf("%d", i), 0,
|
||||
@@ -62,15 +62,15 @@ func TestListSandboxes(t *testing.T) {
|
||||
configs = append(configs, c)
|
||||
}
|
||||
|
||||
expected := []*runtimeApi.PodSandbox{}
|
||||
state := runtimeApi.PodSandboxState_SANDBOX_READY
|
||||
expected := []*runtimeapi.PodSandbox{}
|
||||
state := runtimeapi.PodSandboxState_SANDBOX_READY
|
||||
var createdAt int64 = 0
|
||||
for i := range configs {
|
||||
id, err := ds.RunPodSandbox(configs[i])
|
||||
assert.NoError(t, err)
|
||||
// Prepend to the expected list because ListPodSandbox returns
|
||||
// the most recent sandbox first.
|
||||
expected = append([]*runtimeApi.PodSandbox{{
|
||||
expected = append([]*runtimeapi.PodSandbox{{
|
||||
Metadata: configs[i].Metadata,
|
||||
Id: &id,
|
||||
State: &state,
|
||||
@@ -98,15 +98,15 @@ func TestSandboxStatus(t *testing.T) {
|
||||
fakeIP := "2.3.4.5"
|
||||
fakeNS := fmt.Sprintf("/proc/%d/ns/net", os.Getpid())
|
||||
|
||||
state := runtimeApi.PodSandboxState_SANDBOX_READY
|
||||
state := runtimeapi.PodSandboxState_SANDBOX_READY
|
||||
ct := int64(0)
|
||||
hostNetwork := false
|
||||
expected := &runtimeApi.PodSandboxStatus{
|
||||
expected := &runtimeapi.PodSandboxStatus{
|
||||
State: &state,
|
||||
CreatedAt: &ct,
|
||||
Metadata: config.Metadata,
|
||||
Network: &runtimeApi.PodSandboxNetworkStatus{Ip: &fakeIP},
|
||||
Linux: &runtimeApi.LinuxPodSandboxStatus{Namespaces: &runtimeApi.Namespace{Network: &fakeNS, Options: &runtimeApi.NamespaceOption{HostNetwork: &hostNetwork}}},
|
||||
Network: &runtimeapi.PodSandboxNetworkStatus{Ip: &fakeIP},
|
||||
Linux: &runtimeapi.LinuxPodSandboxStatus{Namespaces: &runtimeapi.Namespace{Network: &fakeNS, Options: &runtimeapi.NamespaceOption{HostNetwork: &hostNetwork}}},
|
||||
Labels: labels,
|
||||
Annotations: annotations,
|
||||
}
|
||||
@@ -128,7 +128,7 @@ func TestSandboxStatus(t *testing.T) {
|
||||
assert.Equal(t, expected, status)
|
||||
|
||||
// Stop the sandbox.
|
||||
*expected.State = runtimeApi.PodSandboxState_SANDBOX_NOTREADY
|
||||
*expected.State = runtimeapi.PodSandboxState_SANDBOX_NOTREADY
|
||||
err = ds.StopPodSandbox(id)
|
||||
assert.NoError(t, err)
|
||||
status, err = ds.PodSandboxStatus(id)
|
||||
@@ -186,9 +186,9 @@ func TestHostNetworkPluginInvocation(t *testing.T) {
|
||||
map[string]string{"annotation": ns},
|
||||
)
|
||||
hostNetwork := true
|
||||
c.Linux = &runtimeApi.LinuxPodSandboxConfig{
|
||||
SecurityContext: &runtimeApi.LinuxSandboxSecurityContext{
|
||||
NamespaceOptions: &runtimeApi.NamespaceOption{
|
||||
c.Linux = &runtimeapi.LinuxPodSandboxConfig{
|
||||
SecurityContext: &runtimeapi.LinuxSandboxSecurityContext{
|
||||
NamespaceOptions: &runtimeapi.NamespaceOption{
|
||||
HostNetwork: &hostNetwork,
|
||||
},
|
||||
},
|
||||
|
@@ -24,8 +24,8 @@ import (
|
||||
"github.com/golang/protobuf/proto"
|
||||
|
||||
"k8s.io/kubernetes/pkg/apis/componentconfig"
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockershim/cm"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockertools"
|
||||
@@ -141,8 +141,8 @@ func NewDockerService(client dockertools.DockerInterface, seccompProfileRoot str
|
||||
// DockerService is an interface that embeds the new RuntimeService and
|
||||
// ImageService interfaces.
|
||||
type DockerService interface {
|
||||
internalApi.RuntimeService
|
||||
internalApi.ImageManagerService
|
||||
internalapi.RuntimeService
|
||||
internalapi.ImageManagerService
|
||||
Start() error
|
||||
// For serving streaming calls.
|
||||
http.Handler
|
||||
@@ -160,7 +160,7 @@ type dockerService struct {
|
||||
}
|
||||
|
||||
// Version returns the runtime name, runtime version and runtime API version
|
||||
func (ds *dockerService) Version(_ string) (*runtimeApi.VersionResponse, error) {
|
||||
func (ds *dockerService) Version(_ string) (*runtimeapi.VersionResponse, error) {
|
||||
v, err := ds.client.Version()
|
||||
if err != nil {
|
||||
return nil, fmt.Errorf("docker: failed to get docker version: %v", err)
|
||||
@@ -170,7 +170,7 @@ func (ds *dockerService) Version(_ string) (*runtimeApi.VersionResponse, error)
|
||||
// Docker API version (e.g., 1.23) is not semver compatible. Add a ".0"
|
||||
// suffix to remedy this.
|
||||
apiVersion := fmt.Sprintf("%s.0", v.APIVersion)
|
||||
return &runtimeApi.VersionResponse{
|
||||
return &runtimeapi.VersionResponse{
|
||||
Version: &runtimeAPIVersion,
|
||||
RuntimeName: &name,
|
||||
RuntimeVersion: &v.Version,
|
||||
@@ -179,7 +179,7 @@ func (ds *dockerService) Version(_ string) (*runtimeApi.VersionResponse, error)
|
||||
}
|
||||
|
||||
// UpdateRuntimeConfig updates the runtime config. Currently only handles podCIDR updates.
|
||||
func (ds *dockerService) UpdateRuntimeConfig(runtimeConfig *runtimeApi.RuntimeConfig) (err error) {
|
||||
func (ds *dockerService) UpdateRuntimeConfig(runtimeConfig *runtimeapi.RuntimeConfig) (err error) {
|
||||
if runtimeConfig == nil {
|
||||
return
|
||||
}
|
||||
@@ -224,16 +224,16 @@ func (ds *dockerService) Start() error {
|
||||
|
||||
// Status returns the status of the runtime.
|
||||
// TODO(random-liu): Set network condition accordingly here.
|
||||
func (ds *dockerService) Status() (*runtimeApi.RuntimeStatus, error) {
|
||||
runtimeReady := &runtimeApi.RuntimeCondition{
|
||||
Type: proto.String(runtimeApi.RuntimeReady),
|
||||
func (ds *dockerService) Status() (*runtimeapi.RuntimeStatus, error) {
|
||||
runtimeReady := &runtimeapi.RuntimeCondition{
|
||||
Type: proto.String(runtimeapi.RuntimeReady),
|
||||
Status: proto.Bool(true),
|
||||
}
|
||||
networkReady := &runtimeApi.RuntimeCondition{
|
||||
Type: proto.String(runtimeApi.NetworkReady),
|
||||
networkReady := &runtimeapi.RuntimeCondition{
|
||||
Type: proto.String(runtimeapi.NetworkReady),
|
||||
Status: proto.Bool(true),
|
||||
}
|
||||
conditions := []*runtimeApi.RuntimeCondition{runtimeReady, networkReady}
|
||||
conditions := []*runtimeapi.RuntimeCondition{runtimeReady, networkReady}
|
||||
if _, err := ds.client.Version(); err != nil {
|
||||
runtimeReady.Status = proto.Bool(false)
|
||||
runtimeReady.Reason = proto.String("DockerDaemonNotReady")
|
||||
@@ -244,7 +244,7 @@ func (ds *dockerService) Status() (*runtimeApi.RuntimeStatus, error) {
|
||||
networkReady.Reason = proto.String("NetworkPluginNotReady")
|
||||
networkReady.Message = proto.String(fmt.Sprintf("docker: network plugin is not ready: %v", err))
|
||||
}
|
||||
return &runtimeApi.RuntimeStatus{Conditions: conditions}, nil
|
||||
return &runtimeapi.RuntimeStatus{Conditions: conditions}, nil
|
||||
}
|
||||
|
||||
func (ds *dockerService) ServeHTTP(w http.ResponseWriter, r *http.Request) {
|
||||
|
@@ -24,7 +24,7 @@ import (
|
||||
"github.com/golang/mock/gomock"
|
||||
"github.com/stretchr/testify/assert"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
containertest "k8s.io/kubernetes/pkg/kubelet/container/testing"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockertools"
|
||||
"k8s.io/kubernetes/pkg/kubelet/network"
|
||||
@@ -48,7 +48,7 @@ func newTestDockerService() (*dockerService, *dockertools.FakeDockerClient, *clo
|
||||
func TestStatus(t *testing.T) {
|
||||
ds, fDocker, _ := newTestDockerService()
|
||||
|
||||
assertStatus := func(expected map[string]bool, status *runtimeApi.RuntimeStatus) {
|
||||
assertStatus := func(expected map[string]bool, status *runtimeapi.RuntimeStatus) {
|
||||
conditions := status.GetConditions()
|
||||
assert.Equal(t, len(expected), len(conditions))
|
||||
for k, v := range expected {
|
||||
@@ -64,8 +64,8 @@ func TestStatus(t *testing.T) {
|
||||
status, err := ds.Status()
|
||||
assert.NoError(t, err)
|
||||
assertStatus(map[string]bool{
|
||||
runtimeApi.RuntimeReady: true,
|
||||
runtimeApi.NetworkReady: true,
|
||||
runtimeapi.RuntimeReady: true,
|
||||
runtimeapi.NetworkReady: true,
|
||||
}, status)
|
||||
|
||||
// Should not report ready status if version returns error.
|
||||
@@ -73,8 +73,8 @@ func TestStatus(t *testing.T) {
|
||||
status, err = ds.Status()
|
||||
assert.NoError(t, err)
|
||||
assertStatus(map[string]bool{
|
||||
runtimeApi.RuntimeReady: false,
|
||||
runtimeApi.NetworkReady: true,
|
||||
runtimeapi.RuntimeReady: false,
|
||||
runtimeapi.NetworkReady: true,
|
||||
}, status)
|
||||
|
||||
// Should not report ready status is network plugin returns error.
|
||||
@@ -85,7 +85,7 @@ func TestStatus(t *testing.T) {
|
||||
status, err = ds.Status()
|
||||
assert.NoError(t, err)
|
||||
assertStatus(map[string]bool{
|
||||
runtimeApi.RuntimeReady: true,
|
||||
runtimeApi.NetworkReady: false,
|
||||
runtimeapi.RuntimeReady: true,
|
||||
runtimeapi.NetworkReady: false,
|
||||
}, status)
|
||||
}
|
||||
|
@@ -29,7 +29,7 @@ import (
|
||||
"github.com/golang/glog"
|
||||
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockertools"
|
||||
"k8s.io/kubernetes/pkg/kubelet/types"
|
||||
)
|
||||
@@ -62,7 +62,7 @@ func (v apiVersion) Compare(other string) (int, error) {
|
||||
|
||||
// generateEnvList converts KeyValue list to a list of strings, in the form of
|
||||
// '<key>=<value>', which can be understood by docker.
|
||||
func generateEnvList(envs []*runtimeApi.KeyValue) (result []string) {
|
||||
func generateEnvList(envs []*runtimeapi.KeyValue) (result []string) {
|
||||
for _, env := range envs {
|
||||
result = append(result, fmt.Sprintf("%s=%s", env.GetKey(), env.GetValue()))
|
||||
}
|
||||
@@ -127,7 +127,7 @@ func extractLabels(input map[string]string) (map[string]string, map[string]strin
|
||||
// '<HostPath>:<ContainerPath>:ro', if the path is read only, or
|
||||
// '<HostPath>:<ContainerPath>:Z', if the volume requires SELinux
|
||||
// relabeling and the pod provides an SELinux label
|
||||
func generateMountBindings(mounts []*runtimeApi.Mount) (result []string) {
|
||||
func generateMountBindings(mounts []*runtimeapi.Mount) (result []string) {
|
||||
for _, m := range mounts {
|
||||
bind := fmt.Sprintf("%s:%s", m.GetHostPath(), m.GetContainerPath())
|
||||
readOnly := m.GetReadonly()
|
||||
@@ -150,7 +150,7 @@ func generateMountBindings(mounts []*runtimeApi.Mount) (result []string) {
|
||||
return
|
||||
}
|
||||
|
||||
func makePortsAndBindings(pm []*runtimeApi.PortMapping) (map[dockernat.Port]struct{}, map[dockernat.Port][]dockernat.PortBinding) {
|
||||
func makePortsAndBindings(pm []*runtimeapi.PortMapping) (map[dockernat.Port]struct{}, map[dockernat.Port][]dockernat.PortBinding) {
|
||||
exposedPorts := map[dockernat.Port]struct{}{}
|
||||
portBindings := map[dockernat.Port][]dockernat.PortBinding{}
|
||||
for _, port := range pm {
|
||||
@@ -198,7 +198,7 @@ func makePortsAndBindings(pm []*runtimeApi.PortMapping) (map[dockernat.Port]stru
|
||||
// getContainerSecurityOpt gets container security options from container and sandbox config, currently from sandbox
|
||||
// annotations.
|
||||
// It is an experimental feature and may be promoted to official runtime api in the future.
|
||||
func getContainerSecurityOpts(containerName string, sandboxConfig *runtimeApi.PodSandboxConfig, seccompProfileRoot string) ([]string, error) {
|
||||
func getContainerSecurityOpts(containerName string, sandboxConfig *runtimeapi.PodSandboxConfig, seccompProfileRoot string) ([]string, error) {
|
||||
appArmorOpts, err := dockertools.GetAppArmorOpts(sandboxConfig.GetAnnotations(), containerName)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
@@ -216,7 +216,7 @@ func getContainerSecurityOpts(containerName string, sandboxConfig *runtimeApi.Po
|
||||
return opts, nil
|
||||
}
|
||||
|
||||
func getSandboxSecurityOpts(sandboxConfig *runtimeApi.PodSandboxConfig, seccompProfileRoot string) ([]string, error) {
|
||||
func getSandboxSecurityOpts(sandboxConfig *runtimeapi.PodSandboxConfig, seccompProfileRoot string) ([]string, error) {
|
||||
// sandboxContainerName doesn't exist in the pod, so pod security options will be returned by default.
|
||||
return getContainerSecurityOpts(sandboxContainerName, sandboxConfig, seccompProfileRoot)
|
||||
}
|
||||
|
@@ -23,7 +23,7 @@ import (
|
||||
"github.com/stretchr/testify/require"
|
||||
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/security/apparmor"
|
||||
)
|
||||
|
||||
@@ -43,13 +43,13 @@ func TestLabelsAndAnnotationsRoundTrip(t *testing.T) {
|
||||
// TODO: Migrate the corresponding test to dockershim.
|
||||
func TestGetContainerSecurityOpts(t *testing.T) {
|
||||
containerName := "bar"
|
||||
makeConfig := func(annotations map[string]string) *runtimeApi.PodSandboxConfig {
|
||||
makeConfig := func(annotations map[string]string) *runtimeapi.PodSandboxConfig {
|
||||
return makeSandboxConfigWithLabelsAndAnnotations("pod", "ns", "1234", 1, nil, annotations)
|
||||
}
|
||||
|
||||
tests := []struct {
|
||||
msg string
|
||||
config *runtimeApi.PodSandboxConfig
|
||||
config *runtimeapi.PodSandboxConfig
|
||||
expectedOpts []string
|
||||
}{{
|
||||
msg: "No security annotations",
|
||||
@@ -106,13 +106,13 @@ func TestGetContainerSecurityOpts(t *testing.T) {
|
||||
|
||||
// TestGetSandboxSecurityOpts tests the logic of generating sandbox security options from sandbox annotations.
|
||||
func TestGetSandboxSecurityOpts(t *testing.T) {
|
||||
makeConfig := func(annotations map[string]string) *runtimeApi.PodSandboxConfig {
|
||||
makeConfig := func(annotations map[string]string) *runtimeapi.PodSandboxConfig {
|
||||
return makeSandboxConfigWithLabelsAndAnnotations("pod", "ns", "1234", 1, nil, annotations)
|
||||
}
|
||||
|
||||
tests := []struct {
|
||||
msg string
|
||||
config *runtimeApi.PodSandboxConfig
|
||||
config *runtimeapi.PodSandboxConfig
|
||||
expectedOpts []string
|
||||
}{{
|
||||
msg: "No security annotations",
|
||||
|
@@ -21,7 +21,7 @@ import (
|
||||
"strconv"
|
||||
"strings"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockertools"
|
||||
"k8s.io/kubernetes/pkg/kubelet/leaky"
|
||||
)
|
||||
@@ -55,7 +55,7 @@ const (
|
||||
DockerPullableImageIDPrefix = dockertools.DockerPullablePrefix
|
||||
)
|
||||
|
||||
func makeSandboxName(s *runtimeApi.PodSandboxConfig) string {
|
||||
func makeSandboxName(s *runtimeapi.PodSandboxConfig) string {
|
||||
return strings.Join([]string{
|
||||
kubePrefix, // 0
|
||||
sandboxContainerName, // 1
|
||||
@@ -66,7 +66,7 @@ func makeSandboxName(s *runtimeApi.PodSandboxConfig) string {
|
||||
}, nameDelimiter)
|
||||
}
|
||||
|
||||
func makeContainerName(s *runtimeApi.PodSandboxConfig, c *runtimeApi.ContainerConfig) string {
|
||||
func makeContainerName(s *runtimeapi.PodSandboxConfig, c *runtimeapi.ContainerConfig) string {
|
||||
return strings.Join([]string{
|
||||
kubePrefix, // 0
|
||||
c.Metadata.GetName(), // 1:
|
||||
@@ -87,7 +87,7 @@ func parseUint32(s string) (uint32, error) {
|
||||
}
|
||||
|
||||
// TODO: Evaluate whether we should rely on labels completely.
|
||||
func parseSandboxName(name string) (*runtimeApi.PodSandboxMetadata, error) {
|
||||
func parseSandboxName(name string) (*runtimeapi.PodSandboxMetadata, error) {
|
||||
// Docker adds a "/" prefix to names. so trim it.
|
||||
name = strings.TrimPrefix(name, "/")
|
||||
|
||||
@@ -104,7 +104,7 @@ func parseSandboxName(name string) (*runtimeApi.PodSandboxMetadata, error) {
|
||||
return nil, fmt.Errorf("failed to parse the sandbox name %q: %v", name, err)
|
||||
}
|
||||
|
||||
return &runtimeApi.PodSandboxMetadata{
|
||||
return &runtimeapi.PodSandboxMetadata{
|
||||
Name: &parts[2],
|
||||
Namespace: &parts[3],
|
||||
Uid: &parts[4],
|
||||
@@ -113,7 +113,7 @@ func parseSandboxName(name string) (*runtimeApi.PodSandboxMetadata, error) {
|
||||
}
|
||||
|
||||
// TODO: Evaluate whether we should rely on labels completely.
|
||||
func parseContainerName(name string) (*runtimeApi.ContainerMetadata, error) {
|
||||
func parseContainerName(name string) (*runtimeapi.ContainerMetadata, error) {
|
||||
// Docker adds a "/" prefix to names. so trim it.
|
||||
name = strings.TrimPrefix(name, "/")
|
||||
|
||||
@@ -130,7 +130,7 @@ func parseContainerName(name string) (*runtimeApi.ContainerMetadata, error) {
|
||||
return nil, fmt.Errorf("failed to parse the container name %q: %v", name, err)
|
||||
}
|
||||
|
||||
return &runtimeApi.ContainerMetadata{
|
||||
return &runtimeapi.ContainerMetadata{
|
||||
Name: &parts[1],
|
||||
Attempt: &attempt,
|
||||
}, nil
|
||||
|
@@ -21,7 +21,7 @@ import (
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
func TestSandboxNameRoundTrip(t *testing.T) {
|
||||
@@ -53,8 +53,8 @@ func TestNonParsableSandboxNames(t *testing.T) {
|
||||
func TestContainerNameRoundTrip(t *testing.T) {
|
||||
sConfig := makeSandboxConfig("foo", "bar", "iamuid", 3)
|
||||
name, attempt := "pause", uint32(5)
|
||||
config := &runtimeApi.ContainerConfig{
|
||||
Metadata: &runtimeApi.ContainerMetadata{
|
||||
config := &runtimeapi.ContainerConfig{
|
||||
Metadata: &runtimeapi.ContainerMetadata{
|
||||
Name: &name,
|
||||
Attempt: &attempt,
|
||||
},
|
||||
|
@@ -25,7 +25,7 @@ import (
|
||||
"github.com/golang/glog"
|
||||
"google.golang.org/grpc"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockershim"
|
||||
"k8s.io/kubernetes/pkg/util/interrupt"
|
||||
)
|
||||
@@ -69,8 +69,8 @@ func (s *DockerServer) Start() error {
|
||||
}
|
||||
// Create the grpc server and register runtime and image services.
|
||||
s.server = grpc.NewServer()
|
||||
runtimeApi.RegisterRuntimeServiceServer(s.server, s.service)
|
||||
runtimeApi.RegisterImageServiceServer(s.server, s.service)
|
||||
runtimeapi.RegisterRuntimeServiceServer(s.server, s.service)
|
||||
runtimeapi.RegisterImageServiceServer(s.server, s.service)
|
||||
go func() {
|
||||
// Use interrupt handler to make sure the server to be stopped properly.
|
||||
h := interrupt.New(nil, s.Stop)
|
||||
|
@@ -21,16 +21,16 @@ import (
|
||||
|
||||
"golang.org/x/net/context"
|
||||
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/dockershim"
|
||||
utilexec "k8s.io/kubernetes/pkg/util/exec"
|
||||
)
|
||||
|
||||
// DockerService is the interface implement CRI remote service server.
|
||||
type DockerService interface {
|
||||
runtimeApi.RuntimeServiceServer
|
||||
runtimeApi.ImageServiceServer
|
||||
runtimeapi.RuntimeServiceServer
|
||||
runtimeapi.ImageServiceServer
|
||||
}
|
||||
|
||||
// dockerService uses dockershim service to implement DockerService.
|
||||
@@ -38,115 +38,115 @@ type DockerService interface {
|
||||
// TODO(random-liu): Change the dockershim service to support context, and implement
|
||||
// internal services and remote services with the dockershim service.
|
||||
type dockerService struct {
|
||||
runtimeService internalApi.RuntimeService
|
||||
imageService internalApi.ImageManagerService
|
||||
runtimeService internalapi.RuntimeService
|
||||
imageService internalapi.ImageManagerService
|
||||
}
|
||||
|
||||
func NewDockerService(s dockershim.DockerService) DockerService {
|
||||
return &dockerService{runtimeService: s, imageService: s}
|
||||
}
|
||||
|
||||
func (d *dockerService) Version(ctx context.Context, r *runtimeApi.VersionRequest) (*runtimeApi.VersionResponse, error) {
|
||||
func (d *dockerService) Version(ctx context.Context, r *runtimeapi.VersionRequest) (*runtimeapi.VersionResponse, error) {
|
||||
return d.runtimeService.Version(r.GetVersion())
|
||||
}
|
||||
|
||||
func (d *dockerService) Status(ctx context.Context, r *runtimeApi.StatusRequest) (*runtimeApi.StatusResponse, error) {
|
||||
func (d *dockerService) Status(ctx context.Context, r *runtimeapi.StatusRequest) (*runtimeapi.StatusResponse, error) {
|
||||
status, err := d.runtimeService.Status()
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.StatusResponse{Status: status}, nil
|
||||
return &runtimeapi.StatusResponse{Status: status}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) RunPodSandbox(ctx context.Context, r *runtimeApi.RunPodSandboxRequest) (*runtimeApi.RunPodSandboxResponse, error) {
|
||||
func (d *dockerService) RunPodSandbox(ctx context.Context, r *runtimeapi.RunPodSandboxRequest) (*runtimeapi.RunPodSandboxResponse, error) {
|
||||
podSandboxId, err := d.runtimeService.RunPodSandbox(r.GetConfig())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.RunPodSandboxResponse{PodSandboxId: &podSandboxId}, nil
|
||||
return &runtimeapi.RunPodSandboxResponse{PodSandboxId: &podSandboxId}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) StopPodSandbox(ctx context.Context, r *runtimeApi.StopPodSandboxRequest) (*runtimeApi.StopPodSandboxResponse, error) {
|
||||
func (d *dockerService) StopPodSandbox(ctx context.Context, r *runtimeapi.StopPodSandboxRequest) (*runtimeapi.StopPodSandboxResponse, error) {
|
||||
err := d.runtimeService.StopPodSandbox(r.GetPodSandboxId())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.StopPodSandboxResponse{}, nil
|
||||
return &runtimeapi.StopPodSandboxResponse{}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) RemovePodSandbox(ctx context.Context, r *runtimeApi.RemovePodSandboxRequest) (*runtimeApi.RemovePodSandboxResponse, error) {
|
||||
func (d *dockerService) RemovePodSandbox(ctx context.Context, r *runtimeapi.RemovePodSandboxRequest) (*runtimeapi.RemovePodSandboxResponse, error) {
|
||||
err := d.runtimeService.RemovePodSandbox(r.GetPodSandboxId())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.RemovePodSandboxResponse{}, nil
|
||||
return &runtimeapi.RemovePodSandboxResponse{}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) PodSandboxStatus(ctx context.Context, r *runtimeApi.PodSandboxStatusRequest) (*runtimeApi.PodSandboxStatusResponse, error) {
|
||||
func (d *dockerService) PodSandboxStatus(ctx context.Context, r *runtimeapi.PodSandboxStatusRequest) (*runtimeapi.PodSandboxStatusResponse, error) {
|
||||
podSandboxStatus, err := d.runtimeService.PodSandboxStatus(r.GetPodSandboxId())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.PodSandboxStatusResponse{Status: podSandboxStatus}, nil
|
||||
return &runtimeapi.PodSandboxStatusResponse{Status: podSandboxStatus}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) ListPodSandbox(ctx context.Context, r *runtimeApi.ListPodSandboxRequest) (*runtimeApi.ListPodSandboxResponse, error) {
|
||||
func (d *dockerService) ListPodSandbox(ctx context.Context, r *runtimeapi.ListPodSandboxRequest) (*runtimeapi.ListPodSandboxResponse, error) {
|
||||
items, err := d.runtimeService.ListPodSandbox(r.GetFilter())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.ListPodSandboxResponse{Items: items}, nil
|
||||
return &runtimeapi.ListPodSandboxResponse{Items: items}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) CreateContainer(ctx context.Context, r *runtimeApi.CreateContainerRequest) (*runtimeApi.CreateContainerResponse, error) {
|
||||
func (d *dockerService) CreateContainer(ctx context.Context, r *runtimeapi.CreateContainerRequest) (*runtimeapi.CreateContainerResponse, error) {
|
||||
containerId, err := d.runtimeService.CreateContainer(r.GetPodSandboxId(), r.GetConfig(), r.GetSandboxConfig())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.CreateContainerResponse{ContainerId: &containerId}, nil
|
||||
return &runtimeapi.CreateContainerResponse{ContainerId: &containerId}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) StartContainer(ctx context.Context, r *runtimeApi.StartContainerRequest) (*runtimeApi.StartContainerResponse, error) {
|
||||
func (d *dockerService) StartContainer(ctx context.Context, r *runtimeapi.StartContainerRequest) (*runtimeapi.StartContainerResponse, error) {
|
||||
err := d.runtimeService.StartContainer(r.GetContainerId())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.StartContainerResponse{}, nil
|
||||
return &runtimeapi.StartContainerResponse{}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) StopContainer(ctx context.Context, r *runtimeApi.StopContainerRequest) (*runtimeApi.StopContainerResponse, error) {
|
||||
func (d *dockerService) StopContainer(ctx context.Context, r *runtimeapi.StopContainerRequest) (*runtimeapi.StopContainerResponse, error) {
|
||||
err := d.runtimeService.StopContainer(r.GetContainerId(), r.GetTimeout())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.StopContainerResponse{}, nil
|
||||
return &runtimeapi.StopContainerResponse{}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) RemoveContainer(ctx context.Context, r *runtimeApi.RemoveContainerRequest) (*runtimeApi.RemoveContainerResponse, error) {
|
||||
func (d *dockerService) RemoveContainer(ctx context.Context, r *runtimeapi.RemoveContainerRequest) (*runtimeapi.RemoveContainerResponse, error) {
|
||||
err := d.runtimeService.RemoveContainer(r.GetContainerId())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.RemoveContainerResponse{}, nil
|
||||
return &runtimeapi.RemoveContainerResponse{}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) ListContainers(ctx context.Context, r *runtimeApi.ListContainersRequest) (*runtimeApi.ListContainersResponse, error) {
|
||||
func (d *dockerService) ListContainers(ctx context.Context, r *runtimeapi.ListContainersRequest) (*runtimeapi.ListContainersResponse, error) {
|
||||
containers, err := d.runtimeService.ListContainers(r.GetFilter())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.ListContainersResponse{Containers: containers}, nil
|
||||
return &runtimeapi.ListContainersResponse{Containers: containers}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) ContainerStatus(ctx context.Context, r *runtimeApi.ContainerStatusRequest) (*runtimeApi.ContainerStatusResponse, error) {
|
||||
func (d *dockerService) ContainerStatus(ctx context.Context, r *runtimeapi.ContainerStatusRequest) (*runtimeapi.ContainerStatusResponse, error) {
|
||||
status, err := d.runtimeService.ContainerStatus(r.GetContainerId())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.ContainerStatusResponse{Status: status}, nil
|
||||
return &runtimeapi.ContainerStatusResponse{Status: status}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) ExecSync(ctx context.Context, r *runtimeApi.ExecSyncRequest) (*runtimeApi.ExecSyncResponse, error) {
|
||||
func (d *dockerService) ExecSync(ctx context.Context, r *runtimeapi.ExecSyncRequest) (*runtimeapi.ExecSyncResponse, error) {
|
||||
stdout, stderr, err := d.runtimeService.ExecSync(r.GetContainerId(), r.GetCmd(), time.Duration(r.GetTimeout())*time.Second)
|
||||
var exitCode int32
|
||||
if err != nil {
|
||||
@@ -156,61 +156,61 @@ func (d *dockerService) ExecSync(ctx context.Context, r *runtimeApi.ExecSyncRequ
|
||||
}
|
||||
exitCode = int32(exitError.ExitStatus())
|
||||
}
|
||||
return &runtimeApi.ExecSyncResponse{
|
||||
return &runtimeapi.ExecSyncResponse{
|
||||
Stdout: stdout,
|
||||
Stderr: stderr,
|
||||
ExitCode: &exitCode,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) Exec(ctx context.Context, r *runtimeApi.ExecRequest) (*runtimeApi.ExecResponse, error) {
|
||||
func (d *dockerService) Exec(ctx context.Context, r *runtimeapi.ExecRequest) (*runtimeapi.ExecResponse, error) {
|
||||
return d.runtimeService.Exec(r)
|
||||
}
|
||||
|
||||
func (d *dockerService) Attach(ctx context.Context, r *runtimeApi.AttachRequest) (*runtimeApi.AttachResponse, error) {
|
||||
func (d *dockerService) Attach(ctx context.Context, r *runtimeapi.AttachRequest) (*runtimeapi.AttachResponse, error) {
|
||||
return d.runtimeService.Attach(r)
|
||||
}
|
||||
|
||||
func (d *dockerService) PortForward(ctx context.Context, r *runtimeApi.PortForwardRequest) (*runtimeApi.PortForwardResponse, error) {
|
||||
func (d *dockerService) PortForward(ctx context.Context, r *runtimeapi.PortForwardRequest) (*runtimeapi.PortForwardResponse, error) {
|
||||
return d.runtimeService.PortForward(r)
|
||||
}
|
||||
|
||||
func (d *dockerService) UpdateRuntimeConfig(ctx context.Context, r *runtimeApi.UpdateRuntimeConfigRequest) (*runtimeApi.UpdateRuntimeConfigResponse, error) {
|
||||
func (d *dockerService) UpdateRuntimeConfig(ctx context.Context, r *runtimeapi.UpdateRuntimeConfigRequest) (*runtimeapi.UpdateRuntimeConfigResponse, error) {
|
||||
err := d.runtimeService.UpdateRuntimeConfig(r.GetRuntimeConfig())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.UpdateRuntimeConfigResponse{}, nil
|
||||
return &runtimeapi.UpdateRuntimeConfigResponse{}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) ListImages(ctx context.Context, r *runtimeApi.ListImagesRequest) (*runtimeApi.ListImagesResponse, error) {
|
||||
func (d *dockerService) ListImages(ctx context.Context, r *runtimeapi.ListImagesRequest) (*runtimeapi.ListImagesResponse, error) {
|
||||
images, err := d.imageService.ListImages(r.GetFilter())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.ListImagesResponse{Images: images}, nil
|
||||
return &runtimeapi.ListImagesResponse{Images: images}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) ImageStatus(ctx context.Context, r *runtimeApi.ImageStatusRequest) (*runtimeApi.ImageStatusResponse, error) {
|
||||
func (d *dockerService) ImageStatus(ctx context.Context, r *runtimeapi.ImageStatusRequest) (*runtimeapi.ImageStatusResponse, error) {
|
||||
image, err := d.imageService.ImageStatus(r.GetImage())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.ImageStatusResponse{Image: image}, nil
|
||||
return &runtimeapi.ImageStatusResponse{Image: image}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) PullImage(ctx context.Context, r *runtimeApi.PullImageRequest) (*runtimeApi.PullImageResponse, error) {
|
||||
func (d *dockerService) PullImage(ctx context.Context, r *runtimeapi.PullImageRequest) (*runtimeapi.PullImageResponse, error) {
|
||||
err := d.imageService.PullImage(r.GetImage(), r.GetAuth())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.PullImageResponse{}, nil
|
||||
return &runtimeapi.PullImageResponse{}, nil
|
||||
}
|
||||
|
||||
func (d *dockerService) RemoveImage(ctx context.Context, r *runtimeApi.RemoveImageRequest) (*runtimeApi.RemoveImageResponse, error) {
|
||||
func (d *dockerService) RemoveImage(ctx context.Context, r *runtimeapi.RemoveImageRequest) (*runtimeapi.RemoveImageResponse, error) {
|
||||
err := d.imageService.RemoveImage(r.GetImage())
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
return &runtimeApi.RemoveImageResponse{}, nil
|
||||
return &runtimeapi.RemoveImageResponse{}, nil
|
||||
}
|
||||
|
@@ -41,7 +41,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/cloudprovider"
|
||||
"k8s.io/kubernetes/pkg/fields"
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
"k8s.io/kubernetes/pkg/kubelet/cadvisor"
|
||||
"k8s.io/kubernetes/pkg/kubelet/cm"
|
||||
"k8s.io/kubernetes/pkg/kubelet/config"
|
||||
@@ -256,7 +256,7 @@ func makePodSourceConfig(kubeCfg *componentconfig.KubeletConfiguration, kubeDeps
|
||||
return cfg, nil
|
||||
}
|
||||
|
||||
func getRuntimeAndImageServices(config *componentconfig.KubeletConfiguration) (internalApi.RuntimeService, internalApi.ImageManagerService, error) {
|
||||
func getRuntimeAndImageServices(config *componentconfig.KubeletConfiguration) (internalapi.RuntimeService, internalapi.ImageManagerService, error) {
|
||||
rs, err := remote.NewRemoteRuntimeService(config.RemoteRuntimeEndpoint, config.RuntimeRequestTimeout.Duration)
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
@@ -529,8 +529,8 @@ func NewMainKubelet(kubeCfg *componentconfig.KubeletConfiguration, kubeDeps *Kub
|
||||
// becomes the default.
|
||||
klet.networkPlugin = nil
|
||||
|
||||
var runtimeService internalApi.RuntimeService
|
||||
var imageService internalApi.ImageManagerService
|
||||
var runtimeService internalapi.RuntimeService
|
||||
var imageService internalapi.ImageManagerService
|
||||
var err error
|
||||
|
||||
switch kubeCfg.ContainerRuntime {
|
||||
@@ -548,8 +548,8 @@ func NewMainKubelet(kubeCfg *componentconfig.KubeletConfiguration, kubeDeps *Kub
|
||||
}
|
||||
|
||||
klet.criHandler = ds
|
||||
rs := ds.(internalApi.RuntimeService)
|
||||
is := ds.(internalApi.ImageManagerService)
|
||||
rs := ds.(internalapi.RuntimeService)
|
||||
is := ds.(internalapi.ImageManagerService)
|
||||
// This is an internal knob to switch between grpc and non-grpc
|
||||
// integration.
|
||||
// TODO: Remove this knob once we switch to using GRPC completely.
|
||||
|
@@ -20,7 +20,7 @@ import (
|
||||
"fmt"
|
||||
"math"
|
||||
"net"
|
||||
goRuntime "runtime"
|
||||
goruntime "runtime"
|
||||
"sort"
|
||||
"strings"
|
||||
"time"
|
||||
@@ -177,8 +177,8 @@ func (kl *Kubelet) initialNode() (*v1.Node, error) {
|
||||
Name: string(kl.nodeName),
|
||||
Labels: map[string]string{
|
||||
unversioned.LabelHostname: kl.hostname,
|
||||
unversioned.LabelOS: goRuntime.GOOS,
|
||||
unversioned.LabelArch: goRuntime.GOARCH,
|
||||
unversioned.LabelOS: goruntime.GOOS,
|
||||
unversioned.LabelArch: goruntime.GOARCH,
|
||||
},
|
||||
},
|
||||
Spec: v1.NodeSpec{
|
||||
@@ -572,8 +572,8 @@ func (kl *Kubelet) setNodeStatusImages(node *v1.Node) {
|
||||
|
||||
// Set the GOOS and GOARCH for this node
|
||||
func (kl *Kubelet) setNodeStatusGoRuntime(node *v1.Node) {
|
||||
node.Status.NodeInfo.OperatingSystem = goRuntime.GOOS
|
||||
node.Status.NodeInfo.Architecture = goRuntime.GOARCH
|
||||
node.Status.NodeInfo.OperatingSystem = goruntime.GOOS
|
||||
node.Status.NodeInfo.Architecture = goruntime.GOARCH
|
||||
}
|
||||
|
||||
// Set status for the node.
|
||||
|
@@ -25,7 +25,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/credentialprovider"
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/kubelet/images"
|
||||
"k8s.io/kubernetes/pkg/kubelet/lifecycle"
|
||||
@@ -91,7 +91,7 @@ func (f *fakePodGetter) GetPodByUID(uid types.UID) (*v1.Pod, bool) {
|
||||
return pod, found
|
||||
}
|
||||
|
||||
func NewFakeKubeRuntimeManager(runtimeService internalApi.RuntimeService, imageService internalApi.ImageManagerService, machineInfo *cadvisorapi.MachineInfo, networkPlugin network.NetworkPlugin, osInterface kubecontainer.OSInterface) (*kubeGenericRuntimeManager, error) {
|
||||
func NewFakeKubeRuntimeManager(runtimeService internalapi.RuntimeService, imageService internalapi.ImageManagerService, machineInfo *cadvisorapi.MachineInfo, networkPlugin network.NetworkPlugin, osInterface kubecontainer.OSInterface) (*kubeGenericRuntimeManager, error) {
|
||||
recorder := &record.FakeRecorder{}
|
||||
kubeRuntimeManager := &kubeGenericRuntimeManager{
|
||||
recorder: recorder,
|
||||
|
@@ -23,7 +23,7 @@ import (
|
||||
|
||||
"github.com/golang/glog"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
)
|
||||
@@ -57,7 +57,7 @@ func (b containersByID) Swap(i, j int) { b[i], b[j] = b[j], b[i] }
|
||||
func (b containersByID) Less(i, j int) bool { return b[i].ID.ID < b[j].ID.ID }
|
||||
|
||||
// Newest first.
|
||||
type podSandboxByCreated []*runtimeApi.PodSandbox
|
||||
type podSandboxByCreated []*runtimeapi.PodSandbox
|
||||
|
||||
func (p podSandboxByCreated) Len() int { return len(p) }
|
||||
func (p podSandboxByCreated) Swap(i, j int) { p[i], p[j] = p[j], p[i] }
|
||||
@@ -69,37 +69,37 @@ func (c containerStatusByCreated) Len() int { return len(c) }
|
||||
func (c containerStatusByCreated) Swap(i, j int) { c[i], c[j] = c[j], c[i] }
|
||||
func (c containerStatusByCreated) Less(i, j int) bool { return c[i].CreatedAt.After(c[j].CreatedAt) }
|
||||
|
||||
// toKubeContainerState converts runtimeApi.ContainerState to kubecontainer.ContainerState.
|
||||
func toKubeContainerState(state runtimeApi.ContainerState) kubecontainer.ContainerState {
|
||||
// toKubeContainerState converts runtimeapi.ContainerState to kubecontainer.ContainerState.
|
||||
func toKubeContainerState(state runtimeapi.ContainerState) kubecontainer.ContainerState {
|
||||
switch state {
|
||||
case runtimeApi.ContainerState_CONTAINER_CREATED:
|
||||
case runtimeapi.ContainerState_CONTAINER_CREATED:
|
||||
return kubecontainer.ContainerStateCreated
|
||||
case runtimeApi.ContainerState_CONTAINER_RUNNING:
|
||||
case runtimeapi.ContainerState_CONTAINER_RUNNING:
|
||||
return kubecontainer.ContainerStateRunning
|
||||
case runtimeApi.ContainerState_CONTAINER_EXITED:
|
||||
case runtimeapi.ContainerState_CONTAINER_EXITED:
|
||||
return kubecontainer.ContainerStateExited
|
||||
case runtimeApi.ContainerState_CONTAINER_UNKNOWN:
|
||||
case runtimeapi.ContainerState_CONTAINER_UNKNOWN:
|
||||
return kubecontainer.ContainerStateUnknown
|
||||
}
|
||||
|
||||
return kubecontainer.ContainerStateUnknown
|
||||
}
|
||||
|
||||
// toRuntimeProtocol converts v1.Protocol to runtimeApi.Protocol.
|
||||
func toRuntimeProtocol(protocol v1.Protocol) runtimeApi.Protocol {
|
||||
// toRuntimeProtocol converts v1.Protocol to runtimeapi.Protocol.
|
||||
func toRuntimeProtocol(protocol v1.Protocol) runtimeapi.Protocol {
|
||||
switch protocol {
|
||||
case v1.ProtocolTCP:
|
||||
return runtimeApi.Protocol_TCP
|
||||
return runtimeapi.Protocol_TCP
|
||||
case v1.ProtocolUDP:
|
||||
return runtimeApi.Protocol_UDP
|
||||
return runtimeapi.Protocol_UDP
|
||||
}
|
||||
|
||||
glog.Warningf("Unknown protocol %q: defaulting to TCP", protocol)
|
||||
return runtimeApi.Protocol_TCP
|
||||
return runtimeapi.Protocol_TCP
|
||||
}
|
||||
|
||||
// toKubeContainer converts runtimeApi.Container to kubecontainer.Container.
|
||||
func (m *kubeGenericRuntimeManager) toKubeContainer(c *runtimeApi.Container) (*kubecontainer.Container, error) {
|
||||
// toKubeContainer converts runtimeapi.Container to kubecontainer.Container.
|
||||
func (m *kubeGenericRuntimeManager) toKubeContainer(c *runtimeapi.Container) (*kubecontainer.Container, error) {
|
||||
if c == nil || c.Id == nil || c.Image == nil || c.State == nil {
|
||||
return nil, fmt.Errorf("unable to convert a nil pointer to a runtime container")
|
||||
}
|
||||
@@ -115,11 +115,11 @@ func (m *kubeGenericRuntimeManager) toKubeContainer(c *runtimeApi.Container) (*k
|
||||
}, nil
|
||||
}
|
||||
|
||||
// sandboxToKubeContainer converts runtimeApi.PodSandbox to kubecontainer.Container.
|
||||
// sandboxToKubeContainer converts runtimeapi.PodSandbox to kubecontainer.Container.
|
||||
// This is only needed because we need to return sandboxes as if they were
|
||||
// kubecontainer.Containers to avoid substantial changes to PLEG.
|
||||
// TODO: Remove this once it becomes obsolete.
|
||||
func (m *kubeGenericRuntimeManager) sandboxToKubeContainer(s *runtimeApi.PodSandbox) (*kubecontainer.Container, error) {
|
||||
func (m *kubeGenericRuntimeManager) sandboxToKubeContainer(s *runtimeapi.PodSandbox) (*kubecontainer.Container, error) {
|
||||
if s == nil || s.Id == nil || s.State == nil {
|
||||
return nil, fmt.Errorf("unable to convert a nil pointer to a runtime container")
|
||||
}
|
||||
@@ -149,7 +149,7 @@ func getContainerSpec(pod *v1.Pod, containerName string) *v1.Container {
|
||||
// getImageUser gets uid or user name that will run the command(s) from image. The function
|
||||
// guarantees that only one of them is set.
|
||||
func (m *kubeGenericRuntimeManager) getImageUser(image string) (*int64, *string, error) {
|
||||
imageStatus, err := m.imageService.ImageStatus(&runtimeApi.ImageSpec{Image: &image})
|
||||
imageStatus, err := m.imageService.ImageStatus(&runtimeapi.ImageSpec{Image: &image})
|
||||
if err != nil {
|
||||
return nil, nil, err
|
||||
}
|
||||
@@ -237,8 +237,8 @@ func buildPodLogsDirectory(podUID types.UID) string {
|
||||
return filepath.Join(podLogsRootDirectory, string(podUID))
|
||||
}
|
||||
|
||||
// toKubeRuntimeStatus converts the runtimeApi.RuntimeStatus to kubecontainer.RuntimeStatus.
|
||||
func toKubeRuntimeStatus(status *runtimeApi.RuntimeStatus) *kubecontainer.RuntimeStatus {
|
||||
// toKubeRuntimeStatus converts the runtimeapi.RuntimeStatus to kubecontainer.RuntimeStatus.
|
||||
func toKubeRuntimeStatus(status *runtimeapi.RuntimeStatus) *kubecontainer.RuntimeStatus {
|
||||
conditions := []kubecontainer.RuntimeCondition{}
|
||||
for _, c := range status.GetConditions() {
|
||||
conditions = append(conditions, kubecontainer.RuntimeCondition{
|
||||
|
@@ -19,30 +19,30 @@ package kuberuntime
|
||||
import (
|
||||
"time"
|
||||
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/metrics"
|
||||
)
|
||||
|
||||
// instrumentedRuntimeService wraps the RuntimeService and records the operations
|
||||
// and errors metrics.
|
||||
type instrumentedRuntimeService struct {
|
||||
service internalApi.RuntimeService
|
||||
service internalapi.RuntimeService
|
||||
}
|
||||
|
||||
// Creates an instrumented RuntimeInterface from an existing RuntimeService.
|
||||
func NewInstrumentedRuntimeService(service internalApi.RuntimeService) internalApi.RuntimeService {
|
||||
func NewInstrumentedRuntimeService(service internalapi.RuntimeService) internalapi.RuntimeService {
|
||||
return &instrumentedRuntimeService{service: service}
|
||||
}
|
||||
|
||||
// instrumentedImageManagerService wraps the ImageManagerService and records the operations
|
||||
// and errors metrics.
|
||||
type instrumentedImageManagerService struct {
|
||||
service internalApi.ImageManagerService
|
||||
service internalapi.ImageManagerService
|
||||
}
|
||||
|
||||
// Creates an instrumented ImageManagerService from an existing ImageManagerService.
|
||||
func NewInstrumentedImageManagerService(service internalApi.ImageManagerService) internalApi.ImageManagerService {
|
||||
func NewInstrumentedImageManagerService(service internalapi.ImageManagerService) internalapi.ImageManagerService {
|
||||
return &instrumentedImageManagerService{service: service}
|
||||
}
|
||||
|
||||
@@ -59,7 +59,7 @@ func recordError(operation string, err error) {
|
||||
}
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) Version(apiVersion string) (*runtimeApi.VersionResponse, error) {
|
||||
func (in instrumentedRuntimeService) Version(apiVersion string) (*runtimeapi.VersionResponse, error) {
|
||||
const operation = "version"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -68,7 +68,7 @@ func (in instrumentedRuntimeService) Version(apiVersion string) (*runtimeApi.Ver
|
||||
return out, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) Status() (*runtimeApi.RuntimeStatus, error) {
|
||||
func (in instrumentedRuntimeService) Status() (*runtimeapi.RuntimeStatus, error) {
|
||||
const operation = "status"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -77,7 +77,7 @@ func (in instrumentedRuntimeService) Status() (*runtimeApi.RuntimeStatus, error)
|
||||
return out, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) CreateContainer(podSandboxID string, config *runtimeApi.ContainerConfig, sandboxConfig *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (in instrumentedRuntimeService) CreateContainer(podSandboxID string, config *runtimeapi.ContainerConfig, sandboxConfig *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
const operation = "create_container"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -113,7 +113,7 @@ func (in instrumentedRuntimeService) RemoveContainer(containerID string) error {
|
||||
return err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) ListContainers(filter *runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error) {
|
||||
func (in instrumentedRuntimeService) ListContainers(filter *runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error) {
|
||||
const operation = "list_containers"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -122,7 +122,7 @@ func (in instrumentedRuntimeService) ListContainers(filter *runtimeApi.Container
|
||||
return out, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) ContainerStatus(containerID string) (*runtimeApi.ContainerStatus, error) {
|
||||
func (in instrumentedRuntimeService) ContainerStatus(containerID string) (*runtimeapi.ContainerStatus, error) {
|
||||
const operation = "container_status"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -140,7 +140,7 @@ func (in instrumentedRuntimeService) ExecSync(containerID string, cmd []string,
|
||||
return stdout, stderr, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) Exec(req *runtimeApi.ExecRequest) (*runtimeApi.ExecResponse, error) {
|
||||
func (in instrumentedRuntimeService) Exec(req *runtimeapi.ExecRequest) (*runtimeapi.ExecResponse, error) {
|
||||
const operation = "exec"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -149,7 +149,7 @@ func (in instrumentedRuntimeService) Exec(req *runtimeApi.ExecRequest) (*runtime
|
||||
return resp, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) Attach(req *runtimeApi.AttachRequest) (*runtimeApi.AttachResponse, error) {
|
||||
func (in instrumentedRuntimeService) Attach(req *runtimeapi.AttachRequest) (*runtimeapi.AttachResponse, error) {
|
||||
const operation = "attach"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -158,7 +158,7 @@ func (in instrumentedRuntimeService) Attach(req *runtimeApi.AttachRequest) (*run
|
||||
return resp, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) RunPodSandbox(config *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (in instrumentedRuntimeService) RunPodSandbox(config *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
const operation = "run_podsandbox"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -185,7 +185,7 @@ func (in instrumentedRuntimeService) RemovePodSandbox(podSandboxID string) error
|
||||
return err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) PodSandboxStatus(podSandboxID string) (*runtimeApi.PodSandboxStatus, error) {
|
||||
func (in instrumentedRuntimeService) PodSandboxStatus(podSandboxID string) (*runtimeapi.PodSandboxStatus, error) {
|
||||
const operation = "podsandbox_status"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -194,7 +194,7 @@ func (in instrumentedRuntimeService) PodSandboxStatus(podSandboxID string) (*run
|
||||
return out, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]*runtimeApi.PodSandbox, error) {
|
||||
func (in instrumentedRuntimeService) ListPodSandbox(filter *runtimeapi.PodSandboxFilter) ([]*runtimeapi.PodSandbox, error) {
|
||||
const operation = "list_podsandbox"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -203,7 +203,7 @@ func (in instrumentedRuntimeService) ListPodSandbox(filter *runtimeApi.PodSandbo
|
||||
return out, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) PortForward(req *runtimeApi.PortForwardRequest) (*runtimeApi.PortForwardResponse, error) {
|
||||
func (in instrumentedRuntimeService) PortForward(req *runtimeapi.PortForwardRequest) (*runtimeapi.PortForwardResponse, error) {
|
||||
const operation = "port_forward"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -212,7 +212,7 @@ func (in instrumentedRuntimeService) PortForward(req *runtimeApi.PortForwardRequ
|
||||
return resp, err
|
||||
}
|
||||
|
||||
func (in instrumentedRuntimeService) UpdateRuntimeConfig(runtimeConfig *runtimeApi.RuntimeConfig) error {
|
||||
func (in instrumentedRuntimeService) UpdateRuntimeConfig(runtimeConfig *runtimeapi.RuntimeConfig) error {
|
||||
const operation = "update_runtime_config"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -221,7 +221,7 @@ func (in instrumentedRuntimeService) UpdateRuntimeConfig(runtimeConfig *runtimeA
|
||||
return err
|
||||
}
|
||||
|
||||
func (in instrumentedImageManagerService) ListImages(filter *runtimeApi.ImageFilter) ([]*runtimeApi.Image, error) {
|
||||
func (in instrumentedImageManagerService) ListImages(filter *runtimeapi.ImageFilter) ([]*runtimeapi.Image, error) {
|
||||
const operation = "list_images"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -230,7 +230,7 @@ func (in instrumentedImageManagerService) ListImages(filter *runtimeApi.ImageFil
|
||||
return out, err
|
||||
}
|
||||
|
||||
func (in instrumentedImageManagerService) ImageStatus(image *runtimeApi.ImageSpec) (*runtimeApi.Image, error) {
|
||||
func (in instrumentedImageManagerService) ImageStatus(image *runtimeapi.ImageSpec) (*runtimeapi.Image, error) {
|
||||
const operation = "image_status"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -239,7 +239,7 @@ func (in instrumentedImageManagerService) ImageStatus(image *runtimeApi.ImageSpe
|
||||
return out, err
|
||||
}
|
||||
|
||||
func (in instrumentedImageManagerService) PullImage(image *runtimeApi.ImageSpec, auth *runtimeApi.AuthConfig) error {
|
||||
func (in instrumentedImageManagerService) PullImage(image *runtimeapi.ImageSpec, auth *runtimeapi.AuthConfig) error {
|
||||
const operation = "pull_image"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
@@ -248,7 +248,7 @@ func (in instrumentedImageManagerService) PullImage(image *runtimeApi.ImageSpec,
|
||||
return err
|
||||
}
|
||||
|
||||
func (in instrumentedImageManagerService) RemoveImage(image *runtimeApi.ImageSpec) error {
|
||||
func (in instrumentedImageManagerService) RemoveImage(image *runtimeapi.ImageSpec) error {
|
||||
const operation = "remove_image"
|
||||
defer recordOperation(operation, time.Now())
|
||||
|
||||
|
@@ -31,7 +31,7 @@ import (
|
||||
"github.com/golang/glog"
|
||||
"k8s.io/kubernetes/pkg/api/unversioned"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/kubelet/events"
|
||||
"k8s.io/kubernetes/pkg/kubelet/qos"
|
||||
@@ -49,7 +49,7 @@ import (
|
||||
// * create the container
|
||||
// * start the container
|
||||
// * run the post start lifecycle hooks (if applicable)
|
||||
func (m *kubeGenericRuntimeManager) startContainer(podSandboxID string, podSandboxConfig *runtimeApi.PodSandboxConfig, container *v1.Container, pod *v1.Pod, podStatus *kubecontainer.PodStatus, pullSecrets []v1.Secret, podIP string) (string, error) {
|
||||
func (m *kubeGenericRuntimeManager) startContainer(podSandboxID string, podSandboxConfig *runtimeapi.PodSandboxConfig, container *v1.Container, pod *v1.Pod, podStatus *kubecontainer.PodStatus, pullSecrets []v1.Secret, podIP string) (string, error) {
|
||||
// Step 1: pull the image.
|
||||
err, msg := m.imagePuller.EnsureImageExists(pod, container, pullSecrets)
|
||||
if err != nil {
|
||||
@@ -129,7 +129,7 @@ func (m *kubeGenericRuntimeManager) startContainer(podSandboxID string, podSandb
|
||||
}
|
||||
|
||||
// generateContainerConfig generates container config for kubelet runtime v1.
|
||||
func (m *kubeGenericRuntimeManager) generateContainerConfig(container *v1.Container, pod *v1.Pod, restartCount int, podIP string) (*runtimeApi.ContainerConfig, error) {
|
||||
func (m *kubeGenericRuntimeManager) generateContainerConfig(container *v1.Container, pod *v1.Pod, restartCount int, podIP string) (*runtimeapi.ContainerConfig, error) {
|
||||
opts, err := m.runtimeHelper.GenerateRunContainerOptions(pod, container, podIP)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
@@ -151,12 +151,12 @@ func (m *kubeGenericRuntimeManager) generateContainerConfig(container *v1.Contai
|
||||
command, args := kubecontainer.ExpandContainerCommandAndArgs(container, opts.Envs)
|
||||
containerLogsPath := buildContainerLogsPath(container.Name, restartCount)
|
||||
restartCountUint32 := uint32(restartCount)
|
||||
config := &runtimeApi.ContainerConfig{
|
||||
Metadata: &runtimeApi.ContainerMetadata{
|
||||
config := &runtimeapi.ContainerConfig{
|
||||
Metadata: &runtimeapi.ContainerMetadata{
|
||||
Name: &container.Name,
|
||||
Attempt: &restartCountUint32,
|
||||
},
|
||||
Image: &runtimeApi.ImageSpec{Image: &container.Image},
|
||||
Image: &runtimeapi.ImageSpec{Image: &container.Image},
|
||||
Command: command,
|
||||
Args: args,
|
||||
WorkingDir: &container.WorkingDir,
|
||||
@@ -172,10 +172,10 @@ func (m *kubeGenericRuntimeManager) generateContainerConfig(container *v1.Contai
|
||||
}
|
||||
|
||||
// set environment variables
|
||||
envs := make([]*runtimeApi.KeyValue, len(opts.Envs))
|
||||
envs := make([]*runtimeapi.KeyValue, len(opts.Envs))
|
||||
for idx := range opts.Envs {
|
||||
e := opts.Envs[idx]
|
||||
envs[idx] = &runtimeApi.KeyValue{
|
||||
envs[idx] = &runtimeapi.KeyValue{
|
||||
Key: &e.Name,
|
||||
Value: &e.Value,
|
||||
}
|
||||
@@ -186,9 +186,9 @@ func (m *kubeGenericRuntimeManager) generateContainerConfig(container *v1.Contai
|
||||
}
|
||||
|
||||
// generateLinuxContainerConfig generates linux container config for kubelet runtime v1.
|
||||
func (m *kubeGenericRuntimeManager) generateLinuxContainerConfig(container *v1.Container, pod *v1.Pod, uid *int64, username *string) *runtimeApi.LinuxContainerConfig {
|
||||
lc := &runtimeApi.LinuxContainerConfig{
|
||||
Resources: &runtimeApi.LinuxContainerResources{},
|
||||
func (m *kubeGenericRuntimeManager) generateLinuxContainerConfig(container *v1.Container, pod *v1.Pod, uid *int64, username *string) *runtimeapi.LinuxContainerConfig {
|
||||
lc := &runtimeapi.LinuxContainerConfig{
|
||||
Resources: &runtimeapi.LinuxContainerResources{},
|
||||
SecurityContext: m.determineEffectiveSecurityContext(pod, container, uid, username),
|
||||
}
|
||||
|
||||
@@ -229,12 +229,12 @@ func (m *kubeGenericRuntimeManager) generateLinuxContainerConfig(container *v1.C
|
||||
}
|
||||
|
||||
// makeDevices generates container devices for kubelet runtime v1.
|
||||
func makeDevices(opts *kubecontainer.RunContainerOptions) []*runtimeApi.Device {
|
||||
devices := make([]*runtimeApi.Device, len(opts.Devices))
|
||||
func makeDevices(opts *kubecontainer.RunContainerOptions) []*runtimeapi.Device {
|
||||
devices := make([]*runtimeapi.Device, len(opts.Devices))
|
||||
|
||||
for idx := range opts.Devices {
|
||||
device := opts.Devices[idx]
|
||||
devices[idx] = &runtimeApi.Device{
|
||||
devices[idx] = &runtimeapi.Device{
|
||||
HostPath: &device.PathOnHost,
|
||||
ContainerPath: &device.PathInContainer,
|
||||
Permissions: &device.Permissions,
|
||||
@@ -245,13 +245,13 @@ func makeDevices(opts *kubecontainer.RunContainerOptions) []*runtimeApi.Device {
|
||||
}
|
||||
|
||||
// makeMounts generates container volume mounts for kubelet runtime v1.
|
||||
func (m *kubeGenericRuntimeManager) makeMounts(opts *kubecontainer.RunContainerOptions, container *v1.Container) []*runtimeApi.Mount {
|
||||
volumeMounts := []*runtimeApi.Mount{}
|
||||
func (m *kubeGenericRuntimeManager) makeMounts(opts *kubecontainer.RunContainerOptions, container *v1.Container) []*runtimeapi.Mount {
|
||||
volumeMounts := []*runtimeapi.Mount{}
|
||||
|
||||
for idx := range opts.Mounts {
|
||||
v := opts.Mounts[idx]
|
||||
selinuxRelabel := v.SELinuxRelabel && selinux.SELinuxEnabled()
|
||||
mount := &runtimeApi.Mount{
|
||||
mount := &runtimeapi.Mount{
|
||||
HostPath: &v.HostPath,
|
||||
ContainerPath: &v.ContainerPath,
|
||||
Readonly: &v.ReadOnly,
|
||||
@@ -276,7 +276,7 @@ func (m *kubeGenericRuntimeManager) makeMounts(opts *kubecontainer.RunContainerO
|
||||
} else {
|
||||
fs.Close()
|
||||
selinuxRelabel := selinux.SELinuxEnabled()
|
||||
volumeMounts = append(volumeMounts, &runtimeApi.Mount{
|
||||
volumeMounts = append(volumeMounts, &runtimeapi.Mount{
|
||||
HostPath: &containerLogPath,
|
||||
ContainerPath: &container.TerminationMessagePath,
|
||||
SelinuxRelabel: &selinuxRelabel,
|
||||
@@ -290,12 +290,12 @@ func (m *kubeGenericRuntimeManager) makeMounts(opts *kubecontainer.RunContainerO
|
||||
// getKubeletContainers lists containers managed by kubelet.
|
||||
// The boolean parameter specifies whether returns all containers including
|
||||
// those already exited and dead containers (used for garbage collection).
|
||||
func (m *kubeGenericRuntimeManager) getKubeletContainers(allContainers bool) ([]*runtimeApi.Container, error) {
|
||||
filter := &runtimeApi.ContainerFilter{
|
||||
func (m *kubeGenericRuntimeManager) getKubeletContainers(allContainers bool) ([]*runtimeapi.Container, error) {
|
||||
filter := &runtimeapi.ContainerFilter{
|
||||
LabelSelector: map[string]string{kubernetesManagedLabel: "true"},
|
||||
}
|
||||
if !allContainers {
|
||||
runningState := runtimeApi.ContainerState_CONTAINER_RUNNING
|
||||
runningState := runtimeapi.ContainerState_CONTAINER_RUNNING
|
||||
filter.State = &runningState
|
||||
}
|
||||
|
||||
@@ -309,7 +309,7 @@ func (m *kubeGenericRuntimeManager) getKubeletContainers(allContainers bool) ([]
|
||||
}
|
||||
|
||||
// getContainers lists containers by filter.
|
||||
func (m *kubeGenericRuntimeManager) getContainersHelper(filter *runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error) {
|
||||
func (m *kubeGenericRuntimeManager) getContainersHelper(filter *runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error) {
|
||||
resp, err := m.runtimeService.ListContainers(filter)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
@@ -324,7 +324,7 @@ func makeUID() string {
|
||||
}
|
||||
|
||||
// getTerminationMessage gets termination message of the container.
|
||||
func getTerminationMessage(status *runtimeApi.ContainerStatus, kubeStatus *kubecontainer.ContainerStatus, terminationMessagePath string) string {
|
||||
func getTerminationMessage(status *runtimeapi.ContainerStatus, kubeStatus *kubecontainer.ContainerStatus, terminationMessagePath string) string {
|
||||
message := ""
|
||||
|
||||
if !kubeStatus.FinishedAt.IsZero() || kubeStatus.ExitCode != 0 {
|
||||
@@ -351,7 +351,7 @@ func getTerminationMessage(status *runtimeApi.ContainerStatus, kubeStatus *kubec
|
||||
// getPodContainerStatuses gets all containers' statuses for the pod.
|
||||
func (m *kubeGenericRuntimeManager) getPodContainerStatuses(uid kubetypes.UID, name, namespace string) ([]*kubecontainer.ContainerStatus, error) {
|
||||
// Select all containers of the given pod.
|
||||
containers, err := m.runtimeService.ListContainers(&runtimeApi.ContainerFilter{
|
||||
containers, err := m.runtimeService.ListContainers(&runtimeapi.ContainerFilter{
|
||||
LabelSelector: map[string]string{types.KubernetesPodUIDLabel: string(uid)},
|
||||
})
|
||||
if err != nil {
|
||||
@@ -384,7 +384,7 @@ func (m *kubeGenericRuntimeManager) getPodContainerStatuses(uid kubetypes.UID, n
|
||||
CreatedAt: time.Unix(0, status.GetCreatedAt()),
|
||||
}
|
||||
|
||||
if c.GetState() == runtimeApi.ContainerState_CONTAINER_RUNNING {
|
||||
if c.GetState() == runtimeapi.ContainerState_CONTAINER_RUNNING {
|
||||
cStatus.StartedAt = time.Unix(0, status.GetStartedAt())
|
||||
} else {
|
||||
cStatus.Reason = status.GetReason()
|
||||
@@ -669,7 +669,7 @@ func (m *kubeGenericRuntimeManager) GetContainerLogs(pod *v1.Pod, containerID ku
|
||||
|
||||
// GetExec gets the endpoint the runtime will serve the exec request from.
|
||||
func (m *kubeGenericRuntimeManager) GetExec(id kubecontainer.ContainerID, cmd []string, stdin, stdout, stderr, tty bool) (*url.URL, error) {
|
||||
req := &runtimeApi.ExecRequest{
|
||||
req := &runtimeapi.ExecRequest{
|
||||
ContainerId: &id.ID,
|
||||
Cmd: cmd,
|
||||
Tty: &tty,
|
||||
@@ -685,7 +685,7 @@ func (m *kubeGenericRuntimeManager) GetExec(id kubecontainer.ContainerID, cmd []
|
||||
|
||||
// GetAttach gets the endpoint the runtime will serve the attach request from.
|
||||
func (m *kubeGenericRuntimeManager) GetAttach(id kubecontainer.ContainerID, stdin, stdout, stderr bool) (*url.URL, error) {
|
||||
req := &runtimeApi.AttachRequest{
|
||||
req := &runtimeapi.AttachRequest{
|
||||
ContainerId: &id.ID,
|
||||
Stdin: &stdin,
|
||||
}
|
||||
|
@@ -22,7 +22,7 @@ import (
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
containertest "k8s.io/kubernetes/pkg/kubelet/container/testing"
|
||||
)
|
||||
|
||||
@@ -60,7 +60,7 @@ func TestRemoveContainer(t *testing.T) {
|
||||
assert.Equal(t, fakeOS.Removes, []string{expectedContainerLogPath, expectedContainerLogSymlink})
|
||||
// Verify container is removed
|
||||
fakeRuntime.AssertCalls([]string{"RemoveContainer"})
|
||||
containers, err := fakeRuntime.ListContainers(&runtimeApi.ContainerFilter{Id: &containerId})
|
||||
containers, err := fakeRuntime.ListContainers(&runtimeapi.ContainerFilter{Id: &containerId})
|
||||
assert.NoError(t, err)
|
||||
assert.Empty(t, containers)
|
||||
}
|
||||
|
@@ -24,8 +24,8 @@ import (
|
||||
"time"
|
||||
|
||||
"github.com/golang/glog"
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/types"
|
||||
)
|
||||
@@ -46,13 +46,13 @@ const sandboxMinGCAge time.Duration = 30 * time.Second
|
||||
|
||||
// containerGC is the manager of garbage collection.
|
||||
type containerGC struct {
|
||||
client internalApi.RuntimeService
|
||||
client internalapi.RuntimeService
|
||||
manager *kubeGenericRuntimeManager
|
||||
podGetter podGetter
|
||||
}
|
||||
|
||||
// NewContainerGC creates a new containerGC.
|
||||
func NewContainerGC(client internalApi.RuntimeService, podGetter podGetter, manager *kubeGenericRuntimeManager) *containerGC {
|
||||
func NewContainerGC(client internalapi.RuntimeService, podGetter podGetter, manager *kubeGenericRuntimeManager) *containerGC {
|
||||
return &containerGC{
|
||||
client: client,
|
||||
manager: manager,
|
||||
@@ -161,7 +161,7 @@ func (cgc *containerGC) evictableContainers(minAge time.Duration) (containersByE
|
||||
newestGCTime := time.Now().Add(-minAge)
|
||||
for _, container := range containers {
|
||||
// Prune out running containers.
|
||||
if container.GetState() == runtimeApi.ContainerState_CONTAINER_RUNNING {
|
||||
if container.GetState() == runtimeapi.ContainerState_CONTAINER_RUNNING {
|
||||
continue
|
||||
}
|
||||
|
||||
@@ -256,7 +256,7 @@ func (cgc *containerGC) evictSandboxes(minAge time.Duration) error {
|
||||
newestGCTime := time.Now().Add(-minAge)
|
||||
for _, sandbox := range sandboxes {
|
||||
// Prune out ready sandboxes.
|
||||
if sandbox.GetState() == runtimeApi.PodSandboxState_SANDBOX_READY {
|
||||
if sandbox.GetState() == runtimeapi.PodSandboxState_SANDBOX_READY {
|
||||
continue
|
||||
}
|
||||
|
||||
|
@@ -25,7 +25,7 @@ import (
|
||||
"github.com/golang/mock/gomock"
|
||||
"github.com/stretchr/testify/assert"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
containertest "k8s.io/kubernetes/pkg/kubelet/container/testing"
|
||||
)
|
||||
@@ -54,7 +54,7 @@ func TestSandboxGC(t *testing.T) {
|
||||
{
|
||||
description: "sandbox with no containers should be garbage collected.",
|
||||
sandboxes: []sandboxTemplate{
|
||||
{pod: pods[0], state: runtimeApi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
{pod: pods[0], state: runtimeapi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
},
|
||||
containers: []containerTemplate{},
|
||||
remain: []int{},
|
||||
@@ -62,7 +62,7 @@ func TestSandboxGC(t *testing.T) {
|
||||
{
|
||||
description: "running sandbox should not be garbage collected.",
|
||||
sandboxes: []sandboxTemplate{
|
||||
{pod: pods[0], state: runtimeApi.PodSandboxState_SANDBOX_READY},
|
||||
{pod: pods[0], state: runtimeapi.PodSandboxState_SANDBOX_READY},
|
||||
},
|
||||
containers: []containerTemplate{},
|
||||
remain: []int{0},
|
||||
@@ -70,18 +70,18 @@ func TestSandboxGC(t *testing.T) {
|
||||
{
|
||||
description: "sandbox with containers should not be garbage collected.",
|
||||
sandboxes: []sandboxTemplate{
|
||||
{pod: pods[0], state: runtimeApi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
{pod: pods[0], state: runtimeapi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
},
|
||||
containers: []containerTemplate{
|
||||
{pod: pods[0], container: &pods[0].Spec.Containers[0], state: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pods[0], container: &pods[0].Spec.Containers[0], state: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
},
|
||||
remain: []int{0},
|
||||
},
|
||||
{
|
||||
description: "sandbox within min age should not be garbage collected.",
|
||||
sandboxes: []sandboxTemplate{
|
||||
{pod: pods[0], createdAt: time.Now().UnixNano(), state: runtimeApi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
{pod: pods[1], createdAt: time.Now().Add(-2 * time.Hour).UnixNano(), state: runtimeApi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
{pod: pods[0], createdAt: time.Now().UnixNano(), state: runtimeapi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
{pod: pods[1], createdAt: time.Now().Add(-2 * time.Hour).UnixNano(), state: runtimeapi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
},
|
||||
containers: []containerTemplate{},
|
||||
minAge: time.Hour, // assume the test won't take an hour
|
||||
@@ -91,14 +91,14 @@ func TestSandboxGC(t *testing.T) {
|
||||
description: "multiple sandboxes should be handled properly.",
|
||||
sandboxes: []sandboxTemplate{
|
||||
// running sandbox.
|
||||
{pod: pods[0], attempt: 1, state: runtimeApi.PodSandboxState_SANDBOX_READY},
|
||||
{pod: pods[0], attempt: 1, state: runtimeapi.PodSandboxState_SANDBOX_READY},
|
||||
// exited sandbox with containers.
|
||||
{pod: pods[1], attempt: 1, state: runtimeApi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
{pod: pods[1], attempt: 1, state: runtimeapi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
// exited sandbox without containers.
|
||||
{pod: pods[1], attempt: 0, state: runtimeApi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
{pod: pods[1], attempt: 0, state: runtimeapi.PodSandboxState_SANDBOX_NOTREADY},
|
||||
},
|
||||
containers: []containerTemplate{
|
||||
{pod: pods[1], container: &pods[1].Spec.Containers[0], sandboxAttempt: 1, state: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pods[1], container: &pods[1].Spec.Containers[0], sandboxAttempt: 1, state: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
},
|
||||
remain: []int{0, 1},
|
||||
},
|
||||
@@ -127,7 +127,7 @@ func TestContainerGC(t *testing.T) {
|
||||
assert.NoError(t, err)
|
||||
|
||||
fakePodGetter := m.containerGC.podGetter.(*fakePodGetter)
|
||||
makeGCContainer := func(podName, containerName string, attempt int, createdAt int64, state runtimeApi.ContainerState) containerTemplate {
|
||||
makeGCContainer := func(podName, containerName string, attempt int, createdAt int64, state runtimeapi.ContainerState) containerTemplate {
|
||||
container := makeTestContainer(containerName, "test-image")
|
||||
pod := makeTestPod(podName, "test-ns", podName, []v1.Container{container})
|
||||
if podName != "deleted" {
|
||||
@@ -153,7 +153,7 @@ func TestContainerGC(t *testing.T) {
|
||||
{
|
||||
description: "all containers should be removed when max container limit is 0",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
policy: &kubecontainer.ContainerGCPolicy{MinAge: time.Minute, MaxPerPodContainer: 1, MaxContainers: 0},
|
||||
remain: []int{},
|
||||
@@ -161,11 +161,11 @@ func TestContainerGC(t *testing.T) {
|
||||
{
|
||||
description: "max containers should be complied when no max per pod container limit is set",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 4, 4, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 3, 3, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 4, 4, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 3, 3, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
policy: &kubecontainer.ContainerGCPolicy{MinAge: time.Minute, MaxPerPodContainer: -1, MaxContainers: 4},
|
||||
remain: []int{0, 1, 2, 3},
|
||||
@@ -173,9 +173,9 @@ func TestContainerGC(t *testing.T) {
|
||||
{
|
||||
description: "no containers should be removed if both max container and per pod container limits are not set",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
policy: &kubecontainer.ContainerGCPolicy{MinAge: time.Minute, MaxPerPodContainer: -1, MaxContainers: -1},
|
||||
remain: []int{0, 1, 2},
|
||||
@@ -183,94 +183,94 @@ func TestContainerGC(t *testing.T) {
|
||||
{
|
||||
description: "recently started containers should not be removed",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 2, time.Now().UnixNano(), runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, time.Now().UnixNano(), runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, time.Now().UnixNano(), runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 2, time.Now().UnixNano(), runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, time.Now().UnixNano(), runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, time.Now().UnixNano(), runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
remain: []int{0, 1, 2},
|
||||
},
|
||||
{
|
||||
description: "oldest containers should be removed when per pod container limit exceeded",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
remain: []int{0, 1},
|
||||
},
|
||||
{
|
||||
description: "running containers should not be removed",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_RUNNING),
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_RUNNING),
|
||||
},
|
||||
remain: []int{0, 1, 2},
|
||||
},
|
||||
{
|
||||
description: "no containers should be removed when limits are not exceeded",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
remain: []int{0, 1},
|
||||
},
|
||||
{
|
||||
description: "max container count should apply per (UID, container) pair",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "baz", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "baz", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "baz", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "baz", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "baz", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "baz", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
remain: []int{0, 1, 3, 4, 6, 7},
|
||||
},
|
||||
{
|
||||
description: "max limit should apply and try to keep from every pod",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar2", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar2", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo3", "bar3", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo3", "bar3", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo4", "bar4", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo4", "bar4", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar2", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar2", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo3", "bar3", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo3", "bar3", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo4", "bar4", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo4", "bar4", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
remain: []int{0, 2, 4, 6, 8},
|
||||
},
|
||||
{
|
||||
description: "oldest pods should be removed if limit exceeded",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar2", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo3", "bar3", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo4", "bar4", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo5", "bar5", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo6", "bar6", 2, 2, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo7", "bar7", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo1", "bar1", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo2", "bar2", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo3", "bar3", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo4", "bar4", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo5", "bar5", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo6", "bar6", 2, 2, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo7", "bar7", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
remain: []int{0, 2, 4, 6, 8, 9},
|
||||
},
|
||||
{
|
||||
description: "containers for deleted pods should be removed",
|
||||
containers: []containerTemplate{
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("foo", "bar", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
// deleted pods still respect MinAge.
|
||||
makeGCContainer("deleted", "bar1", 2, time.Now().UnixNano(), runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("deleted", "bar1", 1, 1, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("deleted", "bar1", 0, 0, runtimeApi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("deleted", "bar1", 2, time.Now().UnixNano(), runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("deleted", "bar1", 1, 1, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
makeGCContainer("deleted", "bar1", 0, 0, runtimeapi.ContainerState_CONTAINER_EXITED),
|
||||
},
|
||||
remain: []int{0, 1, 2},
|
||||
},
|
||||
|
@@ -20,7 +20,7 @@ import (
|
||||
"github.com/golang/glog"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/credentialprovider"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
utilerrors "k8s.io/kubernetes/pkg/util/errors"
|
||||
"k8s.io/kubernetes/pkg/util/parsers"
|
||||
@@ -40,7 +40,7 @@ func (m *kubeGenericRuntimeManager) PullImage(image kubecontainer.ImageSpec, pul
|
||||
return err
|
||||
}
|
||||
|
||||
imgSpec := &runtimeApi.ImageSpec{Image: &img}
|
||||
imgSpec := &runtimeapi.ImageSpec{Image: &img}
|
||||
creds, withCredentials := keyring.Lookup(repoToPull)
|
||||
if !withCredentials {
|
||||
glog.V(3).Infof("Pulling image %q without credentials", img)
|
||||
@@ -57,7 +57,7 @@ func (m *kubeGenericRuntimeManager) PullImage(image kubecontainer.ImageSpec, pul
|
||||
var pullErrs []error
|
||||
for _, currentCreds := range creds {
|
||||
authConfig := credentialprovider.LazyProvide(currentCreds)
|
||||
auth := &runtimeApi.AuthConfig{
|
||||
auth := &runtimeapi.AuthConfig{
|
||||
Username: &authConfig.Username,
|
||||
Password: &authConfig.Password,
|
||||
Auth: &authConfig.Auth,
|
||||
@@ -80,7 +80,7 @@ func (m *kubeGenericRuntimeManager) PullImage(image kubecontainer.ImageSpec, pul
|
||||
|
||||
// IsImagePresent checks whether the container image is already in the local storage.
|
||||
func (m *kubeGenericRuntimeManager) IsImagePresent(image kubecontainer.ImageSpec) (bool, error) {
|
||||
status, err := m.imageService.ImageStatus(&runtimeApi.ImageSpec{Image: &image.Image})
|
||||
status, err := m.imageService.ImageStatus(&runtimeapi.ImageSpec{Image: &image.Image})
|
||||
if err != nil {
|
||||
glog.Errorf("ImageStatus for image %q failed: %v", image, err)
|
||||
return false, err
|
||||
@@ -112,7 +112,7 @@ func (m *kubeGenericRuntimeManager) ListImages() ([]kubecontainer.Image, error)
|
||||
|
||||
// RemoveImage removes the specified image.
|
||||
func (m *kubeGenericRuntimeManager) RemoveImage(image kubecontainer.ImageSpec) error {
|
||||
err := m.imageService.RemoveImage(&runtimeApi.ImageSpec{Image: &image.Image})
|
||||
err := m.imageService.RemoveImage(&runtimeapi.ImageSpec{Image: &image.Image})
|
||||
if err != nil {
|
||||
glog.Errorf("Remove image %q failed: %v", image.Image, err)
|
||||
return err
|
||||
|
@@ -29,8 +29,8 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/client/record"
|
||||
"k8s.io/kubernetes/pkg/credentialprovider"
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/kubelet/events"
|
||||
"k8s.io/kubernetes/pkg/kubelet/images"
|
||||
@@ -101,8 +101,8 @@ type kubeGenericRuntimeManager struct {
|
||||
imagePuller images.ImageManager
|
||||
|
||||
// gRPC service clients
|
||||
runtimeService internalApi.RuntimeService
|
||||
imageService internalApi.ImageManagerService
|
||||
runtimeService internalapi.RuntimeService
|
||||
imageService internalapi.ImageManagerService
|
||||
|
||||
// The version cache of runtime daemon.
|
||||
versionCache *cache.ObjectCache
|
||||
@@ -130,8 +130,8 @@ func NewKubeGenericRuntimeManager(
|
||||
imagePullQPS float32,
|
||||
imagePullBurst int,
|
||||
cpuCFSQuota bool,
|
||||
runtimeService internalApi.RuntimeService,
|
||||
imageService internalApi.ImageManagerService,
|
||||
runtimeService internalapi.RuntimeService,
|
||||
imageService internalapi.ImageManagerService,
|
||||
) (KubeGenericRuntime, error) {
|
||||
kubeRuntimeManager := &kubeGenericRuntimeManager{
|
||||
recorder: recorder,
|
||||
@@ -231,7 +231,7 @@ func (r runtimeVersion) Compare(other string) (int, error) {
|
||||
return 0, nil
|
||||
}
|
||||
|
||||
func (m *kubeGenericRuntimeManager) getTypedVersion() (*runtimeApi.VersionResponse, error) {
|
||||
func (m *kubeGenericRuntimeManager) getTypedVersion() (*runtimeapi.VersionResponse, error) {
|
||||
typedVersion, err := m.runtimeService.Version(kubeRuntimeAPIVersion)
|
||||
if err != nil {
|
||||
glog.Errorf("Get remote runtime typed version failed: %v", err)
|
||||
@@ -259,7 +259,7 @@ func (m *kubeGenericRuntimeManager) APIVersion() (kubecontainer.Version, error)
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
typedVersion := versionObject.(*runtimeApi.VersionResponse)
|
||||
typedVersion := versionObject.(*runtimeapi.VersionResponse)
|
||||
|
||||
return newRuntimeVersion(typedVersion.GetRuntimeApiVersion())
|
||||
}
|
||||
@@ -396,14 +396,14 @@ func (m *kubeGenericRuntimeManager) podSandboxChanged(pod *v1.Pod, podStatus *ku
|
||||
|
||||
readySandboxCount := 0
|
||||
for _, s := range podStatus.SandboxStatuses {
|
||||
if s.GetState() == runtimeApi.PodSandboxState_SANDBOX_READY {
|
||||
if s.GetState() == runtimeapi.PodSandboxState_SANDBOX_READY {
|
||||
readySandboxCount++
|
||||
}
|
||||
}
|
||||
|
||||
// Needs to create a new sandbox when readySandboxCount > 1 or the ready sandbox is not the latest one.
|
||||
sandboxStatus := podStatus.SandboxStatuses[0]
|
||||
if readySandboxCount > 1 || sandboxStatus.GetState() != runtimeApi.PodSandboxState_SANDBOX_READY {
|
||||
if readySandboxCount > 1 || sandboxStatus.GetState() != runtimeapi.PodSandboxState_SANDBOX_READY {
|
||||
glog.V(2).Infof("No ready sandbox for pod %q can be found. Need to start a new one", format.Pod(pod))
|
||||
return true, sandboxStatus.Metadata.GetAttempt() + 1, sandboxStatus.GetId()
|
||||
}
|
||||
@@ -857,7 +857,7 @@ func (m *kubeGenericRuntimeManager) GetPodStatus(uid kubetypes.UID, name, namesp
|
||||
})
|
||||
glog.V(4).Infof("getSandboxIDByPodUID got sandbox IDs %q for pod %q", podSandboxIDs, podFullName)
|
||||
|
||||
sandboxStatuses := make([]*runtimeApi.PodSandboxStatus, len(podSandboxIDs))
|
||||
sandboxStatuses := make([]*runtimeapi.PodSandboxStatus, len(podSandboxIDs))
|
||||
podIP := ""
|
||||
for idx, podSandboxID := range podSandboxIDs {
|
||||
podSandboxStatus, err := m.runtimeService.PodSandboxStatus(podSandboxID)
|
||||
@@ -868,7 +868,7 @@ func (m *kubeGenericRuntimeManager) GetPodStatus(uid kubetypes.UID, name, namesp
|
||||
sandboxStatuses[idx] = podSandboxStatus
|
||||
|
||||
// Only get pod IP from latest sandbox
|
||||
if idx == 0 && podSandboxStatus.GetState() == runtimeApi.PodSandboxState_SANDBOX_READY {
|
||||
if idx == 0 && podSandboxStatus.GetState() == runtimeapi.PodSandboxState_SANDBOX_READY {
|
||||
podIP = m.determinePodSandboxIP(namespace, name, podSandboxStatus)
|
||||
}
|
||||
}
|
||||
@@ -922,8 +922,8 @@ func (m *kubeGenericRuntimeManager) UpdatePodCIDR(podCIDR string) error {
|
||||
// field of the config?
|
||||
glog.Infof("updating runtime config through cri with podcidr %v", podCIDR)
|
||||
return m.runtimeService.UpdateRuntimeConfig(
|
||||
&runtimeApi.RuntimeConfig{
|
||||
NetworkConfig: &runtimeApi.NetworkConfig{
|
||||
&runtimeapi.RuntimeConfig{
|
||||
NetworkConfig: &runtimeapi.NetworkConfig{
|
||||
PodCidr: &podCIDR,
|
||||
},
|
||||
})
|
||||
|
@@ -27,7 +27,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
"k8s.io/kubernetes/pkg/apis/componentconfig"
|
||||
apitest "k8s.io/kubernetes/pkg/kubelet/api/testing"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
containertest "k8s.io/kubernetes/pkg/kubelet/container/testing"
|
||||
"k8s.io/kubernetes/pkg/kubelet/network"
|
||||
@@ -66,7 +66,7 @@ type sandboxTemplate struct {
|
||||
pod *v1.Pod
|
||||
attempt uint32
|
||||
createdAt int64
|
||||
state runtimeApi.PodSandboxState
|
||||
state runtimeapi.PodSandboxState
|
||||
}
|
||||
|
||||
// containerTemplate is a container template to create fake container.
|
||||
@@ -76,7 +76,7 @@ type containerTemplate struct {
|
||||
sandboxAttempt uint32
|
||||
attempt int
|
||||
createdAt int64
|
||||
state runtimeApi.ContainerState
|
||||
state runtimeapi.ContainerState
|
||||
}
|
||||
|
||||
// makeAndSetFakePod is a helper function to create and set one fake sandbox for a pod and
|
||||
@@ -86,7 +86,7 @@ func makeAndSetFakePod(t *testing.T, m *kubeGenericRuntimeManager, fakeRuntime *
|
||||
sandbox := makeFakePodSandbox(t, m, sandboxTemplate{
|
||||
pod: pod,
|
||||
createdAt: fakeCreatedAt,
|
||||
state: runtimeApi.PodSandboxState_SANDBOX_READY,
|
||||
state: runtimeapi.PodSandboxState_SANDBOX_READY,
|
||||
})
|
||||
|
||||
var containers []*apitest.FakeContainer
|
||||
@@ -95,7 +95,7 @@ func makeAndSetFakePod(t *testing.T, m *kubeGenericRuntimeManager, fakeRuntime *
|
||||
pod: pod,
|
||||
container: c,
|
||||
createdAt: fakeCreatedAt,
|
||||
state: runtimeApi.ContainerState_CONTAINER_RUNNING,
|
||||
state: runtimeapi.ContainerState_CONTAINER_RUNNING,
|
||||
}
|
||||
}
|
||||
for i := range pod.Spec.Containers {
|
||||
@@ -117,12 +117,12 @@ func makeFakePodSandbox(t *testing.T, m *kubeGenericRuntimeManager, template san
|
||||
|
||||
podSandboxID := apitest.BuildSandboxName(config.Metadata)
|
||||
return &apitest.FakePodSandbox{
|
||||
PodSandboxStatus: runtimeApi.PodSandboxStatus{
|
||||
PodSandboxStatus: runtimeapi.PodSandboxStatus{
|
||||
Id: &podSandboxID,
|
||||
Metadata: config.Metadata,
|
||||
State: &template.state,
|
||||
CreatedAt: &template.createdAt,
|
||||
Network: &runtimeApi.PodSandboxNetworkStatus{
|
||||
Network: &runtimeapi.PodSandboxNetworkStatus{
|
||||
Ip: &apitest.FakePodSandboxIP,
|
||||
},
|
||||
Labels: config.Labels,
|
||||
@@ -152,7 +152,7 @@ func makeFakeContainer(t *testing.T, m *kubeGenericRuntimeManager, template cont
|
||||
containerID := apitest.BuildContainerName(containerConfig.Metadata, podSandboxID)
|
||||
imageRef := containerConfig.Image.GetImage()
|
||||
return &apitest.FakeContainer{
|
||||
ContainerStatus: runtimeApi.ContainerStatus{
|
||||
ContainerStatus: runtimeapi.ContainerStatus{
|
||||
Id: &containerID,
|
||||
Metadata: containerConfig.Metadata,
|
||||
Image: containerConfig.Image,
|
||||
@@ -321,7 +321,7 @@ func TestGetPods(t *testing.T) {
|
||||
containers := make([]*kubecontainer.Container, len(fakeContainers))
|
||||
for i := range containers {
|
||||
fakeContainer := fakeContainers[i]
|
||||
c, err := m.toKubeContainer(&runtimeApi.Container{
|
||||
c, err := m.toKubeContainer(&runtimeapi.Container{
|
||||
Id: fakeContainer.Id,
|
||||
Metadata: fakeContainer.Metadata,
|
||||
State: fakeContainer.State,
|
||||
@@ -336,7 +336,7 @@ func TestGetPods(t *testing.T) {
|
||||
containers[i] = c
|
||||
}
|
||||
// Convert fakeSandbox to kubecontainer.Container
|
||||
sandbox, err := m.sandboxToKubeContainer(&runtimeApi.PodSandbox{
|
||||
sandbox, err := m.sandboxToKubeContainer(&runtimeapi.PodSandbox{
|
||||
Id: fakeSandbox.Id,
|
||||
Metadata: fakeSandbox.Metadata,
|
||||
State: fakeSandbox.State,
|
||||
@@ -393,7 +393,7 @@ func TestGetPodContainerID(t *testing.T) {
|
||||
fakeSandbox, _ := makeAndSetFakePod(t, m, fakeRuntime, pod)
|
||||
|
||||
// Convert fakeSandbox to kubecontainer.Container
|
||||
sandbox, err := m.sandboxToKubeContainer(&runtimeApi.PodSandbox{
|
||||
sandbox, err := m.sandboxToKubeContainer(&runtimeapi.PodSandbox{
|
||||
Id: fakeSandbox.Id,
|
||||
Metadata: fakeSandbox.Metadata,
|
||||
State: fakeSandbox.State,
|
||||
@@ -476,7 +476,7 @@ func TestKillPod(t *testing.T) {
|
||||
containers := make([]*kubecontainer.Container, len(fakeContainers))
|
||||
for i := range containers {
|
||||
fakeContainer := fakeContainers[i]
|
||||
c, err := m.toKubeContainer(&runtimeApi.Container{
|
||||
c, err := m.toKubeContainer(&runtimeapi.Container{
|
||||
Id: fakeContainer.Id,
|
||||
Metadata: fakeContainer.Metadata,
|
||||
State: fakeContainer.State,
|
||||
@@ -509,10 +509,10 @@ func TestKillPod(t *testing.T) {
|
||||
assert.Equal(t, 2, len(fakeRuntime.Containers))
|
||||
assert.Equal(t, 1, len(fakeRuntime.Sandboxes))
|
||||
for _, sandbox := range fakeRuntime.Sandboxes {
|
||||
assert.Equal(t, runtimeApi.PodSandboxState_SANDBOX_NOTREADY, sandbox.GetState())
|
||||
assert.Equal(t, runtimeapi.PodSandboxState_SANDBOX_NOTREADY, sandbox.GetState())
|
||||
}
|
||||
for _, c := range fakeRuntime.Containers {
|
||||
assert.Equal(t, runtimeApi.ContainerState_CONTAINER_EXITED, c.GetState())
|
||||
assert.Equal(t, runtimeapi.ContainerState_CONTAINER_EXITED, c.GetState())
|
||||
}
|
||||
}
|
||||
|
||||
@@ -550,10 +550,10 @@ func TestSyncPod(t *testing.T) {
|
||||
assert.Equal(t, 2, len(fakeImage.Images))
|
||||
assert.Equal(t, 1, len(fakeRuntime.Sandboxes))
|
||||
for _, sandbox := range fakeRuntime.Sandboxes {
|
||||
assert.Equal(t, runtimeApi.PodSandboxState_SANDBOX_READY, sandbox.GetState())
|
||||
assert.Equal(t, runtimeapi.PodSandboxState_SANDBOX_READY, sandbox.GetState())
|
||||
}
|
||||
for _, c := range fakeRuntime.Containers {
|
||||
assert.Equal(t, runtimeApi.ContainerState_CONTAINER_RUNNING, c.GetState())
|
||||
assert.Equal(t, runtimeapi.ContainerState_CONTAINER_RUNNING, c.GetState())
|
||||
}
|
||||
}
|
||||
|
||||
@@ -575,11 +575,11 @@ func TestPruneInitContainers(t *testing.T) {
|
||||
}
|
||||
|
||||
templates := []containerTemplate{
|
||||
{pod: pod, container: &init1, attempt: 2, createdAt: 2, state: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init1, attempt: 1, createdAt: 1, state: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init2, attempt: 1, createdAt: 1, state: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init2, attempt: 0, createdAt: 0, state: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init1, attempt: 0, createdAt: 0, state: runtimeApi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init1, attempt: 2, createdAt: 2, state: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init1, attempt: 1, createdAt: 1, state: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init2, attempt: 1, createdAt: 1, state: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init2, attempt: 0, createdAt: 0, state: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
{pod: pod, container: &init1, attempt: 0, createdAt: 0, state: runtimeapi.ContainerState_CONTAINER_EXITED},
|
||||
}
|
||||
fakes := makeFakeContainers(t, m, templates)
|
||||
fakeRuntime.SetFakeContainers(fakes)
|
||||
@@ -633,12 +633,12 @@ func TestSyncPodWithInitContainers(t *testing.T) {
|
||||
// and container with default attempt number 0.
|
||||
buildContainerID := func(pod *v1.Pod, container v1.Container) string {
|
||||
uid := string(pod.UID)
|
||||
sandboxID := apitest.BuildSandboxName(&runtimeApi.PodSandboxMetadata{
|
||||
sandboxID := apitest.BuildSandboxName(&runtimeapi.PodSandboxMetadata{
|
||||
Name: &pod.Name,
|
||||
Uid: &uid,
|
||||
Namespace: &pod.Namespace,
|
||||
})
|
||||
return apitest.BuildContainerName(&runtimeApi.ContainerMetadata{Name: &container.Name}, sandboxID)
|
||||
return apitest.BuildContainerName(&runtimeapi.ContainerMetadata{Name: &container.Name}, sandboxID)
|
||||
}
|
||||
|
||||
backOff := flowcontrol.NewBackOff(time.Second, time.Minute)
|
||||
|
@@ -24,7 +24,7 @@ import (
|
||||
|
||||
"github.com/golang/glog"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubecontainer "k8s.io/kubernetes/pkg/kubelet/container"
|
||||
"k8s.io/kubernetes/pkg/kubelet/types"
|
||||
"k8s.io/kubernetes/pkg/kubelet/util/format"
|
||||
@@ -59,12 +59,12 @@ func (m *kubeGenericRuntimeManager) createPodSandbox(pod *v1.Pod, attempt uint32
|
||||
}
|
||||
|
||||
// generatePodSandboxConfig generates pod sandbox config from v1.Pod.
|
||||
func (m *kubeGenericRuntimeManager) generatePodSandboxConfig(pod *v1.Pod, attempt uint32) (*runtimeApi.PodSandboxConfig, error) {
|
||||
func (m *kubeGenericRuntimeManager) generatePodSandboxConfig(pod *v1.Pod, attempt uint32) (*runtimeapi.PodSandboxConfig, error) {
|
||||
// TODO: deprecating podsandbox resource requirements in favor of the pod level cgroup
|
||||
// Refer https://github.com/kubernetes/kubernetes/issues/29871
|
||||
podUID := string(pod.UID)
|
||||
podSandboxConfig := &runtimeApi.PodSandboxConfig{
|
||||
Metadata: &runtimeApi.PodSandboxMetadata{
|
||||
podSandboxConfig := &runtimeapi.PodSandboxConfig{
|
||||
Metadata: &runtimeapi.PodSandboxMetadata{
|
||||
Name: &pod.Name,
|
||||
Namespace: &pod.Namespace,
|
||||
Uid: &podUID,
|
||||
@@ -79,7 +79,7 @@ func (m *kubeGenericRuntimeManager) generatePodSandboxConfig(pod *v1.Pod, attemp
|
||||
if err != nil {
|
||||
return nil, err
|
||||
}
|
||||
podSandboxConfig.DnsConfig = &runtimeApi.DNSConfig{
|
||||
podSandboxConfig.DnsConfig = &runtimeapi.DNSConfig{
|
||||
Servers: dnsServers,
|
||||
Searches: dnsSearches,
|
||||
Options: defaultDNSOptions,
|
||||
@@ -96,7 +96,7 @@ func (m *kubeGenericRuntimeManager) generatePodSandboxConfig(pod *v1.Pod, attemp
|
||||
podSandboxConfig.LogDirectory = &logDir
|
||||
|
||||
cgroupParent := ""
|
||||
portMappings := []*runtimeApi.PortMapping{}
|
||||
portMappings := []*runtimeapi.PortMapping{}
|
||||
for _, c := range pod.Spec.Containers {
|
||||
// TODO: use a separate interface to only generate portmappings
|
||||
opts, err := m.runtimeHelper.GenerateRunContainerOptions(pod, &c, "")
|
||||
@@ -109,7 +109,7 @@ func (m *kubeGenericRuntimeManager) generatePodSandboxConfig(pod *v1.Pod, attemp
|
||||
hostPort := int32(port.HostPort)
|
||||
containerPort := int32(port.ContainerPort)
|
||||
protocol := toRuntimeProtocol(port.Protocol)
|
||||
portMappings = append(portMappings, &runtimeApi.PortMapping{
|
||||
portMappings = append(portMappings, &runtimeapi.PortMapping{
|
||||
HostIp: &port.HostIP,
|
||||
HostPort: &hostPort,
|
||||
ContainerPort: &containerPort,
|
||||
@@ -129,19 +129,19 @@ func (m *kubeGenericRuntimeManager) generatePodSandboxConfig(pod *v1.Pod, attemp
|
||||
}
|
||||
|
||||
// generatePodSandboxLinuxConfig generates LinuxPodSandboxConfig from v1.Pod.
|
||||
func (m *kubeGenericRuntimeManager) generatePodSandboxLinuxConfig(pod *v1.Pod, cgroupParent string) *runtimeApi.LinuxPodSandboxConfig {
|
||||
func (m *kubeGenericRuntimeManager) generatePodSandboxLinuxConfig(pod *v1.Pod, cgroupParent string) *runtimeapi.LinuxPodSandboxConfig {
|
||||
if pod.Spec.SecurityContext == nil && cgroupParent == "" {
|
||||
return nil
|
||||
}
|
||||
|
||||
lc := &runtimeApi.LinuxPodSandboxConfig{}
|
||||
lc := &runtimeapi.LinuxPodSandboxConfig{}
|
||||
if cgroupParent != "" {
|
||||
lc.CgroupParent = &cgroupParent
|
||||
}
|
||||
if pod.Spec.SecurityContext != nil {
|
||||
sc := pod.Spec.SecurityContext
|
||||
lc.SecurityContext = &runtimeApi.LinuxSandboxSecurityContext{
|
||||
NamespaceOptions: &runtimeApi.NamespaceOption{
|
||||
lc.SecurityContext = &runtimeapi.LinuxSandboxSecurityContext{
|
||||
NamespaceOptions: &runtimeapi.NamespaceOption{
|
||||
HostNetwork: &pod.Spec.HostNetwork,
|
||||
HostIpc: &pod.Spec.HostIPC,
|
||||
HostPid: &pod.Spec.HostPID,
|
||||
@@ -159,7 +159,7 @@ func (m *kubeGenericRuntimeManager) generatePodSandboxLinuxConfig(pod *v1.Pod, c
|
||||
lc.SecurityContext.SupplementalGroups = append(lc.SecurityContext.SupplementalGroups, sc.SupplementalGroups...)
|
||||
}
|
||||
if sc.SELinuxOptions != nil {
|
||||
lc.SecurityContext.SelinuxOptions = &runtimeApi.SELinuxOption{
|
||||
lc.SecurityContext.SelinuxOptions = &runtimeapi.SELinuxOption{
|
||||
User: &sc.SELinuxOptions.User,
|
||||
Role: &sc.SELinuxOptions.Role,
|
||||
Type: &sc.SELinuxOptions.Type,
|
||||
@@ -172,11 +172,11 @@ func (m *kubeGenericRuntimeManager) generatePodSandboxLinuxConfig(pod *v1.Pod, c
|
||||
}
|
||||
|
||||
// getKubeletSandboxes lists all (or just the running) sandboxes managed by kubelet.
|
||||
func (m *kubeGenericRuntimeManager) getKubeletSandboxes(all bool) ([]*runtimeApi.PodSandbox, error) {
|
||||
var filter *runtimeApi.PodSandboxFilter
|
||||
func (m *kubeGenericRuntimeManager) getKubeletSandboxes(all bool) ([]*runtimeapi.PodSandbox, error) {
|
||||
var filter *runtimeapi.PodSandboxFilter
|
||||
if !all {
|
||||
readyState := runtimeApi.PodSandboxState_SANDBOX_READY
|
||||
filter = &runtimeApi.PodSandboxFilter{
|
||||
readyState := runtimeapi.PodSandboxState_SANDBOX_READY
|
||||
filter = &runtimeapi.PodSandboxFilter{
|
||||
State: &readyState,
|
||||
}
|
||||
}
|
||||
@@ -187,7 +187,7 @@ func (m *kubeGenericRuntimeManager) getKubeletSandboxes(all bool) ([]*runtimeApi
|
||||
return nil, err
|
||||
}
|
||||
|
||||
result := []*runtimeApi.PodSandbox{}
|
||||
result := []*runtimeapi.PodSandbox{}
|
||||
for _, s := range resp {
|
||||
if !isManagedByKubelet(s.Labels) {
|
||||
glog.V(5).Infof("Sandbox %s is not managed by kubelet", kubecontainer.BuildPodFullName(
|
||||
@@ -202,7 +202,7 @@ func (m *kubeGenericRuntimeManager) getKubeletSandboxes(all bool) ([]*runtimeApi
|
||||
}
|
||||
|
||||
// determinePodSandboxIP determines the IP address of the given pod sandbox.
|
||||
func (m *kubeGenericRuntimeManager) determinePodSandboxIP(podNamespace, podName string, podSandbox *runtimeApi.PodSandboxStatus) string {
|
||||
func (m *kubeGenericRuntimeManager) determinePodSandboxIP(podNamespace, podName string, podSandbox *runtimeapi.PodSandboxStatus) string {
|
||||
if podSandbox.Network == nil {
|
||||
glog.Warningf("Pod Sandbox status doesn't have network information, cannot report IP")
|
||||
return ""
|
||||
@@ -217,8 +217,8 @@ func (m *kubeGenericRuntimeManager) determinePodSandboxIP(podNamespace, podName
|
||||
|
||||
// getPodSandboxID gets the sandbox id by podUID and returns ([]sandboxID, error).
|
||||
// Param state could be nil in order to get all sandboxes belonging to same pod.
|
||||
func (m *kubeGenericRuntimeManager) getSandboxIDByPodUID(podUID kubetypes.UID, state *runtimeApi.PodSandboxState) ([]string, error) {
|
||||
filter := &runtimeApi.PodSandboxFilter{
|
||||
func (m *kubeGenericRuntimeManager) getSandboxIDByPodUID(podUID kubetypes.UID, state *runtimeapi.PodSandboxState) ([]string, error) {
|
||||
filter := &runtimeapi.PodSandboxFilter{
|
||||
State: state,
|
||||
LabelSelector: map[string]string{types.KubernetesPodUIDLabel: string(podUID)},
|
||||
}
|
||||
@@ -252,7 +252,7 @@ func (m *kubeGenericRuntimeManager) GetPortForward(podName, podNamespace string,
|
||||
return nil, fmt.Errorf("failed to find sandboxID for pod %s", format.PodDesc(podName, podNamespace, podUID))
|
||||
}
|
||||
// TODO: Port is unused for now, but we may need it in the future.
|
||||
req := &runtimeApi.PortForwardRequest{
|
||||
req := &runtimeapi.PortForwardRequest{
|
||||
PodSandboxId: &sandboxIDs[0],
|
||||
}
|
||||
resp, err := m.runtimeService.PortForward(req)
|
||||
|
@@ -23,7 +23,7 @@ import (
|
||||
|
||||
"github.com/stretchr/testify/assert"
|
||||
"k8s.io/kubernetes/pkg/api/v1"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
containertest "k8s.io/kubernetes/pkg/kubelet/container/testing"
|
||||
)
|
||||
|
||||
@@ -57,7 +57,7 @@ func TestCreatePodSandbox(t *testing.T) {
|
||||
id, _, err := m.createPodSandbox(pod, 1)
|
||||
assert.NoError(t, err)
|
||||
fakeRuntime.AssertCalls([]string{"RunPodSandbox"})
|
||||
sandboxes, err := fakeRuntime.ListPodSandbox(&runtimeApi.PodSandboxFilter{Id: &id})
|
||||
sandboxes, err := fakeRuntime.ListPodSandbox(&runtimeapi.PodSandboxFilter{Id: &id})
|
||||
assert.NoError(t, err)
|
||||
assert.Equal(t, len(sandboxes), 1)
|
||||
// TODO Check pod sandbox configuration
|
||||
|
@@ -14,6 +14,6 @@ See the License for the specific language governing permissions and
|
||||
limitations under the License.
|
||||
*/
|
||||
|
||||
// Package remote containers gRPC implementation of internalApi.RuntimeService
|
||||
// and internalApi.ImageManagerService.
|
||||
// Package remote containers gRPC implementation of internalapi.RuntimeService
|
||||
// and internalapi.ImageManagerService.
|
||||
package remote
|
||||
|
@@ -21,18 +21,18 @@ import (
|
||||
|
||||
"github.com/golang/glog"
|
||||
"google.golang.org/grpc"
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
// RemoteImageService is a gRPC implementation of internalApi.ImageManagerService.
|
||||
// RemoteImageService is a gRPC implementation of internalapi.ImageManagerService.
|
||||
type RemoteImageService struct {
|
||||
timeout time.Duration
|
||||
imageClient runtimeApi.ImageServiceClient
|
||||
imageClient runtimeapi.ImageServiceClient
|
||||
}
|
||||
|
||||
// NewRemoteImageService creates a new internalApi.ImageManagerService.
|
||||
func NewRemoteImageService(addr string, connectionTimout time.Duration) (internalApi.ImageManagerService, error) {
|
||||
// NewRemoteImageService creates a new internalapi.ImageManagerService.
|
||||
func NewRemoteImageService(addr string, connectionTimout time.Duration) (internalapi.ImageManagerService, error) {
|
||||
glog.V(3).Infof("Connecting to image service %s", addr)
|
||||
conn, err := grpc.Dial(addr, grpc.WithInsecure(), grpc.WithTimeout(connectionTimout), grpc.WithDialer(dial))
|
||||
if err != nil {
|
||||
@@ -42,16 +42,16 @@ func NewRemoteImageService(addr string, connectionTimout time.Duration) (interna
|
||||
|
||||
return &RemoteImageService{
|
||||
timeout: connectionTimout,
|
||||
imageClient: runtimeApi.NewImageServiceClient(conn),
|
||||
imageClient: runtimeapi.NewImageServiceClient(conn),
|
||||
}, nil
|
||||
}
|
||||
|
||||
// ListImages lists available images.
|
||||
func (r *RemoteImageService) ListImages(filter *runtimeApi.ImageFilter) ([]*runtimeApi.Image, error) {
|
||||
func (r *RemoteImageService) ListImages(filter *runtimeapi.ImageFilter) ([]*runtimeapi.Image, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.imageClient.ListImages(ctx, &runtimeApi.ListImagesRequest{
|
||||
resp, err := r.imageClient.ListImages(ctx, &runtimeapi.ListImagesRequest{
|
||||
Filter: filter,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -63,11 +63,11 @@ func (r *RemoteImageService) ListImages(filter *runtimeApi.ImageFilter) ([]*runt
|
||||
}
|
||||
|
||||
// ImageStatus returns the status of the image.
|
||||
func (r *RemoteImageService) ImageStatus(image *runtimeApi.ImageSpec) (*runtimeApi.Image, error) {
|
||||
func (r *RemoteImageService) ImageStatus(image *runtimeapi.ImageSpec) (*runtimeapi.Image, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.imageClient.ImageStatus(ctx, &runtimeApi.ImageStatusRequest{
|
||||
resp, err := r.imageClient.ImageStatus(ctx, &runtimeapi.ImageStatusRequest{
|
||||
Image: image,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -79,11 +79,11 @@ func (r *RemoteImageService) ImageStatus(image *runtimeApi.ImageSpec) (*runtimeA
|
||||
}
|
||||
|
||||
// PullImage pulls an image with authentication config.
|
||||
func (r *RemoteImageService) PullImage(image *runtimeApi.ImageSpec, auth *runtimeApi.AuthConfig) error {
|
||||
func (r *RemoteImageService) PullImage(image *runtimeapi.ImageSpec, auth *runtimeapi.AuthConfig) error {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
_, err := r.imageClient.PullImage(ctx, &runtimeApi.PullImageRequest{
|
||||
_, err := r.imageClient.PullImage(ctx, &runtimeapi.PullImageRequest{
|
||||
Image: image,
|
||||
Auth: auth,
|
||||
})
|
||||
@@ -96,11 +96,11 @@ func (r *RemoteImageService) PullImage(image *runtimeApi.ImageSpec, auth *runtim
|
||||
}
|
||||
|
||||
// RemoveImage removes the image.
|
||||
func (r *RemoteImageService) RemoveImage(image *runtimeApi.ImageSpec) error {
|
||||
func (r *RemoteImageService) RemoveImage(image *runtimeapi.ImageSpec) error {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
_, err := r.imageClient.RemoveImage(ctx, &runtimeApi.RemoveImageRequest{
|
||||
_, err := r.imageClient.RemoveImage(ctx, &runtimeapi.RemoveImageRequest{
|
||||
Image: image,
|
||||
})
|
||||
if err != nil {
|
||||
|
@@ -23,19 +23,19 @@ import (
|
||||
|
||||
"github.com/golang/glog"
|
||||
"google.golang.org/grpc"
|
||||
internalApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
internalapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
utilexec "k8s.io/kubernetes/pkg/util/exec"
|
||||
)
|
||||
|
||||
// RemoteRuntimeService is a gRPC implementation of internalApi.RuntimeService.
|
||||
// RemoteRuntimeService is a gRPC implementation of internalapi.RuntimeService.
|
||||
type RemoteRuntimeService struct {
|
||||
timeout time.Duration
|
||||
runtimeClient runtimeApi.RuntimeServiceClient
|
||||
runtimeClient runtimeapi.RuntimeServiceClient
|
||||
}
|
||||
|
||||
// NewRemoteRuntimeService creates a new internalApi.RuntimeService.
|
||||
func NewRemoteRuntimeService(addr string, connectionTimout time.Duration) (internalApi.RuntimeService, error) {
|
||||
// NewRemoteRuntimeService creates a new internalapi.RuntimeService.
|
||||
func NewRemoteRuntimeService(addr string, connectionTimout time.Duration) (internalapi.RuntimeService, error) {
|
||||
glog.Infof("Connecting to runtime service %s", addr)
|
||||
conn, err := grpc.Dial(addr, grpc.WithInsecure(), grpc.WithTimeout(connectionTimout), grpc.WithDialer(dial))
|
||||
if err != nil {
|
||||
@@ -45,16 +45,16 @@ func NewRemoteRuntimeService(addr string, connectionTimout time.Duration) (inter
|
||||
|
||||
return &RemoteRuntimeService{
|
||||
timeout: connectionTimout,
|
||||
runtimeClient: runtimeApi.NewRuntimeServiceClient(conn),
|
||||
runtimeClient: runtimeapi.NewRuntimeServiceClient(conn),
|
||||
}, nil
|
||||
}
|
||||
|
||||
// Version returns the runtime name, runtime version and runtime API version.
|
||||
func (r *RemoteRuntimeService) Version(apiVersion string) (*runtimeApi.VersionResponse, error) {
|
||||
func (r *RemoteRuntimeService) Version(apiVersion string) (*runtimeapi.VersionResponse, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
typedVersion, err := r.runtimeClient.Version(ctx, &runtimeApi.VersionRequest{
|
||||
typedVersion, err := r.runtimeClient.Version(ctx, &runtimeapi.VersionRequest{
|
||||
Version: &apiVersion,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -67,11 +67,11 @@ func (r *RemoteRuntimeService) Version(apiVersion string) (*runtimeApi.VersionRe
|
||||
|
||||
// RunPodSandbox creates and starts a pod-level sandbox. Runtimes should ensure
|
||||
// the sandbox is in ready state.
|
||||
func (r *RemoteRuntimeService) RunPodSandbox(config *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (r *RemoteRuntimeService) RunPodSandbox(config *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.runtimeClient.RunPodSandbox(ctx, &runtimeApi.RunPodSandboxRequest{
|
||||
resp, err := r.runtimeClient.RunPodSandbox(ctx, &runtimeapi.RunPodSandboxRequest{
|
||||
Config: config,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -88,7 +88,7 @@ func (r *RemoteRuntimeService) StopPodSandbox(podSandBoxID string) error {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
_, err := r.runtimeClient.StopPodSandbox(ctx, &runtimeApi.StopPodSandboxRequest{
|
||||
_, err := r.runtimeClient.StopPodSandbox(ctx, &runtimeapi.StopPodSandboxRequest{
|
||||
PodSandboxId: &podSandBoxID,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -105,7 +105,7 @@ func (r *RemoteRuntimeService) RemovePodSandbox(podSandBoxID string) error {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
_, err := r.runtimeClient.RemovePodSandbox(ctx, &runtimeApi.RemovePodSandboxRequest{
|
||||
_, err := r.runtimeClient.RemovePodSandbox(ctx, &runtimeapi.RemovePodSandboxRequest{
|
||||
PodSandboxId: &podSandBoxID,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -117,11 +117,11 @@ func (r *RemoteRuntimeService) RemovePodSandbox(podSandBoxID string) error {
|
||||
}
|
||||
|
||||
// PodSandboxStatus returns the status of the PodSandbox.
|
||||
func (r *RemoteRuntimeService) PodSandboxStatus(podSandBoxID string) (*runtimeApi.PodSandboxStatus, error) {
|
||||
func (r *RemoteRuntimeService) PodSandboxStatus(podSandBoxID string) (*runtimeapi.PodSandboxStatus, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.runtimeClient.PodSandboxStatus(ctx, &runtimeApi.PodSandboxStatusRequest{
|
||||
resp, err := r.runtimeClient.PodSandboxStatus(ctx, &runtimeapi.PodSandboxStatusRequest{
|
||||
PodSandboxId: &podSandBoxID,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -133,11 +133,11 @@ func (r *RemoteRuntimeService) PodSandboxStatus(podSandBoxID string) (*runtimeAp
|
||||
}
|
||||
|
||||
// ListPodSandbox returns a list of PodSandboxes.
|
||||
func (r *RemoteRuntimeService) ListPodSandbox(filter *runtimeApi.PodSandboxFilter) ([]*runtimeApi.PodSandbox, error) {
|
||||
func (r *RemoteRuntimeService) ListPodSandbox(filter *runtimeapi.PodSandboxFilter) ([]*runtimeapi.PodSandbox, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.runtimeClient.ListPodSandbox(ctx, &runtimeApi.ListPodSandboxRequest{
|
||||
resp, err := r.runtimeClient.ListPodSandbox(ctx, &runtimeapi.ListPodSandboxRequest{
|
||||
Filter: filter,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -149,11 +149,11 @@ func (r *RemoteRuntimeService) ListPodSandbox(filter *runtimeApi.PodSandboxFilte
|
||||
}
|
||||
|
||||
// CreateContainer creates a new container in the specified PodSandbox.
|
||||
func (r *RemoteRuntimeService) CreateContainer(podSandBoxID string, config *runtimeApi.ContainerConfig, sandboxConfig *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (r *RemoteRuntimeService) CreateContainer(podSandBoxID string, config *runtimeapi.ContainerConfig, sandboxConfig *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.runtimeClient.CreateContainer(ctx, &runtimeApi.CreateContainerRequest{
|
||||
resp, err := r.runtimeClient.CreateContainer(ctx, &runtimeapi.CreateContainerRequest{
|
||||
PodSandboxId: &podSandBoxID,
|
||||
Config: config,
|
||||
SandboxConfig: sandboxConfig,
|
||||
@@ -171,7 +171,7 @@ func (r *RemoteRuntimeService) StartContainer(containerID string) error {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
_, err := r.runtimeClient.StartContainer(ctx, &runtimeApi.StartContainerRequest{
|
||||
_, err := r.runtimeClient.StartContainer(ctx, &runtimeapi.StartContainerRequest{
|
||||
ContainerId: &containerID,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -187,7 +187,7 @@ func (r *RemoteRuntimeService) StopContainer(containerID string, timeout int64)
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
_, err := r.runtimeClient.StopContainer(ctx, &runtimeApi.StopContainerRequest{
|
||||
_, err := r.runtimeClient.StopContainer(ctx, &runtimeapi.StopContainerRequest{
|
||||
ContainerId: &containerID,
|
||||
Timeout: &timeout,
|
||||
})
|
||||
@@ -205,7 +205,7 @@ func (r *RemoteRuntimeService) RemoveContainer(containerID string) error {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
_, err := r.runtimeClient.RemoveContainer(ctx, &runtimeApi.RemoveContainerRequest{
|
||||
_, err := r.runtimeClient.RemoveContainer(ctx, &runtimeapi.RemoveContainerRequest{
|
||||
ContainerId: &containerID,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -217,11 +217,11 @@ func (r *RemoteRuntimeService) RemoveContainer(containerID string) error {
|
||||
}
|
||||
|
||||
// ListContainers lists containers by filters.
|
||||
func (r *RemoteRuntimeService) ListContainers(filter *runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error) {
|
||||
func (r *RemoteRuntimeService) ListContainers(filter *runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.runtimeClient.ListContainers(ctx, &runtimeApi.ListContainersRequest{
|
||||
resp, err := r.runtimeClient.ListContainers(ctx, &runtimeapi.ListContainersRequest{
|
||||
Filter: filter,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -233,11 +233,11 @@ func (r *RemoteRuntimeService) ListContainers(filter *runtimeApi.ContainerFilter
|
||||
}
|
||||
|
||||
// ContainerStatus returns the container status.
|
||||
func (r *RemoteRuntimeService) ContainerStatus(containerID string) (*runtimeApi.ContainerStatus, error) {
|
||||
func (r *RemoteRuntimeService) ContainerStatus(containerID string) (*runtimeapi.ContainerStatus, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.runtimeClient.ContainerStatus(ctx, &runtimeApi.ContainerStatusRequest{
|
||||
resp, err := r.runtimeClient.ContainerStatus(ctx, &runtimeapi.ContainerStatusRequest{
|
||||
ContainerId: &containerID,
|
||||
})
|
||||
if err != nil {
|
||||
@@ -255,7 +255,7 @@ func (r *RemoteRuntimeService) ExecSync(containerID string, cmd []string, timeou
|
||||
defer cancel()
|
||||
|
||||
timeoutSeconds := int64(timeout.Seconds())
|
||||
req := &runtimeApi.ExecSyncRequest{
|
||||
req := &runtimeapi.ExecSyncRequest{
|
||||
ContainerId: &containerID,
|
||||
Cmd: cmd,
|
||||
Timeout: &timeoutSeconds,
|
||||
@@ -278,7 +278,7 @@ func (r *RemoteRuntimeService) ExecSync(containerID string, cmd []string, timeou
|
||||
}
|
||||
|
||||
// Exec prepares a streaming endpoint to execute a command in the container, and returns the address.
|
||||
func (r *RemoteRuntimeService) Exec(req *runtimeApi.ExecRequest) (*runtimeApi.ExecResponse, error) {
|
||||
func (r *RemoteRuntimeService) Exec(req *runtimeapi.ExecRequest) (*runtimeapi.ExecResponse, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
@@ -292,7 +292,7 @@ func (r *RemoteRuntimeService) Exec(req *runtimeApi.ExecRequest) (*runtimeApi.Ex
|
||||
}
|
||||
|
||||
// Attach prepares a streaming endpoint to attach to a running container, and returns the address.
|
||||
func (r *RemoteRuntimeService) Attach(req *runtimeApi.AttachRequest) (*runtimeApi.AttachResponse, error) {
|
||||
func (r *RemoteRuntimeService) Attach(req *runtimeapi.AttachRequest) (*runtimeapi.AttachResponse, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
@@ -306,7 +306,7 @@ func (r *RemoteRuntimeService) Attach(req *runtimeApi.AttachRequest) (*runtimeAp
|
||||
}
|
||||
|
||||
// PortForward prepares a streaming endpoint to forward ports from a PodSandbox, and returns the address.
|
||||
func (r *RemoteRuntimeService) PortForward(req *runtimeApi.PortForwardRequest) (*runtimeApi.PortForwardResponse, error) {
|
||||
func (r *RemoteRuntimeService) PortForward(req *runtimeapi.PortForwardRequest) (*runtimeapi.PortForwardResponse, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
@@ -322,14 +322,14 @@ func (r *RemoteRuntimeService) PortForward(req *runtimeApi.PortForwardRequest) (
|
||||
// UpdateRuntimeConfig updates the config of a runtime service. The only
|
||||
// update payload currently supported is the pod CIDR assigned to a node,
|
||||
// and the runtime service just proxies it down to the network plugin.
|
||||
func (r *RemoteRuntimeService) UpdateRuntimeConfig(runtimeConfig *runtimeApi.RuntimeConfig) error {
|
||||
func (r *RemoteRuntimeService) UpdateRuntimeConfig(runtimeConfig *runtimeapi.RuntimeConfig) error {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
// Response doesn't contain anything of interest. This translates to an
|
||||
// Event notification to the network plugin, which can't fail, so we're
|
||||
// really looking to surface destination unreachable.
|
||||
_, err := r.runtimeClient.UpdateRuntimeConfig(ctx, &runtimeApi.UpdateRuntimeConfigRequest{
|
||||
_, err := r.runtimeClient.UpdateRuntimeConfig(ctx, &runtimeapi.UpdateRuntimeConfigRequest{
|
||||
RuntimeConfig: runtimeConfig,
|
||||
})
|
||||
|
||||
@@ -341,11 +341,11 @@ func (r *RemoteRuntimeService) UpdateRuntimeConfig(runtimeConfig *runtimeApi.Run
|
||||
}
|
||||
|
||||
// Status returns the status of the runtime.
|
||||
func (r *RemoteRuntimeService) Status() (*runtimeApi.RuntimeStatus, error) {
|
||||
func (r *RemoteRuntimeService) Status() (*runtimeapi.RuntimeStatus, error) {
|
||||
ctx, cancel := getContextWithTimeout(r.timeout)
|
||||
defer cancel()
|
||||
|
||||
resp, err := r.runtimeClient.Status(ctx, &runtimeApi.StatusRequest{})
|
||||
resp, err := r.runtimeClient.Status(ctx, &runtimeapi.StatusRequest{})
|
||||
if err != nil {
|
||||
glog.Errorf("Status from runtime service failed: %v", err)
|
||||
return nil, err
|
||||
|
@@ -19,8 +19,8 @@ package rktshim
|
||||
import (
|
||||
"time"
|
||||
|
||||
kubeletApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubeletapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
// Runtime provides an API for lifecycle, inspection and introspection
|
||||
@@ -31,12 +31,12 @@ type Runtime struct{}
|
||||
type RuntimeConfig struct{}
|
||||
|
||||
// NewRuntime creates a container.Runtime instance using the Runtime.
|
||||
func NewRuntime(RuntimeConfig) (kubeletApi.ContainerManager, error) {
|
||||
func NewRuntime(RuntimeConfig) (kubeletapi.ContainerManager, error) {
|
||||
return &Runtime{}, nil
|
||||
}
|
||||
|
||||
// CreateContainer creates an app inside the provided pod sandbox and returns the RawContainerID.
|
||||
func (*Runtime) CreateContainer(string, *runtimeApi.ContainerConfig, *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (*Runtime) CreateContainer(string, *runtimeapi.ContainerConfig, *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
@@ -56,12 +56,12 @@ func (*Runtime) RemoveContainer(string) error {
|
||||
}
|
||||
|
||||
// ListContainers lists out the apps residing inside the pod sandbox using the ContainerFilter.
|
||||
func (*Runtime) ListContainers(*runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error) {
|
||||
func (*Runtime) ListContainers(*runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
// ContainerStatus returns the RawContainerStatus of an app inside the pod sandbox.
|
||||
func (*Runtime) ContainerStatus(string) (*runtimeApi.ContainerStatus, error) {
|
||||
func (*Runtime) ContainerStatus(string) (*runtimeapi.ContainerStatus, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
@@ -72,11 +72,11 @@ func (*Runtime) ExecSync(containerID string, cmd []string, timeout time.Duration
|
||||
}
|
||||
|
||||
// Exec prepares a streaming endpoint to execute a command in the container, and returns the address.
|
||||
func (*Runtime) Exec(*runtimeApi.ExecRequest) (*runtimeApi.ExecResponse, error) {
|
||||
func (*Runtime) Exec(*runtimeapi.ExecRequest) (*runtimeapi.ExecResponse, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
// Attach prepares a streaming endpoint to attach to a running container, and returns the address.
|
||||
func (*Runtime) Attach(req *runtimeApi.AttachRequest) (*runtimeApi.AttachResponse, error) {
|
||||
func (*Runtime) Attach(req *runtimeapi.AttachRequest) (*runtimeapi.AttachResponse, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
@@ -23,8 +23,8 @@ import (
|
||||
"math/rand"
|
||||
"time"
|
||||
|
||||
kubeletApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubeletapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
"k8s.io/kubernetes/pkg/kubelet/util/ioutils"
|
||||
)
|
||||
|
||||
@@ -61,7 +61,7 @@ type FakeRuntime struct {
|
||||
|
||||
type FakeRuntimeConfig struct{}
|
||||
|
||||
func NewFakeRuntime() (kubeletApi.ContainerManager, error) {
|
||||
func NewFakeRuntime() (kubeletapi.ContainerManager, error) {
|
||||
return &FakeRuntime{Containers: make(containerRegistry)}, nil
|
||||
}
|
||||
|
||||
@@ -78,23 +78,23 @@ func newCharacterStreams(in io.Reader, out io.Writer, err io.Writer) characterSt
|
||||
}
|
||||
|
||||
type fakeContainer struct {
|
||||
Config *runtimeApi.ContainerConfig
|
||||
Config *runtimeapi.ContainerConfig
|
||||
|
||||
Status runtimeApi.ContainerStatus
|
||||
Status runtimeapi.ContainerStatus
|
||||
|
||||
State runtimeApi.ContainerState
|
||||
State runtimeapi.ContainerState
|
||||
|
||||
Streams characterStreams
|
||||
}
|
||||
|
||||
func (c *fakeContainer) Start() {
|
||||
c.State = runtimeApi.ContainerState_CONTAINER_RUNNING
|
||||
c.State = runtimeapi.ContainerState_CONTAINER_RUNNING
|
||||
|
||||
c.Status.State = &c.State
|
||||
}
|
||||
|
||||
func (c *fakeContainer) Stop() {
|
||||
c.State = runtimeApi.ContainerState_CONTAINER_EXITED
|
||||
c.State = runtimeapi.ContainerState_CONTAINER_EXITED
|
||||
|
||||
c.Status.State = &c.State
|
||||
|
||||
@@ -115,7 +115,7 @@ func (c *fakeContainer) Exec(cmd []string, in io.Reader, out, err io.WriteCloser
|
||||
|
||||
type containerRegistry map[string]*fakeContainer
|
||||
|
||||
func (r *FakeRuntime) CreateContainer(pid string, cfg *runtimeApi.ContainerConfig, sandboxCfg *runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (r *FakeRuntime) CreateContainer(pid string, cfg *runtimeapi.ContainerConfig, sandboxCfg *runtimeapi.PodSandboxConfig) (string, error) {
|
||||
// TODO(tmrts): allow customization
|
||||
containerIDLength := 8
|
||||
|
||||
@@ -135,11 +135,11 @@ func (r *FakeRuntime) StartContainer(id string) error {
|
||||
return ErrContainerNotFound
|
||||
}
|
||||
switch c.State {
|
||||
case runtimeApi.ContainerState_CONTAINER_EXITED:
|
||||
case runtimeapi.ContainerState_CONTAINER_EXITED:
|
||||
fallthrough
|
||||
case runtimeApi.ContainerState_CONTAINER_CREATED:
|
||||
case runtimeapi.ContainerState_CONTAINER_CREATED:
|
||||
c.Start()
|
||||
case runtimeApi.ContainerState_CONTAINER_UNKNOWN:
|
||||
case runtimeapi.ContainerState_CONTAINER_UNKNOWN:
|
||||
// TODO(tmrts): add timeout to Start API or generalize timeout somehow
|
||||
//<-time.After(time.Duration(timeout) * time.Second)
|
||||
fallthrough
|
||||
@@ -157,9 +157,9 @@ func (r *FakeRuntime) StopContainer(id string, timeout int64) error {
|
||||
}
|
||||
|
||||
switch c.State {
|
||||
case runtimeApi.ContainerState_CONTAINER_RUNNING:
|
||||
c.State = runtimeApi.ContainerState_CONTAINER_EXITED // This state might not be the best one
|
||||
case runtimeApi.ContainerState_CONTAINER_UNKNOWN:
|
||||
case runtimeapi.ContainerState_CONTAINER_RUNNING:
|
||||
c.State = runtimeapi.ContainerState_CONTAINER_EXITED // This state might not be the best one
|
||||
case runtimeapi.ContainerState_CONTAINER_UNKNOWN:
|
||||
<-time.After(time.Duration(timeout) * time.Second)
|
||||
fallthrough
|
||||
default:
|
||||
@@ -181,12 +181,12 @@ func (r *FakeRuntime) RemoveContainer(id string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntime) ListContainers(*runtimeApi.ContainerFilter) ([]*runtimeApi.Container, error) {
|
||||
list := []*runtimeApi.Container{}
|
||||
func (r *FakeRuntime) ListContainers(*runtimeapi.ContainerFilter) ([]*runtimeapi.Container, error) {
|
||||
list := []*runtimeapi.Container{}
|
||||
|
||||
// TODO(tmrts): apply the filter
|
||||
for _, c := range r.Containers {
|
||||
list = append(list, &runtimeApi.Container{
|
||||
list = append(list, &runtimeapi.Container{
|
||||
Id: c.Status.Id,
|
||||
Metadata: c.Config.Metadata,
|
||||
Labels: c.Config.Labels,
|
||||
@@ -198,10 +198,10 @@ func (r *FakeRuntime) ListContainers(*runtimeApi.ContainerFilter) ([]*runtimeApi
|
||||
return list, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntime) ContainerStatus(id string) (*runtimeApi.ContainerStatus, error) {
|
||||
func (r *FakeRuntime) ContainerStatus(id string) (*runtimeapi.ContainerStatus, error) {
|
||||
c, ok := r.Containers[id]
|
||||
if !ok {
|
||||
return &runtimeApi.ContainerStatus{}, ErrContainerNotFound
|
||||
return &runtimeapi.ContainerStatus{}, ErrContainerNotFound
|
||||
}
|
||||
|
||||
return &c.Status, nil
|
||||
@@ -214,7 +214,7 @@ func (r *FakeRuntime) ExecSync(containerID string, cmd []string, timeout time.Du
|
||||
}
|
||||
|
||||
// TODO(tmrts): Validate the assumption that container has to be running for exec to work.
|
||||
if c.State != runtimeApi.ContainerState_CONTAINER_RUNNING {
|
||||
if c.State != runtimeapi.ContainerState_CONTAINER_RUNNING {
|
||||
return nil, nil, ErrInvalidContainerStateTransition
|
||||
}
|
||||
|
||||
@@ -225,16 +225,16 @@ func (r *FakeRuntime) ExecSync(containerID string, cmd []string, timeout time.Du
|
||||
return stdoutBuffer.Bytes(), stderrBuffer.Bytes(), err
|
||||
}
|
||||
|
||||
func (r *FakeRuntime) Exec(req *runtimeApi.ExecRequest) (*runtimeApi.ExecResponse, error) {
|
||||
func (r *FakeRuntime) Exec(req *runtimeapi.ExecRequest) (*runtimeapi.ExecResponse, error) {
|
||||
url := "http://" + FakeStreamingHost + ":" + FakeStreamingPort + "/exec/" + req.GetContainerId()
|
||||
return &runtimeApi.ExecResponse{
|
||||
return &runtimeapi.ExecResponse{
|
||||
Url: &url,
|
||||
}, nil
|
||||
}
|
||||
|
||||
func (r *FakeRuntime) Attach(req *runtimeApi.AttachRequest) (*runtimeApi.AttachResponse, error) {
|
||||
func (r *FakeRuntime) Attach(req *runtimeapi.AttachRequest) (*runtimeapi.AttachResponse, error) {
|
||||
url := "http://" + FakeStreamingHost + ":" + FakeStreamingPort + "/attach/" + req.GetContainerId()
|
||||
return &runtimeApi.AttachResponse{
|
||||
return &runtimeapi.AttachResponse{
|
||||
Url: &url,
|
||||
}, nil
|
||||
}
|
||||
|
@@ -19,7 +19,7 @@ package rktshim
|
||||
import (
|
||||
"errors"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
// TODO(tmrts): Move these errors to the container API for code re-use.
|
||||
@@ -41,21 +41,21 @@ func NewImageStore(ImageStoreConfig) (*ImageStore, error) {
|
||||
}
|
||||
|
||||
// List lists the images residing in the image store.
|
||||
func (*ImageStore) List() ([]runtimeApi.Image, error) {
|
||||
func (*ImageStore) List() ([]runtimeapi.Image, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
// Pull pulls an image into the image store and uses the given authentication method.
|
||||
func (*ImageStore) Pull(runtimeApi.ImageSpec, runtimeApi.AuthConfig, *runtimeApi.PodSandboxConfig) error {
|
||||
func (*ImageStore) Pull(runtimeapi.ImageSpec, runtimeapi.AuthConfig, *runtimeapi.PodSandboxConfig) error {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
// Remove removes the image from the image store.
|
||||
func (*ImageStore) Remove(runtimeApi.ImageSpec) error {
|
||||
func (*ImageStore) Remove(runtimeapi.ImageSpec) error {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
// Status returns the status of the image.
|
||||
func (*ImageStore) Status(runtimeApi.ImageSpec) (runtimeApi.Image, error) {
|
||||
func (*ImageStore) Status(runtimeapi.ImageSpec) (runtimeapi.Image, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
@@ -21,21 +21,21 @@ import (
|
||||
"reflect"
|
||||
"testing"
|
||||
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
var (
|
||||
emptyImgStoreConfig = ImageStoreConfig{}
|
||||
// TODO(tmrts): fill the pod configuration
|
||||
testPodConfig *runtimeApi.PodSandboxConfig = nil
|
||||
testPodConfig *runtimeapi.PodSandboxConfig = nil
|
||||
)
|
||||
|
||||
type imageTestCase struct {
|
||||
Spec *runtimeApi.ImageSpec
|
||||
ExpectedStatus *runtimeApi.Image
|
||||
Spec *runtimeapi.ImageSpec
|
||||
ExpectedStatus *runtimeapi.Image
|
||||
}
|
||||
|
||||
func compareContainerImages(got, expected runtimeApi.Image) error {
|
||||
func compareContainerImages(got, expected runtimeapi.Image) error {
|
||||
if got.Id != expected.Id {
|
||||
return fmt.Errorf("mismatching Ids -> expected %q, got %q", got.Id, expected.Id)
|
||||
}
|
||||
@@ -62,16 +62,16 @@ var (
|
||||
|
||||
var testImgSpecs = map[string]imageTestCase{
|
||||
"non-existent-image": {
|
||||
&runtimeApi.ImageSpec{
|
||||
&runtimeapi.ImageSpec{
|
||||
Image: &gibberishStr,
|
||||
},
|
||||
nil,
|
||||
},
|
||||
"busybox": {
|
||||
&runtimeApi.ImageSpec{
|
||||
&runtimeapi.ImageSpec{
|
||||
Image: &busyboxStr,
|
||||
},
|
||||
&runtimeApi.Image{
|
||||
&runtimeapi.Image{
|
||||
Id: nil,
|
||||
RepoTags: []string{},
|
||||
RepoDigests: []string{},
|
||||
@@ -80,7 +80,7 @@ var testImgSpecs = map[string]imageTestCase{
|
||||
},
|
||||
}
|
||||
|
||||
var testAuthConfig = map[string]runtimeApi.AuthConfig{
|
||||
var testAuthConfig = map[string]runtimeapi.AuthConfig{
|
||||
"no-auth": {},
|
||||
}
|
||||
|
||||
|
@@ -17,8 +17,8 @@ limitations under the License.
|
||||
package rktshim
|
||||
|
||||
import (
|
||||
kubeletApi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeApi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
kubeletapi "k8s.io/kubernetes/pkg/kubelet/api"
|
||||
runtimeapi "k8s.io/kubernetes/pkg/kubelet/api/v1alpha1/runtime"
|
||||
)
|
||||
|
||||
// PodSandboxManager provides basic operations to create/delete and examine
|
||||
@@ -29,12 +29,12 @@ type PodSandboxManager struct{}
|
||||
type PodSandboxManagerConfig struct{}
|
||||
|
||||
// NewPodSandboxManager creates a PodSandboxManager.
|
||||
func NewPodSandboxManager(PodSandboxManagerConfig) (kubeletApi.PodSandboxManager, error) {
|
||||
func NewPodSandboxManager(PodSandboxManagerConfig) (kubeletapi.PodSandboxManager, error) {
|
||||
return &PodSandboxManager{}, nil
|
||||
}
|
||||
|
||||
// RunPodSandbox creates and starts a pod sandbox given a pod sandbox configuration.
|
||||
func (*PodSandboxManager) RunPodSandbox(*runtimeApi.PodSandboxConfig) (string, error) {
|
||||
func (*PodSandboxManager) RunPodSandbox(*runtimeapi.PodSandboxConfig) (string, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
@@ -49,16 +49,16 @@ func (*PodSandboxManager) RemovePodSandbox(string) error {
|
||||
}
|
||||
|
||||
// PodSandboxStatus queries the status of the pod sandbox.
|
||||
func (*PodSandboxManager) PodSandboxStatus(string) (*runtimeApi.PodSandboxStatus, error) {
|
||||
func (*PodSandboxManager) PodSandboxStatus(string) (*runtimeapi.PodSandboxStatus, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
// ListPodSandbox lists existing sandboxes, filtered by the PodSandboxFilter.
|
||||
func (*PodSandboxManager) ListPodSandbox(*runtimeApi.PodSandboxFilter) ([]*runtimeApi.PodSandbox, error) {
|
||||
func (*PodSandboxManager) ListPodSandbox(*runtimeapi.PodSandboxFilter) ([]*runtimeapi.PodSandbox, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
||||
// PortForward prepares a streaming endpoint to forward ports from a PodSandbox, and returns the address.
|
||||
func (*PodSandboxManager) PortForward(*runtimeApi.PortForwardRequest) (*runtimeApi.PortForwardResponse, error) {
|
||||
func (*PodSandboxManager) PortForward(*runtimeapi.PortForwardRequest) (*runtimeapi.PortForwardResponse, error) {
|
||||
panic("not implemented")
|
||||
}
|
||||
|
6
pkg/kubelet/util/cache/object_cache.go
vendored
6
pkg/kubelet/util/cache/object_cache.go
vendored
@@ -19,7 +19,7 @@ package cache
|
||||
import (
|
||||
"time"
|
||||
|
||||
expirationCache "k8s.io/kubernetes/pkg/client/cache"
|
||||
expirationcache "k8s.io/kubernetes/pkg/client/cache"
|
||||
)
|
||||
|
||||
// ObjectCache is a simple wrapper of expiration cache that
|
||||
@@ -27,7 +27,7 @@ import (
|
||||
// 2. has an updater to get value directly if it is expired
|
||||
// 3. then update the cache
|
||||
type ObjectCache struct {
|
||||
cache expirationCache.Store
|
||||
cache expirationcache.Store
|
||||
updater func() (interface{}, error)
|
||||
}
|
||||
|
||||
@@ -42,7 +42,7 @@ type objectEntry struct {
|
||||
func NewObjectCache(f func() (interface{}, error), ttl time.Duration) *ObjectCache {
|
||||
return &ObjectCache{
|
||||
updater: f,
|
||||
cache: expirationCache.NewTTLStore(stringKeyFunc, ttl),
|
||||
cache: expirationcache.NewTTLStore(stringKeyFunc, ttl),
|
||||
}
|
||||
}
|
||||
|
||||
|
6
pkg/kubelet/util/cache/object_cache_test.go
vendored
6
pkg/kubelet/util/cache/object_cache_test.go
vendored
@@ -21,7 +21,7 @@ import (
|
||||
"testing"
|
||||
"time"
|
||||
|
||||
expirationCache "k8s.io/kubernetes/pkg/client/cache"
|
||||
expirationcache "k8s.io/kubernetes/pkg/client/cache"
|
||||
"k8s.io/kubernetes/pkg/util/clock"
|
||||
)
|
||||
|
||||
@@ -32,11 +32,11 @@ type testObject struct {
|
||||
|
||||
// A fake objectCache for unit test.
|
||||
func NewFakeObjectCache(f func() (interface{}, error), ttl time.Duration, clock clock.Clock) *ObjectCache {
|
||||
ttlPolicy := &expirationCache.TTLPolicy{Ttl: ttl, Clock: clock}
|
||||
ttlPolicy := &expirationcache.TTLPolicy{Ttl: ttl, Clock: clock}
|
||||
deleteChan := make(chan string, 1)
|
||||
return &ObjectCache{
|
||||
updater: f,
|
||||
cache: expirationCache.NewFakeExpirationStore(stringKeyFunc, deleteChan, ttlPolicy, clock),
|
||||
cache: expirationcache.NewFakeExpirationStore(stringKeyFunc, deleteChan, ttlPolicy, clock),
|
||||
}
|
||||
}
|
||||
|
||||
|
@@ -30,7 +30,7 @@ import (
|
||||
"syscall"
|
||||
|
||||
"github.com/golang/glog"
|
||||
utilExec "k8s.io/kubernetes/pkg/util/exec"
|
||||
utilexec "k8s.io/kubernetes/pkg/util/exec"
|
||||
"k8s.io/kubernetes/pkg/util/sets"
|
||||
)
|
||||
|
||||
@@ -332,9 +332,9 @@ func (mounter *SafeFormatAndMount) formatAndMount(source string, target string,
|
||||
cmd := mounter.Runner.Command("fsck", args...)
|
||||
out, err := cmd.CombinedOutput()
|
||||
if err != nil {
|
||||
ee, isExitError := err.(utilExec.ExitError)
|
||||
ee, isExitError := err.(utilexec.ExitError)
|
||||
switch {
|
||||
case err == utilExec.ErrExecutableNotFound:
|
||||
case err == utilexec.ErrExecutableNotFound:
|
||||
glog.Warningf("'fsck' not found on system; continuing mount without running 'fsck'.")
|
||||
case isExitError && ee.ExitStatus() == fsckErrorsCorrected:
|
||||
glog.Infof("Device %s has errors which were corrected by fsck.", source)
|
||||
|
@@ -30,7 +30,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/util/strings"
|
||||
"k8s.io/kubernetes/pkg/volume"
|
||||
|
||||
flockerApi "github.com/clusterhq/flocker-go"
|
||||
flockerapi "github.com/clusterhq/flocker-go"
|
||||
)
|
||||
|
||||
// This is the primary entrypoint for volume plugins.
|
||||
@@ -50,7 +50,7 @@ type flockerVolume struct {
|
||||
// dataset uuid
|
||||
datasetUUID string
|
||||
//pod *v1.Pod
|
||||
flockerClient flockerApi.Clientable
|
||||
flockerClient flockerapi.Clientable
|
||||
manager volumeManager
|
||||
plugin *flockerPlugin
|
||||
mounter mount.Interface
|
||||
@@ -229,7 +229,7 @@ func (b *flockerVolumeMounter) SetUp(fsGroup *int64) error {
|
||||
|
||||
// newFlockerClient uses environment variables and pod attributes to return a
|
||||
// flocker client capable of talking with the Flocker control service.
|
||||
func (p *flockerPlugin) newFlockerClient(hostIP string) (*flockerApi.Client, error) {
|
||||
func (p *flockerPlugin) newFlockerClient(hostIP string) (*flockerapi.Client, error) {
|
||||
host := env.GetEnvAsStringOrFallback("FLOCKER_CONTROL_SERVICE_HOST", defaultHost)
|
||||
port, err := env.GetEnvAsIntOrFallback("FLOCKER_CONTROL_SERVICE_PORT", defaultPort)
|
||||
|
||||
@@ -240,11 +240,11 @@ func (p *flockerPlugin) newFlockerClient(hostIP string) (*flockerApi.Client, err
|
||||
keyPath := env.GetEnvAsStringOrFallback("FLOCKER_CONTROL_SERVICE_CLIENT_KEY_FILE", defaultClientKeyFile)
|
||||
certPath := env.GetEnvAsStringOrFallback("FLOCKER_CONTROL_SERVICE_CLIENT_CERT_FILE", defaultClientCertFile)
|
||||
|
||||
c, err := flockerApi.NewClient(host, port, hostIP, caCertPath, keyPath, certPath)
|
||||
c, err := flockerapi.NewClient(host, port, hostIP, caCertPath, keyPath, certPath)
|
||||
return c, err
|
||||
}
|
||||
|
||||
func (b *flockerVolumeMounter) newFlockerClient() (*flockerApi.Client, error) {
|
||||
func (b *flockerVolumeMounter) newFlockerClient() (*flockerapi.Client, error) {
|
||||
|
||||
hostIP, err := b.plugin.host.GetHostIP()
|
||||
if err != nil {
|
||||
|
@@ -28,7 +28,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/volume"
|
||||
volumetest "k8s.io/kubernetes/pkg/volume/testing"
|
||||
|
||||
flockerApi "github.com/clusterhq/flocker-go"
|
||||
flockerapi "github.com/clusterhq/flocker-go"
|
||||
"github.com/stretchr/testify/assert"
|
||||
)
|
||||
|
||||
@@ -37,14 +37,14 @@ const datasetOneID = "11111111-1111-1111-1111-111111111100"
|
||||
const nodeOneID = "11111111-1111-1111-1111-111111111111"
|
||||
const nodeTwoID = "22222222-2222-2222-2222-222222222222"
|
||||
|
||||
var _ flockerApi.Clientable = &fakeFlockerClient{}
|
||||
var _ flockerapi.Clientable = &fakeFlockerClient{}
|
||||
|
||||
type fakeFlockerClient struct {
|
||||
DatasetID string
|
||||
Primary string
|
||||
Deleted bool
|
||||
Metadata map[string]string
|
||||
Nodes []flockerApi.NodeState
|
||||
Nodes []flockerapi.NodeState
|
||||
Error error
|
||||
}
|
||||
|
||||
@@ -54,7 +54,7 @@ func newFakeFlockerClient() *fakeFlockerClient {
|
||||
Primary: nodeOneID,
|
||||
Deleted: false,
|
||||
Metadata: map[string]string{"Name": "dataset-one"},
|
||||
Nodes: []flockerApi.NodeState{
|
||||
Nodes: []flockerapi.NodeState{
|
||||
{
|
||||
Host: "1.2.3.4",
|
||||
UUID: nodeOneID,
|
||||
@@ -67,13 +67,13 @@ func newFakeFlockerClient() *fakeFlockerClient {
|
||||
}
|
||||
}
|
||||
|
||||
func (c *fakeFlockerClient) CreateDataset(options *flockerApi.CreateDatasetOptions) (*flockerApi.DatasetState, error) {
|
||||
func (c *fakeFlockerClient) CreateDataset(options *flockerapi.CreateDatasetOptions) (*flockerapi.DatasetState, error) {
|
||||
|
||||
if c.Error != nil {
|
||||
return nil, c.Error
|
||||
}
|
||||
|
||||
return &flockerApi.DatasetState{
|
||||
return &flockerapi.DatasetState{
|
||||
DatasetID: c.DatasetID,
|
||||
}, nil
|
||||
}
|
||||
@@ -84,8 +84,8 @@ func (c *fakeFlockerClient) DeleteDataset(datasetID string) error {
|
||||
return nil
|
||||
}
|
||||
|
||||
func (c *fakeFlockerClient) GetDatasetState(datasetID string) (*flockerApi.DatasetState, error) {
|
||||
return &flockerApi.DatasetState{}, nil
|
||||
func (c *fakeFlockerClient) GetDatasetState(datasetID string) (*flockerapi.DatasetState, error) {
|
||||
return &flockerapi.DatasetState{}, nil
|
||||
}
|
||||
|
||||
func (c *fakeFlockerClient) GetDatasetID(metaName string) (datasetID string, err error) {
|
||||
@@ -99,12 +99,12 @@ func (c *fakeFlockerClient) GetPrimaryUUID() (primaryUUID string, err error) {
|
||||
return
|
||||
}
|
||||
|
||||
func (c *fakeFlockerClient) ListNodes() (nodes []flockerApi.NodeState, err error) {
|
||||
func (c *fakeFlockerClient) ListNodes() (nodes []flockerapi.NodeState, err error) {
|
||||
return c.Nodes, nil
|
||||
}
|
||||
|
||||
func (c *fakeFlockerClient) UpdatePrimaryForDataset(primaryUUID, datasetID string) (*flockerApi.DatasetState, error) {
|
||||
return &flockerApi.DatasetState{}, nil
|
||||
func (c *fakeFlockerClient) UpdatePrimaryForDataset(primaryUUID, datasetID string) (*flockerapi.DatasetState, error) {
|
||||
return &flockerapi.DatasetState{}, nil
|
||||
}
|
||||
|
||||
type fakeFlockerUtil struct {
|
||||
@@ -301,7 +301,7 @@ func TestIsReadOnly(t *testing.T) {
|
||||
|
||||
type mockFlockerClient struct {
|
||||
datasetID, primaryUUID, path string
|
||||
datasetState *flockerApi.DatasetState
|
||||
datasetState *flockerapi.DatasetState
|
||||
}
|
||||
|
||||
func newMockFlockerClient(mockDatasetID, mockPrimaryUUID, mockPath string) *mockFlockerClient {
|
||||
@@ -309,7 +309,7 @@ func newMockFlockerClient(mockDatasetID, mockPrimaryUUID, mockPath string) *mock
|
||||
datasetID: mockDatasetID,
|
||||
primaryUUID: mockPrimaryUUID,
|
||||
path: mockPath,
|
||||
datasetState: &flockerApi.DatasetState{
|
||||
datasetState: &flockerapi.DatasetState{
|
||||
Path: mockPath,
|
||||
DatasetID: mockDatasetID,
|
||||
Primary: mockPrimaryUUID,
|
||||
@@ -317,10 +317,10 @@ func newMockFlockerClient(mockDatasetID, mockPrimaryUUID, mockPath string) *mock
|
||||
}
|
||||
}
|
||||
|
||||
func (m mockFlockerClient) CreateDataset(metaName string) (*flockerApi.DatasetState, error) {
|
||||
func (m mockFlockerClient) CreateDataset(metaName string) (*flockerapi.DatasetState, error) {
|
||||
return m.datasetState, nil
|
||||
}
|
||||
func (m mockFlockerClient) GetDatasetState(datasetID string) (*flockerApi.DatasetState, error) {
|
||||
func (m mockFlockerClient) GetDatasetState(datasetID string) (*flockerapi.DatasetState, error) {
|
||||
return m.datasetState, nil
|
||||
}
|
||||
func (m mockFlockerClient) GetDatasetID(metaName string) (string, error) {
|
||||
@@ -329,7 +329,7 @@ func (m mockFlockerClient) GetDatasetID(metaName string) (string, error) {
|
||||
func (m mockFlockerClient) GetPrimaryUUID() (string, error) {
|
||||
return m.primaryUUID, nil
|
||||
}
|
||||
func (m mockFlockerClient) UpdatePrimaryForDataset(primaryUUID, datasetID string) (*flockerApi.DatasetState, error) {
|
||||
func (m mockFlockerClient) UpdatePrimaryForDataset(primaryUUID, datasetID string) (*flockerapi.DatasetState, error) {
|
||||
return m.datasetState, nil
|
||||
}
|
||||
|
||||
|
@@ -24,7 +24,7 @@ import (
|
||||
"k8s.io/kubernetes/pkg/util/rand"
|
||||
"k8s.io/kubernetes/pkg/volume"
|
||||
|
||||
flockerApi "github.com/clusterhq/flocker-go"
|
||||
flockerapi "github.com/clusterhq/flocker-go"
|
||||
"github.com/golang/glog"
|
||||
)
|
||||
|
||||
@@ -75,7 +75,7 @@ func (util *FlockerUtil) CreateVolume(c *flockerVolumeProvisioner) (datasetUUID
|
||||
requestBytes := capacity.Value()
|
||||
volumeSizeGB = int(volume.RoundUpSize(requestBytes, 1024*1024*1024))
|
||||
|
||||
createOptions := &flockerApi.CreateDatasetOptions{
|
||||
createOptions := &flockerapi.CreateDatasetOptions{
|
||||
MaximumSize: requestBytes,
|
||||
Metadata: map[string]string{
|
||||
"type": "k8s-dynamic-prov",
|
||||
|
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user